DE3152399C2 - - Google Patents
Info
- Publication number
- DE3152399C2 DE3152399C2 DE3152399A DE3152399A DE3152399C2 DE 3152399 C2 DE3152399 C2 DE 3152399C2 DE 3152399 A DE3152399 A DE 3152399A DE 3152399 A DE3152399 A DE 3152399A DE 3152399 C2 DE3152399 C2 DE 3152399C2
- Authority
- DE
- Germany
- Prior art keywords
- recording material
- layer
- material according
- intermediate layer
- gas
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000463 material Substances 0.000 claims description 409
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 72
- 125000005843 halogen group Chemical group 0.000 claims description 70
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical group [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 48
- 239000000126 substance Substances 0.000 claims description 43
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 38
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 36
- 125000004429 atom Chemical group 0.000 claims description 34
- 229910052710 silicon Inorganic materials 0.000 claims description 25
- 229910052757 nitrogen Inorganic materials 0.000 claims description 23
- 239000002800 charge carrier Substances 0.000 claims description 18
- 229910052736 halogen Inorganic materials 0.000 claims description 15
- 150000002367 halogens Chemical class 0.000 claims description 15
- 239000011810 insulating material Substances 0.000 claims description 12
- 239000011159 matrix material Substances 0.000 claims description 12
- 230000000737 periodic effect Effects 0.000 claims description 12
- 229910052801 chlorine Inorganic materials 0.000 claims description 11
- 229910052731 fluorine Inorganic materials 0.000 claims description 11
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 10
- 229910052794 bromium Inorganic materials 0.000 claims description 8
- 239000012535 impurity Substances 0.000 claims description 8
- 238000002347 injection Methods 0.000 claims description 8
- 239000007924 injection Substances 0.000 claims description 8
- 229910052782 aluminium Inorganic materials 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052787 antimony Inorganic materials 0.000 claims description 4
- 229910052796 boron Inorganic materials 0.000 claims description 4
- 229910052785 arsenic Inorganic materials 0.000 claims description 3
- 229910052797 bismuth Inorganic materials 0.000 claims description 3
- 229910052733 gallium Inorganic materials 0.000 claims description 3
- 229910052738 indium Inorganic materials 0.000 claims description 3
- 229910052698 phosphorus Inorganic materials 0.000 claims description 3
- 229910052716 thallium Inorganic materials 0.000 claims description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 230000005855 radiation Effects 0.000 claims description 2
- 239000004615 ingredient Substances 0.000 claims 2
- 239000010410 layer Substances 0.000 description 739
- 239000007789 gas Substances 0.000 description 352
- 238000000034 method Methods 0.000 description 198
- 230000015572 biosynthetic process Effects 0.000 description 143
- 229910021417 amorphous silicon Inorganic materials 0.000 description 97
- 229910004014 SiF4 Inorganic materials 0.000 description 70
- ABTOQLMXBSRXSM-UHFFFAOYSA-N silicon tetrafluoride Chemical compound F[Si](F)(F)F ABTOQLMXBSRXSM-UHFFFAOYSA-N 0.000 description 70
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical class [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 69
- 230000008569 process Effects 0.000 description 67
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 66
- 229910052750 molybdenum Inorganic materials 0.000 description 57
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 56
- 239000011733 molybdenum Substances 0.000 description 56
- 238000000151 deposition Methods 0.000 description 52
- 230000008021 deposition Effects 0.000 description 51
- 229910052581 Si3N4 Inorganic materials 0.000 description 44
- HQVNEWCFYHHQES-UHFFFAOYSA-N silicon nitride Chemical compound N12[Si]34N5[Si]62N3[Si]51N64 HQVNEWCFYHHQES-UHFFFAOYSA-N 0.000 description 44
- 239000007858 starting material Substances 0.000 description 44
- 238000003384 imaging method Methods 0.000 description 35
- 230000006870 function Effects 0.000 description 32
- 238000004519 manufacturing process Methods 0.000 description 32
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 32
- 239000000203 mixture Substances 0.000 description 30
- 238000000889 atomisation Methods 0.000 description 29
- -1 polyethylene Polymers 0.000 description 28
- 238000010348 incorporation Methods 0.000 description 22
- 238000004544 sputter deposition Methods 0.000 description 22
- 238000012360 testing method Methods 0.000 description 22
- 229910021420 polycrystalline silicon Inorganic materials 0.000 description 19
- 239000010703 silicon Substances 0.000 description 17
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 17
- 229910052721 tungsten Inorganic materials 0.000 description 17
- 239000010937 tungsten Substances 0.000 description 17
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 16
- 238000009434 installation Methods 0.000 description 15
- 230000001419 dependent effect Effects 0.000 description 14
- 239000002994 raw material Substances 0.000 description 14
- 238000010894 electron beam technology Methods 0.000 description 13
- 150000003377 silicon compounds Chemical class 0.000 description 13
- 230000004304 visual acuity Effects 0.000 description 13
- 229910007264 Si2H6 Inorganic materials 0.000 description 11
- PZPGRFITIJYNEJ-UHFFFAOYSA-N disilane Chemical compound [SiH3][SiH3] PZPGRFITIJYNEJ-UHFFFAOYSA-N 0.000 description 11
- 239000000460 chlorine Substances 0.000 description 10
- 239000011229 interlayer Substances 0.000 description 10
- 125000004430 oxygen atom Chemical group O* 0.000 description 10
- 238000001816 cooling Methods 0.000 description 9
- 238000007733 ion plating Methods 0.000 description 9
- 125000004432 carbon atom Chemical group C* 0.000 description 8
- 229910001179 chromel Inorganic materials 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 8
- 150000002366 halogen compounds Chemical class 0.000 description 8
- 150000004756 silanes Chemical class 0.000 description 8
- 150000004820 halides Chemical class 0.000 description 7
- 229910052734 helium Inorganic materials 0.000 description 7
- 229910005096 Si3H8 Inorganic materials 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- 229910052786 argon Inorganic materials 0.000 description 6
- 238000007865 diluting Methods 0.000 description 6
- 230000003287 optical effect Effects 0.000 description 6
- 229920000728 polyester Polymers 0.000 description 6
- 238000000682 scanning probe acoustic microscopy Methods 0.000 description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 5
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- GQPLMRYTRLFLPF-UHFFFAOYSA-N Nitrous Oxide Chemical compound [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 description 5
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 5
- 230000008901 benefit Effects 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 229910052593 corundum Inorganic materials 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 230000007613 environmental effect Effects 0.000 description 5
- 239000011737 fluorine Substances 0.000 description 5
- 239000011521 glass Substances 0.000 description 5
- 229910002804 graphite Inorganic materials 0.000 description 5
- 239000010439 graphite Substances 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- 239000011261 inert gas Substances 0.000 description 5
- 238000002156 mixing Methods 0.000 description 5
- 229920000052 poly(p-xylylene) Polymers 0.000 description 5
- 229920002635 polyurethane Polymers 0.000 description 5
- 239000004814 polyurethane Substances 0.000 description 5
- 239000004065 semiconductor Substances 0.000 description 5
- 230000035945 sensitivity Effects 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- 230000006641 stabilisation Effects 0.000 description 5
- 238000011105 stabilization Methods 0.000 description 5
- 229910001845 yogo sapphire Inorganic materials 0.000 description 5
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- MWUXSHHQAYIFBG-UHFFFAOYSA-N Nitric oxide Chemical compound O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 4
- 206010034972 Photosensitivity reaction Diseases 0.000 description 4
- 229910003910 SiCl4 Inorganic materials 0.000 description 4
- 229910003818 SiH2Cl2 Inorganic materials 0.000 description 4
- 229910003816 SiH2F2 Inorganic materials 0.000 description 4
- 229910003822 SiHCl3 Inorganic materials 0.000 description 4
- MGNHOGAVECORPT-UHFFFAOYSA-N difluorosilicon Chemical compound F[Si]F MGNHOGAVECORPT-UHFFFAOYSA-N 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 229910052754 neon Inorganic materials 0.000 description 4
- 230000036211 photosensitivity Effects 0.000 description 4
- 238000000926 separation method Methods 0.000 description 4
- FDNAPBUWERUEDA-UHFFFAOYSA-N silicon tetrachloride Chemical compound Cl[Si](Cl)(Cl)Cl FDNAPBUWERUEDA-UHFFFAOYSA-N 0.000 description 4
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 4
- 229910014271 BrF5 Inorganic materials 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- 229910020323 ClF3 Inorganic materials 0.000 description 3
- 101100441092 Danio rerio crlf3 gene Proteins 0.000 description 3
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 3
- 229910003676 SiBr4 Inorganic materials 0.000 description 3
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 3
- 150000001540 azides Chemical class 0.000 description 3
- 230000004888 barrier function Effects 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- XHVUVQAANZKEKF-UHFFFAOYSA-N bromine pentafluoride Chemical compound FBr(F)(F)(F)F XHVUVQAANZKEKF-UHFFFAOYSA-N 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 229910052804 chromium Inorganic materials 0.000 description 3
- VNNRSPGTAMTISX-UHFFFAOYSA-N chromium nickel Chemical compound [Cr].[Ni] VNNRSPGTAMTISX-UHFFFAOYSA-N 0.000 description 3
- 229910052681 coesite Inorganic materials 0.000 description 3
- 229910052906 cristobalite Inorganic materials 0.000 description 3
- KBDJQNUZLNUGDS-UHFFFAOYSA-N dibromosilicon Chemical compound Br[Si]Br KBDJQNUZLNUGDS-UHFFFAOYSA-N 0.000 description 3
- BUMGIEFFCMBQDG-UHFFFAOYSA-N dichlorosilicon Chemical compound Cl[Si]Cl BUMGIEFFCMBQDG-UHFFFAOYSA-N 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- OMRRUNXAWXNVFW-UHFFFAOYSA-N fluoridochlorine Chemical compound ClF OMRRUNXAWXNVFW-UHFFFAOYSA-N 0.000 description 3
- 150000002430 hydrocarbons Chemical group 0.000 description 3
- 230000006698 induction Effects 0.000 description 3
- 238000005468 ion implantation Methods 0.000 description 3
- 229910052741 iridium Inorganic materials 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 3
- 229910001120 nichrome Inorganic materials 0.000 description 3
- 229910052758 niobium Inorganic materials 0.000 description 3
- 150000004767 nitrides Chemical class 0.000 description 3
- 229910017464 nitrogen compound Inorganic materials 0.000 description 3
- 150000002830 nitrogen compounds Chemical class 0.000 description 3
- 229910052697 platinum Inorganic materials 0.000 description 3
- 230000001105 regulatory effect Effects 0.000 description 3
- 229910000077 silane Inorganic materials 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 235000012239 silicon dioxide Nutrition 0.000 description 3
- 229910052990 silicon hydride Inorganic materials 0.000 description 3
- LIVNPJMFVYWSIS-UHFFFAOYSA-N silicon monoxide Chemical compound [Si-]#[O+] LIVNPJMFVYWSIS-UHFFFAOYSA-N 0.000 description 3
- AIFMYMZGQVTROK-UHFFFAOYSA-N silicon tetrabromide Chemical compound Br[Si](Br)(Br)Br AIFMYMZGQVTROK-UHFFFAOYSA-N 0.000 description 3
- 229910052682 stishovite Inorganic materials 0.000 description 3
- 229910052719 titanium Inorganic materials 0.000 description 3
- 229910052905 tridymite Inorganic materials 0.000 description 3
- JOHWNGGYGAVMGU-UHFFFAOYSA-N trifluorochlorine Chemical compound FCl(F)F JOHWNGGYGAVMGU-UHFFFAOYSA-N 0.000 description 3
- 238000007738 vacuum evaporation Methods 0.000 description 3
- 229910052720 vanadium Inorganic materials 0.000 description 3
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 2
- FKNIDKXOANSRCS-UHFFFAOYSA-N 2,3,4-trinitrofluoren-1-one Chemical compound C1=CC=C2C3=C([N+](=O)[O-])C([N+]([O-])=O)=C([N+]([O-])=O)C(=O)C3=CC2=C1 FKNIDKXOANSRCS-UHFFFAOYSA-N 0.000 description 2
- MGWGWNFMUOTEHG-UHFFFAOYSA-N 4-(3,5-dimethylphenyl)-1,3-thiazol-2-amine Chemical compound CC1=CC(C)=CC(C=2N=C(N)SC=2)=C1 MGWGWNFMUOTEHG-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- 229910014264 BrF Inorganic materials 0.000 description 2
