DE2656344A1 - Ergolinderivate, ihre verwendung und herstellung - Google Patents
Ergolinderivate, ihre verwendung und herstellungInfo
- Publication number
- DE2656344A1 DE2656344A1 DE19762656344 DE2656344A DE2656344A1 DE 2656344 A1 DE2656344 A1 DE 2656344A1 DE 19762656344 DE19762656344 DE 19762656344 DE 2656344 A DE2656344 A DE 2656344A DE 2656344 A1 DE2656344 A1 DE 2656344A1
- Authority
- DE
- Germany
- Prior art keywords
- carbon atoms
- formula
- alkyl
- above meaning
- radical
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000004519 manufacturing process Methods 0.000 title claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 25
- 125000004432 carbon atom Chemical group C* 0.000 claims description 23
- 125000000217 alkyl group Chemical group 0.000 claims description 16
- 239000002253 acid Substances 0.000 claims description 12
- AWFDCTXCTHGORH-HGHGUNKESA-N 6-[4-[(6ar,9r,10ar)-5-bromo-7-methyl-6,6a,8,9,10,10a-hexahydro-4h-indolo[4,3-fg]quinoline-9-carbonyl]piperazin-1-yl]-1-methylpyridin-2-one Chemical class O=C([C@H]1CN([C@H]2[C@@H](C=3C=CC=C4NC(Br)=C(C=34)C2)C1)C)N(CC1)CCN1C1=CC=CC(=O)N1C AWFDCTXCTHGORH-HGHGUNKESA-N 0.000 claims description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 9
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 6
- 229910052794 bromium Inorganic materials 0.000 claims description 6
- 150000002367 halogens Chemical group 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- 125000001589 carboacyl group Chemical group 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 125000004076 pyridyl group Chemical group 0.000 claims description 4
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 3
- 125000004385 trihaloalkyl group Chemical group 0.000 claims description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 238000010534 nucleophilic substitution reaction Methods 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims 1
- 150000002431 hydrogen Chemical class 0.000 claims 1
- 229910052740 iodine Inorganic materials 0.000 claims 1
- 229940126601 medicinal product Drugs 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 238000000034 method Methods 0.000 description 9
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 150000008064 anhydrides Chemical class 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 239000011737 fluorine Substances 0.000 description 3
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- XWKFPIODWVPXLX-UHFFFAOYSA-N 2-methyl-5-methylpyridine Natural products CC1=CC=C(C)N=C1 XWKFPIODWVPXLX-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- 102000003946 Prolactin Human genes 0.000 description 2
- 108010057464 Prolactin Proteins 0.000 description 2
- 235000011054 acetic acid Nutrition 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- -1 monosubstituted phenyl Chemical group 0.000 description 2
- SSOLNOMRVKKSON-UHFFFAOYSA-N proguanil Chemical compound CC(C)\N=C(/N)N=C(N)NC1=CC=C(Cl)C=C1 SSOLNOMRVKKSON-UHFFFAOYSA-N 0.000 description 2
- 229940097325 prolactin Drugs 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 230000028327 secretion Effects 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 208000020401 Depressive disease Diseases 0.000 description 1
- 208000001287 Galactorrhea Diseases 0.000 description 1
- 206010017600 Galactorrhoea Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- JLVHTNZNKOSCNB-YSVLISHTSA-N Mesulergine Chemical compound C1=CC([C@H]2C[C@@H](CN(C)[C@@H]2C2)NS(=O)(=O)N(C)C)=C3C2=CN(C)C3=C1 JLVHTNZNKOSCNB-YSVLISHTSA-N 0.000 description 1
