DE1572098B2 - Benzoldiazoniumverbindungen - Google Patents
BenzoldiazoniumverbindungenInfo
- Publication number
- DE1572098B2 DE1572098B2 DE1967K0061652 DEK0061652A DE1572098B2 DE 1572098 B2 DE1572098 B2 DE 1572098B2 DE 1967K0061652 DE1967K0061652 DE 1967K0061652 DE K0061652 A DEK0061652 A DE K0061652A DE 1572098 B2 DE1572098 B2 DE 1572098B2
- Authority
- DE
- Germany
- Prior art keywords
- compounds
- diazonium
- compound
- carbon atoms
- acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- CIZVQWNPBGYCGK-UHFFFAOYSA-N benzenediazonium Chemical class N#[N+]C1=CC=CC=C1 CIZVQWNPBGYCGK-UHFFFAOYSA-N 0.000 title claims description 4
- 150000001989 diazonium salts Chemical class 0.000 claims description 25
- 125000003545 alkoxy group Chemical group 0.000 claims description 20
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 claims description 12
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 claims description 8
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 8
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 5
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 claims description 3
- HNVIQLPOGUDBSU-UHFFFAOYSA-N 2,6-dimethylmorpholine Chemical compound CC1CNCC(C)O1 HNVIQLPOGUDBSU-UHFFFAOYSA-N 0.000 claims description 3
- LQMMFVPUIVBYII-UHFFFAOYSA-N 2-methylmorpholine Chemical compound CC1CNCCO1 LQMMFVPUIVBYII-UHFFFAOYSA-N 0.000 claims description 3
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 claims description 3
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 claims description 3
- 150000001450 anions Chemical class 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 24
- 239000000463 material Substances 0.000 description 21
- 150000001875 compounds Chemical class 0.000 description 20
- 238000005859 coupling reaction Methods 0.000 description 20
- -1 heterocyclic radical Chemical class 0.000 description 20
- 230000008878 coupling Effects 0.000 description 19
- 238000010168 coupling process Methods 0.000 description 19
- 235000002639 sodium chloride Nutrition 0.000 description 18
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 15
- 150000003839 salts Chemical class 0.000 description 14
- 239000011592 zinc chloride Substances 0.000 description 12
- 235000005074 zinc chloride Nutrition 0.000 description 12
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 10
- 238000011161 development Methods 0.000 description 9
- 206010034972 Photosensitivity reaction Diseases 0.000 description 8
- 239000002585 base Substances 0.000 description 8
- 230000036211 photosensitivity Effects 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 7
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 229920002689 polyvinyl acetate Polymers 0.000 description 5
- 239000011118 polyvinyl acetate Substances 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 150000008049 diazo compounds Chemical class 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- QCDYQQDYXPDABM-UHFFFAOYSA-N phloroglucinol Chemical compound OC1=CC(O)=CC(O)=C1 QCDYQQDYXPDABM-UHFFFAOYSA-N 0.000 description 4
- 229960001553 phloroglucinol Drugs 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- 206010034960 Photophobia Diseases 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 3
- 208000013469 light sensitivity Diseases 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 125000001302 tertiary amino group Chemical group 0.000 description 3
- JUGSKHLZINSXPQ-UHFFFAOYSA-N 2,2,3,3,4,4,5,5-octafluoropentan-1-ol Chemical compound OCC(F)(F)C(F)(F)C(F)(F)C(F)F JUGSKHLZINSXPQ-UHFFFAOYSA-N 0.000 description 2
- NBUKAOOFKZFCGD-UHFFFAOYSA-N 2,2,3,3-tetrafluoropropan-1-ol Chemical compound OCC(F)(F)C(F)F NBUKAOOFKZFCGD-UHFFFAOYSA-N 0.000 description 2
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 2
- 244000215068 Acacia senegal Species 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 229940126062 Compound A Drugs 0.000 description 2
- 229920000084 Gum arabic Polymers 0.000 description 2
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- RHQDFWAXVIIEBN-UHFFFAOYSA-N Trifluoroethanol Chemical compound OCC(F)(F)F RHQDFWAXVIIEBN-UHFFFAOYSA-N 0.000 description 2
- 239000000205 acacia gum Substances 0.000 description 2
- 235000010489 acacia gum Nutrition 0.000 description 2
- 239000001361 adipic acid Substances 0.000 description 2
- 235000011037 adipic acid Nutrition 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 150000001555 benzenes Chemical class 0.000 description 2
- 229910021538 borax Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 239000008119 colloidal silica Substances 0.000 description 2
- 230000001609 comparable effect Effects 0.000 description 2
- 125000003709 fluoroalkyl group Chemical group 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- OBVOEXFRVMVPLQ-UHFFFAOYSA-N naphthalene-1,3,6-trisulfonic acid;sodium Chemical compound [Na].OS(=O)(=O)C1=CC(S(O)(=O)=O)=CC2=CC(S(=O)(=O)O)=CC=C21 OBVOEXFRVMVPLQ-UHFFFAOYSA-N 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000001397 quillaja saponaria molina bark Substances 0.000 description 2
- 229930182490 saponin Natural products 0.000 description 2
- 150000007949 saponins Chemical class 0.000 description 2
- WXMKPNITSTVMEF-UHFFFAOYSA-M sodium benzoate Chemical compound [Na+].[O-]C(=O)C1=CC=CC=C1 WXMKPNITSTVMEF-UHFFFAOYSA-M 0.000 description 2
- 235000010234 sodium benzoate Nutrition 0.000 description 2
- 239000004299 sodium benzoate Substances 0.000 description 2
- 239000001509 sodium citrate Substances 0.000 description 2
- 239000004328 sodium tetraborate Substances 0.000 description 2
- 235000010339 sodium tetraborate Nutrition 0.000 description 2
- FGDMJJQHQDFUCP-UHFFFAOYSA-M sodium;2-propan-2-ylnaphthalene-1-sulfonate Chemical compound [Na+].C1=CC=CC2=C(S([O-])(=O)=O)C(C(C)C)=CC=C21 FGDMJJQHQDFUCP-UHFFFAOYSA-M 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- HRXKRNGNAMMEHJ-UHFFFAOYSA-K trisodium citrate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O HRXKRNGNAMMEHJ-UHFFFAOYSA-K 0.000 description 2
- 229940038773 trisodium citrate Drugs 0.000 description 2
- ANLILZBBUVRVRP-UHFFFAOYSA-N (3-hydroxy-4-methylphenyl)urea Chemical compound CC1=CC=C(NC(N)=O)C=C1O ANLILZBBUVRVRP-UHFFFAOYSA-N 0.000 description 1
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- DDCBPJKVWMBNCC-UHFFFAOYSA-N 2,5-diethoxy-4-morpholin-4-ylaniline Chemical compound C1=C(N)C(OCC)=CC(N2CCOCC2)=C1OCC DDCBPJKVWMBNCC-UHFFFAOYSA-N 0.000 description 1
- WILXXIYXQNNEDE-UHFFFAOYSA-M 2,5-diethoxy-4-pyrrolidin-1-ylbenzenediazonium chloride Chemical compound [Cl-].N1(CCCC1)C1=CC(=C(C=C1OCC)[N+]#N)OCC WILXXIYXQNNEDE-UHFFFAOYSA-M 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical class CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- WXHLLJAMBQLULT-UHFFFAOYSA-N 2-[[6-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-n-(2-methyl-6-sulfanylphenyl)-1,3-thiazole-5-carboxamide;hydrate Chemical compound O.C=1C(N2CCN(CCO)CC2)=NC(C)=NC=1NC(S1)=NC=C1C(=O)NC1=C(C)C=CC=C1S WXHLLJAMBQLULT-UHFFFAOYSA-N 0.000 description 1
- RJHWLZUOICOJGV-UHFFFAOYSA-N 2-chloro-4-N,4-N-dimethyl-3-(2,2,2-trifluoroethoxy)benzene-1,4-diamine Chemical compound NC1=C(C(=C(C=C1)N(C)C)OCC(F)(F)F)Cl RJHWLZUOICOJGV-UHFFFAOYSA-N 0.000 description 1
- VXQZHAMHPXKBJK-UHFFFAOYSA-N 2-methoxy-4-piperidin-1-yl-5-(2,2,2-trifluoroethoxy)aniline Chemical compound NC1=C(C=C(C(=C1)OCC(F)(F)F)N1CCCCC1)OC VXQZHAMHPXKBJK-UHFFFAOYSA-N 0.000 description 1
- VIIYYMZOGKODQG-UHFFFAOYSA-N 2-nitrobenzene-1,4-diol Chemical compound OC1=CC=C(O)C([N+]([O-])=O)=C1 VIIYYMZOGKODQG-UHFFFAOYSA-N 0.000 description 1
- ALKYHXVLJMQRLQ-UHFFFAOYSA-N 3-Hydroxy-2-naphthoate Chemical compound C1=CC=C2C=C(O)C(C(=O)O)=CC2=C1 ALKYHXVLJMQRLQ-UHFFFAOYSA-N 0.000 description 1
- LDSIOPGMLLPSSR-UHFFFAOYSA-N 3-chloro-4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C(Cl)=C1 LDSIOPGMLLPSSR-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- LWEQJBZIPVWVGH-UHFFFAOYSA-M 4-(diethylamino)-2-ethoxybenzenediazonium;chloride Chemical compound [Cl-].CCOC1=CC(N(CC)CC)=CC=C1[N+]#N LWEQJBZIPVWVGH-UHFFFAOYSA-M 0.000 description 1
- YCPXWRQRBFJBPZ-UHFFFAOYSA-N 5-sulfosalicylic acid Chemical compound OC(=O)C1=CC(S(O)(=O)=O)=CC=C1O YCPXWRQRBFJBPZ-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical class [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- YQUNZWINCPFHRG-UHFFFAOYSA-M CN(C)C(C(OCC(F)(F)F)=C1)=CC(Cl)=C1[N+]#N.[Cl-] Chemical compound CN(C)C(C(OCC(F)(F)F)=C1)=CC(Cl)=C1[N+]#N.[Cl-] YQUNZWINCPFHRG-UHFFFAOYSA-M 0.000 description 1
- FZWZVKBACMBVSK-UHFFFAOYSA-M CN(C)C(C=C1)=C(C(F)(F)F)C=C1[N+]#N.[Cl-] Chemical compound CN(C)C(C=C1)=C(C(F)(F)F)C=C1[N+]#N.[Cl-] FZWZVKBACMBVSK-UHFFFAOYSA-M 0.000 description 1
- RSMMSYHWNVVFCM-UHFFFAOYSA-N COC(C(N1CCOCC1)=C1)=CC(N)=C1OCC(F)(F)F Chemical compound COC(C(N1CCOCC1)=C1)=CC(N)=C1OCC(F)(F)F RSMMSYHWNVVFCM-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 206010070834 Sensitisation Diseases 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001347 alkyl bromides Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- JNGZXGGOCLZBFB-IVCQMTBJSA-N compound E Chemical compound N([C@@H](C)C(=O)N[C@@H]1C(N(C)C2=CC=CC=C2C(C=2C=CC=CC=2)=N1)=O)C(=O)CC1=CC(F)=CC(F)=C1 JNGZXGGOCLZBFB-IVCQMTBJSA-N 0.000 description 1
- 230000001808 coupling effect Effects 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000010408 film Substances 0.000 description 1
- 125000004428 fluoroalkoxy group Chemical group 0.000 description 1
- NBVXSUQYWXRMNV-UHFFFAOYSA-N fluoromethane Chemical group FC NBVXSUQYWXRMNV-UHFFFAOYSA-N 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 229910052740 iodine Chemical class 0.000 description 1
- 239000011630 iodine Chemical class 0.000 description 1
- 125000002510 isobutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])O* 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 235000021190 leftovers Nutrition 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- ZPBSAMLXSQCSOX-UHFFFAOYSA-N naphthalene-1,3,6-trisulfonic acid Chemical compound OS(=O)(=O)C1=CC(S(O)(=O)=O)=CC2=CC(S(=O)(=O)O)=CC=C21 ZPBSAMLXSQCSOX-UHFFFAOYSA-N 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 239000002985 plastic film Substances 0.000 description 1
- 229920006255 plastic film Polymers 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920006267 polyester film Polymers 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 1
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 229940100486 rice starch Drugs 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 230000008313 sensitization Effects 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/52—Compositions containing diazo compounds as photosensitive substances
- G03C1/54—Diazonium salts or diazo anhydrides
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
- Heat Sensitive Colour Forming Recording (AREA)
- Pyrrole Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Priority Applications (21)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| ZA6801453D ZA6801453B (cg-RX-API-DMAC10.html) | 1967-03-08 | ||
| DE1797615A DE1797615C2 (de) | 1967-03-08 | 1967-03-08 | Diazotypiematerial |
| DE1967K0061652 DE1572098B2 (de) | 1967-03-08 | 1967-03-08 | Benzoldiazoniumverbindungen |
| NL6802734A NL6802734A (nl) | 1967-03-08 | 1968-02-27 | Diazotypiemateriaal |
| BR197370/68A BR6897370D0 (pt) | 1967-03-08 | 1968-03-04 | Processo para a preparacao de um material para diazotipia |
| BE711687A BE711687A (fr) | 1967-03-08 | 1968-03-05 | Matériel de diazotype à vitesse de copulation accrue |
| AT215568A AT282345B (de) | 1967-03-08 | 1968-03-05 | Diazotypiematerial |
| ES351305A ES351305A1 (es) | 1967-03-08 | 1968-03-06 | Mejoras introducidas en un procedimiento para la fabrica- cion de un material de diazotipia. |
| GB10909/68A GB1197376A (en) | 1967-03-08 | 1968-03-06 | Diazotype Material |
| SE2954/68A SE342703B (sv) | 1967-03-08 | 1968-03-06 | Diazotypimaterial med ett ljuskaensligt en- eller tvaakomponentskikt |
| CH331568A CH489823A (de) | 1967-03-08 | 1968-03-06 | Diazotypiematerial |
| DK93968AA DK116489B (da) | 1967-03-08 | 1968-03-07 | Diazotypimateriale. |
| FI0623/68A FI44089B (fi) | 1967-03-08 | 1968-03-07 | Diatsotyyppiaine - diazotypmaterial |
| FR142869A FR1559274A (fr) | 1967-03-08 | 1968-03-08 | Matériel de diazotype à vitesse de copulation accrue |
| US723931A US3539347A (en) | 1967-03-08 | 1968-04-24 | Diazinium compounds and diazotype material therefrom |
| DE19681793332 DE1793332C3 (de) | 1968-09-03 | Benzoldiazoniumverbindungen | |
| NL6912851A NL6912851A (nl) | 1967-03-08 | 1969-08-22 | Werkwijze voor het bereiden van benzeendiazoniumverbindingen en diazotypiemateriaal, dat een dergelijke verbinding bevat |
| BE738312A BE738312A (fr) | 1967-03-08 | 1969-09-01 | Matériel de diazotypie à vitesse de copulation accrue |
| SE1213369A SE367875B (sv) | 1967-03-08 | 1969-09-02 | Diazotypimaterial |
| GB4340169A GB1271754A (en) | 1967-03-08 | 1969-09-02 | Benzene diazonium compounds and diazotype material containing the same |
| FR6930007A FR2022150A6 (fr) | 1967-03-08 | 1969-09-03 | Matériel de diazotypie à vitesse de copulation accrue |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1967K0061652 DE1572098B2 (de) | 1967-03-08 | 1967-03-08 | Benzoldiazoniumverbindungen |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1572098A1 DE1572098A1 (de) | 1970-02-19 |
| DE1572098B2 true DE1572098B2 (de) | 1976-05-26 |
Family
ID=7230191
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1967K0061652 Granted DE1572098B2 (de) | 1967-03-08 | 1967-03-08 | Benzoldiazoniumverbindungen |
| DE1797615A Expired DE1797615C2 (de) | 1967-03-08 | 1967-03-08 | Diazotypiematerial |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1797615A Expired DE1797615C2 (de) | 1967-03-08 | 1967-03-08 | Diazotypiematerial |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US3539347A (cg-RX-API-DMAC10.html) |
| AT (1) | AT282345B (cg-RX-API-DMAC10.html) |
| BE (1) | BE711687A (cg-RX-API-DMAC10.html) |
| BR (1) | BR6897370D0 (cg-RX-API-DMAC10.html) |
| CH (1) | CH489823A (cg-RX-API-DMAC10.html) |
| DE (2) | DE1572098B2 (cg-RX-API-DMAC10.html) |
| DK (1) | DK116489B (cg-RX-API-DMAC10.html) |
| ES (1) | ES351305A1 (cg-RX-API-DMAC10.html) |
| FI (1) | FI44089B (cg-RX-API-DMAC10.html) |
| FR (1) | FR1559274A (cg-RX-API-DMAC10.html) |
| GB (1) | GB1197376A (cg-RX-API-DMAC10.html) |
| NL (1) | NL6802734A (cg-RX-API-DMAC10.html) |
| SE (1) | SE342703B (cg-RX-API-DMAC10.html) |
| ZA (1) | ZA6801453B (cg-RX-API-DMAC10.html) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1793331C3 (de) * | 1968-09-03 | 1979-11-22 | Hoechst Ag, 6000 Frankfurt | Benzoldiazoniumverbindungen |
| US3719491A (en) * | 1968-06-18 | 1973-03-06 | Gaf Corp | Diazo-type reproduction process |
| US3985724A (en) * | 1974-10-15 | 1976-10-12 | Salsbury Laboratories | 1-(4'-Diazoniumphenyl)-pyridinium salts and the process of preparation |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2657141A (en) * | 1947-07-14 | 1953-10-27 | Grinten Chem L V D | Diazotype developer composition containing a potassium borate and process of using same |
| BE521426A (cg-RX-API-DMAC10.html) * | 1952-08-13 | |||
| US2990281A (en) * | 1956-12-17 | 1961-06-27 | Monsanto Chemicals | Photosensitive resinous compositions and photographic elements |
| GB867630A (en) * | 1958-06-04 | 1961-05-10 | Grinten Chem L V D | Diazotype material |
| NL233065A (cg-RX-API-DMAC10.html) * | 1958-11-10 | |||
| GB1080576A (en) * | 1965-05-14 | 1967-08-23 | Hall Harding Ltd | Improvements in or relating to diazotype materials |
| US3281246A (en) * | 1964-11-30 | 1966-10-25 | Keuffel & Esser Co | Diazotype reproduction material |
| DE1244575C2 (de) * | 1965-02-24 | 1974-01-10 | Diazotypiematerial |
-
0
- ZA ZA6801453D patent/ZA6801453B/xx unknown
-
1967
- 1967-03-08 DE DE1967K0061652 patent/DE1572098B2/de active Granted
- 1967-03-08 DE DE1797615A patent/DE1797615C2/de not_active Expired
-
1968
- 1968-02-27 NL NL6802734A patent/NL6802734A/xx not_active Application Discontinuation
- 1968-03-04 BR BR197370/68A patent/BR6897370D0/pt unknown
- 1968-03-05 AT AT215568A patent/AT282345B/de not_active IP Right Cessation
- 1968-03-05 BE BE711687A patent/BE711687A/fr unknown
- 1968-03-06 CH CH331568A patent/CH489823A/de not_active IP Right Cessation
- 1968-03-06 GB GB10909/68A patent/GB1197376A/en not_active Expired
- 1968-03-06 SE SE2954/68A patent/SE342703B/xx unknown
- 1968-03-06 ES ES351305A patent/ES351305A1/es not_active Expired
- 1968-03-07 DK DK93968AA patent/DK116489B/da unknown
- 1968-03-07 FI FI0623/68A patent/FI44089B/fi active
- 1968-03-08 FR FR142869A patent/FR1559274A/fr not_active Expired
- 1968-04-24 US US723931A patent/US3539347A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| BR6897370D0 (pt) | 1973-02-27 |
| SE342703B (sv) | 1972-02-14 |
| AT282345B (de) | 1970-06-25 |
| ES351305A1 (es) | 1976-09-01 |
| DE1797615B1 (de) | 1977-07-21 |
| BE711687A (fr) | 1968-09-05 |
| FI44089B (fi) | 1971-04-30 |
| CH489823A (de) | 1970-04-30 |
| FR1559274A (fr) | 1969-03-07 |
| DK116489B (da) | 1970-01-12 |
| DE1797615C2 (de) | 1978-03-16 |
| ZA6801453B (cg-RX-API-DMAC10.html) | |
| US3539347A (en) | 1970-11-10 |
| NL6802734A (nl) | 1968-09-09 |
| GB1197376A (en) | 1970-07-01 |
| DE1572098A1 (de) | 1970-02-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1216105B (de) | Zweikomponenten-Diazotypiematerial mit einer Benzoldiazoniumverbindung | |
| DE1068556B (cg-RX-API-DMAC10.html) | ||
| DE1236331B (de) | Zweikomponenten-Diazotypiematerial | |
| DE1289736B (de) | Lichtempfindliches Kopiermaterial, das als lichtempfindliche Substanz mindestens einDerivat des einseitig diazotierten p-Phenylendiamins mit einer Alkoxygruppe in m-Stellung zur Diazogruppe enthaelt | |
| DE1174612B (de) | Diazotypiematerial | |
| DE1572098B2 (de) | Benzoldiazoniumverbindungen | |
| DE1172952B (de) | Diazotypiematerial | |
| DE1572098C3 (cg-RX-API-DMAC10.html) | ||
| DE1086124B (de) | Diazotypie-Kopierschichten zur Herstellung von Zwischenoriginalen | |
| DE1793331C3 (de) | Benzoldiazoniumverbindungen | |
| DE1547913A1 (de) | Lichtempfindliches Material | |
| DE1797636C3 (de) | Diazotypiematerial | |
| DE1770074C3 (cg-RX-API-DMAC10.html) | ||
| DE1244575C2 (de) | Diazotypiematerial | |
| DE1693191B2 (de) | Diazoniumverbindungen und Einkomponenten-Diazotypiematerial | |
| DE1793342C3 (de) | Fluorhaltige Benzoldiazoniumverbindungen und deren Verwendung in Diazotypiematerial | |
| DE1206725B (de) | Diazoschichten zur Herstellung von Zwischenoriginalen | |
| DE1155331B (de) | Diazotypiematerial | |
| DE2018687A1 (de) | Lichtempfindliches, fotografisches AufZeichenmaterial | |
| DE1962391C2 (de) | Benzoldiazoniumverbindungen und deren Verwendung | |
| DE2226532C2 (de) | Benzoldiazoniumverbindungen und ein mit diesen Verbindungen hergestelltes Diazotypiematerial | |
| DE1572106C3 (de) | Einkomponenten-Diazotypiematerial | |
| DE2153633A1 (de) | Verfahren zum Entwickeln eines lichtempfindlichen Silberhalogenidmaterials | |
| DE1522448B2 (de) | Diazoverbindungen, verfahren zu deren herstellung und diese enthaltende diazotypiematerialien | |
| DE1472805C (de) | Diazotypiematerial |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| E77 | Valid patent as to the heymanns-index 1977 |