- 229910014263 BrF3 Inorganic materials 0.000 description 2
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 2
- 229910020313 ClF Inorganic materials 0.000 description 2
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 2
- 229910007260 Si2F6 Inorganic materials 0.000 description 2
- 229910003826 SiH3Cl Inorganic materials 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- UAZDIGCOBKKMPU-UHFFFAOYSA-O azanium;azide Chemical compound [NH4+].[N-]=[N+]=[N-] UAZDIGCOBKKMPU-UHFFFAOYSA-O 0.000 description 2
- 238000007630 basic procedure Methods 0.000 description 2
- KDKYADYSIPSCCQ-UHFFFAOYSA-N but-1-yne Chemical compound CCC#C KDKYADYSIPSCCQ-UHFFFAOYSA-N 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002091 carbon monoxide Inorganic materials 0.000 description 2
- SLLGVCUQYRMELA-UHFFFAOYSA-N chlorosilicon Chemical compound Cl[Si] SLLGVCUQYRMELA-UHFFFAOYSA-N 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 229910021419 crystalline silicon Inorganic materials 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 238000009792 diffusion process Methods 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 238000010494 dissociation reaction Methods 0.000 description 2
- 230000005593 dissociations Effects 0.000 description 2
- 230000005284 excitation Effects 0.000 description 2
- 238000002309 gasification Methods 0.000 description 2
- 230000036541 health Effects 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 238000002513 implantation Methods 0.000 description 2
- PJXISJQVUVHSOJ-UHFFFAOYSA-N indium(III) oxide Inorganic materials [O-2].[O-2].[O-2].[In+3].[In+3] PJXISJQVUVHSOJ-UHFFFAOYSA-N 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 230000014759 maintenance of location Effects 0.000 description 2
- 229910021421 monocrystalline silicon Inorganic materials 0.000 description 2
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 2
- JCXJVPUVTGWSNB-UHFFFAOYSA-N nitrogen dioxide Inorganic materials O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 2
- GVGCUCJTUSOZKP-UHFFFAOYSA-N nitrogen trifluoride Chemical compound FN(F)F GVGCUCJTUSOZKP-UHFFFAOYSA-N 0.000 description 2
- 239000001272 nitrous oxide Substances 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 229920003227 poly(N-vinyl carbazole) Polymers 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 229920000515 polycarbonate Polymers 0.000 description 2
- 239000004417 polycarbonate Substances 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- 229920002223 polystyrene Polymers 0.000 description 2
- 229920000915 polyvinyl chloride Polymers 0.000 description 2
- 239000004800 polyvinyl chloride Substances 0.000 description 2
- 239000005033 polyvinylidene chloride Substances 0.000 description 2
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 2
- 238000005546 reactive sputtering Methods 0.000 description 2
- 230000000717 retained effect Effects 0.000 description 2
- 229930195734 saturated hydrocarbon Natural products 0.000 description 2
- 229920003002 synthetic resin Polymers 0.000 description 2
- 239000000057 synthetic resin Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- SDNBGJALFMSQER-UHFFFAOYSA-N trifluoro(trifluorosilyl)silane Chemical compound F[Si](F)(F)[Si](F)(F)F SDNBGJALFMSQER-UHFFFAOYSA-N 0.000 description 2
- FQFKTKUFHWNTBN-UHFFFAOYSA-N trifluoro-$l^{3}-bromane Chemical compound FBr(F)F FQFKTKUFHWNTBN-UHFFFAOYSA-N 0.000 description 2
- 238000007740 vapor deposition Methods 0.000 description 2
- MIZLGWKEZAPEFJ-UHFFFAOYSA-N 1,1,2-trifluoroethene Chemical group FC=C(F)F MIZLGWKEZAPEFJ-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- XPDWGBQVDMORPB-UHFFFAOYSA-N Fluoroform Chemical compound FC(F)F XPDWGBQVDMORPB-UHFFFAOYSA-N 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 1
- 239000002033 PVDF binder Substances 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 229910004074 SiF6 Inorganic materials 0.000 description 1
- KURZCZMGELAPSV-UHFFFAOYSA-N [Br].[I] Chemical compound [Br].[I] KURZCZMGELAPSV-UHFFFAOYSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 230000001133 acceleration Effects 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001343 alkyl silanes Chemical class 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 1
- FTYZKCCJUXJFLT-UHFFFAOYSA-N bromosilicon Chemical compound Br[Si] FTYZKCCJUXJFLT-UHFFFAOYSA-N 0.000 description 1
- IAQRGUVFOMOMEM-UHFFFAOYSA-N butene Natural products CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 238000007872 degassing Methods 0.000 description 1
- RWRIWBAIICGTTQ-UHFFFAOYSA-N difluoromethane Chemical compound FCF RWRIWBAIICGTTQ-UHFFFAOYSA-N 0.000 description 1
- 238000007599 discharging Methods 0.000 description 1
- 230000005684 electric field Effects 0.000 description 1
- 238000005566 electron beam evaporation Methods 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- NBVXSUQYWXRMNV-UHFFFAOYSA-N fluoromethane Chemical compound FC NBVXSUQYWXRMNV-UHFFFAOYSA-N 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- HCDGVLDPFQMKDK-UHFFFAOYSA-N hexafluoropropylene Chemical group FC(F)=C(F)C(F)(F)F HCDGVLDPFQMKDK-UHFFFAOYSA-N 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 239000012212 insulator Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 238000003475 lamination Methods 0.000 description 1
- 229910052745 lead Inorganic materials 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 229910001635 magnesium fluoride Inorganic materials 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- QKCGXXHCELUCKW-UHFFFAOYSA-N n-[4-[4-(dinaphthalen-2-ylamino)phenyl]phenyl]-n-naphthalen-2-ylnaphthalen-2-amine Chemical compound C1=CC=CC2=CC(N(C=3C=CC(=CC=3)C=3C=CC(=CC=3)N(C=3C=C4C=CC=CC4=CC=3)C=3C=C4C=CC=CC4=CC=3)C3=CC4=CC=CC=C4C=C3)=CC=C21 QKCGXXHCELUCKW-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 229910052756 noble gas Inorganic materials 0.000 description 1
- YWAKXRMUMFPDSH-UHFFFAOYSA-N pentene Chemical compound CCCC=C YWAKXRMUMFPDSH-UHFFFAOYSA-N 0.000 description 1
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 description 1
- 229920001083 polybutene Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 1
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 1
- 239000004810 polytetrafluoroethylene Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 229920002620 polyvinyl fluoride Polymers 0.000 description 1
- 229920002981 polyvinylidene fluoride Polymers 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- MWWATHDPGQKSAR-UHFFFAOYSA-N propyne Chemical group CC#C MWWATHDPGQKSAR-UHFFFAOYSA-N 0.000 description 1
- 230000009993 protective function Effects 0.000 description 1
- 239000011241 protective layer Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229910021332 silicide Inorganic materials 0.000 description 1
- 150000003376 silicon Chemical class 0.000 description 1
- 229910052814 silicon oxide Inorganic materials 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000002356 single layer Substances 0.000 description 1
- 238000009751 slip forming Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 238000010025 steaming Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 150000003464 sulfur compounds Chemical class 0.000 description 1
- 229910052715 tantalum Inorganic materials 0.000 description 1
- 238000012549 training Methods 0.000 description 1
- IAQRGUVFOMOMEM-ONEGZZNKSA-N trans-but-2-ene Chemical compound C\C=C\C IAQRGUVFOMOMEM-ONEGZZNKSA-N 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/08—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being inorganic
- G03G5/082—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being inorganic and not being incorporated in a bonding material, e.g. vacuum deposited
- G03G5/08214—Silicon-based
- G03G5/08235—Silicon-based comprising three or four silicon-based layers
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/08—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being inorganic
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/08—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being inorganic
- G03G5/082—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being inorganic and not being incorporated in a bonding material, e.g. vacuum deposited
- G03G5/08214—Silicon-based
- G03G5/08221—Silicon-based comprising one or two silicon based layers
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Photoreceptors In Electrophotography (AREA)
- Light Receiving Elements (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP55134116A JPS5758161A (en) | 1980-09-25 | 1980-09-25 | Photoconductive member |
| JP55134114A JPS5758159A (en) | 1980-09-25 | 1980-09-25 | Photoconductive member |
| JP55134115A JPS5758160A (en) | 1980-09-25 | 1980-09-25 | Photoconductive member |
| JP55137150A JPS5762054A (en) | 1980-09-30 | 1980-09-30 | Photoconductive member |
| JP55137151A JPS5762055A (en) | 1980-09-30 | 1980-09-30 | Photoconductive member |
| JP55137149A JPS5762053A (en) | 1980-09-30 | 1980-09-30 | Photoconductive member |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3152399A1 DE3152399A1 (en) | 1982-09-23 |
| DE3152399C2 true DE3152399C2 (enExample) | 1988-06-09 |
Family
ID=27552830
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE813152399A Granted DE3152399A1 (en) | 1980-09-25 | 1981-09-25 | Photoconductive member |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4394426A (enExample) |
| AU (1) | AU554181B2 (enExample) |
| CA (1) | CA1181628A (enExample) |
| DE (1) | DE3152399A1 (enExample) |
| FR (1) | FR2490839B1 (enExample) |
| GB (1) | GB2087643B (enExample) |
| NL (1) | NL192142C (enExample) |
| WO (1) | WO1982001261A1 (enExample) |
Families Citing this family (47)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4484809B1 (en) * | 1977-12-05 | 1995-04-18 | Plasma Physics Corp | Glow discharge method and apparatus and photoreceptor devices made therewith |
| JPS5795677A (en) * | 1980-12-03 | 1982-06-14 | Kanegafuchi Chem Ind Co Ltd | Amorphous silicon type photoelectric tranducer |
| GB2088628B (en) * | 1980-10-03 | 1985-06-12 | Canon Kk | Photoconductive member |
| US4522905A (en) * | 1982-02-04 | 1985-06-11 | Canon Kk | Amorphous silicon photoconductive member with interface and rectifying layers |
| US4452874A (en) * | 1982-02-08 | 1984-06-05 | Canon Kabushiki Kaisha | Photoconductive member with multiple amorphous Si layers |
| US4452875A (en) * | 1982-02-15 | 1984-06-05 | Canon Kabushiki Kaisha | Amorphous photoconductive member with α-Si interlayers |
| US4536459A (en) * | 1982-03-12 | 1985-08-20 | Canon Kabushiki Kaisha | Photoconductive member having multiple amorphous layers |
| US4490454A (en) * | 1982-03-17 | 1984-12-25 | Canon Kabushiki Kaisha | Photoconductive member comprising multiple amorphous layers |
| JPS58217938A (ja) * | 1982-06-12 | 1983-12-19 | Konishiroku Photo Ind Co Ltd | 電子写真感光体 |
| US5219698A (en) * | 1982-09-27 | 1993-06-15 | Canon Kabushiki Kaisha | Laser imaging method and apparatus for electrophotography |
| JPS5957247A (ja) * | 1982-09-27 | 1984-04-02 | Canon Inc | 電子写真用感光体 |
| US4466380A (en) * | 1983-01-10 | 1984-08-21 | Xerox Corporation | Plasma deposition apparatus for photoconductive drums |
| US4569894A (en) * | 1983-01-14 | 1986-02-11 | Canon Kabushiki Kaisha | Photoconductive member comprising germanium atoms |
| JPS59193463A (ja) * | 1983-04-18 | 1984-11-02 | Canon Inc | 電子写真用光導電部材 |
| JPS59200248A (ja) * | 1983-04-28 | 1984-11-13 | Canon Inc | 像形成部材の製造法 |
| JPS6041046A (ja) * | 1983-08-16 | 1985-03-04 | Kanegafuchi Chem Ind Co Ltd | 電子写真用感光体 |
| US4585721A (en) * | 1983-09-05 | 1986-04-29 | Canon Kabushiki Kaisha | Photoconductive member comprising amorphous germanium, amorphous silicon and nitrogen |
| US4544617A (en) * | 1983-11-02 | 1985-10-01 | Xerox Corporation | Electrophotographic devices containing overcoated amorphous silicon compositions |
| JPS60146251A (ja) * | 1984-01-10 | 1985-08-01 | Sharp Corp | 電子写真用感光体の製造方法 |
| US4619729A (en) | 1984-02-14 | 1986-10-28 | Energy Conversion Devices, Inc. | Microwave method of making semiconductor members |
| DE3506657A1 (de) * | 1984-02-28 | 1985-09-05 | Sharp K.K., Osaka | Photoleitfaehige vorrichtung |
| DE3511315A1 (de) * | 1984-03-28 | 1985-10-24 | Konishiroku Photo Industry Co., Ltd., Tokio/Tokyo | Elektrostatographisches, insbesondere elektrophotographisches aufzeichnungsmaterial |
| US4720443A (en) * | 1984-04-05 | 1988-01-19 | Canon Kabushiki Kaisha | Member having light receiving layer with nonparallel interfaces |
| JPS60212768A (ja) * | 1984-04-06 | 1985-10-25 | Canon Inc | 光受容部材 |
| US4603401A (en) * | 1984-04-17 | 1986-07-29 | University Of Pittsburgh | Apparatus and method for infrared imaging |
| US4602352A (en) * | 1984-04-17 | 1986-07-22 | University Of Pittsburgh | Apparatus and method for detection of infrared radiation |
| US4705732A (en) * | 1984-04-27 | 1987-11-10 | Canon Kabushiki Kaisha | Member having substrate with projecting portions at surface and light receiving layer of amorphous silicon |
| JPS6129847A (ja) * | 1984-07-20 | 1986-02-10 | Minolta Camera Co Ltd | 電子写真感光体 |
| JPH071395B2 (ja) * | 1984-09-27 | 1995-01-11 | 株式会社東芝 | 電子写真感光体 |
| US4613556A (en) * | 1984-10-18 | 1986-09-23 | Xerox Corporation | Heterogeneous electrophotographic imaging members of amorphous silicon and silicon oxide |
| US4849315A (en) * | 1985-01-21 | 1989-07-18 | Xerox Corporation | Processes for restoring hydrogenated and halogenated amorphous silicon imaging members |
| JPS61221752A (ja) * | 1985-03-12 | 1986-10-02 | Sharp Corp | 電子写真感光体 |
| JPH0624238B2 (ja) * | 1985-04-16 | 1994-03-30 | キヤノン株式会社 | フォトセンサアレイの製造方法 |
| US4582773A (en) * | 1985-05-02 | 1986-04-15 | Energy Conversion Devices, Inc. | Electrophotographic photoreceptor and method for the fabrication thereof |
| US4741982A (en) * | 1985-09-13 | 1988-05-03 | Minolta Camera Kabushiki Kaisha | Photosensitive member having undercoat layer of amorphous carbon |
| US4743522A (en) * | 1985-09-13 | 1988-05-10 | Minolta Camera Kabushiki Kaisha | Photosensitive member with hydrogen-containing carbon layer |
| US4738912A (en) * | 1985-09-13 | 1988-04-19 | Minolta Camera Kabushiki Kaisha | Photosensitive member having an amorphous carbon transport layer |
| US5166018A (en) * | 1985-09-13 | 1992-11-24 | Minolta Camera Kabushiki Kaisha | Photosensitive member with hydrogen-containing carbon layer |
| US4749636A (en) * | 1985-09-13 | 1988-06-07 | Minolta Camera Kabushiki Kaisha | Photosensitive member with hydrogen-containing carbon layer |
| US4663258A (en) * | 1985-09-30 | 1987-05-05 | Xerox Corporation | Overcoated amorphous silicon imaging members |
| US4666806A (en) * | 1985-09-30 | 1987-05-19 | Xerox Corporation | Overcoated amorphous silicon imaging members |
| US4885226A (en) * | 1986-01-18 | 1989-12-05 | Sanyo Electric Co., Ltd. | Electrophotographic photosensitive sensor |
| US5000831A (en) * | 1987-03-09 | 1991-03-19 | Minolta Camera Kabushiki Kaisha | Method of production of amorphous hydrogenated carbon layer |
| US4916116A (en) * | 1987-05-06 | 1990-04-10 | Semiconductor Energy Laboratory Co., Ltd. | Method of adding a halogen element into oxide superconducting materials by ion injection |
| JPH02124578A (ja) * | 1988-10-11 | 1990-05-11 | Fuji Xerox Co Ltd | 電子写真感光体 |
| US4957602A (en) * | 1989-06-12 | 1990-09-18 | The United States Of America As Represented By The Secretary Of The Army | Method of modifying the dielectric properties of an organic polymer film |
| DE69326878T2 (de) * | 1992-12-14 | 2000-04-27 | Canon K.K., Tokio/Tokyo | Lichtempfindliches Element mit einer mehrschichtigen Schicht mit erhöhter Wasserstoff oder/und Halogenatom Konzentration im Grenzflächenbereich benachbarter Schichten |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2908123A1 (de) * | 1978-03-03 | 1979-09-06 | Canon Kk | Bildaufzeichnungsmaterial fuer elektrophotographie |
Family Cites Families (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3650737A (en) * | 1968-03-25 | 1972-03-21 | Ibm | Imaging method using photoconductive element having a protective coating |
| US3712810A (en) * | 1970-12-18 | 1973-01-23 | Xerox Corp | Ambipolar photoreceptor and method |
| US4317844A (en) * | 1975-07-28 | 1982-03-02 | Rca Corporation | Semiconductor device having a body of amorphous silicon and method of making the same |
| DE2746967C2 (de) * | 1977-10-19 | 1981-09-24 | Siemens AG, 1000 Berlin und 8000 München | Elektrofotographische Aufzeichnungstrommel |
| US4265991A (en) * | 1977-12-22 | 1981-05-05 | Canon Kabushiki Kaisha | Electrophotographic photosensitive member and process for production thereof |
| JPS6035059B2 (ja) * | 1977-12-22 | 1985-08-12 | キヤノン株式会社 | 電子写真感光体およびその製造方法 |
| JPS54143645A (en) * | 1978-04-28 | 1979-11-09 | Canon Inc | Image forming member for electrophotography |
| US4217374A (en) * | 1978-03-08 | 1980-08-12 | Energy Conversion Devices, Inc. | Amorphous semiconductors equivalent to crystalline semiconductors |
| US4226898A (en) * | 1978-03-16 | 1980-10-07 | Energy Conversion Devices, Inc. | Amorphous semiconductors equivalent to crystalline semiconductors produced by a glow discharge process |
| JPS54145539A (en) * | 1978-05-04 | 1979-11-13 | Canon Inc | Electrophotographic image forming material |
| JPS54145541A (en) * | 1978-05-04 | 1979-11-13 | Canon Inc | Electrophotographic image forming material |
| JPS54145540A (en) * | 1978-05-04 | 1979-11-13 | Canon Inc | Electrophotographic image forming material |
| JPS54145537A (en) * | 1978-05-04 | 1979-11-13 | Canon Inc | Preparation of electrophotographic image forming material |
| JPS54155046A (en) * | 1978-05-26 | 1979-12-06 | Canon Inc | Method of manufacturing electrophotographic image forming material |
| JPS554040A (en) * | 1978-06-26 | 1980-01-12 | Hitachi Ltd | Photoconductive material |
| JPS557761A (en) * | 1978-07-03 | 1980-01-19 | Canon Inc | Image forming member for electrophotography |
| JPS5820426B2 (ja) * | 1978-10-17 | 1983-04-22 | キヤノン株式会社 | 電子写真感光体 |
| JPS5562779A (en) * | 1978-11-01 | 1980-05-12 | Canon Inc | Preparation of amorphous photoconductive portion material |
| JPS5562780A (en) * | 1978-11-01 | 1980-05-12 | Canon Inc | Preparation of amorphous photoconductive portion material |
| JPS5562781A (en) * | 1978-11-01 | 1980-05-12 | Canon Inc | Preparation of amorphous photoconductive portion material |
| JPS5569149A (en) * | 1978-11-17 | 1980-05-24 | Matsushita Electric Ind Co Ltd | Electrophotographic photosensitive plate |
| JPS5589844A (en) * | 1978-12-28 | 1980-07-07 | Canon Inc | Electrophotographic photoreceptor |
| JPS5591885A (en) * | 1978-12-28 | 1980-07-11 | Canon Inc | Amorphous silicon hydride photoconductive layer |
| JPS5591884A (en) * | 1978-12-28 | 1980-07-11 | Canon Inc | Manufacture of amorphous photoconductive component |
| US4253882A (en) * | 1980-02-15 | 1981-03-03 | University Of Delaware | Multiple gap photovoltaic device |
| JPS574053A (en) * | 1980-06-09 | 1982-01-09 | Canon Inc | Photoconductive member |
| JPS5727263A (en) * | 1980-07-28 | 1982-02-13 | Hitachi Ltd | Electrophotographic photosensitive film |
-
1981
- 1981-09-22 US US06/304,568 patent/US4394426A/en not_active Expired - Lifetime
- 1981-09-24 AU AU75648/81A patent/AU554181B2/en not_active Expired
- 1981-09-24 GB GB8128841A patent/GB2087643B/en not_active Expired
- 1981-09-25 DE DE813152399A patent/DE3152399A1/de active Granted
- 1981-09-25 WO PCT/JP1981/000256 patent/WO1982001261A1/ja not_active Ceased
- 1981-09-25 FR FR8118123A patent/FR2490839B1/fr not_active Expired
- 1981-09-25 CA CA000386703A patent/CA1181628A/en not_active Expired
- 1981-09-25 NL NL8104426A patent/NL192142C/nl not_active IP Right Cessation
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2908123A1 (de) * | 1978-03-03 | 1979-09-06 | Canon Kk | Bildaufzeichnungsmaterial fuer elektrophotographie |
Also Published As
| Publication number | Publication date |
|---|---|
| AU7564881A (en) | 1982-04-01 |
| AU554181B2 (en) | 1986-08-14 |
| US4394426A (en) | 1983-07-19 |
| FR2490839A1 (fr) | 1982-03-26 |
| FR2490839B1 (fr) | 1986-05-23 |
| NL192142B (nl) | 1996-10-01 |
| WO1982001261A1 (en) | 1982-04-15 |
| NL8104426A (nl) | 1982-04-16 |
| NL192142C (nl) | 1997-02-04 |
| DE3152399A1 (en) | 1982-09-23 |
| CA1181628A (en) | 1985-01-29 |
| GB2087643A (en) | 1982-05-26 |
| GB2087643B (en) | 1985-06-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3152399C2 (enExample) | ||
| DE3136141C2 (enExample) | ||
| DE3116798C2 (enExample) | ||
| DE3143764C2 (enExample) | ||
| DE3201146C2 (enExample) | ||
| DE3215151C2 (enExample) | ||
| DE3151146C2 (enExample) | ||
| DE3201081C2 (enExample) | ||
| DE3140994C2 (enExample) | ||
| DE2954552C2 (enExample) | ||
| DE3247526C2 (de) | Lichtempfindliches Aufzeichnungsmaterial | |
| DE3304198C2 (enExample) | ||
| DE3305091C2 (enExample) | ||
| DE3248369C2 (enExample) | ||
| DE3433473C2 (enExample) | ||
| DE3346891C2 (enExample) | ||
| DE3046509C2 (enExample) | ||
| DE3209055C2 (enExample) | ||
| DE3200376C2 (enExample) | ||
| DE3204004C2 (enExample) | ||
| DE3303700C2 (enExample) | ||
| DE3751017T2 (de) | Lichtempfindliches Element mit verbesserten Bildformungseigenschaften. | |
| DE3433507C2 (enExample) | ||
| DE3309219C2 (enExample) | ||
| DE3447687C2 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |