DE2718997A1 - Verfahren zur herstellung von 4,4'- isopropylidenbis (2,6-dibrom)phenol - Google Patents
Verfahren zur herstellung von 4,4'- isopropylidenbis (2,6-dibrom)phenolInfo
- Publication number
- DE2718997A1 DE2718997A1 DE19772718997 DE2718997A DE2718997A1 DE 2718997 A1 DE2718997 A1 DE 2718997A1 DE 19772718997 DE19772718997 DE 19772718997 DE 2718997 A DE2718997 A DE 2718997A DE 2718997 A1 DE2718997 A1 DE 2718997A1
- Authority
- DE
- Germany
- Prior art keywords
- bromine
- dibromo
- phenol
- isopropylidenebis
- preparation
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 14
- 238000002360 preparation method Methods 0.000 title claims description 5
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 title 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 15
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 15
- 229910052794 bromium Inorganic materials 0.000 claims description 15
- SSIZLKDLDKIHEV-UHFFFAOYSA-N 2,6-dibromophenol Chemical compound OC1=C(Br)C=CC=C1Br SSIZLKDLDKIHEV-UHFFFAOYSA-N 0.000 claims description 7
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 claims description 6
- BZSXEZOLBIJVQK-UHFFFAOYSA-N 2-methylsulfonylbenzoic acid Chemical compound CS(=O)(=O)C1=CC=CC=C1C(O)=O BZSXEZOLBIJVQK-UHFFFAOYSA-N 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- -1 alkali metal chlorates Chemical class 0.000 claims description 3
- 239000003960 organic solvent Substances 0.000 claims description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 2
- 239000011707 mineral Substances 0.000 claims description 2
- 239000000203 mixture Substances 0.000 claims description 2
- 230000031709 bromination Effects 0.000 claims 1
- 238000005893 bromination reaction Methods 0.000 claims 1
- 239000007795 chemical reaction product Substances 0.000 claims 1
- XTEGARKTQYYJKE-UHFFFAOYSA-M chlorate Inorganic materials [O-]Cl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-M 0.000 claims 1
- 239000012429 reaction media Substances 0.000 claims 1
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- VEORPZCZECFIRK-UHFFFAOYSA-N 3,3',5,5'-tetrabromobisphenol A Chemical compound C=1C(Br)=C(O)C(Br)=CC=1C(C)(C)C1=CC(Br)=C(O)C(Br)=C1 VEORPZCZECFIRK-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- KDVYCTOWXSLNNI-UHFFFAOYSA-N 4-t-Butylbenzoic acid Chemical compound CC(C)(C)C1=CC=C(C(O)=O)C=C1 KDVYCTOWXSLNNI-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- CODNYICXDISAEA-UHFFFAOYSA-N bromine monochloride Chemical compound BrCl CODNYICXDISAEA-UHFFFAOYSA-N 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C37/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring
- C07C37/62—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom of a six-membered aromatic ring by introduction of halogen; by substitution of halogen atoms by other halogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL1976189331A PL103336B1 (pl) | 1976-05-04 | 1976-05-04 | Sposob wytwarzania 4,4'-izopropylidenobis/2,6-dwubromo/fenolu |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2718997A1 true DE2718997A1 (de) | 1977-11-17 |
Family
ID=19976725
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19772718997 Withdrawn DE2718997A1 (de) | 1976-05-04 | 1977-04-28 | Verfahren zur herstellung von 4,4'- isopropylidenbis (2,6-dibrom)phenol |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4112242A (enExample) |
| JP (1) | JPS5390252A (enExample) |
| BE (1) | BE854063A (enExample) |
| DE (1) | DE2718997A1 (enExample) |
| FR (1) | FR2350321A1 (enExample) |
| GB (1) | GB1515661A (enExample) |
| IT (1) | IT1104770B (enExample) |
| NL (1) | NL7704775A (enExample) |
| PL (1) | PL103336B1 (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4451675A (en) * | 1982-07-16 | 1984-05-29 | The Dow Chemical Company | Preparation of alkylidenebis(dibromophenol) |
| US4661644A (en) * | 1985-09-09 | 1987-04-28 | The Dow Chemical Company | Brominated epoxyaromatic compounds |
| US4628124A (en) * | 1985-09-23 | 1986-12-09 | Ethyl Corporation | Tetrabromobisphenol-A process |
| US4783556A (en) * | 1985-09-23 | 1988-11-08 | Ethyl Corporation | Tetrabromobisphenol-A process |
| US5017728A (en) * | 1990-08-20 | 1991-05-21 | Ethyl Corporation | Tetrabromobisphenol-A process |
| US5107035A (en) * | 1990-11-15 | 1992-04-21 | Ethyl Corporation | Process for high purity tetrabromobisphenol-A |
| US5208389A (en) * | 1992-04-01 | 1993-05-04 | Ethyl Corporation | Process for high purity tetrabromobisphenol-A |
| US5283375A (en) * | 1992-04-01 | 1994-02-01 | Ethyl Corporation | Process for high purity tetrabromobisphenol-A |
| US6235946B1 (en) | 1995-03-06 | 2001-05-22 | Albemarle Corporation | Process for the preparation of tetrabromobisphenol-A |
| US5527971A (en) * | 1995-04-24 | 1996-06-18 | Albemarle Corporation | Process for the preparation of tetrabromobisphenol-A |
| DE69616525T2 (de) * | 1995-03-06 | 2002-05-08 | Albemarle Corp., Baton Rouge | Verfahren zur herstellung von tetrabrombisphenol-a |
| US6084136A (en) * | 1995-03-06 | 2000-07-04 | Albmarle Corporation | Process for the preparation of tetrabromobisphenol-A |
| US6084137A (en) * | 1995-03-06 | 2000-07-04 | Albemarle Corporation | Process for the preparation of tetrabromobisphenol-A |
| US6218584B1 (en) | 1995-03-06 | 2001-04-17 | Albemarle Corporation | Process for the preparation of tetrabromobisphenol-A |
| US6002050A (en) * | 1995-03-06 | 1999-12-14 | Albemarle Corporation | Process for the preparation of tetrabromobisphenol-A |
| US6147264A (en) * | 1999-04-08 | 2000-11-14 | Albemarle Corporation | Process for producing tetrabromobisphenol-A |
| US6365786B1 (en) * | 2001-01-22 | 2002-04-02 | Council Of Scientific And Industrial Research | Eco-friendly method of preparation of high purity tetrabromobisphenol-A |
| DE60127652T2 (de) * | 2001-01-22 | 2007-12-13 | Council Of Scientific And Industrial Research | Umweltfreundliches Verfahren zur Herstellung von hochreinem Tetrabrombisphenol-A |
| CN103896738B (zh) * | 2014-04-28 | 2016-05-11 | 潍坊汇韬化工有限公司 | 一种用气体溴制备2,4,6-三溴苯酚的装置及其工艺 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3012035A (en) * | 1959-02-24 | 1961-12-05 | Monsanto Chemicals | Ionic bromination of aromatic and aliphatic compounds without hbr formation |
| US3029291A (en) * | 1959-03-12 | 1962-04-10 | Dow Chemical Co | Method for making alkylidenebis |
| US3546302A (en) * | 1964-04-03 | 1970-12-08 | Dow Chemical Co | Process for brominating phenols |
| CH537350A (de) * | 1970-12-23 | 1973-05-31 | Sir Soc Italiana Resine Spa | Procedimento per la preparazione di beta,beta'-bis-(3,5--dibromo-4-ossifenil)-propano |
| DE2227439B2 (de) * | 1972-06-06 | 1977-05-05 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Chlorierung oder bromierung phenolischer verbindungen |
-
1976
- 1976-05-04 PL PL1976189331A patent/PL103336B1/pl unknown
-
1977
- 1977-04-25 US US05/790,568 patent/US4112242A/en not_active Expired - Lifetime
- 1977-04-28 DE DE19772718997 patent/DE2718997A1/de not_active Withdrawn
- 1977-04-28 BE BE177100A patent/BE854063A/xx unknown
- 1977-04-29 GB GB17913/77A patent/GB1515661A/en not_active Expired
- 1977-05-02 NL NL7704775A patent/NL7704775A/xx not_active Application Discontinuation
- 1977-05-03 IT IT23130/77A patent/IT1104770B/it active
- 1977-05-04 JP JP5088877A patent/JPS5390252A/ja active Pending
- 1977-05-04 FR FR7713532A patent/FR2350321A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| PL103336B1 (pl) | 1979-05-31 |
| PL189331A1 (pl) | 1978-01-02 |
| BE854063A (fr) | 1977-08-16 |
| NL7704775A (nl) | 1977-11-08 |
| GB1515661A (en) | 1978-06-28 |
| FR2350321B3 (enExample) | 1980-03-07 |
| US4112242A (en) | 1978-09-05 |
| FR2350321A1 (fr) | 1977-12-02 |
| JPS5390252A (en) | 1978-08-08 |
| IT1104770B (it) | 1985-10-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2718997A1 (de) | Verfahren zur herstellung von 4,4'- isopropylidenbis (2,6-dibrom)phenol | |
| DE3873983T2 (de) | Verfahren zur herstellung von halogenierten imiden. | |
| DE863937C (de) | Verfahren zur Herstellung von 1, 4-Dichlor- oder 1, 4-Dibrombutan | |
| DE1129957B (de) | Verfahren zur Herstellung von ª‰, ª‰'-Bis (3, 5-dibrom-4-oxyphenyl)-propan | |
| DE69401162T2 (de) | Verfahren zur Herstellung von Hydroxyphenylessigsäuren | |
| DE432801C (de) | Verfahren zur Herstellung von 2-Chlor-4-nitro-1-aminobenzol | |
| DE506280C (de) | Verfahren zur Herstellung von Monochloressigsaeure | |
| DE845503C (de) | Verfahren zur Herstellung von Chlormethylgruppen enthaltenden aromatischen Verbindungen | |
| DE702889C (de) | Verfahren zur Reinigung von Tetrachlorkohlenstoff | |
| DE486864C (de) | Verfahren zur Herstellung der 1-Halogennaphthyl-2-thioglykolsaeuren | |
| DE875201C (de) | Verfahren zur Herstellung von substituierten Arylvinylsulfonen | |
| DE949567C (de) | Verfahren zur Herstellung von ªŠ-Benzamido-ª‡-bromcapronsaeure und ihren Alkalisalzen | |
| DE3017339C2 (de) | Verfahen zur Herstellung von Difluormethoxyderivaten aromatischer Aldehyde | |
| DE2513952C2 (de) | Verfahren zur herstellung von monochlorbenzoesaeuren | |
| AT225696B (de) | Verfahren zur Herstellung von Bromderivaten aromatischer Kohlenwasserstoffe mit 4 und mehr Bromatomen im Molekül | |
| DE1217947B (de) | Verfahren zur Herstellung von 2, 3-Dichlorbutadien-(1, 3) | |
| AT218510B (de) | Verfahren zur Herstellung von 2, 6-Dichlorbenzalchlorid oder 2, 6-Dichlorbenzaldehyd | |
| DE1543781C3 (de) | Verfahren zur Herstellung von Alkylarylaminen | |
| DE747816C (de) | Verfahren zur Herstellung von Aminohalogenpropanolen | |
| DE1263781B (de) | Verfahren zur Herstellung von 2-Methoxy-3, 6-dichlorbenzoesaeure | |
| AT55401B (de) | Verfahren zur Herstellung von Karbaminsäureestern tertiärer Alkohole. | |
| DE406861C (de) | Gewinnung von Bromiden aus Brom | |
| AT165079B (de) | Verfahren zur Herstellung von Trimethyl-(beta-jodäthyl)-ammoniumjodid | |
| AT229301B (de) | Verfahren zur Chlorierung von o-Kresol | |
| DE1106746B (de) | Verfahren zur Herstellung von 2-p-Chlorphenyl-3-methyl-butandiol-(2, 3) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8139 | Disposal/non-payment of the annual fee |