NZ204352A - Mitomycin analogs carrying one or more guanidino substituents in the 7- and/or 10-positions - Google Patents
Mitomycin analogs carrying one or more guanidino substituents in the 7- and/or 10-positionsInfo
- Publication number
- NZ204352A NZ204352A NZ204352A NZ20435283A NZ204352A NZ 204352 A NZ204352 A NZ 204352A NZ 204352 A NZ204352 A NZ 204352A NZ 20435283 A NZ20435283 A NZ 20435283A NZ 204352 A NZ204352 A NZ 204352A
- Authority
- NZ
- New Zealand
- Prior art keywords
- amino
- ccnpound
- formula
- compound
- methylene
- Prior art date
Links
- NWIBSHFKIJFRCO-WUDYKRTCSA-N Mytomycin Chemical class C1N2C(C(C(C)=C(N)C3=O)=O)=C3[C@@H](COC(N)=O)[C@@]2(OC)[C@@H]2[C@H]1N2 NWIBSHFKIJFRCO-WUDYKRTCSA-N 0.000 title claims description 54
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 title description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 201
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 161
- 150000001875 compounds Chemical class 0.000 claims description 53
- 238000006243 chemical reaction Methods 0.000 claims description 45
- -1 amino, methoxy, hydroxy Chemical group 0.000 claims description 41
- 125000003739 carbamimidoyl group Chemical group C(N)(=N)* 0.000 claims description 34
- 125000000217 alkyl group Chemical group 0.000 claims description 29
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical group ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 28
- 229960004857 mitomycin Drugs 0.000 claims description 25
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 25
- 238000000034 method Methods 0.000 claims description 23
- 229910052799 carbon Inorganic materials 0.000 claims description 21
- 229910000104 sodium hydride Inorganic materials 0.000 claims description 19
- 239000000203 mixture Substances 0.000 claims description 17
- 239000002904 solvent Substances 0.000 claims description 17
- 239000000126 substance Substances 0.000 claims description 16
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 15
- 229910052757 nitrogen Inorganic materials 0.000 claims description 15
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims description 14
- 125000004432 carbon atom Chemical group C* 0.000 claims description 13
- 230000008569 process Effects 0.000 claims description 13
- 230000000259 anti-tumor effect Effects 0.000 claims description 12
- 230000000694 effects Effects 0.000 claims description 12
- 239000003153 chemical reaction reagent Substances 0.000 claims description 11
- 150000003141 primary amines Chemical class 0.000 claims description 11
- 241000699670 Mus sp. Species 0.000 claims description 9
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 9
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 claims description 9
- 239000012312 sodium hydride Substances 0.000 claims description 9
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 8
- 125000003118 aryl group Chemical group 0.000 claims description 8
- 206010028980 Neoplasm Diseases 0.000 claims description 7
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 claims description 7
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- 125000000129 anionic group Chemical group 0.000 claims description 7
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 7
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 7
- 239000007788 liquid Substances 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 7
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims description 6
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 6
