DE644593C - Maschine zum Lochen von Zaehlkarten unter Steuerung durch bereits gelochte Karten - Google Patents
Maschine zum Lochen von Zaehlkarten unter Steuerung durch bereits gelochte KartenInfo
- Publication number
- DE644593C DE644593C DEI50149D DEI0050149D DE644593C DE 644593 C DE644593 C DE 644593C DE I50149 D DEI50149 D DE I50149D DE I0050149 D DEI0050149 D DE I0050149D DE 644593 C DE644593 C DE 644593C
- Authority
- DE
- Germany
- Prior art keywords
- card
- cards
- contact
- magnet
- hole
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000004080 punching Methods 0.000 title claims description 39
- 239000004020 conductor Substances 0.000 claims description 64
- 238000012360 testing method Methods 0.000 claims description 27
- 230000008878 coupling Effects 0.000 claims description 16
- 238000010168 coupling process Methods 0.000 claims description 16
- 238000005859 coupling reaction Methods 0.000 claims description 16
- 230000005284 excitation Effects 0.000 claims description 12
- 210000000056 organ Anatomy 0.000 claims description 10
- ZMYDAPJHGNEFGQ-UHFFFAOYSA-N 6-(2-fluorophenyl)-5h-[1,3]dioxolo[4,5-g]quinolin-8-one Chemical compound FC1=CC=CC=C1C(NC1=C2)=CC(=O)C1=CC1=C2OCO1 ZMYDAPJHGNEFGQ-UHFFFAOYSA-N 0.000 claims description 9
- 230000000694 effects Effects 0.000 claims description 9
- 230000007246 mechanism Effects 0.000 claims description 9
- 238000012546 transfer Methods 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 3
- 230000008569 process Effects 0.000 claims description 2
- 230000004913 activation Effects 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 claims 1
- 238000011144 upstream manufacturing Methods 0.000 claims 1
- 238000012795 verification Methods 0.000 claims 1
- 230000033001 locomotion Effects 0.000 description 8
- 238000012545 processing Methods 0.000 description 4
- 238000004804 winding Methods 0.000 description 4
- 230000005540 biological transmission Effects 0.000 description 3
- 230000009471 action Effects 0.000 description 2
- 230000000295 complement effect Effects 0.000 description 2
- 238000010586 diagram Methods 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000012937 correction Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 230000005291 magnetic effect Effects 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000003252 repetitive effect Effects 0.000 description 1
- 230000001360 synchronised effect Effects 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B21—MECHANICAL METAL-WORKING WITHOUT ESSENTIALLY REMOVING MATERIAL; PUNCHING METAL
- B21D—WORKING OR PROCESSING OF SHEET METAL OR METAL TUBES, RODS OR PROFILES WITHOUT ESSENTIALLY REMOVING MATERIAL; PUNCHING METAL
- B21D28/00—Shaping by press-cutting; Perforating
- B21D28/24—Perforating, i.e. punching holes
- B21D28/246—Selection of punches
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Perforating, Stamping-Out Or Severing By Means Other Than Cutting (AREA)
- Catalysts (AREA)
- Control Of Vending Devices And Auxiliary Devices For Vending Devices (AREA)
- Conveying Record Carriers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US685373A US2032805A (en) | 1933-08-09 | 1933-08-09 | Perforating machine |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE644593C true DE644593C (de) | 1937-05-08 |
Family
ID=32508409
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEI50149D Expired DE644593C (de) | 1933-08-09 | 1934-07-13 | Maschine zum Lochen von Zaehlkarten unter Steuerung durch bereits gelochte Karten |
Country Status (5)
| Country | Link |
|---|---|
| US (2) | US2032805A (env) |
| DE (1) | DE644593C (env) |
| FR (1) | FR796365A (env) |
| GB (1) | GB442534A (env) |
| NL (2) | NL50871C (env) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE747603C (de) * | 1940-06-11 | 1944-11-18 | Hollerith Maschinen Ges M B H | Eintragungsmaschine fuer Registrierkarten |
| DE973735C (de) * | 1951-08-24 | 1960-05-25 | Michael Maul | Kartendoppler fuer Doppeldeck-Karten |
| DE1139674B (de) * | 1957-06-29 | 1962-11-15 | Aritma, narodni podnik, Prag | Lochkartendupliziermaschine. |
| DE1178626B (de) * | 1953-11-17 | 1964-09-24 | Ibm Deutschland | Verfahren zur maschinellen Kontoueberwachung |
Families Citing this family (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2623592A (en) * | 1952-12-30 | Card reproducing machine | ||
| US2711794A (en) * | 1955-06-28 | ghertman | ||
| DE976542C (de) * | 1942-03-14 | 1963-11-07 | Ibm Deutschland | Druckwerk fuer Kartenlochmaschinen |
| US2448781A (en) * | 1942-03-14 | 1948-09-07 | Ibm | Record controlled machine |
| US2532331A (en) * | 1946-01-05 | 1950-12-05 | Rose Ernest | Punching circuit |
| US2614632A (en) * | 1948-07-27 | 1952-10-21 | American Telephone & Telegraph | Apparatus for recording numerals in code |
| NL80458C (env) * | 1948-10-08 | 1955-09-15 | ||
| US2647581A (en) * | 1949-07-06 | 1953-08-04 | Ibm | Record card punching machine |
| US2690222A (en) * | 1950-08-19 | 1954-09-28 | Ibm | Mark sensing reproducer |
| US2684719A (en) * | 1950-08-19 | 1954-07-27 | Ibm | Storage key punch |
| NL166471B (nl) * | 1951-08-09 | Upjohn Co | Werkwijze ter bereiding van een therapeutisch preparaat alsmede werkwijze ter bereiding van een daarvoor ge- schikt benzofenonderivaat. | |
| NL166510B (nl) * | 1951-08-10 | France Etat | Vangrail, welke in dwarsrichting kan glijden. | |
| NL166511B (nl) * | 1951-08-14 | Vredestein Nv | Waterafdicht-of waterkeersamenstel voor een voeg in een betonconstructie en werkwijze voor het aan- brengen daarvan. | |
| NL168464B (nl) * | 1951-09-26 | Kaupert Guenter Dr Ing | Tot een stapel in elkaar te schuiven, van een aantal komvormige delen voorziene, inlegvellen. | |
| NL94435C (env) * | 1951-10-02 | |||
| US2844307A (en) * | 1952-01-29 | 1958-07-22 | Bell Telephone Labor Inc | Record-controlled apparatus |
| US2775297A (en) * | 1952-05-01 | 1956-12-25 | Ibm | Record controlled perforating machine |
| US2768691A (en) * | 1952-05-23 | 1956-10-30 | Cooper | Reproducing punch |
| US2751985A (en) * | 1952-12-05 | 1956-06-26 | Sperry Rand Corp | Field selection mechanism for record controlled machines |
| US2771137A (en) * | 1953-04-30 | 1956-11-20 | Ibm | Record controlled punch with provision for serial numbering |
| US2889110A (en) * | 1953-06-19 | 1959-06-02 | Ibm | Bill feeding and piercing devices |
| BE532427A (env) * | 1953-10-09 | |||
| US2888077A (en) * | 1954-04-13 | 1959-05-26 | Ibm | Interspersed gang punch device |
| US2793695A (en) * | 1954-10-14 | 1957-05-28 | Ibm | Record punching machine |
| US3070366A (en) * | 1957-01-04 | 1962-12-25 | William F Huck | Record processing machine |
| US2902005A (en) * | 1957-05-23 | 1959-09-01 | Ibm | Hydraulic control for intermittent starting and stopping of a hydraulic motor |
| US3001693A (en) * | 1957-07-25 | 1961-09-26 | Parsons Corp | Data handling system |
| NL234659A (env) * | 1957-12-30 | |||
| US3509323A (en) * | 1962-05-17 | 1970-04-28 | Houdaille Industries Inc | Tape control device |
-
0
- NL NL45012D patent/NL45012C/xx active
- NL NL50871D patent/NL50871C/xx active
- US US21133D patent/USRE21133E/en not_active Expired
-
1933
- 1933-08-09 US US685373A patent/US2032805A/en not_active Expired - Lifetime
-
1934
- 1934-07-13 DE DEI50149D patent/DE644593C/de not_active Expired
- 1934-08-08 GB GB22990/34A patent/GB442534A/en not_active Expired
- 1934-08-08 FR FR796365D patent/FR796365A/fr not_active Expired
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE747603C (de) * | 1940-06-11 | 1944-11-18 | Hollerith Maschinen Ges M B H | Eintragungsmaschine fuer Registrierkarten |
| DE973735C (de) * | 1951-08-24 | 1960-05-25 | Michael Maul | Kartendoppler fuer Doppeldeck-Karten |
| DE1178626B (de) * | 1953-11-17 | 1964-09-24 | Ibm Deutschland | Verfahren zur maschinellen Kontoueberwachung |
| DE1139674B (de) * | 1957-06-29 | 1962-11-15 | Aritma, narodni podnik, Prag | Lochkartendupliziermaschine. |
Also Published As
| Publication number | Publication date |
|---|---|
| NL50871C (env) | |
| GB442534A (en) | 1936-02-10 |
| NL45012C (env) | |
| USRE21133E (en) | 1939-06-27 |
| US2032805A (en) | 1936-03-03 |
| FR796365A (fr) | 1936-04-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE644593C (de) | Maschine zum Lochen von Zaehlkarten unter Steuerung durch bereits gelochte Karten | |
| DE2126031C2 (de) | Vorrichtung zum Überwachen des Beschickungsflusses in einer Zigarettenverpackungsmaschine | |
| DE1011186B (de) | Verfahren zum maschinellen Mischen und Sortieren von Zaehlkarten | |
| DE544645C (de) | Elektrische Fernbedienungsanlage | |
| DE674139C (de) | Verbundgeschaeftsmaschine | |
| DE652100C (de) | Lochmaschine zur Nachbildung von Musterkarten | |
| DE1806373C3 (de) | Fadenzuführvorrichtung zu Tuftingwerkzeugen einer Tuftingmaschine | |
| DE424814C (de) | Lochkartenkopiermaschine | |
| DE679640C (de) | Schreibrechenmaschine mit Lochbandsteuerung | |
| DE503119C (de) | Durch Zaehlkarten mit Lochkombinationen gesteuerte Maschine | |
| CH638001A5 (de) | Tuftverfahren sowie tuftmaschine zur durchfuehrung des verfahrens. | |
| DE638782C (de) | Lochmaschine zum Duplizieren von gelochten Musterkarten | |
| DE643110C (de) | Lochkartendupliziereinrichtung | |
| DE876488C (de) | Zaehlkarten-Sortiermaschine | |
| DE646257C (de) | Druckende Tabelliermaschine mit Einrichtung zur Bildung von Salden positiver und negativer Posten | |
| DE695039C (de) | Durch Tasten gesteuerte Sortiermaschine fuer mit verschiedenen Kennzeichen versehene Schecks u. dgl. | |
| DE2505552A1 (de) | Verfahren und vorrichtung zum schneiden eines furnierblattes | |
| DE883359C (de) | Anordnung zum spaltenweisen Lochen von Zaehlkarten | |
| DE619869C (de) | Durch Lochkarten gesteuerte druckende Geschaeftsmaschine | |
| DE925502C (de) | Durch Aufzeichnungstraeger gesteuerte Rechenmaschine mit einer Einrichtung zur Herstellung von Summenkarten | |
| DE756392C (de) | Durch Zaehlkarten gesteuerte Geschaeftsmaschine | |
| DE619867C (de) | Durch Lochkarten gesteuerte Multiplikationsmaschine mit Einrichtung zur Resultatlochung | |
| DE1011195B (de) | Unter Zaehlkarten-(Lochkarten-) Steuerung arbeitende Maschinenanlage mit Druckwerk und mit einer Einrichtung zum Aussuchen von mit Kennmarkierungen versehenen Registrierunterlagen | |
| DE909638C (de) | Anordnung zur druckschriftlichen Darstellung der Angaben eines Aufzeichnungstraegers | |
| DE900887C (de) | Lochkarten-Dupliziermaschine |