- 230000006181 N-acylation Effects 0.000 description 1
- 208000018737 Parkinson disease Diseases 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 150000001243 acetic acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000003291 dopaminomimetic effect Effects 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 150000004674 formic acids Chemical class 0.000 description 1
- 238000006170 formylation reaction Methods 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- LIAWOTKNAVAKCX-UHFFFAOYSA-N hydrazine;dihydrochloride Chemical compound Cl.Cl.NN LIAWOTKNAVAKCX-UHFFFAOYSA-N 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000006651 lactation Effects 0.000 description 1
- 125000005905 mesyloxy group Chemical group 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 125000001424 substituent group Chemical class 0.000 description 1
- 229960002317 succinimide Drugs 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 238000011282 treatment Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/04—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 8
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/24—Antidepressants
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/26—Psychostimulants, e.g. nicotine, cocaine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/04—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 8
- C07D457/06—Lysergic acid amides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/10—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with hetero atoms directly attached in position 8
- C07D457/12—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Neurosurgery (AREA)
- Biomedical Technology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Neurology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Psychiatry (AREA)
- Pain & Pain Management (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1668075A CH620441A5 (en) | 1975-12-23 | 1975-12-23 | Process for the preparation of novel ergoline compounds |
| CH618876 | 1976-05-18 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2656344A1 true DE2656344A1 (de) | 1977-07-07 |
| DE2656344C2 DE2656344C2 (enExample) | 1990-11-08 |
Family
ID=25699142
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19762656344 Granted DE2656344A1 (de) | 1975-12-23 | 1976-12-13 | Ergolinderivate, ihre verwendung und herstellung |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4348391A (enExample) |
| JP (1) | JPS5278900A (enExample) |
| AU (1) | AU514288B2 (enExample) |
| CA (1) | CA1092100A (enExample) |
| DE (1) | DE2656344A1 (enExample) |
| DK (2) | DK146205C (enExample) |
| ES (1) | ES454442A1 (enExample) |
| FI (1) | FI763587A7 (enExample) |
| FR (1) | FR2336135A1 (enExample) |
| GB (1) | GB1567484A (enExample) |
| HK (1) | HK3483A (enExample) |
| IE (1) | IE44242B1 (enExample) |
| IL (1) | IL51133A (enExample) |
| MY (1) | MY8400060A (enExample) |
| NL (1) | NL7614018A (enExample) |
| NZ (1) | NZ182934A (enExample) |
| PH (1) | PH14035A (enExample) |
| PT (1) | PT66006B (enExample) |
| SE (1) | SE432253B (enExample) |
| SG (1) | SG63382G (enExample) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1982000463A1 (en) * | 1980-07-25 | 1982-02-18 | Ag Sandoz | Ergoline derivatives,method for their preparation,pharmaceutical compositions containing them and their therapeutic application |
| EP0048695A1 (de) * | 1980-09-23 | 1982-03-31 | Sandoz Ag | Verfahren zur Isomerisierung von Ergolinderivaten |
| WO1983003758A1 (fr) * | 1982-05-03 | 1983-11-10 | Schering Aktiengesellschaft | Composition pharmaceutique a action cytostatique |
| DE3404400A1 (de) * | 1983-02-16 | 1984-08-16 | Sandoz-Patent-GmbH, 7850 Lörrach | Mutterkornalkoloide, ihre herstellung und verwendung |
| AT391317B (de) * | 1984-01-12 | 1990-09-25 | Sandoz Ag | Verfahren zur herstellung von neuen 8alpha-acylaminoergolinen |
| AT392945B (de) * | 1988-06-27 | 1991-07-10 | Gerhard Mader Ges M B H Ing | Lager- und transportbehaelter fuer schuettgueter und lose materialien |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE889713A (fr) * | 1980-07-25 | 1982-01-25 | Sandoz Sa | Nouveaux derives de l'ergoline, leur preparation et leur application comme medicaments |
| DE3101535A1 (de) * | 1981-01-14 | 1982-08-12 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Neue (2-halogen-ergolinyl)-n'.n'-diethyl-harnstoffderivate, verfahren zu ihrer herstellung und deren verwendung als arzneimittel |
| GB2112382B (en) * | 1981-11-06 | 1985-03-06 | Erba Farmitalia | Ergoline derivatives |
| DE3151912A1 (de) * | 1981-12-23 | 1983-06-30 | Schering Ag, 1000 Berlin Und 4619 Bergkamen | Neue ergolin-aminoderivate, verfahren zu ihrer herstellung und deren verwendung als arzneimittel |
| CH652719A5 (en) * | 1983-02-16 | 1985-11-29 | Sandoz Ag | Ergoline derivatives, their preparation and use |
| US4675322A (en) * | 1984-12-10 | 1987-06-23 | Eli Lilly And Company | 1-Substituted-6-n-propyl-8β-methylthio-methylergolines |
| CH666035A5 (de) * | 1984-12-24 | 1988-06-30 | Sandoz Ag | 8-alpha-acylaminoergolene. |
| HU193317B (en) * | 1985-06-12 | 1987-09-28 | Richter Gedeon Vegyeszet | Process for producing 2-bromo-alpha-ergochristin |
| US4801712A (en) * | 1985-06-24 | 1989-01-31 | Eli Lilly And Company | 2-Alkyl(or phenyl)thio-6-n-alkylergolines are dopamine D-1 antagonists without D-2 agonist activity |
| DE3535929A1 (de) * | 1985-10-04 | 1987-04-09 | Schering Ag | 1,2-disubstituierte ergolinderivate |
| HU196598B (en) * | 1986-04-25 | 1988-12-28 | Richter Gedeon Vegyeszet | Process for producing 1- and/or 8-substituted 2-halogenated ergoline derivatives and pharmaceutics comprising such compounds |
| GB8615471D0 (en) * | 1986-06-25 | 1986-07-30 | Erba Farmitalia | T-butyl ergoline derivatives |
| US4798834A (en) * | 1987-08-31 | 1989-01-17 | Eli Lilly And Company | Optionally substituted (3β-9,10-didehydro-2,3-dihydro ergoline as serotonergic function enhancement |
| IT1232692B (it) * | 1989-08-04 | 1992-03-04 | Poli Ind Chimica Spa | Derivati ergolinici con attivita' dopaminergica |
| AU2635599A (en) * | 1999-03-17 | 2000-10-04 | Eugen Eigenmann | Use of prolactin inhibitors for the treatment of fertility problems in animal species |
| WO2022153266A1 (en) | 2021-01-15 | 2022-07-21 | Beckley Psytech Limited | Ergoline analogues |
| US12264131B2 (en) | 2022-08-19 | 2025-04-01 | Beckley Psytech Limited | Pharmaceutically acceptable salts and compositions thereof |
| US12246005B2 (en) | 2023-06-13 | 2025-03-11 | Beckley Psytech Limited | 5-methoxy-n,n-dimethyltryptamine (5-MeO-DMT) formulations |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2530577A1 (de) * | 1974-07-19 | 1976-01-29 | Sandoz Ag | Neue organische verbindungen, ihre herstellung und verwendung |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2533698A (en) * | 1950-12-12 | Urethanes containing the lysergic | ||
| US3270020A (en) * | 1966-08-30 | Dihydro ergocornine | ||
| US3232943A (en) * | 1966-02-01 | Cyanoethyl ergolene and ergoline derivatives | ||
| US3185695A (en) * | 1965-05-25 | Dbwethyl-ergoline ii derivatives | ||
| US3218323A (en) * | 1965-11-16 | Esters of i,g-dimethyl-b-ergolenyl carbamic acid | ||
| US3245996A (en) * | 1966-04-12 | Cyanoethyl lysergol | ||
| CH415658A (de) * | 1962-06-18 | 1966-06-30 | Sandoz Ag | Verfahren zur Herstellung von neuen Urethanen |
| BE712054A (enExample) * | 1967-03-16 | 1968-07-15 | ||
| US3920664A (en) * | 1972-07-21 | 1975-11-18 | Lilly Co Eli | D-2-halo-6-alkyl-8-substituted ergolines and related compounds |
| US3880856A (en) * | 1973-06-29 | 1975-04-29 | Lilly Co Eli | Ergoline dimers |
| CS171480B1 (enExample) * | 1974-03-19 | 1976-10-29 | ||
| CH605936A5 (en) * | 1974-07-19 | 1978-10-13 | Sandoz Ag | 8-Alpha-(Amino-or cyanomethyl)-ergoline derivs |
| US3904757A (en) * | 1974-08-08 | 1975-09-09 | Lilly Co Eli | Treatment of parkinsonism |
| US3922347A (en) * | 1974-12-19 | 1975-11-25 | Lilly Co Eli | Method of inhibiting prolactin secretion with 8-acylaminoergolenes |
-
1976
- 1976-12-13 DE DE19762656344 patent/DE2656344A1/de active Granted
- 1976-12-14 FI FI763587A patent/FI763587A7/fi not_active Application Discontinuation
- 1976-12-14 DK DK562376A patent/DK146205C/da not_active IP Right Cessation
- 1976-12-15 SE SE7614085A patent/SE432253B/xx not_active IP Right Cessation
- 1976-12-17 NL NL7614018A patent/NL7614018A/xx not_active Application Discontinuation
- 1976-12-21 AU AU20793/76A patent/AU514288B2/en not_active Expired
- 1976-12-21 IL IL51133A patent/IL51133A/xx unknown
- 1976-12-21 IE IE2803/76A patent/IE44242B1/en unknown
- 1976-12-21 PH PH19276A patent/PH14035A/en unknown
- 1976-12-21 GB GB53303/76A patent/GB1567484A/en not_active Expired
- 1976-12-21 NZ NZ182934A patent/NZ182934A/xx unknown
- 1976-12-21 CA CA268,415A patent/CA1092100A/en not_active Expired
- 1976-12-21 ES ES454442A patent/ES454442A1/es not_active Expired
- 1976-12-22 PT PT66006A patent/PT66006B/pt unknown
- 1976-12-22 JP JP51153514A patent/JPS5278900A/ja active Granted
- 1976-12-22 FR FR7638697A patent/FR2336135A1/fr active Granted
-
1979
- 1979-12-21 DK DK554179A patent/DK554179A/da unknown
-
1980
- 1980-09-22 US US06/189,068 patent/US4348391A/en not_active Expired - Lifetime
-
1982
- 1982-12-23 SG SG633/82A patent/SG63382G/en unknown
-
1983
- 1983-01-20 HK HK34/83A patent/HK3483A/xx unknown
-
1984
- 1984-12-30 MY MY60/84A patent/MY8400060A/xx unknown
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2530577A1 (de) * | 1974-07-19 | 1976-01-29 | Sandoz Ag | Neue organische verbindungen, ihre herstellung und verwendung |
Non-Patent Citations (4)
| Title |
|---|
| Derwent 72488W/44 B02 * |
| J.Clin.Endocrinol.Metab.39 (1974) 579-584 * |
| J.Med.Chem.17 (1974) 300-307 * |
| J.Med.Chem.18 (1975) 892-895 * |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1982000463A1 (en) * | 1980-07-25 | 1982-02-18 | Ag Sandoz | Ergoline derivatives,method for their preparation,pharmaceutical compositions containing them and their therapeutic application |
| DE3127845A1 (de) * | 1980-07-25 | 1982-04-22 | Sandoz-Patent-GmbH, 7850 Lörrach | Ergolinderivate, verfahren zu deren herstellung, diese enthaltende pharmazeutische zusammensetzungen und ihre anwendung bei der therapeutischen behandlung |
| EP0048695A1 (de) * | 1980-09-23 | 1982-03-31 | Sandoz Ag | Verfahren zur Isomerisierung von Ergolinderivaten |
| WO1983003758A1 (fr) * | 1982-05-03 | 1983-11-10 | Schering Aktiengesellschaft | Composition pharmaceutique a action cytostatique |
| DE3404400A1 (de) * | 1983-02-16 | 1984-08-16 | Sandoz-Patent-GmbH, 7850 Lörrach | Mutterkornalkoloide, ihre herstellung und verwendung |
| AT391317B (de) * | 1984-01-12 | 1990-09-25 | Sandoz Ag | Verfahren zur herstellung von neuen 8alpha-acylaminoergolinen |
| AT392945B (de) * | 1988-06-27 | 1991-07-10 | Gerhard Mader Ges M B H Ing | Lager- und transportbehaelter fuer schuettgueter und lose materialien |
Also Published As
| Publication number | Publication date |
|---|---|
| PT66006B (fr) | 1978-07-06 |
| AU514288B2 (en) | 1981-02-05 |
| JPS6133031B2 (enExample) | 1986-07-31 |
| SG63382G (en) | 1983-09-09 |
| MY8400060A (en) | 1984-12-31 |
| NZ182934A (en) | 1978-12-18 |
| DK146205C (da) | 1983-12-27 |
| SE432253B (sv) | 1984-03-26 |
| NL7614018A (nl) | 1977-06-27 |
| PH14035A (en) | 1980-12-12 |
| CA1092100A (en) | 1980-12-23 |
| DK146205B (da) | 1983-07-25 |
| IL51133A (en) | 1981-11-30 |
| DE2656344C2 (enExample) | 1990-11-08 |
| GB1567484A (en) | 1980-05-14 |
| DK562376A (da) | 1977-06-24 |
| HK3483A (en) | 1983-01-20 |
| IL51133A0 (en) | 1977-02-28 |
| ES454442A1 (es) | 1978-03-01 |
| JPS5278900A (en) | 1977-07-02 |
| AU2079376A (en) | 1978-06-29 |
| SE7614085L (sv) | 1977-06-24 |
| DK554179A (da) | 1979-12-21 |
| IE44242B1 (en) | 1981-09-23 |
| FR2336135A1 (fr) | 1977-07-22 |
| US4348391A (en) | 1982-09-07 |
| PT66006A (fr) | 1977-01-01 |
| FI763587A7 (enExample) | 1977-06-24 |
| FR2336135B1 (enExample) | 1980-03-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2656344A1 (de) | Ergolinderivate, ihre verwendung und herstellung | |
| DE3856493T2 (de) | Alpha-ungesättigte Amine, ihre Herstellung und Verwendung | |
| DE1227445C2 (de) | Verfahren zur Herstellung von Harnstoffderivaten | |
| DE3546658C2 (enExample) | ||
| CH653989A5 (de) | Cyclobutendion-verbindungen. | |
| DE69131636T2 (de) | (6,7-substituierte-8-Alkoxy-1-cyclopropyl-1,4-dihydro-4-oxo-3-chinolinkarbonsäure-03,04)-bis(acyloxy-0)-Borate und ihre Salze sowie Methoden zu ihrer Herstellung | |
| DE2530577A1 (de) | Neue organische verbindungen, ihre herstellung und verwendung | |
| DE69224507T2 (de) | Beta-Oxo-Beta-Benzenepropanthioamidderivate | |
| DE2439455A1 (de) | 7-cyanmethylmercapto-, -sulfinylund sulfonylacetamidocephalosporine, ihre salze, verfahren zu ihrer herstellung und arzneimittel | |
| CH615929A5 (en) | Process for the preparation of novel ergoline compounds | |
| CH505097A (de) | Verfahren zur Herstellung heteroaromatischer Sulfone | |
| DE2554000A1 (de) | 6-methyl-8-(substituierte)methylergoline | |
| CH622518A5 (en) | Process for the preparation of novel ergoline compounds | |
| AT376221B (de) | Verfahren zur herstellung neuer ergolinderivate | |
| DE2412598C2 (de) | Verfahren zur Herstellung von 7-Alkoxycephalosporinen bzw. 6-Alkoxypenicillinen | |
| DE2620777A1 (de) | Neue derivate des 1-hydroxy-benzo-2,3, 1-diazaborins und verfahren zu deren herstellung | |
| DE3874698T2 (de) | 1-(3,5-diamino-2,4,6-trinitrophenyl)-3-nitro-1h-1,2,4-triazol, verfahren zu seiner herstellung und dieses enthaltender sprengstoff. | |
| DE2525962A1 (de) | Neue heterocyclische verbindungen, ihre herstellung und verwendung | |
| DE3434553C2 (enExample) | ||
| US2927925A (en) | Scopine and sgopoline esters of alpha | |
| DE3204074C2 (enExample) | ||
| DE2633782A1 (de) | Neue organische verbindungen, ihre herstellung und verwendung | |
| AT349484B (de) | Verfahren zur herstellung von neuen thieno- thiazinderivaten | |
| AT370102B (de) | Verfahren zur herstellung neuer ergolinderivate | |
| DE2635216A1 (de) | 4-hydorxy-3-nitropyrido eckige klammer auf 2,3-b eckige klammer zu pyridin2-one und ihre herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |