DE2343549A1 - 4-hydroxychinolinverbindungen und solche verbindungen enthaltende arzneimittel - Google Patents
4-hydroxychinolinverbindungen und solche verbindungen enthaltende arzneimittelInfo
- Publication number
- DE2343549A1 DE2343549A1 DE19732343549 DE2343549A DE2343549A1 DE 2343549 A1 DE2343549 A1 DE 2343549A1 DE 19732343549 DE19732343549 DE 19732343549 DE 2343549 A DE2343549 A DE 2343549A DE 2343549 A1 DE2343549 A1 DE 2343549A1
- Authority
- DE
- Germany
- Prior art keywords
- compounds
- hydrogen
- methyl
- hydroxyquinoline
- hydroxychinoline
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000001875 compounds Chemical class 0.000 title claims description 12
- 229940126601 medicinal product Drugs 0.000 title description 2
- PMZDQRJGMBOQBF-UHFFFAOYSA-N quinolin-4-ol Chemical class C1=CC=C2C(O)=CC=NC2=C1 PMZDQRJGMBOQBF-UHFFFAOYSA-N 0.000 title 1
- 239000001257 hydrogen Substances 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- -1 trimethylene, 2,2-dimethyl-trimethylene Chemical group 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- 125000004122 cyclic group Chemical group 0.000 claims description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims 1
- 239000003814 drug Substances 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 16
- 150000003254 radicals Chemical class 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- 238000000354 decomposition reaction Methods 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- RREANTFLPGEWEN-MBLPBCRHSA-N 7-[4-[[(3z)-3-[4-amino-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-2-yl]imino-5-fluoro-2-oxoindol-1-yl]methyl]piperazin-1-yl]-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound COC1=C(OC)C(OC)=CC(CC=2C(=NC(\N=C/3C4=CC(F)=CC=C4N(CN4CCN(CC4)C=4C(=CC=5C(=O)C(C(O)=O)=CN(C=5C=4)C4CC4)F)C\3=O)=NC=2)N)=C1 RREANTFLPGEWEN-MBLPBCRHSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 2
- 230000001078 anti-cholinergic effect Effects 0.000 description 2
- 230000001430 anti-depressive effect Effects 0.000 description 2
- 239000000935 antidepressant agent Substances 0.000 description 2
- 229940005513 antidepressants Drugs 0.000 description 2
- 239000000939 antiparkinson agent Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- VVSASNKOFCZVES-UHFFFAOYSA-N 1,3-dimethyl-1,3-diazinane-2,4,6-trione Chemical compound CN1C(=O)CC(=O)N(C)C1=O VVSASNKOFCZVES-UHFFFAOYSA-N 0.000 description 1
- CVBUKMMMRLOKQR-UHFFFAOYSA-N 1-phenylbutane-1,3-dione Chemical compound CC(=O)CC(=O)C1=CC=CC=C1 CVBUKMMMRLOKQR-UHFFFAOYSA-N 0.000 description 1
- OJQZKRYTKCRNDY-UHFFFAOYSA-N 3-(diethylaminomethyl)-2-methyl-1h-quinolin-4-one Chemical compound C1=CC=C2C(=O)C(CN(CC)CC)=C(C)NC2=C1 OJQZKRYTKCRNDY-UHFFFAOYSA-N 0.000 description 1
- JOBKZALYQYGIAA-UHFFFAOYSA-N 5-benzyl-1,3-dimethyl-1,3-diazinane-2,4,6-trione Chemical compound O=C1N(C)C(=O)N(C)C(=O)C1CC1=CC=CC=C1 JOBKZALYQYGIAA-UHFFFAOYSA-N 0.000 description 1
- OQAUDOFERGTKHL-UHFFFAOYSA-N 5-ethyl-1-methyl-1,3-diazinane-2,4,6-trione Chemical compound CCC1C(=O)NC(=O)N(C)C1=O OQAUDOFERGTKHL-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 208000003098 Ganglion Cysts Diseases 0.000 description 1
- 208000005400 Synovial Cyst Diseases 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229940035678 anti-parkinson drug Drugs 0.000 description 1
- 229940125688 antiparkinson agent Drugs 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- BADXJIPKFRBFOT-UHFFFAOYSA-N dimedone Chemical compound CC1(C)CC(=O)CC(=O)C1 BADXJIPKFRBFOT-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000002431 hydrogen Chemical group 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 229940001470 psychoactive drug Drugs 0.000 description 1
- 239000004089 psychotropic agent Substances 0.000 description 1
- 230000000506 psychotropic effect Effects 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/22—Oxygen atoms attached in position 2 or 4
- C07D215/233—Oxygen atoms attached in position 2 or 4 only one oxygen atom which is attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/24—Oxygen atoms attached in position 8
- C07D215/26—Alcohols; Ethers thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/38—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/38—Nitrogen atoms
- C07D215/40—Nitrogen atoms attached in position 8
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19732343549 DE2343549A1 (de) | 1973-08-29 | 1973-08-29 | 4-hydroxychinolinverbindungen und solche verbindungen enthaltende arzneimittel |
| NL7411347A NL7411347A (nl) | 1973-08-29 | 1974-08-26 | 4-hydroxychinolineverbindingen en geneesmidde- len die deze verbindingen bevatten. |
| FR7429361A FR2242100B1 (enExample) | 1973-08-29 | 1974-08-28 | |
| GB3787074A GB1441533A (en) | 1973-08-29 | 1974-08-29 | Hydroxyquinolines and pharmaceutical preparations comprising such compounds |
| BE148052A BE819363A (fr) | 1973-08-29 | 1974-08-29 | Derives de 4-hydroxyquinoleine |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19732343549 DE2343549A1 (de) | 1973-08-29 | 1973-08-29 | 4-hydroxychinolinverbindungen und solche verbindungen enthaltende arzneimittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2343549A1 true DE2343549A1 (de) | 1975-03-13 |
Family
ID=5891033
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19732343549 Pending DE2343549A1 (de) | 1973-08-29 | 1973-08-29 | 4-hydroxychinolinverbindungen und solche verbindungen enthaltende arzneimittel |
Country Status (5)
| Country | Link |
|---|---|
| BE (1) | BE819363A (enExample) |
| DE (1) | DE2343549A1 (enExample) |
| FR (1) | FR2242100B1 (enExample) |
| GB (1) | GB1441533A (enExample) |
| NL (1) | NL7411347A (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH625521A5 (enExample) * | 1976-10-15 | 1981-09-30 | Sandoz Ag |
-
1973
- 1973-08-29 DE DE19732343549 patent/DE2343549A1/de active Pending
-
1974
- 1974-08-26 NL NL7411347A patent/NL7411347A/xx not_active Application Discontinuation
- 1974-08-28 FR FR7429361A patent/FR2242100B1/fr not_active Expired
- 1974-08-29 BE BE148052A patent/BE819363A/xx unknown
- 1974-08-29 GB GB3787074A patent/GB1441533A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1441533A (en) | 1976-07-07 |
| FR2242100B1 (enExample) | 1978-07-21 |
| BE819363A (fr) | 1974-12-16 |
| FR2242100A1 (enExample) | 1975-03-28 |
| NL7411347A (nl) | 1975-03-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2203373C3 (de) | Neue 2- [(2- Alkylbenzofuran-3-yl)-methyl] -A2 -imidazoline | |
| DE69716062T2 (de) | Benzofuran-derivate und deren verwendung | |
| EP0253327A2 (de) | Neue Diphenylpropylamin-Derivate, ihre Herstellung sowie ihre pharmazeutische Verwendung | |
| DE2343549A1 (de) | 4-hydroxychinolinverbindungen und solche verbindungen enthaltende arzneimittel | |
| CH628040A5 (de) | Verfahren zur herstellung neuer 4-hydroxy-2h-naphtho(2,1-e)-1,2-thiazin-3-carboxamid-1,1-dioxyde. | |
| DE2345422C2 (de) | Substituierte Isochinolyl-arylpiperazine diese enthaltende Arzneimittel sowie Verfahren zu deren Herstellung | |
| DE2728602A1 (de) | 6-amido-penicillansaeure-ester, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneipraeparate | |
| DE2457979A1 (de) | 2-n-aryl-hydroxyamino-imidazoline-(2) und verfahren zu deren herstellung | |
| DE2735589A1 (de) | 1-phenyl-1-methoxy-2-amino-aethan- derivate und verfahren zu ihrer herstellung | |
| DE1668146C3 (de) | N-substituierte S,S-Diphenylsulfoximine und ihre Salze sowie Verfahren zu ihrer Herstellung | |
| AT273139B (de) | Verfahren zur Herstellung von neuen 2,4,6-Triaminochinazolinen sowie von deren Säureadditionssalzen | |
| DE2352702A1 (de) | Basisch substituierte 1,4-dihydro-2hisochinolinderivate und verfahren zu ihrer herstellung | |
| AT275518B (de) | Verfahren zur Herstellung von neuen in 4-Stellung substituierten 1-(4-Oxo-4-phenyl-butyl)-piperidinen sowie von deren Säureaddtionssalzen | |
| AT218506B (de) | Verfahren zur Herstellung von basisch substituierten Carbinolen, sowie von ihren sterisch einheitlichen Razematen und deren optisch aktiven Komponenten und/oder ihren Säureadditionssalzen | |
| CH635097A5 (de) | 3-((4-chromanyliden)-amino)-2-oxazolidinone. | |
| DE1695804B2 (de) | N-acyl-2-methyl-3-indolylcarbonsaeuren, verfahren zu ihrer herstellung und arzneimittel | |
| AT235836B (de) | Verfahren zur Herstellung von neuen basisch substituierten Polymethylentetrahydrochinolinen | |
| AT223196B (de) | Verfahren zur Herstellung von neuen, 2-araliphatischen 3,4-Dihydro-1,2,4-benzothiadiazin-1,1-dioxyden | |
| DE2658766A1 (de) | Pyrrolobenzoesaeure-derivate und verfahren zu ihrer herstellung | |
| DE1223388B (de) | Verfahren zur Herstellung von neuen Isonicotinsaeureamiden | |
| AT244327B (de) | Verfahren zur Herstellung von Diphenylalkylaminen und ihren physiologisch verträglichen Salzen | |
| DE1670011C3 (de) | Am Kohlenstoff des Heterocyclus alkylierte NJV'-disubstituierte Diazacycloalkane und diese enthaltende Arzneimittel | |
| AT345843B (de) | Verfahren zur herstellung neuer 4-hydroxy-2h- naphtho- (2,1-e)-1,2-thiazin-3-carboxamid-1,1-dioxide und deren salze | |
| AT317205B (de) | Verfahren zur Herstellung neuer Phenylimidazolidinonderivate und ihrer Salze | |
| AT317194B (de) | Verfahren zur Herstellung neuer 9-(2-Hydroxy-3-aminopropyl)-9,10-dihydro-9,10-äthanoanthracene |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHN | Withdrawal |