DE2850994C2 - - Google Patents
Info
- Publication number
- DE2850994C2 DE2850994C2 DE19782850994 DE2850994A DE2850994C2 DE 2850994 C2 DE2850994 C2 DE 2850994C2 DE 19782850994 DE19782850994 DE 19782850994 DE 2850994 A DE2850994 A DE 2850994A DE 2850994 C2 DE2850994 C2 DE 2850994C2
- Authority
- DE
- Germany
- Prior art keywords
- optionally substituted
- carbon atoms
- monoazo dyes
- methyl
- alkyl radical
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000975 dye Substances 0.000 claims description 43
- -1 methoxyethyl Chemical group 0.000 claims description 31
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 23
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 17
- 125000004432 carbon atom Chemical group C* 0.000 claims description 16
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 claims description 16
- 125000003118 aryl group Chemical group 0.000 claims description 15
- 125000004104 aryloxy group Chemical group 0.000 claims description 11
- 230000008878 coupling Effects 0.000 claims description 11
- 238000010168 coupling process Methods 0.000 claims description 11
- 238000005859 coupling reaction Methods 0.000 claims description 11
- 125000003545 alkoxy group Chemical group 0.000 claims description 10
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 9
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 9
- 229910052794 bromium Inorganic materials 0.000 claims description 9
- 239000000460 chlorine Substances 0.000 claims description 9
- 229910052801 chlorine Inorganic materials 0.000 claims description 9
- 238000004043 dyeing Methods 0.000 claims description 9
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 9
- 239000000463 material Substances 0.000 claims description 9
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 8
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 8
- 239000000835 fiber Substances 0.000 claims description 8
- 238000007639 printing Methods 0.000 claims description 8
- 125000004423 acyloxy group Chemical group 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 125000005842 heteroatom Chemical group 0.000 claims description 7
- 229920000728 polyester Polymers 0.000 claims description 6
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 6
- 239000002202 Polyethylene glycol Substances 0.000 claims description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 5
- 229920001223 polyethylene glycol Polymers 0.000 claims description 5
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 claims description 5
- 125000005278 alkyl sulfonyloxy group Chemical group 0.000 claims description 4
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical group 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 3
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 229920002284 Cellulose triacetate Polymers 0.000 claims description 2
- NNLVGZFZQQXQNW-ADJNRHBOSA-N [(2r,3r,4s,5r,6s)-4,5-diacetyloxy-3-[(2s,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6s)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@H]1[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)OC(C)=O)COC(=O)C)[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O NNLVGZFZQQXQNW-ADJNRHBOSA-N 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims description 2
- 230000002209 hydrophobic effect Effects 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims 2
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 239000000243 solution Substances 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 6
- 239000003086 colorant Substances 0.000 description 5
- 239000006185 dispersion Substances 0.000 description 5
- 239000004744 fabric Substances 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 238000004040 coloring Methods 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 239000002657 fibrous material Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 239000004753 textile Substances 0.000 description 3