- 150000001412 amines Chemical class 0.000 claims description 6
- 150000001721 carbon Chemical group 0.000 claims description 6
- 125000004122 cyclic group Chemical group 0.000 claims description 6
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 239000012429 reaction media Substances 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 6
- 238000010171 animal model Methods 0.000 claims description 5
- MGHPNCMVUAKAIE-UHFFFAOYSA-N diphenylmethanamine Chemical compound C=1C=CC=CC=1C(N)C1=CC=CC=C1 MGHPNCMVUAKAIE-UHFFFAOYSA-N 0.000 claims description 5
- 125000005059 halophenyl group Chemical group 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 125000006501 nitrophenyl group Chemical group 0.000 claims description 5
- 239000012430 organic reaction media Substances 0.000 claims description 5
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 4
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 4
- 125000001589 carboacyl group Chemical group 0.000 claims description 4
- 125000000219 ethylidene group Chemical group [H]C(=[*])C([H])([H])[H] 0.000 claims description 4
- 125000001188 haloalkyl group Chemical group 0.000 claims description 4
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 claims description 3
- 125000003282 alkyl amino group Chemical group 0.000 claims description 3
- 125000004414 alkyl thio group Chemical group 0.000 claims description 3
- 125000000304 alkynyl group Chemical group 0.000 claims description 3
- XYOVOXDWRFGKEX-UHFFFAOYSA-N azepine Chemical compound N1C=CC=CC=C1 XYOVOXDWRFGKEX-UHFFFAOYSA-N 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 3
- 238000007912 intraperitoneal administration Methods 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 125000003944 tolyl group Chemical group 0.000 claims description 3
- NDOVLWQBFFJETK-UHFFFAOYSA-N 1,4-thiazinane 1,1-dioxide Chemical compound O=S1(=O)CCNCC1 NDOVLWQBFFJETK-UHFFFAOYSA-N 0.000 claims description 2
- 150000001350 alkyl halides Chemical class 0.000 claims description 2
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 125000002541 furyl group Chemical group 0.000 claims description 2
- 150000004820 halides Chemical class 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000001072 heteroaryl group Chemical group 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- ODUCDPQEXGNKDN-UHFFFAOYSA-N nitroxyl Chemical compound O=N ODUCDPQEXGNKDN-UHFFFAOYSA-N 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- GLBQVJGBPFPMMV-UHFFFAOYSA-N sulfilimine Chemical compound S=N GLBQVJGBPFPMMV-UHFFFAOYSA-N 0.000 claims description 2
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 claims description 2
- 125000001544 thienyl group Chemical group 0.000 claims description 2
- 241000124008 Mammalia Species 0.000 claims 1
- 102100038334 N-alpha-acetyltransferase 60 Human genes 0.000 claims 1
- 101710094344 N-alpha-acetyltransferase 60 Proteins 0.000 claims 1
- 108091000080 Phosphotransferase Proteins 0.000 claims 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims 1
- 125000002723 alicyclic group Chemical group 0.000 claims 1
- 125000001931 aliphatic group Chemical group 0.000 claims 1
- 125000005036 alkoxyphenyl group Chemical group 0.000 claims 1
- 210000004369 blood Anatomy 0.000 claims 1
- 239000008280 blood Substances 0.000 claims 1
- 239000004202 carbamide Substances 0.000 claims 1
- 230000002401 inhibitory effect Effects 0.000 claims 1
- 210000003734 kidney Anatomy 0.000 claims 1
- 230000003907 kidney function Effects 0.000 claims 1
- 230000003908 liver function Effects 0.000 claims 1
- 210000004698 lymphocyte Anatomy 0.000 claims 1
- 231100000989 no adverse effect Toxicity 0.000 claims 1
- 231100000252 nontoxic Toxicity 0.000 claims 1
- 230000003000 nontoxic effect Effects 0.000 claims 1
- 102000020233 phosphotransferase Human genes 0.000 claims 1
- 230000001629 suppression Effects 0.000 claims 1
- 231100000419 toxicity Toxicity 0.000 claims 1
- 230000001988 toxicity Effects 0.000 claims 1
- 230000002110 toxicologic effect Effects 0.000 claims 1
- 231100000027 toxicology Toxicity 0.000 claims 1
- 239000000243 solution Substances 0.000 description 59
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 38
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 32
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 27
- 239000000047 product Substances 0.000 description 25
- 238000005481 NMR spectroscopy Methods 0.000 description 20
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 19
- 239000007787 solid Substances 0.000 description 19
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 18
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 18
- 239000000741 silica gel Substances 0.000 description 15
- 229910002027 silica gel Inorganic materials 0.000 description 15
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 14
- 238000004458 analytical method Methods 0.000 description 14
- 230000008859 change Effects 0.000 description 12
- 235000019439 ethyl acetate Nutrition 0.000 description 11
- 239000011541 reaction mixture Substances 0.000 description 11
- 238000003756 stirring Methods 0.000 description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- 239000006188 syrup Substances 0.000 description 10
- 235000020357 syrup Nutrition 0.000 description 10
- 239000000725 suspension Substances 0.000 description 9
- 229910001868 water Inorganic materials 0.000 description 9
- SPEUIVXLLWOEMJ-UHFFFAOYSA-N 1,1-dimethoxyethane Chemical compound COC(C)OC SPEUIVXLLWOEMJ-UHFFFAOYSA-N 0.000 description 8
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 8
- 241001465754 Metazoa Species 0.000 description 8
- 238000001704 evaporation Methods 0.000 description 8
- 230000008020 evaporation Effects 0.000 description 8
- 238000003818 flash chromatography Methods 0.000 description 8
- 238000004809 thin layer chromatography Methods 0.000 description 8
- 239000007858 starting material Substances 0.000 description 7
- 230000004083 survival effect Effects 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 150000007975 iminium salts Chemical class 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 6
- 238000012360 testing method Methods 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 238000005303 weighing Methods 0.000 description 6
- 241001529936 Murinae Species 0.000 description 5
- 241000786363 Rhampholeon spectrum Species 0.000 description 5
- 238000000855 fermentation Methods 0.000 description 5
- 230000004151 fermentation Effects 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 239000012266 salt solution Substances 0.000 description 5
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 4
- 238000010828 elution Methods 0.000 description 4
- 239000012535 impurity Substances 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- 208000032839 leukemia Diseases 0.000 description 4
- 238000001556 precipitation Methods 0.000 description 4
- JUJWROOIHBZHMG-RALIUCGRSA-N pyridine-d5 Chemical compound [2H]C1=NC([2H])=C([2H])C([2H])=C1[2H] JUJWROOIHBZHMG-RALIUCGRSA-N 0.000 description 4
- FEWLNYSYJNLUOO-UHFFFAOYSA-N 1-Piperidinecarboxaldehyde Chemical compound O=CN1CCCCC1 FEWLNYSYJNLUOO-UHFFFAOYSA-N 0.000 description 3
- 229930192392 Mitomycin Natural products 0.000 description 3
- HYFMSAFINFJTFH-UHFFFAOYSA-N Mitomycin-A Natural products O=C1C(OC)=C(C)C(=O)C2=C1C(COC(N)=O)C1(OC)N2CC2NC21 HYFMSAFINFJTFH-UHFFFAOYSA-N 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 150000001450 anions Chemical class 0.000 description 3
- 239000003242 anti bacterial agent Substances 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- HYFMSAFINFJTFH-NGSRAFSJSA-N mitomycin A Chemical compound O=C1C(OC)=C(C)C(=O)C2=C1[C@@H](COC(N)=O)[C@]1(OC)N2C[C@@H]2N[C@@H]21 HYFMSAFINFJTFH-NGSRAFSJSA-N 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- 125000006239 protecting group Chemical group 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 238000006467 substitution reaction Methods 0.000 description 3
- IWVFFVBJTCPIIG-UHFFFAOYSA-N 2,2-dimethoxy-1-methylpyrrolidine Chemical compound COC1(OC)CCCN1C IWVFFVBJTCPIIG-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 101150041968 CDC13 gene Proteins 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 2
- 241000699666 Mus <mouse, genus> Species 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- SEZWJRWTCIPRSV-UHFFFAOYSA-N [N]C(N)=O Chemical compound [N]C(N)=O SEZWJRWTCIPRSV-UHFFFAOYSA-N 0.000 description 2
- 150000001241 acetals Chemical class 0.000 description 2
- 150000001409 amidines Chemical class 0.000 description 2
- 229940088710 antibiotic agent Drugs 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 235000011089 carbon dioxide Nutrition 0.000 description 2
- 239000007810 chemical reaction solvent Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 230000005595 deprotonation Effects 0.000 description 2
- 238000010537 deprotonation reaction Methods 0.000 description 2
- 238000006073 displacement reaction Methods 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 150000002465 imidoyl halides Chemical class 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- 239000004533 oil dispersion Substances 0.000 description 2
- 239000013641 positive control Substances 0.000 description 2
- NWCBOWOTHFLANG-UHFFFAOYSA-N propan-2-yl methanimidate;hydrochloride Chemical compound Cl.CC(C)OC=N NWCBOWOTHFLANG-UHFFFAOYSA-N 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 230000001131 transforming effect Effects 0.000 description 2
- 125000006564 (C4-C8) cycloalkyl group Chemical group 0.000 description 1
- FBZVZUSVGKOWHG-UHFFFAOYSA-N 1,1-dimethoxy-n,n-dimethylethanamine Chemical compound COC(C)(OC)N(C)C FBZVZUSVGKOWHG-UHFFFAOYSA-N 0.000 description 1
- CYSGHNMQYZDMIA-UHFFFAOYSA-N 1,3-Dimethyl-2-imidazolidinon Chemical compound CN1CCN(C)C1=O CYSGHNMQYZDMIA-UHFFFAOYSA-N 0.000 description 1
- KIPSRYDSZQRPEA-UHFFFAOYSA-N 2,2,2-trifluoroethanamine Chemical class NCC(F)(F)F KIPSRYDSZQRPEA-UHFFFAOYSA-N 0.000 description 1
- SCNPZYFBDOEUPZ-UHFFFAOYSA-N 4-(diethoxymethyl)morpholine Chemical compound CCOC(OCC)N1CCOCC1 SCNPZYFBDOEUPZ-UHFFFAOYSA-N 0.000 description 1
- FCSKOFQQCWLGMV-UHFFFAOYSA-N 5-{5-[2-chloro-4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]pentyl}-3-methylisoxazole Chemical compound O1N=C(C)C=C1CCCCCOC1=CC=C(C=2OCCN=2)C=C1Cl FCSKOFQQCWLGMV-UHFFFAOYSA-N 0.000 description 1
- 241001530105 Anax Species 0.000 description 1
- 206010003445 Ascites Diseases 0.000 description 1
- 125000006519 CCH3 Chemical group 0.000 description 1
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 1
- 208000030453 Drug-Related Side Effects and Adverse reaction Diseases 0.000 description 1
- 208000001382 Experimental Melanoma Diseases 0.000 description 1
- 241000295146 Gallionellaceae Species 0.000 description 1
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 1
- 241000272168 Laridae Species 0.000 description 1
- ZSXGLVDWWRXATF-UHFFFAOYSA-N N,N-dimethylformamide dimethyl acetal Chemical compound COC(OC)N(C)C ZSXGLVDWWRXATF-UHFFFAOYSA-N 0.000 description 1
- 241000577979 Peromyscus spicilegus Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 206010070863 Toxicity to various agents Diseases 0.000 description 1
- 241000282495 Vulpes corsac Species 0.000 description 1
- 235000008529 Ziziphus vulgaris Nutrition 0.000 description 1
- 244000126002 Ziziphus vulgaris Species 0.000 description 1
- WKYZYLKGCNBEMG-WUDYKRTCSA-N [(1as,8s,8ar,8bs)-6-hydroxy-8a-methoxy-5-methyl-4,7-dioxo-1,1a,2,4,7,8,8a,8b-octahydroazireno[2',3':3,4]pyrrolo[1,2-a]indol-8-yl]methyl carbamate Chemical compound C1N2C(C(=C(C)C(=O)C3=O)O)=C3[C@@H](COC(N)=O)[C@@]2(OC)[C@@H]2[C@H]1N2 WKYZYLKGCNBEMG-WUDYKRTCSA-N 0.000 description 1
- OCBFFGCSTGGPSQ-UHFFFAOYSA-N [CH2]CC Chemical compound [CH2]CC OCBFFGCSTGGPSQ-UHFFFAOYSA-N 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000000538 analytical sample Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- DXZDEAJXVCLRLE-UHFFFAOYSA-N azepin-2-one Chemical class O=C1C=CC=CC=N1 DXZDEAJXVCLRLE-UHFFFAOYSA-N 0.000 description 1
- MNFORVFSTILPAW-UHFFFAOYSA-N azetidin-2-one Chemical class O=C1CCN1 MNFORVFSTILPAW-UHFFFAOYSA-N 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 235000010633 broth Nutrition 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- WOXAMAFQCDBSNP-UHFFFAOYSA-N chloro(piperidin-1-ium-1-ylidene)methanamine;chloride Chemical compound [Cl-].NC(Cl)=[N+]1CCCCC1 WOXAMAFQCDBSNP-UHFFFAOYSA-N 0.000 description 1
- 235000019365 chlortetracycline Nutrition 0.000 description 1
- 238000011097 chromatography purification Methods 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- ZYMLBOINJTXUAK-UHFFFAOYSA-N dimethoxymethanamine Chemical compound COC(N)OC ZYMLBOINJTXUAK-UHFFFAOYSA-N 0.000 description 1
- HPYNZHMRTTWQTB-UHFFFAOYSA-N dimethylpyridine Natural products CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- HWJHWSBFPPPIPD-UHFFFAOYSA-N ethoxyethane;propan-2-one Chemical compound CC(C)=O.CCOCC HWJHWSBFPPPIPD-UHFFFAOYSA-N 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- 239000002038 ethyl acetate fraction Substances 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- ZHNUHDYFZUAESO-UHFFFAOYSA-N formamide Substances NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000000383 hazardous chemical Substances 0.000 description 1
- XNXVOSBNFZWHBV-UHFFFAOYSA-N hydron;o-methylhydroxylamine;chloride Chemical compound Cl.CON XNXVOSBNFZWHBV-UHFFFAOYSA-N 0.000 description 1
- 150000002463 imidates Chemical class 0.000 description 1
- QMRIWYCCTCNABA-UHFFFAOYSA-N indole-4,7-quinone Chemical compound O=C1C=CC(=O)C2=C1C=CN2 QMRIWYCCTCNABA-UHFFFAOYSA-N 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000002054 inoculum Substances 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 239000007928 intraperitoneal injection Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 238000009533 lab test Methods 0.000 description 1
- 231100001231 less toxic Toxicity 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 201000001441 melanoma Diseases 0.000 description 1
- 206010061289 metastatic neoplasm Diseases 0.000 description 1
- AGJSNMGHAVDLRQ-IWFBPKFRSA-N methyl (2s)-2-[[(2s)-2-[[(2s)-2-[[(2r)-2-amino-3-sulfanylpropanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxy-2,3-dimethylphenyl)propanoyl]amino]-4-methylsulfanylbutanoate Chemical compound SC[C@H](N)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)OC)CC1=CC=C(O)C(C)=C1C AGJSNMGHAVDLRQ-IWFBPKFRSA-N 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- JZOQMHXMLBFRDB-UHFFFAOYSA-N n-methylmethanimidoyl chloride Chemical compound CN=CCl JZOQMHXMLBFRDB-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- HYDZPXNVHXJHBG-UHFFFAOYSA-N o-benzylhydroxylamine;hydron;chloride Chemical compound Cl.NOCC1=CC=CC=C1 HYDZPXNVHXJHBG-UHFFFAOYSA-N 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 238000002638 palliative care Methods 0.000 description 1
- 210000000496 pancreas Anatomy 0.000 description 1
- 201000002094 pancreatic adenocarcinoma Diseases 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- XUWHAWMETYGRKB-UHFFFAOYSA-N piperidin-2-one Chemical class O=C1CCCCN1 XUWHAWMETYGRKB-UHFFFAOYSA-N 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- WTUJMUAZXUEIEM-UHFFFAOYSA-N propan-2-yl methanimidate Chemical compound CC(C)OC=N WTUJMUAZXUEIEM-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 230000001502 supplementing effect Effects 0.000 description 1
- 230000009897 systematic effect Effects 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 238000002371 ultraviolet--visible spectrum Methods 0.000 description 1
- 230000004584 weight gain Effects 0.000 description 1
- 235000019786 weight gain Nutrition 0.000 description 1
- 230000004580 weight loss Effects 0.000 description 1
- 150000003953 γ-lactams Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/12—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains three hetero rings
- C07D487/14—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US38514982A | 1982-06-04 | 1982-06-04 | |
| US06/492,903 US4487769A (en) | 1982-06-04 | 1983-05-09 | Amidines |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NZ204352A true NZ204352A (en) | 1987-07-31 |
Family
ID=27010906
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NZ204352A NZ204352A (en) | 1982-06-04 | 1983-05-25 | Mitomycin analogs carrying one or more guanidino substituents in the 7- and/or 10-positions |
Country Status (27)
| Country | Link |
|---|---|
| US (1) | US4487769A (esLanguage) |
| KR (1) | KR870000932B1 (esLanguage) |
| AR (1) | AR241438A1 (esLanguage) |
| AT (1) | AT394853B (esLanguage) |
| AU (1) | AU571179B2 (esLanguage) |
| CA (1) | CA1230333A (esLanguage) |
| CH (1) | CH657856A5 (esLanguage) |
| DD (1) | DD210275A5 (esLanguage) |
| DE (1) | DE3319992A1 (esLanguage) |
| DK (2) | DK161023C (esLanguage) |
| ES (3) | ES522948A0 (esLanguage) |
| FI (1) | FI78700C (esLanguage) |
| FR (1) | FR2528048B1 (esLanguage) |
| GB (1) | GB2121796B (esLanguage) |
| GR (1) | GR78277B (esLanguage) |
| HU (1) | HU198936B (esLanguage) |
| IE (1) | IE56107B1 (esLanguage) |
| IL (1) | IL68852A0 (esLanguage) |
| IT (1) | IT1206452B (esLanguage) |
| LU (1) | LU84843A1 (esLanguage) |
| NL (1) | NL8301949A (esLanguage) |
| NO (1) | NO161676C (esLanguage) |
| NZ (1) | NZ204352A (esLanguage) |
| OA (1) | OA07452A (esLanguage) |
| PT (1) | PT76810B (esLanguage) |
| SE (1) | SE455504B (esLanguage) |
| YU (2) | YU42866B (esLanguage) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NZ206932A (en) * | 1983-02-07 | 1987-08-31 | University Patents Inc | Certain 6-(heterocyclyl or amino) mitosanes and pharmaceutical compositions |
| US4803212A (en) * | 1983-04-11 | 1989-02-07 | Bristol-Myers Company | Amino disulfides |
| US4579737A (en) * | 1983-05-09 | 1986-04-01 | Bristol-Myers Company | Bis-amidines |
| US4642352A (en) * | 1983-12-23 | 1987-02-10 | Bristol-Myers Company | Acylamino mitosanes |
| US4814445A (en) * | 1984-09-04 | 1989-03-21 | Bristol-Myers Company | Process for preparing mitomycin analogs |
| AU581673B2 (en) * | 1984-09-04 | 1989-03-02 | Bristol-Myers Company | Substituted 7-oxomitosanes |
| JPS61176590A (ja) * | 1985-01-31 | 1986-08-08 | Kyowa Hakko Kogyo Co Ltd | 7−n−アミノメチレンマイトマイシン誘導体、製造法及び抗腫瘍剤 |
| AT396688B (de) * | 1985-02-21 | 1993-11-25 | Bristol Myers Squibb Co | Verfahren zur herstellung von kristallinem |
| US4639528A (en) * | 1985-02-21 | 1987-01-27 | Bristol-Myers Company | Crystalline form of 7-(dimethylaminomethylene-amino-9a-methoxymitosane |
| ZA86308B (en) * | 1985-02-25 | 1986-11-26 | Bristol Myers Co | In-vial deposition of 7-(dimethylaminomethylene)amino-9a-methoxy-mitosane |
| US4652644A (en) * | 1985-04-29 | 1987-03-24 | Bristol-Myers Company | Process for preparation of N7 -amidino substituted mitomycin C derivatives |
| JPH066592B2 (ja) * | 1986-04-18 | 1994-01-26 | 協和醗酵工業株式会社 | マイトマイシン誘導体 |
| US4791113A (en) * | 1986-05-14 | 1988-12-13 | Kyowa Hakko Kogyo Kabushiki Kaisha | Mitomycin derivatives as antileukemia agents |
| JPS6354380A (ja) * | 1986-08-26 | 1988-03-08 | Kyowa Hakko Kogyo Co Ltd | マイトマイシン誘導体 |
| JPS63150282A (ja) * | 1986-12-13 | 1988-06-22 | Kyowa Hakko Kogyo Co Ltd | マイトマイシン誘導体 |
| IL86665A0 (en) * | 1987-06-12 | 1988-11-30 | Bristol Myers Co | Mitomycin analogs |
| IL89203A0 (en) * | 1988-02-11 | 1989-09-10 | Univ Houston | 7-substituted hydrazine mitomycin analogs and pharmaceutical compositions containing them |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3660578A (en) * | 1957-04-06 | 1972-05-02 | Kyowa Hakko Kogyo Kk | Mitomycin c |
| US3121084A (en) * | 1962-09-17 | 1964-02-11 | Du Pont | Selected n, n, n'-trisubstituted amidines and their preparation by reaction of compounds with-nh2 groups with amide acetals |
| NL129868C (esLanguage) * | 1963-06-07 | |||
| DE1570029A1 (de) * | 1964-07-09 | 1970-04-09 | Kyowa Hakko Kogyo Kk | Verfahren zur Herstellung von Mitosanverbindungen |
| US3420846A (en) * | 1964-08-25 | 1969-01-07 | Kyowa Hakko Kogyo Kk | 7-substituted mitomycin a |
| US3332944A (en) * | 1964-11-02 | 1967-07-25 | American Cyanamid Co | Antibiotic derivatives of mitomycins a, b, c and porfiromycin |
| JPS5439098A (en) * | 1977-08-31 | 1979-03-24 | Kyowa Hakko Kogyo Co Ltd | Mitomycin c derivatives |
| US4268676A (en) * | 1979-12-05 | 1981-05-19 | University Patents, Inc. | Mitomycin analogs |
| NZ206932A (en) * | 1983-02-07 | 1987-08-31 | University Patents Inc | Certain 6-(heterocyclyl or amino) mitosanes and pharmaceutical compositions |
| US4803212A (en) * | 1983-04-11 | 1989-02-07 | Bristol-Myers Company | Amino disulfides |
| JPS6073085A (ja) * | 1983-09-28 | 1985-04-25 | Matsushita Refrig Co | ロ−タリ−コンプレツサ |
| US4642352A (en) * | 1983-12-23 | 1987-02-10 | Bristol-Myers Company | Acylamino mitosanes |
-
1983
- 1983-05-09 US US06/492,903 patent/US4487769A/en not_active Expired - Fee Related
- 1983-05-25 NZ NZ204352A patent/NZ204352A/en unknown
- 1983-05-26 AU AU15014/83A patent/AU571179B2/en not_active Ceased
- 1983-05-27 FR FR8308807A patent/FR2528048B1/fr not_active Expired
- 1983-06-01 NL NL8301949A patent/NL8301949A/nl not_active Application Discontinuation
- 1983-06-01 DE DE19833319992 patent/DE3319992A1/de active Granted
- 1983-06-01 IL IL68852A patent/IL68852A0/xx not_active IP Right Cessation
- 1983-06-01 FI FI831972A patent/FI78700C/fi not_active IP Right Cessation
- 1983-06-02 GB GB08315205A patent/GB2121796B/en not_active Expired
- 1983-06-03 DK DK253083A patent/DK161023C/da not_active IP Right Cessation
- 1983-06-03 ES ES522948A patent/ES522948A0/es active Granted
- 1983-06-03 DD DD83251741A patent/DD210275A5/de not_active IP Right Cessation
- 1983-06-03 IE IE1320/83A patent/IE56107B1/en not_active IP Right Cessation
- 1983-06-03 GR GR71552A patent/GR78277B/el unknown
- 1983-06-03 OA OA58018A patent/OA07452A/xx unknown
- 1983-06-03 YU YU1241/83A patent/YU42866B/xx unknown
- 1983-06-03 PT PT76810A patent/PT76810B/pt not_active IP Right Cessation
- 1983-06-03 NO NO832022A patent/NO161676C/no unknown
- 1983-06-03 CA CA000429642A patent/CA1230333A/en not_active Expired
- 1983-06-03 SE SE8303160A patent/SE455504B/sv not_active IP Right Cessation
- 1983-06-03 IT IT8321461A patent/IT1206452B/it active
- 1983-06-03 LU LU84843A patent/LU84843A1/fr unknown
- 1983-06-03 HU HU834817A patent/HU198936B/hu unknown
- 1983-06-04 KR KR1019830002499A patent/KR870000932B1/ko not_active Expired
- 1983-06-06 AT AT0206483A patent/AT394853B/de not_active IP Right Cessation
- 1983-06-10 CH CH3099/83A patent/CH657856A5/de not_active IP Right Cessation
-
1984
- 1984-02-09 ES ES529584A patent/ES529584A0/es active Granted
- 1984-02-09 ES ES529585A patent/ES529585A0/es active Granted
-
1985
- 1985-08-16 AR AR85301300A patent/AR241438A1/es active
-
1986
- 1986-02-05 YU YU164/86A patent/YU43427B/xx unknown
-
1990
- 1990-11-27 DK DK281490A patent/DK162167C/da not_active IP Right Cessation
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NZ204352A (en) | Mitomycin analogs carrying one or more guanidino substituents in the 7- and/or 10-positions | |
| US4866180A (en) | Amino disulfide thiol exchange products | |
| US4803212A (en) | Amino disulfides | |
| FI81099B (fi) | Foerfarande foer framstaellning av terapeutiskt aktiva mitomycinanaloger. | |
| US4567256A (en) | Amidine process | |
| US4814445A (en) | Process for preparing mitomycin analogs | |
| US4562203A (en) | Rifamycins derivatives and preparation and pharmaceutical compositions thereof | |
| CY1585A (en) | Pyrroloindole derivatives | |
| US4691023A (en) | Amino disulfides | |
| US4652644A (en) | Process for preparation of N7 -amidino substituted mitomycin C derivatives | |
| US4927943A (en) | Substituted 7-oxomitosanes | |
| EP0294828B1 (en) | Mitomycin analogs, a process for preparing them and pharmaceutical compositions | |
| JPS59205382A (ja) | アミノ2硫化物 | |
| JPS591486A (ja) | アミジン類 | |
| US4590074A (en) | Bis-amidines | |
| US5097036A (en) | Substituted 7-oxomitosanes | |
| AU2006243407A1 (en) | Antitumoral tetrahydro-pyrimidines | |
| ITOH et al. | Syntheses of some tricyclic heterocycles from 5, 6-diamino-1, 3-dimethyluracil | |
| US4667035A (en) | Substituted triazanonanes and process for their preparation | |
| US5099016A (en) | Substituted 7-oxomitosanes | |
| Toman et al. | Derivatives of 3, 4-dihydro-3-thioxo-2-quinoxalinylacetic acid | |
| NO881204L (no) | Mitosanderivater. | |
| US6875865B1 (en) | Selected derivatives of K-252a | |
| GB2171406A (en) | Mitosane derivative | |
| KISHIMOTO et al. | and Structure-Antitumor Activity Relationship of |