DE2218097A1 - Herbizides Mittel und seine Verwendung - Google Patents
Herbizides Mittel und seine VerwendungInfo
- Publication number
- DE2218097A1 DE2218097A1 DE19722218097 DE2218097A DE2218097A1 DE 2218097 A1 DE2218097 A1 DE 2218097A1 DE 19722218097 DE19722218097 DE 19722218097 DE 2218097 A DE2218097 A DE 2218097A DE 2218097 A1 DE2218097 A1 DE 2218097A1
- Authority
- DE
- Germany
- Prior art keywords
- chcl
- radicals
- alkyl
- radical
- haloalkyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000004009 herbicide Substances 0.000 title claims description 60
- 239000000729 antidote Substances 0.000 claims description 77
- 230000002363 herbicidal effect Effects 0.000 claims description 59
- -1 carbοalkoxyalkyl Chemical group 0.000 claims description 42
- 239000000203 mixture Substances 0.000 claims description 32
- 241000196324 Embryophyta Species 0.000 claims description 27
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 25
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 claims description 22
- 239000002689 soil Substances 0.000 claims description 22
- 125000000217 alkyl group Chemical group 0.000 claims description 19
- 125000005843 halogen group Chemical group 0.000 claims description 15
- 239000005631 2,4-Dichlorophenoxyacetic acid Substances 0.000 claims description 14
- 125000001188 haloalkyl group Chemical group 0.000 claims description 14
- 125000003342 alkenyl group Chemical group 0.000 claims description 10
- MXWJVTOOROXGIU-UHFFFAOYSA-N atrazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)C)=N1 MXWJVTOOROXGIU-UHFFFAOYSA-N 0.000 claims description 7
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 7
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 claims description 7
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 7
- 239000004480 active ingredient Substances 0.000 claims description 6
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 6
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 5
- MZZBPDKVEFVLFF-UHFFFAOYSA-N cyanazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)(C)C#N)=N1 MZZBPDKVEFVLFF-UHFFFAOYSA-N 0.000 claims description 5
- 125000004966 cyanoalkyl group Chemical group 0.000 claims description 5
- 125000000262 haloalkenyl group Chemical group 0.000 claims description 4
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 4
- KCZIUKYAJJEIQG-UHFFFAOYSA-N 1,3,5-triazin-2-amine Chemical compound NC1=NC=NC=N1 KCZIUKYAJJEIQG-UHFFFAOYSA-N 0.000 claims description 3
- UENGBOCGGKLVJJ-UHFFFAOYSA-N 2-chloro-1-(2,4-difluorophenyl)ethanone Chemical compound FC1=CC=C(C(=O)CCl)C(F)=C1 UENGBOCGGKLVJJ-UHFFFAOYSA-N 0.000 claims description 3
- 125000005119 alkyl cycloalkyl group Chemical group 0.000 claims description 3
- 125000006350 alkyl thio alkyl group Chemical group 0.000 claims description 3
- 125000000304 alkynyl group Chemical group 0.000 claims description 3
- 150000001602 bicycloalkyls Chemical group 0.000 claims description 3
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 3
- 125000004438 haloalkoxy group Chemical group 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 125000002071 phenylalkoxy group Chemical group 0.000 claims description 3
- 125000003170 phenylsulfonyl group Chemical class C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 3
- 125000003386 piperidinyl group Chemical group 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- HXKWSTRRCHTUEC-UHFFFAOYSA-N 2,4-Dichlorophenoxyaceticacid Chemical compound OC(=O)C(Cl)OC1=CC=C(Cl)C=C1 HXKWSTRRCHTUEC-UHFFFAOYSA-N 0.000 claims description 2
- DFCAFRGABIXSDS-UHFFFAOYSA-N Cycloate Chemical compound CCSC(=O)N(CC)C1CCCCC1 DFCAFRGABIXSDS-UHFFFAOYSA-N 0.000 claims description 2
- 229960001413 acetanilide Drugs 0.000 claims description 2
- 125000000278 alkyl amino alkyl group Chemical group 0.000 claims description 2
- 125000006383 alkylpyridyl group Chemical group 0.000 claims description 2
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 claims description 2
- 125000004993 haloalkoxycarbonyl group Chemical group 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 125000000335 thiazolyl group Chemical group 0.000 claims description 2
- MDBGGTQNNUOQRC-UHFFFAOYSA-N Allidochlor Chemical compound ClCC(=O)N(CC=C)CC=C MDBGGTQNNUOQRC-UHFFFAOYSA-N 0.000 claims 1
- YXOXBCQDQJEUTB-UHFFFAOYSA-N [3,4-di(propan-2-yl)thiophen-2-yl]carbamic acid Chemical compound CC(C)C1=CSC(NC(O)=O)=C1C(C)C YXOXBCQDQJEUTB-UHFFFAOYSA-N 0.000 claims 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims 1
- 125000005277 alkyl imino group Chemical group 0.000 claims 1
- 150000001735 carboxylic acids Chemical group 0.000 claims 1
- 125000000392 cycloalkenyl group Chemical group 0.000 claims 1
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims 1
- 125000002541 furyl group Chemical group 0.000 claims 1
- 125000004692 haloalkylcarbonyl group Chemical group 0.000 claims 1
- 125000005059 halophenyl group Chemical group 0.000 claims 1
- DEDOPGXGGQYYMW-UHFFFAOYSA-N molinate Chemical compound CCSC(=O)N1CCCCCC1 DEDOPGXGGQYYMW-UHFFFAOYSA-N 0.000 claims 1
- MFOUDYKPLGXPGO-UHFFFAOYSA-N propachlor Chemical compound ClCC(=O)N(C(C)C)C1=CC=CC=C1 MFOUDYKPLGXPGO-UHFFFAOYSA-N 0.000 claims 1
- 125000001544 thienyl group Chemical group 0.000 claims 1
- 240000008042 Zea mays Species 0.000 description 560
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 552
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 552
- 235000005822 corn Nutrition 0.000 description 552
- GUVLYNGULCJVDO-UHFFFAOYSA-N EPTC Chemical compound CCCN(CCC)C(=O)SCC GUVLYNGULCJVDO-UHFFFAOYSA-N 0.000 description 499
- 239000000460 chlorine Substances 0.000 description 79
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 73
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 69
- 235000013339 cereals Nutrition 0.000 description 61
- 230000006378 damage Effects 0.000 description 58
- 238000011282 treatment Methods 0.000 description 41
- 239000000047 product Substances 0.000 description 40
- 239000000243 solution Substances 0.000 description 36
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 35
- 210000003608 fece Anatomy 0.000 description 35
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 34
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 33
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 33
- 150000001875 compounds Chemical class 0.000 description 27
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- 239000010871 livestock manure Substances 0.000 description 19
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 17
- 235000019341 magnesium sulphate Nutrition 0.000 description 17
- UWNADWZGEHDQAB-UHFFFAOYSA-N i-Pr2C2H4i-Pr2 Natural products CC(C)CCC(C)C UWNADWZGEHDQAB-UHFFFAOYSA-N 0.000 description 15
- 238000003756 stirring Methods 0.000 description 15
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 14
- 238000001816 cooling Methods 0.000 description 14
- COAABSMONFNYQH-TTWCUHKNSA-N (2r,3s,4s,5r,6s)-2-(hydroxymethyl)-6-(oxiran-2-ylmethylsulfanyl)oxane-3,4,5-triol Chemical compound O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1SCC1OC1 COAABSMONFNYQH-TTWCUHKNSA-N 0.000 description 13
- FBCCMZVIWNDFMO-UHFFFAOYSA-N dichloroacetyl chloride Chemical compound ClC(Cl)C(Cl)=O FBCCMZVIWNDFMO-UHFFFAOYSA-N 0.000 description 12
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- 150000003573 thiols Chemical class 0.000 description 10
- DYUWTXWIYMHBQS-UHFFFAOYSA-N n-prop-2-enylprop-2-en-1-amine Chemical compound C=CCNCC=C DYUWTXWIYMHBQS-UHFFFAOYSA-N 0.000 description 9
- 229910000029 sodium carbonate Inorganic materials 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- 244000000626 Daucus carota Species 0.000 description 6
- 235000002767 Daucus carota Nutrition 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 241000209140 Triticum Species 0.000 description 6
- 235000021307 Triticum Nutrition 0.000 description 6
- 239000011550 stock solution Substances 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 5
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 5
- 240000007594 Oryza sativa Species 0.000 description 5
- 235000007164 Oryza sativa Nutrition 0.000 description 5
- 244000062793 Sorghum vulgare Species 0.000 description 5
- 229940075522 antidotes Drugs 0.000 description 5
- RBHJBMIOOPYDBQ-UHFFFAOYSA-N carbon dioxide;propan-2-one Chemical compound O=C=O.CC(C)=O RBHJBMIOOPYDBQ-UHFFFAOYSA-N 0.000 description 5
- 239000007795 chemical reaction product Substances 0.000 description 5
- 235000009566 rice Nutrition 0.000 description 5
- ODCWYMIRDDJXKW-UHFFFAOYSA-N simazine Chemical compound CCNC1=NC(Cl)=NC(NCC)=N1 ODCWYMIRDDJXKW-UHFFFAOYSA-N 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 238000009331 sowing Methods 0.000 description 5
- 241000251730 Chondrichthyes Species 0.000 description 4
- 235000019713 millet Nutrition 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 238000005191 phase separation Methods 0.000 description 4
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 4
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 3
- 229910014033 C-OH Inorganic materials 0.000 description 3
- 229910014570 C—OH Inorganic materials 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- UKLDJPRMSDWDSL-UHFFFAOYSA-L [dibutyl(dodecanoyloxy)stannyl] dodecanoate Chemical compound CCCCCCCCCCCC(=O)O[Sn](CCCC)(CCCC)OC(=O)CCCCCCCCCCC UKLDJPRMSDWDSL-UHFFFAOYSA-L 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 239000004568 cement Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000012975 dibutyltin dilaurate Substances 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 230000008635 plant growth Effects 0.000 description 3
- PMXZRZWRZLYYNS-UHFFFAOYSA-N 2,2-dichloro-n,n-bis(2-hydroxyethyl)acetamide Chemical compound OCCN(CCO)C(=O)C(Cl)Cl PMXZRZWRZLYYNS-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- RCEJCSULJQNRQQ-UHFFFAOYSA-N 2-methylbutanenitrile Chemical compound CCC(C)C#N RCEJCSULJQNRQQ-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 101000913968 Ipomoea purpurea Chalcone synthase C Proteins 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- FZERHIULMFGESH-UHFFFAOYSA-N N-phenylacetamide Chemical compound CC(=O)NC1=CC=CC=C1 FZERHIULMFGESH-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- 101000907988 Petunia hybrida Chalcone-flavanone isomerase C Proteins 0.000 description 2
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- OKUGPJPKMAEJOE-UHFFFAOYSA-N S-propyl dipropylcarbamothioate Chemical compound CCCSC(=O)N(CCC)CCC OKUGPJPKMAEJOE-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- QMKYBPDZANOJGF-UHFFFAOYSA-N benzene-1,3,5-tricarboxylic acid Chemical compound OC(=O)C1=CC(C(O)=O)=CC(C(O)=O)=C1 QMKYBPDZANOJGF-UHFFFAOYSA-N 0.000 description 2
- IRXBNHGNHKNOJI-UHFFFAOYSA-N butanedioyl dichloride Chemical compound ClC(=O)CCC(Cl)=O IRXBNHGNHKNOJI-UHFFFAOYSA-N 0.000 description 2
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- WCGGWVOVFQNRRS-UHFFFAOYSA-N dichloroacetamide Chemical compound NC(=O)C(Cl)Cl WCGGWVOVFQNRRS-UHFFFAOYSA-N 0.000 description 2
- 238000007865 diluting Methods 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 208000037824 growth disorder Diseases 0.000 description 2
- 239000003815 herbicide antidote Substances 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000011814 protection agent Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000004576 sand Substances 0.000 description 2
- 244000045561 useful plants Species 0.000 description 2
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical class C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 description 1
- ZILSBZLQGRBMOR-UHFFFAOYSA-N 1,3-benzodioxol-5-ylmethanamine Chemical compound NCC1=CC=C2OCOC2=C1 ZILSBZLQGRBMOR-UHFFFAOYSA-N 0.000 description 1
- GDRFQURHBGZPQY-UHFFFAOYSA-N 1-chloro-3-(3-chloroprop-1-enyl)benzene Chemical compound ClCC=CC1=CC=CC(Cl)=C1 GDRFQURHBGZPQY-UHFFFAOYSA-N 0.000 description 1
- MSYLETHDEIJMAF-UHFFFAOYSA-N 2,2-diphenylacetyl chloride Chemical compound C=1C=CC=CC=1C(C(=O)Cl)C1=CC=CC=C1 MSYLETHDEIJMAF-UHFFFAOYSA-N 0.000 description 1
- ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 2,3-dimethylbutane Chemical group CC(C)C(C)C ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 0.000 description 1
- FJSKXQVRKZTKSI-UHFFFAOYSA-N 2,3-dimethylfuran Chemical compound CC=1C=COC=1C FJSKXQVRKZTKSI-UHFFFAOYSA-N 0.000 description 1
- QOZOFODNIBQPGN-UHFFFAOYSA-N 2,4-dimethylpiperidine Chemical compound CC1CCNC(C)C1 QOZOFODNIBQPGN-UHFFFAOYSA-N 0.000 description 1
- QRWRJDVVXAXGBT-UHFFFAOYSA-N 2-Methylindoline Chemical compound C1=CC=C2NC(C)CC2=C1 QRWRJDVVXAXGBT-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- TWASTFFGKLUULN-UHFFFAOYSA-N 2-chloro-n,n-bis(2-hydroxyethyl)acetamide Chemical compound OCCN(CCO)C(=O)CCl TWASTFFGKLUULN-UHFFFAOYSA-N 0.000 description 1
- RAAGZOYMEQDCTD-UHFFFAOYSA-N 2-fluorobenzoyl chloride Chemical compound FC1=CC=CC=C1C(Cl)=O RAAGZOYMEQDCTD-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- GSLTVFIVJMCNBH-UHFFFAOYSA-N 2-isocyanatopropane Chemical compound CC(C)N=C=O GSLTVFIVJMCNBH-UHFFFAOYSA-N 0.000 description 1
- VUGCBIWQHSRQBZ-UHFFFAOYSA-N 2-methylbut-3-yn-2-amine Chemical compound CC(C)(N)C#C VUGCBIWQHSRQBZ-UHFFFAOYSA-N 0.000 description 1
- WBEKRMVYCWRRDJ-UHFFFAOYSA-N 2-n-propan-2-yl-1,3,5-triazine-2,4-diamine Chemical compound CC(C)NC1=NC=NC(N)=N1 WBEKRMVYCWRRDJ-UHFFFAOYSA-N 0.000 description 1
- NUWCDHQYCLUEDS-UHFFFAOYSA-N 3-(4-methylphenyl)propan-1-amine Chemical compound CC1=CC=C(CCCN)C=C1 NUWCDHQYCLUEDS-UHFFFAOYSA-N 0.000 description 1
- DQAZPZIYEOGZAF-UHFFFAOYSA-N 4-ethyl-n-[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]piperazine-1-carboxamide Chemical compound C1CN(CC)CCN1C(=O)NC(C(=CC1=NC=N2)OC)=CC1=C2NC1=CC=CC(C#C)=C1 DQAZPZIYEOGZAF-UHFFFAOYSA-N 0.000 description 1
- PXRKCOCTEMYUEG-UHFFFAOYSA-N 5-aminoisoindole-1,3-dione Chemical compound NC1=CC=C2C(=O)NC(=O)C2=C1 PXRKCOCTEMYUEG-UHFFFAOYSA-N 0.000 description 1
- VZEBSJIOUMDNLY-UHFFFAOYSA-N 6-bromo-1,3-benzothiazol-2-amine Chemical compound C1=C(Br)C=C2SC(N)=NC2=C1 VZEBSJIOUMDNLY-UHFFFAOYSA-N 0.000 description 1
- OOHIAOSLOGDBCE-UHFFFAOYSA-N 6-chloro-4-n-cyclopropyl-2-n-propan-2-yl-1,3,5-triazine-2,4-diamine Chemical compound CC(C)NC1=NC(Cl)=NC(NC2CC2)=N1 OOHIAOSLOGDBCE-UHFFFAOYSA-N 0.000 description 1
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical compound CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 1
- 206010013883 Dwarfism Diseases 0.000 description 1
- RCZNYTXJVULKCR-UHFFFAOYSA-N I.I.I.I.I.I.I.I Chemical compound I.I.I.I.I.I.I.I RCZNYTXJVULKCR-UHFFFAOYSA-N 0.000 description 1
- 241001520820 Joinvillea ascendens Species 0.000 description 1
- 231100000674 Phytotoxicity Toxicity 0.000 description 1
- 241000209504 Poaceae Species 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 101150046432 Tril gene Proteins 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- 150000008061 acetanilides Chemical class 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000003927 aminopyridines Chemical class 0.000 description 1
- NEEDEQSZOUAJMU-UHFFFAOYSA-N but-2-yn-1-ol Chemical compound CC#CCO NEEDEQSZOUAJMU-UHFFFAOYSA-N 0.000 description 1
- WQAQPCDUOCURKW-UHFFFAOYSA-N butanethiol Chemical compound CCCCS WQAQPCDUOCURKW-UHFFFAOYSA-N 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000010411 cooking Methods 0.000 description 1
- KQWGXHWJMSMDJJ-UHFFFAOYSA-N cyclohexyl isocyanate Chemical compound O=C=NC1CCCCC1 KQWGXHWJMSMDJJ-UHFFFAOYSA-N 0.000 description 1
- ZOOSILUVXHVRJE-UHFFFAOYSA-N cyclopropanecarbonyl chloride Chemical compound ClC(=O)C1CC1 ZOOSILUVXHVRJE-UHFFFAOYSA-N 0.000 description 1
- IPIVAXLHTVNRBS-UHFFFAOYSA-N decanoyl chloride Chemical compound CCCCCCCCCC(Cl)=O IPIVAXLHTVNRBS-UHFFFAOYSA-N 0.000 description 1
- 230000035613 defoliation Effects 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- 230000004720 fertilization Effects 0.000 description 1
- 125000004967 formylalkyl group Chemical group 0.000 description 1
- DDRPCXLAQZKBJP-UHFFFAOYSA-N furfurylamine Chemical compound NCC1=CC=CO1 DDRPCXLAQZKBJP-UHFFFAOYSA-N 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 125000001475 halogen functional group Chemical group 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 230000000266 injurious effect Effects 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- LRDFRRGEGBBSRN-UHFFFAOYSA-N isobutyronitrile Chemical compound CC(C)C#N LRDFRRGEGBBSRN-UHFFFAOYSA-N 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 125000005358 mercaptoalkyl group Chemical group 0.000 description 1
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- SWDCCXMLXSTSCC-UHFFFAOYSA-N n-phenyl-n-propan-2-ylacetamide Chemical compound CC(C)N(C(C)=O)C1=CC=CC=C1 SWDCCXMLXSTSCC-UHFFFAOYSA-N 0.000 description 1
- QZXRFOHTSOCLGK-UHFFFAOYSA-N n-propyl-1,3,5-triazin-2-amine Chemical compound CCCNC1=NC=NC=N1 QZXRFOHTSOCLGK-UHFFFAOYSA-N 0.000 description 1
- ODBVEGWTXOEBIY-UHFFFAOYSA-N n-propylcyclooctanamine Chemical compound CCCNC1CCCCCCC1 ODBVEGWTXOEBIY-UHFFFAOYSA-N 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- ZNNZYHKDIALBAK-UHFFFAOYSA-M potassium thiocyanate Chemical compound [K+].[S-]C#N ZNNZYHKDIALBAK-UHFFFAOYSA-M 0.000 description 1
- 229940116357 potassium thiocyanate Drugs 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- KJRCEJOSASVSRA-UHFFFAOYSA-N propane-2-thiol Chemical compound CC(C)S KJRCEJOSASVSRA-UHFFFAOYSA-N 0.000 description 1
- SXYFKXOFMCIXQW-UHFFFAOYSA-N propanedioyl dichloride Chemical compound ClC(=O)CC(Cl)=O SXYFKXOFMCIXQW-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 230000009528 severe injury Effects 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000004557 technical material Substances 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 150000003558 thiocarbamic acid derivatives Chemical class 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 238000012549 training Methods 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C243/00—Compounds containing chains of nitrogen atoms singly-bound to each other, e.g. hydrazines, triazanes
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C279/00—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups
- C07C279/20—Derivatives of guanidine, i.e. compounds containing the group, the singly-bound nitrogen atoms not being part of nitro or nitroso groups containing any of the groups, X being a hetero atom, Y being any atom, e.g. acylguanidines
- C07C279/22—Y being a hydrogen or a carbon atom, e.g. benzoylguanidines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/08—Indoles; Hydrogenated indoles with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/10—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D261/14—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/04—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/08—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D277/12—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/18—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
- C07D285/12—1,3,4-Thiadiazoles; Hydrogenated 1,3,4-thiadiazoles
- C07D285/125—1,3,4-Thiadiazoles; Hydrogenated 1,3,4-thiadiazoles with oxygen, sulfur or nitrogen atoms, directly attached to ring carbon atoms, the nitrogen atoms not forming part of a nitro radical
- C07D285/135—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/18—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carboxylic acids, or sulfur or nitrogen analogues thereof
- C07D295/182—Radicals derived from carboxylic acids
- C07D295/185—Radicals derived from carboxylic acids from aliphatic carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/04—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D307/10—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/12—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/04—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D307/10—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/14—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/52—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/56—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/68—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/24—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/38—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US13486871A | 1971-04-16 | 1971-04-16 | |
| US05/208,041 US4137070A (en) | 1971-04-16 | 1971-12-09 | Herbicide compositions |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2218097A1 true DE2218097A1 (de) | 1972-11-02 |
| DE2218097C2 DE2218097C2 (enExample) | 1987-07-30 |
Family
ID=26832761
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19722218097 Granted DE2218097A1 (de) | 1971-04-16 | 1972-04-14 | Herbizides Mittel und seine Verwendung |
Country Status (18)
| Country | Link |
|---|---|
| AR (1) | AR192928A1 (enExample) |
| BE (1) | BE782120A (enExample) |
| CA (1) | CA1174865A (enExample) |
| CH (1) | CH577785A5 (enExample) |
| CS (1) | CS196241B2 (enExample) |
| DD (1) | DD102075A5 (enExample) |
| DE (1) | DE2218097A1 (enExample) |
| DK (1) | DK143583C (enExample) |
| ES (1) | ES401779A1 (enExample) |
| FR (1) | FR2133793B1 (enExample) |
| GB (2) | GB1396942A (enExample) |
| IL (1) | IL39219A (enExample) |
| IT (1) | IT953649B (enExample) |
| MY (1) | MY7700206A (enExample) |
| NL (1) | NL175965C (enExample) |
| PL (1) | PL99481B1 (enExample) |
| RO (3) | RO78996A (enExample) |
| TR (1) | TR18613A (enExample) |
Cited By (46)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2350800A1 (de) * | 1972-10-13 | 1974-04-25 | Stauffer Chemical Co | Nutzpflanzenschutzzusaetze fuer unkrautvernichtungsmittel |
| DE2441741A1 (de) * | 1973-09-04 | 1975-03-13 | Stauffer Chemical Co | Saatschuetzende herbizide zubereitung |
| DE2605586A1 (de) * | 1975-02-14 | 1976-08-26 | Stauffer Chemical Co | Halogenacyl- und thiohalogenacylaryl- substituierte oxazolidine und thiazolidine- gegenmittel gegen schaedigungen durch herbizide |
| EP0006540A1 (de) * | 1978-06-28 | 1980-01-09 | Bayer Ag | N-Dichloracetyl-1,2,3,4-tetrahydro-chinaldin, Verfahren zu dessen Herstellung und dessen Verwendung zur Verhütung von Herbizidschäden an Kulturpflanzen sowie selektive herbizide Mittel auf Basis von N-Dichloracetyl-1,2,3,4-tetrahydro-chinaldin und herbizid wirksamen Acetaniliden oder Thiolcarbamaten |
| EP0007588A1 (de) * | 1978-07-27 | 1980-02-06 | BASF Aktiengesellschaft | Tetrahydro-1,3-oxazine, herbizide Mittel, die Acetanilide als herbizide Wirkstoffe und diese Tetrahydro-1,3-oxazine als antagonistische Mittel enthalten, sowie ihre Verwendung zur Bekämpfung unerwünschten Pflanzenwuchses |
| EP0008649A1 (de) * | 1978-07-27 | 1980-03-19 | BASF Aktiengesellschaft | Herbicide Mittel auf der Basis von Acetaniliden und N-Isopropyl-N-propargyl-dichloracetamid und Verfahren zur selektiven Bekämpfung von unerwünschtem Pflanzenwuchs |
| EP0009091A1 (de) * | 1978-07-27 | 1980-04-02 | BASF Aktiengesellschaft | Verfahren zur selektiven Bekämpfung von unerwünschtem Pflanzenwachstum mit herbiziden Mitteln auf Basis von Acetaniliden und N-Dichloracetyl-2,2-dimethyl-1,3-oxazolidin |
| EP0009555A1 (de) * | 1978-07-27 | 1980-04-16 | BASF Aktiengesellschaft | Herbizide Mittel auf der Basis eines Thiolcarbamats, die Halogenacylamide als Antagonisten enthalten, und ihre Verwendung in einem Verfahren zur selektiven Bekämpfung von unerwünschtem Pflanzenwuchs |
| DE2905650A1 (de) * | 1978-02-06 | 1980-08-21 | Nitrokemia Ipartelepek | Unkrautvernichtungsmittel |
| US4237302A (en) * | 1978-09-29 | 1980-12-02 | Gulf Oil Corporation | Dichloroacetylimino herbicide antagonists as plant protection agents |
| EP0023287A1 (de) * | 1979-07-26 | 1981-02-04 | Bayer Ag | Gegenmittel zum Schutz von Kulturpflanzen vor Schädigungen durch Herbizide |
| EP0023306A1 (de) * | 1979-07-26 | 1981-02-04 | Bayer Ag | N-(Alpha-Chlorpropionyl)-1,2,3,4-tetrahydro-chinaldin, Verfahren zu dessen Herstellung und dessen Verwendung als Gegenmittel zum Schutz von Kulturpflanzen vor Schädigungen durch Herbizide |
| EP0023307A1 (de) * | 1979-07-26 | 1981-02-04 | Bayer Ag | N-(Alpha-Chlorpropionyl)-1,2,3,4-tetrahydro-iso-chinolin, Verfahren zu dessen Herstellung und dessen Verwendung als Gegenmittel zum Schutz von Kulturpflanzen vor Schädigungen durch Herbizide |
| EP0031042A1 (de) * | 1979-12-03 | 1981-07-01 | BASF Aktiengesellschaft | N-Dichloracetyldiazabicycloderivate,Verfahren zu ihrer Herstellung,herbizide Mittel,die Acetanilide als herbizide Wirkstoffe und diese N-Dichloroacetyldiazaantagonistische Mittel enthalten, sowie ihre Verwendung zur Bekämpfung unerwünschten Pflanzenwuchses |
| US4279636A (en) * | 1978-09-29 | 1981-07-21 | Gulf Oil Corporation | Dichloroacetylimino herbicide antagonists as plant protection agents |
| EP0035638A3 (de) * | 1980-02-09 | 1981-10-07 | Bayer Ag | Halogenalkylamide, Verfahren zu deren Herstellung und deren Verwendung als Gegenmittel zum Schutz von Kulturpflanzen vor Schädigungen durch Herbizide |
| EP0049760A3 (de) * | 1980-09-19 | 1982-08-18 | Bayer Ag | Heterocyclisch substituierte Amide, Verfahren zu deren Herstellung und deren Verwendung als Gegenmittel zum Schutz von Kulturpflanzen vor Schädigungen durch Herbizide |
| EP0065724A1 (de) * | 1981-05-26 | 1982-12-01 | BASF Aktiengesellschaft | Dihalogenacetamide, Verfahren zu ihrer Herstellung und herbizide Mittel, die Acetanilide als herbizide Wirkstoffe und diese Dihalogenacetamide als antagonistische Mittel enthalten |
| US4392882A (en) | 1979-07-26 | 1983-07-12 | Bayer Aktiengesellschaft | N-N-Bis(haloacyl)-diaza-cycloalkanes for protecting plants from herbicide damage |
| US4396416A (en) | 1979-09-21 | 1983-08-02 | Bayer Aktiengesellschaft | N-Acyl-piperidon compounds and their use as antidotes for protecting crop plants from herbicidal damage |
| DE3426541A1 (de) * | 1983-07-21 | 1985-01-31 | Eszakmagyarországi Vegyimüvek, Sajóbábony | N- und gegebenenfalls n'-substituierte n-(dichloracetyl)-glycinamide und ihre verwendung als antidota fuer herbizide |
| US4548639A (en) * | 1979-07-26 | 1985-10-22 | Bayer Aktiengesellschaft | N-Acyl-piperidone ketal compounds and their use as antidotes for protecting crop plants from herbicidal damage |
| US4618361A (en) * | 1983-12-12 | 1986-10-21 | Ciba-Geigy Corporation | Acylamides and compositions for the protection of cultivated plants against the phytotoxic action of herbicides |
| EP0190105A3 (de) * | 1985-01-31 | 1988-10-26 | Ciba-Geigy Ag | Herbizides Mittel |
| US4897109A (en) * | 1984-05-28 | 1990-01-30 | Ciba-Geigy Corporation | Compositions for protecting culture plants from the phytotoxic action of herbicidally active chloracetanilides |
| WO2004111042A1 (de) | 2003-06-12 | 2004-12-23 | Bayer Cropscience Aktiengesellschaft | N-heterocyclyl-phenylsubstituierte cyclische ketoenole |
| WO2005092897A2 (de) | 2004-03-25 | 2005-10-06 | Bayer Cropscience Ag | 2,4,6-phenylsubstituierte cyclische ketoenole |
| WO2006000355A1 (de) | 2004-06-25 | 2006-01-05 | Bayer Cropscience Aktiengesellschaft | 3'-alkoxy spirocyclische tetram- und tetronsäuren |
| WO2006029799A1 (de) | 2004-09-16 | 2006-03-23 | Bayer Cropscience Ag | Jod-phenylsubstituierte cyclische ketoenole |
| WO2007073856A2 (de) | 2005-12-15 | 2007-07-05 | Bayer Cropscience Ag | 3'-alkoxy-spirocyclopentyl substituierte tetram- und tetronsäuren |
| WO2007096058A1 (de) | 2006-02-21 | 2007-08-30 | Bayer Cropscience Ag | Cycloalkyl-phenylsubstituierte cyclische ketoenole |
| US7420062B2 (en) | 2003-07-14 | 2008-09-02 | Bayer Cropscience, Ag | Hetaryl-substituted pyrazolidindione derivatives with pesticidal characteristics |
| EP1974607A2 (de) | 2004-07-20 | 2008-10-01 | Bayer CropScience AG | Selektive Insektizide auf Basis von Anthranilsäurediamiden und Safenern |
| WO2009015801A1 (de) | 2007-08-02 | 2009-02-05 | Bayer Cropscience Ag | Oxaspirocyclische-spiro-substituierte tetram- und tetronsäure-derivate |
| WO2009039975A1 (de) | 2007-09-25 | 2009-04-02 | Bayer Cropscience Ag | Halogenalkoxyspirocyclische tetram- und tetronsäure-derivate |
| US7569517B2 (en) | 2003-08-14 | 2009-08-04 | Bayer Cropscience Ag | 4-biphenyl-substituted pyrazolidin-3 5-diones pesticide agent and/or microbicide and/or herbicide |
| EP2103615A1 (de) | 2008-03-19 | 2009-09-23 | Bayer CropScience AG | 4'4'-Dioxaspiro-spirocyclisch substituierte Tetramate |
| US7727933B2 (en) | 2003-11-22 | 2010-06-01 | Bayer Cropscience Ag | 2-ethyl-4,6-dimethyl-phenyl-substituted spirocyclic tetramic acid derivatives |
| EP2216317A1 (de) | 2004-11-04 | 2010-08-11 | Bayer CropScience AG | Phenylessigsäurehalogenide |
| EP2218710A1 (de) | 2004-11-04 | 2010-08-18 | Bayer CropScience AG | Verfahren zur Herstellung von 2,6-Diethyl-4-methylphenylessigsäure |
| EP2218330A1 (de) | 2003-11-22 | 2010-08-18 | Bayer CropScience AG | Verfahren zur Herstellung von 2-Ethyl-4,6-dimethylphenylessigsäure durch Umsetzung von 2-Ethyl-4,6-dimethylbrombenzol mit tert.-Butylacetat |
| US8119566B2 (en) | 2003-08-14 | 2012-02-21 | Bayer Cropscience Ag | 4-biphenyl-substituted pyrazolidin-3,5-dione derivatives |
| US8173697B2 (en) | 2006-06-02 | 2012-05-08 | Bayer Cropscience Ag | Alkoxyalkyl-substituted cyclic keto-enols |
| US8507537B2 (en) | 2006-10-25 | 2013-08-13 | Bayer Cropscience Ag | Trifluromethoxyphenyl-substituted tetramic acid derivatives pesticides and/or herbicides |
| US8993782B2 (en) | 2006-12-04 | 2015-03-31 | Bayer Cropscience Ag | Cis-alkoxyspirocyclic biphenyl-substituted tetramic acid derivatives |
| US9000189B2 (en) | 2006-12-04 | 2015-04-07 | Bayer Cropscience Ag | Biphenyl-substituted spirocyclic ketoenols |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3931313A (en) | 1972-07-17 | 1976-01-06 | Stauffer Chemical Company | Schiff's base dichloroacetamides |
| CH574207A5 (enExample) * | 1973-01-25 | 1976-04-15 | Ciba Geigy Ag | |
| DE2438332A1 (de) * | 1974-08-09 | 1976-02-19 | Consortium Elektrochem Ind | Herbicide mittel |
| GB1519762A (en) | 1974-08-09 | 1978-08-02 | Wellcome Found | Cinnamamides their preparation and pharmaceutical compositions containing them |
| US4091112A (en) | 1974-08-09 | 1978-05-23 | Burroughs Wellcome Co. | Biologically active amides |
| US4152442A (en) * | 1975-06-05 | 1979-05-01 | Lilly Industries Limited | Certain acylamino-oxa (or thia) diazoles in treatment of hypersensitivity conditions |
| US4166818A (en) * | 1975-06-05 | 1979-09-04 | Lilly Industries Limited | Acylamino derivatives |
| US4013681A (en) * | 1975-06-23 | 1977-03-22 | Hawaiian Sugar Planters' Association | Derivatives of thiophene |
| IN144916B (enExample) * | 1975-08-08 | 1978-07-29 | Stauffer Chemical Co | |
| US4107320A (en) | 1976-08-06 | 1978-08-15 | Burroughs Wellcome Co. | Biologically active amides |
| HU178301B (en) * | 1978-02-06 | 1982-04-28 | Nitrokemia Ipartelepek | Herbicide compositions containing naphthaline-carboxylic acid derivatives as antidotes and carbamide derivatives and antidote compositions containing naphthaline-carboxylic acid derivatives |
| DE2828303A1 (de) * | 1978-06-28 | 1980-01-17 | Bayer Ag | Verwendung von n,n-diallyl-dichloracetamid zur verbesserung der kulturpflanzen- vertraeglichkeit von herbizid wirksamen acetaniliden |
| DE2828222A1 (de) * | 1978-06-28 | 1980-01-10 | Bayer Ag | Gegenmittel zum schutz von kulturpflanzen vor schaedigungen durch herbizide |
| HU182177B (en) * | 1980-08-13 | 1983-12-28 | Eszakmagyar Vegyimuevek | Composition for influencing plant growth |
| GB2107308B (en) * | 1981-09-30 | 1986-01-15 | Ici Plc | Herbicidal and fungicidal |
| ATE20888T1 (de) * | 1982-05-10 | 1986-08-15 | Ciba Geigy Ag | Cyclopropancarbonsaeurederivate. |
| US4518789A (en) * | 1982-06-30 | 1985-05-21 | Yu Ruey J | Phenyl alpha-acyloxyacetamide derivatives and their therapeutic use |
| HU194686B (en) * | 1985-05-10 | 1988-03-28 | Eszakmagyar Vegyimuevek | Herbicidal composition of prolonged action, comprising alpha-chlorine-acetanilide derivatives as active substance |
| US5425789A (en) * | 1986-12-22 | 1995-06-20 | Exxon Chemical Patents Inc. | Chemical compositions and their use as fuel additives |
Citations (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2973258A (en) * | 1957-12-30 | 1961-02-28 | Monsanto Chemicals | Unsymmetrical alpha-haloacetamide herbicides |
| US3131509A (en) * | 1961-05-08 | 1964-05-05 | Spencer Chem Co | Compositions and methods for reducing herbicidal injury |
| US3133810A (en) * | 1961-04-19 | 1964-05-19 | Monsanto Chemicals | Herbicidal compositions |
| US3152884A (en) * | 1961-04-24 | 1964-10-13 | Upjohn Co | Herbicidal composition and method |
| US3152883A (en) * | 1961-09-12 | 1964-10-13 | Upjohn Co | Herbicidal composition and method |
| US3154400A (en) * | 1961-11-15 | 1964-10-27 | Monsanto Co | Alkyl substituted chloroacetamide weed control |
| US3268526A (en) * | 1962-09-12 | 1966-08-23 | Monsanto Co | Heterocyclic polyhalobenzamide derivatives |
| US3321295A (en) * | 1965-11-04 | 1967-05-23 | Monsanto Co | Method of controlling undesired plants |
| US3357816A (en) * | 1964-12-08 | 1967-12-12 | Monsanto Co | Herbicidal benzamides and methods |
| US3362810A (en) * | 1966-08-01 | 1968-01-09 | Monsanto Co | Herbicidal clay formulation |
| US3469966A (en) * | 1967-01-23 | 1969-09-30 | Allied Chem | Bicyclic amides having herbicidal properties |
| DE1952910A1 (de) * | 1968-10-25 | 1970-06-25 | Gulf Res And Dev Corp | Verfahren zum Resistentmachen von Getreidesamen gegenueber bestimmten Herbiziden |
| DE2007924A1 (de) * | 1969-03-26 | 1970-10-01 | Rohm and Haas Company, Philadelphia, Pa. (V.St.A.) | Di- und trisubstituierte Benzamide |
| US3534098A (en) * | 1967-01-10 | 1970-10-13 | Rohm & Haas | 3,5-disubstituted benzamides |
| US3551484A (en) * | 1968-04-01 | 1970-12-29 | Rohm & Haas | 3,5-disubstituted benzamides |
| DE1618644A1 (de) * | 1966-02-01 | 1971-04-01 | Monsanto Co | Biocide,insbesondere phytotoxische Zubereitungen |
| BE762601A (fr) * | 1970-02-06 | 1971-07-16 | Gulf Research Development Co | Nouveaux n-benzylcarboxamides doues d'activite herbicide |
| BE765936A (fr) * | 1970-04-21 | 1971-09-16 | Lenning Chemicals Ltd | Compositions pesticides a au moins deux ingredients actifs et leur utilisation comme herbicides |
| ZA712246B (en) * | 1970-04-16 | 1972-01-26 | Gulf Research Development Co | Protection of wheat and grain sorghum from herbicidal injury |
| IL37610A (en) * | 1970-08-31 | 1974-09-10 | Stauffer Chemical Co | Herbicidal compositions containing s-esters of thiocarbamates,triazines,2,4-dichlorophenoxy acetic acid or mixtures thereof and a haloalkoxysulfonyl derivative as antidote |
-
1972
- 1972-04-06 CA CA000139060A patent/CA1174865A/en not_active Expired
- 1972-04-12 NL NLAANVRAGE7204894,A patent/NL175965C/xx not_active IP Right Cessation
- 1972-04-12 DD DD162258A patent/DD102075A5/xx unknown
- 1972-04-12 DK DK177372A patent/DK143583C/da active
- 1972-04-12 AR AR241425A patent/AR192928A1/es active
- 1972-04-13 CS CS722480A patent/CS196241B2/cs unknown
- 1972-04-14 IL IL39219A patent/IL39219A/xx unknown
- 1972-04-14 DE DE19722218097 patent/DE2218097A1/de active Granted
- 1972-04-14 FR FR7213316A patent/FR2133793B1/fr not_active Expired
- 1972-04-14 BE BE782120A patent/BE782120A/xx not_active IP Right Cessation
- 1972-04-14 PL PL1972154732A patent/PL99481B1/pl unknown
- 1972-04-15 ES ES401779A patent/ES401779A1/es not_active Expired
- 1972-04-15 IT IT23209/72A patent/IT953649B/it active
- 1972-04-16 GB GB5447574A patent/GB1396942A/en not_active Expired
- 1972-04-16 GB GB1475472A patent/GB1396941A/en not_active Expired
- 1972-04-17 TR TR18613A patent/TR18613A/xx unknown
- 1972-04-17 RO RO7270563A patent/RO78996A/ro unknown
- 1972-04-17 RO RO108381A patent/RO83877B/ro unknown
- 1972-04-17 RO RO108380A patent/RO83875B/ro unknown
- 1972-04-17 CH CH563772A patent/CH577785A5/xx not_active IP Right Cessation
-
1977
- 1977-12-30 MY MY206/77A patent/MY7700206A/xx unknown
Patent Citations (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2973258A (en) * | 1957-12-30 | 1961-02-28 | Monsanto Chemicals | Unsymmetrical alpha-haloacetamide herbicides |
| US3133810A (en) * | 1961-04-19 | 1964-05-19 | Monsanto Chemicals | Herbicidal compositions |
| US3152884A (en) * | 1961-04-24 | 1964-10-13 | Upjohn Co | Herbicidal composition and method |
| US3131509A (en) * | 1961-05-08 | 1964-05-05 | Spencer Chem Co | Compositions and methods for reducing herbicidal injury |
| US3152883A (en) * | 1961-09-12 | 1964-10-13 | Upjohn Co | Herbicidal composition and method |
| US3154400A (en) * | 1961-11-15 | 1964-10-27 | Monsanto Co | Alkyl substituted chloroacetamide weed control |
| US3268526A (en) * | 1962-09-12 | 1966-08-23 | Monsanto Co | Heterocyclic polyhalobenzamide derivatives |
| US3357816A (en) * | 1964-12-08 | 1967-12-12 | Monsanto Co | Herbicidal benzamides and methods |
| US3321295A (en) * | 1965-11-04 | 1967-05-23 | Monsanto Co | Method of controlling undesired plants |
| DE1618644A1 (de) * | 1966-02-01 | 1971-04-01 | Monsanto Co | Biocide,insbesondere phytotoxische Zubereitungen |
| US3362810A (en) * | 1966-08-01 | 1968-01-09 | Monsanto Co | Herbicidal clay formulation |
| US3534098A (en) * | 1967-01-10 | 1970-10-13 | Rohm & Haas | 3,5-disubstituted benzamides |
| US3469966A (en) * | 1967-01-23 | 1969-09-30 | Allied Chem | Bicyclic amides having herbicidal properties |
| US3551484A (en) * | 1968-04-01 | 1970-12-29 | Rohm & Haas | 3,5-disubstituted benzamides |
| DE1952910A1 (de) * | 1968-10-25 | 1970-06-25 | Gulf Res And Dev Corp | Verfahren zum Resistentmachen von Getreidesamen gegenueber bestimmten Herbiziden |
| DE2007924A1 (de) * | 1969-03-26 | 1970-10-01 | Rohm and Haas Company, Philadelphia, Pa. (V.St.A.) | Di- und trisubstituierte Benzamide |
| BE762601A (fr) * | 1970-02-06 | 1971-07-16 | Gulf Research Development Co | Nouveaux n-benzylcarboxamides doues d'activite herbicide |
| ZA712246B (en) * | 1970-04-16 | 1972-01-26 | Gulf Research Development Co | Protection of wheat and grain sorghum from herbicidal injury |
| BE765936A (fr) * | 1970-04-21 | 1971-09-16 | Lenning Chemicals Ltd | Compositions pesticides a au moins deux ingredients actifs et leur utilisation comme herbicides |
| IL37610A (en) * | 1970-08-31 | 1974-09-10 | Stauffer Chemical Co | Herbicidal compositions containing s-esters of thiocarbamates,triazines,2,4-dichlorophenoxy acetic acid or mixtures thereof and a haloalkoxysulfonyl derivative as antidote |
Cited By (61)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2350800A1 (de) * | 1972-10-13 | 1974-04-25 | Stauffer Chemical Co | Nutzpflanzenschutzzusaetze fuer unkrautvernichtungsmittel |
| DE2441741A1 (de) * | 1973-09-04 | 1975-03-13 | Stauffer Chemical Co | Saatschuetzende herbizide zubereitung |
| DE2605586A1 (de) * | 1975-02-14 | 1976-08-26 | Stauffer Chemical Co | Halogenacyl- und thiohalogenacylaryl- substituierte oxazolidine und thiazolidine- gegenmittel gegen schaedigungen durch herbizide |
| DE2905650A1 (de) * | 1978-02-06 | 1980-08-21 | Nitrokemia Ipartelepek | Unkrautvernichtungsmittel |
| EP0006540A1 (de) * | 1978-06-28 | 1980-01-09 | Bayer Ag | N-Dichloracetyl-1,2,3,4-tetrahydro-chinaldin, Verfahren zu dessen Herstellung und dessen Verwendung zur Verhütung von Herbizidschäden an Kulturpflanzen sowie selektive herbizide Mittel auf Basis von N-Dichloracetyl-1,2,3,4-tetrahydro-chinaldin und herbizid wirksamen Acetaniliden oder Thiolcarbamaten |
| EP0007588A1 (de) * | 1978-07-27 | 1980-02-06 | BASF Aktiengesellschaft | Tetrahydro-1,3-oxazine, herbizide Mittel, die Acetanilide als herbizide Wirkstoffe und diese Tetrahydro-1,3-oxazine als antagonistische Mittel enthalten, sowie ihre Verwendung zur Bekämpfung unerwünschten Pflanzenwuchses |
| EP0008649A1 (de) * | 1978-07-27 | 1980-03-19 | BASF Aktiengesellschaft | Herbicide Mittel auf der Basis von Acetaniliden und N-Isopropyl-N-propargyl-dichloracetamid und Verfahren zur selektiven Bekämpfung von unerwünschtem Pflanzenwuchs |
| EP0009091A1 (de) * | 1978-07-27 | 1980-04-02 | BASF Aktiengesellschaft | Verfahren zur selektiven Bekämpfung von unerwünschtem Pflanzenwachstum mit herbiziden Mitteln auf Basis von Acetaniliden und N-Dichloracetyl-2,2-dimethyl-1,3-oxazolidin |
| EP0009555A1 (de) * | 1978-07-27 | 1980-04-16 | BASF Aktiengesellschaft | Herbizide Mittel auf der Basis eines Thiolcarbamats, die Halogenacylamide als Antagonisten enthalten, und ihre Verwendung in einem Verfahren zur selektiven Bekämpfung von unerwünschtem Pflanzenwuchs |
| US4237302A (en) * | 1978-09-29 | 1980-12-02 | Gulf Oil Corporation | Dichloroacetylimino herbicide antagonists as plant protection agents |
| US4279636A (en) * | 1978-09-29 | 1981-07-21 | Gulf Oil Corporation | Dichloroacetylimino herbicide antagonists as plant protection agents |
| US4422866A (en) | 1979-07-26 | 1983-12-27 | Bayer Aktiengesellschaft | Antidotes for protecting plants from herbicide damage |
| EP0023287A1 (de) * | 1979-07-26 | 1981-02-04 | Bayer Ag | Gegenmittel zum Schutz von Kulturpflanzen vor Schädigungen durch Herbizide |
| EP0023307A1 (de) * | 1979-07-26 | 1981-02-04 | Bayer Ag | N-(Alpha-Chlorpropionyl)-1,2,3,4-tetrahydro-iso-chinolin, Verfahren zu dessen Herstellung und dessen Verwendung als Gegenmittel zum Schutz von Kulturpflanzen vor Schädigungen durch Herbizide |
| US4392882A (en) | 1979-07-26 | 1983-07-12 | Bayer Aktiengesellschaft | N-N-Bis(haloacyl)-diaza-cycloalkanes for protecting plants from herbicide damage |
| EP0023306A1 (de) * | 1979-07-26 | 1981-02-04 | Bayer Ag | N-(Alpha-Chlorpropionyl)-1,2,3,4-tetrahydro-chinaldin, Verfahren zu dessen Herstellung und dessen Verwendung als Gegenmittel zum Schutz von Kulturpflanzen vor Schädigungen durch Herbizide |
| US4614537A (en) * | 1979-07-26 | 1986-09-30 | Bayer Aktiengesellschaft | N-acyl-piperidone ketal compounds and their use as antidotes for protecting crop plants from herbicidal damage |
| US4548639A (en) * | 1979-07-26 | 1985-10-22 | Bayer Aktiengesellschaft | N-Acyl-piperidone ketal compounds and their use as antidotes for protecting crop plants from herbicidal damage |
| US4396416A (en) | 1979-09-21 | 1983-08-02 | Bayer Aktiengesellschaft | N-Acyl-piperidon compounds and their use as antidotes for protecting crop plants from herbicidal damage |
| EP0031042A1 (de) * | 1979-12-03 | 1981-07-01 | BASF Aktiengesellschaft | N-Dichloracetyldiazabicycloderivate,Verfahren zu ihrer Herstellung,herbizide Mittel,die Acetanilide als herbizide Wirkstoffe und diese N-Dichloroacetyldiazaantagonistische Mittel enthalten, sowie ihre Verwendung zur Bekämpfung unerwünschten Pflanzenwuchses |
| US4391626A (en) | 1980-02-09 | 1983-07-05 | Bayer Aktiengesellschaft | Haloalkylamide compounds and herbicidal antidote compositions |
| EP0035638A3 (de) * | 1980-02-09 | 1981-10-07 | Bayer Ag | Halogenalkylamide, Verfahren zu deren Herstellung und deren Verwendung als Gegenmittel zum Schutz von Kulturpflanzen vor Schädigungen durch Herbizide |
| EP0049760A3 (de) * | 1980-09-19 | 1982-08-18 | Bayer Ag | Heterocyclisch substituierte Amide, Verfahren zu deren Herstellung und deren Verwendung als Gegenmittel zum Schutz von Kulturpflanzen vor Schädigungen durch Herbizide |
| EP0065724A1 (de) * | 1981-05-26 | 1982-12-01 | BASF Aktiengesellschaft | Dihalogenacetamide, Verfahren zu ihrer Herstellung und herbizide Mittel, die Acetanilide als herbizide Wirkstoffe und diese Dihalogenacetamide als antagonistische Mittel enthalten |
| DE3426541A1 (de) * | 1983-07-21 | 1985-01-31 | Eszakmagyarországi Vegyimüvek, Sajóbábony | N- und gegebenenfalls n'-substituierte n-(dichloracetyl)-glycinamide und ihre verwendung als antidota fuer herbizide |
| US4618361A (en) * | 1983-12-12 | 1986-10-21 | Ciba-Geigy Corporation | Acylamides and compositions for the protection of cultivated plants against the phytotoxic action of herbicides |
| US4897109A (en) * | 1984-05-28 | 1990-01-30 | Ciba-Geigy Corporation | Compositions for protecting culture plants from the phytotoxic action of herbicidally active chloracetanilides |
| EP0190105A3 (de) * | 1985-01-31 | 1988-10-26 | Ciba-Geigy Ag | Herbizides Mittel |
| WO2004111042A1 (de) | 2003-06-12 | 2004-12-23 | Bayer Cropscience Aktiengesellschaft | N-heterocyclyl-phenylsubstituierte cyclische ketoenole |
| US7420062B2 (en) | 2003-07-14 | 2008-09-02 | Bayer Cropscience, Ag | Hetaryl-substituted pyrazolidindione derivatives with pesticidal characteristics |
| US7569517B2 (en) | 2003-08-14 | 2009-08-04 | Bayer Cropscience Ag | 4-biphenyl-substituted pyrazolidin-3 5-diones pesticide agent and/or microbicide and/or herbicide |
| US8987500B2 (en) | 2003-08-14 | 2015-03-24 | Bayer Cropscience Ag | 4-biphenyl-substituted pyrazolidin-3,5-dione derivatives |
| US8586783B2 (en) | 2003-08-14 | 2013-11-19 | Bayer Cropscience Ag | 4-biphenyl-substituted pyrazolidin-3,5-dione derivatives |
| US8119566B2 (en) | 2003-08-14 | 2012-02-21 | Bayer Cropscience Ag | 4-biphenyl-substituted pyrazolidin-3,5-dione derivatives |
| EP2218330A1 (de) | 2003-11-22 | 2010-08-18 | Bayer CropScience AG | Verfahren zur Herstellung von 2-Ethyl-4,6-dimethylphenylessigsäure durch Umsetzung von 2-Ethyl-4,6-dimethylbrombenzol mit tert.-Butylacetat |
| US7727933B2 (en) | 2003-11-22 | 2010-06-01 | Bayer Cropscience Ag | 2-ethyl-4,6-dimethyl-phenyl-substituted spirocyclic tetramic acid derivatives |
| WO2005092897A2 (de) | 2004-03-25 | 2005-10-06 | Bayer Cropscience Ag | 2,4,6-phenylsubstituierte cyclische ketoenole |
| WO2006000355A1 (de) | 2004-06-25 | 2006-01-05 | Bayer Cropscience Aktiengesellschaft | 3'-alkoxy spirocyclische tetram- und tetronsäuren |
| US8410289B2 (en) | 2004-06-25 | 2013-04-02 | Bayer Cropscience Ag | Spirocyclic 3'-alkoxytetramic acids and-tetronic acids |
| EP2246328A1 (de) | 2004-06-25 | 2010-11-03 | Bayer CropScience AG | 3'-Alkoxy spirocyclische Tetronsäuren |
| EP1974607A2 (de) | 2004-07-20 | 2008-10-01 | Bayer CropScience AG | Selektive Insektizide auf Basis von Anthranilsäurediamiden und Safenern |
| WO2006029799A1 (de) | 2004-09-16 | 2006-03-23 | Bayer Cropscience Ag | Jod-phenylsubstituierte cyclische ketoenole |
| EP2253207A1 (de) | 2004-11-04 | 2010-11-24 | Bayer CropScience AG | Substituierte Phenylessigsäureester |
| EP2216317A1 (de) | 2004-11-04 | 2010-08-11 | Bayer CropScience AG | Phenylessigsäurehalogenide |
| EP2216316A1 (de) | 2004-11-04 | 2010-08-11 | Bayer CropScience Aktiengesellschaft | Phenylessigsäurederivate |
| EP2218710A1 (de) | 2004-11-04 | 2010-08-18 | Bayer CropScience AG | Verfahren zur Herstellung von 2,6-Diethyl-4-methylphenylessigsäure |
| WO2007073856A2 (de) | 2005-12-15 | 2007-07-05 | Bayer Cropscience Ag | 3'-alkoxy-spirocyclopentyl substituierte tetram- und tetronsäuren |
| US8039014B2 (en) | 2005-12-15 | 2011-10-18 | Bayer Cropscience Ag | 3′-alkoxyspirocyclopentyl-substituted tetramic and tetronic acids |
| EP2186791A1 (de) | 2006-02-21 | 2010-05-19 | Bayer CropScience AG | Cycloalkyl-phenylsubstituierte cyclische Ketoenole |
| EP2186805A1 (de) | 2006-02-21 | 2010-05-19 | Bayer CropScience AG | Cycloalkyl-phenylsubstituierte cyclische Ketoenole |
| WO2007096058A1 (de) | 2006-02-21 | 2007-08-30 | Bayer Cropscience Ag | Cycloalkyl-phenylsubstituierte cyclische ketoenole |
| EP2184275A1 (de) | 2006-02-21 | 2010-05-12 | Bayer CropScience AG | Cycloalkyl-phenylsubstituierte cyclische Ketoenole |
| US8173697B2 (en) | 2006-06-02 | 2012-05-08 | Bayer Cropscience Ag | Alkoxyalkyl-substituted cyclic keto-enols |
| US8507537B2 (en) | 2006-10-25 | 2013-08-13 | Bayer Cropscience Ag | Trifluromethoxyphenyl-substituted tetramic acid derivatives pesticides and/or herbicides |
| US8993782B2 (en) | 2006-12-04 | 2015-03-31 | Bayer Cropscience Ag | Cis-alkoxyspirocyclic biphenyl-substituted tetramic acid derivatives |
| US9000189B2 (en) | 2006-12-04 | 2015-04-07 | Bayer Cropscience Ag | Biphenyl-substituted spirocyclic ketoenols |
| WO2009015801A1 (de) | 2007-08-02 | 2009-02-05 | Bayer Cropscience Ag | Oxaspirocyclische-spiro-substituierte tetram- und tetronsäure-derivate |
| US8859466B2 (en) | 2007-08-02 | 2014-10-14 | Bayer Cropscience Ag | Oxaspirocyclic spiro-substituted tetramic acid and tetronic acid derivatives |
| WO2009039975A1 (de) | 2007-09-25 | 2009-04-02 | Bayer Cropscience Ag | Halogenalkoxyspirocyclische tetram- und tetronsäure-derivate |
| WO2009115262A1 (de) | 2008-03-19 | 2009-09-24 | Bayer Cropscience Ag | 4'4'-dioxaspiro-spirocyclisch substituierte tetramate |
| EP2103615A1 (de) | 2008-03-19 | 2009-09-23 | Bayer CropScience AG | 4'4'-Dioxaspiro-spirocyclisch substituierte Tetramate |
Also Published As
| Publication number | Publication date |
|---|---|
| TR18613A (tr) | 1977-05-13 |
| IT953649B (it) | 1973-08-10 |
| RO83877B (ro) | 1984-04-30 |
| DE2218097C2 (enExample) | 1987-07-30 |
| FR2133793A1 (enExample) | 1972-12-01 |
| PL99481B1 (pl) | 1978-07-31 |
| IL39219A0 (en) | 1972-07-26 |
| RO83875A (ro) | 1984-04-02 |
| CH577785A5 (enExample) | 1976-07-30 |
| ES401779A1 (es) | 1975-11-01 |
| RO83877A (ro) | 1984-04-02 |
| IL39219A (en) | 1978-12-17 |
| GB1396941A (en) | 1975-06-11 |
| NL7204894A (enExample) | 1972-10-18 |
| RO83875B (ro) | 1984-04-30 |
| CA1174865A (en) | 1984-09-25 |
| BE782120A (fr) | 1972-10-16 |
| FR2133793B1 (enExample) | 1977-06-24 |
| DK143583C (da) | 1982-02-01 |
| DK143583B (da) | 1981-09-14 |
| NL175965C (nl) | 1985-02-01 |
| RO78996A (ro) | 1982-06-25 |
| MY7700206A (en) | 1977-12-31 |
| CS196241B2 (en) | 1980-03-31 |
| GB1396942A (en) | 1975-06-11 |
| DD102075A5 (enExample) | 1973-12-05 |
| AR192928A1 (es) | 1973-03-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2218097A1 (de) | Herbizides Mittel und seine Verwendung | |
| DE2927480C2 (de) | 1-Acetyl-3-cyano-4-phenylpyrrol-Derivate | |
| DE1695968C3 (de) | 4-Methylthiazolyl-5-carboxanilidverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als fungizide Mittel | |
| DE2604989A1 (de) | 1,5-alkylen-3-aryl-hydantoin-derivate, verfahren zu ihrer herstellung und mittel mit herbizider und/oder fungizider wirkung | |
| DE2911865C2 (de) | N-Halogenacetyl-phenylamino-carbonyl-oxime, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Mittel zur Bekämpfung von Unkraut | |
| DE2101938C2 (de) | 3-[2-Chlor-4-(3,3-dimethylureido)-phenyl]-5-tert.-butyl-1,3,4-oxadiazolon-(2), seine Herstellung und herbicide Zusammensetzungen, die es enthalten | |
| DE1618644C3 (de) | zu ihrer Herstellung und sie enthaltende Herbicide | |
| DE3002595A1 (de) | N-(heterocyclyl)-methylacetanilide und sie enthaltende herbizide und pflanzenwachstumsregulatoren | |
| DD149454A5 (de) | Lepidoptere vertilgende zusammensetzung | |
| DE69018847T2 (de) | Maleimidverbindungen und diese enthaltende Fungizide. | |
| DE2659404A1 (de) | Neue verbindungen, verfahren zu ihrer herstellung und sie enthaltende herbizide zusammensetzungen | |
| DE2524577C3 (de) | Substituierte Tetrahydropyran-3,5dione und 13-Dioxan-4,6-dione, Verfahren zu ihrer Herstellung und ihre Verwendung als selektive Herbicide | |
| DD149935A5 (de) | Verfahren zur herstellung von racemen oder optisch aktivem 2-(propargyloxyimino)-1,7,7-trimethylbicyclo(2,2,1)heptan | |
| DE1567104A1 (de) | Herbicide Zubereitungen mit neuen Hydrazinverbindungen als Wirkstoff | |
| DE3422346C2 (enExample) | ||
| DE2554866A1 (de) | Fungizide zusammensetzung | |
| DE2040580A1 (de) | Thiazolderivate | |
| DE2524578C3 (de) | 5-Hydroxylaminomethylen-barbitursäurederivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbicide | |
| DE2155391A1 (de) | l-Hydrocarbyldithio-3-arylharnstoffe und dieselben enthaltende Herbizide | |
| DE2824126A1 (de) | Tetrahydro-1,3,5-thiadiazin-4-on- verbindungen | |
| CH635107A5 (de) | Herbizid wirksame alpha-halogenacetamide. | |
| DE2510936A1 (de) | Thienylharnstoffe | |
| EP0106949B1 (de) | 3,7-Dichlor-8-chinolinderivate, Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung unerwünschten Pflanzenwuchses | |
| DE2451899A1 (de) | Triazindionverbindungen | |
| DE2601447A1 (de) | Cyclohexen-ester |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8172 | Supplementary division/partition in: |
Ref country code: DE Ref document number: 2266035 Format of ref document f/p: P |
|
| Q171 | Divided out to: |
Ref country code: DE Ref document number: 2266035 |
|
| AH | Division in |
Ref country code: DE Ref document number: 2266035 Format of ref document f/p: P |
|
| D2 | Grant after examination | ||
| AH | Division in |
Ref country code: DE Ref document number: 2266035 Format of ref document f/p: P |
|
| 8364 | No opposition during term of opposition | ||
| 8380 | Miscellaneous part iii |
Free format text: DER OT LAUTET RICHTIG: 02.11.72 |