DE2455155C2 - Verfahren zur Herstellung von Hydroxyarylbenzotriazolen oder -N-Oxiden - Google Patents
Verfahren zur Herstellung von Hydroxyarylbenzotriazolen oder -N-OxidenInfo
- Publication number
- DE2455155C2 DE2455155C2 DE2455155A DE2455155A DE2455155C2 DE 2455155 C2 DE2455155 C2 DE 2455155C2 DE 2455155 A DE2455155 A DE 2455155A DE 2455155 A DE2455155 A DE 2455155A DE 2455155 C2 DE2455155 C2 DE 2455155C2
- Authority
- DE
- Germany
- Prior art keywords
- catalyst
- hydrogenation
- filtered
- product
- compounds
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 14
- 238000002360 preparation method Methods 0.000 title claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 8
- 238000006243 chemical reaction Methods 0.000 claims description 7
- 125000003118 aryl group Chemical group 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000001246 bromo group Chemical group Br* 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 42
- 239000003054 catalyst Substances 0.000 description 34
- -1 platinum metals Chemical class 0.000 description 27
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 20
- 238000005984 hydrogenation reaction Methods 0.000 description 20
- 239000000047 product Substances 0.000 description 20
- 150000001875 compounds Chemical class 0.000 description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- 229910052739 hydrogen Inorganic materials 0.000 description 16
- 239000001257 hydrogen Substances 0.000 description 16
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 14
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 14
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 13
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 12
- 229910052736 halogen Inorganic materials 0.000 description 11
- 150000002367 halogens Chemical class 0.000 description 11
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 10
- 239000012964 benzotriazole Substances 0.000 description 8
- 239000000706 filtrate Substances 0.000 description 7
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 7
- 239000002585 base Substances 0.000 description 6
- 239000003638 chemical reducing agent Substances 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- 238000006722 reduction reaction Methods 0.000 description 6
- JOKPITBUODAHEN-UHFFFAOYSA-N sulfanylideneplatinum Chemical compound [Pt]=S JOKPITBUODAHEN-UHFFFAOYSA-N 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 239000003610 charcoal Substances 0.000 description 5
- 238000003776 cleavage reaction Methods 0.000 description 5
- 125000005027 hydroxyaryl group Chemical group 0.000 description 5
- 229910052759 nickel Inorganic materials 0.000 description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 5
- 230000002829 reductive effect Effects 0.000 description 5
- 230000007017 scission Effects 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 150000001204 N-oxides Chemical class 0.000 description 4
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 4
- 239000003513 alkali Substances 0.000 description 4
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 4
- 150000001565 benzotriazoles Chemical class 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 229910052976 metal sulfide Inorganic materials 0.000 description 4
- 229910052763 palladium Inorganic materials 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 150000004763 sulfides Chemical class 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 150000002736 metal compounds Chemical class 0.000 description 3
- 229910052697 platinum Inorganic materials 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- DSZOTMKIKJOOPG-UHFFFAOYSA-N (2-nitrophenyl)-phenyldiazene Chemical class [O-][N+](=O)C1=CC=CC=C1N=NC1=CC=CC=C1 DSZOTMKIKJOOPG-UHFFFAOYSA-N 0.000 description 2
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 2
- KMNUICNHXIGHME-UHFFFAOYSA-N 2-[(2-hydroxyphenyl)diazenyl]-4-nitro-3-phenylphenol Chemical compound OC1=CC=CC=C1N=NC1=C(O)C=CC([N+]([O-])=O)=C1C1=CC=CC=C1 KMNUICNHXIGHME-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- UYJXRRSPUVSSMN-UHFFFAOYSA-P ammonium sulfide Chemical compound [NH4+].[NH4+].[S-2] UYJXRRSPUVSSMN-UHFFFAOYSA-P 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 229910017052 cobalt Inorganic materials 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 229910044991 metal oxide Inorganic materials 0.000 description 2
- 150000004706 metal oxides Chemical class 0.000 description 2
- 229910052750 molybdenum Inorganic materials 0.000 description 2
- 239000011733 molybdenum Substances 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 125000006501 nitrophenyl group Chemical group 0.000 description 2
