DE2556883C2 - Aromatische Copolyamide und deren Verwendung zur Herstellung von Fasern, Fäden, Filmen und Folien - Google Patents
Aromatische Copolyamide und deren Verwendung zur Herstellung von Fasern, Fäden, Filmen und FolienInfo
- Publication number
- DE2556883C2 DE2556883C2 DE2556883A DE2556883A DE2556883C2 DE 2556883 C2 DE2556883 C2 DE 2556883C2 DE 2556883 A DE2556883 A DE 2556883A DE 2556883 A DE2556883 A DE 2556883A DE 2556883 C2 DE2556883 C2 DE 2556883C2
- Authority
- DE
- Germany
- Prior art keywords
- solution
- mol
- aromatic
- den
- threads
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 125000003118 aryl group Chemical group 0.000 title claims description 51
- 239000000835 fiber Substances 0.000 title description 29
- 238000004519 manufacturing process Methods 0.000 title description 10
- -1 threads Substances 0.000 title description 8
- 239000011888 foil Substances 0.000 title description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 8
- 125000004427 diamine group Chemical group 0.000 claims description 7
- 239000000243 solution Substances 0.000 description 91
- 230000001112 coagulating effect Effects 0.000 description 29
- LXEJRKJRKIFVNY-UHFFFAOYSA-N terephthaloyl chloride Chemical compound ClC(=O)C1=CC=C(C(Cl)=O)C=C1 LXEJRKJRKIFVNY-UHFFFAOYSA-N 0.000 description 29
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 28
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 28
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 27
- 229920000642 polymer Polymers 0.000 description 25
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 21
- 238000006068 polycondensation reaction Methods 0.000 description 21
- 239000002904 solvent Substances 0.000 description 20
- 239000001110 calcium chloride Substances 0.000 description 19
- 229910001628 calcium chloride Inorganic materials 0.000 description 19
- ZBMISJGHVWNWTE-UHFFFAOYSA-N 3-(4-aminophenoxy)aniline Chemical compound C1=CC(N)=CC=C1OC1=CC=CC(N)=C1 ZBMISJGHVWNWTE-UHFFFAOYSA-N 0.000 description 17
- 238000003756 stirring Methods 0.000 description 17
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 16
- 238000009987 spinning Methods 0.000 description 16
- 239000000292 calcium oxide Substances 0.000 description 15
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 15
- 239000000203 mixture Substances 0.000 description 14
- 229910052757 nitrogen Inorganic materials 0.000 description 13
- 238000006243 chemical reaction Methods 0.000 description 12
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 12
- 230000000052 comparative effect Effects 0.000 description 11
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 11
- 239000004952 Polyamide Substances 0.000 description 10
- 238000001035 drying Methods 0.000 description 10
- 229920002647 polyamide Polymers 0.000 description 10
- 150000003839 salts Chemical class 0.000 description 10
- 238000002474 experimental method Methods 0.000 description 9
- 238000001125 extrusion Methods 0.000 description 9
- 238000000034 method Methods 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 8
- 239000004760 aramid Substances 0.000 description 8
- 229920003235 aromatic polyamide Polymers 0.000 description 8
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 8
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 8
- 239000003960 organic solvent Substances 0.000 description 8
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 7
- 239000002253 acid Substances 0.000 description 7
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 7
- 238000010438 heat treatment Methods 0.000 description 7
- 229940018564 m-phenylenediamine Drugs 0.000 description 7
- 239000000178 monomer Substances 0.000 description 7
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 6
- 239000006227 byproduct Substances 0.000 description 5
- 229910017053 inorganic salt Inorganic materials 0.000 description 5
- 230000003472 neutralizing effect Effects 0.000 description 5
- 229920003366 poly(p-phenylene terephthalamide) Polymers 0.000 description 5
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 4
- HLBLWEWZXPIGSM-UHFFFAOYSA-N 4-Aminophenyl ether Chemical compound C1=CC(N)=CC=C1OC1=CC=C(N)C=C1 HLBLWEWZXPIGSM-UHFFFAOYSA-N 0.000 description 4
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 4
- 239000000370 acceptor Substances 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- 150000004984 aromatic diamines Chemical class 0.000 description 4
- 239000011575 calcium Substances 0.000 description 4
- 150000004985 diamines Chemical class 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 229910000039 hydrogen halide Inorganic materials 0.000 description 4
- 239000012433 hydrogen halide Substances 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 239000012299 nitrogen atmosphere Substances 0.000 description 4
- 239000003791 organic solvent mixture Substances 0.000 description 4
- 230000004580 weight loss Effects 0.000 description 4
- 238000004804 winding Methods 0.000 description 4
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 230000015271 coagulation Effects 0.000 description 3
- 238000005345 coagulation Methods 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 229920006240 drawn fiber Polymers 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 229910001629 magnesium chloride Inorganic materials 0.000 description 3
- 229910001507 metal halide Inorganic materials 0.000 description 3
- 150000005309 metal halides Chemical class 0.000 description 3
- 230000000737 periodic effect Effects 0.000 description 3
- 239000002798 polar solvent Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 238000002166 wet spinning Methods 0.000 description 3
- 239000011592 zinc chloride Substances 0.000 description 3
- 235000005074 zinc chloride Nutrition 0.000 description 3
- LNWWQYYLZVZXKS-UHFFFAOYSA-N 1-pyrrolidin-1-ylethanone Chemical compound CC(=O)N1CCCC1 LNWWQYYLZVZXKS-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- ZWXPDGCFMMFNRW-UHFFFAOYSA-N N-methylcaprolactam Chemical compound CN1CCCCCC1=O ZWXPDGCFMMFNRW-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- IYXMNTLBLQNMLM-UHFFFAOYSA-N benzene-1,4-diamine;hydron;dichloride Chemical compound Cl.Cl.NC1=CC=C(N)C=C1 IYXMNTLBLQNMLM-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 229920001971 elastomer Polymers 0.000 description 2
- 230000009477 glass transition Effects 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 150000002736 metal compounds Chemical class 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 2
- 239000005060 rubber Substances 0.000 description 2
- MHSKRLJMQQNJNC-UHFFFAOYSA-N terephthalamide Chemical compound NC(=O)C1=CC=C(C(N)=O)C=C1 MHSKRLJMQQNJNC-UHFFFAOYSA-N 0.000 description 2
- ONDPHDOFVYQSGI-UHFFFAOYSA-N zinc nitrate Chemical compound [Zn+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ONDPHDOFVYQSGI-UHFFFAOYSA-N 0.000 description 2
- BNGXYYYYKUGPPF-UHFFFAOYSA-M (3-methylphenyl)methyl-triphenylphosphanium;chloride Chemical compound [Cl-].CC1=CC=CC(C[P+](C=2C=CC=CC=2)(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 BNGXYYYYKUGPPF-UHFFFAOYSA-M 0.000 description 1
- CSDQQAQKBAQLLE-UHFFFAOYSA-N 4-(4-chlorophenyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine Chemical compound C1=CC(Cl)=CC=C1C1C(C=CS2)=C2CCN1 CSDQQAQKBAQLLE-UHFFFAOYSA-N 0.000 description 1
- FJVIHKKXPLPDSV-UHFFFAOYSA-N 4-phenoxybenzene-1,2-diamine Chemical compound C1=C(N)C(N)=CC=C1OC1=CC=CC=C1 FJVIHKKXPLPDSV-UHFFFAOYSA-N 0.000 description 1
- 241000239290 Araneae Species 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 229910021586 Nickel(II) chloride Inorganic materials 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001508 alkali metal halide Inorganic materials 0.000 description 1
- 229910001615 alkaline earth metal halide Inorganic materials 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 238000010936 aqueous wash Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910001622 calcium bromide Inorganic materials 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- WGEFECGEFUFIQW-UHFFFAOYSA-L calcium dibromide Chemical compound [Ca+2].[Br-].[Br-] WGEFECGEFUFIQW-UHFFFAOYSA-L 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 239000000701 coagulant Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 101150044757 danr gene Proteins 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 229910003460 diamond Inorganic materials 0.000 description 1
- 239000010432 diamond Substances 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- GUVUOGQBMYCBQP-UHFFFAOYSA-N dmpu Chemical compound CN1CCCN(C)C1=O GUVUOGQBMYCBQP-UHFFFAOYSA-N 0.000 description 1
- 238000000578 dry spinning Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000010408 film Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000005067 haloformyl group Chemical group 0.000 description 1
- 239000012210 heat-resistant fiber Substances 0.000 description 1
- 229920006017 homo-polyamide Polymers 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 239000011810 insulating material Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- XGZVUEUWXADBQD-UHFFFAOYSA-L lithium carbonate Chemical compound [Li+].[Li+].[O-]C([O-])=O XGZVUEUWXADBQD-UHFFFAOYSA-L 0.000 description 1
- 229910052808 lithium carbonate Inorganic materials 0.000 description 1
- 229910000103 lithium hydride Inorganic materials 0.000 description 1
- OTCKOJUMXQWKQG-UHFFFAOYSA-L magnesium bromide Chemical compound [Mg+2].[Br-].[Br-] OTCKOJUMXQWKQG-UHFFFAOYSA-L 0.000 description 1
- 229910001623 magnesium bromide Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- AJFDBNQQDYLMJN-UHFFFAOYSA-N n,n-diethylacetamide Chemical compound CCN(CC)C(C)=O AJFDBNQQDYLMJN-UHFFFAOYSA-N 0.000 description 1
- ZCOGQSHZVSZAHH-UHFFFAOYSA-N n,n-dimethylaziridine-1-carboxamide Chemical compound CN(C)C(=O)N1CC1 ZCOGQSHZVSZAHH-UHFFFAOYSA-N 0.000 description 1
- QMMRZOWCJAIUJA-UHFFFAOYSA-L nickel dichloride Chemical compound Cl[Ni]Cl QMMRZOWCJAIUJA-UHFFFAOYSA-L 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 235000010333 potassium nitrate Nutrition 0.000 description 1
- 239000004323 potassium nitrate Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 230000002787 reinforcement Effects 0.000 description 1
- 239000012779 reinforcing material Substances 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 229910001631 strontium chloride Inorganic materials 0.000 description 1
- AHBGXTDRMVNFER-UHFFFAOYSA-L strontium dichloride Chemical compound [Cl-].[Cl-].[Sr+2] AHBGXTDRMVNFER-UHFFFAOYSA-L 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 230000003685 thermal hair damage Effects 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G69/00—Macromolecular compounds obtained by reactions forming a carboxylic amide link in the main chain of the macromolecule
- C08G69/02—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids
- C08G69/26—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids derived from polyamines and polycarboxylic acids
- C08G69/32—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids derived from polyamines and polycarboxylic acids from aromatic diamines and aromatic dicarboxylic acids with both amino and carboxylic groups aromatically bound
-
- D—TEXTILES; PAPER
- D01—NATURAL OR MAN-MADE THREADS OR FIBRES; SPINNING
- D01F—CHEMICAL FEATURES IN THE MANUFACTURE OF ARTIFICIAL FILAMENTS, THREADS, FIBRES, BRISTLES OR RIBBONS; APPARATUS SPECIALLY ADAPTED FOR THE MANUFACTURE OF CARBON FILAMENTS
- D01F6/00—Monocomponent artificial filaments or the like of synthetic polymers; Manufacture thereof
- D01F6/78—Monocomponent artificial filaments or the like of synthetic polymers; Manufacture thereof from copolycondensation products
- D01F6/80—Monocomponent artificial filaments or the like of synthetic polymers; Manufacture thereof from copolycondensation products from copolyamides
- D01F6/805—Monocomponent artificial filaments or the like of synthetic polymers; Manufacture thereof from copolycondensation products from copolyamides from aromatic copolyamides
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- General Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Polyamides (AREA)
- Artificial Filaments (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP14902774A JPS5176386A (ja) | 1974-12-27 | 1974-12-27 | Hokozokuhoriamidonoseizoho |
| JP5920075A JPS51134743A (en) | 1975-05-20 | 1975-05-20 | Aromatic polyamide solution |
| JP5920175A JPS51136916A (en) | 1975-05-20 | 1975-05-20 | Aromatic polyamide fibers and method of manuf acturing the same |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2556883A1 DE2556883A1 (de) | 1976-07-01 |
| DE2556883C2 true DE2556883C2 (de) | 1981-11-26 |
Family
ID=27296804
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2556883A Expired DE2556883C2 (de) | 1974-12-27 | 1975-12-17 | Aromatische Copolyamide und deren Verwendung zur Herstellung von Fasern, Fäden, Filmen und Folien |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4075172A (esLanguage) |
| AU (1) | AU500143B2 (esLanguage) |
| BR (1) | BR7508668A (esLanguage) |
| CA (1) | CA1070447A (esLanguage) |
| DE (1) | DE2556883C2 (esLanguage) |
| ES (1) | ES443888A1 (esLanguage) |
| FR (1) | FR2295977A1 (esLanguage) |
| GB (1) | GB1501948A (esLanguage) |
| IT (1) | IT1051943B (esLanguage) |
| NL (1) | NL175830C (esLanguage) |
| NZ (1) | NZ179586A (esLanguage) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0790335A1 (de) | 1996-02-15 | 1997-08-20 | Hoechst Trevira GmbH & Co. KG | Schnittresistente Aramidfasern, Garne enthaltend diese Aramidfasern und dieser Verwendung |
Families Citing this family (48)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL157327C (nl) * | 1975-02-21 | 1984-05-16 | Akzo Nv | Werkwijze ter bereiding van poly-p-fenyleentereftaalamide. |
| DE2554932A1 (de) * | 1975-12-06 | 1977-06-08 | Bayer Ag | Semipermeable membranen aus copolyamiden |
| US4162346A (en) * | 1976-09-23 | 1979-07-24 | Celanese Corporation | High performance wholly aromatic polyamide fibers |
| US4297479A (en) * | 1977-04-27 | 1981-10-27 | Rhone-Poulenc-Textile | Process for the continuous production of aromatic polyamides in a mixture of calcium chloride and N-methylpyrrolidone-2 |
| FR2388844A1 (fr) * | 1977-04-27 | 1978-11-24 | Rhone Poulenc Textile | Procede d'obtention en discontinu de polymeres derives de para-phenylenediamine |
| US4245082A (en) * | 1979-07-09 | 1981-01-13 | E. I. Du Pont De Nemours And Company | Polyesters derived from 3,4'-dihydroxy-benzophenones or 3-hydroxy-4'-(4-hydroxyphenyl-)benzophenone and certain aromatic dicarboxylic acids and filaments thereof |
| JPS55115428A (en) * | 1979-02-26 | 1980-09-05 | Teijin Ltd | Aromatic compolyamide and preparation thereof |
| JPS56107073A (en) * | 1980-01-22 | 1981-08-25 | Teijin Ltd | Improved all aromatic polyamide fiber and cloth |
| JPS5734125A (en) * | 1980-08-07 | 1982-02-24 | Teijin Ltd | Fully aromatic polyamide fiber and film and their production |
| US4532275A (en) * | 1981-02-03 | 1985-07-30 | Teijin Limited | Fiber-reinforced composite materials |
| JPS60231873A (ja) * | 1984-04-26 | 1985-11-18 | 帝人株式会社 | 全芳香族ポリアミド繊維 |
| DE3674620D1 (de) * | 1985-03-23 | 1990-11-08 | Hoechst Ag | Geformte gebilde aus aromatischen copolyamiden und verfahren zu ihrer herstellung. |
| JPS62116303A (ja) * | 1985-11-18 | 1987-05-27 | Bridgestone Corp | 重車両用空気入りタイヤ |
| US4952669A (en) * | 1988-09-30 | 1990-08-28 | Hoechst Celanese Corp. | Copolyimides prepared from 2-(3-aminophenyl)-2-(4-aminophenyl) Hexafluoro propane |
| US4914180A (en) * | 1988-09-30 | 1990-04-03 | Hoechst Celanese Corporation | Polyamides prepared from 2-(3-aminophenyl)-2-(4-aminophenyl) hexafluoro propane |
| US4978742A (en) * | 1988-09-30 | 1990-12-18 | Hoechst Celanese Corp. | Polymers prepared from 2-(3-aminophenyl)-2-(4-aminophenyl) hexafluoro propane |
| DE3835419A1 (de) * | 1988-10-18 | 1990-04-19 | Hoechst Ag | Vollaromatische polyamide, verfahren zu ihrer herstellung und daraus geformte gebilde |
| DE3835441A1 (de) * | 1988-10-18 | 1990-04-26 | Hoechst Ag | Vollaromatische polyamide, verfahren zu ihrer herstellung und daraus geformte gebilde |
| DE3835405A1 (de) * | 1988-10-18 | 1990-05-03 | Hoechst Ag | Vollaromatische polyamide, verfahren zu ihrer herstellung und daraus geformte gebilde |
| US4869947A (en) * | 1988-12-21 | 1989-09-26 | E. I. Du Pont De Nemours And Company | Laminated fabric for protective clothing |
| US4980446A (en) * | 1989-03-16 | 1990-12-25 | E. I. Du Pont De Nemours And Company | Melt-processible aromatic containing copolyamide from 3,4'-bis (amino phenyl)ether |
| JPH03143922A (ja) * | 1989-10-30 | 1991-06-19 | Teijin Ltd | 全芳香族共重合ポリアミド及びその成形物 |
| DE4007142A1 (de) * | 1990-03-07 | 1991-09-12 | Hoechst Ag | Aromatische copolyamide, verfahren zu ihrer herstellung und daraus geformte gebilde |
| DE4138872B4 (de) * | 1990-03-30 | 2005-12-29 | E.I. Du Pont De Nemours And Co., Wilmington | Verstreckbare Aramide hoher Zugfestigkeit |
| US5459231A (en) * | 1990-03-30 | 1995-10-17 | E. I. Du Pont De Nemours And Company | Drawable high tensile strength aramids |
| US5266672A (en) * | 1991-07-02 | 1993-11-30 | Hoechst Aktiengesellschaft | Aromatic copolyaide from diamino benzanilide |
| JPH05163610A (ja) * | 1991-12-18 | 1993-06-29 | Teijin Ltd | 芳香族ポリアミド偏平繊維 |
| US5334694A (en) * | 1992-01-27 | 1994-08-02 | Hoechst Aktiengesellschaft | Aromatic copolyamides, processes for their preparation and structures formed therefrom |
| EP0568912B1 (en) * | 1992-05-07 | 1996-11-13 | Teijin Limited | Aromatic polyamide filament having an enhanced weathering resistance |
| DE4421650A1 (de) | 1994-06-21 | 1996-01-04 | Hoechst Ag | Formkörper enthaltend Garne oder Bänder aus Fasern aus aromatischen Polyamiden, Garne oder Bänder aus aromatischen Polyamiden, sowie Verwendung dieser Garne zur Verstärkung von Polymerbeton oder von hydraulisch oder an der Luft abbindenden Materialien |
| DE4443456A1 (de) | 1994-12-07 | 1996-07-04 | Hoechst Trevira Gmbh & Co Kg | Zweikomponenten-Schlingengarne aus Aramidfilamenten, Verfahren zu deren Herstellung und deren Verwendung |
| DE19606959A1 (de) | 1996-02-26 | 1997-09-04 | Hoechst Trevira Gmbh & Co Kg | Faserpulp, Verfahren zu dessen Herstellung und dessen Verwendung |
| JP3142777B2 (ja) * | 1996-05-22 | 2001-03-07 | 帝人株式会社 | 芳香族ポリアミド剛毛 |
| KR100448034B1 (ko) * | 1997-05-20 | 2005-06-01 | 데이진 가부시키가이샤 | 이축배향적층전방향족폴리아미드막및자기기록매체 |
| TW590877B (en) | 1997-10-27 | 2004-06-11 | Teijin Ltd | Biaxially oriented film and magnetic recording medium comprising the same as a base film |
| WO1999053483A1 (en) | 1998-04-13 | 1999-10-21 | Teijin Limited | Aromatic polyamide film for high-density magnetic recording medium |
| JP3475234B2 (ja) * | 1998-10-15 | 2003-12-08 | 帝人テクノプロダクツ株式会社 | 芳香族ポリアミド繊維紙 |
| DE69908530T2 (de) | 1998-10-15 | 2004-05-06 | Teijin Ltd. | Synthetisches Papier aus vollaromatischen Polyamidfasern |
| CA2517957C (en) | 2003-03-05 | 2012-01-24 | Toray Industries, Inc. | Aromatic polymer, film, electrolyte membrane and separator |
| US7803247B2 (en) * | 2007-12-21 | 2010-09-28 | E.I. Du Pont De Nemours And Company | Papers containing floc derived from diamino diphenyl sulfone |
| US8118975B2 (en) * | 2007-12-21 | 2012-02-21 | E. I. Du Pont De Nemours And Company | Papers containing fibrids derived from diamino diphenyl sulfone |
| US8114251B2 (en) * | 2007-12-21 | 2012-02-14 | E.I. Du Pont De Nemours And Company | Papers containing fibrids derived from diamino diphenyl sulfone |
| EP2663679B1 (en) * | 2011-01-13 | 2018-03-21 | E. I. du Pont de Nemours and Company | Production of and drying of copolymer fibers |
| DE102011003958A1 (de) | 2011-02-10 | 2012-08-16 | Papierfabrik Schoellershammer Heinr. Aug. Schoeller Söhne GmbH & Co. KG | Zellstoffbasierte hitzebeständige Papiere mit hoher Durchschlagsfestigkeit und Verfahren zur Herstellung derselben |
| EP3026148B1 (en) * | 2014-11-27 | 2019-02-13 | Teijin Limited | Cord comprising a fully aromatic polyamide fiber |
| RU2659975C1 (ru) * | 2017-09-07 | 2018-07-04 | Тамара Курмангазиевна Мусина | Нить на основе ароматического гетероциклического сополиамида с улучшенными эластическими свойствами и способ ее получения |
| CN114053890B (zh) * | 2021-12-09 | 2023-07-18 | 天津工业大学 | 一种高性能耐碱纳滤膜及其制备方法 |
| CN118047945B (zh) * | 2024-04-16 | 2024-06-25 | 烟台泰和新材高分子新材料研究院有限公司 | 一种高粘度芳香族聚酰胺共聚原液及制备方法和应用 |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL108880C (esLanguage) * | 1957-02-28 | |||
| NL108288C (esLanguage) * | 1957-02-28 | |||
| US3322728A (en) * | 1963-06-17 | 1967-05-30 | Du Pont | Sulfonyl aromatic polyamides |
| US3354125A (en) * | 1963-07-29 | 1967-11-21 | Monsanto Co | Polymers from diaminobenzanilides |
| NL133092C (esLanguage) * | 1965-05-21 | |||
| US3354127A (en) * | 1966-04-18 | 1967-11-21 | Du Pont | Aromatic copolyamides |
| DE1720984A1 (de) * | 1966-08-03 | 1971-07-22 | Ici Ltd | Polyamide und Verfahren zu deren Herstellung |
| DE1595681A1 (de) * | 1966-09-19 | 1970-01-22 | Bayer Ag | Verfahren zur Herstellung von hochschmelzenden Polyamiden |
| US3498955A (en) * | 1967-07-06 | 1970-03-03 | Monsanto Co | Neutralization of polymerization solutions of aromatic polyamides |
| GB1201531A (en) * | 1968-01-24 | 1970-08-05 | Ici Ltd | Aromatic polyamides |
| GB1254005A (en) * | 1969-05-02 | 1971-11-17 | Ici Ltd | Copolyamides and their production |
| DE2037254A1 (de) * | 1970-07-28 | 1972-02-03 | Farbwerke Hoechst AG, vorm. Meister Lucius & Brüning, 6000 Frankfurt | Verfahren zur Herstellung von Fäden aus hochschmelzenden Polyamiden |
| CH545861A (esLanguage) * | 1971-02-11 | 1974-02-15 | ||
| US3738964A (en) * | 1972-05-31 | 1973-06-12 | Monsanto Co | Aromatic polyamides derived from a mixture of aromatic diamines containing 4,4-diamino-oxanilide |
| DE2248663A1 (de) * | 1972-10-04 | 1974-04-11 | Bayer Ag | Aromatische copolyamide und daraus hergestellte faeden mit hohem elastizitaetsmodul und hoher reissfestigkeit |
| DE2259123A1 (de) * | 1972-12-02 | 1974-06-06 | Bayer Ag | Chinazolindion-strukturen enthaltende copolyamide |
| JPS5523923B2 (esLanguage) * | 1973-02-01 | 1980-06-26 | ||
| JPS49130494A (esLanguage) * | 1973-04-17 | 1974-12-13 |
-
1975
- 1975-12-17 DE DE2556883A patent/DE2556883C2/de not_active Expired
- 1975-12-17 AU AU87626/75A patent/AU500143B2/en not_active Expired
- 1975-12-18 US US05/641,898 patent/US4075172A/en not_active Expired - Lifetime
- 1975-12-18 GB GB51844/75A patent/GB1501948A/en not_active Expired
- 1975-12-18 NZ NZ179586A patent/NZ179586A/xx unknown
- 1975-12-23 IT IT30748/75A patent/IT1051943B/it active
- 1975-12-24 CA CA242,585A patent/CA1070447A/en not_active Expired
- 1975-12-26 ES ES75443888A patent/ES443888A1/es not_active Expired
- 1975-12-26 BR BR7508668*A patent/BR7508668A/pt unknown
- 1975-12-26 FR FR7539827A patent/FR2295977A1/fr active Granted
- 1975-12-29 NL NLAANVRAGE7515131,A patent/NL175830C/xx not_active IP Right Cessation
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0790335A1 (de) | 1996-02-15 | 1997-08-20 | Hoechst Trevira GmbH & Co. KG | Schnittresistente Aramidfasern, Garne enthaltend diese Aramidfasern und dieser Verwendung |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1501948A (en) | 1978-02-22 |
| AU500143B2 (en) | 1979-05-10 |
| CA1070447A (en) | 1980-01-22 |
| NL7515131A (nl) | 1976-06-29 |
| ES443888A1 (es) | 1977-05-01 |
| AU8762675A (en) | 1977-06-23 |
| US4075172A (en) | 1978-02-21 |
| NL175830C (nl) | 1985-01-02 |
| FR2295977B1 (esLanguage) | 1979-06-22 |
| NZ179586A (en) | 1978-04-03 |
| DE2556883A1 (de) | 1976-07-01 |
| BR7508668A (pt) | 1976-09-08 |
| FR2295977A1 (fr) | 1976-07-23 |
| IT1051943B (it) | 1981-05-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2556883C2 (de) | Aromatische Copolyamide und deren Verwendung zur Herstellung von Fasern, Fäden, Filmen und Folien | |
| DE3007063C2 (de) | Faser- oder filmbildendes aromatisches Copolyamid, Verfahren zu seiner Herstellung und dessen Verwendung | |
| DE60125870T2 (de) | Verfahren zur herstellung einer meta-vollaromatischen polyamidfaser | |
| EP0199090B1 (de) | Geformte Gebilde aus aromatischen Copolyamiden und Verfahren zu ihrer Herstellung | |
| EP0678539A2 (de) | Aromatische Copolyamide, Verfahren zu deren Herstellung, geformte Gebilde und deren Herstellung | |
| DE4411755A1 (de) | Verfahren zur Herstellung von Fasern oder Filmen unter Verwendung spezieller Ausformlösungen, sowie die danach erhältlichen Fasern oder Filme | |
| DE1570890A1 (de) | Polymerisate aus Diaminobenzaniliden | |
| EP0364893A2 (de) | Vollaromatische Polyamide, Verfahren zu ihrer Herstellung und daraus geformte Gebilde | |
| EP0647731B1 (de) | Aramidfasern hoher Festigkeit und hohen Titers, Verfahren zu deren Herstellung sowie deren Verwendung | |
| DE69015575T2 (de) | Vollaromatisches Copolyamid und damit hergestellte Artikel. | |
| DE69115942T2 (de) | Vollaromatisches Polyamid | |
| DE2723867A1 (de) | Neue copolyamidfasern und verfahren zu deren herstellung | |
| DE69714954T2 (de) | Borste aus aromatischem polyamid | |
| DE69027709T2 (de) | Verfahren zur Herstellung von Fasern mit Verbesserter Hydrolysebeständigkeit. | |
| EP0567998A1 (de) | Verfahren zur Herstellung von Faserbildenden meta-Aramiden | |
| DE2327679A1 (de) | Aromatische polyamide und ihre verwendung | |
| EP0553755A2 (de) | Aromatische Copolyamide, Verfahren zu ihrer Herstellung und daraus geformte Gebilde | |
| DE68927235T2 (de) | Vollaromatisches Polyamidcopolymer | |
| EP0553756B1 (de) | Aromatische Copolyamide, Verfahren zu ihrer Herstellung und daraus geformte Gebilde | |
| EP0522418B1 (de) | Aromatische Copolyamide, Verfahren zu ihrer Herstellung und daraus geformte Gebilde | |
| DE69018068T2 (de) | Aromatisches Polyamid und Verfahren zur Herstellung. | |
| EP0499230B1 (de) | Aromatische Copolyamide, Verfahren zu ihrer Herstellung und daraus geformte Gebilde | |
| DE2900264A1 (de) | Neue copolyamidfasern und verfahren zu deren herstellung | |
| EP0442399A2 (de) | Vollaromatische Polyamide, Verfahren zu ihrer Herstellung und daraus geformte Gebilde | |
| EP0578164A2 (de) | Aromatische Copolyamide, Verfahren zu ihrer Herstellung und daraus geformte Gebilde |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| D2 | Grant after examination | ||
| 8328 | Change in the person/name/address of the agent |
Free format text: KOHLER, M., DIPL.-CHEM. DR.RER.NAT., PAT.-ANW., 8000 MUENCHEN |
|
| 8365 | Fully valid after opposition proceedings |