DE3705621C2 - Heterocyclisch substituierte Chinoloncarbonsäurederivate - Google Patents
Heterocyclisch substituierte ChinoloncarbonsäurederivateInfo
- Publication number
- DE3705621C2 DE3705621C2 DE3705621A DE3705621A DE3705621C2 DE 3705621 C2 DE3705621 C2 DE 3705621C2 DE 3705621 A DE3705621 A DE 3705621A DE 3705621 A DE3705621 A DE 3705621A DE 3705621 C2 DE3705621 C2 DE 3705621C2
- Authority
- DE
- Germany
- Prior art keywords
- compound
- methyl
- cyclopropyl
- fluoro
- mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 125000000623 heterocyclic group Chemical group 0.000 title description 12
- XOQQVKDBGLYPGH-UHFFFAOYSA-N 2-oxo-1h-quinoline-3-carboxylic acid Chemical class C1=CC=C2NC(=O)C(C(=O)O)=CC2=C1 XOQQVKDBGLYPGH-UHFFFAOYSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 278
- 239000000203 mixture Substances 0.000 claims description 172
- 238000006243 chemical reaction Methods 0.000 claims description 161
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 48
- 125000005843 halogen group Chemical group 0.000 claims description 26
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 22
- 238000000034 method Methods 0.000 claims description 20
- 238000002360 preparation method Methods 0.000 claims description 19
- 230000007062 hydrolysis Effects 0.000 claims description 18
- 238000006460 hydrolysis reaction Methods 0.000 claims description 18
- 150000003839 salts Chemical class 0.000 claims description 18
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 13
- 229910052731 fluorine Inorganic materials 0.000 claims description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- 230000000845 anti-microbial effect Effects 0.000 claims description 10
- 125000003277 amino group Chemical group 0.000 claims description 8
- 125000002252 acyl group Chemical group 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 230000008569 process Effects 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 238000007363 ring formation reaction Methods 0.000 claims description 5
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 4
- DLZNDDWHACGVQG-UHFFFAOYSA-N 1-cyclopropyl-6-fluoro-8-methyl-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1CNC(C)CN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1C DLZNDDWHACGVQG-UHFFFAOYSA-N 0.000 claims description 4
- 125000001153 fluoro group Chemical group F* 0.000 claims description 4
- 125000004043 oxo group Chemical group O=* 0.000 claims description 4
- DUKKNFPERUTJLR-UHFFFAOYSA-N 1-cyclopropyl-6-fluoro-8-methyl-7-(3-methylmorpholin-4-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound CC1COCCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1C DUKKNFPERUTJLR-UHFFFAOYSA-N 0.000 claims description 3
- SKMHFGBSMXYZOR-UHFFFAOYSA-N 1-cyclopropyl-6-fluoro-8-methyl-7-morpholin-4-yl-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=CC(C(C(C(O)=O)=CN2C3CC3)=O)=C2C(C)=C1N1CCOCC1 SKMHFGBSMXYZOR-UHFFFAOYSA-N 0.000 claims description 3
- 239000003085 diluting agent Substances 0.000 claims description 3
- 239000011737 fluorine Substances 0.000 claims description 3
- KQNTUQNHMUIAHK-UHFFFAOYSA-N 1-cyclopropyl-6-fluoro-7-(4-fluoropiperidin-1-yl)-8-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=CC(C(C(C(O)=O)=CN2C3CC3)=O)=C2C(C)=C1N1CCC(F)CC1 KQNTUQNHMUIAHK-UHFFFAOYSA-N 0.000 claims description 2
- WTQUVXKOMKEMAE-UHFFFAOYSA-N 1-cyclopropyl-6-fluoro-8-methyl-7-[3-(methylamino)pyrrolidin-1-yl]-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(NC)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1C WTQUVXKOMKEMAE-UHFFFAOYSA-N 0.000 claims description 2
- ZCEWFYWYTCPQKI-UHFFFAOYSA-N 7-[3-(aminomethyl)pyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-8-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=CC(C(C(C(O)=O)=CN2C3CC3)=O)=C2C(C)=C1N1CCC(CN)C1 ZCEWFYWYTCPQKI-UHFFFAOYSA-N 0.000 claims description 2
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- FMDBZBDGTVTPLE-UHFFFAOYSA-N 1-cyclopropyl-7-[3-(ethylaminomethyl)pyrrolidin-1-yl]-6-fluoro-8-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(CNCC)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1C FMDBZBDGTVTPLE-UHFFFAOYSA-N 0.000 claims 1
- INNOJAOLWAIAQK-UHFFFAOYSA-N 7-(3-amino-4-methylpyrrolidin-1-yl)-1-cyclopropyl-6-fluoro-8-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound C1C(N)C(C)CN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1C INNOJAOLWAIAQK-UHFFFAOYSA-N 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 200
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 190
- -1 p-aminobenzyl Chemical group 0.000 description 164
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 159
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 132
- 239000002904 solvent Substances 0.000 description 111
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 105
- 235000019441 ethanol Nutrition 0.000 description 95
- 239000000243 solution Substances 0.000 description 78
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 69
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 63
- 229960004756 ethanol Drugs 0.000 description 63
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 60
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 57
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 55
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 54
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 54
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 53
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 53
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 52
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 48
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 47
- 239000011541 reaction mixture Substances 0.000 description 46
- 239000002253 acid Substances 0.000 description 42
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 41
- 239000000843 powder Substances 0.000 description 40
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 38
- 239000007858 starting material Substances 0.000 description 38
- 239000000284 extract Substances 0.000 description 33
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 33
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 31
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 30
- 235000011167 hydrochloric acid Nutrition 0.000 description 30
- 239000003795 chemical substances by application Substances 0.000 description 28
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 27
- 239000013078 crystal Substances 0.000 description 25
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 24
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 24
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 24
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 24
- 235000019341 magnesium sulphate Nutrition 0.000 description 24
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 23
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 22
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 21
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 20
- 150000007514 bases Chemical class 0.000 description 20
- 238000001816 cooling Methods 0.000 description 19
- 150000002170 ethers Chemical class 0.000 description 19
- 239000005457 ice water Substances 0.000 description 19
- 239000011734 sodium Substances 0.000 description 19
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 18
- 238000010898 silica gel chromatography Methods 0.000 description 18
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 18
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 17
- 229960000583 acetic acid Drugs 0.000 description 17
- 150000001298 alcohols Chemical class 0.000 description 17
- 238000001914 filtration Methods 0.000 description 16
- 229910000027 potassium carbonate Inorganic materials 0.000 description 16
- 235000011181 potassium carbonates Nutrition 0.000 description 16
- 238000003756 stirring Methods 0.000 description 16
- 150000007513 acids Chemical class 0.000 description 15
- 229960004592 isopropanol Drugs 0.000 description 15
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 14
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 14
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 14
- 239000008096 xylene Substances 0.000 description 14
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 13
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 13
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 12
- CSJLBAMHHLJAAS-UHFFFAOYSA-N diethylaminosulfur trifluoride Chemical compound CCN(CC)S(F)(F)F CSJLBAMHHLJAAS-UHFFFAOYSA-N 0.000 description 12
- 230000002140 halogenating effect Effects 0.000 description 12
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 12
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 12
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 12
- 238000010992 reflux Methods 0.000 description 12
- 239000003054 catalyst Substances 0.000 description 11
- 239000003638 chemical reducing agent Substances 0.000 description 11
- 229960001701 chloroform Drugs 0.000 description 11
- 235000017557 sodium bicarbonate Nutrition 0.000 description 11
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 11
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 10
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 10
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 10
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 10
- 239000002798 polar solvent Substances 0.000 description 10
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 10
- 229910052708 sodium Inorganic materials 0.000 description 10
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 10
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 9
- 239000000706 filtrate Substances 0.000 description 9
- 150000007530 organic bases Chemical class 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- 238000006722 reduction reaction Methods 0.000 description 9
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 8
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 8
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 8
- 239000002585 base Substances 0.000 description 8
- 230000026030 halogenation Effects 0.000 description 8
- 238000005658 halogenation reaction Methods 0.000 description 8
- 239000007924 injection Substances 0.000 description 8
- 238000002347 injection Methods 0.000 description 8
- 239000010410 layer Substances 0.000 description 8
- 239000012280 lithium aluminium hydride Substances 0.000 description 8
- 230000009467 reduction Effects 0.000 description 8
- 229910000029 sodium carbonate Inorganic materials 0.000 description 8
- 235000017550 sodium carbonate Nutrition 0.000 description 8
- 239000003826 tablet Substances 0.000 description 8
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 8
- YLBUIEHYXAVBQZ-UHFFFAOYSA-N 1-cyclopropyl-6-fluoro-8-methyl-4-oxo-7-piperazin-1-ylquinoline-3-carboxylic acid Chemical compound FC1=CC(C(C(C(O)=O)=CN2C3CC3)=O)=C2C(C)=C1N1CCNCC1 YLBUIEHYXAVBQZ-UHFFFAOYSA-N 0.000 description 7
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 7
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 7
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 7
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 7
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 7
- 239000007868 Raney catalyst Substances 0.000 description 7
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 7
- 229910000564 Raney nickel Inorganic materials 0.000 description 7
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 7
- 239000000460 chlorine Substances 0.000 description 7
- 229910052801 chlorine Inorganic materials 0.000 description 7
- 235000019253 formic acid Nutrition 0.000 description 7
- 239000008103 glucose Substances 0.000 description 7
- 229930195733 hydrocarbon Natural products 0.000 description 7
- 150000002430 hydrocarbons Chemical class 0.000 description 7
- 229910052500 inorganic mineral Inorganic materials 0.000 description 7
- 235000010755 mineral Nutrition 0.000 description 7
- 239000011707 mineral Substances 0.000 description 7
- 229910017604 nitric acid Inorganic materials 0.000 description 7
- 239000011591 potassium Substances 0.000 description 7
- 229910052700 potassium Inorganic materials 0.000 description 7
- 235000011118 potassium hydroxide Nutrition 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 7
- 239000012279 sodium borohydride Substances 0.000 description 7
- 229910000033 sodium borohydride Inorganic materials 0.000 description 7
- 239000012312 sodium hydride Substances 0.000 description 7
- 229910000104 sodium hydride Inorganic materials 0.000 description 7
- WATLIFHZDGFZNO-UHFFFAOYSA-N 1-cyclopropyl-6,7-difluoro-8-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound CC1=C(F)C(F)=CC(C(C(C(O)=O)=C2)=O)=C1N2C1CC1 WATLIFHZDGFZNO-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 6
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 6
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 6
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 6
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 6
- 229920002472 Starch Polymers 0.000 description 6
- 235000014655 lactic acid Nutrition 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- 239000000825 pharmaceutical preparation Substances 0.000 description 6
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 6
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 6
- 229920006395 saturated elastomer Polymers 0.000 description 6
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 6
- 239000008107 starch Substances 0.000 description 6
- 235000019698 starch Nutrition 0.000 description 6
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 5
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 5
- 239000004599 antimicrobial Substances 0.000 description 5
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 5
- 238000010531 catalytic reduction reaction Methods 0.000 description 5
- 239000012230 colorless oil Substances 0.000 description 5
- 229910052802 copper Inorganic materials 0.000 description 5
- 239000010949 copper Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 5
- 229940052308 general anesthetics halogenated hydrocarbons Drugs 0.000 description 5
- 150000008282 halocarbons Chemical class 0.000 description 5
- 150000007529 inorganic bases Chemical class 0.000 description 5
- 239000004310 lactic acid Substances 0.000 description 5
- 239000011777 magnesium Substances 0.000 description 5
- 229910052749 magnesium Inorganic materials 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 235000019198 oils Nutrition 0.000 description 5
- 150000007524 organic acids Chemical class 0.000 description 5
- 239000012044 organic layer Substances 0.000 description 5
- 239000011698 potassium fluoride Substances 0.000 description 5
- 235000003270 potassium fluoride Nutrition 0.000 description 5
- 239000011780 sodium chloride Substances 0.000 description 5
- 235000010288 sodium nitrite Nutrition 0.000 description 5
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Substances C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 5
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 4
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 4
- 208000035473 Communicable disease Diseases 0.000 description 4
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 4
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 4
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 4
- 108010010803 Gelatin Proteins 0.000 description 4
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 4
- 239000013522 chelant Substances 0.000 description 4
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 4
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 4
- 238000006477 desulfuration reaction Methods 0.000 description 4
- 230000023556 desulfurization Effects 0.000 description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 4
- 201000010099 disease Diseases 0.000 description 4
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 4
- LJQKCYFTNDAAPC-UHFFFAOYSA-N ethanol;ethyl acetate Chemical compound CCO.CCOC(C)=O LJQKCYFTNDAAPC-UHFFFAOYSA-N 0.000 description 4
- 239000008273 gelatin Substances 0.000 description 4
- 229920000159 gelatin Polymers 0.000 description 4
- 235000019322 gelatine Nutrition 0.000 description 4
- 235000011852 gelatine desserts Nutrition 0.000 description 4
- 238000005984 hydrogenation reaction Methods 0.000 description 4
- 239000008101 lactose Substances 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 229910001507 metal halide Inorganic materials 0.000 description 4
- 150000005309 metal halides Chemical class 0.000 description 4
- 238000006396 nitration reaction Methods 0.000 description 4
- 125000004193 piperazinyl group Chemical group 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 description 3
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 3
- WNWHHMBRJJOGFJ-UHFFFAOYSA-N 16-methylheptadecan-1-ol Chemical class CC(C)CCCCCCCCCCCCCCCO WNWHHMBRJJOGFJ-UHFFFAOYSA-N 0.000 description 3
- MEKOFIRRDATTAG-UHFFFAOYSA-N 2,2,5,8-tetramethyl-3,4-dihydrochromen-6-ol Chemical compound C1CC(C)(C)OC2=C1C(C)=C(O)C=C2C MEKOFIRRDATTAG-UHFFFAOYSA-N 0.000 description 3
- KOMUAHNBARRVKH-UHFFFAOYSA-N 4-chloro-1,2-difluoro-3-methyl-5-nitrobenzene Chemical compound CC1=C(F)C(F)=CC([N+]([O-])=O)=C1Cl KOMUAHNBARRVKH-UHFFFAOYSA-N 0.000 description 3
- XJFMKFDCUGPJAU-UHFFFAOYSA-N 6-bromo-3,4-difluoro-2-(methylsulfanylmethyl)aniline Chemical compound CSCC1=C(N)C(Br)=CC(F)=C1F XJFMKFDCUGPJAU-UHFFFAOYSA-N 0.000 description 3
- 229920001817 Agar Polymers 0.000 description 3
- 239000005995 Aluminium silicate Substances 0.000 description 3
- 241000894006 Bacteria Species 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 239000002202 Polyethylene glycol Substances 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 241000191940 Staphylococcus Species 0.000 description 3
- 150000008065 acid anhydrides Chemical class 0.000 description 3
- 230000009471 action Effects 0.000 description 3
- 239000008272 agar Substances 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 235000012211 aluminium silicate Nutrition 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- 229910000019 calcium carbonate Inorganic materials 0.000 description 3
- 125000001589 carboacyl group Chemical group 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 210000004027 cell Anatomy 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- GKIRPKYJQBWNGO-OCEACIFDSA-N clomifene Chemical compound C1=CC(OCCN(CC)CC)=CC=C1C(\C=1C=CC=CC=1)=C(\Cl)C1=CC=CC=C1 GKIRPKYJQBWNGO-OCEACIFDSA-N 0.000 description 3
- 239000011248 coating agent Substances 0.000 description 3
- 229940110456 cocoa butter Drugs 0.000 description 3
- 235000019868 cocoa butter Nutrition 0.000 description 3
- 239000007884 disintegrant Substances 0.000 description 3
- SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 3
- KGLWOERAWLUGDL-UHFFFAOYSA-N ethyl 1-cyclopropyl-6-fluoro-8-(hydroxymethyl)-7-morpholin-4-yl-4-oxoquinoline-3-carboxylate Chemical compound C12=C(CO)C(N3CCOCC3)=C(F)C=C2C(=O)C(C(=O)OCC)=CN1C1CC1 KGLWOERAWLUGDL-UHFFFAOYSA-N 0.000 description 3
- UREBWPXBXRYXRJ-UHFFFAOYSA-N ethyl acetate;methanol Chemical compound OC.CCOC(C)=O UREBWPXBXRYXRJ-UHFFFAOYSA-N 0.000 description 3
- 229940093915 gynecological organic acid Drugs 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 3
- 229960000829 kaolin Drugs 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 229940032007 methylethyl ketone Drugs 0.000 description 3
- 244000005700 microbiome Species 0.000 description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 235000005985 organic acids Nutrition 0.000 description 3
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 3
- 239000006187 pill Substances 0.000 description 3
- 125000003386 piperidinyl group Chemical group 0.000 description 3
- 229920001223 polyethylene glycol Polymers 0.000 description 3
- 239000011736 potassium bicarbonate Substances 0.000 description 3
- 235000015497 potassium bicarbonate Nutrition 0.000 description 3
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 3
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 3
- 239000004323 potassium nitrate Substances 0.000 description 3
- 235000010333 potassium nitrate Nutrition 0.000 description 3
- 230000004044 response Effects 0.000 description 3
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 3
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 3
- 241000894007 species Species 0.000 description 3
- QRMKWVNXYORDRU-UHFFFAOYSA-N tert-butyl n-(1-benzyl-4-methylpyrrolidin-3-yl)carbamate Chemical compound C1C(NC(=O)OC(C)(C)C)C(C)CN1CC1=CC=CC=C1 QRMKWVNXYORDRU-UHFFFAOYSA-N 0.000 description 3
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 3
- 239000003871 white petrolatum Substances 0.000 description 3
- WPZLVEJZLVCCJE-UHFFFAOYSA-N (2,3,6-trifluoro-5-nitrophenyl)methanol Chemical compound OCC1=C(F)C(F)=CC([N+]([O-])=O)=C1F WPZLVEJZLVCCJE-UHFFFAOYSA-N 0.000 description 2
- DWOWBLURUYIVOU-UHFFFAOYSA-N (2,3,6-trifluorophenyl)methanol Chemical compound OCC1=C(F)C=CC(F)=C1F DWOWBLURUYIVOU-UHFFFAOYSA-N 0.000 description 2
- DBTMGCOVALSLOR-DEVYUCJPSA-N (2s,3r,4s,5r,6r)-4-[(2s,3r,4s,5r,6r)-3,5-dihydroxy-6-(hydroxymethyl)-4-[(2s,3r,4s,5s,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-6-(hydroxymethyl)oxane-2,3,5-triol Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](O)[C@H](O[C@H]2[C@@H]([C@@H](CO)O[C@H](O)[C@@H]2O)O)O[C@H](CO)[C@H]1O DBTMGCOVALSLOR-DEVYUCJPSA-N 0.000 description 2
- FTTATHOUSOIFOQ-UHFFFAOYSA-N 1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine Chemical compound C1NCCN2CCCC21 FTTATHOUSOIFOQ-UHFFFAOYSA-N 0.000 description 2
- OGFAWKRXZLGJSK-UHFFFAOYSA-N 1-(2,4-dihydroxyphenyl)-2-(4-nitrophenyl)ethanone Chemical compound OC1=CC(O)=CC=C1C(=O)CC1=CC=C([N+]([O-])=O)C=C1 OGFAWKRXZLGJSK-UHFFFAOYSA-N 0.000 description 2
- IYXMNQZTTVPLEW-UHFFFAOYSA-N 1-(2-ethyl-3,6-difluoro-4-nitrophenyl)-4-methylpiperazine Chemical compound CCC1=C(F)C([N+]([O-])=O)=CC(F)=C1N1CCN(C)CC1 IYXMNQZTTVPLEW-UHFFFAOYSA-N 0.000 description 2
- BMAKPKLFHZENQL-UHFFFAOYSA-N 1-(3-chloro-6-fluoro-2-methyl-4-nitrophenyl)-4-methylpiperazine Chemical compound C1CN(C)CCN1C1=C(C)C(Cl)=C([N+]([O-])=O)C=C1F BMAKPKLFHZENQL-UHFFFAOYSA-N 0.000 description 2
- ZQDOMDSNFDESCG-UHFFFAOYSA-N 1-cyclopropyl-6-fluoro-7-(4-hydroxypiperidin-1-yl)-8-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=CC(C(C(C(O)=O)=CN2C3CC3)=O)=C2C(C)=C1N1CCC(O)CC1 ZQDOMDSNFDESCG-UHFFFAOYSA-N 0.000 description 2
- YGMAVEFFQNOCIO-UHFFFAOYSA-N 1-cyclopropyl-6-fluoro-8-methyl-4-oxo-7-(4-oxopiperidin-1-yl)quinoline-3-carboxylic acid Chemical compound FC1=CC(C(C(C(O)=O)=CN2C3CC3)=O)=C2C(C)=C1N1CCC(=O)CC1 YGMAVEFFQNOCIO-UHFFFAOYSA-N 0.000 description 2
- ZSEJADLCFCHIGX-UHFFFAOYSA-N 1-ethyl-4-oxoquinoline-3-carboxylic acid Chemical compound C1=CC=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 ZSEJADLCFCHIGX-UHFFFAOYSA-N 0.000 description 2
- QYEARBVAXUPCMX-UHFFFAOYSA-N 2,3,6-trifluoro-5-nitrobenzoic acid Chemical compound OC(=O)C1=C(F)C(F)=CC([N+]([O-])=O)=C1F QYEARBVAXUPCMX-UHFFFAOYSA-N 0.000 description 2
- MGUPHQGQNHDGNK-UHFFFAOYSA-N 2,3,6-trifluorobenzoic acid Chemical compound OC(=O)C1=C(F)C=CC(F)=C1F MGUPHQGQNHDGNK-UHFFFAOYSA-N 0.000 description 2
- QRAZASHLGLHKEB-UHFFFAOYSA-N 2-(2,3,6-trifluorophenyl)acetic acid Chemical compound OC(=O)CC1=C(F)C=CC(F)=C1F QRAZASHLGLHKEB-UHFFFAOYSA-N 0.000 description 2
- PQIFHBOOYBTJLD-UHFFFAOYSA-N 2-(2,3,6-trifluorophenyl)acetonitrile Chemical compound FC1=CC=C(F)C(CC#N)=C1F PQIFHBOOYBTJLD-UHFFFAOYSA-N 0.000 description 2
- FCUGMGBBCZGVAM-UHFFFAOYSA-N 2-(2,3,6-trifluorophenyl)ethyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OCCC1=C(F)C=CC(F)=C1F FCUGMGBBCZGVAM-UHFFFAOYSA-N 0.000 description 2
- UTBZSKCFFUFLEA-UHFFFAOYSA-N 2-amino-4,5-difluoro-3-(methylsulfanylmethyl)benzonitrile Chemical compound CSCC1=C(N)C(C#N)=CC(F)=C1F UTBZSKCFFUFLEA-UHFFFAOYSA-N 0.000 description 2
- NRMNKEKAAAVREC-UHFFFAOYSA-N 2-amino-4,5-difluoro-3-methylbenzonitrile Chemical compound CC1=C(N)C(C#N)=CC(F)=C1F NRMNKEKAAAVREC-UHFFFAOYSA-N 0.000 description 2
- FOCRJRKFQBRTPZ-UHFFFAOYSA-N 2-chloro-4,5-difluoro-3-methylbenzoic acid Chemical compound CC1=C(F)C(F)=CC(C(O)=O)=C1Cl FOCRJRKFQBRTPZ-UHFFFAOYSA-N 0.000 description 2
- VCEMHEWDNONLGD-UHFFFAOYSA-N 2-chloro-4,5-difluoro-3-methylbenzoyl chloride Chemical compound CC1=C(F)C(F)=CC(C(Cl)=O)=C1Cl VCEMHEWDNONLGD-UHFFFAOYSA-N 0.000 description 2
- BRKMUYFGBWFQSD-UHFFFAOYSA-N 2-ethyl-1,3,4-trifluorobenzene Chemical compound CCC1=C(F)C=CC(F)=C1F BRKMUYFGBWFQSD-UHFFFAOYSA-N 0.000 description 2
- XJAHORJCHQYGOY-UHFFFAOYSA-N 3,4-difluoro-2-(methylsulfanylmethyl)-6-nitroaniline Chemical compound CSCC1=C(N)C([N+]([O-])=O)=CC(F)=C1F XJAHORJCHQYGOY-UHFFFAOYSA-N 0.000 description 2
- LWFRQMHPGYHOFI-UHFFFAOYSA-N 3,4-difluoro-2-methyl-6-nitroaniline Chemical compound CC1=C(N)C([N+]([O-])=O)=CC(F)=C1F LWFRQMHPGYHOFI-UHFFFAOYSA-N 0.000 description 2
- HYODOAMUBRENLA-UHFFFAOYSA-N 3,4-difluoro-2-methylaniline Chemical compound CC1=C(N)C=CC(F)=C1F HYODOAMUBRENLA-UHFFFAOYSA-N 0.000 description 2
- ZAASFUFLSAKEFR-UHFFFAOYSA-N 3-ethyl-1,2,4-trifluoro-5-nitrobenzene Chemical compound CCC1=C(F)C(F)=CC([N+]([O-])=O)=C1F ZAASFUFLSAKEFR-UHFFFAOYSA-N 0.000 description 2
- WDMCABATCGQAKK-UHFFFAOYSA-N 4,5-difluoro-2-nitroaniline Chemical compound NC1=CC(F)=C(F)C=C1[N+]([O-])=O WDMCABATCGQAKK-UHFFFAOYSA-N 0.000 description 2
- SGDDSFKEZSVYRP-UHFFFAOYSA-N 4-methyl-N-[(2-methylpropan-2-yl)oxy]pyrrolidin-3-amine Chemical compound C(C)(C)(C)ONC1CNCC1C SGDDSFKEZSVYRP-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- SLMMMRSCBXVPQS-UHFFFAOYSA-N 7-(3-amino-4-methylpyrrolidin-1-yl)-1-cyclopropyl-6-fluoro-8-methyl-4-oxoquinoline-3-carboxylic acid;hydrochloride Chemical compound Cl.C1C(N)C(C)CN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1C SLMMMRSCBXVPQS-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 2
- 229920002261 Corn starch Polymers 0.000 description 2
- 241000194032 Enterococcus faecalis Species 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 244000292411 Excoecaria agallocha Species 0.000 description 2
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 2
- 239000005717 Laminarin Substances 0.000 description 2
- 229920001543 Laminarin Polymers 0.000 description 2
- 239000004166 Lanolin Substances 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 2
- 241001024304 Mino Species 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 2
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical compound O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 2
- GEYBMYRBIABFTA-UHFFFAOYSA-N O-methyltyrosine Chemical compound COC1=CC=C(CC(N)C(O)=O)C=C1 GEYBMYRBIABFTA-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- 239000004280 Sodium formate Substances 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- 235000011941 Tilia x europaea Nutrition 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- UXKZFJDNFBNQHE-RITPCOANSA-N [(1s,4r)-4-aminocyclopent-2-en-1-yl]methanol Chemical compound N[C@@H]1C[C@H](CO)C=C1 UXKZFJDNFBNQHE-RITPCOANSA-N 0.000 description 2
- 239000003377 acid catalyst Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 150000001448 anilines Chemical class 0.000 description 2
- 230000000844 anti-bacterial effect Effects 0.000 description 2
- 235000013871 bee wax Nutrition 0.000 description 2
- 239000012166 beeswax Substances 0.000 description 2
- 239000000440 bentonite Substances 0.000 description 2
- 229910000278 bentonite Inorganic materials 0.000 description 2
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- PBCANFHOOFRAJM-UHFFFAOYSA-N benzyl n-(2,2-dichlorocyclopropyl)carbamate Chemical compound ClC1(Cl)CC1NC(=O)OCC1=CC=CC=C1 PBCANFHOOFRAJM-UHFFFAOYSA-N 0.000 description 2
- VBICKXHEKHSIBG-UHFFFAOYSA-N beta-monoglyceryl stearate Natural products CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 2
- 210000001124 body fluid Anatomy 0.000 description 2
- 239000010839 body fluid Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000004359 castor oil Substances 0.000 description 2
- 235000019438 castor oil Nutrition 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 235000010980 cellulose Nutrition 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- PGQRQZKSXBTFRH-UHFFFAOYSA-N chloroform ethanol Chemical compound C(C)O.C(C)O.C(C)O.C(Cl)(Cl)Cl.C(C)O PGQRQZKSXBTFRH-UHFFFAOYSA-N 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 2
- 239000008120 corn starch Substances 0.000 description 2
- 229940099112 cornstarch Drugs 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 239000012954 diazonium Substances 0.000 description 2
- 150000001989 diazonium salts Chemical class 0.000 description 2
- NPOMSUOUAZCMBL-UHFFFAOYSA-N dichloromethane;ethoxyethane Chemical compound ClCCl.CCOCC NPOMSUOUAZCMBL-UHFFFAOYSA-N 0.000 description 2
- RRTKXFRDLZMSPC-UHFFFAOYSA-N diethyl 2-(2-chloro-4,5-difluoro-3-methylbenzoyl)propanedioate Chemical compound CCOC(=O)C(C(=O)OCC)C(=O)C1=CC(F)=C(F)C(C)=C1Cl RRTKXFRDLZMSPC-UHFFFAOYSA-N 0.000 description 2
- ACAJPOAALYJZQP-UHFFFAOYSA-N diethyl 2-[[n-cyclopropyl-3-(4-ethoxycarbonylpiperazin-1-yl)-4-fluoro-2-methyl-6-nitroanilino]methylidene]propanedioate Chemical compound C1CN(C(=O)OCC)CCN1C1=C(F)C=C([N+]([O-])=O)C(N(C=C(C(=O)OCC)C(=O)OCC)C2CC2)=C1C ACAJPOAALYJZQP-UHFFFAOYSA-N 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- WFPZPJSADLPSON-UHFFFAOYSA-N dinitrogen tetraoxide Chemical compound [O-][N+](=O)[N+]([O-])=O WFPZPJSADLPSON-UHFFFAOYSA-N 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 229940032049 enterococcus faecalis Drugs 0.000 description 2
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 2
- DGGVXYONARNLOA-UHFFFAOYSA-N ethyl 1-cyclopropyl-6,7-difluoro-8-methyl-4-oxoquinoline-3-carboxylate Chemical compound C12=C(C)C(F)=C(F)C=C2C(=O)C(C(=O)OCC)=CN1C1CC1 DGGVXYONARNLOA-UHFFFAOYSA-N 0.000 description 2
- PZHKLKSPMNFVMN-UHFFFAOYSA-N ethyl 2-(2,3,6-trifluorophenyl)acetate Chemical compound CCOC(=O)CC1=C(F)C=CC(F)=C1F PZHKLKSPMNFVMN-UHFFFAOYSA-N 0.000 description 2
- LWGPYPTWLDONNX-UHFFFAOYSA-N ethyl 3-(2-chloro-4,5-difluoro-3-methylphenyl)-3-oxopropanoate Chemical compound CCOC(=O)CC(=O)C1=CC(F)=C(F)C(C)=C1Cl LWGPYPTWLDONNX-UHFFFAOYSA-N 0.000 description 2
- ATQVEXGTZVVKJV-UHFFFAOYSA-N ethyl 4-(3,6-difluoro-2-methyl-4-nitrophenyl)piperazine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCN1C1=C(F)C=C([N+]([O-])=O)C(F)=C1C ATQVEXGTZVVKJV-UHFFFAOYSA-N 0.000 description 2
- MZIBUSFSAWDJQD-UHFFFAOYSA-N ethyl 4-[2-(chloromethyl)-3,6-difluoro-4-nitrophenyl]piperazine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCN1C1=C(F)C=C([N+]([O-])=O)C(F)=C1CCl MZIBUSFSAWDJQD-UHFFFAOYSA-N 0.000 description 2
- AAMGCQXRBIDDAV-UHFFFAOYSA-N ethyl 4-[3-(cyclopropylamino)-6-fluoro-2-methyl-4-nitrophenyl]piperazine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCN1C1=C(C)C(NC2CC2)=C([N+]([O-])=O)C=C1F AAMGCQXRBIDDAV-UHFFFAOYSA-N 0.000 description 2
- YBEOYBKKSWUSBR-UHFFFAOYSA-N ethyl 4-oxo-1h-quinoline-3-carboxylate Chemical compound C1=CC=C2C(=O)C(C(=O)OCC)=CNC2=C1 YBEOYBKKSWUSBR-UHFFFAOYSA-N 0.000 description 2
- SBELZMDYRLGMIF-UHFFFAOYSA-N ethyl 6,7-difluoro-1-(2-fluorocyclopropyl)-4-oxoquinoline-3-carboxylate Chemical compound C12=CC(F)=C(F)C=C2C(=O)C(C(=O)OCC)=CN1C1CC1F SBELZMDYRLGMIF-UHFFFAOYSA-N 0.000 description 2
- YOBKNZNTLWMYCH-UHFFFAOYSA-N ethyl 8-(acetyloxymethyl)-1-cyclopropyl-6-fluoro-7-morpholin-4-yl-4-oxoquinoline-3-carboxylate Chemical compound C12=C(COC(C)=O)C(N3CCOCC3)=C(F)C=C2C(=O)C(C(=O)OCC)=CN1C1CC1 YOBKNZNTLWMYCH-UHFFFAOYSA-N 0.000 description 2
- ONZQVPFHQMWEOB-UHFFFAOYSA-N ethyl 8-(acetyloxymethyl)-1-cyclopropyl-7-(4-ethoxycarbonylpiperazin-1-yl)-6-fluoro-4-oxoquinoline-3-carboxylate Chemical compound C1CN(C(=O)OCC)CCN1C1=C(F)C=C2C(=O)C(C(=O)OCC)=CN(C3CC3)C2=C1COC(C)=O ONZQVPFHQMWEOB-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 230000002650 habitual effect Effects 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000012433 hydrogen halide Substances 0.000 description 2
- 229910000039 hydrogen halide Inorganic materials 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 229910052806 inorganic carbonate Inorganic materials 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- PHTQWCKDNZKARW-UHFFFAOYSA-N isoamylol Chemical compound CC(C)CCO PHTQWCKDNZKARW-UHFFFAOYSA-N 0.000 description 2
- 235000019388 lanolin Nutrition 0.000 description 2
- 229940039717 lanolin Drugs 0.000 description 2
- 239000004571 lime Substances 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 229940098779 methanesulfonic acid Drugs 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- GVWISOJSERXQBM-UHFFFAOYSA-N n-methylpropan-1-amine Chemical compound CCCNC GVWISOJSERXQBM-UHFFFAOYSA-N 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 231100000989 no adverse effect Toxicity 0.000 description 2
- 239000002674 ointment Substances 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 229940093429 polyethylene glycol 6000 Drugs 0.000 description 2
- 230000001376 precipitating effect Effects 0.000 description 2
- 238000012746 preparative thin layer chromatography Methods 0.000 description 2
- 235000019260 propionic acid Nutrition 0.000 description 2
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- HLBBKKJFGFRGMU-UHFFFAOYSA-M sodium formate Chemical compound [Na+].[O-]C=O HLBBKKJFGFRGMU-UHFFFAOYSA-M 0.000 description 2
- 235000019254 sodium formate Nutrition 0.000 description 2
- 235000009518 sodium iodide Nutrition 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 2
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- BQDWNVSBOSPLOD-UHFFFAOYSA-N 1,2,4-trifluoro-3-methyl-5-nitrobenzene Chemical compound CC1=C(F)C(F)=CC([N+]([O-])=O)=C1F BQDWNVSBOSPLOD-UHFFFAOYSA-N 0.000 description 1
- NQVCXCCXZDLJCQ-UHFFFAOYSA-N 1-(2-chlorocyclopropyl)-6,7-difluoro-4-oxoquinoline-3-carboxylic acid Chemical compound ClC1C(C1)N1C=C(C(C2=CC(=C(C=C12)F)F)=O)C(=O)O NQVCXCCXZDLJCQ-UHFFFAOYSA-N 0.000 description 1
- QTKPMIKIIXLHLO-UHFFFAOYSA-N 1-[3,6-difluoro-2-(methoxymethyl)-4-nitrophenyl]-4-methylpiperazine Chemical compound COCC1=C(F)C([N+]([O-])=O)=CC(F)=C1N1CCN(C)CC1 QTKPMIKIIXLHLO-UHFFFAOYSA-N 0.000 description 1
- JGEODYUVEMNPPY-UHFFFAOYSA-N 1-benzyl-2-methylpiperazine Chemical compound CC1CNCCN1CC1=CC=CC=C1 JGEODYUVEMNPPY-UHFFFAOYSA-N 0.000 description 1
- XBMHYUVQTGXUIR-UHFFFAOYSA-N 1-benzyl-4-(3,6-difluoro-2-methyl-4-nitrophenyl)-2-methylpiperazine Chemical compound CC1CN(C=2C(=C(F)C(=CC=2F)[N+]([O-])=O)C)CCN1CC1=CC=CC=C1 XBMHYUVQTGXUIR-UHFFFAOYSA-N 0.000 description 1
- VXKFDPVLWWTLCF-UHFFFAOYSA-N 1-benzyl-4-[2-(chloromethyl)-3,6-difluoro-4-nitrophenyl]-2-methylpiperazine Chemical compound CC1CN(C=2C(=C(F)C(=CC=2F)[N+]([O-])=O)CCl)CCN1CC1=CC=CC=C1 VXKFDPVLWWTLCF-UHFFFAOYSA-N 0.000 description 1
- FAQVXCYMCXHRJY-UHFFFAOYSA-N 1-benzyl-4-[3,6-difluoro-2-(methoxymethyl)-4-nitrophenyl]-2-methylpiperazine Chemical compound COCC1=C(F)C([N+]([O-])=O)=CC(F)=C1N1CC(C)N(CC=2C=CC=CC=2)CC1 FAQVXCYMCXHRJY-UHFFFAOYSA-N 0.000 description 1
- NFZIZQCPMPUVFT-UHFFFAOYSA-N 1-benzyl-4-methylpyrrolidin-3-amine Chemical compound C1C(N)C(C)CN1CC1=CC=CC=C1 NFZIZQCPMPUVFT-UHFFFAOYSA-N 0.000 description 1
- IQXXEPZFOOTTBA-UHFFFAOYSA-N 1-benzylpiperazine Chemical compound C=1C=CC=CC=1CN1CCNCC1 IQXXEPZFOOTTBA-UHFFFAOYSA-N 0.000 description 1
- LKQCRNYORFBFHR-UHFFFAOYSA-N 1-cyclopropyl-4-oxoquinoline-3-carboxylic acid Chemical class C12=CC=CC=C2C(=O)C(C(=O)O)=CN1C1CC1 LKQCRNYORFBFHR-UHFFFAOYSA-N 0.000 description 1
- FJVLCMRRMRCYKL-UHFFFAOYSA-N 1-cyclopropyl-6-fluoro-7-(4-formyl-3-methylpiperazin-1-yl)-8-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound C1CN(C=O)C(C)CN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1C FJVLCMRRMRCYKL-UHFFFAOYSA-N 0.000 description 1
- TWZOTKDYRJQDLD-UHFFFAOYSA-N 1-cyclopropyl-6-fluoro-8-methyl-7-(4-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1CN(C)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1C TWZOTKDYRJQDLD-UHFFFAOYSA-N 0.000 description 1
- ZJAGEZCTDIFVFH-UHFFFAOYSA-N 1-cyclopropyl-7-(3,4-dimethylpiperazin-1-yl)-6-fluoro-8-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound C1CN(C)C(C)CN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1C ZJAGEZCTDIFVFH-UHFFFAOYSA-N 0.000 description 1
- CJLJMVPPOGFXKP-UHFFFAOYSA-N 1-cyclopropyl-7-(4-ethylpiperazin-1-yl)-6-fluoro-8-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound C1CN(CC)CCN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1C CJLJMVPPOGFXKP-UHFFFAOYSA-N 0.000 description 1
- TVCUGJDTFWHTBZ-UHFFFAOYSA-N 1-cyclopropyl-8-ethyl-6-fluoro-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound C1(CC1)N1C=C(C(C2=CC(=C(C(=C12)CC)N1CC(NCC1)C)F)=O)C(=O)O TVCUGJDTFWHTBZ-UHFFFAOYSA-N 0.000 description 1
- VAXMDZNFFSEWDE-UHFFFAOYSA-N 1-cyclopropyl-8-ethyl-6-fluoro-7-(4-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=CC(C(C(C(O)=O)=CN2C3CC3)=O)=C2C(CC)=C1N1CCN(C)CC1 VAXMDZNFFSEWDE-UHFFFAOYSA-N 0.000 description 1
- IVXYJHVKQFVNRQ-UHFFFAOYSA-N 1-diacetylboranylethanone Chemical compound CC(=O)B(C(C)=O)C(C)=O IVXYJHVKQFVNRQ-UHFFFAOYSA-N 0.000 description 1
- SUYBZZRXNMWRIY-UHFFFAOYSA-N 2,2-dichlorocyclopropan-1-amine;hydrochloride Chemical compound Cl.NC1CC1(Cl)Cl SUYBZZRXNMWRIY-UHFFFAOYSA-N 0.000 description 1
- GVGFEJPTKINGLP-UHFFFAOYSA-N 2,2-dichlorocyclopropane-1-carboxylic acid Chemical compound OC(=O)C1CC1(Cl)Cl GVGFEJPTKINGLP-UHFFFAOYSA-N 0.000 description 1
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- BUTIDJREEDINSI-UHFFFAOYSA-N 2-bromo-4,5-difluoroaniline Chemical compound NC1=CC(F)=C(F)C=C1Br BUTIDJREEDINSI-UHFFFAOYSA-N 0.000 description 1
- SQAWXMDHCHHDFJ-UHFFFAOYSA-N 2-chloro-4,5-difluoro-3-methylbenzonitrile Chemical compound CC1=C(F)C(F)=CC(C#N)=C1Cl SQAWXMDHCHHDFJ-UHFFFAOYSA-N 0.000 description 1
- YNMIPSBIQDTEPN-UHFFFAOYSA-N 2-chlorocyclopropan-1-amine;hydrochloride Chemical compound Cl.NC1CC1Cl YNMIPSBIQDTEPN-UHFFFAOYSA-N 0.000 description 1
- DYTNTYHQHKPQEX-UHFFFAOYSA-N 2-fluorocyclopropan-1-amine;hydrochloride Chemical compound Cl.NC1CC1F DYTNTYHQHKPQEX-UHFFFAOYSA-N 0.000 description 1
- MWFMGBPGAXYFAR-UHFFFAOYSA-N 2-hydroxy-2-methylpropanenitrile Chemical compound CC(C)(O)C#N MWFMGBPGAXYFAR-UHFFFAOYSA-N 0.000 description 1
- CZMRCDWAGMRECN-UHFFFAOYSA-N 2-{[3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy}-6-(hydroxymethyl)oxane-3,4,5-triol Chemical compound OCC1OC(CO)(OC2OC(CO)C(O)C(O)C2O)C(O)C1O CZMRCDWAGMRECN-UHFFFAOYSA-N 0.000 description 1
- CCOYZKVNOMMFIR-UHFFFAOYSA-N 3-(4-benzyl-3-methylpiperazin-1-yl)-n-cyclopropyl-4-fluoro-2-(methoxymethyl)-6-nitroaniline Chemical compound [O-][N+](=O)C1=CC(F)=C(N2CC(C)N(CC=3C=CC=CC=3)CC2)C(COC)=C1NC1CC1 CCOYZKVNOMMFIR-UHFFFAOYSA-N 0.000 description 1
- PHXVGYFYZYIQJO-UHFFFAOYSA-N 3-(4-benzyl-3-methylpiperazin-1-yl)-n-cyclopropyl-4-fluoro-2-methyl-6-nitroaniline Chemical compound CC1CN(C=2C(=C(NC3CC3)C(=CC=2F)[N+]([O-])=O)C)CCN1CC1=CC=CC=C1 PHXVGYFYZYIQJO-UHFFFAOYSA-N 0.000 description 1
- WSGYTJNNHPZFKR-UHFFFAOYSA-N 3-hydroxypropanenitrile Chemical compound OCCC#N WSGYTJNNHPZFKR-UHFFFAOYSA-N 0.000 description 1
- ACQZZWXJIMLDIE-UHFFFAOYSA-N 4-(3,6-difluoro-2-methyl-4-nitrophenyl)morpholine Chemical compound CC1=C(F)C([N+]([O-])=O)=CC(F)=C1N1CCOCC1 ACQZZWXJIMLDIE-UHFFFAOYSA-N 0.000 description 1
- TZJCZCSYKYEMOE-UHFFFAOYSA-N 4-[2-(chloromethyl)-3,6-difluoro-4-nitrophenyl]morpholine Chemical compound ClCC1=C(F)C([N+](=O)[O-])=CC(F)=C1N1CCOCC1 TZJCZCSYKYEMOE-UHFFFAOYSA-N 0.000 description 1
- KTAGZAVZGCOWCK-UHFFFAOYSA-N 4-[3,6-difluoro-2-(methoxymethyl)-4-nitrophenyl]morpholine Chemical compound COCC1=C(F)C([N+]([O-])=O)=CC(F)=C1N1CCOCC1 KTAGZAVZGCOWCK-UHFFFAOYSA-N 0.000 description 1
- SVFCSNYSCGBTOA-UHFFFAOYSA-N 4-chloro-1,2-difluoro-3-methylsulfanyl-5-nitrobenzene Chemical compound CSC1=C(F)C(F)=CC([N+]([O-])=O)=C1Cl SVFCSNYSCGBTOA-UHFFFAOYSA-N 0.000 description 1
- PUGDHSSOXPHLPT-UHFFFAOYSA-N 4-fluoro-2-nitroaniline Chemical compound NC1=CC=C(F)C=C1[N+]([O-])=O PUGDHSSOXPHLPT-UHFFFAOYSA-N 0.000 description 1
- ILNJBIQQAIIMEY-UHFFFAOYSA-N 4-oxo-1h-quinoline-3-carboxylic acid Chemical class C1=CC=CC2=C(O)C(C(=O)O)=CN=C21 ILNJBIQQAIIMEY-UHFFFAOYSA-N 0.000 description 1
- TVOYMYXRLULSCE-UHFFFAOYSA-N 6,7-difluoro-1-(2-fluorocyclopropyl)-4-oxoquinoline-3-carboxylic acid Chemical compound C12=CC(F)=C(F)C=C2C(=O)C(C(=O)O)=CN1C1CC1F TVOYMYXRLULSCE-UHFFFAOYSA-N 0.000 description 1
- IDGBOHBRMINNEA-UHFFFAOYSA-N 6,7-difluoro-1-(2-methylcyclopropyl)-4-oxoquinoline-3-carboxylic acid Chemical compound CC1C(C1)N1C=C(C(C2=CC(=C(C=C12)F)F)=O)C(=O)O IDGBOHBRMINNEA-UHFFFAOYSA-N 0.000 description 1
- FHVDTGUDJYJELY-UHFFFAOYSA-N 6-{[2-carboxy-4,5-dihydroxy-6-(phosphanyloxy)oxan-3-yl]oxy}-4,5-dihydroxy-3-phosphanyloxane-2-carboxylic acid Chemical compound O1C(C(O)=O)C(P)C(O)C(O)C1OC1C(C(O)=O)OC(OP)C(O)C1O FHVDTGUDJYJELY-UHFFFAOYSA-N 0.000 description 1
- YKWTZHWQBCPRQJ-UHFFFAOYSA-N 7-(3,4,6,7,8,8a-hexahydro-1h-pyrrolo[1,2-a]pyrazin-2-yl)-1-cyclopropyl-6-fluoro-8-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound CC1=C(N2CC3CCCN3CC2)C(F)=CC(C(C(C(O)=O)=C2)=O)=C1N2C1CC1 YKWTZHWQBCPRQJ-UHFFFAOYSA-N 0.000 description 1
- KKSPDZLVCALKIJ-UHFFFAOYSA-N 7-(3-aminopyrrolidin-1-yl)-1-cyclopropyl-6-fluoro-8-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=CC(C(C(C(O)=O)=CN2C3CC3)=O)=C2C(C)=C1N1CCC(N)C1 KKSPDZLVCALKIJ-UHFFFAOYSA-N 0.000 description 1
- HHMPUQOBQXYHDD-UHFFFAOYSA-N 7-(3-aminopyrrolidin-1-yl)-1-cyclopropyl-8-ethyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=CC(C(C(C(O)=O)=CN2C3CC3)=O)=C2C(CC)=C1N1CCC(N)C1 HHMPUQOBQXYHDD-UHFFFAOYSA-N 0.000 description 1
- WDRIDYJVYVBTHR-UHFFFAOYSA-N 7-(4-acetyl-3-methylpiperazin-1-yl)-1-cyclopropyl-6-fluoro-8-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound C1CN(C(C)=O)C(C)CN1C1=C(F)C=C2C(=O)C(C(O)=O)=CN(C3CC3)C2=C1C WDRIDYJVYVBTHR-UHFFFAOYSA-N 0.000 description 1
- LARKANSQDIEZSJ-UHFFFAOYSA-N 7-(4-benzyl-3-methylpiperazin-1-yl)-1-cyclopropyl-6-fluoro-8-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound CC1CN(C=2C(=C3C(C(C(C(O)=O)=CN3C3CC3)=O)=CC=2F)C)CCN1CC1=CC=CC=C1 LARKANSQDIEZSJ-UHFFFAOYSA-N 0.000 description 1
- JUIJQOQRCBQEAW-UHFFFAOYSA-N 7-(4-benzylpiperazin-1-yl)-1-cyclopropyl-6-fluoro-8-methyl-4-oxoquinoline-3-carboxylic acid Chemical compound FC1=CC(C(C(C(O)=O)=CN2C3CC3)=O)=C2C(C)=C1N(CC1)CCN1CC1=CC=CC=C1 JUIJQOQRCBQEAW-UHFFFAOYSA-N 0.000 description 1
- DMUMFMIUUQCVDX-UHFFFAOYSA-N 7-amino-1-cyclopropyl-2h-quinoline-3-carboxylic acid Chemical class C12=CC(N)=CC=C2C=C(C(O)=O)CN1C1CC1 DMUMFMIUUQCVDX-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- 241000251468 Actinopterygii Species 0.000 description 1
- 229910000761 Aluminium amalgam Inorganic materials 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 241000272517 Anseriformes Species 0.000 description 1
- 241000490494 Arabis Species 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- 241000606124 Bacteroides fragilis Species 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 1
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 1
- 241000186427 Cutibacterium acnes Species 0.000 description 1
- 241000062613 Cutibacterium granulosum DSM 20700 Species 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 241000186398 Eubacterium limosum Species 0.000 description 1
- 241000192125 Firmicutes Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 101100134929 Gallus gallus COR9 gene Proteins 0.000 description 1
- DCXXMTOCNZCJGO-UHFFFAOYSA-N Glycerol trioctadecanoate Natural products CCCCCCCCCCCCCCCCCC(=O)OCC(OC(=O)CCCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCC DCXXMTOCNZCJGO-UHFFFAOYSA-N 0.000 description 1
- 241001026509 Kata Species 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- OKIZCWYLBDKLSU-UHFFFAOYSA-M N,N,N-Trimethylmethanaminium chloride Chemical compound [Cl-].C[N+](C)(C)C OKIZCWYLBDKLSU-UHFFFAOYSA-M 0.000 description 1
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 1
- KQNCUENBPACEHJ-UHFFFAOYSA-N N-[[1-[2-(chloromethyl)-3,6-difluoro-4-(nitromethyl)phenyl]pyrrolidin-3-yl]methyl]acetamide Chemical compound FC1=C(C[N+](=O)[O-])C=C(C(=C1CCl)N1CC(CC1)CNC(C)=O)F KQNCUENBPACEHJ-UHFFFAOYSA-N 0.000 description 1
- UZRXBRDLQIJZPW-UHFFFAOYSA-N N-benzyl-1-[2-(chloromethyl)-3,6-difluoro-4-(nitromethyl)phenyl]-N-methylpyrrolidin-3-amine Chemical compound FC1=C(C[N+](=O)[O-])C=C(C(=C1CCl)N1CC(CC1)N(CC1=CC=CC=C1)C)F UZRXBRDLQIJZPW-UHFFFAOYSA-N 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 241000206591 Peptococcus Species 0.000 description 1
- 229920001214 Polysorbate 60 Polymers 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 1
- 241000085494 Pseudomonas aeruginosa E2 Species 0.000 description 1
- 229920001800 Shellac Polymers 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 239000005708 Sodium hypochlorite Substances 0.000 description 1
- 241000191967 Staphylococcus aureus Species 0.000 description 1
- 241000193996 Streptococcus pyogenes Species 0.000 description 1
- 241000287181 Sturnus vulgaris Species 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 244000104547 Ziziphus oenoplia Species 0.000 description 1
- 235000005505 Ziziphus oenoplia Nutrition 0.000 description 1
- AZFNGPAYDKGCRB-XCPIVNJJSA-M [(1s,2s)-2-amino-1,2-diphenylethyl]-(4-methylphenyl)sulfonylazanide;chlororuthenium(1+);1-methyl-4-propan-2-ylbenzene Chemical compound [Ru+]Cl.CC(C)C1=CC=C(C)C=C1.C1=CC(C)=CC=C1S(=O)(=O)[N-][C@@H](C=1C=CC=CC=1)[C@@H](N)C1=CC=CC=C1 AZFNGPAYDKGCRB-XCPIVNJJSA-M 0.000 description 1
- YSVZGWAJIHWNQK-UHFFFAOYSA-N [3-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]methanol Chemical compound C1CC2C(CO)C(CO)C1C2 YSVZGWAJIHWNQK-UHFFFAOYSA-N 0.000 description 1
- SYOIWFNFUFXXMV-UHFFFAOYSA-N [Br].Cl Chemical compound [Br].Cl SYOIWFNFUFXXMV-UHFFFAOYSA-N 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 230000009102 absorption Effects 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 229940072056 alginate Drugs 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 1
- 229910001963 alkali metal nitrate Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 125000006295 amino methylene group Chemical group [H]N(*)C([H])([H])* 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- JPNZKPRONVOMLL-UHFFFAOYSA-N azane;octadecanoic acid Chemical class [NH4+].CCCCCCCCCCCCCCCCCC([O-])=O JPNZKPRONVOMLL-UHFFFAOYSA-N 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- BBXKXMCAYZORIZ-UHFFFAOYSA-N benzyl N-(2-chlorocyclopropyl)carbamate Chemical compound ClC1C(C1)NC(=O)OCC1=CC=CC=C1 BBXKXMCAYZORIZ-UHFFFAOYSA-N 0.000 description 1
- XKIFNDSUUQVBIM-UHFFFAOYSA-N benzyl N-(2-fluorocyclopropyl)carbamate Chemical compound FC1C(C1)NC(=O)OCC1=CC=CC=C1 XKIFNDSUUQVBIM-UHFFFAOYSA-N 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- MOOAHMCRPCTRLV-UHFFFAOYSA-N boron sodium Chemical compound [B].[Na] MOOAHMCRPCTRLV-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 229960001777 castor oil Drugs 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 239000008119 colloidal silica Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000012050 conventional carrier Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- NKNDPYCGAZPOFS-UHFFFAOYSA-M copper(i) bromide Chemical compound Br[Cu] NKNDPYCGAZPOFS-UHFFFAOYSA-M 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- GBRBMTNGQBKBQE-UHFFFAOYSA-L copper;diiodide Chemical compound I[Cu]I GBRBMTNGQBKBQE-UHFFFAOYSA-L 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 229940045803 cuprous chloride Drugs 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- SIIJRCRHAIMFNT-UHFFFAOYSA-N cyclopropanamine;hydrochloride Chemical compound Cl.NC1CC1 SIIJRCRHAIMFNT-UHFFFAOYSA-N 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 239000000645 desinfectant Substances 0.000 description 1
- SPWVRYZQLGQKGK-UHFFFAOYSA-N dichloromethane;hexane Chemical compound ClCCl.CCCCCC SPWVRYZQLGQKGK-UHFFFAOYSA-N 0.000 description 1
- WGLUMOCWFMKWIL-UHFFFAOYSA-N dichloromethane;methanol Chemical compound OC.ClCCl WGLUMOCWFMKWIL-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- LTMHNWPUDSTBKD-UHFFFAOYSA-N diethyl 2-(ethoxymethylidene)propanedioate Chemical compound CCOC=C(C(=O)OCC)C(=O)OCC LTMHNWPUDSTBKD-UHFFFAOYSA-N 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 229960004704 dihydroergotamine Drugs 0.000 description 1
- 238000003113 dilution method Methods 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- FPAFDBFIGPHWGO-UHFFFAOYSA-N dioxosilane;oxomagnesium;hydrate Chemical compound O.[Mg]=O.[Mg]=O.[Mg]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O FPAFDBFIGPHWGO-UHFFFAOYSA-N 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 238000009505 enteric coating Methods 0.000 description 1
- 239000002702 enteric coating Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 1
- DQYBDCGIPTYXML-UHFFFAOYSA-N ethoxyethane;hydrate Chemical compound O.CCOCC DQYBDCGIPTYXML-UHFFFAOYSA-N 0.000 description 1
- KLKFAASOGCDTDT-UHFFFAOYSA-N ethoxymethoxyethane Chemical compound CCOCOCC KLKFAASOGCDTDT-UHFFFAOYSA-N 0.000 description 1
- DXPFJFBNGSCLQG-UHFFFAOYSA-N ethyl 1-(2-chlorocyclopropyl)-6,7-difluoro-4-oxoquinoline-3-carboxylate Chemical compound ClC1C(C1)N1C=C(C(C2=CC(=C(C=C12)F)F)=O)C(=O)OCC DXPFJFBNGSCLQG-UHFFFAOYSA-N 0.000 description 1
- YVYYHQYNLFYAPY-UHFFFAOYSA-N ethyl 1-cyclopropyl-6-fluoro-7-(4-methylpiperazin-1-yl)-8-(methylsulfanylmethyl)-4-oxoquinoline-3-carboxylate Chemical compound C12=C(CSC)C(N3CCN(C)CC3)=C(F)C=C2C(=O)C(C(=O)OCC)=CN1C1CC1 YVYYHQYNLFYAPY-UHFFFAOYSA-N 0.000 description 1
- MPAQYMTZVOUHTQ-UHFFFAOYSA-N ethyl 1-cyclopropyl-6-fluoro-8-(hydroxymethyl)-7-(4-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylate Chemical compound C12=C(CO)C(N3CCN(C)CC3)=C(F)C=C2C(=O)C(C(=O)OCC)=CN1C1CC1 MPAQYMTZVOUHTQ-UHFFFAOYSA-N 0.000 description 1
- VBCWRYBMZVBWGW-UHFFFAOYSA-N ethyl 1-cyclopropyl-6-fluoro-8-(methoxymethyl)-7-(4-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylate Chemical compound C12=C(COC)C(N3CCN(C)CC3)=C(F)C=C2C(=O)C(C(=O)OCC)=CN1C1CC1 VBCWRYBMZVBWGW-UHFFFAOYSA-N 0.000 description 1
- MSTAZJQSSZAYRS-UHFFFAOYSA-N ethyl 1-cyclopropyl-6-fluoro-8-methyl-7-morpholin-4-yl-4-oxoquinoline-3-carboxylate Chemical compound C12=C(C)C(N3CCOCC3)=C(F)C=C2C(=O)C(C(=O)OCC)=CN1C1CC1 MSTAZJQSSZAYRS-UHFFFAOYSA-N 0.000 description 1
- SQKRHQSVXMCTMS-UHFFFAOYSA-N ethyl 1-cyclopropyl-7-(4-ethoxycarbonylpiperazin-1-yl)-6-fluoro-8-(hydroxymethyl)-4-oxoquinoline-3-carboxylate Chemical compound C1CN(C(=O)OCC)CCN1C1=C(F)C=C2C(=O)C(C(=O)OCC)=CN(C3CC3)C2=C1CO SQKRHQSVXMCTMS-UHFFFAOYSA-N 0.000 description 1
- MNEMJPFAXNKOGD-UHFFFAOYSA-N ethyl 1-cyclopropyl-8-ethyl-6-fluoro-7-(4-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylate Chemical compound C12=C(CC)C(N3CCN(C)CC3)=C(F)C=C2C(=O)C(C(=O)OCC)=CN1C1CC1 MNEMJPFAXNKOGD-UHFFFAOYSA-N 0.000 description 1
- YEBHRKLBLVBWBO-UHFFFAOYSA-N ethyl 2-(2-chloro-4,5-difluoro-3-methylbenzoyl)-3-(cyclopropylamino)prop-2-enoate Chemical compound C=1C(F)=C(F)C(C)=C(Cl)C=1C(=O)C(C(=O)OCC)=CNC1CC1 YEBHRKLBLVBWBO-UHFFFAOYSA-N 0.000 description 1
- KQKDPROKNKSZOD-UHFFFAOYSA-N ethyl 3-ethoxy-2-(2,4,5-trifluorobenzoyl)prop-2-enoate Chemical compound CCOC=C(C(=O)OCC)C(=O)C1=CC(F)=C(F)C=C1F KQKDPROKNKSZOD-UHFFFAOYSA-N 0.000 description 1
- UHAVPHWXHMLQMQ-UHFFFAOYSA-N ethyl 4-[2-(acetyloxymethyl)-3-(cyclopropylamino)-6-fluoro-4-nitrophenyl]piperazine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCN1C1=C(F)C=C([N+]([O-])=O)C(NC2CC2)=C1COC(C)=O UHAVPHWXHMLQMQ-UHFFFAOYSA-N 0.000 description 1
- POARJKWRHUCARG-UHFFFAOYSA-N ethyl 4-[3,6-difluoro-2-(fluoromethyl)-4-nitrophenyl]piperazine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCN1C1=C(F)C=C([N+]([O-])=O)C(F)=C1CF POARJKWRHUCARG-UHFFFAOYSA-N 0.000 description 1
- MCZOSCBQMJZHFY-UHFFFAOYSA-N ethyl 4-[3,6-difluoro-2-(methoxymethyl)-4-nitrophenyl]piperazine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCN1C1=C(F)C=C([N+]([O-])=O)C(F)=C1COC MCZOSCBQMJZHFY-UHFFFAOYSA-N 0.000 description 1
- JGLMATMEWCQMPR-UHFFFAOYSA-N ethyl 4-[3-(cyclopropylamino)-6-fluoro-2-(methoxymethyl)-4-nitrophenyl]piperazine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCN1C1=C(F)C=C([N+]([O-])=O)C(NC2CC2)=C1COC JGLMATMEWCQMPR-UHFFFAOYSA-N 0.000 description 1
- OXYVORAKSUHDQL-UHFFFAOYSA-N ethyl 6,7-difluoro-1-(2-methylcyclopropyl)-4-oxoquinoline-3-carboxylate Chemical compound C(C)OC(=O)C1=CN(C2=CC(=C(C=C2C1=O)F)F)C1C(C1)C OXYVORAKSUHDQL-UHFFFAOYSA-N 0.000 description 1
- GYNLWLKZLOEPKL-UHFFFAOYSA-N ethyl 7-(3-acetamidopyrrolidin-1-yl)-1-cyclopropyl-6-fluoro-8-methyl-4-oxoquinoline-3-carboxylate Chemical compound C12=C(C)C(N3CC(CC3)NC(C)=O)=C(F)C=C2C(=O)C(C(=O)OCC)=CN1C1CC1 GYNLWLKZLOEPKL-UHFFFAOYSA-N 0.000 description 1
- RTVFOVBHCHRTLE-UHFFFAOYSA-N ethyl 7-[3-(acetamidomethyl)pyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-8-methyl-4-oxoquinoline-3-carboxylate Chemical compound C12=C(C)C(N3CC(CNC(C)=O)CC3)=C(F)C=C2C(=O)C(C(=O)OCC)=CN1C1CC1 RTVFOVBHCHRTLE-UHFFFAOYSA-N 0.000 description 1
- MXJAFMLFWOGDOI-UHFFFAOYSA-N ethyl 7-[3-[benzyl(methyl)amino]pyrrolidin-1-yl]-1-cyclopropyl-6-fluoro-8-methyl-4-oxoquinoline-3-carboxylate Chemical compound C12=C(C)C(N3CC(CC3)N(C)CC=3C=CC=CC=3)=C(F)C=C2C(=O)C(C(=O)OCC)=CN1C1CC1 MXJAFMLFWOGDOI-UHFFFAOYSA-N 0.000 description 1
- AHWNTZDLTXMUOT-UHFFFAOYSA-N ethyl 8-(acetyloxymethyl)-1-cyclopropyl-6-fluoro-7-(4-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylate Chemical compound C12=C(COC(C)=O)C(N3CCN(C)CC3)=C(F)C=C2C(=O)C(C(=O)OCC)=CN1C1CC1 AHWNTZDLTXMUOT-UHFFFAOYSA-N 0.000 description 1
- JVXSKZAMFOWKLY-UHFFFAOYSA-N ethyl 8-(acetyloxymethyl)-7-(4-benzylpiperazin-1-yl)-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylate Chemical compound C12=C(COC(C)=O)C(N3CCN(CC=4C=CC=CC=4)CC3)=C(F)C=C2C(=O)C(C(=O)OCC)=CN1C1CC1 JVXSKZAMFOWKLY-UHFFFAOYSA-N 0.000 description 1
- IZLHSYGESNSOLR-UHFFFAOYSA-N ethyl 8-(chloromethyl)-1-cyclopropyl-6-fluoro-7-morpholin-4-yl-4-oxoquinoline-3-carboxylate Chemical compound C12=C(CCl)C(N3CCOCC3)=C(F)C=C2C(=O)C(C(=O)OCC)=CN1C1CC1 IZLHSYGESNSOLR-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- LNOQURRKNJKKBU-UHFFFAOYSA-N ethyl piperazine-1-carboxylate Chemical compound CCOC(=O)N1CCNCC1 LNOQURRKNJKKBU-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000007941 film coated tablet Substances 0.000 description 1
- 239000007888 film coating Substances 0.000 description 1
- 238000009501 film coating Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- 125000003104 hexanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003707 hexyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 230000000887 hydrating effect Effects 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- BICAGYDGRXJYGD-UHFFFAOYSA-N hydrobromide;hydrochloride Chemical compound Cl.Br BICAGYDGRXJYGD-UHFFFAOYSA-N 0.000 description 1
- 150000002431 hydrogen Chemical group 0.000 description 1
- 239000008172 hydrogenated vegetable oil Substances 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 1
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 1
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 1
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 1
- JGJLWPGRMCADHB-UHFFFAOYSA-N hypobromite Inorganic materials Br[O-] JGJLWPGRMCADHB-UHFFFAOYSA-N 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 229940102223 injectable solution Drugs 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 230000002934 lysing effect Effects 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002483 medication Methods 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- PSXXZHPJADTUNB-UHFFFAOYSA-N n-(3,4-difluorophenyl)acetamide Chemical compound CC(=O)NC1=CC=C(F)C(F)=C1 PSXXZHPJADTUNB-UHFFFAOYSA-N 0.000 description 1
- NLZNKYVQDMTHBN-UHFFFAOYSA-N n-[1-(3,6-difluoro-2-methyl-4-nitrophenyl)pyrrolidin-3-yl]acetamide Chemical compound C1C(NC(=O)C)CCN1C1=C(F)C=C([N+]([O-])=O)C(F)=C1C NLZNKYVQDMTHBN-UHFFFAOYSA-N 0.000 description 1
- OJFZCZGFZFWTBH-UHFFFAOYSA-N n-[1-[2-(chloromethyl)-3,6-difluoro-4-nitrophenyl]pyrrolidin-3-yl]acetamide Chemical compound C1C(NC(=O)C)CCN1C1=C(F)C=C([N+]([O-])=O)C(F)=C1CCl OJFZCZGFZFWTBH-UHFFFAOYSA-N 0.000 description 1
- JMSUQPIIOGSUHY-UHFFFAOYSA-N n-[1-[3-(cyclopropylamino)-6-fluoro-2-methyl-4-nitrophenyl]pyrrolidin-3-yl]acetamide Chemical compound C1C(NC(=O)C)CCN1C1=C(F)C=C([N+]([O-])=O)C(NC2CC2)=C1C JMSUQPIIOGSUHY-UHFFFAOYSA-N 0.000 description 1
- BNLMYNMRKFYQCT-UHFFFAOYSA-N n-benzyl-1-(3,6-difluoro-2-methyl-4-nitrophenyl)-n-methylpyrrolidin-3-amine Chemical compound C1CN(C=2C(=C(F)C(=CC=2F)[N+]([O-])=O)C)CC1N(C)CC1=CC=CC=C1 BNLMYNMRKFYQCT-UHFFFAOYSA-N 0.000 description 1
- WJKILAUZDMBKMQ-UHFFFAOYSA-N n-benzyl-1-[3-(cyclopropylamino)-6-fluoro-2-methyl-4-nitrophenyl]-n-methylpyrrolidin-3-amine Chemical compound C1CN(C=2C(=C(NC3CC3)C(=CC=2F)[N+]([O-])=O)C)CC1N(C)CC1=CC=CC=C1 WJKILAUZDMBKMQ-UHFFFAOYSA-N 0.000 description 1
- ZFEQOFIQABNVMY-UHFFFAOYSA-N n-cyclopropyl-4-fluoro-2-(methoxymethyl)-3-morpholin-4-yl-6-nitroaniline Chemical compound [O-][N+](=O)C1=CC(F)=C(N2CCOCC2)C(COC)=C1NC1CC1 ZFEQOFIQABNVMY-UHFFFAOYSA-N 0.000 description 1
- KERBAAIBDHEFDD-UHFFFAOYSA-N n-ethylformamide Chemical compound CCNC=O KERBAAIBDHEFDD-UHFFFAOYSA-N 0.000 description 1
- 230000000802 nitrating effect Effects 0.000 description 1
- 238000005121 nitriding Methods 0.000 description 1
- JCZMXVGQBBATMY-UHFFFAOYSA-N nitro acetate Chemical compound CC(=O)O[N+]([O-])=O JCZMXVGQBBATMY-UHFFFAOYSA-N 0.000 description 1
- JBCXQJHXIYZCNI-UHFFFAOYSA-N nitro benzoate Chemical compound [O-][N+](=O)OC(=O)C1=CC=CC=C1 JBCXQJHXIYZCNI-UHFFFAOYSA-N 0.000 description 1
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Substances [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 239000003444 phase transfer catalyst Substances 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- UXCDUFKZSUBXGM-UHFFFAOYSA-N phosphoric tribromide Chemical compound BrP(Br)(Br)=O UXCDUFKZSUBXGM-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 235000007686 potassium Nutrition 0.000 description 1
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 1
- 229910000105 potassium hydride Inorganic materials 0.000 description 1
- 239000004304 potassium nitrite Substances 0.000 description 1
- 235000010289 potassium nitrite Nutrition 0.000 description 1
- 229910000160 potassium phosphate Inorganic materials 0.000 description 1
- 235000011009 potassium phosphates Nutrition 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 229950008352 promoxolane Drugs 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- RIBFXMJCUYXJDZ-UHFFFAOYSA-N propanoyl bromide Chemical compound CCC(Br)=O RIBFXMJCUYXJDZ-UHFFFAOYSA-N 0.000 description 1
- 229940055019 propionibacterium acne Drugs 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000002510 pyrogen Substances 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 238000013207 serial dilution Methods 0.000 description 1
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 1
- 239000004208 shellac Substances 0.000 description 1
- 229940113147 shellac Drugs 0.000 description 1
- 235000013874 shellac Nutrition 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 235000020374 simple syrup Nutrition 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- CRWJEUDFKNYSBX-UHFFFAOYSA-N sodium;hypobromite Chemical compound [Na+].Br[O-] CRWJEUDFKNYSBX-UHFFFAOYSA-N 0.000 description 1
- 239000008279 sol Substances 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000007940 sugar coated tablet Substances 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- HIFJUMGIHIZEPX-UHFFFAOYSA-N sulfuric acid;sulfur trioxide Chemical compound O=S(=O)=O.OS(O)(=O)=O HIFJUMGIHIZEPX-UHFFFAOYSA-N 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- XKXIQBVKMABYQJ-UHFFFAOYSA-N tert-butyl hydrogen carbonate Chemical compound CC(C)(C)OC(O)=O XKXIQBVKMABYQJ-UHFFFAOYSA-N 0.000 description 1
- IXZDIALLLMRYOU-UHFFFAOYSA-N tert-butyl hypochlorite Chemical compound CC(C)(C)OCl IXZDIALLLMRYOU-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 238000012549 training Methods 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- FEONEKOZSGPOFN-UHFFFAOYSA-K tribromoiron Chemical compound Br[Fe](Br)Br FEONEKOZSGPOFN-UHFFFAOYSA-K 0.000 description 1
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 1
- BDZBKCUKTQZUTL-UHFFFAOYSA-N triethyl phosphite Chemical compound CCOP(OCC)OCC BDZBKCUKTQZUTL-UHFFFAOYSA-N 0.000 description 1
- 230000001960 triggered effect Effects 0.000 description 1
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 1
- 241001148471 unidentified anaerobic bacterium Species 0.000 description 1
- 210000001635 urinary tract Anatomy 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D215/54—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3
- C07D215/56—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3 with oxygen atoms in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP4092186 | 1986-02-25 | ||
| JP10565586 | 1986-05-08 | ||
| JP11856886 | 1986-05-22 | ||
| JP17337086 | 1986-07-23 | ||
| JP19383886 | 1986-08-19 | ||
| JP23383786 | 1986-09-30 | ||
| JP24605086 | 1986-10-15 | ||
| JP30351586 | 1986-12-18 | ||
| JP62037000A JPH0753715B2 (ja) | 1986-02-25 | 1987-02-19 | ベンゾヘテロ環化合物 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3705621A1 DE3705621A1 (de) | 1987-10-15 |
| DE3705621C2 true DE3705621C2 (de) | 1997-01-09 |
Family
ID=27576899
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3705621A Expired - Fee Related DE3705621C2 (de) | 1986-02-25 | 1987-02-21 | Heterocyclisch substituierte Chinoloncarbonsäurederivate |
Country Status (7)
| Country | Link |
|---|---|
| US (4) | US4874764A (enExample) |
| CH (1) | CH672126A5 (enExample) |
| DE (1) | DE3705621C2 (enExample) |
| DK (1) | DK93887A (enExample) |
| FR (1) | FR2603584B1 (enExample) |
| GB (1) | GB2188317B (enExample) |
| NL (1) | NL191890C (enExample) |
Families Citing this family (44)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3509546A1 (de) * | 1985-03-16 | 1986-09-25 | Bayer Ag, 5090 Leverkusen | 7-amino-1-(subst.cyclopropyl)-1,4-dihydro-4-oxo-3-chinolincarbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| DE3719764A1 (de) * | 1987-06-13 | 1988-12-22 | Bayer Ag | Ionenaustauscherharze beladen mit chinoloncarbonsaeurederivaten, ihre herstellung und verwendung |
| US4780468A (en) * | 1987-08-07 | 1988-10-25 | Warner-Lambert Company | 8-trifluoromethyl quinolones as antibacterial agents |
| DE3814517A1 (de) * | 1988-02-05 | 1989-08-17 | Bayer Ag | Chinolon- und naphthyridoncarbonsaeurederivate, verfahren zu ihrer herstellung und sie enthaltende antibakterielle mittel und futterzusatzstoffe |
| DE3902079A1 (de) * | 1988-04-15 | 1989-10-26 | Bayer Ag | I.m. injektionsformen von gyrase-inhibitoren |
| MY105136A (en) | 1988-04-27 | 1994-08-30 | Daiichi Seiyaku Co | Optically active pyridonecarboxylic acid derivatives. |
| AU618823B2 (en) * | 1988-07-20 | 1992-01-09 | Sankyo Company Limited | 4-oxoquinoline-3-carboxylic acid derivatives, their preparation and their use |
| JP2777661B2 (ja) * | 1988-10-20 | 1998-07-23 | 大塚製薬株式会社 | ベンゾヘテロ環化合物 |
| CA2001203C (en) * | 1988-10-24 | 2001-02-13 | Thomas P. Demuth, Jr. | Novel antimicrobial dithiocarbamoyl quinolones |
| EP0366189A3 (en) * | 1988-10-24 | 1992-01-02 | Norwich Eaton Pharmaceuticals, Inc. | Novel antimicrobial lactam-quinolones |
| US5153203A (en) * | 1989-03-30 | 1992-10-06 | Wakunaga Seiyaku Kabushiki Kaisha | Quinolone derivatives and salts thereof, preparation processes thereof, and antibacterial agents containing the same |
| CA2012681A1 (en) * | 1989-03-31 | 1990-09-30 | Masayasu Okuhira | Quinolone derivatives, preparation processes thereof, and antibacterial agents containing the same |
| ES2018977A6 (es) * | 1989-11-29 | 1991-05-16 | Marga Investigacion | Procedimiento de preparacion de n-ciclopropil-4-fluoroanilinas. |
| US5175356A (en) * | 1990-04-12 | 1992-12-29 | Warner-Lambert Company | Quinolinecarboxylic acid antibacterial agents |
| US5256662A (en) * | 1990-04-12 | 1993-10-26 | Warner-Lambert Company | Quinolinecarboxylic acid antibacterial agents |
| US5047538A (en) * | 1990-04-12 | 1991-09-10 | Warner-Lambert Company | Quinolinecarboxylic acid antibacterial agents |
| DE4019023A1 (de) * | 1990-06-14 | 1991-12-19 | Bayer Ag | Verfahren zur herstellung von chinolincarbonsaeuren |
| JPH0778065B2 (ja) * | 1990-07-06 | 1995-08-23 | 杏林製薬株式会社 | (6,7―置換―8―アルコキシ―1―シクロプロピル―1,4―ジヒドロ―4―オキソ―3―キノリンカルボン酸―o▲上3▼,o▲上4▼)ビス(アシルオキシ―o)ホウ素化合物及びその塩並びにその製造方法 |
| US5342846A (en) * | 1990-12-05 | 1994-08-30 | Synphar Laboratories, Inc. | 7-substituted-6-fluoro-1,4-dihydro-4-oxo-quinoline-3-carboxylic acid compounds and 7-(substituted triazolyl pyrrolidin-1-yl) 4-oxoquinoline-3-carboxylic acid derivatives useful as antibacterial agents |
| RU2100351C1 (ru) * | 1991-05-28 | 1997-12-27 | Дайити Фармасьютикал Ко., Лтд. | Производные пиридонкарбоновой кислоты и композиция на их основе |
| DE4123918A1 (de) * | 1991-07-19 | 1993-01-21 | Bayer Ag | 8-vinyl- und 8-ethinyl-chinoloncarbonsaeuren |
| NO304832B1 (no) * | 1992-05-27 | 1999-02-22 | Ube Industries | Aminokinolonderivater samt middel mot HIV |
| KR19980701625A (ko) * | 1995-01-24 | 1998-06-25 | 이토 마사노리 | 퀴놀린카르본산유도체 |
| US5696117A (en) * | 1995-11-07 | 1997-12-09 | Ortho Pharmaceutical Corporation | Benzoxazine antimicrobial agents |
| WO1999014214A1 (en) | 1997-09-15 | 1999-03-25 | The Procter & Gamble Company | Antimicrobial quinolones, their compositions and uses |
| US6387928B1 (en) * | 1997-09-15 | 2002-05-14 | The Procter & Gamble Co. | Antimicrobial quinolones, their compositions and uses |
| IN186245B (enExample) | 1997-09-19 | 2001-07-14 | Ranbaxy Lab Ltd | |
| DK1262477T3 (da) | 2000-02-09 | 2008-12-01 | Daiichi Sankyo Co Ltd | Antibakterielle midler, der er virksomme mod syrefaste bakterier og indeholder pyridoncarboxylsyrer som aktiv ingrediens |
| US6608078B2 (en) | 2000-05-08 | 2003-08-19 | Wockhardt Limited | Antibacterial chiral 8-(substituted piperidino)-benzo [i,j] quinolizines, processes, compositions and methods of treatment |
| US7098219B2 (en) | 2000-08-01 | 2006-08-29 | Wockhart Limited | Inhibitors of cellular efflux pumps of microbes |
| US6964966B2 (en) | 2001-04-25 | 2005-11-15 | Wockhardt Limited | Generation triple-targeting, chiral, broad-spectrum antimicrobial 7-substituted piperidino-quinolone carboxylic acid derivatives, their preparation, compositions and use as medicaments |
| US6878713B2 (en) | 2001-04-25 | 2005-04-12 | Wockhardt Limited | Generation triple-targeting, chiral, broad-spectrum antimicrobial 7-substituted piperidino-quinolone carboxylic acid derivatives, their preparation, compositions and use as medicaments |
| US6664267B1 (en) * | 2002-05-28 | 2003-12-16 | Wockhardt Limited | Crystalline fluoroquinolone arginine salt form |
| KR100519158B1 (ko) * | 2002-12-21 | 2005-10-06 | 주식회사유한양행 | 퀴놀론 카르복실레이트 유도체의 제조방법 |
| ATE366734T1 (de) * | 2003-09-04 | 2007-08-15 | Wockhardt Ltd | Benzochinolizin-2-carbonsäureargininsalz- tetrahydrat |
| WO2005026145A2 (en) * | 2003-09-12 | 2005-03-24 | Warner-Lambert Company Llc | Quinolone antibacterial agents |
| FR2862969A1 (fr) | 2003-11-28 | 2005-06-03 | Oreal | Procede de preparation de derives paraphenylenediamine a groupement pyrrolidinyle, substitue par un radical azote, et composes intermediaires |
| US8374887B1 (en) | 2005-02-11 | 2013-02-12 | Emily H. Alexander | System and method for remotely supervising and verifying pharmacy functions |
| CA2647346C (en) * | 2006-03-28 | 2011-07-19 | The Procter & Gamble Company | Malate salts, and polymorphs of (3s,5s)-7-[3-amino-5-methyl-piperidinyl]-1-cyclopropyl-1,4-dihydro-8-methoxy-4-oxo-3-quinolinecarboxylic acid |
| CA2647454A1 (en) * | 2006-03-28 | 2007-10-04 | The Procter & Gamble Company | A coupling process for preparing quinolone intermediates |
| WO2007110836A1 (en) * | 2006-03-28 | 2007-10-04 | The Procter & Gamble Company | A hydride reduction process for preparing quinolone intermediates |
| CN102827075A (zh) * | 2011-06-14 | 2012-12-19 | 四川科伦药物研究有限公司 | 一种西他沙星中间体的合成方法 |
| CN102617568B (zh) * | 2012-03-06 | 2014-06-25 | 天津市汉康医药生物技术有限公司 | 一种稳定的盐酸莫西沙星化合物、其制备方法 |
| ES2927524T3 (es) | 2014-09-08 | 2022-11-08 | Becton Dickinson Co | Recinto aerodinámico para dispositivos de entrada de un sistema de preparación de medicamentos |
Family Cites Families (47)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| HU170951B (hu) * | 1975-06-06 | 1977-10-28 | Chinoin Gyogyszer Es Vegyeszet | Novyj sposob poluchenija hinolin-3-karbonovykh kislot |
| JPS5845426B2 (ja) * | 1978-09-29 | 1983-10-08 | 杏林製薬株式会社 | 置換キノリンカルボン酸誘導体 |
| JPS604820B2 (ja) * | 1979-02-26 | 1985-02-06 | 大塚製薬株式会社 | キノリンカルボン酸誘導体 |
| JPS5630964A (en) * | 1979-08-22 | 1981-03-28 | Kyorin Pharmaceut Co Ltd | Novel substituted quinolinecarboxylic acid and its preparation |
| DE3142854A1 (de) * | 1981-10-29 | 1983-05-11 | Bayer Ag, 5090 Leverkusen | 1-cyclopropyl-6-fluor-1,4-dihydro-4-oxo-7-piperazino-chinolin-3-carbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| DE3033157A1 (de) * | 1980-09-03 | 1982-04-01 | Bayer Ag, 5090 Leverkusen | 7-amino-1-cyclopropyl-4-oxo-1,4-dihydro-naphthyridin-3-carbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| SE440354B (sv) * | 1981-02-19 | 1985-07-29 | Kyorin Seiyaku Kk | Kinolinkarboxylsyraderivat |
| AU85768S (en) | 1981-11-16 | 1983-01-14 | Brian Davis And Co Pty Ltd | freezer basket |
| US4665079A (en) * | 1984-02-17 | 1987-05-12 | Warner-Lambert Company | Antibacterial agents |
| DE3248505A1 (de) * | 1982-12-29 | 1984-07-05 | Bayer Ag, 5090 Leverkusen | 1-cyclopropyl-6-fluor-1,4-dihydro-4-oxo-7(4- (oxoalkyl)-1-piperazinyl/-3-chinolincarbonsaeuren und ihre derivate, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| DE3248507A1 (de) * | 1982-12-29 | 1984-07-05 | Bayer Ag, 5090 Leverkusen | Mikrobizide mittel auf chinoloncarbonsaeure basis |
| DE3248506A1 (de) * | 1982-12-29 | 1984-07-05 | Bayer Ag, 5090 Leverkusen | 1-cyclopropyl-6-fluor-1,4-dihydro-4-oxo-7(alkyl-1-piperazinyl)-3-chinolincarbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| DE3306771A1 (de) * | 1983-02-25 | 1984-08-30 | Bayer Ag, 5090 Leverkusen | Chinoloncarbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| DE3306772A1 (de) * | 1983-02-25 | 1984-08-30 | Bayer Ag, 5090 Leverkusen | Chinolonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| DE3308909A1 (de) * | 1983-03-12 | 1984-09-13 | Bayer Ag, 5090 Leverkusen | Bakterizide mittel auf chinoloncarbonsaeure-basis |
| DE3308908A1 (de) * | 1983-03-12 | 1984-09-13 | Bayer Ag, 5090 Leverkusen | Bakterizide mittel |
| DE3318145A1 (de) * | 1983-05-18 | 1984-11-22 | Bayer Ag, 5090 Leverkusen | 7-amino-1-cyclopropyl-6,8-difluor-1,4-dihydro-4-oxo-3-chinolincarbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| JPS60123837A (ja) * | 1983-12-09 | 1985-07-02 | Mitsubishi Paper Mills Ltd | ハロゲン化銀写真乳剤 |
| JPS60126271A (ja) * | 1983-12-09 | 1985-07-05 | Kyorin Pharmaceut Co Ltd | キノロンカルボン酸誘導体 |
| GB8333798D0 (en) * | 1983-12-19 | 1984-01-25 | Fujisawa Pharmaceutical Co | Quinolone compounds |
| IL74244A (en) * | 1984-02-17 | 1988-06-30 | Warner Lambert Co | Quinoline derivatives,their preparation and pharmaceutical compositions containing them |
| CA1230320A (en) * | 1984-04-02 | 1987-12-15 | James Minifie | Recovery of aleurone cells from wheat bran |
| DE3420116A1 (de) * | 1984-05-30 | 1985-12-05 | Bayer Ag, 5090 Leverkusen | Immunstimulierende mittel |
| DE3420798A1 (de) * | 1984-06-04 | 1985-12-05 | Bayer Ag, 5090 Leverkusen | 7-(3-aryl-l-piperazinyl)- sowie 7-(3-cyclohexyl-l-piperazinyl)-3-chinoloncarbonsaeuren |
| DE3420743A1 (de) * | 1984-06-04 | 1985-12-05 | Bayer Ag, 5090 Leverkusen | 7-amino-1-cyclopropyl-6,8-dihalogen-1,4-dihydro-4-oxo-3-chinolincarbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| DE3420770A1 (de) * | 1984-06-04 | 1985-12-05 | Bayer Ag, 5090 Leverkusen | 1-cyclopropyl-6-fluor-1,4-dihydro-4-oxo-7-(3-oxo-1-piperazinyl)-3-chinoloncarbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| ZA854792B (en) * | 1984-07-13 | 1986-02-26 | Abbott Lab | Quinoline and naphthyridine compounds |
| IE58742B1 (en) * | 1984-07-20 | 1993-11-05 | Warner Lambert Co | Substituted-9-fluoro-3-methyl-7-oxo-2,3-dihydro-7h-pyrido[1,2,3-de] [1,4]benzoxauine-6-carboxylic acids; sibstituted-5-amino-6-6fluoro-4-oxo.1,4-dihydroquinoline-3 carboxylic acids; substituted-5-amino-6-fluoro-1,4-dihydro-4-oxo-1.8-naphthyridine-3-carboxylic acids; derivatives thereof; pharmaceutical compositions comprising the compounds; and processes for producing the compounds |
| JPS6191183A (ja) * | 1984-10-11 | 1986-05-09 | Kyorin Pharmaceut Co Ltd | キノロンカルボン酸誘導体 |
| IN162769B (enExample) * | 1984-11-13 | 1988-07-09 | Kyorin Seiyaku Kk | |
| JPH0670032B2 (ja) * | 1984-11-22 | 1994-09-07 | 大日本製薬株式会社 | アミノピロリジン誘導体、そのエステルおよびその塩 |
| EP0191185B1 (en) * | 1984-12-14 | 1990-03-07 | Daiichi Seiyaku Co., Ltd. | Quinoline-carboxylic acid derivatives |
| DE3517709A1 (de) * | 1985-01-05 | 1986-07-10 | Bayer Ag | Basische zubereitungen von chinoloncarbonsaeuren |
| DE3504643A1 (de) * | 1985-02-12 | 1986-08-14 | Bayer Ag, 5090 Leverkusen | 1-cyclopropyl-1,4-dihydro-4-oxo-7-(4-(2-oxo-1,3-dioxol-4-yl-methyl)-1-piperazinyl)-3-chinolin carbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| AU578793B2 (en) * | 1985-02-15 | 1988-11-03 | Dainippon Pharmaceutical Co. Ltd. | Novel 1,8-naphthyridine derivatives and processes for preparation thereof |
| JPS61205258A (ja) * | 1985-03-08 | 1986-09-11 | Kyorin Pharmaceut Co Ltd | キノロンカルボン酸誘導体及びその製造方法 |
| DE3509546A1 (de) * | 1985-03-16 | 1986-09-25 | Bayer Ag, 5090 Leverkusen | 7-amino-1-(subst.cyclopropyl)-1,4-dihydro-4-oxo-3-chinolincarbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel |
| JPS61229877A (ja) * | 1985-04-05 | 1986-10-14 | Kanebo Ltd | 新規キノリンカルボン酸誘導体および該化合物を有効成分とする抗菌剤 |
| US4578473A (en) * | 1985-04-15 | 1986-03-25 | Warner-Lambert Company | Process for quinoline-3-carboxylic acid antibacterial agents |
| US4657913A (en) * | 1985-04-18 | 1987-04-14 | Warner-Lambert Company | Trifluoro- quinoline -3- carboxylic acids and their use as anti-bacterial agents |
| GB8512143D0 (en) * | 1985-05-14 | 1985-06-19 | Beecham Group Plc | Method of treatment |
| DE3525108A1 (de) * | 1985-06-07 | 1986-12-11 | Bayer Ag, 5090 Leverkusen | Antibakteriell wirksame chinoloncarbonsaeureester |
| JPH0635457B2 (ja) * | 1985-06-28 | 1994-05-11 | 杏林製薬株式会社 | ピリドンカルボン酸誘導体およびその製造方法 |
| DE3525335A1 (de) * | 1985-07-16 | 1987-01-22 | Bayer Ag | Embonate von chinoloncarbonsaeuren und ihren derivaten |
| DE3608745A1 (de) * | 1985-07-24 | 1987-01-29 | Bayer Ag | Bakterizide zubereitungen zur anwendung auf dem gebiet der veterinaermedizin |
| JPS62215572A (ja) * | 1986-03-17 | 1987-09-22 | Kyorin Pharmaceut Co Ltd | キノロンカルボン酸誘導体 |
| US4803205A (en) * | 1987-08-07 | 1989-02-07 | Warner-Lambert Company | Quinolones as antibacterial agents |
-
1987
- 1987-02-21 DE DE3705621A patent/DE3705621C2/de not_active Expired - Fee Related
- 1987-02-24 GB GB8704228A patent/GB2188317B/en not_active Expired - Fee Related
- 1987-02-24 CH CH703/87A patent/CH672126A5/de not_active IP Right Cessation
- 1987-02-24 DK DK093887A patent/DK93887A/da unknown
- 1987-02-25 NL NL8700471A patent/NL191890C/xx not_active IP Right Cessation
- 1987-02-25 FR FR878702510A patent/FR2603584B1/fr not_active Expired - Lifetime
- 1987-06-18 US US07/063,401 patent/US4874764A/en not_active Expired - Fee Related
- 1987-07-23 US US07/076,888 patent/US4855292A/en not_active Expired - Fee Related
- 1987-07-23 US US07/076,890 patent/US4880806A/en not_active Expired - Fee Related
-
1988
- 1988-10-17 US US07/259,471 patent/US4935420A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| NL8700471A (nl) | 1987-09-16 |
| US4935420A (en) | 1990-06-19 |
| FR2603584A1 (fr) | 1988-03-11 |
| US4874764A (en) | 1989-10-17 |
| GB2188317A (en) | 1987-09-30 |
| GB2188317B (en) | 1990-04-18 |
| FR2603584B1 (fr) | 1992-11-27 |
| CH672126A5 (enExample) | 1989-10-31 |
| DE3705621A1 (de) | 1987-10-15 |
| DK93887A (da) | 1987-08-26 |
| DK93887D0 (da) | 1987-02-24 |
| NL191890B (nl) | 1996-06-03 |
| GB8704228D0 (en) | 1987-04-01 |
| US4855292A (en) | 1989-08-08 |
| US4880806A (en) | 1989-11-14 |
| NL191890C (nl) | 1996-10-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3705621C2 (de) | Heterocyclisch substituierte Chinoloncarbonsäurederivate | |
| DE3856434T2 (de) | Benzoheterocyclische Verbindungen | |
| EP0757990B1 (de) | 7-(1-Pyrrolidinyl)-3-chinolon- und -naphthyridoncarbonsäure-Derivate, Verfahren zu ihrer Herstellung sowie substituierte mono- und bicyclische Pyrrolidinderivate als Zwischenprodukte zu ihrer Herstellung, und sie enthaltende antibakterielle Mittel und Futterzusatzstoffe | |
| AT390258B (de) | Verfahren zur herstellung von neuen 1,4-dihydro-4-oxonaphthydridin-derivaten und deren salzen | |
| DE3786843T2 (de) | Chinolincarbonsäurederivate. | |
| CH648845A5 (de) | Benzoheterozyklische verbindungen, verfahren zu deren herstellung und bakteriostatische mittel, welche diese enthalten. | |
| EP0216345B1 (de) | Chinolinderivate | |
| EP0187376B1 (de) | 6,7-Disubstituierte 1-Cyclopropyl-1,4-dihydro-4-oxo-1,8-naphthyridin-3-carbonsäuren | |
| EP0201829A1 (de) | 1-Aryl-4-chinolon-3-carbonsäuren | |
| DE69020199T2 (de) | Durch Azetidine substituierte Derivate von Pyridon-Carboxylsäure, ihre Herstellung und Verwendung als Arzneimittel. | |
| DE3542002A1 (de) | 1-cyclopropyl-6-fluor-1,4-dihydro-4-oxo-7- (1-piperazinyl)-3-chinolincarbonsaeuren, verfahren zu ihrer herstellung sowie diese enthaltende antibakterielle mittel | |
| EP0191390A1 (de) | 1-Cyclopropyl-1,4-dihydro-4-oxo-7-[4-(2-oxo-1,3-dioxol-4-yl-methyl)-1-piperazinyl]-3-chinolincarbonsäuren, Verfahren zu ihrer Herstellung sowie diese enthaltende antibakterielle Mittel | |
| DE69428206T2 (de) | Chinolincarbonsäurederivate und ihre salze | |
| DE69708640T2 (de) | Pyridoncarbonsäure-derivate und zwischenverbindungen für deren herstellung | |
| DE3721745A1 (de) | Bicyclisch substituierte chinoloncarbonsaeurederivate, verfahren zu ihrer herstellung und diese enthaltende pharmazeutische praeparate | |
| JPS63264461A (ja) | ベンゾヘテロ環化合物 | |
| EP0704443B1 (de) | Chinolon- und Naphthyridoncarbonsäurederivate | |
| EP0726270B1 (de) | 1,6-Naphthyridoncarbonsäurederivate | |
| AU603352B2 (en) | Benzoheterocyclic compounds | |
| JPH0348682A (ja) | ピリドンカルボン酸化合物 | |
| KR940007309B1 (ko) | 벤조헤테로 사이클릭 화합물 | |
| SE501371C2 (sv) | Kinolinkarboxylsyror, förfarande för framställning av dessa och en antimikrobiell komposition | |
| DD257427A5 (de) | Verfahren zur herstellung 1(yclopropyl-1,4-dihydro-4oxo-1.8-nephthyridin-3-carbonsaeuren | |
| DE19506535A1 (de) | 1,6-Naphthyridoncarbonsäurederivate | |
| DD283640A5 (de) | Verfahren zur herstellung von neuen chinolinderivaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |