DE7603244U1 - Sitzlehnen-einstellvorrichtung - Google Patents
Sitzlehnen-einstellvorrichtungInfo
- Publication number
- DE7603244U1 DE7603244U1 DE7603244U DE7603244U DE7603244U1 DE 7603244 U1 DE7603244 U1 DE 7603244U1 DE 7603244 U DE7603244 U DE 7603244U DE 7603244 U DE7603244 U DE 7603244U DE 7603244 U1 DE7603244 U1 DE 7603244U1
- Authority
- DE
- Germany
- Prior art keywords
- gear
- ring
- swivel plate
- gears
- adjusting
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- CVRALZAYCYJELZ-UHFFFAOYSA-N O-(4-bromo-2,5-dichlorophenyl) O-methyl phenylphosphonothioate Chemical compound C=1C=CC=CC=1P(=S)(OC)OC1=CC(Cl)=C(Br)C=C1Cl CVRALZAYCYJELZ-UHFFFAOYSA-N 0.000 claims 1
- 210000000056 organ Anatomy 0.000 claims 1
- 238000010276 construction Methods 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000000969 carrier Substances 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B60—VEHICLES IN GENERAL
- B60N—SEATS SPECIALLY ADAPTED FOR VEHICLES; VEHICLE PASSENGER ACCOMMODATION NOT OTHERWISE PROVIDED FOR
- B60N2/00—Seats specially adapted for vehicles; Arrangement or mounting of seats in vehicles
- B60N2/02—Seats specially adapted for vehicles; Arrangement or mounting of seats in vehicles the seat or part thereof being movable, e.g. adjustable
- B60N2/22—Seats specially adapted for vehicles; Arrangement or mounting of seats in vehicles the seat or part thereof being movable, e.g. adjustable the back-rest being adjustable
- B60N2/225—Seats specially adapted for vehicles; Arrangement or mounting of seats in vehicles the seat or part thereof being movable, e.g. adjustable the back-rest being adjustable by cycloidal or planetary mechanisms
- B60N2/2251—Seats specially adapted for vehicles; Arrangement or mounting of seats in vehicles the seat or part thereof being movable, e.g. adjustable the back-rest being adjustable by cycloidal or planetary mechanisms with gears having orbital motion, e.g. sun and planet gears
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F16—ENGINEERING ELEMENTS AND UNITS; GENERAL MEASURES FOR PRODUCING AND MAINTAINING EFFECTIVE FUNCTIONING OF MACHINES OR INSTALLATIONS; THERMAL INSULATION IN GENERAL
- F16H—GEARING
- F16H57/00—General details of gearing
- F16H57/08—General details of gearing of gearings with members having orbital motion
- F16H57/082—Planet carriers
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F16—ENGINEERING ELEMENTS AND UNITS; GENERAL MEASURES FOR PRODUCING AND MAINTAINING EFFECTIVE FUNCTIONING OF MACHINES OR INSTALLATIONS; THERMAL INSULATION IN GENERAL
- F16H—GEARING
- F16H1/00—Toothed gearings for conveying rotary motion
- F16H1/28—Toothed gearings for conveying rotary motion with gears having orbital motion
- F16H2001/2881—Toothed gearings for conveying rotary motion with gears having orbital motion comprising two axially spaced central gears, i.e. ring or sun gear, engaged by at least one common orbital gear wherein one of the central gears is forming the output
Landscapes
- Engineering & Computer Science (AREA)
- General Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Aviation & Aerospace Engineering (AREA)
- Transportation (AREA)
- Chairs For Special Purposes, Such As Reclining Chairs (AREA)
- Retarders (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB5235/75A GB1528357A (en) | 1975-02-07 | 1975-02-07 | Seat reclining mechanism |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE7603244U1 true DE7603244U1 (de) | 1976-11-04 |
Family
ID=9792261
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE7603244U Expired DE7603244U1 (de) | 1975-02-07 | 1976-02-03 | Sitzlehnen-einstellvorrichtung |
| DE2604489A Expired DE2604489C3 (de) | 1975-02-07 | 1976-02-03 | Sitzlehnen-Einstellvorrichtung |
| DE2907134A Expired DE2907134C3 (de) | 1975-02-07 | 1979-02-20 | Sitzlehnen-Einstellvorrichtung |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2604489A Expired DE2604489C3 (de) | 1975-02-07 | 1976-02-03 | Sitzlehnen-Einstellvorrichtung |
| DE2907134A Expired DE2907134C3 (de) | 1975-02-07 | 1979-02-20 | Sitzlehnen-Einstellvorrichtung |
Country Status (8)
| Country | Link |
|---|---|
| US (2) | US4211451A (https=) |
| JP (1) | JPS51104722A (https=) |
| DE (3) | DE7603244U1 (https=) |
| ES (1) | ES444962A1 (https=) |
| FR (2) | FR2299984A1 (https=) |
| GB (2) | GB1528357A (https=) |
| IT (1) | IT1061876B (https=) |
| SE (1) | SE412192B (https=) |
Families Citing this family (71)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1528357A (en) * | 1975-02-07 | 1978-10-11 | Ihw Eng Ltd | Seat reclining mechanism |
| DE2655535C3 (de) * | 1976-12-08 | 1981-04-30 | Adam Opel AG, 6090 Rüsselsheim | Gelenkbeschlag für Kraftfahrzeugsitze |
| US4181357A (en) * | 1978-03-20 | 1980-01-01 | Milsco Manufacturing Company | Seat backrest tilt and height adjustment means |
| JPS55118714A (en) * | 1979-03-07 | 1980-09-11 | Ai Eichi W Eng Ltd | Seat reclining system |
| DE2927544C2 (de) * | 1979-07-07 | 1985-04-11 | Keiper Automobiltechnik Gmbh & Co Kg, 5630 Remscheid | Gelenkbeschlag für Sitze mit verstellbarer Lehne |
| DE3201309C2 (de) * | 1982-01-18 | 1985-11-07 | Manfred Ing.(grad.) 4050 Mönchengladbach Lortz | Verstellmechanismus zur Drehverstellung zweier zentrisch gelagerter Bauteile |
| GB2117441B (en) * | 1982-03-13 | 1985-06-19 | Ihw Eng Ltd | Seat reclining mechanism |
| US4478455A (en) * | 1982-04-26 | 1984-10-23 | Keiper U.S.A., Inc. | Hollow eccentric bolt for taumel hinge fitting |
| DE3226714C2 (de) * | 1982-07-16 | 1986-09-18 | P.A. Rentrop, Hubbert & Wagner Fahrzeugausstattungen Gmbh & Co Kg, 3060 Stadthagen | Gelenkbeschlag für Kraftfahrzeugsitze mit verstellbarer Lehne |
| GB8401872D0 (en) * | 1984-01-25 | 1984-02-29 | Ihw Eng Ltd | Seat reclining mechanism |
| FR2568340B1 (fr) * | 1984-07-27 | 1986-12-19 | Paris & Du Rhone | Train epicycloidal |
| GB2179997B (en) * | 1985-07-17 | 1988-11-23 | Ihw Eng Ltd | Seat reclining mechanism |
| US4641887A (en) * | 1985-09-16 | 1987-02-10 | Keiper Recaro Incorporated | Planetary seat back adjuster |
| JPS63318911A (ja) * | 1987-06-24 | 1988-12-27 | 池田物産株式会社 | リクライニング装置 |
| DE3726433A1 (de) * | 1987-08-08 | 1989-02-16 | Keiper Recaro Gmbh Co | Gelenkbeschlag fuer sitze, insbesondere kraftfahrzeugsitze mit verstellbarer rueckenlehne |
| DE3729134C2 (de) * | 1987-09-01 | 2001-05-17 | Hammerstein Gmbh C Rob | Verstellbeschlag für einen Fahrzeugsitz |
| FR2624239A1 (fr) * | 1987-12-03 | 1989-06-09 | Cousin Cie Ets A & M Freres | Mecanisme reducteur sans jeu utilisable notamment pour le reglage de diverses parties d'un siege de vehicule automobile |
| GB2213869B (en) * | 1987-12-21 | 1991-09-18 | Ihw Eng Ltd | Reclining mechanism |
| DE3804352A1 (de) * | 1988-02-12 | 1989-08-24 | Keiper Recaro Gmbh Co | Verstellvorrichtung fuer sitze |
| FR2627437B1 (fr) * | 1988-02-23 | 1990-06-22 | Tubauto | Articulation continue irreversible pour siege |
| GB8805290D0 (en) * | 1988-03-05 | 1988-04-07 | Ihw Eng Ltd | Seat reclining mechanism |
| FR2644859B1 (fr) * | 1989-03-24 | 1991-07-12 | Rapid Sa | Dispositif elastique de maintien sensiblement sans jeux de l'axe de rotation d'au moins un element mecanique tournant dans ou sur un autre element |
| JPH0525480Y2 (https=) * | 1989-07-31 | 1993-06-28 | ||
| US5232417A (en) * | 1990-04-25 | 1993-08-03 | Viscodrive Gmbh | Differential drive |
| JPH0446850U (https=) * | 1990-08-29 | 1992-04-21 | ||
| SE470256B (sv) * | 1991-05-21 | 1993-12-20 | Linvent Ab | Anordning för inbördes vinkelinställning av två enheter, företrädesvis inställning av ryggstödslutningen hos ett fordonssäte |
| SE508679C2 (sv) * | 1992-06-29 | 1998-10-26 | Linvent Ab | Anordning för inbördes inställning av ledbara delar |
| US5368363A (en) * | 1992-08-04 | 1994-11-29 | Ikeda Bussan Co., Ltd. | Seat reclining mechanism |
| CA2121929A1 (en) * | 1994-04-22 | 1995-10-23 | Pierre Doucet | Gear reducer |
| DE4437073A1 (de) * | 1994-07-01 | 1996-01-04 | Hammerstein Gmbh C Rob | Gelenkbeschlag für einen verstellbaren Fahrzeugsitz |
| GB2301394B (en) * | 1995-05-27 | 1998-09-02 | Philip Charles Shephard | Angular adjustment mechanisms |
| GB2312730B (en) * | 1996-05-04 | 1999-11-03 | Philip Charles Shephard | Seat adjusting mechanism |
| GB9614787D0 (en) | 1996-07-13 | 1996-09-04 | Johnson Controls Adwest | Seat reclining mechanism |
| DE19631776A1 (de) * | 1996-08-06 | 1998-02-12 | Tolges Kunststoffverarbeitung | Gelenk für verschwenkbare Teile eines Kinderwagens, eines Rasenmähers oder eines ähnlichen Kleinfahrzeuges |
| US5845666A (en) * | 1996-10-25 | 1998-12-08 | Graco Children's Products Inc. | Canopy with latch and pivot members |
| FR2798099B1 (fr) * | 1999-09-03 | 2001-11-16 | Faure Bertrand Equipements Sa | Siege de vehicule dote d'un mecanisme d'articulation |
| GB2354284A (en) * | 1999-09-14 | 2001-03-21 | Johnson Controls Gmbh | A lever operated rotary drive mechanism for a reclining seat |
| US6296311B1 (en) | 1999-10-29 | 2001-10-02 | Fisher Dynamics Corporation | Constant engagement infinite recliner |
| WO2001044009A1 (de) | 1999-12-13 | 2001-06-21 | Wolfgang Lortz | Verstellgetriebe |
| US6547332B2 (en) * | 2001-01-24 | 2003-04-15 | Fishers Dynamics Corporation | Constant engagement linear mechanism |
| DE10106422A1 (de) * | 2001-02-12 | 2002-08-29 | Hoehn Bernd Robert | Planetenradgetriebe |
| MXPA03011687A (es) | 2001-06-12 | 2004-12-06 | Isringhausen S P A | Dispositivo para ajustar la posicion de por lo menos una parte movil de un asiento de un vehiculo. |
| JP2003237433A (ja) * | 2002-02-21 | 2003-08-27 | Aisin Seiki Co Ltd | シートバーチカル装置 |
| KR100446127B1 (ko) * | 2002-03-14 | 2004-08-30 | 주식회사다스 | 자동차용 시트 리클라이닝 장치 |
| DE10219199A1 (de) * | 2002-04-29 | 2003-11-06 | Hammerstein Gmbh C Rob | Lehnengelenkbeschlag für einen Kraftfahrzeugsitz |
| US6708376B1 (en) | 2002-10-01 | 2004-03-23 | North Safety Products Ltd. | Length adjustment mechanism for a strap |
| DE10250987A1 (de) * | 2002-10-28 | 2004-05-13 | Volkswagen Ag | Verstelleinrichtung mit einer Zentralbuchse zur Drehverstellung zweier zentrisch gelagerter Adapterstücke, insbesondere für einen Sitz vorzugsweise eines Kraftfahrzeuges |
| USD484437S1 (en) | 2003-02-26 | 2003-12-30 | North Safety Products Inc. | Knob for a length adjustment mechanism for a strap |
| US20040218968A1 (en) * | 2003-05-01 | 2004-11-04 | Jeffrey Beaver | Hinge lock indicator for center-folding ladder |
| DE102004061817B4 (de) * | 2004-12-22 | 2017-06-01 | Robert Bosch Gmbh | Getriebevorrichtung, insbesondere Planetengetriebe mit verbessertem Aufbau |
| DE102007017617B4 (de) * | 2006-11-02 | 2016-06-09 | Johnson Controls Gmbh | Verstelleinrichtung eines Kraftfahrzeugsitzes |
| DE102007039363B4 (de) * | 2006-11-23 | 2015-03-19 | Johnson Controls Metals and Mechanisms GmbH & Co. KG | Verstellvorrichtung in einem Kraftfahrzeug mit einem bewegbaren Verstellteil und Verfahren zu seiner Herstellung |
| CA2711966C (en) * | 2008-01-17 | 2016-05-17 | Fisher Dynamics Corporation | Round recliner mechanism |
| DE102008034800B4 (de) * | 2008-07-24 | 2016-02-11 | Johnson Controls Gmbh | Verstelleinrichtung, insbesondere für einen Fahrzeugsitz |
| US7914076B2 (en) * | 2008-10-31 | 2011-03-29 | Midmark Corporation | Device with a limit switch and trunnion |
| US7708344B1 (en) * | 2008-10-31 | 2010-05-04 | Midmark Corporation | Patient chair with locking assembly |
| US8025336B2 (en) * | 2008-10-31 | 2011-09-27 | Midmark Corporation | Dental chair |
| US8267492B2 (en) * | 2009-05-07 | 2012-09-18 | Whirlpool Corporation | Method of routing utilities through an articulated hinge |
| CA2734194A1 (en) * | 2010-03-17 | 2011-09-17 | Fisher & Company, Incorporated | Recliner mechanism with mounting feature |
| CN103140374B (zh) * | 2010-08-10 | 2016-10-05 | 约翰逊控股公司 | 具有调整装置的车辆座椅 |
| DE102011052044B4 (de) * | 2011-07-21 | 2024-05-23 | Keiper Seating Mechanisms Co., Ltd. | Beschlag für eine Verstellvorrichtung eines Kraftfahrzeugsitzes |
| DE102012006059B4 (de) * | 2011-11-30 | 2014-04-24 | Johnson Controls Gmbh | Verstellvorrichtung für einer Kraftfahrzeugkomponente |
| DE102012006058B4 (de) * | 2011-11-30 | 2014-05-15 | Johnson Controls Gmbh | Verstellvorrichtung und Verfahren zum Verstellen einer Kraftfahrzeugkomponente |
| FR2997351B1 (fr) * | 2012-10-26 | 2016-07-08 | Faurecia Sieges Automobile | Dispositif d'articulation motorise pour articulation de siege de vehicule |
| DE102013201514A1 (de) * | 2013-01-30 | 2014-07-31 | Brose Fahrzeugteile Gmbh & Co. Kommanditgesellschaft, Coburg | Sitzrahmen eines Fahrzeugsitzes |
| US9296315B2 (en) | 2013-02-26 | 2016-03-29 | Fisher & Company, Incorporated | Recliner mechanism with backdriving feature |
| US9902297B2 (en) | 2014-06-11 | 2018-02-27 | Fisher & Company, Incorporated | Latch mechanism with locking feature |
| JP6682300B2 (ja) * | 2016-03-04 | 2020-04-15 | シロキ工業株式会社 | シートリクライニング装置 |
| US10337223B2 (en) * | 2016-11-23 | 2019-07-02 | Kohler Co. | Shower door hinge assembly |
| CN107028392B (zh) * | 2017-06-21 | 2020-12-08 | 王祥樟 | 一种多功能椅子 |
| DE102023121040A1 (de) * | 2023-08-08 | 2025-02-13 | Oechsler Ag | Getriebebauteil, Planetenradgetriebe, Stellantrieb, Verwendung sowie Verfahren zur Herstellung eines Stellantriebs |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2192881A (en) * | 1937-12-30 | 1940-03-12 | Helicopter Corp Of America | Helicopter device |
| US2721591A (en) * | 1953-02-17 | 1955-10-25 | Walter H Criswell | Geared screw driver |
| US3116651A (en) * | 1961-03-21 | 1964-01-07 | Gen Motors Corp | Gearing |
| GB1104023A (en) * | 1964-03-17 | 1968-02-21 | Pametrada | Improvements in and relating to epicyclic gears |
| DE1580540B1 (de) * | 1966-06-11 | 1970-10-29 | Putsch Friedrich Wilhelm | Gelenkbeschlag fuer Sitze mit verstellbarer Lehne,insbesondere Kraftfahrzeugsitze |
| US3401979A (en) * | 1966-07-19 | 1968-09-17 | Putsch Friedrich W | Articulated mount for seats, particularly motor vehicle seats |
| GB1170708A (en) * | 1967-04-06 | 1969-11-12 | Recaro A G | Hinge Fitment |
| FR2115774A5 (https=) * | 1970-11-30 | 1972-07-07 | Automobilwerk Eisenach Veb | |
| CS151290B1 (https=) | 1971-05-26 | 1973-09-17 | ||
| ZA745939B (en) * | 1974-09-18 | 1976-01-28 | Bus Bodies Sa Ltd | Controlling rotary mechanisms |
| GB1528357A (en) * | 1975-02-07 | 1978-10-11 | Ihw Eng Ltd | Seat reclining mechanism |
| FR2307495A1 (fr) * | 1975-04-18 | 1976-11-12 | Faure Bertrand | Perfectionnements aux articulations de sieges |
| DE2539023C3 (de) * | 1975-09-04 | 1980-10-02 | Gustaf Erik Vaexjoe Gustafsson (Schweden) | Gelenkbeschlag für Sitze |
-
1975
- 1975-02-07 GB GB5235/75A patent/GB1528357A/en not_active Expired
-
1976
- 1976-01-29 SE SE7600922A patent/SE412192B/xx not_active IP Right Cessation
- 1976-02-03 DE DE7603244U patent/DE7603244U1/de not_active Expired
- 1976-02-03 DE DE2604489A patent/DE2604489C3/de not_active Expired
- 1976-02-05 FR FR7603208A patent/FR2299984A1/fr active Granted
- 1976-02-06 JP JP51012134A patent/JPS51104722A/ja active Pending
- 1976-02-06 ES ES444962A patent/ES444962A1/es not_active Expired
- 1976-02-09 IT IT19974/76A patent/IT1061876B/it active
-
1978
- 1978-05-30 GB GB27773/77A patent/GB1586869A/en not_active Expired
- 1978-09-08 US US05/940,965 patent/US4211451A/en not_active Expired - Lifetime
-
1979
- 1979-02-20 DE DE2907134A patent/DE2907134C3/de not_active Expired
- 1979-03-07 FR FR7905884A patent/FR2450713A2/fr active Granted
- 1979-06-01 US US06/044,451 patent/US4345792A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US4211451A (en) | 1980-07-08 |
| JPS51104722A (https=) | 1976-09-16 |
| DE2907134B2 (de) | 1981-04-23 |
| DE2907134C3 (de) | 1981-12-24 |
| DE2907134A1 (de) | 1980-12-11 |
| GB1586869A (en) | 1981-03-25 |
| IT1061876B (it) | 1983-04-30 |
| SE7600922L (sv) | 1976-08-09 |
| DE2604489A1 (de) | 1976-08-19 |
| SE412192B (sv) | 1980-02-25 |
| US4345792A (en) | 1982-08-24 |
| ES444962A1 (es) | 1977-05-01 |
| FR2299984B1 (https=) | 1980-10-31 |
| DE2604489B2 (de) | 1978-07-27 |
| DE2604489C3 (de) | 1979-03-29 |
| FR2450713A2 (fr) | 1980-10-03 |
| FR2299984A1 (fr) | 1976-09-03 |
| FR2450713B2 (https=) | 1983-07-18 |
| GB1528357A (en) | 1978-10-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE7603244U1 (de) | Sitzlehnen-einstellvorrichtung | |
| DE3226714C2 (de) | Gelenkbeschlag für Kraftfahrzeugsitze mit verstellbarer Lehne | |
| DE2254841A1 (de) | Gelenkbeschlag fuer eine verstellbare rueckenlehne, insbesondere von kraftfahrzeugsitzen | |
| DE2808954A1 (de) | Gelenkbeschlag fuer sitze mit verstellbarer rueckenlehne, insbesondere kraftfahrzeugsitze | |
| DE2328908A1 (de) | Gelenkbeschlag fuer sitze mit verstellbarer lehne, insbesondere kraftfahrzeugsitze | |
| DE7212432U (de) | Beschlagpaar fuer einen kfz-sitz | |
| DE7417259U (de) | Drehvorrichtung zum regulieren der relativen winkelstellung zweier organe | |
| EP0995371B1 (de) | Bürostuhl mit einer Sitzneigungsverstellung | |
| EP0518130B1 (de) | Fahrzeugsitz mit Sitztiefen- und Rückenlehnenverstellung | |
| DE10217534A1 (de) | Verriegelungseinrichtung von Einstelleinrichtungen für Lenksäulen von Kraftfahrzeugen | |
| DE2238899C3 (de) | Gelenkbeschlag für Kraftfahrzeugsitze | |
| DE2845281A1 (de) | Gelenkbeschlag fuer fahrzeugsitze, insbesondere kraftfahrzeugsitze | |
| EP0602361A2 (de) | Rückenlehnengelenk für einen Fahrzeugsitz | |
| EP0755824A1 (de) | Fahrzeugsitz | |
| DE19530717A1 (de) | Gelenk | |
| EP0098400B1 (de) | Stellvorrichtung für Sitze, insbesondere Kraftfahrzeugsitze | |
| DE1755424A1 (de) | Sitz,insbesondere Kraftfahrzeugsitz | |
| DE8331237U1 (de) | Vorrichtung zur einstellung der position eines fahrzeugsitzes | |
| DE19709524C2 (de) | Neigungsverstellbeschlag für die Rückenlehne eines Kraftfahrzeugsitzes | |
| DE3923893C1 (en) | Adjusting device for pram frame - has fixed section to which second section is pivoted about shaft to set angle of inclination, adjusters with toothed rims, and eccentric | |
| DE3839741A1 (de) | Neigungsverstellvorrichtung fuer rueckenlehnen von kraftfahrzeugsitzen | |
| DE2845545A1 (de) | Gelenkbeschlag fuer kraftfahrzeugsitze | |
| DE3810612A1 (de) | Drehgelenk fuer sitze mit verstellbarer lehne, insbesondere kraftfahrzeugsitze | |
| DE2927544A1 (de) | Gelenkbeschlag fuer sitze mit verstellbarer lehne | |
| DE10027202A1 (de) | Getriebe zur Verstellung des Winkels zwischen zwei Bauteilen |