DE1618005A1 - Verfahren zur Herstellung von neuen Amino-dihalogen-phenyl-aethylaminen - Google Patents
Verfahren zur Herstellung von neuen Amino-dihalogen-phenyl-aethylaminenInfo
- Publication number
- DE1618005A1 DE1618005A1 DE19671618005 DE1618005A DE1618005A1 DE 1618005 A1 DE1618005 A1 DE 1618005A1 DE 19671618005 DE19671618005 DE 19671618005 DE 1618005 A DE1618005 A DE 1618005A DE 1618005 A1 DE1618005 A1 DE 1618005A1
- Authority
- DE
- Germany
- Prior art keywords
- general formula
- amino
- phenyl
- hal
- shark
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 40
- 238000002360 preparation method Methods 0.000 title claims 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 21
- 239000002253 acid Substances 0.000 claims description 7
- -1 alkyl radicals Chemical class 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- 150000007522 mineralic acids Chemical class 0.000 claims description 4
- 150000007524 organic acids Chemical class 0.000 claims description 4
- 239000002904 solvent Substances 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 3
- 238000009835 boiling Methods 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 241000251730 Chondrichthyes Species 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000003277 amino group Chemical group 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 238000006243 chemical reaction Methods 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 235000005985 organic acids Nutrition 0.000 claims description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims 2
- 239000011230 binding agent Substances 0.000 claims 2
- 239000012433 hydrogen halide Substances 0.000 claims 2
- 229910000039 hydrogen halide Inorganic materials 0.000 claims 2
- CHRAJVQLWOMYQI-SCZZXKLOSA-N (1s,5r)-5,8,8-trimethyl-3-azabicyclo[3.2.1]octane Chemical group C1NC[C@H]2CC[C@]1(C)C2(C)C CHRAJVQLWOMYQI-SCZZXKLOSA-N 0.000 claims 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims 1
- 125000000304 alkynyl group Chemical group 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 claims 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims 1
- 239000000460 chlorine Substances 0.000 claims 1
- 229910052801 chlorine Inorganic materials 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 125000000753 cycloalkyl group Chemical group 0.000 claims 1
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 claims 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 35
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 2
- 229940013085 2-diethylaminoethanol Drugs 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- OHVLMTFVQDZYHP-UHFFFAOYSA-N 1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-2-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]ethanone Chemical compound N1N=NC=2CN(CCC=21)C(CN1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)=O OHVLMTFVQDZYHP-UHFFFAOYSA-N 0.000 description 1
- VVZTUODWEYORTB-UHFFFAOYSA-N 2,6-dibromo-4-(2-bromoethyl)aniline Chemical compound NC1=C(Br)C=C(CCBr)C=C1Br VVZTUODWEYORTB-UHFFFAOYSA-N 0.000 description 1
- LDLCZOVUSADOIV-UHFFFAOYSA-N 2-bromoethanol Chemical compound OCCBr LDLCZOVUSADOIV-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 229920000219 Ethylene vinyl alcohol Polymers 0.000 description 1
- OPKOKAMJFNKNAS-UHFFFAOYSA-N N-methylethanolamine Chemical compound CNCCO OPKOKAMJFNKNAS-UHFFFAOYSA-N 0.000 description 1
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 1
- 241001425800 Pipa Species 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 230000000954 anitussive effect Effects 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 230000001754 anti-pyretic effect Effects 0.000 description 1
- 239000002221 antipyretic Substances 0.000 description 1
- 229940124584 antitussives Drugs 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- PCHPORCSPXIHLZ-UHFFFAOYSA-N diphenhydramine hydrochloride Chemical compound [Cl-].C=1C=CC=CC=1C(OCC[NH+](C)C)C1=CC=CC=C1 PCHPORCSPXIHLZ-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 150000002780 morpholines Chemical class 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 230000001151 other effect Effects 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/02—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms containing only hydrogen and carbon atoms in addition to the ring hetero elements
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/13—Amines
- A61K31/135—Amines having aromatic rings, e.g. ketamine, nortriptyline
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/12—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Organic Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DET0032111 | 1966-09-22 | ||
| DET0033217 | 1967-02-15 | ||
| DET0034019 | 1967-06-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1618005A1 true DE1618005A1 (de) | 1971-09-09 |
Family
ID=27213171
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19671618005 Pending DE1618005A1 (de) | 1966-09-22 | 1967-02-15 | Verfahren zur Herstellung von neuen Amino-dihalogen-phenyl-aethylaminen |
| DE19671618009 Pending DE1618009A1 (de) | 1966-09-22 | 1967-06-02 | Verfahren zur Herstellung von neuen Amino-dihalogen-phenylaethylaminen |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19671618009 Pending DE1618009A1 (de) | 1966-09-22 | 1967-06-02 | Verfahren zur Herstellung von neuen Amino-dihalogen-phenylaethylaminen |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3536712A (https=) |
| AT (8) | AT277976B (https=) |
| BE (1) | BE704213A (https=) |
| CH (2) | CH489464A (https=) |
| DE (2) | DE1618005A1 (https=) |
| DK (1) | DK125417B (https=) |
| ES (8) | ES345210A1 (https=) |
| FI (1) | FI48460C (https=) |
| FR (2) | FR1544212A (https=) |
| GB (1) | GB1178191A (https=) |
| IT (1) | IT7949574A0 (https=) |
| NL (1) | NL6712787A (https=) |
| SE (1) | SE366539B (https=) |
| YU (2) | YU33283B (https=) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2354961A1 (de) * | 1973-11-02 | 1975-06-05 | Thomae Gmbh Dr K | Neue verfahren zur herstellung von amino-phenyl-aethanolaminen |
Families Citing this family (62)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3862987A (en) * | 1966-10-18 | 1975-01-28 | Delmar Chem | Phenyl-hydroxypropyl-substituted 1-amino adamantanes |
| US3929871A (en) * | 1968-04-01 | 1975-12-30 | Haessle Ab | 1-(3-Hydroxy-4-alkyl-phenyl)-alkylamines(-2) and the salts thereof |
| DE2157040A1 (de) * | 1971-11-17 | 1973-05-24 | Thomae Gmbh Dr K | Neues verfahren zur herstellung von 4-amino-3,5-dihalogen-phenyl-aethanolaminen |
| AT326634B (de) * | 1972-04-22 | 1975-12-29 | Thomae Gmbh Dr K | Verfahren zur herstellung von neuen 1-(4'-amino-3',5'-dihalogenphenyl)-2-cycloalkylaminoathanolen |
| US4024281A (en) * | 1972-05-26 | 1977-05-17 | Smithkline Corporation | N,N-bis[2-(3-substituted-4-hydroxyphenyl)-ethyl or -2-hydroxyethyl]-polymethylenediamines |
| US4119710A (en) * | 1972-12-18 | 1978-10-10 | Boehringer Ingelheim Gmbh | Bronchospasmolytic 1-(p-amino-phenyl)-2-amino-ethanols-(1) and salts |
| FR2281108A1 (fr) * | 1974-08-06 | 1976-03-05 | Ferrer Labor | Medicaments constitues par de nouvelles dihalogene-acetamino-benzylamines et leur procede de fabrication |
| US3984421A (en) * | 1975-05-08 | 1976-10-05 | E. R. Squibb & Sons, Inc. | Derivatives of [[(1-piperidinyl)ethyl]phenyl]alkanediamines |
| US4061778A (en) * | 1975-06-20 | 1977-12-06 | Sandoz, Inc. | Iminodimethylene di-tert-alkylophenones and phenols |
| US4154761A (en) * | 1976-02-09 | 1979-05-15 | Allen & Hanburys Limited | Pharmacologically active compounds |
| DE2861733D1 (en) * | 1977-08-16 | 1982-05-27 | Ici Plc | Anti-inflammatory 1-phenylethanolamine derivatives, pharmaceutical compositions thereof and processes for their manufacture |
| IL60530A (en) * | 1979-08-16 | 1984-10-31 | American Cyanamid Co | Animal feed compositions useful as growth promotors and for reduction of fat in animals,comprising phenylethanolamine derivatives and certain such novel compounds |
| US4404222A (en) * | 1980-08-25 | 1983-09-13 | American Cyanamid Company | Phenylethanolamine derivatives and acid addition salts thereof for enhancing the growth rate of meat-producing animals and improving the efficiency of feed utilization thereby |
| US4754047A (en) * | 1979-08-16 | 1988-06-28 | American Cyanamid Company | Phenylethanolamine derivatives and acid addition salts thereof for enhancing the growth rate of meat-producing animals and/or improving the efficiency of feed utilization thereby |
| EP0049728B1 (en) * | 1980-08-25 | 1986-11-12 | American Cyanamid Company | Method for enhancing the growth rate of meat-producing animals and for improving the lean meat to fat ratio thereof |
| US4407819A (en) * | 1980-08-25 | 1983-10-04 | American Cyanamid Company | Phenylethanolamine derivatives and acid addition salts thereof for the depression of fat deposition in warm blooded animals |
| ZA81947B (en) * | 1980-08-25 | 1982-03-31 | American Cyanamid Co | 1-(aminodihalophenyl)-2-aminoethane derivatives for enhancing the growth and for the depression of fat in warm-blooded animals |
| US4432995A (en) * | 1980-12-22 | 1984-02-21 | American Cyanamid Company | 5-[2-(Ethylamino)-1-hydroxylethyl] anthranilonitrile and the use thereof in meat producing animals |
| DE3104850A1 (de) * | 1981-02-11 | 1982-08-26 | Dr. Karl Thomae Gmbh, 7950 Biberach | "neuer futterzusatz zur verbesserung des wachstums" |
| US4649158A (en) * | 1983-02-01 | 1987-03-10 | American Cyanamid Company | Novel salts of 1-(aminodihalophenyl)-2-aminoethanols and antilipogenic compositions prepared therefrom |
| US4906781A (en) * | 1983-02-01 | 1990-03-06 | American Cyanamid Company | Method for the preparation of 4'-(substituted)-amino-2-(substituted) amino-3',5'-dichloroacetophenone and salts thereof |
| US4552897A (en) * | 1983-02-01 | 1985-11-12 | American Cyanamid Company | Salts of 1-(aminodihalophenyl)-2-aminoethanols and antilipogenic compositions prepared therefrom |
| DE3483779D1 (de) * | 1983-12-23 | 1991-01-31 | American Cyanamid Co | Antimikrobielle tierfutterzusatzzusammensetzungen. |
| FR2569184A1 (fr) * | 1984-08-20 | 1986-02-21 | Lafon Labor | Derives de 1-(aminophenyl) therapeutique et leur procede de preparation |
| US5236922A (en) * | 1984-08-20 | 1993-08-17 | Laboratoire L. Lafon | Method for treating depression using 1-(aminophenyl)-2-aminopropanone derivatives |
| US5250546A (en) * | 1984-09-28 | 1993-10-05 | Nippon Chemiphar Co., Ltd. | Amino-alcohol derivatives and processes for their preparation |
| GB8525321D0 (en) * | 1985-10-15 | 1985-11-20 | Glaxo Group Ltd | Chemical compounds |
| US4943591A (en) * | 1984-10-17 | 1990-07-24 | Glaxo Group Limited | Dichloroaniline derivatives |
| ES537634A0 (es) * | 1984-11-14 | 1985-09-16 | Elmu Sa | Procedimiento de obtencion de -(((2-hidroxi-1, 1-dimetil-etil)-amino)metil), benceno-metanol clorhidrato |
| US5059422A (en) * | 1985-07-29 | 1991-10-22 | American Cyanamid Company | Continuous release phenylethanolamine derivative compositions |
| US5169633A (en) * | 1985-07-29 | 1992-12-08 | American Cyanamid Company | Continuous release phenylethanolamine derivative compositions |
| ATE61794T1 (de) * | 1985-10-17 | 1991-04-15 | American Cyanamid Co | Anthranilonitrilderivate und verwandte verbindungen als nuetzliche stoffe zur wachstumsbeschleunigung, zur verbesserung der futterqualitaet und zur steigerung des fleisch/fett-verhaeltnisses bei warmbluetigen tieren. |
| US4863959A (en) * | 1985-10-17 | 1989-09-05 | American Cyanamid Company | Anthranilonitrile derivatives as useful agents for promoting growth, improving feed efficiency, and for increasing the lean meat to fat ratio of warm-blooded animals |
| US4665095A (en) * | 1985-12-11 | 1987-05-12 | Abbott Laboratories | Use of 2-[(3,5-dihalo-4-aminobenzyl)]imidazolines to stimulate alpha-1 adrenergic receptors and to treat nasal congestion |
| GB8603475D0 (en) * | 1986-02-12 | 1986-03-19 | Glaxo Group Ltd | Chemical compounds |
| GB8703007D0 (en) * | 1987-02-10 | 1987-03-18 | Glaxo Group Ltd | Chemical compounds |
| DE3714484A1 (de) * | 1987-04-30 | 1988-11-10 | Bayer Ag | Neue aminophenylethylamin-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als leistungsfoerderer |
| US5149698A (en) * | 1987-08-11 | 1992-09-22 | Glaxo Group Limited | Chloroaniline derivatives |
| US5198586A (en) * | 1987-08-12 | 1993-03-30 | Sanofi | Process for the preparation of phenylethanolaminotetralins |
| US5541188A (en) * | 1987-09-15 | 1996-07-30 | The Rowett Research Institute | Therapeutic applications of beta-adrenergic agonists |
| US5530029A (en) * | 1987-09-15 | 1996-06-25 | The Rowett Research Institute | Therapeutic applications of clenbuterol |
| FR2626878B1 (fr) * | 1988-02-10 | 1990-06-08 | Lafon Labor | Derives de 1-(aminophenyl)-2-dimethylaminopropanone, procede de preparation et utilisation en therapeutique |
| US5453418A (en) * | 1988-03-07 | 1995-09-26 | Eli Lilly And Company | Ractopamine and growth hormone combinations |
| IT1216120B (it) * | 1988-03-17 | 1990-02-22 | Poli Ind Chimica Spa | Derivati n_cicloalchilaminoetilbenzamidici, loro preparazione e composizioni farmaceutiche che li contengono. |
| GB8909273D0 (en) * | 1989-04-24 | 1989-06-07 | Glaxo Group Ltd | Chemical compounds |
| IT1230931B (it) * | 1989-06-27 | 1991-11-08 | Chiesi Farma Spa | Derivati di 2 ammino 1,2,3,4 tetraidronaftalene ad attivita' cardiovascolare, procedimento per la loro preparazione e composizioni farmaceutiche che li contengono |
| FR2653767B1 (fr) * | 1989-10-30 | 1992-02-14 | Lafon Labor | Derives de 1-(aminophenyl)-2-piperidinopropanone, procede et utilisation en therapeutique. |
| AT399874B (de) * | 1990-06-05 | 1995-08-25 | Glaxo Group Ltd | Dichloranilinverbindung |
| US6313146B1 (en) | 1991-08-23 | 2001-11-06 | Nps Pharmaceuticals, Inc. | Calcium receptor-active molecules |
| US6031003A (en) * | 1991-08-23 | 2000-02-29 | Nps Pharmaceuticals, Inc. | Calcium receptor-active molecules |
| US6011068A (en) * | 1991-08-23 | 2000-01-04 | Nps Pharmaceuticals, Inc. | Calcium receptor-active molecules |
| US6001884A (en) * | 1991-08-23 | 1999-12-14 | Nps Pharmaceuticals, Inc. | Calcium receptor-active molecules |
| EP0664788A1 (de) * | 1992-10-16 | 1995-08-02 | Byk Nederland BV | Substituierte ethanolaminester |
| ES2285707T3 (es) | 1994-10-21 | 2007-11-16 | Nps Pharmaceuticals, Inc. | Compuestos activos frente al receptor de calcio. |
| WO1997041090A1 (en) | 1996-05-01 | 1997-11-06 | Nps Pharmaceuticals, Inc. | Inorganic ion receptor-active compounds |
| US20030216423A1 (en) * | 2000-05-24 | 2003-11-20 | Sergio Ulloa | Stable liquid and solid formulations |
| MX2007001561A (es) * | 2004-08-04 | 2007-04-16 | Schering Corp | Formulacion farmaceutica que comprende pleconaril para tratamiento de enfermedades de vias aereas. |
| EP1754474A1 (en) * | 2005-02-02 | 2007-02-21 | Eucro European Contract Research GmbH & Co. KG | Use of S-Clenbuterol |
| US20080014152A1 (en) * | 2006-07-13 | 2008-01-17 | Di Mauro Thomas M | Intranasal delivery of clenbuterol across the cribriform plate and into the brain |
| CN102834406A (zh) | 2009-06-16 | 2012-12-19 | 默沙东公司 | 作为糖皮质激素受体激动剂的新的[3.2-c]杂芳基甾体、其组合物和用途 |
| DK2925725T3 (en) | 2012-12-03 | 2017-01-16 | Pfizer | androgen receptor modulators |
| EP3331848A4 (en) | 2015-08-06 | 2019-07-17 | Vamsi Labs Ltd. | PROCESS FOR THE PREPARATION OF BETA AGONISTS |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL287142A (https=) * | 1961-12-22 | |||
| GB1121857A (en) * | 1965-01-05 | 1968-07-31 | Science Union & Cie | New phenylisopropylamine derivatives and process for their preparation and pharmaceutical preparations of such derivatives |
-
1967
- 1967-02-15 DE DE19671618005 patent/DE1618005A1/de active Pending
- 1967-06-02 DE DE19671618009 patent/DE1618009A1/de active Pending
- 1967-09-19 CH CH324470A patent/CH489464A/de not_active IP Right Cessation
- 1967-09-19 CH CH1309567A patent/CH490319A/de not_active IP Right Cessation
- 1967-09-19 US US668953A patent/US3536712A/en not_active Expired - Lifetime
- 1967-09-19 NL NL6712787A patent/NL6712787A/xx unknown
- 1967-09-19 ES ES345210A patent/ES345210A1/es not_active Expired
- 1967-09-20 YU YU1841/67A patent/YU33283B/xx unknown
- 1967-09-21 AT AT01178/69A patent/AT277976B/de not_active IP Right Cessation
- 1967-09-21 AT AT01174/69A patent/AT277972B/de active
- 1967-09-21 AT AT861267A patent/AT277210B/de not_active IP Right Cessation
- 1967-09-21 DK DK471767AA patent/DK125417B/da not_active IP Right Cessation
- 1967-09-21 AT AT01172/69A patent/AT280997B/de not_active IP Right Cessation
- 1967-09-21 AT AT117569A patent/AT277973B/de not_active IP Right Cessation
- 1967-09-21 AT AT01173/69A patent/AT277971B/de not_active IP Right Cessation
- 1967-09-21 AT AT01176/69A patent/AT277974B/de active
- 1967-09-21 AT AT01177/69A patent/AT277975B/de active
- 1967-09-22 BE BE704213A patent/BE704213A/xx not_active IP Right Cessation
- 1967-09-22 FR FR121990A patent/FR1544212A/fr not_active Expired
- 1967-09-22 ES ES345318A patent/ES345318A1/es not_active Expired
- 1967-09-22 FI FI672539A patent/FI48460C/fi active
- 1967-09-22 SE SE13060/67A patent/SE366539B/xx unknown
- 1967-09-22 FR FR121989A patent/FR6923M/fr not_active Expired
- 1967-09-22 GB GB43327/67A patent/GB1178191A/en not_active Expired
- 1967-10-03 ES ES345685A patent/ES345685A1/es not_active Expired
- 1967-10-03 ES ES345686A patent/ES345686A1/es not_active Expired
- 1967-10-06 ES ES345820A patent/ES345820A1/es not_active Expired
- 1967-10-06 ES ES345818A patent/ES345818A1/es not_active Expired
- 1967-10-06 ES ES345819A patent/ES345819A1/es not_active Expired
- 1967-10-06 ES ES345817A patent/ES345817A1/es not_active Expired
-
1974
- 1974-04-10 YU YU1005/74A patent/YU33114B/xx unknown
-
1979
- 1979-06-28 IT IT7949574A patent/IT7949574A0/it unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2354961A1 (de) * | 1973-11-02 | 1975-06-05 | Thomae Gmbh Dr K | Neue verfahren zur herstellung von amino-phenyl-aethanolaminen |
Also Published As
| Publication number | Publication date |
|---|---|
| FR6923M (https=) | 1969-05-05 |
| CH490319A (de) | 1970-05-15 |
| ES345686A1 (es) | 1969-01-16 |
| ES345210A1 (es) | 1969-01-01 |
| AT277972B (de) | 1970-01-12 |
| SE366539B (https=) | 1974-04-29 |
| AT277971B (de) | 1970-01-12 |
| CH489464A (de) | 1970-04-30 |
| AT277975B (de) | 1970-01-12 |
| YU33114B (en) | 1976-04-30 |
| AT277974B (de) | 1970-01-12 |
| FI48460C (fi) | 1974-10-10 |
| FI48460B (https=) | 1974-07-01 |
| ES345685A1 (es) | 1969-03-16 |
| DE1543928A1 (de) | 1970-01-29 |
| ES345817A1 (es) | 1969-01-01 |
| YU100574A (en) | 1975-10-31 |
| GB1178191A (en) | 1970-01-21 |
| ES345318A1 (es) | 1969-01-01 |
| DE1618009A1 (de) | 1971-04-29 |
| AT280997B (de) | 1970-05-11 |
| ES345819A1 (es) | 1969-03-16 |
| FR1544212A (fr) | 1968-10-31 |
| ES345820A1 (es) | 1969-11-01 |
| NL6712787A (https=) | 1968-03-25 |
| YU184167A (en) | 1976-03-31 |
| DK125417B (da) | 1973-02-19 |
| YU33283B (en) | 1976-08-31 |
| AT277976B (de) | 1970-01-12 |
| BE704213A (https=) | 1968-03-22 |
| AT277210B (de) | 1969-12-10 |
| US3536712A (en) | 1970-10-27 |
| ES345818A1 (es) | 1969-05-16 |
| AT277973B (de) | 1970-01-12 |
| IT7949574A0 (it) | 1979-06-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1618005A1 (de) | Verfahren zur Herstellung von neuen Amino-dihalogen-phenyl-aethylaminen | |
| DE1618007A1 (de) | Verfahren zur Herstellung von neuen Amino-monohalogenphenylaethanolaminen | |
| DE1445181A1 (de) | Basisch substituierte 10,11-Dihyrro-5 H-dibenzo [auf b,e] zu [auf 1,4] zu diazepine | |
| CH631448A5 (de) | Verfahren zur herstellung neuer piperazinderivate. | |
| DE2264668A1 (de) | Propenylaminderivate und verfahren zu dereb herstellung | |
| DE2351281C3 (de) | Aminophenyl-äthanolamin-Derivate, deren Herstellung und Verwendung | |
| DE2603046C2 (de) | 4'α- und 4'β-Amino-4'-desoxy-oleandrine, Verfahren zu ihrer Herstellung sowie diese enthaltende pharmazeutische Präparate | |
| DE1593728A1 (de) | Verfahren zur Herstellung von substituierten Amidinen | |
| DE3042844A1 (de) | 2-(1h-imidazol-1-yl)-aethoxyderivate von chinolin-2- und 4-methanolen, verfahren zu ihrer herstellung, arzneimittel und ihre verwendung | |
| DE2621539A1 (de) | Eckige klammer auf (2-oxepanyliden) -methyl eckige klammer zu -triphenylphosphoniumsalze | |
| DE2311637C3 (de) | Verfahren zur Herstellung von 2-Aminobenzylaminen | |
| DE1951614C3 (de) | Substituierte Benzylalkohol, deren physiologisch verträgliche Salze, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel | |
| DE2210121C3 (de) | Pyrido eckige Klammer auf 2,3-b eckige Klammer zu indole, ein Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE1668413A1 (de) | Neue Derivate von 1-Amino-fluoren und 1-Aminofluorenon | |
| DE2411848A1 (de) | Verfahren zur herstellung eines cyclohexylaminderivats | |
| DE2116213A1 (de) | Piperazinderivate | |
| AT219611B (de) | Verfahren zur Herstellung von neuen N-heterocyclischen Verbindungen und deren Salzen | |
| AT283322B (de) | Verfahren zur herstellung von neuen aminoketonen und ihren salzen | |
| AT363092B (de) | Verfahren zur herstellung von neuen piperazinderivaten und deren salzen | |
| AT276381B (de) | Verfahren zur Herstellung von neuen Phenylisoindolderivaten und deren Salzen | |
| AT363094B (de) | Verfahren zur herstellung von neuen piperazinderivaten und deren salzen | |
| DE1052982B (de) | Verfahren zur Herstellung neuer, spasmolytisch wirksamer, basischer AEther, deren Salzen bzw. quaternaeren Ammoniumverbindungen | |
| DE1695695C3 (de) | Verfahren zur Herstellung von 2-Aminofuro eckige Klammer auf 2,3-d eckige Klammer zu thiazolen | |
| DE2021668A1 (de) | Neue Amine und Verfahren zu ihrer Herstellung | |
| DE2345443A1 (de) | Neues verfahren zur herstellung von 2-amino-benzylaminen |