JPH0262543B2 - - Google Patents
Info
- Publication number
- JPH0262543B2 JPH0262543B2 JP61007824A JP782486A JPH0262543B2 JP H0262543 B2 JPH0262543 B2 JP H0262543B2 JP 61007824 A JP61007824 A JP 61007824A JP 782486 A JP782486 A JP 782486A JP H0262543 B2 JPH0262543 B2 JP H0262543B2
- Authority
- JP
- Japan
- Prior art keywords
- group
- formula
- hydroxy
- carbon atoms
- cyclobutyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 150000001875 compounds Chemical class 0.000 claims abstract description 229
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 41
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 36
- 150000003839 salts Chemical class 0.000 claims abstract description 29
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims abstract description 20
- 125000001424 substituent group Chemical group 0.000 claims abstract description 20
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 12
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 12
- -1 hydroxy, methoxy, phenyl Chemical group 0.000 claims description 296
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 171
- 125000004432 carbon atom Chemical group C* 0.000 claims description 87
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 51
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical group CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 35
- 125000001931 aliphatic group Chemical group 0.000 claims description 34
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 24
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 23
- 125000003545 alkoxy group Chemical group 0.000 claims description 20
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 18
- 229920006395 saturated elastomer Polymers 0.000 claims description 17
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 16
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 16
- 125000005843 halogen group Chemical group 0.000 claims description 16
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 14
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 13
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 12
- 125000004429 atom Chemical group 0.000 claims description 11
- 125000000000 cycloalkoxy group Chemical group 0.000 claims description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 10
- 125000004414 alkyl thio group Chemical group 0.000 claims description 8
- 125000001624 naphthyl group Chemical group 0.000 claims description 7
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 claims description 7
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 7
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 7
- 125000001246 bromo group Chemical group Br* 0.000 claims description 6
- 125000001153 fluoro group Chemical group F* 0.000 claims description 6
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 claims description 6
- 125000004066 1-hydroxyethyl group Chemical group [H]OC([H])([*])C([H])([H])[H] 0.000 claims description 5
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 5
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 5
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 5
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 claims description 4
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 claims description 4
- KPAKBKTVDFSMLH-UHFFFAOYSA-N 1-[1-(4-chlorophenyl)cyclobutyl]-1-(dimethylamino)butan-2-one Chemical compound C=1C=C(Cl)C=CC=1C1(C(N(C)C)C(=O)CC)CCC1 KPAKBKTVDFSMLH-UHFFFAOYSA-N 0.000 claims description 3
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 claims description 3
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims description 3
- 239000003085 diluting agent Substances 0.000 claims description 3
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims description 3
- 125000004076 pyridyl group Chemical group 0.000 claims description 3
- DHNWSEROHSZCDI-UHFFFAOYSA-N 1-amino-1-[1-(4-chlorophenyl)cyclobutyl]-3-methylpentan-3-ol Chemical compound C=1C=C(Cl)C=CC=1C1(C(N)CC(C)(O)CC)CCC1 DHNWSEROHSZCDI-UHFFFAOYSA-N 0.000 claims description 2
- LDKSCZJUIURGMW-UHFFFAOYSA-N 1-isothiocyanato-3-methylsulfanylpropane Chemical group CSCCCN=C=S LDKSCZJUIURGMW-UHFFFAOYSA-N 0.000 claims description 2
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 claims description 2
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 claims description 2
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 claims description 2
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 claims description 2
- SXIFAEWFOJETOA-UHFFFAOYSA-N 4-hydroxy-butyl Chemical group [CH2]CCCO SXIFAEWFOJETOA-UHFFFAOYSA-N 0.000 claims description 2
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 claims description 2
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 claims description 2
- 125000001064 morpholinomethyl group Chemical group [H]C([H])(*)N1C([H])([H])C([H])([H])OC([H])([H])C1([H])[H] 0.000 claims description 2
- UFUASNAHBMBJIX-UHFFFAOYSA-N propan-1-one Chemical group CC[C]=O UFUASNAHBMBJIX-UHFFFAOYSA-N 0.000 claims description 2
- XQJFVETZOZGLHG-UHFFFAOYSA-N 1-amino-3-ethyl-1-[1-(4-fluorophenyl)cyclobutyl]pentan-3-ol Chemical compound C=1C=C(F)C=CC=1C1(C(N)CC(O)(CC)CC)CCC1 XQJFVETZOZGLHG-UHFFFAOYSA-N 0.000 claims 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 claims 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 claims 1
- AACKDBZAQRRAID-UHFFFAOYSA-N 4-amino-2-methyl-4-(1-phenylcyclobutyl)butan-2-ol Chemical compound C=1C=CC=CC=1C1(C(N)CC(C)(O)C)CCC1 AACKDBZAQRRAID-UHFFFAOYSA-N 0.000 claims 1
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 claims 1
- 125000006639 cyclohexyl carbonyl group Chemical group 0.000 claims 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 claims 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims 1
- 125000005415 substituted alkoxy group Chemical group 0.000 abstract description 8
- 125000005530 alkylenedioxy group Chemical group 0.000 abstract description 7
- 125000005338 substituted cycloalkoxy group Chemical group 0.000 abstract description 3
- 125000001183 hydrocarbyl group Chemical group 0.000 abstract 3
- 208000020401 Depressive disease Diseases 0.000 abstract 1
- 125000002029 aromatic hydrocarbon group Chemical group 0.000 abstract 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 435
- 239000000203 mixture Substances 0.000 description 286
- 239000000243 solution Substances 0.000 description 183
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 129
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 94
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 94
- 239000003921 oil Substances 0.000 description 85
- 235000019198 oils Nutrition 0.000 description 85
- 238000006243 chemical reaction Methods 0.000 description 84
- 239000000284 extract Substances 0.000 description 84
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 78
- 238000010992 reflux Methods 0.000 description 59
- 239000000047 product Substances 0.000 description 52
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 50
- 238000000034 method Methods 0.000 description 47
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 43
- 238000009835 boiling Methods 0.000 description 39
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 36
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 36
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 35
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 34
- 150000002576 ketones Chemical class 0.000 description 34
- 239000002904 solvent Substances 0.000 description 34
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 33
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 33
- 238000003756 stirring Methods 0.000 description 33
- 239000002585 base Substances 0.000 description 31
- 239000003208 petroleum Substances 0.000 description 31
- 239000011541 reaction mixture Substances 0.000 description 30
- 239000012279 sodium borohydride Substances 0.000 description 29
- 229910000033 sodium borohydride Inorganic materials 0.000 description 29
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 28
- 239000007787 solid Substances 0.000 description 28
- 230000009467 reduction Effects 0.000 description 27
- 238000006722 reduction reaction Methods 0.000 description 27
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 24
- 238000001704 evaporation Methods 0.000 description 24
- 230000008020 evaporation Effects 0.000 description 24
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 24
- 229910052744 lithium Inorganic materials 0.000 description 22
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 21
- 125000004093 cyano group Chemical group *C#N 0.000 description 21
- 239000000126 substance Substances 0.000 description 20
- 239000002253 acid Substances 0.000 description 19
- 239000010410 layer Substances 0.000 description 19
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 18
- 239000007864 aqueous solution Substances 0.000 description 18
- 150000003141 primary amines Chemical class 0.000 description 18
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 17
- 239000012259 ether extract Substances 0.000 description 17
- 239000011734 sodium Substances 0.000 description 17
- 229910052708 sodium Inorganic materials 0.000 description 17
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 16
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 16
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 16
- 150000001412 amines Chemical class 0.000 description 15
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 15
- 239000003480 eluent Substances 0.000 description 15
- 238000003818 flash chromatography Methods 0.000 description 15
- 239000000725 suspension Substances 0.000 description 15
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 14
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 14
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 14
- 230000015572 biosynthetic process Effects 0.000 description 14
- 235000019253 formic acid Nutrition 0.000 description 14
- 150000002148 esters Chemical class 0.000 description 13
- 239000000706 filtrate Substances 0.000 description 13
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 229910052799 carbon Inorganic materials 0.000 description 12
- 238000006460 hydrolysis reaction Methods 0.000 description 12
- 125000004043 oxo group Chemical group O=* 0.000 description 12
- 150000003254 radicals Chemical class 0.000 description 12
- 150000003335 secondary amines Chemical class 0.000 description 12
- 239000003153 chemical reaction reagent Substances 0.000 description 11
- 150000002170 ethers Chemical class 0.000 description 11
- 235000019256 formaldehyde Nutrition 0.000 description 11
- 229960004279 formaldehyde Drugs 0.000 description 11
- 230000007062 hydrolysis Effects 0.000 description 11
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 10
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 10
- TZIHFWKZFHZASV-UHFFFAOYSA-N methyl formate Chemical compound COC=O TZIHFWKZFHZASV-UHFFFAOYSA-N 0.000 description 10
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 10
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 9
- 239000007818 Grignard reagent Substances 0.000 description 9
- 150000001721 carbon Chemical group 0.000 description 9
- 238000001816 cooling Methods 0.000 description 9
- 239000012458 free base Substances 0.000 description 9
- 150000002466 imines Chemical class 0.000 description 9
- 239000011777 magnesium Substances 0.000 description 9
- 229910052749 magnesium Inorganic materials 0.000 description 9
- 229910052751 metal Inorganic materials 0.000 description 9
- 239000002184 metal Substances 0.000 description 9
- 125000002524 organometallic group Chemical group 0.000 description 9
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 9
- 239000003826 tablet Substances 0.000 description 9
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 8
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 8
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 8
- 239000004480 active ingredient Substances 0.000 description 8
- 125000005219 aminonitrile group Chemical group 0.000 description 8
- 229910052786 argon Inorganic materials 0.000 description 8
- 239000012267 brine Substances 0.000 description 8
- 239000003638 chemical reducing agent Substances 0.000 description 8
- 239000003814 drug Substances 0.000 description 8
- 229950004696 flusalan Drugs 0.000 description 8
- 150000004795 grignard reagents Chemical class 0.000 description 8
- 239000001257 hydrogen Substances 0.000 description 8
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 8
- 239000011976 maleic acid Substances 0.000 description 8
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 8
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 8
- 150000003512 tertiary amines Chemical class 0.000 description 8
- 229960000583 acetic acid Drugs 0.000 description 7
- 238000010533 azeotropic distillation Methods 0.000 description 7
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 7
- 238000000354 decomposition reaction Methods 0.000 description 7
- 238000004821 distillation Methods 0.000 description 7
- 238000001035 drying Methods 0.000 description 7
- 238000004128 high performance liquid chromatography Methods 0.000 description 7
- 239000012280 lithium aluminium hydride Substances 0.000 description 7
- 239000000463 material Substances 0.000 description 7
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 7
- 235000017557 sodium bicarbonate Nutrition 0.000 description 7
- 239000012312 sodium hydride Substances 0.000 description 7
- 229910000104 sodium hydride Inorganic materials 0.000 description 7
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 150000001299 aldehydes Chemical class 0.000 description 6
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical compound [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 6
- MCQRPQCQMGVWIQ-UHFFFAOYSA-N boron;methylsulfanylmethane Chemical compound [B].CSC MCQRPQCQMGVWIQ-UHFFFAOYSA-N 0.000 description 6
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 6
- 239000002775 capsule Substances 0.000 description 6
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 6
- 239000007789 gas Substances 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 239000002480 mineral oil Substances 0.000 description 6
- 235000010446 mineral oil Nutrition 0.000 description 6
- 230000002829 reductive effect Effects 0.000 description 6
- ISIJQEHRDSCQIU-UHFFFAOYSA-N tert-butyl 2,7-diazaspiro[4.5]decane-7-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCCC11CNCC1 ISIJQEHRDSCQIU-UHFFFAOYSA-N 0.000 description 6
- UZFMOKQJFYMBGY-UHFFFAOYSA-N 4-hydroxy-TEMPO Chemical compound CC1(C)CC(O)CC(C)(C)N1[O] UZFMOKQJFYMBGY-UHFFFAOYSA-N 0.000 description 5
- 150000001241 acetals Chemical class 0.000 description 5
- 230000002378 acidificating effect Effects 0.000 description 5
- 230000029936 alkylation Effects 0.000 description 5
- 238000005804 alkylation reaction Methods 0.000 description 5
- 239000008346 aqueous phase Substances 0.000 description 5
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 5
- GFBLFDSCAKHHGX-UHFFFAOYSA-N cyclobutanecarbonitrile Chemical compound N#CC1CCC1 GFBLFDSCAKHHGX-UHFFFAOYSA-N 0.000 description 5
- 229940043279 diisopropylamine Drugs 0.000 description 5
- QMMFVYPAHWMCMS-UHFFFAOYSA-N dimethylsulfide Substances CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 5
- 239000006185 dispersion Substances 0.000 description 5
- 229940079593 drug Drugs 0.000 description 5
- 125000004185 ester group Chemical group 0.000 description 5
- 239000012362 glacial acetic acid Substances 0.000 description 5
- 239000012044 organic layer Substances 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- 230000003647 oxidation Effects 0.000 description 5
- 238000007254 oxidation reaction Methods 0.000 description 5
- 239000002243 precursor Substances 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 5
- 239000000377 silicon dioxide Substances 0.000 description 5
- 239000012258 stirred mixture Substances 0.000 description 5
- 125000005424 tosyloxy group Chemical group S(=O)(=O)(C1=CC=C(C)C=C1)O* 0.000 description 5
- BNJNVVFPYYPNKP-UHFFFAOYSA-N 1-[1-(4-chlorophenyl)cyclobutyl]-1-(dimethylamino)propan-2-one Chemical compound C=1C=C(Cl)C=CC=1C1(C(C(C)=O)N(C)C)CCC1 BNJNVVFPYYPNKP-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 4
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 4
- 239000005695 Ammonium acetate Substances 0.000 description 4
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 4
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 4
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- FZENGILVLUJGJX-UHFFFAOYSA-N acetaldehyde oxime Chemical compound CC=NO FZENGILVLUJGJX-UHFFFAOYSA-N 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- 229910052783 alkali metal Inorganic materials 0.000 description 4
- 229910052782 aluminium Inorganic materials 0.000 description 4
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 4
- 235000019257 ammonium acetate Nutrition 0.000 description 4
- 229940043376 ammonium acetate Drugs 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 4
- 150000004678 hydrides Chemical class 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- IUYHWZFSGMZEOG-UHFFFAOYSA-M magnesium;propane;chloride Chemical compound [Mg+2].[Cl-].C[CH-]C IUYHWZFSGMZEOG-UHFFFAOYSA-M 0.000 description 4
- 235000006408 oxalic acid Nutrition 0.000 description 4
- 239000008194 pharmaceutical composition Substances 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- 239000006187 pill Substances 0.000 description 4
- 125000006239 protecting group Chemical class 0.000 description 4
- 238000000746 purification Methods 0.000 description 4
- 235000015096 spirit Nutrition 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- RKANFKZOBUUWHM-UHFFFAOYSA-N 1-[1-(4-chlorophenyl)cyclobutyl]-2-methoxyethanone Chemical compound C=1C=C(Cl)C=CC=1C1(C(=O)COC)CCC1 RKANFKZOBUUWHM-UHFFFAOYSA-N 0.000 description 3
- GQUJIUJJYMQXEF-UHFFFAOYSA-N 3-amino-3-[1-(4-chlorophenyl)cyclobutyl]propan-1-ol Chemical compound C=1C=C(Cl)C=CC=1C1(C(CCO)N)CCC1 GQUJIUJJYMQXEF-UHFFFAOYSA-N 0.000 description 3
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- 241000699670 Mus sp. Species 0.000 description 3
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 3
- 238000005917 acylation reaction Methods 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 3
- 229910000085 borane Inorganic materials 0.000 description 3
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 3
- MOIPGXQKZSZOQX-UHFFFAOYSA-N carbonyl bromide Chemical compound BrC(Br)=O MOIPGXQKZSZOQX-UHFFFAOYSA-N 0.000 description 3
- 125000003262 carboxylic acid ester group Chemical class [H]C([H])([*:2])OC(=O)C([H])([H])[*:1] 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 229960003887 dichlorophen Drugs 0.000 description 3
- 150000002081 enamines Chemical class 0.000 description 3
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 3
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 239000008101 lactose Substances 0.000 description 3
- BJEPYKJPYRNKOW-UHFFFAOYSA-L malate(2-) Chemical compound [O-]C(=O)C(O)CC([O-])=O BJEPYKJPYRNKOW-UHFFFAOYSA-L 0.000 description 3
- 150000004701 malic acid derivatives Chemical class 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 3
- 239000001294 propane Substances 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 238000006268 reductive amination reaction Methods 0.000 description 3
- 210000002784 stomach Anatomy 0.000 description 3
- 125000000547 substituted alkyl group Chemical group 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- 125000003944 tolyl group Chemical group 0.000 description 3
- DNXIKVLOVZVMQF-UHFFFAOYSA-N (3beta,16beta,17alpha,18beta,20alpha)-17-hydroxy-11-methoxy-18-[(3,4,5-trimethoxybenzoyl)oxy]-yohimban-16-carboxylic acid, methyl ester Natural products C1C2CN3CCC(C4=CC=C(OC)C=C4N4)=C4C3CC2C(C(=O)OC)C(O)C1OC(=O)C1=CC(OC)=C(OC)C(OC)=C1 DNXIKVLOVZVMQF-UHFFFAOYSA-N 0.000 description 2
- RHUYHJGZWVXEHW-UHFFFAOYSA-N 1,1-Dimethyhydrazine Chemical compound CN(C)N RHUYHJGZWVXEHW-UHFFFAOYSA-N 0.000 description 2
- ULTHEAFYOOPTTB-UHFFFAOYSA-N 1,4-dibromobutane Chemical compound BrCCCCBr ULTHEAFYOOPTTB-UHFFFAOYSA-N 0.000 description 2
- XQONXPWVIZZJIL-UHFFFAOYSA-N 1-(4-chlorophenyl)cyclobutane-1-carbonitrile Chemical compound C1=CC(Cl)=CC=C1C1(C#N)CCC1 XQONXPWVIZZJIL-UHFFFAOYSA-N 0.000 description 2
- RBCZPQRUWINABO-UHFFFAOYSA-N 1-[1-(4-chlorophenyl)cyclobutyl]-2-methylsulfanylethanamine Chemical compound C=1C=C(Cl)C=CC=1C1(C(N)CSC)CCC1 RBCZPQRUWINABO-UHFFFAOYSA-N 0.000 description 2
- DQELVDVHFJLWIY-UHFFFAOYSA-N 1-[1-(4-chlorophenyl)cyclobutyl]-2-methylsulfonylethenamine Chemical compound C=1C=C(Cl)C=CC=1C1(C(N)=CS(=O)(=O)C)CCC1 DQELVDVHFJLWIY-UHFFFAOYSA-N 0.000 description 2
- KJAJWYWBYJPAMX-UHFFFAOYSA-N 1-[1-(4-chlorophenyl)cyclobutyl]ethanone Chemical compound C=1C=C(Cl)C=CC=1C1(C(=O)C)CCC1 KJAJWYWBYJPAMX-UHFFFAOYSA-N 0.000 description 2
- VQKFNUFAXTZWDK-UHFFFAOYSA-N 2-Methylfuran Chemical compound CC1=CC=CO1 VQKFNUFAXTZWDK-UHFFFAOYSA-N 0.000 description 2
- FBTRVDVXAWGYLM-UHFFFAOYSA-N 2-[1-(3,4-dichlorophenyl)cyclobutyl]-2-(dimethylamino)acetonitrile Chemical compound C=1C=C(Cl)C(Cl)=CC=1C1(C(C#N)N(C)C)CCC1 FBTRVDVXAWGYLM-UHFFFAOYSA-N 0.000 description 2
- ZVQKOXVFRDBHRS-UHFFFAOYSA-N 2-[1-(3,4-dichlorophenyl)cyclobutyl]-2-hydroxyacetonitrile Chemical compound C=1C=C(Cl)C(Cl)=CC=1C1(C(C#N)O)CCC1 ZVQKOXVFRDBHRS-UHFFFAOYSA-N 0.000 description 2
- SOUCVINXHOMOIV-UHFFFAOYSA-N 2-[1-(4-chlorophenyl)cyclobutyl]-2,2-dimethoxyethanol Chemical compound C=1C=C(Cl)C=CC=1C1(C(CO)(OC)OC)CCC1 SOUCVINXHOMOIV-UHFFFAOYSA-N 0.000 description 2
- VSKKEMRRASGNJT-UHFFFAOYSA-N 2-[1-(4-chlorophenyl)cyclobutyl]-2-(dimethylamino)acetonitrile Chemical compound C=1C=C(Cl)C=CC=1C1(C(C#N)N(C)C)CCC1 VSKKEMRRASGNJT-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- YPEWWCINWMJFRK-UHFFFAOYSA-N 2-bromo-1-[1-(4-chlorophenyl)cyclobutyl]ethanone Chemical compound C1=CC(Cl)=CC=C1C1(C(=O)CBr)CCC1 YPEWWCINWMJFRK-UHFFFAOYSA-N 0.000 description 2
- YMQRPXBBBOXHNZ-UHFFFAOYSA-N 2-chloro-1-morpholin-4-ylethanone Chemical compound ClCC(=O)N1CCOCC1 YMQRPXBBBOXHNZ-UHFFFAOYSA-N 0.000 description 2
- ZSLUVFAKFWKJRC-IGMARMGPSA-N 232Th Chemical compound [232Th] ZSLUVFAKFWKJRC-IGMARMGPSA-N 0.000 description 2
- SDBFXQVWYWFMLZ-UHFFFAOYSA-N 3-[1-(4-chlorophenyl)cyclobutyl]-3-(dimethylamino)propan-1-ol Chemical compound C=1C=C(Cl)C=CC=1C1(C(CCO)N(C)C)CCC1 SDBFXQVWYWFMLZ-UHFFFAOYSA-N 0.000 description 2
- WNEODWDFDXWOLU-QHCPKHFHSA-N 3-[3-(hydroxymethyl)-4-[1-methyl-5-[[5-[(2s)-2-methyl-4-(oxetan-3-yl)piperazin-1-yl]pyridin-2-yl]amino]-6-oxopyridin-3-yl]pyridin-2-yl]-7,7-dimethyl-1,2,6,8-tetrahydrocyclopenta[3,4]pyrrolo[3,5-b]pyrazin-4-one Chemical compound C([C@@H](N(CC1)C=2C=NC(NC=3C(N(C)C=C(C=3)C=3C(=C(N4C(C5=CC=6CC(C)(C)CC=6N5CC4)=O)N=CC=3)CO)=O)=CC=2)C)N1C1COC1 WNEODWDFDXWOLU-QHCPKHFHSA-N 0.000 description 2
- LAMUXTNQCICZQX-UHFFFAOYSA-N 3-chloropropan-1-ol Chemical compound OCCCCl LAMUXTNQCICZQX-UHFFFAOYSA-N 0.000 description 2
- KCBWAFJCKVKYHO-UHFFFAOYSA-N 6-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-1-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]pyrazolo[3,4-d]pyrimidine Chemical compound C1(CC1)C1=NC=NC(=C1C1=NC=C2C(=N1)N(N=C2)CC1=CC=C(C=C1)C=1N(C=C(N=1)C(F)(F)F)C(C)C)OC KCBWAFJCKVKYHO-UHFFFAOYSA-N 0.000 description 2
- 244000215068 Acacia senegal Species 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- KRVQALMTMXRXDE-UHFFFAOYSA-M Br[Zn] Chemical compound Br[Zn] KRVQALMTMXRXDE-UHFFFAOYSA-M 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 229920000623 Cellulose acetate phthalate Polymers 0.000 description 2
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 2
- 229920002261 Corn starch Polymers 0.000 description 2
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 229920000084 Gum arabic Polymers 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- CPLXHLVBOLITMK-UHFFFAOYSA-N Magnesium oxide Chemical compound [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 2
- 229930195725 Mannitol Natural products 0.000 description 2
- 241000699666 Mus <mouse, genus> Species 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- NBBJYMSMWIIQGU-UHFFFAOYSA-N Propionic aldehyde Chemical compound CCC=O NBBJYMSMWIIQGU-UHFFFAOYSA-N 0.000 description 2
- LCQMZZCPPSWADO-UHFFFAOYSA-N Reserpilin Natural products COC(=O)C1COCC2CN3CCc4c([nH]c5cc(OC)c(OC)cc45)C3CC12 LCQMZZCPPSWADO-UHFFFAOYSA-N 0.000 description 2
- QEVHRUUCFGRFIF-SFWBKIHZSA-N Reserpine Natural products O=C(OC)[C@@H]1[C@H](OC)[C@H](OC(=O)c2cc(OC)c(OC)c(OC)c2)C[C@H]2[C@@H]1C[C@H]1N(C2)CCc2c3c([nH]c12)cc(OC)cc3 QEVHRUUCFGRFIF-SFWBKIHZSA-N 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 235000021355 Stearic acid Nutrition 0.000 description 2
- 229910052776 Thorium Inorganic materials 0.000 description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 2
- 235000018936 Vitellaria paradoxa Nutrition 0.000 description 2
- 239000000205 acacia gum Substances 0.000 description 2
- 235000010489 acacia gum Nutrition 0.000 description 2
- LVAMVZXECCXUGI-UHFFFAOYSA-N acetic acid;thallium Chemical compound [Tl].CC(O)=O LVAMVZXECCXUGI-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 description 2
- 238000005903 acid hydrolysis reaction Methods 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 230000036760 body temperature Effects 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- MOOAHMCRPCTRLV-UHFFFAOYSA-N boron sodium Chemical compound [B].[Na] MOOAHMCRPCTRLV-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 2
- MSZJEPVVQWJCIF-UHFFFAOYSA-N butylazanide Chemical compound CCCC[NH-] MSZJEPVVQWJCIF-UHFFFAOYSA-N 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 229940081734 cellulose acetate phthalate Drugs 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000008120 corn starch Substances 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- INVYSLWXPIEDIQ-UHFFFAOYSA-N cyclobutanecarbaldehyde Chemical compound O=CC1CCC1 INVYSLWXPIEDIQ-UHFFFAOYSA-N 0.000 description 2
- KVFDZFBHBWTVID-UHFFFAOYSA-N cyclohexanecarbaldehyde Chemical compound O=CC1CCCCC1 KVFDZFBHBWTVID-UHFFFAOYSA-N 0.000 description 2
- 239000008367 deionised water Substances 0.000 description 2
- 229910021641 deionized water Inorganic materials 0.000 description 2
- WQOXQRCZOLPYPM-UHFFFAOYSA-N dimethyl disulfide Chemical compound CSSC WQOXQRCZOLPYPM-UHFFFAOYSA-N 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- 239000002702 enteric coating Substances 0.000 description 2
- 238000009505 enteric coating Methods 0.000 description 2
- NDDYSHMVXYYPHP-UHFFFAOYSA-N ethyl 3-amino-3-[1-(4-chlorophenyl)cyclobutyl]propanoate Chemical compound C=1C=C(Cl)C=CC=1C1(C(N)CC(=O)OCC)CCC1 NDDYSHMVXYYPHP-UHFFFAOYSA-N 0.000 description 2
- 125000001207 fluorophenyl group Chemical group 0.000 description 2
- 235000013305 food Nutrition 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 230000022244 formylation Effects 0.000 description 2
- 238000006170 formylation reaction Methods 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 239000007903 gelatin capsule Substances 0.000 description 2
- JARKCYVAAOWBJS-UHFFFAOYSA-N hexanal Chemical compound CCCCCC=O JARKCYVAAOWBJS-UHFFFAOYSA-N 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- ULYZAYCEDJDHCC-UHFFFAOYSA-N isopropyl chloride Chemical compound CC(C)Cl ULYZAYCEDJDHCC-UHFFFAOYSA-N 0.000 description 2
- 230000002045 lasting effect Effects 0.000 description 2
- YQNQTEBHHUSESQ-UHFFFAOYSA-N lithium aluminate Chemical compound [Li+].[O-][Al]=O YQNQTEBHHUSESQ-UHFFFAOYSA-N 0.000 description 2
- 125000003588 lysine group Chemical group [H]N([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])(N([H])[H])C(*)=O 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- FRIJBUGBVQZNTB-UHFFFAOYSA-M magnesium;ethane;bromide Chemical compound [Mg+2].[Br-].[CH2-]C FRIJBUGBVQZNTB-UHFFFAOYSA-M 0.000 description 2
- 229940049920 malate Drugs 0.000 description 2
- 239000000594 mannitol Substances 0.000 description 2
- 235000010355 mannitol Nutrition 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- XNLICIUVMPYHGG-UHFFFAOYSA-N methyl n-propyl ketone Natural products CCCC(C)=O XNLICIUVMPYHGG-UHFFFAOYSA-N 0.000 description 2
- XONPDZSGENTBNJ-UHFFFAOYSA-N molecular hydrogen;sodium Chemical compound [Na].[H][H] XONPDZSGENTBNJ-UHFFFAOYSA-N 0.000 description 2
- VLAPMBHFAWRUQP-UHFFFAOYSA-L molybdic acid Chemical compound O[Mo](O)(=O)=O VLAPMBHFAWRUQP-UHFFFAOYSA-L 0.000 description 2
- PGGUGELFIVZRGN-UHFFFAOYSA-N n-[1-[1-(4-chlorophenyl)cyclobutyl]-4-ethoxybutyl]formamide Chemical compound C=1C=C(Cl)C=CC=1C1(C(NC=O)CCCOCC)CCC1 PGGUGELFIVZRGN-UHFFFAOYSA-N 0.000 description 2
- OCPUNEPBKGULNZ-UHFFFAOYSA-N n-[1-[1-(4-chlorophenyl)cyclobutyl]ethylideneamino]-n-methylmethanamine Chemical compound C=1C=C(Cl)C=CC=1C1(C(C)=NN(C)C)CCC1 OCPUNEPBKGULNZ-UHFFFAOYSA-N 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen(.) Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 2
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 2
- 150000002900 organolithium compounds Chemical class 0.000 description 2
- 239000012285 osmium tetroxide Substances 0.000 description 2
- 229910000489 osmium tetroxide Inorganic materials 0.000 description 2
- 150000003891 oxalate salts Chemical class 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- OVWIGQXNKGEUQN-UHFFFAOYSA-N pentan-2-one Chemical compound [CH2]C(=O)CCC OVWIGQXNKGEUQN-UHFFFAOYSA-N 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- BJOIZNZVOZKDIG-MDEJGZGSSA-N reserpine Chemical compound O([C@H]1[C@@H]([C@H]([C@H]2C[C@@H]3C4=C([C]5C=CC(OC)=CC5=N4)CCN3C[C@H]2C1)C(=O)OC)OC)C(=O)C1=CC(OC)=C(OC)C(OC)=C1 BJOIZNZVOZKDIG-MDEJGZGSSA-N 0.000 description 2
- 229960003147 reserpine Drugs 0.000 description 2
- MDMGHDFNKNZPAU-UHFFFAOYSA-N roserpine Natural products C1C2CN3CCC(C4=CC=C(OC)C=C4N4)=C4C3CC2C(OC(C)=O)C(OC)C1OC(=O)C1=CC(OC)=C(OC)C(OC)=C1 MDMGHDFNKNZPAU-UHFFFAOYSA-N 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- KKCBUQHMOMHUOY-UHFFFAOYSA-N sodium oxide Chemical compound [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 2
- 229910001948 sodium oxide Inorganic materials 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000008117 stearic acid Substances 0.000 description 2
- 125000005346 substituted cycloalkyl group Chemical group 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- HHVIBTZHLRERCL-UHFFFAOYSA-N sulfonyldimethane Chemical compound CS(C)(=O)=O HHVIBTZHLRERCL-UHFFFAOYSA-N 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- FKHIFSZMMVMEQY-UHFFFAOYSA-N talc Chemical compound [Mg+2].[O-][Si]([O-])=O FKHIFSZMMVMEQY-UHFFFAOYSA-N 0.000 description 2
- 239000010936 titanium Substances 0.000 description 2
- 229910052719 titanium Inorganic materials 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 238000011200 topical administration Methods 0.000 description 2
- CFOAUYCPAUGDFF-UHFFFAOYSA-N tosmic Chemical compound CC1=CC=C(S(=O)(=O)C[N+]#[C-])C=C1 CFOAUYCPAUGDFF-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- CSRZQMIRAZTJOY-UHFFFAOYSA-N trimethylsilyl iodide Chemical compound C[Si](C)(C)I CSRZQMIRAZTJOY-UHFFFAOYSA-N 0.000 description 2
- 229910052721 tungsten Inorganic materials 0.000 description 2
- YKYIFUROKBDHCY-ONEGZZNKSA-N (e)-4-ethoxy-1,1,1-trifluorobut-3-en-2-one Chemical group CCO\C=C\C(=O)C(F)(F)F YKYIFUROKBDHCY-ONEGZZNKSA-N 0.000 description 1
- MOWXJLUYGFNTAL-DEOSSOPVSA-N (s)-[2-chloro-4-fluoro-5-(7-morpholin-4-ylquinazolin-4-yl)phenyl]-(6-methoxypyridazin-3-yl)methanol Chemical compound N1=NC(OC)=CC=C1[C@@H](O)C1=CC(C=2C3=CC=C(C=C3N=CN=2)N2CCOCC2)=C(F)C=C1Cl MOWXJLUYGFNTAL-DEOSSOPVSA-N 0.000 description 1
- QQXAZSXISHZROU-BTJKTKAUSA-N (z)-but-2-enedioic acid;1-[1-(3,4-dichlorophenyl)cyclobutyl]-n,n-dimethyl-2-methylsulfonylethanamine Chemical compound OC(=O)\C=C/C(O)=O.C=1C=C(Cl)C(Cl)=CC=1C1(C(CS(C)(=O)=O)N(C)C)CCC1 QQXAZSXISHZROU-BTJKTKAUSA-N 0.000 description 1
- RIGAYNQWBKERCM-BTJKTKAUSA-N (z)-but-2-enedioic acid;1-[1-(4-chlorophenyl)cyclobutyl]-4-ethoxy-n-methylbutan-1-amine Chemical compound OC(=O)\C=C/C(O)=O.C=1C=C(Cl)C=CC=1C1(C(NC)CCCOCC)CCC1 RIGAYNQWBKERCM-BTJKTKAUSA-N 0.000 description 1
- BLIGRPKTCLOQJB-BTJKTKAUSA-N (z)-but-2-enedioic acid;1-[1-(4-chlorophenyl)cyclobutyl]-5-ethoxy-n-methylpentan-1-amine Chemical compound OC(=O)\C=C/C(O)=O.C=1C=C(Cl)C=CC=1C1(C(NC)CCCCOCC)CCC1 BLIGRPKTCLOQJB-BTJKTKAUSA-N 0.000 description 1
- BHGDVLVZQZOGTN-BTJKTKAUSA-N (z)-but-2-enedioic acid;1-[1-(4-chlorophenyl)cyclobutyl]-5-methoxy-n-methylpentan-1-amine Chemical compound OC(=O)\C=C/C(O)=O.C=1C=C(Cl)C=CC=1C1(C(CCCCOC)NC)CCC1 BHGDVLVZQZOGTN-BTJKTKAUSA-N 0.000 description 1
- 150000000185 1,3-diols Chemical class 0.000 description 1
- IBODDUNKEPPBKW-UHFFFAOYSA-N 1,5-dibromopentane Chemical compound BrCCCCCBr IBODDUNKEPPBKW-UHFFFAOYSA-N 0.000 description 1
- AWTCCUOSNDOLCV-UHFFFAOYSA-N 1-(dimethylamino)-1-[1-(4-fluorophenyl)cyclobutyl]-3-methylpentan-3-ol Chemical compound C=1C=C(F)C=CC=1C1(C(N(C)C)CC(C)(O)CC)CCC1 AWTCCUOSNDOLCV-UHFFFAOYSA-N 0.000 description 1
- CJZHEIYHTCESRV-UHFFFAOYSA-N 1-(dimethylamino)-3-ethyl-1-[1-(4-fluorophenyl)cyclobutyl]pentan-3-ol Chemical compound C=1C=C(F)C=CC=1C1(C(N(C)C)CC(O)(CC)CC)CCC1 CJZHEIYHTCESRV-UHFFFAOYSA-N 0.000 description 1
- RANXCYKBTYXAEO-UHFFFAOYSA-N 1-[1-(3,4-dichlorophenyl)cyclobutyl]-1-(dimethylamino)-5-hydroxypentan-2-one Chemical compound C=1C=C(Cl)C(Cl)=CC=1C1(C(C(=O)CCCO)N(C)C)CCC1 RANXCYKBTYXAEO-UHFFFAOYSA-N 0.000 description 1
- KDSRQJOAZKSKAZ-UHFFFAOYSA-N 1-[1-(3,4-dichlorophenyl)cyclobutyl]-2-methylsulfonylethanamine Chemical compound C=1C=C(Cl)C(Cl)=CC=1C1(C(N)CS(=O)(=O)C)CCC1 KDSRQJOAZKSKAZ-UHFFFAOYSA-N 0.000 description 1
- WRYRTVDECSTINL-UHFFFAOYSA-N 1-[1-(3,4-dichlorophenyl)cyclobutyl]-4-methoxy-n-propylbutan-1-amine Chemical compound C=1C=C(Cl)C(Cl)=CC=1C1(C(CCCOC)NCCC)CCC1 WRYRTVDECSTINL-UHFFFAOYSA-N 0.000 description 1
- NAWMNUVYUVZDJL-UHFFFAOYSA-N 1-[1-(3,4-dichlorophenyl)cyclobutyl]-4-methylsulfanylbutan-1-amine Chemical compound C=1C=C(Cl)C(Cl)=CC=1C1(C(N)CCCSC)CCC1 NAWMNUVYUVZDJL-UHFFFAOYSA-N 0.000 description 1
- DEUQJFCDTKLBHE-UHFFFAOYSA-N 1-[1-(3,4-dichlorophenyl)cyclobutyl]-7-methoxyheptan-1-amine Chemical compound C=1C=C(Cl)C(Cl)=CC=1C1(C(N)CCCCCCOC)CCC1 DEUQJFCDTKLBHE-UHFFFAOYSA-N 0.000 description 1
- USYBJEWIVSTUDJ-UHFFFAOYSA-N 1-[1-(3,4-dichlorophenyl)cyclobutyl]-n,n-dimethyl-4-(2-methylbutan-2-yloxy)butan-1-amine Chemical compound C=1C=C(Cl)C(Cl)=CC=1C1(C(N(C)C)CCCOC(C)(C)CC)CCC1 USYBJEWIVSTUDJ-UHFFFAOYSA-N 0.000 description 1
- OKENWYXQNKMMPF-UHFFFAOYSA-N 1-[1-(3,4-dichlorophenyl)cyclobutyl]-n,n-dimethyl-4-(5-methylfuran-2-yl)butan-1-amine Chemical compound C1CCC1(C=1C=C(Cl)C(Cl)=CC=1)C(N(C)C)CCCC1=CC=C(C)O1 OKENWYXQNKMMPF-UHFFFAOYSA-N 0.000 description 1
- FJXZSOADJNFCFA-UHFFFAOYSA-N 1-[1-(3-chloro-5-methylphenyl)cyclobutyl]-1-(dimethylamino)butan-2-one Chemical compound C=1C(C)=CC(Cl)=CC=1C1(C(N(C)C)C(=O)CC)CCC1 FJXZSOADJNFCFA-UHFFFAOYSA-N 0.000 description 1
- IHWSTBONSPKNJB-UHFFFAOYSA-N 1-[1-(4-chlorophenyl)cyclobutyl]-1-(dimethylamino)-3-methylbutan-2-one Chemical compound C=1C=C(Cl)C=CC=1C1(C(N(C)C)C(=O)C(C)C)CCC1 IHWSTBONSPKNJB-UHFFFAOYSA-N 0.000 description 1
- QWTMAVLYCQEICY-UHFFFAOYSA-N 1-[1-(4-chlorophenyl)cyclobutyl]-1-(dimethylamino)butan-2-ol;hydrochloride Chemical compound Cl.C=1C=C(Cl)C=CC=1C1(C(N(C)C)C(O)CC)CCC1 QWTMAVLYCQEICY-UHFFFAOYSA-N 0.000 description 1
- DIJZCDJTNLORHK-UHFFFAOYSA-N 1-[1-(4-chlorophenyl)cyclobutyl]-1-(dimethylamino)butan-2-one;hydrochloride Chemical compound Cl.C=1C=C(Cl)C=CC=1C1(C(N(C)C)C(=O)CC)CCC1 DIJZCDJTNLORHK-UHFFFAOYSA-N 0.000 description 1
- GHRFYFXWCJRUNQ-UHFFFAOYSA-N 1-[1-(4-chlorophenyl)cyclobutyl]-1-(dimethylamino)hept-6-en-2-one Chemical compound C=1C=C(Cl)C=CC=1C1(C(C(=O)CCCC=C)N(C)C)CCC1 GHRFYFXWCJRUNQ-UHFFFAOYSA-N 0.000 description 1
- DVVWFNATHRYOKN-UHFFFAOYSA-N 1-[1-(4-chlorophenyl)cyclobutyl]-1-hydroxyimino-3-methylpentan-3-ol Chemical compound C=1C=C(Cl)C=CC=1C1(C(=NO)CC(C)(O)CC)CCC1 DVVWFNATHRYOKN-UHFFFAOYSA-N 0.000 description 1
- SKECMATVZGCRBJ-UHFFFAOYSA-N 1-[1-(4-chlorophenyl)cyclobutyl]-2-methoxy-n,n-dimethylethanamine Chemical compound C=1C=C(Cl)C=CC=1C1(C(N(C)C)COC)CCC1 SKECMATVZGCRBJ-UHFFFAOYSA-N 0.000 description 1
- SGGNIAJIBWTEQV-UHFFFAOYSA-N 1-[1-(4-chlorophenyl)cyclobutyl]-2-methoxy-n,n-dimethylethanamine;hydrochloride Chemical compound Cl.C=1C=C(Cl)C=CC=1C1(C(N(C)C)COC)CCC1 SGGNIAJIBWTEQV-UHFFFAOYSA-N 0.000 description 1
- RUCDAPVIARCDAI-UHFFFAOYSA-N 1-[1-(4-chlorophenyl)cyclobutyl]-2-methoxy-n-methyl-n-(2-morpholin-4-ylethyl)ethanamine Chemical compound C1CCC1(C=1C=CC(Cl)=CC=1)C(COC)N(C)CCN1CCOCC1 RUCDAPVIARCDAI-UHFFFAOYSA-N 0.000 description 1
- SUNQQQYHKRJRLC-UHFFFAOYSA-N 1-[1-(4-chlorophenyl)cyclobutyl]-2-methoxyethanamine Chemical compound C=1C=C(Cl)C=CC=1C1(C(N)COC)CCC1 SUNQQQYHKRJRLC-UHFFFAOYSA-N 0.000 description 1
- ZRGVEMOUYHSNEB-UHFFFAOYSA-N 1-[1-(4-chlorophenyl)cyclobutyl]-2-methoxyethanamine;hydrochloride Chemical compound Cl.C=1C=C(Cl)C=CC=1C1(C(N)COC)CCC1 ZRGVEMOUYHSNEB-UHFFFAOYSA-N 0.000 description 1
- XZTNWIGUFGNTPC-UHFFFAOYSA-N 1-[1-(4-chlorophenyl)cyclobutyl]-2-methylsulfonylethanamine Chemical compound C=1C=C(Cl)C=CC=1C1(C(N)CS(=O)(=O)C)CCC1 XZTNWIGUFGNTPC-UHFFFAOYSA-N 0.000 description 1
- YNXHNCLRJRPKGW-UHFFFAOYSA-N 1-[1-(4-chlorophenyl)cyclobutyl]-3-ethyl-1-hydroxyiminopentan-3-ol Chemical compound C=1C=C(Cl)C=CC=1C1(C(=NO)CC(O)(CC)CC)CCC1 YNXHNCLRJRPKGW-UHFFFAOYSA-N 0.000 description 1
- UTZBVDWSNXLNJR-UHFFFAOYSA-N 1-[1-(4-chlorophenyl)cyclobutyl]-3-ethyl-1-iminopentan-3-ol Chemical compound C=1C=C(Cl)C=CC=1C1(C(=N)CC(O)(CC)CC)CCC1 UTZBVDWSNXLNJR-UHFFFAOYSA-N 0.000 description 1
- WXSIYUAHTYCIEB-UHFFFAOYSA-N 1-[1-(4-chlorophenyl)cyclobutyl]-3-methoxy-n,n-dimethylpropan-1-amine Chemical compound C=1C=C(Cl)C=CC=1C1(C(N(C)C)CCOC)CCC1 WXSIYUAHTYCIEB-UHFFFAOYSA-N 0.000 description 1
- LJWNLCNYSMAOHN-UHFFFAOYSA-N 1-[1-(4-chlorophenyl)cyclobutyl]-4-ethoxy-n-methylbutan-1-amine Chemical compound C=1C=C(Cl)C=CC=1C1(C(NC)CCCOCC)CCC1 LJWNLCNYSMAOHN-UHFFFAOYSA-N 0.000 description 1
- CBQDIMLDVGSNNX-UHFFFAOYSA-N 1-[1-(4-chlorophenyl)cyclobutyl]-5-methoxypentan-1-amine Chemical compound C=1C=C(Cl)C=CC=1C1(C(N)CCCCOC)CCC1 CBQDIMLDVGSNNX-UHFFFAOYSA-N 0.000 description 1
- OEYOZRCHOVLQNZ-UHFFFAOYSA-N 1-[1-(4-chlorophenyl)cyclobutyl]-n,n-dimethyl-4-(2-pyridin-4-ylethoxy)butan-1-amine Chemical compound C1CCC1(C=1C=CC(Cl)=CC=1)C(N(C)C)CCCOCCC1=CC=NC=C1 OEYOZRCHOVLQNZ-UHFFFAOYSA-N 0.000 description 1
- DOVFIUMRZPVEQR-UHFFFAOYSA-N 1-[1-(4-chlorophenyl)cyclobutyl]-n,n-dimethyl-4-methylsulfanylbutan-1-amine Chemical compound C=1C=C(Cl)C=CC=1C1(C(N(C)C)CCCSC)CCC1 DOVFIUMRZPVEQR-UHFFFAOYSA-N 0.000 description 1
- DKILACVNWSMKHY-UHFFFAOYSA-N 1-[1-(4-chlorophenyl)cyclobutyl]-n,n-dimethyl-4-methylsulfinylbutan-1-amine Chemical compound C=1C=C(Cl)C=CC=1C1(C(CCCS(C)=O)N(C)C)CCC1 DKILACVNWSMKHY-UHFFFAOYSA-N 0.000 description 1
- UJTLRVGWKUFWEC-UHFFFAOYSA-N 1-[1-[1-(3,4-dichlorophenyl)cyclobutyl]-4-methoxybutyl]pyrrolidine Chemical compound C1CCC1(C=1C=C(Cl)C(Cl)=CC=1)C(CCCOC)N1CCCC1 UJTLRVGWKUFWEC-UHFFFAOYSA-N 0.000 description 1
- BCBAAPOYUKNVLH-UHFFFAOYSA-N 1-[4-[1-(4-chlorophenyl)cyclobutyl]-4-(dimethylamino)butoxy]propan-2-one Chemical compound C=1C=C(Cl)C=CC=1C1(C(CCCOCC(C)=O)N(C)C)CCC1 BCBAAPOYUKNVLH-UHFFFAOYSA-N 0.000 description 1
- XHKHCTZNXWWJQJ-UHFFFAOYSA-N 1-amino-3-ethyl-1-(1-phenylcyclobutyl)pentan-3-ol Chemical compound C=1C=CC=CC=1C1(C(N)CC(O)(CC)CC)CCC1 XHKHCTZNXWWJQJ-UHFFFAOYSA-N 0.000 description 1
- RUCDTTGWDZFICR-UHFFFAOYSA-N 1-amino-3-ethyl-1-[1-(4-phenylphenyl)cyclobutyl]pentan-3-ol Chemical compound C=1C=C(C=2C=CC=CC=2)C=CC=1C1(C(N)CC(O)(CC)CC)CCC1 RUCDTTGWDZFICR-UHFFFAOYSA-N 0.000 description 1
- LCUKVWFDKDKGCD-UHFFFAOYSA-N 1-amino-3-methyl-1-(1-phenylcyclobutyl)pentan-3-ol Chemical compound C=1C=CC=CC=1C1(C(N)CC(C)(O)CC)CCC1 LCUKVWFDKDKGCD-UHFFFAOYSA-N 0.000 description 1
- FOZVXADQAHVUSV-UHFFFAOYSA-N 1-bromo-2-(2-bromoethoxy)ethane Chemical compound BrCCOCCBr FOZVXADQAHVUSV-UHFFFAOYSA-N 0.000 description 1
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- UWSOHRJFHHIUOB-UHFFFAOYSA-N 1-chloro-4-(cyclobuten-1-yl)benzene Chemical compound C1=CC(Cl)=CC=C1C1=CCC1 UWSOHRJFHHIUOB-UHFFFAOYSA-N 0.000 description 1
- CURPYTVPGIUPTK-UHFFFAOYSA-N 1-cyclohexyl-2-[1-(3,4-dichlorophenyl)cyclobutyl]-2-(dimethylamino)ethanone Chemical compound C1CCC1(C=1C=C(Cl)C(Cl)=CC=1)C(N(C)C)C(=O)C1CCCCC1 CURPYTVPGIUPTK-UHFFFAOYSA-N 0.000 description 1
- PKGWPMKHZJVCFC-UHFFFAOYSA-N 10-[1-(3,4-dichlorophenyl)cyclobutyl]-10-(dimethylamino)decan-2-one Chemical compound C=1C=C(Cl)C(Cl)=CC=1C1(C(CCCCCCCC(C)=O)N(C)C)CCC1 PKGWPMKHZJVCFC-UHFFFAOYSA-N 0.000 description 1
- SYIYWQLNUJDGMB-UHFFFAOYSA-N 10-[1-(4-chlorophenyl)cyclobutyl]-10-(dimethylamino)decan-2-one Chemical compound C=1C=C(Cl)C=CC=1C1(C(CCCCCCCC(C)=O)N(C)C)CCC1 SYIYWQLNUJDGMB-UHFFFAOYSA-N 0.000 description 1
- VMAKIQSICJHVNP-UHFFFAOYSA-N 2-(3-bromopropyl)-2-methyl-1,3-dioxolane Chemical compound BrCCCC1(C)OCCO1 VMAKIQSICJHVNP-UHFFFAOYSA-N 0.000 description 1
- WCASXYBKJHWFMY-NSCUHMNNSA-N 2-Buten-1-ol Chemical compound C\C=C\CO WCASXYBKJHWFMY-NSCUHMNNSA-N 0.000 description 1
- YXDBNUZAZSKGIH-UHFFFAOYSA-N 2-[1-(4-chlorophenyl)cyclobutyl]-2-(dimethylamino)ethanol;hydrochloride Chemical compound Cl.C=1C=C(Cl)C=CC=1C1(C(CO)N(C)C)CCC1 YXDBNUZAZSKGIH-UHFFFAOYSA-N 0.000 description 1
- WJEGVEHOMMKDEA-UHFFFAOYSA-N 2-[4-[1-(4-chlorophenyl)cyclobutyl]-4-(dimethylamino)butoxy]acetamide Chemical compound C=1C=C(Cl)C=CC=1C1(C(CCCOCC(N)=O)N(C)C)CCC1 WJEGVEHOMMKDEA-UHFFFAOYSA-N 0.000 description 1
- 125000005999 2-bromoethyl group Chemical group 0.000 description 1
- MHMIICKCHQITOX-UHFFFAOYSA-N 2-chloropentanenitrile Chemical compound CCCC(Cl)C#N MHMIICKCHQITOX-UHFFFAOYSA-N 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- JJKWHOSQTYYFAE-UHFFFAOYSA-N 2-methoxyacetyl chloride Chemical compound COCC(Cl)=O JJKWHOSQTYYFAE-UHFFFAOYSA-N 0.000 description 1
- BYHQTRFJOGIQAO-GOSISDBHSA-N 3-(4-bromophenyl)-8-[(2R)-2-hydroxypropyl]-1-[(3-methoxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decan-2-one Chemical compound C[C@H](CN1CCC2(CC1)CN(C(=O)N2CC3=CC(=CC=C3)OC)C4=CC=C(C=C4)Br)O BYHQTRFJOGIQAO-GOSISDBHSA-N 0.000 description 1
- ZSPTYLOMNJNZNG-UHFFFAOYSA-N 3-Buten-1-ol Chemical compound OCCC=C ZSPTYLOMNJNZNG-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- GPQAUWSDPSHAJR-UHFFFAOYSA-N 4-(2-cyclohexylethoxy)-1-[1-(3,4-dichlorophenyl)cyclobutyl]butan-1-amine Chemical compound C1CCC1(C=1C=C(Cl)C(Cl)=CC=1)C(N)CCCOCCC1CCCCC1 GPQAUWSDPSHAJR-UHFFFAOYSA-N 0.000 description 1
- APWDHNCMPXZVFK-UHFFFAOYSA-N 4-[1-(4-chlorophenyl)cyclobutyl]-4-hydroxyimino-2-methylbutan-2-ol Chemical compound C=1C=C(Cl)C=CC=1C1(C(=NO)CC(C)(O)C)CCC1 APWDHNCMPXZVFK-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical group N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- XCHNQICDCKAXOC-UHFFFAOYSA-N 4-amino-4-[1-(4-chlorophenyl)cyclobutyl]-2,3-dimethylbutan-2-ol Chemical compound C=1C=C(Cl)C=CC=1C1(C(N)C(C)C(C)(C)O)CCC1 XCHNQICDCKAXOC-UHFFFAOYSA-N 0.000 description 1
- FWIOXCLPBFFEDC-UHFFFAOYSA-N 4-amino-4-[1-(4-chlorophenyl)cyclobutyl]-2-methylbutan-2-ol Chemical compound C=1C=C(Cl)C=CC=1C1(C(N)CC(C)(O)C)CCC1 FWIOXCLPBFFEDC-UHFFFAOYSA-N 0.000 description 1
- BLTKJOKXBWSXQL-UHFFFAOYSA-N 4-amino-4-[1-(4-chlorophenyl)cyclobutyl]butan-1-ol Chemical compound C=1C=C(Cl)C=CC=1C1(C(CCCO)N)CCC1 BLTKJOKXBWSXQL-UHFFFAOYSA-N 0.000 description 1
- ZYAYQYHEADHVOW-UHFFFAOYSA-N 4-cyclopentyloxy-1-[1-(3,4-dichlorophenyl)cyclobutyl]butan-1-amine Chemical compound C1CCC1(C=1C=C(Cl)C(Cl)=CC=1)C(N)CCCOC1CCCC1 ZYAYQYHEADHVOW-UHFFFAOYSA-N 0.000 description 1
- KFDVPJUYSDEJTH-UHFFFAOYSA-N 4-ethenylpyridine Chemical compound C=CC1=CC=NC=C1 KFDVPJUYSDEJTH-UHFFFAOYSA-N 0.000 description 1
- GDELFUQKNPLION-UHFFFAOYSA-N 4-ethoxybutan-1-amine Chemical compound CCOCCCCN GDELFUQKNPLION-UHFFFAOYSA-N 0.000 description 1
- CNPURSDMOWDNOQ-UHFFFAOYSA-N 4-methoxy-7h-pyrrolo[2,3-d]pyrimidin-2-amine Chemical compound COC1=NC(N)=NC2=C1C=CN2 CNPURSDMOWDNOQ-UHFFFAOYSA-N 0.000 description 1
- UZOFELREXGAFOI-UHFFFAOYSA-N 4-methylpiperidine Chemical compound CC1CCNCC1 UZOFELREXGAFOI-UHFFFAOYSA-N 0.000 description 1
- AHQREBOLGLXSMC-UHFFFAOYSA-N 4-propoxy-1-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]butan-1-amine Chemical compound C=1C=CC(C(F)(F)F)=CC=1C1(C(N)CCCOCCC)CCC1 AHQREBOLGLXSMC-UHFFFAOYSA-N 0.000 description 1
- ROTIBVLKBBCUIR-UHFFFAOYSA-N 5-[1-(3,4-dichlorophenyl)cyclobutyl]-5-(dimethylamino)pentane-1,2-diol Chemical compound C=1C=C(Cl)C(Cl)=CC=1C1(C(CCC(O)CO)N(C)C)CCC1 ROTIBVLKBBCUIR-UHFFFAOYSA-N 0.000 description 1
- PAZALEKDBLKRKI-UHFFFAOYSA-N 6-[1-(3,4-dichlorophenyl)cyclobutyl]-6-(dimethylamino)hexan-2-ol Chemical compound C=1C=C(Cl)C(Cl)=CC=1C1(C(N(C)C)CCCC(O)C)CCC1 PAZALEKDBLKRKI-UHFFFAOYSA-N 0.000 description 1
- IVNQXOZVAJHPRU-UHFFFAOYSA-N 6-[1-(3,4-dichlorophenyl)cyclobutyl]-6-(dimethylamino)hexan-2-one Chemical compound C=1C=C(Cl)C(Cl)=CC=1C1(C(CCCC(C)=O)N(C)C)CCC1 IVNQXOZVAJHPRU-UHFFFAOYSA-N 0.000 description 1
- KOAWAWHSMVKCON-UHFFFAOYSA-N 6-[difluoro-(6-pyridin-4-yl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)methyl]quinoline Chemical compound C=1C=C2N=CC=CC2=CC=1C(F)(F)C(N1N=2)=NN=C1C=CC=2C1=CC=NC=C1 KOAWAWHSMVKCON-UHFFFAOYSA-N 0.000 description 1
- BBGIFVDTPBEKTR-UHFFFAOYSA-N 8-[1-(4-chlorophenyl)cyclobutyl]-8-(dimethylamino)octan-2-one Chemical compound C=1C=C(Cl)C=CC=1C1(C(CCCCCC(C)=O)N(C)C)CCC1 BBGIFVDTPBEKTR-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- NADTUDXSPFPHPK-UHFFFAOYSA-N B.[Na] Chemical compound B.[Na] NADTUDXSPFPHPK-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 240000007124 Brassica oleracea Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- QSJXEFYPDANLFS-UHFFFAOYSA-N Diacetyl Chemical compound CC(=O)C(C)=O QSJXEFYPDANLFS-UHFFFAOYSA-N 0.000 description 1
- 241000790917 Dioxys <bee> Species 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- 240000001414 Eucalyptus viminalis Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- 238000000023 Kugelrohr distillation Methods 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 241000219745 Lupinus Species 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- SFROFCSSRFUSNP-UHFFFAOYSA-J N.[Cl-].[Cl-].[Cl-].[Cl-].Cl.Cl.Cl.[Ti+4] Chemical compound N.[Cl-].[Cl-].[Cl-].[Cl-].Cl.Cl.Cl.[Ti+4] SFROFCSSRFUSNP-UHFFFAOYSA-J 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 241000750004 Nestor meridionalis Species 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 235000014676 Phragmites communis Nutrition 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical compound CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- RWRDLPDLKQPQOW-UHFFFAOYSA-O Pyrrolidinium ion Chemical compound C1CC[NH2+]C1 RWRDLPDLKQPQOW-UHFFFAOYSA-O 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 239000004280 Sodium formate Substances 0.000 description 1
- 240000006394 Sorghum bicolor Species 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 241000384512 Trachichthyidae Species 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- ABTNIQNUAYTLTJ-UHFFFAOYSA-N [5-[1-(3,4-dichlorophenyl)cyclobutyl]-5-(dimethylamino)-4-oxopentyl] acetate Chemical compound C=1C=C(Cl)C(Cl)=CC=1C1(C(C(=O)CCCOC(C)=O)N(C)C)CCC1 ABTNIQNUAYTLTJ-UHFFFAOYSA-N 0.000 description 1
- LXYIXJJWHUOJBY-UHFFFAOYSA-N [Li]CCCOC(C)OCC Chemical compound [Li]CCCOC(C)OCC LXYIXJJWHUOJBY-UHFFFAOYSA-N 0.000 description 1
- HZQCEWLNLSCGHA-UHFFFAOYSA-N [Na].B(Cl)(Cl)Cl Chemical compound [Na].B(Cl)(Cl)Cl HZQCEWLNLSCGHA-UHFFFAOYSA-N 0.000 description 1
- JEDZLBFUGJTJGQ-UHFFFAOYSA-N [Na].COCCO[AlH]OCCOC Chemical compound [Na].COCCO[AlH]OCCOC JEDZLBFUGJTJGQ-UHFFFAOYSA-N 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- CDXSJGDDABYYJV-UHFFFAOYSA-N acetic acid;ethanol Chemical compound CCO.CC(O)=O CDXSJGDDABYYJV-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- VZTDIZULWFCMLS-UHFFFAOYSA-N ammonium formate Chemical compound [NH4+].[O-]C=O VZTDIZULWFCMLS-UHFFFAOYSA-N 0.000 description 1
- 230000001430 anti-depressive effect Effects 0.000 description 1
- 239000000935 antidepressant agent Substances 0.000 description 1
- 229940005513 antidepressants Drugs 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- QLFNUXTWJGXNLH-UHFFFAOYSA-N bis(2-methoxyethoxy)alumane Chemical compound COCCO[AlH]OCCOC QLFNUXTWJGXNLH-UHFFFAOYSA-N 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 229910010277 boron hydride Inorganic materials 0.000 description 1
- UWTDFICHZKXYAC-UHFFFAOYSA-N boron;oxolane Chemical compound [B].C1CCOC1 UWTDFICHZKXYAC-UHFFFAOYSA-N 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- WYXUZTXCGKPAEH-UHFFFAOYSA-N bromoethane;magnesium Chemical compound [Mg].CCBr WYXUZTXCGKPAEH-UHFFFAOYSA-N 0.000 description 1
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N butyric aldehyde Natural products CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 1
- FGNLEIGUMSBZQP-UHFFFAOYSA-N cadaverine dihydrochloride Chemical compound Cl.Cl.NCCCCCN FGNLEIGUMSBZQP-UHFFFAOYSA-N 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000004517 catalytic hydrocracking Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000004490 chloroalkoxy group Chemical group 0.000 description 1
- KRVSOGSZCMJSLX-UHFFFAOYSA-L chromic acid Substances O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 description 1
- 229960001653 citalopram Drugs 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229940110456 cocoa butter Drugs 0.000 description 1
- 235000019868 cocoa butter Nutrition 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000013270 controlled release Methods 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000001352 cyclobutyloxy group Chemical group C1(CCC1)O* 0.000 description 1
- 125000001887 cyclopentyloxy group Chemical group C1(CCCC1)O* 0.000 description 1
- PBGGNZZGJIKBMJ-UHFFFAOYSA-N di(propan-2-yl)azanide Chemical compound CC(C)[N-]C(C)C PBGGNZZGJIKBMJ-UHFFFAOYSA-N 0.000 description 1
- 125000005117 dialkylcarbamoyl group Chemical group 0.000 description 1
- AQIXEPGDORPWBJ-UHFFFAOYSA-N diethyl carbinol Natural products CCC(O)CC AQIXEPGDORPWBJ-UHFFFAOYSA-N 0.000 description 1
- BLBIZNCSZLTDPW-UHFFFAOYSA-N dihydrogenphosphite Chemical compound OP(O)[O-] BLBIZNCSZLTDPW-UHFFFAOYSA-N 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- HALQELOKLVRWRI-VDBOFHIQSA-N doxycycline hyclate Chemical group O.[Cl-].[Cl-].CCO.O=C1C2=C(O)C=CC=C2[C@H](C)[C@@H]2C1=C(O)[C@]1(O)C(=O)C(C(N)=O)=C(O)[C@@H]([NH+](C)C)[C@@H]1[C@H]2O.O=C1C2=C(O)C=CC=C2[C@H](C)[C@@H]2C1=C(O)[C@]1(O)C(=O)C(C(N)=O)=C(O)[C@@H]([NH+](C)C)[C@@H]1[C@H]2O HALQELOKLVRWRI-VDBOFHIQSA-N 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 239000002662 enteric coated tablet Substances 0.000 description 1
- MATUTGQFXRGVAT-UHFFFAOYSA-N ethyl 2-[4-[1-(4-chlorophenyl)cyclobutyl]-4-(dimethylamino)butoxy]acetate Chemical compound C=1C=C(Cl)C=CC=1C1(C(N(C)C)CCCOCC(=O)OCC)CCC1 MATUTGQFXRGVAT-UHFFFAOYSA-N 0.000 description 1
- 235000019197 fats Nutrition 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000010419 fine particle Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000008098 formaldehyde solution Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- AWJWCTOOIBYHON-UHFFFAOYSA-N furo[3,4-b]pyrazine-5,7-dione Chemical compound C1=CN=C2C(=O)OC(=O)C2=N1 AWJWCTOOIBYHON-UHFFFAOYSA-N 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 150000002307 glutamic acids Chemical class 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 150000004820 halides Chemical group 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 1
- 230000002631 hypothermal effect Effects 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 229910052738 indium Inorganic materials 0.000 description 1
- 230000006698 induction Effects 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical class II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 238000004898 kneading Methods 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- VVNXEADCOVSAER-UHFFFAOYSA-N lithium sodium Chemical compound [Li].[Na] VVNXEADCOVSAER-UHFFFAOYSA-N 0.000 description 1
- YBOJGJXSYDWZBR-UHFFFAOYSA-N lithium;1-(1-ethoxyethoxy)propane Chemical compound [Li+].CCOC(C)OCC[CH2-] YBOJGJXSYDWZBR-UHFFFAOYSA-N 0.000 description 1
- 230000005923 long-lasting effect Effects 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- OTCKOJUMXQWKQG-UHFFFAOYSA-L magnesium bromide Chemical compound [Mg+2].[Br-].[Br-] OTCKOJUMXQWKQG-UHFFFAOYSA-L 0.000 description 1
- 229910001623 magnesium bromide Inorganic materials 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- JAUWOQLHLFMTON-UHFFFAOYSA-M magnesium;but-1-ene;bromide Chemical compound [Mg+2].[Br-].[CH2-]CC=C JAUWOQLHLFMTON-UHFFFAOYSA-M 0.000 description 1
- NXPHGHWWQRMDIA-UHFFFAOYSA-M magnesium;carbanide;bromide Chemical compound [CH3-].[Mg+2].[Br-] NXPHGHWWQRMDIA-UHFFFAOYSA-M 0.000 description 1
- 238000002483 medication Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- BTJNFUQPOPGSTO-UHFFFAOYSA-N n,n-dimethyl-4-propoxy-1-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]butan-1-amine Chemical compound C=1C=CC(C(F)(F)F)=CC=1C1(C(N(C)C)CCCOCCC)CCC1 BTJNFUQPOPGSTO-UHFFFAOYSA-N 0.000 description 1
- RWIVICVCHVMHMU-UHFFFAOYSA-N n-aminoethylmorpholine Chemical compound NCCN1CCOCC1 RWIVICVCHVMHMU-UHFFFAOYSA-N 0.000 description 1
- CMWTZPSULFXXJA-VIFPVBQESA-N naproxen Chemical group C1=C([C@H](C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-VIFPVBQESA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 239000003883 ointment base Substances 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 125000001979 organolithium group Chemical group 0.000 description 1
- 150000002902 organometallic compounds Chemical class 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 229920002866 paraformaldehyde Polymers 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- JNEHELHRDRBJNC-UHFFFAOYSA-N pentan-3-ol Chemical compound C[CH]C(O)CC JNEHELHRDRBJNC-UHFFFAOYSA-N 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 239000002831 pharmacologic agent Substances 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- OWAQGBSFGKBQQS-UHFFFAOYSA-N phosphorous acid;sodium Chemical compound [Na].OP(O)O OWAQGBSFGKBQQS-UHFFFAOYSA-N 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 150000005375 primary alkyl halides Chemical class 0.000 description 1
- XUWVIABDWDTJRZ-UHFFFAOYSA-N propan-2-ylazanide Chemical compound CC(C)[NH-] XUWVIABDWDTJRZ-UHFFFAOYSA-N 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000010298 pulverizing process Methods 0.000 description 1
- 125000001725 pyrenyl group Chemical group 0.000 description 1
- WQGWDDDVZFFDIG-UHFFFAOYSA-N pyrogallol Chemical class OC1=CC=CC(O)=C1O WQGWDDDVZFFDIG-UHFFFAOYSA-N 0.000 description 1
- GGWBHVILAJZWKJ-KJEVSKRMSA-N ranitidine hydrochloride Chemical compound [H+].[Cl-].[O-][N+](=O)\C=C(/NC)NCCSCC1=CC=C(CN(C)C)O1 GGWBHVILAJZWKJ-KJEVSKRMSA-N 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- JWHOQZUREKYPBY-UHFFFAOYSA-N rubonic acid Natural products CC1(C)CCC2(CCC3(C)C(=CCC4C5(C)CCC(=O)C(C)(C)C5CC(=O)C34C)C2C1)C(=O)O JWHOQZUREKYPBY-UHFFFAOYSA-N 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- XIIOFHFUYBLOLW-UHFFFAOYSA-N selpercatinib Chemical compound OC(COC=1C=C(C=2N(C=1)N=CC=2C#N)C=1C=NC(=CC=1)N1CC2N(C(C1)C2)CC=1C=NC(=CC=1)OC)(C)C XIIOFHFUYBLOLW-UHFFFAOYSA-N 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000012419 sodium bis(2-methoxyethoxy)aluminum hydride Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 1
- HLBBKKJFGFRGMU-UHFFFAOYSA-M sodium formate Chemical compound [Na+].[O-]C=O HLBBKKJFGFRGMU-UHFFFAOYSA-M 0.000 description 1
- 235000019254 sodium formate Nutrition 0.000 description 1
- 229940001584 sodium metabisulfite Drugs 0.000 description 1
- 235000010262 sodium metabisulphite Nutrition 0.000 description 1
- WZWGGYFEOBVNLA-UHFFFAOYSA-N sodium;dihydrate Chemical compound O.O.[Na] WZWGGYFEOBVNLA-UHFFFAOYSA-N 0.000 description 1
- KIMPPGSMONZDMN-UHFFFAOYSA-N sodium;dihydrogen phosphite Chemical compound [Na+].OP(O)[O-] KIMPPGSMONZDMN-UHFFFAOYSA-N 0.000 description 1
- 239000012453 solvate Substances 0.000 description 1
- 238000000935 solvent evaporation Methods 0.000 description 1
- 150000003890 succinate salts Chemical class 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 150000003892 tartrate salts Chemical class 0.000 description 1
- 150000003509 tertiary alcohols Chemical class 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 125000001382 thioacetal group Chemical group 0.000 description 1
- 150000003555 thioacetals Chemical class 0.000 description 1
- DUYAAUVXQSMXQP-UHFFFAOYSA-M thioacetate Chemical group CC([S-])=O DUYAAUVXQSMXQP-UHFFFAOYSA-M 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/30—Oxygen atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/24—Antidepressants
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/26—Psychostimulants, e.g. nicotine, cocaine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/63—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by introduction of halogen; by substitution of halogen atoms by other halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/527—Unsaturated compounds containing keto groups bound to rings other than six-membered aromatic rings
- C07C49/567—Unsaturated compounds containing keto groups bound to rings other than six-membered aromatic rings containing halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/70—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/06—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by halogen atoms or nitro radicals
- C07D295/073—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by halogen atoms or nitro radicals with the ring nitrogen atoms and the substituents separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/084—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/092—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings with aromatic radicals attached to the chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/12—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms
- C07D295/125—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/13—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/14—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D295/145—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals with the ring nitrogen atoms and the carbon atoms with three bonds to hetero atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/18—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carboxylic acids, or sulfur or nitrogen analogues thereof
- C07D295/182—Radicals derived from carboxylic acids
- C07D295/185—Radicals derived from carboxylic acids from aliphatic carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/10—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings
- C07D317/14—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D317/28—Radicals substituted by nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Animal Behavior & Ethology (AREA)
- Veterinary Medicine (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Psychiatry (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biomedical Technology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Pain & Pain Management (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Steroid Compounds (AREA)
- Furan Compounds (AREA)
- Pyridine Compounds (AREA)
- Heterocyclic Compounds That Contain Two Or More Ring Oxygen Atoms (AREA)
- Physical Vapour Deposition (AREA)
- Lubricants (AREA)
- Inorganic Insulating Materials (AREA)
- Catalysts (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Cephalosporin Compounds (AREA)
- Saccharide Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8501192 | 1985-01-17 | ||
| GB858501192A GB8501192D0 (en) | 1985-01-17 | 1985-01-17 | Therapeutic agents |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| JPS61197548A JPS61197548A (ja) | 1986-09-01 |
| JPH0262543B2 true JPH0262543B2 (enEXAMPLES) | 1990-12-26 |
Family
ID=10572997
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| JP61007824A Granted JPS61197548A (ja) | 1985-01-17 | 1986-01-17 | 治療剤 |
Country Status (27)
| Country | Link |
|---|---|
| US (2) | US4925879A (enEXAMPLES) |
| EP (1) | EP0191542B1 (enEXAMPLES) |
| JP (1) | JPS61197548A (enEXAMPLES) |
| CN (1) | CN1012733B (enEXAMPLES) |
| AT (1) | ATE34976T1 (enEXAMPLES) |
| AU (1) | AU591390B2 (enEXAMPLES) |
| CS (3) | CS258149B2 (enEXAMPLES) |
| DD (3) | DD267727A5 (enEXAMPLES) |
| DE (1) | DE3660286D1 (enEXAMPLES) |
| DK (1) | DK5386A (enEXAMPLES) |
| ES (3) | ES8706608A1 (enEXAMPLES) |
| FI (1) | FI860111A7 (enEXAMPLES) |
| GB (1) | GB8501192D0 (enEXAMPLES) |
| GR (1) | GR860092B (enEXAMPLES) |
| HU (1) | HUT41713A (enEXAMPLES) |
| IL (1) | IL77452A (enEXAMPLES) |
| IN (1) | IN162780B (enEXAMPLES) |
| JO (1) | JO1438B1 (enEXAMPLES) |
| NO (1) | NO163855C (enEXAMPLES) |
| NZ (1) | NZ214787A (enEXAMPLES) |
| PH (1) | PH25979A (enEXAMPLES) |
| PL (3) | PL148184B1 (enEXAMPLES) |
| PT (1) | PT81855B (enEXAMPLES) |
| RO (1) | RO93855A (enEXAMPLES) |
| YU (3) | YU4686A (enEXAMPLES) |
| ZA (1) | ZA86262B (enEXAMPLES) |
| ZW (1) | ZW24085A1 (enEXAMPLES) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8531071D0 (en) * | 1985-12-17 | 1986-01-29 | Boots Co Plc | Therapeutic compound |
| GB8704777D0 (en) * | 1987-02-28 | 1987-04-01 | Boots Co Plc | Medical treatment |
| JP2675573B2 (ja) * | 1988-03-31 | 1997-11-12 | 科研製薬株式会社 | 脳機能改善剤 |
| GB9127306D0 (en) * | 1991-12-23 | 1992-02-19 | Boots Co Plc | Therapeutic agents |
| GB9309749D0 (en) * | 1993-05-12 | 1993-06-23 | Boots Co Plc | Therapeutic agents |
| PL177947B1 (pl) * | 1993-06-22 | 2000-02-29 | Knoll Ag | Nowe związki tetrahydroizochinolinowe, kompozycja farmaceutyczna i sposób wytwarzania nowych związków tetrahydroizochinolinowych |
| GB9524681D0 (en) * | 1995-12-02 | 1996-01-31 | Knoll Ag | Chemical process |
| US6974838B2 (en) | 1998-08-24 | 2005-12-13 | Sepracor Inc. | Methods of treating or preventing pain using sibutramine metabolites |
| US6331571B1 (en) * | 1998-08-24 | 2001-12-18 | Sepracor, Inc. | Methods of treating and preventing attention deficit disorders |
| GB9915617D0 (en) * | 1999-07-05 | 1999-09-01 | Knoll Ag | Therapeutic agents |
| US6399826B1 (en) * | 1999-08-11 | 2002-06-04 | Sepracor Inc. | Salts of sibutramine metabolites, methods of making sibutramine metabolites and intermediates useful in the same, and methods of treating pain |
| AU2002210816A1 (en) * | 2000-11-02 | 2002-05-15 | Torrent Pharmaceuticals Ltd | Process for preparation of beta-phenethylamine derivative |
| US20020115727A1 (en) * | 2000-12-04 | 2002-08-22 | Senanayake Chris H. | Synthesis, methods of using, and compositions of hydroxylated cyclobutylalkylamines |
| US20030087963A1 (en) * | 2001-09-13 | 2003-05-08 | Senanayake Chris H. | Methods of preparing and using 2-hydroxy derivatives of sibutramine and its metabolites |
| US20080207950A1 (en) * | 2004-12-22 | 2008-08-28 | Ciba Specialty Chemicals Corp. | Enantioselective Synthesis of a Sterically Hindered Amine |
| JP2007229046A (ja) * | 2006-02-28 | 2007-09-13 | Hitachi Ltd | 磁場補正装置 |
| BRPI0716952A2 (pt) | 2006-09-15 | 2013-10-29 | Reviva Pharmaceuticals Inc | Composto, métodos para tratar e/ou prevenir obesidade ou indicação co-mórbida relacionada à obesidade, e para sintetizar derivado de cicloalquilmetilamina |
| US8604244B2 (en) | 2010-07-02 | 2013-12-10 | Reviva Pharmaceuticals, Inc. | Compositions, synthesis, and methods of using cycloalkylmethylamine derivatives |
| ES2404336T3 (es) * | 2008-09-10 | 2013-05-27 | Celgene Corporation | Procedimientos para la preparación de compuestos de aminosulfona |
| CA2858837C (en) | 2011-12-30 | 2022-08-30 | Reviva Pharmaceuticals, Inc. | Compositions, synthesis, and methods of using phenylcycloalkylmethylamine derivatives |
| CN102786444A (zh) * | 2012-07-24 | 2012-11-21 | 上海瑞博化学有限公司 | 一种西布曲明类似物的磺酸盐的制备方法 |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2565592A (en) * | 1948-02-27 | 1951-08-28 | Merck & Co Inc | 3-hydroxy-4, 4-diphenyl-6-aminoheptanes |
| US3054822A (en) * | 1959-11-27 | 1962-09-18 | Hoechst Ag | Benzyl substituted propylamines |
| DE1124485B (de) * | 1960-02-12 | 1962-03-01 | Hoechst Ag | Verfahren zur Herstellung von analeptisch wirksamen Phenylcycloalkylmethylaminen |
| US3573304A (en) * | 1968-12-03 | 1971-03-30 | Delalande Sa | 1-dimethylamino - 3 - methyl-2(pyridyl or pyridazinyl) pentane and the corresponding non-toxic acid addition salts thereof |
| US3706764A (en) * | 1969-04-16 | 1972-12-19 | Yoshitomi Pharmaceutical | Phenethylaminomethyl-chromanones and- thiochromanones |
| BE757408A (fr) * | 1969-10-13 | 1971-04-13 | Thomae Gmbh Dr K | Nouveaux butanols tertiaires a constituants basiques |
| SE7600674L (sv) * | 1975-02-05 | 1976-08-06 | Rohm & Haas | Fungicider |
| IE52768B1 (en) * | 1981-04-06 | 1988-02-17 | Boots Co Ltd | 1-arylcyclobutylalkylamine compounds useful as therapeutic agents |
| ZA821577B (en) * | 1981-04-06 | 1983-03-30 | Boots Co Plc | Therapeutic agents |
| US4443449A (en) * | 1981-04-06 | 1984-04-17 | The Boots Company Limited | Arylcyclobutylalkylamines and anti-depression composition and methods using same |
| DK101683A (da) * | 1982-03-12 | 1983-09-13 | Duphar Int Res | Phenylpiperazinderivater og fremgangsmaade til fremstilling heraf |
| IE56000B1 (en) * | 1982-09-30 | 1991-03-13 | Boots Co Plc | 1-arylcyclobutylalkylamine compounds |
| IE56001B1 (en) * | 1982-09-30 | 1991-03-13 | Boots Co Plc | 1-arylcyclobutylmethylamine compounds |
| IE56324B1 (en) * | 1982-12-13 | 1991-06-19 | American Home Prod | Phenethylamine derivatives and intermediates therefor |
| GB8704777D0 (en) * | 1987-02-28 | 1987-04-01 | Boots Co Plc | Medical treatment |
-
1985
- 1985-01-17 GB GB858501192A patent/GB8501192D0/en active Pending
- 1985-12-17 IN IN1013/MAS/85A patent/IN162780B/en unknown
- 1985-12-19 ZW ZW240/85A patent/ZW24085A1/xx unknown
- 1985-12-20 NO NO855204A patent/NO163855C/no unknown
- 1985-12-26 IL IL77452A patent/IL77452A/xx unknown
- 1985-12-30 AU AU51725/85A patent/AU591390B2/en not_active Ceased
-
1986
- 1986-01-02 PH PH33247A patent/PH25979A/en unknown
- 1986-01-07 DK DK5386A patent/DK5386A/da not_active Application Discontinuation
- 1986-01-07 EP EP86300059A patent/EP0191542B1/en not_active Expired
- 1986-01-07 DE DE8686300059T patent/DE3660286D1/de not_active Expired
- 1986-01-07 AT AT86300059T patent/ATE34976T1/de not_active IP Right Cessation
- 1986-01-10 FI FI860111A patent/FI860111A7/fi not_active Application Discontinuation
- 1986-01-10 NZ NZ214787A patent/NZ214787A/xx unknown
- 1986-01-13 JO JO19861438A patent/JO1438B1/en active
- 1986-01-14 YU YU00046/86A patent/YU4686A/xx unknown
- 1986-01-14 ZA ZA86262A patent/ZA86262B/xx unknown
- 1986-01-15 GR GR860092A patent/GR860092B/el unknown
- 1986-01-15 DD DD86312979A patent/DD267727A5/de unknown
- 1986-01-15 PL PL1986262502A patent/PL148184B1/pl unknown
- 1986-01-15 PL PL1986257486A patent/PL146910B1/pl unknown
- 1986-01-15 PL PL1986262501A patent/PL148185B1/pl unknown
- 1986-01-15 DD DD86286215A patent/DD258004A5/de unknown
- 1986-01-16 CS CS87895A patent/CS258149B2/cs unknown
- 1986-01-16 CS CS87896A patent/CS258150B2/cs unknown
- 1986-01-16 PT PT81855A patent/PT81855B/pt not_active IP Right Cessation
- 1986-01-16 HU HU86223A patent/HUT41713A/hu unknown
- 1986-01-16 CS CS86342A patent/CS258138B2/cs unknown
- 1986-01-16 RO RO86121885A patent/RO93855A/ro unknown
- 1986-01-16 ES ES550933A patent/ES8706608A1/es not_active Expired
- 1986-01-17 CN CN86100954A patent/CN1012733B/zh not_active Expired
- 1986-01-17 JP JP61007824A patent/JPS61197548A/ja active Granted
-
1987
- 1987-03-16 ES ES557444A patent/ES8801617A1/es not_active Expired
- 1987-03-16 ES ES557445A patent/ES8801618A1/es not_active Expired
- 1987-07-23 YU YU01396/87A patent/YU139687A/xx unknown
- 1987-07-23 YU YU01395/87A patent/YU139587A/xx unknown
-
1988
- 1988-02-17 DD DD88312977A patent/DD267728A5/de unknown
- 1988-08-01 US US07/227,869 patent/US4925879A/en not_active Expired - Fee Related
-
1990
- 1990-06-20 US US07/541,174 patent/US5047432A/en not_active Expired - Lifetime
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPH0262543B2 (enEXAMPLES) | ||
| US7166592B2 (en) | Nonsteroidal antiinflammatory agents | |
| KR900000274B1 (ko) | 1-(1-아릴사이클로부틸)알킬아민 유도체의 제조방법 | |
| JP3255421B2 (ja) | ニューロキニンアンタゴニストとしての置換されたオキシム、ヒドラゾンおよびオレフィン | |
| KR100524159B1 (ko) | 모노아민 재흡수 억제제로서 유용한 비아릴 에테르 유도체 | |
| TWI254038B (en) | N-phenpropylcyclopentyl-substituted glutaramide derivatives as NEP inhibitors for FSAD | |
| JPS63313753A (ja) | プロペニルアミン類、その製造法、これを含む薬剤組成物および医薬としてのその用途 | |
| JPH09506632A (ja) | コルチコトロピン放出因子(crf)アンタゴニスト活性を有する置換ピラゾール | |
| JPH10508870A (ja) | カンナビノイド受容体への親和性を有するインドール誘導体 | |
| WO2005000778A1 (ja) | Hsp90ファミリー蛋白質阻害剤 | |
| PT93753B (pt) | Processo para a preparacao de compostos azabiciclicos | |
| HUT72082A (en) | Substituted triols, pharmaceutical compositions containing them and process for their production | |
| TW200304815A (en) | NK1 antagonists | |
| CN104781245A (zh) | 用于生产二氢-2h-吡喃衍生物的方法 | |
| TW201240973A (en) | Heterocyclic compound | |
| NZ196086A (en) | 1-phenyl-2-cyclohexene-1-alkylamine derivatives and pharmaceutical compositions | |
| KR900005256B1 (ko) | 페닐사이클로부틸메틸아민 유도체의 제조방법 | |
| JPH07505402A (ja) | 5−ht↓1様アゴニストとしてのインドール誘導体 | |
| JPH03206084A (ja) | 複素環薬剤化合物及びその調製法と用途 | |
| JPH05504769A (ja) | 4,5―シクロアルカノ―3―ベンズアゼピン―7―オール誘導体およびその使用 | |
| JPH05320103A (ja) | プロパンアミンおよびその治療用とくに止瀉用医薬組成物 | |
| JPS5877846A (ja) | 新規な3−フエニル−1−インダンアミン | |
| CA1335816C (en) | 4-pyridyl-1,3-dioxan-5-ylalkenoic acid derivatives | |
| JPH07138214A (ja) | 置換アミド酸誘導体 | |
| JP2006504792A (ja) | I.a.hivの治療における逆転写酵素変調剤として使用の4−(3,5−ジシアノフェノキシ)ピラゾール誘導体 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| LAPS | Cancellation because of no payment of annual fees |