- ZMESHQOXZMOOQQ-UHFFFAOYSA-N 1-(naphthalen-1-ylmethyl)naphthalene Chemical compound C1=CC=C2C(CC=3C4=CC=CC=C4C=CC=3)=CC=CC2=C1 ZMESHQOXZMOOQQ-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 238000007792 addition Methods 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000007859 condensation product Substances 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000000859 sublimation Methods 0.000 description 2
- 230000008022 sublimation Effects 0.000 description 2
- 229920002994 synthetic fiber Polymers 0.000 description 2
- 239000004758 synthetic textile Substances 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- RELMFMZEBKVZJC-UHFFFAOYSA-N 1,2,3-trichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1Cl RELMFMZEBKVZJC-UHFFFAOYSA-N 0.000 description 1
- LHRIICYSGQGXSX-UHFFFAOYSA-N 2-chloro-4,6-dinitroaniline Chemical compound NC1=C(Cl)C=C([N+]([O-])=O)C=C1[N+]([O-])=O LHRIICYSGQGXSX-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- RXQNKKRGJJRMKD-UHFFFAOYSA-N 5-bromo-2-methylaniline Chemical compound CC1=CC=C(Br)C=C1N RXQNKKRGJJRMKD-UHFFFAOYSA-N 0.000 description 1
- ONMOULMPIIOVTQ-UHFFFAOYSA-N 98-47-5 Chemical compound OS(=O)(=O)C1=CC=CC([N+]([O-])=O)=C1 ONMOULMPIIOVTQ-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 229920000161 Locust bean gum Polymers 0.000 description 1
- WRQNANDWMGAFTP-UHFFFAOYSA-N Methylacetoacetic acid Chemical compound COC(=O)CC(C)=O WRQNANDWMGAFTP-UHFFFAOYSA-N 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000002262 Schiff base Substances 0.000 description 1
- 150000004753 Schiff bases Chemical class 0.000 description 1
- 229920006221 acetate fiber Polymers 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 239000000980 acid dye Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000012752 auxiliary agent Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- LLEMOWNGBBNAJR-UHFFFAOYSA-N biphenyl-2-ol Chemical compound OC1=CC=CC=C1C1=CC=CC=C1 LLEMOWNGBBNAJR-UHFFFAOYSA-N 0.000 description 1
- YXVFYQXJAXKLAK-UHFFFAOYSA-N biphenyl-4-ol Chemical compound C1=CC(O)=CC=C1C1=CC=CC=C1 YXVFYQXJAXKLAK-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 239000007857 degradation product Substances 0.000 description 1
- 150000008049 diazo compounds Chemical class 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000000986 disperse dye Substances 0.000 description 1
- GRWZHXKQBITJKP-UHFFFAOYSA-L dithionite(2-) Chemical compound [O-]S(=O)S([O-])=O GRWZHXKQBITJKP-UHFFFAOYSA-L 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000000711 locust bean gum Substances 0.000 description 1
- 235000010420 locust bean gum Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- KQGBYRNFIMZEBI-UHFFFAOYSA-N n-(3-amino-4-methoxyphenyl)propanamide Chemical compound CCC(=O)NC1=CC=C(OC)C(N)=C1 KQGBYRNFIMZEBI-UHFFFAOYSA-N 0.000 description 1
- ILGQIWVECKRNLJ-UHFFFAOYSA-N nitroso hydrogen sulfate;sulfuric acid Chemical compound OS(O)(=O)=O.OS(=O)(=O)ON=O ILGQIWVECKRNLJ-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000010665 pine oil Substances 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 229940096992 potassium oleate Drugs 0.000 description 1
- MLICVSDCCDDWMD-KVVVOXFISA-M potassium;(z)-octadec-9-enoate Chemical compound [K+].CCCCCCCC\C=C/CCCCCCCC([O-])=O MLICVSDCCDDWMD-KVVVOXFISA-M 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000002829 reductive effect Effects 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000005346 substituted cycloalkyl group Chemical group 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 238000010023 transfer printing Methods 0.000 description 1
- 229920006304 triacetate fiber Polymers 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/06—Monoazo dyes prepared by diazotising and coupling from coupling components containing amino as the only directing group
- C09B29/08—Amino benzenes
- C09B29/0805—Amino benzenes free of acid groups
- C09B29/0807—Amino benzenes free of acid groups characterised by the amino group
- C09B29/0809—Amino benzenes free of acid groups characterised by the amino group substituted amino group
- C09B29/0811—Amino benzenes free of acid groups characterised by the amino group substituted amino group further substituted alkylamino, alkenylamino, alkynylamino, cycloalkylamino aralkylamino or arylamino
- C09B29/0813—Amino benzenes free of acid groups characterised by the amino group substituted amino group further substituted alkylamino, alkenylamino, alkynylamino, cycloalkylamino aralkylamino or arylamino substituted by OH, O-C(=X)-R, O-C(=X)-X-R, O-R (X being O,S,NR; R being hydrocarbonyl)
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/06—Monoazo dyes prepared by diazotising and coupling from coupling components containing amino as the only directing group
- C09B29/08—Amino benzenes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| LU78596A LU78596A1 (de) | 1977-11-28 | 1977-11-28 | Monoazofarbstoffe,verfahren zu deren herstellung und ihre verwendung |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2850994A1 DE2850994A1 (de) | 1979-05-31 |
| DE2850994C2 true DE2850994C2 (enExample) | 1988-12-22 |
Family
ID=19728779
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782850994 Granted DE2850994A1 (de) | 1977-11-28 | 1978-11-24 | Monoazofarbstoffe, verfahren zu deren herstellung und ihre verwendung |
Country Status (7)
| Country | Link |
|---|---|
| JP (1) | JPS5483031A (enExample) |
| CA (1) | CA1242190A (enExample) |
| CH (1) | CH638551A5 (enExample) |
| DE (1) | DE2850994A1 (enExample) |
| FR (1) | FR2410023A1 (enExample) |
| GB (1) | GB2011456B (enExample) |
| LU (1) | LU78596A1 (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4210586A (en) * | 1978-06-23 | 1980-07-01 | Eastman Kodak Company | Disperse dyes from 2-bromo, chloro, or cyano-4,6-dinitroaniline and selected alkyl-3-(2'-alkoxy-5-alkanoylaminoanilino)butyrate or alkyl-4-(2'-alkoxy-5'-alkanoylaminoanilino)valerate |
| US5466791A (en) * | 1990-01-22 | 1995-11-14 | Cassella Aktiengesellschaft | Monoazo dyes, their preparation and use |
| DE4001671A1 (de) * | 1990-01-22 | 1991-07-25 | Cassella Ag | Monoazofarbstoffe, ihre herstellung und verwendung |
| JPH07232142A (ja) * | 1994-02-22 | 1995-09-05 | Kimura Chem Plants Co Ltd | 超音波振動洗浄装置 |
| JP6001398B2 (ja) * | 2012-09-28 | 2016-10-05 | 東海染工株式会社 | ポリアリレート繊維の染色方法 |
| CN103709787B (zh) * | 2013-09-05 | 2015-12-23 | 浙江吉华集团股份有限公司 | 一种偶氮型分散染料组合物的合成方法 |
Family Cites Families (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1260654B (de) * | 1962-07-11 | 1968-02-08 | Bayer Ag | Verfahren zur Herstellung von Monoazofarbstoffen |
| FR1361809A (fr) * | 1963-07-08 | 1964-05-22 | Bayer Ag | Colorants monoazoïques et leur procédé de fabrication |
| BE668829A (enExample) * | 1964-08-26 | |||
| FR1456744A (fr) * | 1964-08-26 | 1966-07-08 | Ici Ltd | Nouveaux colorants monoazoïques insolubles dans l'eau |
| GB1176797A (en) * | 1966-07-15 | 1970-01-07 | Ici Ltd | Water-insoluble Monoazo Dyestuffs |
| FR1531147A (fr) * | 1966-07-15 | 1968-06-28 | Ici Ltd | Colorants azoïques insolubles dans l'eau et procédé de fabrication desdits colorants |
| FR1533014A (fr) * | 1966-07-30 | 1968-07-12 | Hoechst Ag | Colorants mono-azoïques et leur préparation |
| US3558593A (en) * | 1966-07-30 | 1971-01-26 | Hoechst Ag | Water-insoluble monoazo dyestuffs and process for preparing them |
| DE1506528A1 (de) * | 1967-05-22 | 1969-07-24 | Mannesmann Ag | Kranhakengeschirr mit Schwerpunktsausgleich zum Umsetzen von Grossbehaltern |
| US3436113A (en) * | 1967-06-06 | 1969-04-01 | Pacific Coast Eng Co | Rotatable and convertible lifting spreader |
| GB1162878A (en) * | 1967-06-09 | 1969-08-27 | John Stevenson Thomson | Improvements relating to Cranes for Handling Containers |
| DE1781116A1 (de) * | 1967-11-15 | 1971-03-04 | Schwermaschb Verlade Und Trans | Lastdrehvorrichtung,insbesondere bei Seilzugkatzen fuer Containerumschlag |
| US3543952A (en) * | 1968-03-29 | 1970-12-01 | Kaiser Ind Corp | Container handling and storage system |
| GB1153607A (en) * | 1968-05-13 | 1969-05-29 | Kone Oy | Self-Levelling Lifting Frames for Containers |
| FR1600241A (enExample) * | 1968-12-31 | 1970-07-20 | ||