- 125000000018 nitroso group Chemical group N(=O)* 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 239000010970 precious metal Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- HHUOYYNHGMRSIF-UHFFFAOYSA-N 2,4-bis(2-methylbutan-2-yl)-6-[(2-nitrophenyl)diazenyl]phenol Chemical compound CCC(C)(C)C1=CC(C(C)(C)CC)=CC(N=NC=2C(=CC=CC=2)[N+]([O-])=O)=C1O HHUOYYNHGMRSIF-UHFFFAOYSA-N 0.000 description 1
- IXHSKUUYQMXYQR-UHFFFAOYSA-N 2-(2H-benzotriazol-4-yl)-4-chlorophenol Chemical compound Oc1ccc(Cl)cc1-c1cccc2[nH]nnc12 IXHSKUUYQMXYQR-UHFFFAOYSA-N 0.000 description 1
- FJGQBLRYBUAASW-UHFFFAOYSA-N 2-(benzotriazol-2-yl)phenol Chemical compound OC1=CC=CC=C1N1N=C2C=CC=CC2=N1 FJGQBLRYBUAASW-UHFFFAOYSA-N 0.000 description 1
- XJRLKUOFBZMRBR-UHFFFAOYSA-N 2-phenylbenzotriazole Chemical class C1=CC=CC=C1N1N=C2C=CC=CC2=N1 XJRLKUOFBZMRBR-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- QXDZTGKHZHYJAG-UHFFFAOYSA-N 4-bromo-2-[(2-nitrophenyl)diazenyl]phenol Chemical compound OC1=CC=C(Br)C=C1N=NC1=CC=CC=C1[N+]([O-])=O QXDZTGKHZHYJAG-UHFFFAOYSA-N 0.000 description 1
- GZFGOTFRPZRKDS-UHFFFAOYSA-N 4-bromophenol Chemical compound OC1=CC=C(Br)C=C1 GZFGOTFRPZRKDS-UHFFFAOYSA-N 0.000 description 1
- RXFBLKKBFIUWOH-UHFFFAOYSA-N 4-chloro-2-[(2-nitrophenyl)diazenyl]phenol Chemical compound OC1=CC=C(Cl)C=C1N=NC1=CC=CC=C1[N+]([O-])=O RXFBLKKBFIUWOH-UHFFFAOYSA-N 0.000 description 1
- DRPPFIRCBMBJCM-UHFFFAOYSA-N 4-methyl-2-[(2-nitrophenyl)diazenyl]phenol Chemical compound CC1=CC=C(O)C(N=NC=2C(=CC=CC=2)[N+]([O-])=O)=C1 DRPPFIRCBMBJCM-UHFFFAOYSA-N 0.000 description 1
- ZCILGMFPJBRCNO-UHFFFAOYSA-N 4-phenyl-2H-benzotriazol-5-ol Chemical class OC1=CC=C2NN=NC2=C1C1=CC=CC=C1 ZCILGMFPJBRCNO-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 125000001980 alanyl group Chemical group 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000000278 alkyl amino alkyl group Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 125000004947 alkyl aryl amino group Chemical group 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000005115 alkyl carbamoyl group Chemical group 0.000 description 1
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003435 aroyl group Chemical group 0.000 description 1
- 125000001769 aryl amino group Chemical group 0.000 description 1
- 125000005160 aryl oxy alkyl group Chemical group 0.000 description 1
- 125000005135 aryl sulfinyl group Chemical group 0.000 description 1
- 125000005110 aryl thio group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- DMLAVOWQYNRWNQ-UHFFFAOYSA-N azobenzene Chemical compound C1=CC=CC=C1N=NC1=CC=CC=C1 DMLAVOWQYNRWNQ-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 229950011260 betanaphthol Drugs 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 125000006309 butyl amino group Chemical group 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 229910052570 clay Inorganic materials 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 238000005695 dehalogenation reaction Methods 0.000 description 1
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 125000005117 dialkylcarbamoyl group Chemical group 0.000 description 1
- 125000004986 diarylamino group Chemical group 0.000 description 1
- 125000002147 dimethylamino group Chemical class [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 230000004992 fission Effects 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 125000000350 glycoloyl group Chemical group O=C([*])C([H])([H])O[H] 0.000 description 1
- 125000003630 glycyl group Chemical group [H]N([H])C([H])([H])C(*)=O 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 229920006113 non-polar polymer Polymers 0.000 description 1
- 125000001209 o-nitrophenyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])[N+]([O-])=O 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 229920006112 polar polymer Polymers 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000006476 reductive cyclization reaction Methods 0.000 description 1
- 238000006894 reductive elimination reaction Methods 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 238000001308 synthesis method Methods 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 125000002221 trityl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1C([*])(C1=C(C(=C(C(=C1[H])[H])[H])[H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- UGZADUVQMDAIAO-UHFFFAOYSA-L zinc hydroxide Chemical compound [OH-].[OH-].[Zn+2] UGZADUVQMDAIAO-UHFFFAOYSA-L 0.000 description 1
- 229910021511 zinc hydroxide Inorganic materials 0.000 description 1
- 229940007718 zinc hydroxide Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/16—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms condensed with carbocyclic rings or ring systems
- C07D249/18—Benzotriazoles
- C07D249/20—Benzotriazoles with aryl radicals directly attached in position 2
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Description
(theoretisch: C 73,55; 114,24; N 16.08'!
CI 14.68%
Ci 14,43%)
In einen 1-I-Magne-Drive-Autoklaven wurden 6,8 g (0.021 Mol) 4-Brom-2-(2'-nitrophenylazo)-phenol. 4 ml
(theoretisch: C 57.9: 113.53%
Claims (1)
(O),
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US05/418,135 US3978074A (en) | 1973-11-21 | 1973-11-21 | Method of making hydroxyarylbenzotriazoles and their N-oxides |
Publications (2)
Publication Number | Publication Date |
---|---|
DE2455155A1 DE2455155A1 (de) | 1975-05-22 |
DE2455155C2 true DE2455155C2 (de) | 1984-05-30 |
Family
ID=23656859
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
DE2455155A Expired DE2455155C2 (de) | 1973-11-21 | 1974-11-21 | Verfahren zur Herstellung von Hydroxyarylbenzotriazolen oder -N-Oxiden |
Country Status (3)
Country | Link |
---|---|
US (2) | US3978074A (de) |
CH (2) | CH612955A5 (de) |
DE (1) | DE2455155C2 (de) |
Families Citing this family (22)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE2620896A1 (de) * | 1975-05-14 | 1976-12-02 | Ciba Geigy Ag | Verfahren zur herstellung von 2-aryl-2h-benzotriazolen |
DE2621006A1 (de) * | 1975-05-14 | 1976-12-02 | Ciba Geigy Ag | Verfahren zur herstellung von 2-aryl-2h-benzotriazolen |
CH615166A5 (en) * | 1975-05-14 | 1980-01-15 | Ciba Geigy Ag | Process for the preparation of 2-aryl-2H-benzotriazoles |
CH615427A5 (en) * | 1975-05-14 | 1980-01-31 | Ciba Geigy Ag | Process for the preparation of 2-aryl-2H-benzotriazoles |
US4141903A (en) * | 1977-08-17 | 1979-02-27 | Ciba-Geigy Corporation | Process for the production of 2-aryl-2H-benzotriazoles |
CH633003A5 (de) * | 1977-08-17 | 1982-11-15 | Ciba Geigy Ag | Verfahren zur herstellung von benzotriazolen. |
US4219480A (en) * | 1977-09-20 | 1980-08-26 | Ciba-Geigy Corporation | Process for the production of 2-aryl-2H-benzotriazoles |
US4230867A (en) * | 1977-11-25 | 1980-10-28 | Ciba-Geigy Corporation | Process for the production of 2-aryl-2H-benzotriazoles |
US4543360A (en) * | 1981-09-10 | 1985-09-24 | Degussa Aktiengesellschaft | 2-(Hydroxy-phenyl)-indoles and process for their production |
EP0130938B1 (de) * | 1983-06-01 | 1989-02-15 | Ciba-Geigy Ag | Verfahren zur Herstellung von 2-Arylbenzotriazolen |
AU572896B2 (en) * | 1983-11-09 | 1988-05-19 | Sumitomo Chemical Company, Limited | 2-phenylbenzotriazoles |
US4535104A (en) * | 1984-07-20 | 1985-08-13 | General Electric Company | Ultraviolet light stabilized copolyestercarbonate |
GB8709488D0 (en) * | 1987-04-22 | 1987-05-28 | Shell Int Research | Copolymer composition |
GB8720365D0 (en) * | 1987-08-28 | 1987-10-07 | Sandoz Ltd | Organic compounds |
ES2062096T3 (es) * | 1988-09-28 | 1994-12-16 | Ciba Geigy Ag | Procedimiento para la obtencion de derivados del benzotriazol. |
US5187289A (en) * | 1989-01-31 | 1993-02-16 | Chemipro Kasei Kaisha, Ltd. | Method of preparing 2-phenyl benzotriazoles |
JPH02202879A (ja) * | 1989-01-31 | 1990-08-10 | Kemipuro Kasei Kk | 2―フェニルベンゾトリアゾール類の製造法 |
EP0419412B1 (de) * | 1989-09-20 | 1993-11-10 | Ciba-Geigy Ag | Verfahren zur Herstellung von Benztriazolen |
US5571924A (en) * | 1995-07-12 | 1996-11-05 | Ciba-Geigy Corporation | Process for the preparation of benzotriazoles |
US5675015A (en) * | 1996-03-07 | 1997-10-07 | Eastman Kodak Company | Process for the preparation of benzotriazole derivatives |
AU2002356731A1 (en) | 2001-12-05 | 2003-06-17 | Ciba Specialty Chemicals Holding Inc. | Organic solvent-free process for the preparation of 2-(2-nitrophenylazo)phenols |
US6608162B1 (en) | 2002-03-15 | 2003-08-19 | Borden Chemical, Inc. | Spray-dried phenol formaldehyde resins |
Family Cites Families (14)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE1185610B (de) * | 1956-12-14 | 1965-01-21 | Geigy Ag J R | Verwendung von 2-Phenylbenzotriazol-verbindungen zum Schuetzen von organischen Stoffen gegen ultraviolette Strahlung |
NL105044C (de) * | 1956-12-14 | |||
DE1108698B (de) * | 1959-09-03 | 1961-06-15 | Hoechst Ag | Verfahren zur Herstellung von 2-(2'-Aminoaryl)-4, 5-arylen-1, 2, 3-triazolen |
DE1116230B (de) * | 1960-05-11 | 1961-11-02 | Hoechst Ag | Verfahren zur Herstellung von 2-(2'-Oxyaryl)-4,5-arylen-1,2,3-triazol-1-oxyden |
BE620608A (de) * | 1961-07-24 | |||
US3230194A (en) * | 1961-12-22 | 1966-01-18 | American Cyanamid Co | 2-(2'-hydroxy-5'-tertiary-octylphenyl)-benzotriazole and polyolefins stabilized therewith |
NL288451A (de) | 1962-02-08 | |||
NL288798A (de) * | 1962-02-13 | |||
DE1210560B (de) * | 1964-04-18 | 1966-02-10 | Hoechst Ag | Stabilisatorgemisch fuer Homo- oder Copolymerisate von Alkylenoxyden |
US3600355A (en) * | 1964-05-12 | 1971-08-17 | Universal Oil Prod Co | Abs and hydrocarbon polymers stabilized with boron ester-benzotriazole mixtures |
US3272891A (en) * | 1964-10-14 | 1966-09-13 | American Cyanamid Co | Stabilizing polymers with alkenoylamido- and phenylbenzatriazoles |
FR1519364A (fr) | 1966-04-28 | 1968-03-29 | American Cyanamid Co | Nouvelles compositions stabilisantes absorbant les rayons ultraviolets |
US3481897A (en) * | 1967-01-23 | 1969-12-02 | Paul J Marinaccio | Polyolefins containing a combination of antioxidants and ultraviolet absorbers |
JPS4826012A (de) * | 1971-08-06 | 1973-04-05 |
-
1973
- 1973-11-21 US US05/418,135 patent/US3978074A/en not_active Expired - Lifetime
-
1974
- 1974-11-21 CH CH234678A patent/CH612955A5/xx not_active IP Right Cessation
- 1974-11-21 DE DE2455155A patent/DE2455155C2/de not_active Expired
- 1974-11-21 CH CH1553174A patent/CH611891A5/xx not_active IP Right Cessation
-
1976
- 1976-06-07 US US05/693,568 patent/US4089839A/en not_active Expired - Lifetime
Also Published As
Publication number | Publication date |
---|---|
US3978074A (en) | 1976-08-31 |
CH611891A5 (de) | 1979-06-29 |
DE2455155A1 (de) | 1975-05-22 |
CH612955A5 (de) | 1979-08-31 |
US4089839A (en) | 1978-05-16 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
DE2455155C2 (de) | Verfahren zur Herstellung von Hydroxyarylbenzotriazolen oder -N-Oxiden | |
CH616923A5 (de) | ||
DE2366349C2 (de) | Verfahren zur Herstellung von 5-Methyl-1-phenyl-2-(1H)-pyridon | |
DE2900810A1 (de) | Substituierte n-benzhydryl-n'-p- hydroxybenzyl-piperazine und verfahren zu ihrer herstellung | |
DE2726820A1 (de) | Imidazothiazine | |
EP0005821B1 (de) | Indanaminderivate, Verfahren zur Herstellung derselben und Arzneimittel, welche diese enthalten | |
DE2535599C2 (de) | Substituierte Zimtsäureamide, Verfahren zu ihrer Herstellung und pharmazeutische Zubereitungen, welche diese Verbindungen enthalten | |
EP0004529B1 (de) | Tantomere Arylaminoimidazolinderivate, deren Herstellung und sie enthaltende Arzneimittel zur Bekämpfung von Schmerzzuständen | |
DE3330403A1 (de) | Benzamidderivate | |
AT395006B (de) | Verfahren zur herstellung von aminodiarylsulfoxiden sowie von deren saeureadditionssalzen | |
EP0013408A1 (de) | 4-Aminopyridine, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
EP0068259A1 (de) | Substituierte 2-Amino-pyridinderivate, Verfahren zu ihrer Herstellung, ihre Verwendung in Arzneimitteln, sowie deren Herstellung | |
DE2253748A1 (de) | Carboxamidobenzoesaeuren | |
EP0186049B1 (de) | N-substituierte Aziridin-2-Carbonsäurederivate, Verfahren zu deren Herstellung sowie diese Substanzen enthaltende Arzneimittel | |
DE1670552A1 (de) | Verfahren zur Herstellung von in 5,5-Stellung zweifach substituierten 1-Sulfonylhydantoinen | |
DE2747987C2 (de) | ||
DE1695804C3 (de) | N Acyl 2 methyl 3 lndolylcarbon sauren, Verfahren zu ihrer Herstellung und Arzneimittel | |
DE2752020A1 (de) | Neue 2-sulfonyl (bzw. -sulfinyl)-2'- aminoacetophenone und verfahren zu ihrer herstellung | |
EP0250436B1 (de) | Mehrfach substituierte pyridin-1-oxide, verfahren zu ihrer herstellung, die sie enthaltenden arzneimittel und ihre verwendung | |
DE2551355A1 (de) | N-benzylpiperazine | |
AT338811B (de) | Verfahren zur herstellung von neuen 2-amino-5-sulfamoylbenzoesaureamiden und ihren salzen sowie optischen isomeren | |
DE1200313B (de) | Verfahren zur Herstellung von 3, 5-Dioxo-1, 2, 4-triazolidinen | |
AT263778B (de) | Verfahren zur Herstellung von neuen cycloaliphatischen Verbindungen | |
CH634835A5 (de) | Verfahren zur herstellung von neuen benzodiazepinderivaten. | |
DE1200824B (de) | Verfahren zur Herstellung von 3, 5-Dioxo-triazolidinen |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
OD | Request for examination | ||
8172 | Supplementary division/partition in: |
Ref country code: DE Ref document number: 2463087 Format of ref document f/p: P |
|
AH | Division in |
Ref country code: DE Ref document number: 2463087 Format of ref document f/p: P |
|
Q171 | Divided out to: |
Ref country code: DE Ref document number: 2463087 |
|
D2 | Grant after examination | ||
8364 | No opposition during term of opposition | ||
8327 | Change in the person/name/address of the patent owner |
Owner name: CIBA-GEIGY AG, BASEL, CH |
|
8328 | Change in the person/name/address of the agent |
Free format text: ZUMSTEIN SEN., F., DR. ASSMANN, E., DIPL.-CHEM. DR.RER.NAT. KLINGSEISEN, F., DIPL.-ING. ZUMSTEIN JUN., F., DIPL.-CHEM. DR.RER.NAT., PAT.-ANW., 8000 MUENCHEN |