DE4104930C2 - Sprunggelenk-Bandage - Google Patents
Sprunggelenk-BandageInfo
- Publication number
- DE4104930C2 DE4104930C2 DE4104930A DE4104930A DE4104930C2 DE 4104930 C2 DE4104930 C2 DE 4104930C2 DE 4104930 A DE4104930 A DE 4104930A DE 4104930 A DE4104930 A DE 4104930A DE 4104930 C2 DE4104930 C2 DE 4104930C2
- Authority
- DE
- Germany
- Prior art keywords
- ankle
- bandage according
- ankle bandage
- shaped
- elastic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 210000003423 ankle Anatomy 0.000 title claims description 130
- 239000004744 fabric Substances 0.000 claims description 56
- 239000000463 material Substances 0.000 claims description 49
- 210000002683 foot Anatomy 0.000 claims description 30
- 239000004753 textile Substances 0.000 claims description 16
- 229920002379 silicone rubber Polymers 0.000 claims description 13
- 210000004872 soft tissue Anatomy 0.000 claims description 11
- 239000004952 Polyamide Substances 0.000 claims description 9
- 229920002647 polyamide Polymers 0.000 claims description 9
- 239000004945 silicone rubber Substances 0.000 claims description 9
- 229920001971 elastomer Polymers 0.000 claims description 8
- 239000004033 plastic Substances 0.000 claims description 8
- 229920003023 plastic Polymers 0.000 claims description 8
- 239000005060 rubber Substances 0.000 claims description 8
- 244000309466 calf Species 0.000 claims description 7
- 239000013013 elastic material Substances 0.000 claims description 7
- 241001135254 Bisgaard taxa Species 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 230000015572 biosynthetic process Effects 0.000 claims description 5
- 229920002635 polyurethane Polymers 0.000 claims description 5
- 239000004814 polyurethane Substances 0.000 claims description 5
- 229920001194 natural rubber Polymers 0.000 claims description 4
- 229920000742 Cotton Polymers 0.000 claims description 3
- 229920003052 natural elastomer Polymers 0.000 claims description 3
- 229920001084 poly(chloroprene) Polymers 0.000 claims description 3
- 229920000642 polymer Polymers 0.000 claims description 3
- 229920003051 synthetic elastomer Polymers 0.000 claims description 3
- 230000007704 transition Effects 0.000 claims description 3
- 229920001875 Ebonite Polymers 0.000 claims description 2
- 229920002323 Silicone foam Polymers 0.000 claims description 2
- YACLQRRMGMJLJV-UHFFFAOYSA-N chloroprene Chemical compound ClC(=C)C=C YACLQRRMGMJLJV-UHFFFAOYSA-N 0.000 claims description 2
- 229920001821 foam rubber Polymers 0.000 claims description 2
- 239000007788 liquid Substances 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 230000002787 reinforcement Effects 0.000 claims description 2
- 239000013514 silicone foam Substances 0.000 claims description 2
- 239000002023 wood Substances 0.000 claims description 2
- 244000043261 Hevea brasiliensis Species 0.000 claims 1
- 230000002093 peripheral effect Effects 0.000 claims 1
- 230000003716 rejuvenation Effects 0.000 claims 1
- 210000003205 muscle Anatomy 0.000 description 24
- 210000001361 achilles tendon Anatomy 0.000 description 19
- 238000009940 knitting Methods 0.000 description 15
- 230000033001 locomotion Effects 0.000 description 14
- 230000006835 compression Effects 0.000 description 13
- 238000007906 compression Methods 0.000 description 13
- 210000002414 leg Anatomy 0.000 description 12
- 210000000988 bone and bone Anatomy 0.000 description 7
- 210000000474 heel Anatomy 0.000 description 7
- 210000002435 tendon Anatomy 0.000 description 7
- 210000001699 lower leg Anatomy 0.000 description 6
- 210000002303 tibia Anatomy 0.000 description 6
- 230000000694 effects Effects 0.000 description 5
- 239000000835 fiber Substances 0.000 description 5
- 210000002082 fibula Anatomy 0.000 description 5
- 238000003780 insertion Methods 0.000 description 5
- 230000037431 insertion Effects 0.000 description 5
- 238000013459 approach Methods 0.000 description 4
- 210000000459 calcaneus Anatomy 0.000 description 4
- 208000014674 injury Diseases 0.000 description 4
- 210000003041 ligament Anatomy 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 230000036961 partial effect Effects 0.000 description 4
- 210000002027 skeletal muscle Anatomy 0.000 description 4
- 238000005452 bending Methods 0.000 description 3
- 230000006378 damage Effects 0.000 description 3
- 238000009826 distribution Methods 0.000 description 3
- 230000007794 irritation Effects 0.000 description 3
- 210000001503 joint Anatomy 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 230000000087 stabilizing effect Effects 0.000 description 3
- 210000004233 talus Anatomy 0.000 description 3
- 210000000689 upper leg Anatomy 0.000 description 3
- OOKDYUQHMDBHMB-UHFFFAOYSA-N 3,6-dichloro-2-methoxybenzoic acid;2-(2,4-dichlorophenoxy)acetic acid;n-methylmethanamine Chemical compound CNC.CNC.COC1=C(Cl)C=CC(Cl)=C1C(O)=O.OC(=O)COC1=CC=C(Cl)C=C1Cl OOKDYUQHMDBHMB-UHFFFAOYSA-N 0.000 description 2
- 229920002943 EPDM rubber Polymers 0.000 description 2
- 241000219146 Gossypium Species 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- 241000269907 Pleuronectes platessa Species 0.000 description 2
- 208000027418 Wounds and injury Diseases 0.000 description 2
- 230000001154 acute effect Effects 0.000 description 2
- 210000000544 articulatio talocruralis Anatomy 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 210000004439 collateral ligament Anatomy 0.000 description 2
- 210000004177 elastic tissue Anatomy 0.000 description 2
- 201000008482 osteoarthritis Diseases 0.000 description 2
- 210000000453 second toe Anatomy 0.000 description 2
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 230000008093 supporting effect Effects 0.000 description 2
- 230000008961 swelling Effects 0.000 description 2
- 210000001519 tissue Anatomy 0.000 description 2
- 230000008733 trauma Effects 0.000 description 2
- 230000037303 wrinkles Effects 0.000 description 2
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- 244000299507 Gossypium hirsutum Species 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- 206010023215 Joint effusion Diseases 0.000 description 1
- 206010060820 Joint injury Diseases 0.000 description 1
- 206010023232 Joint swelling Diseases 0.000 description 1
- 208000034693 Laceration Diseases 0.000 description 1
- 241000985630 Lota lota Species 0.000 description 1
- 206010030113 Oedema Diseases 0.000 description 1
- 229920013648 Perbunan Polymers 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 229920002334 Spandex Polymers 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 210000003484 anatomy Anatomy 0.000 description 1
- 208000022542 ankle injury Diseases 0.000 description 1
- 230000003042 antagnostic effect Effects 0.000 description 1
- 206010003246 arthritis Diseases 0.000 description 1
- 210000004204 blood vessel Anatomy 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- GQSGZTBDVNUIQS-DGCLKSJQSA-N ciclonicate Chemical compound C1C(C)(C)C[C@H](C)C[C@H]1OC(=O)C1=CC=CN=C1 GQSGZTBDVNUIQS-DGCLKSJQSA-N 0.000 description 1
- 238000005253 cladding Methods 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 238000013016 damping Methods 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 210000001255 hallux Anatomy 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- 210000003630 histaminocyte Anatomy 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 210000003127 knee Anatomy 0.000 description 1
- 230000003902 lesion Effects 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 210000002346 musculoskeletal system Anatomy 0.000 description 1
- 150000002796 natural product derivatives Chemical class 0.000 description 1
- 238000007747 plating Methods 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 230000002980 postoperative effect Effects 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 230000000750 progressive effect Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 238000002407 reforming Methods 0.000 description 1
- 230000000284 resting effect Effects 0.000 description 1
- 229940076279 serotonin Drugs 0.000 description 1
- 238000009958 sewing Methods 0.000 description 1
- 238000010008 shearing Methods 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- 239000007779 soft material Substances 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 230000001960 triggered effect Effects 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 238000003466 welding Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61F—FILTERS IMPLANTABLE INTO BLOOD VESSELS; PROSTHESES; DEVICES PROVIDING PATENCY TO, OR PREVENTING COLLAPSING OF, TUBULAR STRUCTURES OF THE BODY, e.g. STENTS; ORTHOPAEDIC, NURSING OR CONTRACEPTIVE DEVICES; FOMENTATION; TREATMENT OR PROTECTION OF EYES OR EARS; BANDAGES, DRESSINGS OR ABSORBENT PADS; FIRST-AID KITS
- A61F13/00—Bandages or dressings; Absorbent pads
- A61F13/06—Bandages or dressings; Absorbent pads specially adapted for feet or legs; Corn-pads; Corn-rings
- A61F13/064—Bandages or dressings; Absorbent pads specially adapted for feet or legs; Corn-pads; Corn-rings for feet
- A61F13/066—Bandages or dressings; Absorbent pads specially adapted for feet or legs; Corn-pads; Corn-rings for feet for the ankle
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61F—FILTERS IMPLANTABLE INTO BLOOD VESSELS; PROSTHESES; DEVICES PROVIDING PATENCY TO, OR PREVENTING COLLAPSING OF, TUBULAR STRUCTURES OF THE BODY, e.g. STENTS; ORTHOPAEDIC, NURSING OR CONTRACEPTIVE DEVICES; FOMENTATION; TREATMENT OR PROTECTION OF EYES OR EARS; BANDAGES, DRESSINGS OR ABSORBENT PADS; FIRST-AID KITS
- A61F5/00—Orthopaedic methods or devices for non-surgical treatment of bones or joints; Nursing devices ; Anti-rape devices
- A61F5/01—Orthopaedic devices, e.g. long-term immobilising or pressure directing devices for treating broken or deformed bones such as splints, casts or braces
- A61F5/0102—Orthopaedic devices, e.g. long-term immobilising or pressure directing devices for treating broken or deformed bones such as splints, casts or braces specially adapted for correcting deformities of the limbs or for supporting them; Ortheses, e.g. with articulations
- A61F5/0104—Orthopaedic devices, e.g. long-term immobilising or pressure directing devices for treating broken or deformed bones such as splints, casts or braces specially adapted for correcting deformities of the limbs or for supporting them; Ortheses, e.g. with articulations without articulation
- A61F5/0111—Orthopaedic devices, e.g. long-term immobilising or pressure directing devices for treating broken or deformed bones such as splints, casts or braces specially adapted for correcting deformities of the limbs or for supporting them; Ortheses, e.g. with articulations without articulation for the feet or ankles
-
- D—TEXTILES; PAPER
- D04—BRAIDING; LACE-MAKING; KNITTING; TRIMMINGS; NON-WOVEN FABRICS
- D04B—KNITTING
- D04B1/00—Weft knitting processes for the production of fabrics or articles not dependent on the use of particular machines; Fabrics or articles defined by such processes
- D04B1/14—Other fabrics or articles characterised primarily by the use of particular thread materials
- D04B1/18—Other fabrics or articles characterised primarily by the use of particular thread materials elastic threads
-
- A—HUMAN NECESSITIES
- A41—WEARING APPAREL
- A41B—SHIRTS; UNDERWEAR; BABY LINEN; HANDKERCHIEFS
- A41B11/00—Hosiery; Panti-hose
- A41B11/003—Hosiery with intermediate sections of different elasticity
-
- D—TEXTILES; PAPER
- D10—INDEXING SCHEME ASSOCIATED WITH SUBLASSES OF SECTION D, RELATING TO TEXTILES
- D10B—INDEXING SCHEME ASSOCIATED WITH SUBLASSES OF SECTION D, RELATING TO TEXTILES
- D10B2403/00—Details of fabric structure established in the fabric forming process
- D10B2403/01—Surface features
- D10B2403/011—Dissimilar front and back faces
- D10B2403/0113—One surface including hollow piping or integrated straps, e.g. for inserts or mountings
-
- D—TEXTILES; PAPER
- D10—INDEXING SCHEME ASSOCIATED WITH SUBLASSES OF SECTION D, RELATING TO TEXTILES
- D10B—INDEXING SCHEME ASSOCIATED WITH SUBLASSES OF SECTION D, RELATING TO TEXTILES
- D10B2509/00—Medical; Hygiene
- D10B2509/02—Bandages, dressings or absorbent pads
- D10B2509/028—Elastic support stockings or elastic bandages
Landscapes
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Biomedical Technology (AREA)
- Heart & Thoracic Surgery (AREA)
- Vascular Medicine (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Nursing (AREA)
- Orthopedic Medicine & Surgery (AREA)
- Textile Engineering (AREA)
- Orthopedics, Nursing, And Contraception (AREA)
Priority Applications (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE4104930A DE4104930C2 (de) | 1991-02-18 | 1991-02-18 | Sprunggelenk-Bandage |
| EP91121304A EP0499710A2 (de) | 1991-02-18 | 1991-12-12 | Sprunggelenk-Bandage |
| US07/822,161 US5185000A (en) | 1991-02-18 | 1992-01-16 | Ankle joint bandage |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE4104930A DE4104930C2 (de) | 1991-02-18 | 1991-02-18 | Sprunggelenk-Bandage |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE4104930A1 DE4104930A1 (de) | 1992-08-20 |
| DE4104930C2 true DE4104930C2 (de) | 2000-05-04 |
Family
ID=6425268
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE4104930A Expired - Lifetime DE4104930C2 (de) | 1991-02-18 | 1991-02-18 | Sprunggelenk-Bandage |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US5185000A (OSRAM) |
| EP (1) | EP0499710A2 (OSRAM) |
| DE (1) | DE4104930C2 (OSRAM) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE20203275U1 (de) * | 2002-02-28 | 2003-07-10 | Ferd. Hauber GmbH & Co. KG, 72622 Nürtingen | Fußbandage |
| DE202006003245U1 (de) * | 2006-02-27 | 2007-08-02 | Thuasne Deutschland Gmbh & Co. Kg | Sprunggelenkbandage |
| US20240164932A1 (en) * | 2022-11-17 | 2024-05-23 | Medi Gmbh & Co. Kg | Compression garment set |
Families Citing this family (100)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5474524A (en) * | 1992-10-07 | 1995-12-12 | Carey; Michael J. | Joint support |
| DE4237389A1 (de) * | 1992-11-05 | 1994-05-11 | Beiersdorf Ag | Bandage für das Kniegelenk |
| DE4306554C2 (de) * | 1993-03-03 | 1996-07-25 | Schieber Universal Maschf | Strickverfahren |
| US5464384A (en) * | 1993-11-24 | 1995-11-07 | Leonardo W. Cromartie | Achilles tendon support brace |
| DE4404911C2 (de) * | 1994-02-16 | 1997-10-02 | Georg Dr Ahlbaeumer | Schuh, insbesondere Sportschuh oder orthopädischer Strumpf, mit Sprunggelenkstabilisierung |
| DE19500303C2 (de) * | 1994-03-21 | 1998-07-16 | Juergen Hoefer | Heftpflaster |
| US5520628A (en) * | 1994-04-18 | 1996-05-28 | Wehr; Maxon P. | Ankle encompassing pressure orthosis |
| AT368U1 (de) * | 1994-10-31 | 1995-09-25 | Beiersdorf Ag | Sprunggelenk-bandage |
| JP3736852B2 (ja) * | 1995-01-03 | 2006-01-18 | ディジェイ オルソペディックス,エルエルシー | 1枚のカフを持つ整形外科用装具 |
| IT1282181B1 (it) * | 1995-01-19 | 1998-03-16 | Pasquale Martella | Dispositivo per terapie di repressione di sindromi recettoriali dovute a traumi o processi infiammatori interessanti il piede o la caviglia |
| US6656141B1 (en) * | 1995-02-17 | 2003-12-02 | Tony Reid | Multiple sleeve method and apparatus for treating edema and other swelling disorders |
| SE515196C2 (sv) * | 1995-02-22 | 2001-06-25 | Rehband Anatomiska Ab | Vristbandage, som ger stöd åt såväl ankelområdet som hälbenet |
| US5592756A (en) * | 1995-07-03 | 1997-01-14 | Decker; John W. | Ankle supporting system for athletic footwear including mating articulation surfaces |
| US6861570B1 (en) | 1997-09-22 | 2005-03-01 | A. Bart Flick | Multilayer conductive appliance having wound healing and analgesic properties |
| US5814094A (en) | 1996-03-28 | 1998-09-29 | Becker; Robert O. | Iontopheretic system for stimulation of tissue healing and regeneration |
| US8455710B2 (en) | 1997-09-22 | 2013-06-04 | Argentum Medical, Llc | Conductive wound dressings and methods of use |
| US7214847B1 (en) | 1997-09-22 | 2007-05-08 | Argentum Medical, L.L.C. | Multilayer conductive appliance having wound healing and analgesic properties |
| US6087549A (en) * | 1997-09-22 | 2000-07-11 | Argentum International | Multilayer laminate wound dressing |
| US8801681B2 (en) | 1995-09-05 | 2014-08-12 | Argentum Medical, Llc | Medical device |
| US5617745A (en) * | 1996-01-04 | 1997-04-08 | Della Corte; Michael P. | Support sock |
| FR2749754B1 (fr) * | 1996-06-14 | 1998-12-11 | Innothera Topic Int | Orthese compressive a usage unique, notamment pour la contention d'une jambe a la suite d'un ulcere veineux |
| WO1998005277A1 (en) * | 1996-08-02 | 1998-02-12 | Gary Kara Deirmendjian | Ankle brace |
| USD408120S (en) * | 1997-02-06 | 1999-04-20 | Cramer Products, Inc. | Heel cup |
| US5926847A (en) * | 1997-07-01 | 1999-07-27 | Eibert; Bruce A. | Golf practice glove |
| IT1295328B1 (it) * | 1997-10-14 | 1999-05-04 | Calzificio Pinelli Srl | Corpino di calza-maglia,sostanzialmente la parte costituente la mutanda,realizzato da una maglia a punto trattenuto tale da conferire |
| DE69831010T2 (de) * | 1997-10-15 | 2006-06-01 | Robert John Fordingbridge Watts | Knöchel-fuss orthese |
| US6554963B1 (en) * | 1998-11-02 | 2003-04-29 | Albany International Corp. | Embossed fabrics and method of making the same |
| IT1307843B1 (it) * | 1999-02-26 | 2001-11-19 | Filodoro Calze Spa | Capo di vestiario a calza con fascia intermedia ad elasticita'maggiorata. |
| DE20000265U1 (de) * | 2000-01-07 | 2001-06-07 | Otto Bock Orthopädische Industrie GmbH & Co., 37115 Duderstadt | Kniebandage |
| DE20002875U1 (de) * | 2000-02-17 | 2001-06-28 | Gomoluch, Jan M., 88299 Leutkirch | Schlankheitsgurt mit einem Rückenschutz |
| US6440159B1 (en) | 2000-03-01 | 2002-08-27 | Joseph H. Edwards | Multiuse therapy wrap |
| US7028419B2 (en) * | 2000-08-04 | 2006-04-18 | Jeffrey S. Brooks, Inc. | Footwear |
| US6776769B2 (en) * | 2001-03-05 | 2004-08-17 | Joseph Smith | Anatomically configured tubular body of woven or knitted fabric for pressure support of articulating joint |
| AU2002316167A1 (en) * | 2002-05-21 | 2003-12-12 | Ubertech Products, Inc. | Method and application for biomechanical support device |
| US20030217485A1 (en) * | 2002-05-22 | 2003-11-27 | Mark Oishi | Method and application of biomechanical support device |
| AU2003243536A1 (en) * | 2002-06-12 | 2003-12-31 | Britek Footwear Development, Llc | Sole construction for footwear having metal components |
| DE20217332U1 (de) * | 2002-11-11 | 2003-02-27 | Brand Factory Swiss Gmbh, Rotkreuz | Socke |
| WO2004089263A1 (en) * | 2003-04-14 | 2004-10-21 | Robert John Watts | Ankle-foot orthosis |
| US7597676B2 (en) * | 2004-01-22 | 2009-10-06 | University Of Massachusetts | Malleolar pad |
| AU2006268928B2 (en) * | 2005-07-09 | 2012-02-02 | X-Technology Swiss Gmbh | Sock |
| DE102005043541A1 (de) * | 2005-09-12 | 2007-03-15 | X Technology Swiss Gmbh | Socke |
| DE202006001379U1 (de) * | 2006-01-27 | 2006-06-22 | X-Technology Swiss Gmbh | Socke |
| US7584721B2 (en) * | 2006-01-31 | 2009-09-08 | Rotano International | Disposable bootie for pets |
| USD572827S1 (en) * | 2006-04-26 | 2008-07-08 | Bauerfeind Ag | Knee joint bandage |
| TWM306031U (en) * | 2006-08-11 | 2007-02-01 | Hon Hai Prec Ind Co Ltd | Shielding device and electronic product using the same |
| US7739810B2 (en) * | 2006-12-01 | 2010-06-22 | Nike, Inc. | Article of footwear for contact sports |
| USD580557S1 (en) * | 2008-02-28 | 2008-11-11 | Mueller Sports Medicine, Inc. | Ankle support |
| USD581057S1 (en) * | 2008-02-28 | 2008-11-18 | Mueller Sports Medicine, Inc. | Ankle support |
| WO2009114135A1 (en) * | 2008-03-10 | 2009-09-17 | Trident Sports, Corp. | Orthotic brace |
| US8424117B2 (en) * | 2008-06-02 | 2013-04-23 | Achilles Comfort, Llc | Garment including ankle cushion and method of making same |
| US20100016813A1 (en) * | 2008-07-18 | 2010-01-21 | Brown Medical Industries | Product for treating heel fissures |
| EP2159255A1 (de) * | 2008-08-27 | 2010-03-03 | Bayer MaterialScience AG | Verfahren zur Herstellung von geformten Polyurethanschaum-Wundauflagen |
| DE102008052860B4 (de) * | 2008-10-23 | 2011-01-05 | Otto Bock Healthcare Gmbh | Gelenkbandage |
| WO2011025363A1 (en) * | 2009-07-07 | 2011-03-03 | Maxxcare B.V. | Heel protection device, buffer member and method |
| DE102009037823B3 (de) * | 2009-08-10 | 2011-02-24 | Peter Müller GmbH | Orthopädisches Stützmittel und Herstellungsverfahren hierzu |
| US8856968B2 (en) * | 2009-11-25 | 2014-10-14 | PTX Performance Products, Inc. | Foot stabilizer socks and stabilizer pads therefor |
| USD623763S1 (en) * | 2010-01-27 | 2010-09-14 | Pang-Ching Chiang | Ankle brace |
| USD623761S1 (en) * | 2010-01-27 | 2010-09-14 | Pang-Ching Chiang | Ankle brace |
| USD623762S1 (en) * | 2010-01-27 | 2010-09-14 | Pang-Ching Chiang | Ankle brace |
| JP5449043B2 (ja) * | 2010-06-10 | 2014-03-19 | 美津濃株式会社 | スポーツ用サポーター |
| DE102010046945A1 (de) * | 2010-09-29 | 2012-03-29 | Bsn-Jobst Gmbh | Kompressionsartikel mit Einsatz |
| GB201103512D0 (en) * | 2011-03-01 | 2011-04-13 | Watts Robert J | Ankle-foot orthoses |
| US9125787B2 (en) | 2011-09-30 | 2015-09-08 | Covidien Lp | Compression garment having a foam layer |
| US20130191966A1 (en) * | 2012-01-26 | 2013-08-01 | Richard A. Rivkin | Bi-colored insulating sleeve |
| DE102012206062B4 (de) | 2012-04-13 | 2019-09-12 | Adidas Ag | Schuhoberteil |
| DE102012017722B4 (de) * | 2012-09-07 | 2020-02-27 | Bauerfeind Ag | Maschenware in medizinischen Hilfsmitteln |
| EP2961366B1 (en) * | 2013-02-27 | 2019-09-18 | 3M Innovative Properties Company | Compression device |
| US9402779B2 (en) | 2013-03-11 | 2016-08-02 | Covidien Lp | Compression garment with perspiration relief |
| US11666113B2 (en) | 2013-04-19 | 2023-06-06 | Adidas Ag | Shoe with knitted outer sole |
| US12250994B2 (en) | 2013-04-19 | 2025-03-18 | Adidas Ag | Shoe |
| DE102013207155B4 (de) | 2013-04-19 | 2020-04-23 | Adidas Ag | Schuhoberteil |
| DE102013207163B4 (de) | 2013-04-19 | 2022-09-22 | Adidas Ag | Schuhoberteil |
| DE102013207156B4 (de) | 2013-04-19 | 2025-12-24 | Adidas Ag | Schuh, insbesondere ein Sportschuh |
| US10299531B2 (en) * | 2013-05-14 | 2019-05-28 | Nike, Inc. | Article of footwear incorporating a knitted component for a heel portion of an upper |
| FR3005570B1 (fr) * | 2013-05-16 | 2016-07-29 | Millet Innovation | Orthese proprioceptive assurant le maintien d'une articulation |
| US20210244572A1 (en) * | 2013-07-19 | 2021-08-12 | Presscise Ab | Elastic bandage or hosiery, and textile material for use in such an elastic bandage or hosiery |
| US20150059209A1 (en) | 2013-08-29 | 2015-03-05 | Nike, Inc. | Article Of Footwear Incorporating A Knitted Component With An Integral Knit Ankle Cuff |
| FR3009952A1 (fr) * | 2013-09-02 | 2015-03-06 | Millet Innovation | Orthese de main pour le maintien du pouce notamment en cas de rhizarthrose |
| DE102014202432B4 (de) | 2014-02-11 | 2017-07-27 | Adidas Ag | Verbesserter Fußballschuh |
| USD733306S1 (en) | 2014-04-17 | 2015-06-30 | Stephen Brock Blankenship | Compression and tourniquet band |
| DE102014005704A1 (de) * | 2014-04-22 | 2015-10-22 | Michael H. Amlang | lndividuell adaptierbare Achillessehnenorthese |
| DE102014220087B4 (de) | 2014-10-02 | 2016-05-12 | Adidas Ag | Flachgestricktes Schuhoberteil für Sportschuhe |
| US10076436B2 (en) | 2014-12-10 | 2018-09-18 | Apolla Performace Wear LLC | Wearable foot garment |
| US20180000166A1 (en) * | 2014-12-29 | 2018-01-04 | Base360 Inc. | A protective sock |
| EP3344207B1 (en) | 2015-08-31 | 2022-06-01 | Sanford Health | Contact point reduction garment |
| USD878739S1 (en) * | 2015-12-10 | 2020-03-24 | Apolla Performance Wear LLC | Wearable foot garment |
| EP3838037B1 (de) * | 2016-03-08 | 2025-09-17 | KOB GmbH | Socke |
| FR3051354B1 (fr) * | 2016-05-18 | 2020-02-21 | Laboratoires Innothera | Orthese de compression veineuse elastique |
| USD865977S1 (en) * | 2016-06-23 | 2019-11-05 | Bauerfeind Ag | Orthosis |
| USD848007S1 (en) * | 2016-06-23 | 2019-05-07 | Bauerfeind Ag | Orthosis |
| TWD186110S (zh) * | 2016-12-15 | 2017-10-21 | 璟茂實業股份有限公司 | 護踝 |
| US20180200096A1 (en) * | 2017-01-17 | 2018-07-19 | Camp Scandinavia Ab | Tubular Sleeve to be Used Together With an Orthosis |
| SE1750035A1 (en) * | 2017-01-17 | 2018-07-18 | Camp Scandinavia Ab | Tubular sleeve to be used together with an orthosis |
| USD844157S1 (en) * | 2017-07-31 | 2019-03-26 | 3M Innovative Properties Company | Ankle support |
| US11457671B2 (en) * | 2019-12-20 | 2022-10-04 | Maddox Holdings Inc. | Maternity undergarment for gentle support and shape enhancement |
| US20220117768A1 (en) * | 2020-10-19 | 2022-04-21 | Royal Manufacturing LLC | Ankle brace with rear heel calcaneal stabilizing depression |
| USD1017221S1 (en) * | 2021-04-14 | 2024-03-12 | Tbl Licensing Llc | Sock |
| JP7788150B2 (ja) * | 2022-08-10 | 2025-12-18 | 岡本株式会社 | 足装着具 |
| CN116420951A (zh) * | 2023-04-26 | 2023-07-14 | 广州众乐体育用品有限公司 | 一种用于提高跟距关节稳定性的护踝垫片 |
| US12478119B1 (en) * | 2024-09-04 | 2025-11-25 | 1Lifeonearth Llc | Ankle protector |
Citations (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE7635735U1 (OSRAM) * | 1900-01-01 | Kaphingst, Wieland, 3578 Schwalmstadt | ||
| US1408267A (en) * | 1920-07-23 | 1922-02-28 | Caterini Rocco | Arch support |
| US1477357A (en) * | 1922-08-10 | 1923-12-11 | Frank H Jensen | Anklet and arch retainer |
| US1544641A (en) * | 1924-03-19 | 1925-07-07 | Kleinert I B Rubber Co | Ankle reducer |
| DE581230C (de) * | 1932-03-18 | 1933-07-24 | Julius Roempler A G | Verfahren zur Herstellung einer den Knoechel umfassenden Bandage auf der flachen Kulierwirk- oder Strickmaschine |
| DE587228C (de) * | 1933-11-01 | August Muenz | Aufblasbare Bruchbandpelotte | |
| CH166603A (de) * | 1932-08-26 | 1934-01-15 | Rathgeber Karl | Fussbandage. |
| CH171170A (de) * | 1932-07-19 | 1934-08-15 | Rathgeber Karl | Fussbandage. |
| DE663643C (de) * | 1936-01-28 | 1938-08-10 | Thalysia Paul Garms Komm Ges R | Kniebandage |
| US2323826A (en) * | 1940-10-17 | 1943-07-06 | Chesterman Leeland Company | Differential truss pad |
| DE1874605U (de) * | 1959-11-12 | 1963-06-27 | William M Dr Scholl | Mehrschichtiges fusspolster. |
| DE2240945A1 (de) * | 1972-08-19 | 1974-02-28 | Hartmann Paul Ag | Gewebte binde mit laengs- und querelastizitaet fuer medizinische zwecke |
| DE2436831A1 (de) * | 1973-08-21 | 1975-03-13 | Refinetz Ag | Netzfoermiges stoffstueck aus elastischem gewebe, das vorgefertigt ist und teile von unterschiedlicher elastizitaet besitzt |
| CH569472A5 (en) * | 1974-01-18 | 1975-11-28 | Schreiber Herbert | Ankle bandage fitted inside ski boot - soft protective layer incorporates stiffners of variable rigidity |
| EP0027172A1 (de) * | 1979-09-07 | 1981-04-22 | Bauerfeind Gmbh & Co. | Bandage |
| GB2068237A (en) * | 1980-01-31 | 1981-08-12 | Attenburrow D | Splints or casts made from reinforced resin |
| DE8322899U1 (de) * | 1983-08-09 | 1984-11-15 | Künzli & Co. AG Sportschuhfabrik, 5200 Windisch | Schuhwerk, insbesondere auf Sportschuhe, Wanderschuhe, orthopädische Stützschuhe u.dgl. |
| DE8422279U1 (de) * | 1985-01-24 | Buschmeyer, Horst, 4400 Münster | Bausatz für eine Bandage zur Behandlung des menschlichen Sprunggelenkes | |
| DE8433254U1 (de) * | 1985-03-14 | Garbe, Gernulf, Dr. med., 3005 Hemmingen | Vorrichtung zur Stützung erschlaffter Gewölbe und insuffizienter Muskel- und Bandführungen des menschlichen Fußes | |
| DE8503139U1 (de) * | 1985-02-02 | 1985-05-02 | Weihermüller & Voigtmann GmbH & Co KG, 8580 Bayreuth | Fussgelenk-bandage |
| DE3412772C1 (de) * | 1984-04-05 | 1985-10-24 | Horst 8502 Zirndorf Kleylein | Knie-Orthese |
| DE3415657C2 (de) * | 1984-04-27 | 1986-03-06 | Oskar 2000 Hamburg Thum | Fußgelenkbandage |
| DE3441496C1 (de) * | 1984-11-09 | 1986-04-24 | Gernulf Dr.med. 3005 Hemmingen Garbe | Vorrichtung zur Stützung erschlaffter Gewölbe und insuffizienter Muskel- und Bandführungen des menschlichen Fußes |
| US4590932A (en) * | 1984-05-14 | 1986-05-27 | Wilkerson Gary B | Ankle-sprain edema-control boot assembly |
| DE3514211A1 (de) * | 1985-04-19 | 1986-10-23 | Detlef 3167 Burgdorf Wichmann | Formkoerper zur absorption schwacher, insbesondere aus nicht zu starken stoessen und schlaegen herruehrender bewegungsenergie |
| DE3519677A1 (de) * | 1985-06-01 | 1986-12-04 | Otto Fankhänel & Sohn Gummistrickwaren- und Bandagenfabrik, 8600 Bamberg | Elastische kompressions-gelenkbandage |
| DE8700201U1 (de) * | 1987-01-05 | 1987-02-19 | Rau, Roland, Dr.med., 7614 Gengenbach | Stütze für den Sprunggelenkbereich |
| EP0217451A1 (en) * | 1985-09-17 | 1987-04-08 | Macintosh N.V. | Support |
| US4705025A (en) * | 1986-06-20 | 1987-11-10 | Dedo Richard G | Heel padding |
| US4719926A (en) * | 1986-02-28 | 1988-01-19 | Nelson Ronald E | Hinged foot and ankle brace |
| US4724847A (en) * | 1987-06-22 | 1988-02-16 | Nelson Ronald E | Ankle brace |
| FR2606630A1 (fr) * | 1986-11-19 | 1988-05-20 | Richard Freres Sa | Chevillere |
| US4762123A (en) * | 1986-06-20 | 1988-08-09 | Dedo Richard G | Heel padding |
| DE8808919U1 (de) * | 1988-07-12 | 1988-11-24 | Kleylein, Horst, 8502 Zirndorf | Medizinisch orientierte Einlage für Schuhe, insbes. Sportschuhe, wie Tennisschuhe, Basketballschuhe u.a. |
| US4878504A (en) * | 1988-07-22 | 1989-11-07 | Nelson Ronald E | Ankle brace with compression straps |
| US4960135A (en) * | 1989-01-19 | 1990-10-02 | Nelson Ronald E | Ankle restraint device |
| EP0485943A1 (de) * | 1990-11-13 | 1992-05-20 | Horst Kleylein | Knöchelpelotte, Pelotteneinheit und diese enthaltende Knöchelbandage |
| DE4101965A1 (de) * | 1991-01-24 | 1992-07-30 | Beiersdorf Ag | Gelenkbandage |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US663749A (en) * | 1899-12-28 | 1900-12-11 | Frank W Gorse | Knee or elbow cap. |
| US1727897A (en) * | 1927-01-20 | 1929-09-10 | Myers Woolly Animals Co | Knee, elbow, or shoulder cap |
| CH333717A (fr) * | 1955-03-25 | 1958-10-31 | Anatole Vilpou Ulysse | Appareil orthopédique |
| US3266058A (en) * | 1964-05-26 | 1966-08-16 | Yolan R Guttman | Padded foot protector for the bedridden |
| US4495942A (en) * | 1981-12-04 | 1985-01-29 | Palumbo Pasquale M | Dynamic ankle brace |
| US5092347A (en) * | 1990-03-19 | 1992-03-03 | Shaffer David E | Personalized sock kit for relieving foot and ankle pain |
-
1991
- 1991-02-18 DE DE4104930A patent/DE4104930C2/de not_active Expired - Lifetime
- 1991-12-12 EP EP91121304A patent/EP0499710A2/de not_active Withdrawn
-
1992
- 1992-01-16 US US07/822,161 patent/US5185000A/en not_active Expired - Lifetime
Patent Citations (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE8422279U1 (de) * | 1985-01-24 | Buschmeyer, Horst, 4400 Münster | Bausatz für eine Bandage zur Behandlung des menschlichen Sprunggelenkes | |
| DE587228C (de) * | 1933-11-01 | August Muenz | Aufblasbare Bruchbandpelotte | |
| DE7635735U1 (OSRAM) * | 1900-01-01 | Kaphingst, Wieland, 3578 Schwalmstadt | ||
| DE8433254U1 (de) * | 1985-03-14 | Garbe, Gernulf, Dr. med., 3005 Hemmingen | Vorrichtung zur Stützung erschlaffter Gewölbe und insuffizienter Muskel- und Bandführungen des menschlichen Fußes | |
| US1408267A (en) * | 1920-07-23 | 1922-02-28 | Caterini Rocco | Arch support |
| US1477357A (en) * | 1922-08-10 | 1923-12-11 | Frank H Jensen | Anklet and arch retainer |
| US1544641A (en) * | 1924-03-19 | 1925-07-07 | Kleinert I B Rubber Co | Ankle reducer |
| DE581230C (de) * | 1932-03-18 | 1933-07-24 | Julius Roempler A G | Verfahren zur Herstellung einer den Knoechel umfassenden Bandage auf der flachen Kulierwirk- oder Strickmaschine |
| CH171170A (de) * | 1932-07-19 | 1934-08-15 | Rathgeber Karl | Fussbandage. |
| CH166603A (de) * | 1932-08-26 | 1934-01-15 | Rathgeber Karl | Fussbandage. |
| DE663643C (de) * | 1936-01-28 | 1938-08-10 | Thalysia Paul Garms Komm Ges R | Kniebandage |
| US2323826A (en) * | 1940-10-17 | 1943-07-06 | Chesterman Leeland Company | Differential truss pad |
| DE1874605U (de) * | 1959-11-12 | 1963-06-27 | William M Dr Scholl | Mehrschichtiges fusspolster. |
| DE2240945A1 (de) * | 1972-08-19 | 1974-02-28 | Hartmann Paul Ag | Gewebte binde mit laengs- und querelastizitaet fuer medizinische zwecke |
| DE2436831A1 (de) * | 1973-08-21 | 1975-03-13 | Refinetz Ag | Netzfoermiges stoffstueck aus elastischem gewebe, das vorgefertigt ist und teile von unterschiedlicher elastizitaet besitzt |
| CH569472A5 (en) * | 1974-01-18 | 1975-11-28 | Schreiber Herbert | Ankle bandage fitted inside ski boot - soft protective layer incorporates stiffners of variable rigidity |
| EP0027172A1 (de) * | 1979-09-07 | 1981-04-22 | Bauerfeind Gmbh & Co. | Bandage |
| GB2068237A (en) * | 1980-01-31 | 1981-08-12 | Attenburrow D | Splints or casts made from reinforced resin |
| DE8322899U1 (de) * | 1983-08-09 | 1984-11-15 | Künzli & Co. AG Sportschuhfabrik, 5200 Windisch | Schuhwerk, insbesondere auf Sportschuhe, Wanderschuhe, orthopädische Stützschuhe u.dgl. |
| DE3412772C1 (de) * | 1984-04-05 | 1985-10-24 | Horst 8502 Zirndorf Kleylein | Knie-Orthese |
| DE3415657C2 (de) * | 1984-04-27 | 1986-03-06 | Oskar 2000 Hamburg Thum | Fußgelenkbandage |
| US4590932A (en) * | 1984-05-14 | 1986-05-27 | Wilkerson Gary B | Ankle-sprain edema-control boot assembly |
| DE3441496C1 (de) * | 1984-11-09 | 1986-04-24 | Gernulf Dr.med. 3005 Hemmingen Garbe | Vorrichtung zur Stützung erschlaffter Gewölbe und insuffizienter Muskel- und Bandführungen des menschlichen Fußes |
| DE8503139U1 (de) * | 1985-02-02 | 1985-05-02 | Weihermüller & Voigtmann GmbH & Co KG, 8580 Bayreuth | Fussgelenk-bandage |
| DE3514211A1 (de) * | 1985-04-19 | 1986-10-23 | Detlef 3167 Burgdorf Wichmann | Formkoerper zur absorption schwacher, insbesondere aus nicht zu starken stoessen und schlaegen herruehrender bewegungsenergie |
| DE3519677A1 (de) * | 1985-06-01 | 1986-12-04 | Otto Fankhänel & Sohn Gummistrickwaren- und Bandagenfabrik, 8600 Bamberg | Elastische kompressions-gelenkbandage |
| EP0217451A1 (en) * | 1985-09-17 | 1987-04-08 | Macintosh N.V. | Support |
| US4719926A (en) * | 1986-02-28 | 1988-01-19 | Nelson Ronald E | Hinged foot and ankle brace |
| US4762123A (en) * | 1986-06-20 | 1988-08-09 | Dedo Richard G | Heel padding |
| US4705025A (en) * | 1986-06-20 | 1987-11-10 | Dedo Richard G | Heel padding |
| FR2606630A1 (fr) * | 1986-11-19 | 1988-05-20 | Richard Freres Sa | Chevillere |
| DE8700201U1 (de) * | 1987-01-05 | 1987-02-19 | Rau, Roland, Dr.med., 7614 Gengenbach | Stütze für den Sprunggelenkbereich |
| US4724847A (en) * | 1987-06-22 | 1988-02-16 | Nelson Ronald E | Ankle brace |
| DE8808919U1 (de) * | 1988-07-12 | 1988-11-24 | Kleylein, Horst, 8502 Zirndorf | Medizinisch orientierte Einlage für Schuhe, insbes. Sportschuhe, wie Tennisschuhe, Basketballschuhe u.a. |
| US4878504A (en) * | 1988-07-22 | 1989-11-07 | Nelson Ronald E | Ankle brace with compression straps |
| US4960135A (en) * | 1989-01-19 | 1990-10-02 | Nelson Ronald E | Ankle restraint device |
| EP0485943A1 (de) * | 1990-11-13 | 1992-05-20 | Horst Kleylein | Knöchelpelotte, Pelotteneinheit und diese enthaltende Knöchelbandage |
| DE4101965A1 (de) * | 1991-01-24 | 1992-07-30 | Beiersdorf Ag | Gelenkbandage |
Non-Patent Citations (4)
| Title |
|---|
| DE-Z.: Firmenprospekt der Fa. Bauernfeind GmbH über die Aktiv-Knöchelbandage Malleotrain * |
| Med.-orthop.Technik, 1/90, S.III Anzeige FA. OZO- ZOURS GmbH, Malleobandage * |
| Med.-orthop.Technik, 6/85, S.223 ff mit Anzeige FA. Schein Orthopädie Service * |
| Med.-orthop.Technik, 9/90, S.III * |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE20203275U1 (de) * | 2002-02-28 | 2003-07-10 | Ferd. Hauber GmbH & Co. KG, 72622 Nürtingen | Fußbandage |
| DE202006003245U1 (de) * | 2006-02-27 | 2007-08-02 | Thuasne Deutschland Gmbh & Co. Kg | Sprunggelenkbandage |
| WO2007098898A3 (de) * | 2006-02-27 | 2007-11-15 | Thuasne Deutschland Gmbh & Co | Sprunggelenkbandage |
| US20240164932A1 (en) * | 2022-11-17 | 2024-05-23 | Medi Gmbh & Co. Kg | Compression garment set |
Also Published As
| Publication number | Publication date |
|---|---|
| EP0499710A3 (OSRAM) | 1994-03-23 |
| US5185000A (en) | 1993-02-09 |
| DE4104930A1 (de) | 1992-08-20 |
| EP0499710A2 (de) | 1992-08-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE4104930C2 (de) | Sprunggelenk-Bandage | |
| DE4237389A1 (de) | Bandage für das Kniegelenk | |
| DE69726464T2 (de) | Schutzbekleidung für regionen der unteren gliedmassen | |
| EP1179325B1 (de) | Bandage für das Sprunggelenk | |
| EP1906890B1 (de) | Sprunggelenkbandage | |
| EP0496071B1 (de) | Gelenkbandage | |
| EP2612631B1 (de) | Stützbandage | |
| DE4106994C2 (de) | Stützverband | |
| DE4091302C2 (de) | Stützverband und Verfahren zu dessen Herstellung | |
| DE112007003134T5 (de) | Fußstützvorrichtung | |
| EP2381907B1 (de) | Sprunggelenkbandage | |
| EP0600218B1 (de) | Bandage für das Kniegelenk | |
| DE4103383C2 (de) | Ellenbogen-Bandage | |
| DE20203275U1 (de) | Fußbandage | |
| DE10022524A1 (de) | Bandage für das Sprunggelenk | |
| EP3661382B1 (de) | Schuh zum dämpfen einer fussbewegung über das sprunggelenk | |
| DE102018107576B4 (de) | Bandagesystem mit Entstauungsfunktion | |
| DE102004019007A1 (de) | Orthese | |
| DE9316342U1 (de) | Bandage für das Kniegelenk | |
| DE4106883C2 (de) | Schultergelenk-Bandage | |
| DE9417712U1 (de) | Sprunggelenk-Bandage | |
| AT368U1 (de) | Sprunggelenk-bandage | |
| DE102009025415B3 (de) | Stützbandage | |
| CH716437A2 (de) | Medizinisches Gestrickteil, dessen Verwendung und Verfahren zur Herstellung eines solchen Gestrickteils. | |
| EP4034060B1 (de) | Bandagesystem mit entstauungsfunktion |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OM8 | Search report available as to paragraph 43 lit. 1 sentence 1 patent law | ||
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: 3M INNOVATIVE PROPERTIES CO., ST. PAUL, MINN., US |
|
| 8328 | Change in the person/name/address of the agent |
Representative=s name: VOSSIUS & PARTNER, 81675 MUENCHEN |
|
| R071 | Expiry of right |