| US3598440A (en) * | 1969-03-18 | 1971-08-10 | Fruehauf Corp | Rotatable container-hoisting apparatus |
| US3656795A (en) * | 1970-06-30 | 1972-04-18 | Letourneau Inc | Spreader skew arrangement |
| US3789998A (en) * | 1972-01-17 | 1974-02-05 | Midland Ross Corp | Hoisting equipment including spreader with longitudinal and transverse tilting mechanism |
| US4035143A (en) * | 1972-11-04 | 1977-07-12 | Cassella Farbwerke Mainkur Aktiengesellschaft | Water-insoluble azo dyestuffs |
| GB1479644A (en) * | 1975-10-15 | 1977-07-13 | Ici Ltd | Disperse monoazo dyestuffs |
| NL7614360A (en) * | 1976-12-23 | 1978-06-27 | Stork Conrad Bv | Freight container lifting equipment - has rope reeved round pulley driving power generator supplying accumulator for actuating mechanism |
-
1977
- 1977-11-28 LU LU78596A patent/LU78596A1/de unknown
-
1978
- 1978-11-24 CA CA000316855A patent/CA1242190A/en not_active Expired
- 1978-11-24 DE DE19782850994 patent/DE2850994A1/de active Granted
- 1978-11-24 CH CH1206778A patent/CH638551A5/de not_active IP Right Cessation
- 1978-11-27 FR FR7833479A patent/FR2410023A1/fr active Granted
- 1978-11-27 GB GB7846133A patent/GB2011456B/en not_active Expired
- 1978-11-28 JP JP14613278A patent/JPS5483031A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| LU78596A1 (de) | 1979-06-13 |
| DE2850994A1 (de) | 1979-05-31 |
| FR2410023A1 (fr) | 1979-06-22 |
| CH638551A5 (de) | 1983-09-30 |
| GB2011456B (en) | 1982-06-30 |
| GB2011456A (en) | 1979-07-11 |
| JPS5483031A (en) | 1979-07-02 |
| JPS6256187B2 (enExample) | 1987-11-24 |
| CA1242190A (en) | 1988-09-20 |
| FR2410023B1 (enExample) | 1982-04-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2844299C2 (enExample) | ||
| DE1644328C3 (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| DE2850994C2 (enExample) | ||
| EP0038439A1 (de) | Farbstoffmischung, Verfahren zu ihrer Herstellung, sie enthaltende Farbstoffe und Verfahren zum Färben und Bedrucken von synthetischem, hydrophobem Fasermaterial | |
| DE1932810B2 (de) | Wasserunlösliche Monoazofarbstoffe und Verfahren zu deren Herstellung | |
| DE2524481A1 (de) | Verfahren zum faerben von synthetischen fasermaterialien | |
| DE3035912A1 (de) | Monoazoverbindungen und verfahren zum faerben von polyesterfasern | |
| DE2606716C2 (de) | Neue Dispersionsfarbstoffe | |
| DE3016301A1 (de) | Wasserunloesliche azofarbstoffe, verfahren zu ihrer herstellung und ihre verwendung | |
| DE2849995C3 (de) | Monoazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2013791A1 (en) | Yellow basic hydrazone dyes for polyacry-lonitrile etc | |
| DE2001821A1 (de) | Wasserunloesliche Monoazofarbstoffe | |
| DE1298661B (de) | Verfahren zur Herstellung in Wasser schwer loeslicher Dispersionsfarbstoffe | |
| DE2147811A1 (de) | In Wasser schwerlösliche Styrylfarbstoffe und deren Herstellung und Verwendung | |
| DE2103612C3 (de) | Wasserunlösliche Azofarbstoffe | |
| EP0434609A1 (de) | Verfahren zum Färben von Polyacrylnitrilmaterialien | |
| DE1923999C (de) | Verfahren zur Herstellung von Azoverbindungen und deren Verwendung zum Färben von Polyamiden und Leder | |
| EP0027930A2 (de) | Wasserunlösliche Azlactonfarbstoffe, Verfahren zu ihrer Herstellung und deren Verwendung zum Färben oder Bedrucken von synthetischen Fasermaterialien | |
| DE2234465C3 (de) | Farbstoffmischungen und Verfahren zum Färben und Bedrucken von Polyesterfasermaterialien | |
| DE4238231A1 (enExample) | ||
| DE2101912C3 (de) | In Wasser schwerlösliche Monoazofarbstoffe und deren Verwendung | |
| DE2139449A1 (de) | Verfahren zur Herstellung von Azoverbindungen und deren Verwendung | |
| DE2631525A1 (de) | Neue farbstoffe | |
| DE1644121A1 (de) | Verfahren zur Herstellung wasserunloeslicher A/ofarbstoffe | |
| DE2710653A1 (de) | Azo-verbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8128 | New person/name/address of the agent |
Representative=s name: SCHWABE, H., DIPL.-ING. SANDMAIR, K., DIPL.-CHEM. |
|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |