DE1572088C3 - Zweikomponenten-Diazotypiematerial für die Herstellung von Zwischenoriginalen - Google Patents
Zweikomponenten-Diazotypiematerial für die Herstellung von ZwischenoriginalenInfo
- Publication number
- DE1572088C3 DE1572088C3 DE1572088A DE1572088A DE1572088C3 DE 1572088 C3 DE1572088 C3 DE 1572088C3 DE 1572088 A DE1572088 A DE 1572088A DE 1572088 A DE1572088 A DE 1572088A DE 1572088 C3 DE1572088 C3 DE 1572088C3
- Authority
- DE
- Germany
- Prior art keywords
- acid
- diazo
- aniline
- component
- zinc chloride
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000463 material Substances 0.000 title claims description 42
- 238000004519 manufacturing process Methods 0.000 title claims description 7
- 230000008878 coupling Effects 0.000 claims description 21
- 238000010168 coupling process Methods 0.000 claims description 21
- 238000005859 coupling reaction Methods 0.000 claims description 21
- 150000001875 compounds Chemical class 0.000 claims description 12
- 150000001989 diazonium salts Chemical class 0.000 claims description 11
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 6
- 239000003381 stabilizer Substances 0.000 claims description 5
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 claims description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 46
- 235000005074 zinc chloride Nutrition 0.000 description 23
- 239000011592 zinc chloride Substances 0.000 description 23
- 150000003839 salts Chemical class 0.000 description 21
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 16
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 13
- UIAFKZKHHVMJGS-UHFFFAOYSA-N 2,4-dihydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1O UIAFKZKHHVMJGS-UHFFFAOYSA-N 0.000 description 12
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 12
- 239000000243 solution Substances 0.000 description 9
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 8
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 8
- VDUQSXJYBDIGFR-UHFFFAOYSA-N n-benzyl-4-diazo-n-ethylcyclohexa-1,5-dien-1-amine Chemical compound C=1CC(=[N+]=[N-])C=CC=1N(CC)CC1=CC=CC=C1 VDUQSXJYBDIGFR-UHFFFAOYSA-N 0.000 description 8
- 239000011975 tartaric acid Substances 0.000 description 8
- 235000002906 tartaric acid Nutrition 0.000 description 8
- IPRCBIWIPMJXIK-UHFFFAOYSA-N (3-hydroxyphenyl)urea Chemical compound NC(=O)NC1=CC=CC(O)=C1 IPRCBIWIPMJXIK-UHFFFAOYSA-N 0.000 description 7
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 7
- 239000004327 boric acid Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- RNVFYQUEEMZKLR-UHFFFAOYSA-N 1-carbomethoxy-3,5-dihydroxybenzene Natural products COC(=O)C1=CC(O)=CC(O)=C1 RNVFYQUEEMZKLR-UHFFFAOYSA-N 0.000 description 6
- YCPXWRQRBFJBPZ-UHFFFAOYSA-N 5-sulfosalicylic acid Chemical compound OC(=O)C1=CC(S(O)(=O)=O)=CC=C1O YCPXWRQRBFJBPZ-UHFFFAOYSA-N 0.000 description 6
- 229940081735 acetylcellulose Drugs 0.000 description 6
- 229910021529 ammonia Inorganic materials 0.000 description 6
- 229940114055 beta-resorcylic acid Drugs 0.000 description 6
- 229920002301 cellulose acetate Polymers 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 230000018109 developmental process Effects 0.000 description 6
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 6
- ZPBSAMLXSQCSOX-UHFFFAOYSA-N naphthalene-1,3,6-trisulfonic acid Chemical compound OS(=O)(=O)C1=CC(S(O)(=O)=O)=CC2=CC(S(=O)(=O)O)=CC=C21 ZPBSAMLXSQCSOX-UHFFFAOYSA-N 0.000 description 6
- 159000000000 sodium salts Chemical class 0.000 description 6
- -1 6-membered heterocyclic radical Chemical class 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- ALKYHXVLJMQRLQ-UHFFFAOYSA-N 3-Hydroxy-2-naphthoate Chemical compound C1=CC=C2C=C(O)C(C(=O)O)=CC2=C1 ALKYHXVLJMQRLQ-UHFFFAOYSA-N 0.000 description 4
- UIKUBYKUYUSRSM-UHFFFAOYSA-N 3-morpholinopropylamine Chemical compound NCCCN1CCOCC1 UIKUBYKUYUSRSM-UHFFFAOYSA-N 0.000 description 4
- RGCITEKHKXPDDH-UHFFFAOYSA-N 4-(diethylamino)benzenediazonium Chemical compound CCN(CC)C1=CC=C([N+]#N)C=C1 RGCITEKHKXPDDH-UHFFFAOYSA-N 0.000 description 4
- SCETWWDGKCBPMK-UHFFFAOYSA-N 4-[(4e)-4-diazocyclohexa-1,5-dien-1-yl]morpholine Chemical compound C1=CC(=[N+]=[N-])CC=C1N1CCOCC1 SCETWWDGKCBPMK-UHFFFAOYSA-N 0.000 description 4
- HVLAFPUUUISBRV-UHFFFAOYSA-N 4-diazo-n-ethyl-2-methylcyclohexa-1,5-dien-1-amine Chemical compound CCNC1=C(C)CC(=[N+]=[N-])C=C1 HVLAFPUUUISBRV-UHFFFAOYSA-N 0.000 description 4
- 229940092714 benzenesulfonic acid Drugs 0.000 description 4
- 239000012954 diazonium Substances 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 4
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 4
- IIUJCQYKTGNRHH-UHFFFAOYSA-N 2,4-dihydroxybenzamide Chemical compound NC(=O)C1=CC=C(O)C=C1O IIUJCQYKTGNRHH-UHFFFAOYSA-N 0.000 description 3
- LAXPFHMCFLHGKK-UHFFFAOYSA-N 4-diazo-n,n-dimethylcyclohexa-1,5-dien-1-amine Chemical compound CN(C)C1=CCC(=[N+]=[N-])C=C1 LAXPFHMCFLHGKK-UHFFFAOYSA-N 0.000 description 3
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 150000001450 anions Chemical class 0.000 description 3
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 3
- 150000008049 diazo compounds Chemical class 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 230000006641 stabilisation Effects 0.000 description 3
- 238000011105 stabilization Methods 0.000 description 3
- 230000000007 visual effect Effects 0.000 description 3
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- QEJUOCBDRDCLOP-UHFFFAOYSA-N 4-diazo-3-ethoxy-n,n-diethylcyclohexa-1,5-dien-1-amine Chemical compound CCOC1C=C(N(CC)CC)C=CC1=[N+]=[N-] QEJUOCBDRDCLOP-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 206010070834 Sensitisation Diseases 0.000 description 2
- SMEGJBVQLJJKKX-HOTMZDKISA-N [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4,6-trihydroxyoxan-2-yl]methyl acetate Chemical compound CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)OC(=O)C)O)O SMEGJBVQLJJKKX-HOTMZDKISA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 125000004103 aminoalkyl group Chemical group 0.000 description 2
- 150000008107 benzenesulfonic acids Chemical class 0.000 description 2
- YKYOUMDCQGMQQO-UHFFFAOYSA-L cadmium dichloride Chemical compound Cl[Cd]Cl YKYOUMDCQGMQQO-UHFFFAOYSA-L 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 230000008313 sensitization Effects 0.000 description 2
- 125000006569 (C5-C6) heterocyclic group Chemical group 0.000 description 1
- GLDQAMYCGOIJDV-UHFFFAOYSA-N 2,3-dihydroxybenzoic acid Chemical class OC(=O)C1=CC=CC(O)=C1O GLDQAMYCGOIJDV-UHFFFAOYSA-N 0.000 description 1
- WXHLLJAMBQLULT-UHFFFAOYSA-N 2-[[6-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methylpyrimidin-4-yl]amino]-n-(2-methyl-6-sulfanylphenyl)-1,3-thiazole-5-carboxamide;hydrate Chemical compound O.C=1C(N2CCN(CCO)CC2)=NC(C)=NC=1NC(S1)=NC=C1C(=O)NC1=C(C)C=CC=C1S WXHLLJAMBQLULT-UHFFFAOYSA-N 0.000 description 1
- NFTNTGFZYSCPSK-UHFFFAOYSA-N 3-hydroxynaphthalene-2-carboxamide Chemical class C1=CC=C2C=C(O)C(C(=O)N)=CC2=C1 NFTNTGFZYSCPSK-UHFFFAOYSA-N 0.000 description 1
- WDQHMOVTWMCTAX-UHFFFAOYSA-N CCC1=CC=CC([N+]#N)=C1NCC1=CC=CC=C1 Chemical class CCC1=CC=CC([N+]#N)=C1NCC1=CC=CC=C1 WDQHMOVTWMCTAX-UHFFFAOYSA-N 0.000 description 1
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- HTKFORQRBXIQHD-UHFFFAOYSA-N allylthiourea Chemical compound NC(=S)NCC=C HTKFORQRBXIQHD-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 238000006149 azo coupling reaction Methods 0.000 description 1
- 239000001045 blue dye Substances 0.000 description 1
- 239000001049 brown dye Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 235000019646 color tone Nutrition 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 230000031700 light absorption Effects 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- GPUMPJNVOBTUFM-UHFFFAOYSA-N naphthalene-1,2,3-trisulfonic acid Chemical compound C1=CC=C2C(S(O)(=O)=O)=C(S(O)(=O)=O)C(S(=O)(=O)O)=CC2=C1 GPUMPJNVOBTUFM-UHFFFAOYSA-N 0.000 description 1
- 150000004780 naphthols Chemical class 0.000 description 1
- 150000004989 p-phenylenediamines Chemical class 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 230000035882 stress Effects 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 239000012780 transparent material Substances 0.000 description 1
- LEMQFBIYMVUIIG-UHFFFAOYSA-N trifluoroborane;hydrofluoride Chemical compound F.FB(F)F LEMQFBIYMVUIIG-UHFFFAOYSA-N 0.000 description 1
- 239000000052 vinegar Substances 0.000 description 1
- 235000021419 vinegar Nutrition 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/52—Compositions containing diazo compounds as photosensitive substances
- G03C1/58—Coupling substances therefor
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
- Paper (AREA)
- Fodder In General (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DER0060482 | 1966-10-18 | ||
| DEK0060482 | 1966-10-18 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1572088A1 DE1572088A1 (de) | 1970-02-19 |
| DE1572088B2 DE1572088B2 (de) | 1975-10-09 |
| DE1572088C3 true DE1572088C3 (de) | 1982-05-27 |
Family
ID=25984305
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1572088A Expired DE1572088C3 (de) | 1966-10-18 | 1966-10-18 | Zweikomponenten-Diazotypiematerial für die Herstellung von Zwischenoriginalen |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3565629A (enExample) |
| AT (1) | AT290984B (enExample) |
| BE (1) | BE705261A (enExample) |
| CH (1) | CH505404A (enExample) |
| DE (1) | DE1572088C3 (enExample) |
| ES (1) | ES346154A1 (enExample) |
| FI (1) | FI44981C (enExample) |
| GB (1) | GB1187813A (enExample) |
| GR (1) | GR37065B (enExample) |
| NL (1) | NL6713430A (enExample) |
| NO (1) | NO127687B (enExample) |
| SE (1) | SE343150B (enExample) |
| ZA (1) | ZA6706181B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3836369A (en) * | 1972-09-05 | 1974-09-17 | Du Pont | Diazo photosensitive composition |
| JPS58143336A (ja) * | 1982-02-19 | 1983-08-25 | Ricoh Co Ltd | 熱現像型ジアゾ複写材料 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2416773A (en) * | 1945-01-04 | 1947-03-04 | Gen Aniline & Film Corp | Stabilized diazotype photoprinting materials |
| US2501874A (en) * | 1946-06-12 | 1950-03-28 | Gen Aniline & Film Corp | Photographic diazo-sensitized glassine paper |
| NL144426B (nl) * | 1948-01-20 | Telemecanique Electrique | Elektrische schakelinrichting, omvattende een in willekeurige richtingen dwars op zijn lengteas verzwenkbare, staafvormige bedieningshefboom. | |
| BE525958A (enExample) * | 1953-06-22 |
-
0
- ZA ZA6706181D patent/ZA6706181B/xx unknown
-
1966
- 1966-10-18 DE DE1572088A patent/DE1572088C3/de not_active Expired
-
1967
- 1967-10-03 NL NL6713430A patent/NL6713430A/xx unknown
- 1967-10-06 US US673291A patent/US3565629A/en not_active Expired - Lifetime
- 1967-10-16 GR GR670137065A patent/GR37065B/el unknown
- 1967-10-16 SE SE14138/67A patent/SE343150B/xx unknown
- 1967-10-16 AT AT933767A patent/AT290984B/de active
- 1967-10-17 ES ES346154A patent/ES346154A1/es not_active Expired
- 1967-10-17 GB GB47243/67A patent/GB1187813A/en not_active Expired
- 1967-10-17 NO NO00170162A patent/NO127687B/no unknown
- 1967-10-17 FI FI672784A patent/FI44981C/fi active
- 1967-10-17 CH CH1447267A patent/CH505404A/de not_active IP Right Cessation
- 1967-10-17 BE BE705261D patent/BE705261A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE1572088B2 (de) | 1975-10-09 |
| US3565629A (en) | 1971-02-23 |
| DE1572088A1 (de) | 1970-02-19 |
| CH505404A (de) | 1971-03-31 |
| NL6713430A (enExample) | 1968-04-19 |
| FI44981C (fi) | 1972-02-10 |
| ES346154A1 (es) | 1968-12-16 |
| ZA6706181B (enExample) | |
| AT290984B (de) | 1971-06-25 |
| BE705261A (enExample) | 1968-04-17 |
| GB1187813A (en) | 1970-04-15 |
| SE343150B (enExample) | 1972-02-28 |
| FI44981B (enExample) | 1971-11-01 |
| GR37065B (el) | 1969-04-16 |
| NO127687B (enExample) | 1973-07-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1200681B (de) | Durch Waerme entwickelbares Diazo-typiematerial | |
| DE1015679B (de) | Einkomponenten-Diazotypiematerial, das wenigstens zwei lichtempfindliche Diazoverbindungen enthaelt | |
| DE1236331B (de) | Zweikomponenten-Diazotypiematerial | |
| DE1597619C3 (de) | Zweikomponenten-Diazotypiematerial | |
| DE1572088C3 (de) | Zweikomponenten-Diazotypiematerial für die Herstellung von Zwischenoriginalen | |
| DE1172952B (de) | Diazotypiematerial | |
| DE864657C (de) | Material fuer die Herstellung von Diazotypien | |
| DE832396C (de) | Lichtempfindliche Schichten fuer die Diazotypie | |
| DE2319162A1 (de) | Imidazol kuppler fuer zweikomponentendiazotypiematerialien | |
| DE1772017A1 (de) | Diazotypie-Materialien | |
| DE1547913A1 (de) | Lichtempfindliches Material | |
| DE2553136C3 (de) | Zweikomponenten-Diazotypiematerial | |
| DE831804C (de) | Lichtempfindliche Schichten fuer die Diazotypie | |
| DE1597617A1 (de) | Zweikomponenten-Diazotypiematerial | |
| DE1797615C2 (de) | Diazotypiematerial | |
| DE1286897B (de) | Zweikomponentendiazotypiematerial | |
| AT279349B (de) | Zweikomponenten-Diazotypiematerial | |
| DE896453C (de) | Azokomponenten fuer die Diazotypie | |
| DE1597631C3 (de) | Verfahren zur Herstellung von Bildkopien | |
| DE1572106C3 (de) | Einkomponenten-Diazotypiematerial | |
| DE1229844B (de) | Verfahren zur Herstellung von Lichtpausen | |
| AT269644B (de) | Lichtempfindliches Kopiermaterial | |
| DE1572084C3 (de) | Verfahren zur Herstellung von Diazotypiekopien mit roten Linien | |
| DE694078C (de) | Lichtempfindliche Schichten | |
| DE1597616A1 (de) | Verfahren zur Herstellung von lichtempfindlichem Diazopapier fuer schwarzgefaerbte Bilder |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |