FI66298B - Foerfarande foer framstaellning av kristallina alkalimetallalumosilikatbasbytarmaterial - Google Patents
Foerfarande foer framstaellning av kristallina alkalimetallalumosilikatbasbytarmaterial Download PDFInfo
- Publication number
- FI66298B FI66298B FI762117A FI762117A FI66298B FI 66298 B FI66298 B FI 66298B FI 762117 A FI762117 A FI 762117A FI 762117 A FI762117 A FI 762117A FI 66298 B FI66298 B FI 66298B
- Authority
- FI
- Finland
- Prior art keywords
- alkali metal
- aqueous
- aluminate
- solution
- sio
- Prior art date
Links
- 239000000243 solution Substances 0.000 claims description 47
- 238000000034 method Methods 0.000 claims description 35
- 229910052783 alkali metal Inorganic materials 0.000 claims description 33
- -1 alkali metal aluminate Chemical class 0.000 claims description 25
- 238000006243 chemical reaction Methods 0.000 claims description 24
- 239000000047 product Substances 0.000 claims description 24
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 claims description 19
- 150000004645 aluminates Chemical class 0.000 claims description 18
- 238000001556 precipitation Methods 0.000 claims description 18
- 229910000323 aluminium silicate Inorganic materials 0.000 claims description 16
- 229910004298 SiO 2 Inorganic materials 0.000 claims description 15
- 239000013078 crystal Substances 0.000 claims description 15
- 239000007788 liquid Substances 0.000 claims description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 12
- 229910052910 alkali metal silicate Inorganic materials 0.000 claims description 11
- 239000000203 mixture Substances 0.000 claims description 10
- 239000002585 base Substances 0.000 claims description 9
- 229910052708 sodium Inorganic materials 0.000 claims description 9
- 150000001340 alkali metals Chemical class 0.000 claims description 8
- 230000015572 biosynthetic process Effects 0.000 claims description 8
- 238000000746 purification Methods 0.000 claims description 8
- 239000007787 solid Substances 0.000 claims description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 8
- 239000012535 impurity Substances 0.000 claims description 7
- 239000012452 mother liquor Substances 0.000 claims description 7
- 238000002425 crystallisation Methods 0.000 claims description 6
- 230000008025 crystallization Effects 0.000 claims description 6
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 claims description 6
- 239000000706 filtrate Substances 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 238000000926 separation method Methods 0.000 claims description 6
- 238000005406 washing Methods 0.000 claims description 6
- 238000001816 cooling Methods 0.000 claims description 5
- 239000007864 aqueous solution Substances 0.000 claims description 4
- 238000000605 extraction Methods 0.000 claims description 4
- 150000004820 halides Chemical class 0.000 claims description 4
- 238000004040 coloring Methods 0.000 claims description 3
- 230000012010 growth Effects 0.000 claims description 3
- 239000010802 sludge Substances 0.000 claims description 3
- 229910018072 Al 2 O 3 Inorganic materials 0.000 claims description 2
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 claims description 2
- 239000000049 pigment Substances 0.000 claims description 2
- 239000006228 supernatant Substances 0.000 claims 1
- 239000011734 sodium Substances 0.000 description 12
- 239000000499 gel Substances 0.000 description 10
- 239000000376 reactant Substances 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 7
- 238000002360 preparation method Methods 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 150000001768 cations Chemical class 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- KKCBUQHMOMHUOY-UHFFFAOYSA-N Na2O Inorganic materials [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 238000002156 mixing Methods 0.000 description 3
- 239000002994 raw material Substances 0.000 description 3
- 239000003643 water by type Substances 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 239000004115 Sodium Silicate Substances 0.000 description 2
- 229910021536 Zeolite Inorganic materials 0.000 description 2
- 238000005341 cation exchange Methods 0.000 description 2
- 238000004140 cleaning Methods 0.000 description 2
- 238000000635 electron micrograph Methods 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 229910052911 sodium silicate Inorganic materials 0.000 description 2
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 2
- 239000002699 waste material Substances 0.000 description 2
- 239000010457 zeolite Substances 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 1
- BFRXZIMAUMUZJH-UHFFFAOYSA-M [OH-].[Na+].[Na+].[Na+].[Na+].[Al+3].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-] Chemical compound [OH-].[Na+].[Na+].[Na+].[Na+].[Al+3].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-].[O-][Si]([O-])([O-])[O-] BFRXZIMAUMUZJH-UHFFFAOYSA-M 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 230000005791 algae growth Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- RREGISFBPQOLTM-UHFFFAOYSA-N alumane;trihydrate Chemical compound O.O.O.[AlH3] RREGISFBPQOLTM-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- ANBBXQWFNXMHLD-UHFFFAOYSA-N aluminum;sodium;oxygen(2-) Chemical compound [O-2].[O-2].[Na+].[Al+3] ANBBXQWFNXMHLD-UHFFFAOYSA-N 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 238000006065 biodegradation reaction Methods 0.000 description 1
- 229910052681 coesite Inorganic materials 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 229910052906 cristobalite Inorganic materials 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 238000012851 eutrophication Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000013505 freshwater Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 239000008233 hard water Substances 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 150000007529 inorganic bases Chemical group 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 230000036284 oxygen consumption Effects 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229910001388 sodium aluminate Inorganic materials 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000001694 spray drying Methods 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 229910052682 stishovite Inorganic materials 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 239000003760 tallow Substances 0.000 description 1
- 229910052905 tridymite Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B33/00—Silicon; Compounds thereof
- C01B33/20—Silicates
- C01B33/26—Aluminium-containing silicates, i.e. silico-aluminates
- C01B33/28—Base exchange silicates, e.g. zeolites
- C01B33/2807—Zeolitic silicoaluminates with a tridimensional crystalline structure possessing molecular sieve properties; Isomorphous compounds wherein a part of the aluminium ore of the silicon present may be replaced by other elements such as gallium, germanium, phosphorus; Preparation of zeolitic molecular sieves from molecular sieves of another type or from preformed reacting mixtures
- C01B33/2815—Zeolitic silicoaluminates with a tridimensional crystalline structure possessing molecular sieve properties; Isomorphous compounds wherein a part of the aluminium ore of the silicon present may be replaced by other elements such as gallium, germanium, phosphorus; Preparation of zeolitic molecular sieves from molecular sieves of another type or from preformed reacting mixtures of type A (UNION CARBIDE trade name; corresponds to GRACE's types Z-12 or Z-12L)
- C01B33/2823—Zeolitic silicoaluminates with a tridimensional crystalline structure possessing molecular sieve properties; Isomorphous compounds wherein a part of the aluminium ore of the silicon present may be replaced by other elements such as gallium, germanium, phosphorus; Preparation of zeolitic molecular sieves from molecular sieves of another type or from preformed reacting mixtures of type A (UNION CARBIDE trade name; corresponds to GRACE's types Z-12 or Z-12L) from aqueous solutions of an alkali metal aluminate and an alkali metal silicate excluding any other source of alumina or silica
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B33/00—Silicon; Compounds thereof
- C01B33/20—Silicates
- C01B33/26—Aluminium-containing silicates, i.e. silico-aluminates
- C01B33/28—Base exchange silicates, e.g. zeolites
- C01B33/2807—Zeolitic silicoaluminates with a tridimensional crystalline structure possessing molecular sieve properties; Isomorphous compounds wherein a part of the aluminium ore of the silicon present may be replaced by other elements such as gallium, germanium, phosphorus; Preparation of zeolitic molecular sieves from molecular sieves of another type or from preformed reacting mixtures
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Life Sciences & Earth Sciences (AREA)
- Geology (AREA)
- Inorganic Chemistry (AREA)
- Silicates, Zeolites, And Molecular Sieves (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US59923275 | 1975-07-25 | ||
| US05/599,232 US4041135A (en) | 1975-07-25 | 1975-07-25 | Production of high capacity inorganic crystalline base exchange materials |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FI762117A7 FI762117A7 (OSRAM) | 1977-01-26 |
| FI66298B true FI66298B (fi) | 1984-06-29 |
Family
ID=24398806
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI762117A FI66298B (fi) | 1975-07-25 | 1976-07-23 | Foerfarande foer framstaellning av kristallina alkalimetallalumosilikatbasbytarmaterial |
Country Status (26)
| Country | Link |
|---|---|
| US (1) | US4041135A (OSRAM) |
| JP (1) | JPS6031762B2 (OSRAM) |
| AR (1) | AR212504A1 (OSRAM) |
| AT (1) | AT351457B (OSRAM) |
| AU (1) | AU499687B2 (OSRAM) |
| BE (1) | BE844473A (OSRAM) |
| BR (1) | BR7604752A (OSRAM) |
| CA (1) | CA1074766A (OSRAM) |
| CH (1) | CH629162A5 (OSRAM) |
| DE (1) | DE2633304C2 (OSRAM) |
| DK (1) | DK325276A (OSRAM) |
| ES (1) | ES450100A1 (OSRAM) |
| FI (1) | FI66298B (OSRAM) |
| FR (1) | FR2318823A1 (OSRAM) |
| GB (1) | GB1508548A (OSRAM) |
| HU (1) | HU174755B (OSRAM) |
| IN (1) | IN145462B (OSRAM) |
| IT (1) | IT1062652B (OSRAM) |
| LU (1) | LU75454A1 (OSRAM) |
| MX (1) | MX4022E (OSRAM) |
| NL (1) | NL7608105A (OSRAM) |
| NO (1) | NO150114C (OSRAM) |
| PL (1) | PL107716B1 (OSRAM) |
| SE (1) | SE424438B (OSRAM) |
| YU (1) | YU181676A (OSRAM) |
| ZA (1) | ZA764152B (OSRAM) |
Families Citing this family (47)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4041135A (en) * | 1975-07-25 | 1977-08-09 | J. M. Huber Corporation | Production of high capacity inorganic crystalline base exchange materials |
| US4102977A (en) * | 1975-11-18 | 1978-07-25 | Mizusawa Kagaku Kogyo Kabushiki Kaisha | Process for the preparation of alkali aluminosilicate detergent builder |
| DE2651436A1 (de) * | 1976-11-11 | 1978-05-18 | Degussa | Kristallines zeolithpulver des typs a iii |
| DE2651419A1 (de) * | 1976-11-11 | 1978-05-18 | Degussa | Kristallines zeolithpulver des typs a iv |
| DE2651420A1 (de) * | 1976-11-11 | 1978-05-18 | Degussa | Kristallines zeolithpulver des typs a v |
| DE2651485A1 (de) * | 1976-11-11 | 1978-05-24 | Degussa | Kristallines zeolithpulver des typs a i |
| DE2651437A1 (de) * | 1976-11-11 | 1978-05-18 | Degussa | Kristallines zeolithpulver des typs a vi |
| DE2705088C2 (de) * | 1977-02-08 | 1986-05-22 | Kali-Chemie Ag, 3000 Hannover | Verfahren zur Herstellung von überwiegend kristallinen Natriumaluminiumsilikaten |
| DE2719425C2 (de) * | 1977-04-30 | 1984-04-12 | Hoechst Ag, 6230 Frankfurt | Verfahren zur Abtrennung von Zeolithkristallen |
| FR2392932A1 (fr) * | 1977-06-03 | 1978-12-29 | Rhone Poulenc Ind | Procede de fabrication d'un silico-aluminate alcalin cristallin, produit obtenu et application |
| DE2734296A1 (de) * | 1977-07-29 | 1979-02-08 | Degussa | Verfahren zur herstellung von feinteiligen, zum kationenaustausch befaehigten wasserunloeslichen silikaten |
| FR2398698A1 (fr) * | 1977-07-29 | 1979-02-23 | Ugine Kuhlmann | Procede industriel de fabrication en continu de zeolithe a |
| DE2744784B1 (de) * | 1977-10-05 | 1978-08-17 | Basf Ag | Verfahren zur Herstellung von Zeolith A und seine Verwendung |
| US4576986A (en) * | 1978-01-31 | 1986-03-18 | J. M. Huber Corporation | Rubber compositions containing small particle size zeolites and mixtures |
| US4288342A (en) * | 1978-03-03 | 1981-09-08 | J. M. Huber Corporation | Inorganic water-softening bead |
| US4150100A (en) * | 1978-06-13 | 1979-04-17 | Pq Corporation | Preparing zeolite NaA |
| JPS553321A (en) * | 1978-06-19 | 1980-01-11 | Toyo Soda Mfg Co Ltd | Production of zeolite |
| US4243429A (en) * | 1978-06-22 | 1981-01-06 | Kubota Ltd. | Process for producing tobermorite and ettringite |
| JPS5524112A (en) * | 1978-08-09 | 1980-02-21 | Toyo Soda Mfg Co Ltd | Dentifrice zeolite |
| US4235856A (en) * | 1978-12-20 | 1980-11-25 | J. M. Huber Corporation | Method of producing a zeolite of controlled particle size |
| US4612342A (en) * | 1978-12-20 | 1986-09-16 | J. M. Huber Corporation | Rubber compositions containing small particle size zeolites |
| US4330518A (en) * | 1978-12-20 | 1982-05-18 | J. M. Huber Corporation | Removal of contaminants from zeolite mother liquors |
| US4888378A (en) * | 1978-12-20 | 1989-12-19 | J. M. Huber Corporation | Plastic compositions containing small particle size zeolites and mixtures |
| DE2856278A1 (de) * | 1978-12-27 | 1980-07-10 | Degussa | Verfahren zur herstellung feinstteiliger natriumaluminiumsilikate |
| IT1165442B (it) * | 1979-01-26 | 1987-04-22 | Montedison Spa | Zeoliti di tipo a,ad elevato grado di cristallinita' e a granulometria fine e processo per la loro produzione |
| DE2907108A1 (de) * | 1979-02-23 | 1980-09-04 | Basf Ag | Verfahren zur herstellung lagerstabiler, pumpbarer und fliessfaehiger alumosilikat-suspensionen durch nassvermahlung |
| DE2910147A1 (de) * | 1979-03-15 | 1980-10-30 | Degussa | Verfahren zur herstellung von amorphen natriumaluminiumsilikaten |
| DE2910152A1 (de) * | 1979-03-15 | 1980-10-16 | Degussa | Verfahren zur herstellung von amorphen natriumaluminiumsilikaten |
| CA1142500A (en) * | 1979-03-28 | 1983-03-08 | Grace (W.R.) & Co. | Cyclic process for forming high purity zsm-5 catalyst |
| DE2941636A1 (de) * | 1979-10-13 | 1981-05-07 | Degussa Ag, 6000 Frankfurt | Verfahren zur kontinuierlichen herstellung feinstteiliger zeolithischer natriumaluminiumsilikate |
| DE3007080A1 (de) * | 1980-02-26 | 1981-09-10 | Degussa Ag, 6000 Frankfurt | Verfahren zur herstellung von kristallinem zeolithpulver des typs a |
| DE3007087A1 (de) * | 1980-02-26 | 1981-09-10 | Degussa Ag, 6000 Frankfurt | Verfahren zur herstellung von zeolith a |
| DE3007123A1 (de) * | 1980-02-26 | 1981-09-10 | Degussa Ag, 6000 Frankfurt | Verfahren zur herstellung von zeolith a |
| US4289629A (en) * | 1980-07-10 | 1981-09-15 | J. M. Huber Corporation | Removal of contaminants from strongly alkaline solution |
| JPS5738317A (en) * | 1980-08-12 | 1982-03-03 | Toyo Soda Mfg Co Ltd | Zeolite powder with high fluidity and its manufacture |
| AU559968B2 (en) * | 1982-04-29 | 1987-03-26 | Mobil Oil Corp. | Controlled morphology high silica zeolites |
| AU558660B2 (en) * | 1982-06-21 | 1987-02-05 | Unilever Plc | Aluminosilicates |
| DE3233289A1 (de) * | 1982-09-08 | 1984-03-08 | Henkel KGaA, 4000 Düsseldorf | Vorrichtung und verfahren zur behandlung einer zeolithsuspension zum zwecke der feststoffabtrennung von der mutter- und/oder waschlauge |
| GB8329973D0 (en) * | 1983-11-10 | 1983-12-14 | Exxon Research Engineering Co | Recycled zeolite l preparation |
| ZA851734B (en) * | 1984-03-23 | 1986-10-29 | Mobil Oil Corp | A continuous process for manufacturing crystalline zeolites |
| US4818509A (en) * | 1984-03-23 | 1989-04-04 | Mobil Oil Corporation | Continuous process for manufacturing crystalline zeolites in continuously stirred backmixed crystallizers |
| US4623631A (en) | 1984-04-19 | 1986-11-18 | J. M. Huber Corporation | Filtration of zeolites |
| US4900529A (en) * | 1984-09-04 | 1990-02-13 | W. R. Grace & Co.-Conn. | Process for making crystalline siliceous materials |
| JPH033045Y2 (OSRAM) * | 1985-10-31 | 1991-01-28 | ||
| US5296208A (en) * | 1992-08-07 | 1994-03-22 | Uop | Molecular sieve synthesis |
| US5948383A (en) * | 1997-03-26 | 1999-09-07 | Engelhard Corporation | Hybrid zeolite-silica compositions |
| US6413492B1 (en) * | 2000-03-23 | 2002-07-02 | Engelhard Corporation | Method of forming high aluminum aluminosilicate zeolites |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1117776A (fr) * | 1953-12-24 | 1956-05-28 | Union Carbide & Carbon Corp | Procédé de fabrication de matières adsorbantes synthétiques |
| US2882243A (en) * | 1953-12-24 | 1959-04-14 | Union Carbide Corp | Molecular sieve adsorbents |
| FR1240756A (fr) * | 1958-10-03 | 1960-09-09 | Bayer Ag | Procédé de préparation de zéolite sodique synthétique |
| US3058805A (en) * | 1958-10-03 | 1962-10-16 | Bayer Ag | Process for the production of sodium zeolite a |
| US3071434A (en) * | 1960-01-20 | 1963-01-01 | Socony Mobil Oil Co Inc | Process for makling crystalline zeolites |
| US3310373A (en) * | 1963-04-03 | 1967-03-21 | Mobil Oil Corp | Method for producing crystalline aluminosilicates |
| US3313594A (en) * | 1963-07-05 | 1967-04-11 | Mobil Oil Corp | Method for producing crystalline aluminosilicate zeolitic particles of uniform size |
| NL6609779A (OSRAM) * | 1964-07-21 | 1967-01-13 | ||
| US3481699A (en) * | 1966-02-14 | 1969-12-02 | Air Liquide | Process for the preparation of synthetic faujasite |
| FR1536947A (fr) * | 1967-03-01 | 1968-09-02 | Mines Domaniales De Potasse | Zéolites synthétiques et leur procédé de fabrication |
| DE1767001A1 (de) * | 1967-03-22 | 1971-07-29 | Grace W R & Co | Verfahren zur Herstellung eines Aluminiumsilikat-Zeoliths |
| DE1667620C3 (de) * | 1967-08-09 | 1980-04-03 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Verfahren zur gelenkten Herstellung von Natriumaluminiumsilikaten mit vorbestimmten chemischen und/oder physikalischen Eigenschaften |
| US3692475A (en) * | 1970-11-16 | 1972-09-19 | Nalco Chemical Co | Method for making crystalline zeolite y |
| DE2333068C3 (de) * | 1973-06-29 | 1983-06-09 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung eines pulverförmigen kristallinen zeolithischen Molekularsiebes des Typs A und dessen Verwendung |
| DE2433485A1 (de) * | 1973-07-16 | 1975-02-06 | Procter & Gamble | Zur verwendung in waschmitteln geeignete aluminosilikat-ionenaustauscher |
| AT335031B (de) * | 1974-01-17 | 1977-02-25 | Degussa | Optische aufheller enthaltende gemische und verfahren zu deren herstellung |
| US3985669A (en) * | 1974-06-17 | 1976-10-12 | The Procter & Gamble Company | Detergent compositions |
| US4041135A (en) * | 1975-07-25 | 1977-08-09 | J. M. Huber Corporation | Production of high capacity inorganic crystalline base exchange materials |
-
1975
- 1975-07-25 US US05/599,232 patent/US4041135A/en not_active Expired - Lifetime
-
1976
- 1976-07-13 ZA ZA764152A patent/ZA764152B/xx unknown
- 1976-07-15 NO NO762477A patent/NO150114C/no unknown
- 1976-07-19 DK DK325276A patent/DK325276A/da not_active Application Discontinuation
- 1976-07-19 AU AU15995/76A patent/AU499687B2/en not_active Expired
- 1976-07-22 YU YU01816/76A patent/YU181676A/xx unknown
- 1976-07-22 SE SE7608365A patent/SE424438B/xx unknown
- 1976-07-22 IT IT50564/76A patent/IT1062652B/it active
- 1976-07-22 NL NL7608105A patent/NL7608105A/xx not_active Application Discontinuation
- 1976-07-22 BR BR7604752A patent/BR7604752A/pt unknown
- 1976-07-23 CH CH948876A patent/CH629162A5/de not_active IP Right Cessation
- 1976-07-23 FR FR7622597A patent/FR2318823A1/fr active Granted
- 1976-07-23 LU LU75454A patent/LU75454A1/xx unknown
- 1976-07-23 ES ES450100A patent/ES450100A1/es not_active Expired
- 1976-07-23 MX MX761797U patent/MX4022E/es unknown
- 1976-07-23 HU HU76HU268A patent/HU174755B/hu unknown
- 1976-07-23 FI FI762117A patent/FI66298B/fi not_active Application Discontinuation
- 1976-07-23 GB GB30711/76A patent/GB1508548A/en not_active Expired
- 1976-07-23 AR AR264067A patent/AR212504A1/es active
- 1976-07-23 CA CA257,633A patent/CA1074766A/en not_active Expired
- 1976-07-23 BE BE169197A patent/BE844473A/xx not_active IP Right Cessation
- 1976-07-23 DE DE2633304A patent/DE2633304C2/de not_active Expired
- 1976-07-24 PL PL1976191418A patent/PL107716B1/pl unknown
- 1976-07-24 IN IN1326/CAL/76A patent/IN145462B/en unknown
- 1976-07-26 AT AT547676A patent/AT351457B/de not_active IP Right Cessation
- 1976-07-26 JP JP51088957A patent/JPS6031762B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ZA764152B (en) | 1977-06-29 |
| JPS5242484A (en) | 1977-04-02 |
| NO762477L (OSRAM) | 1977-01-26 |
| FI762117A7 (OSRAM) | 1977-01-26 |
| AT351457B (de) | 1979-07-25 |
| US4041135A (en) | 1977-08-09 |
| DK325276A (da) | 1977-01-26 |
| AU1599576A (en) | 1978-01-26 |
| SE424438B (sv) | 1982-07-19 |
| NL7608105A (nl) | 1977-01-27 |
| ES450100A1 (es) | 1977-11-16 |
| BE844473A (fr) | 1977-01-24 |
| JPS6031762B2 (ja) | 1985-07-24 |
| CA1074766A (en) | 1980-04-01 |
| ATA547676A (de) | 1978-12-15 |
| DE2633304C2 (de) | 1986-10-16 |
| AU499687B2 (en) | 1979-04-26 |
| LU75454A1 (OSRAM) | 1978-02-08 |
| NO150114B (no) | 1984-05-14 |
| FR2318823B1 (OSRAM) | 1981-08-21 |
| DE2633304A1 (de) | 1977-02-17 |
| SE7608365L (sv) | 1977-01-26 |
| AR212504A1 (es) | 1978-07-31 |
| GB1508548A (en) | 1978-04-26 |
| CH629162A5 (de) | 1982-04-15 |
| PL107716B1 (pl) | 1980-02-29 |
| BR7604752A (pt) | 1977-08-02 |
| HU174755B (hu) | 1980-03-28 |
| IN145462B (OSRAM) | 1978-10-14 |
| FR2318823A1 (fr) | 1977-02-18 |
| YU181676A (en) | 1982-05-31 |
| IT1062652B (it) | 1984-10-20 |
| MX4022E (es) | 1981-11-04 |
| NO150114C (no) | 1984-08-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI66298B (fi) | Foerfarande foer framstaellning av kristallina alkalimetallalumosilikatbasbytarmaterial | |
| FI67791B (fi) | Kontinuerligt foerfarande foer framstaellning av zeolit a med konstant och homogen kvalitet | |
| US3544476A (en) | Coagulant and method for treating aqueous medium comprising a basic metal salt and a multivalent anion | |
| US4503024A (en) | Process for the preparation of synthetic zeolites, and zeolites obtained by said process | |
| AU2004226362B2 (en) | Aluminosilicates of zeolite N structure | |
| Dalai et al. | Synthesis of NaX zeolite using silica from rice husk ash | |
| CA1095877A (en) | Process for producing silicon-dioxide-containing waste fines to crystalline zeolitic type-a molecular sieves | |
| JPH0123414B2 (OSRAM) | ||
| EP0551061B1 (en) | Process for the preparation of a coagulating chemical | |
| US4486314A (en) | Process for the handling of waste waters | |
| US4749676A (en) | Process for the preparation of a crystalline, swellable sheet silicate of the saponite type | |
| US20080311033A1 (en) | Process for preparing detergent builder zeolite-a from kimberlite tailings | |
| JPH1171108A (ja) | 合成ケイ酸マグネシウム | |
| DK142117B (da) | Polymere organiske siliciumoxidreaktionsprodukter til anvendelse som midler til hindring eller hæmning af aflejringer fra vand eller vandige systemar, og fremgangsmåde til deres fremstilling. | |
| CN108314152A (zh) | 一种高效复合絮凝剂的制备方法 | |
| CN101172619A (zh) | 低温煅烧制备4a沸石分子筛的方法 | |
| RU2085509C1 (ru) | Способ очистки щелочных сточных вод, неорганический коагулянт для очистки щелочных сточных вод и способ его получения | |
| KR20020011820A (ko) | 실리카졸의 제조방법 | |
| HUT77696A (hu) | Eljárás savas folyadékok kezelésére és ennek során kereskedelmi termékek előállítására | |
| NO801181L (no) | Krystallisering av zeolit a ved industrielle fremstillingsprosesser | |
| GB1483610A (en) | Cation-exchanging aluminium silicates and a process for their manufacture | |
| JPH10503459A (ja) | 廃棄物処理剤 | |
| RU2816067C1 (ru) | Способ получения сорбента | |
| US1906181A (en) | Compound silicate gels and methods of making the same | |
| RU2617155C1 (ru) | Способ получения коагулянта на основе полиоксисульфата алюминия, коагулянт, полученный указанным способом |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FC | Application refused |
Owner name: J.M. HUBER CORPORATION |