DE1445467A1 - Verfahren zur Herstellung von Benzodiazepinen - Google Patents
Verfahren zur Herstellung von BenzodiazepinenInfo
- Publication number
- DE1445467A1 DE1445467A1 DE19641445467 DE1445467A DE1445467A1 DE 1445467 A1 DE1445467 A1 DE 1445467A1 DE 19641445467 DE19641445467 DE 19641445467 DE 1445467 A DE1445467 A DE 1445467A DE 1445467 A1 DE1445467 A1 DE 1445467A1
- Authority
- DE
- Germany
- Prior art keywords
- aryl
- phenyl
- substituted
- radical
- carbon atoms
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 10
- 238000002360 preparation method Methods 0.000 title claims description 5
- 229940049706 benzodiazepine Drugs 0.000 title description 3
- 150000001557 benzodiazepines Chemical class 0.000 title description 3
- -1 hydrocarbon radical Chemical class 0.000 claims description 13
- 239000000460 chlorine Substances 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 7
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 6
- 229910052794 bromium Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 125000001931 aliphatic group Chemical class 0.000 claims 2
- 239000004215 Carbon black (E152) Substances 0.000 claims 1
- 241000283984 Rodentia Species 0.000 claims 1
- DKJGJYLQPURRFB-UHFFFAOYSA-N diethyl 2-[(2-methylphenyl)iminomethyl]propanedioate Chemical class CCOC(=O)C(C(=O)OCC)C=NC1=CC=CC=C1C DKJGJYLQPURRFB-UHFFFAOYSA-N 0.000 claims 1
- 239000012530 fluid Substances 0.000 claims 1
- 229930195733 hydrocarbon Natural products 0.000 claims 1
- 150000003254 radicals Chemical class 0.000 claims 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims 1
- VLPFTAMPNXLGLX-UHFFFAOYSA-N trioctanoin Chemical compound CCCCCCCC(=O)OCC(OC(=O)CCCCCCC)COC(=O)CCCCCCC VLPFTAMPNXLGLX-UHFFFAOYSA-N 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 34
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 20
- 125000000217 alkyl group Chemical group 0.000 description 13
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 11
- 238000002844 melting Methods 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- 229910021529 ammonia Inorganic materials 0.000 description 9
- 230000008018 melting Effects 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 7
- 229920006395 saturated elastomer Polymers 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- 125000001424 substituent group Chemical group 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 4
- 125000003710 aryl alkyl group Chemical group 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 125000002252 acyl group Chemical group 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 2
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 125000004423 acyloxy group Chemical group 0.000 description 2
- 125000003368 amide group Chemical group 0.000 description 2
- 230000001773 anti-convulsant effect Effects 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 230000008030 elimination Effects 0.000 description 2
- 238000003379 elimination reaction Methods 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 230000003301 hydrolyzing effect Effects 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000006798 ring closing metathesis reaction Methods 0.000 description 2
- 239000000932 sedative agent Substances 0.000 description 2
- 230000001624 sedative effect Effects 0.000 description 2
- RGGLEJFUEMKQSH-UHFFFAOYSA-N 1,4-benzodiazepin-2-one Chemical compound O=C1C=NC=C2C=CC=CC2=N1 RGGLEJFUEMKQSH-UHFFFAOYSA-N 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- JFFAZXGQPXXESR-UHFFFAOYSA-N 3-phenyl-1,4-benzodiazepin-2-one Chemical compound O=C1N=C2C=CC=CC2=CN=C1C1=CC=CC=C1 JFFAZXGQPXXESR-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- CVICEEPAFUYBJG-UHFFFAOYSA-N 5-chloro-2,2-difluoro-1,3-benzodioxole Chemical group C1=C(Cl)C=C2OC(F)(F)OC2=C1 CVICEEPAFUYBJG-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- HETCEOQFVDFGSY-UHFFFAOYSA-N Isopropenyl acetate Chemical compound CC(=C)OC(C)=O HETCEOQFVDFGSY-UHFFFAOYSA-N 0.000 description 1
- 102000006835 Lamins Human genes 0.000 description 1
- 108010047294 Lamins Proteins 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- NOMOFJPLAPOHHG-UHFFFAOYSA-N [2-[(2-methylpropan-2-yl)oxy]-4-nitrophenyl] hydrogen carbonate Chemical compound CC(C)(C)OC1=C(C=CC(=C1)[N+](=O)[O-])OC(=O)O NOMOFJPLAPOHHG-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 230000002082 anti-convulsion Effects 0.000 description 1
- 239000001961 anticonvulsive agent Substances 0.000 description 1
- 229960003965 antiepileptics Drugs 0.000 description 1
- 125000003435 aroyl group Chemical group 0.000 description 1
- 125000005333 aroyloxy group Chemical group 0.000 description 1
- HXCHRJMJMALFHP-UHFFFAOYSA-N azanium;ethanol;hydroxide Chemical compound N.O.CCO HXCHRJMJMALFHP-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 230000007812 deficiency Effects 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- CCGKOQOJPYTBIH-UHFFFAOYSA-N ethenone Chemical compound C=C=O CCGKOQOJPYTBIH-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 210000005053 lamin Anatomy 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 125000005394 methallyl group Chemical group 0.000 description 1
- 230000003387 muscular Effects 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000002040 relaxant effect Effects 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 238000009738 saturating Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D243/00—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms
- C07D243/06—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4
- C07D243/10—Heterocyclic compounds containing seven-membered rings having two nitrogen atoms as the only ring hetero atoms having the nitrogen atoms in positions 1 and 4 condensed with carbocyclic rings or ring systems
- C07D243/14—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines
- C07D243/16—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines substituted in position 5 by aryl radicals
- C07D243/18—1,4-Benzodiazepines; Hydrogenated 1,4-benzodiazepines substituted in position 5 by aryl radicals substituted in position 2 by nitrogen, oxygen or sulfur atoms
- C07D243/24—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Furan Compounds (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US32767463A | 1963-12-03 | 1963-12-03 | |
| US414583A US3344136A (en) | 1963-12-03 | 1964-11-30 | Process for producing 3-acetamido-1, 3-dihydro-5-phenyl-2h-1, 4-benzodiazepin-2-ones |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1445467A1 true DE1445467A1 (de) | 1969-02-13 |
Family
ID=26986000
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19641445467 Pending DE1445467A1 (de) | 1963-12-03 | 1964-11-27 | Verfahren zur Herstellung von Benzodiazepinen |
| DE19641645920 Pending DE1645920A1 (de) | 1963-12-03 | 1964-11-27 | Verfahren zur Herstellung von 3-Amino-5-aryl-1,2-dihydro-3H-1,4-benzodiazepin-2-on-derivaten |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19641645920 Pending DE1645920A1 (de) | 1963-12-03 | 1964-11-27 | Verfahren zur Herstellung von 3-Amino-5-aryl-1,2-dihydro-3H-1,4-benzodiazepin-2-on-derivaten |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3344136A (https=) |
| BE (1) | BE656606A (https=) |
| BR (1) | BR6464985D0 (https=) |
| CH (1) | CH451173A (https=) |
| DE (2) | DE1445467A1 (https=) |
| DK (1) | DK120492B (https=) |
| FI (1) | FI47487C (https=) |
| GB (2) | GB1082212A (https=) |
| IL (1) | IL22545A (https=) |
| IT (1) | IT1044774B (https=) |
| NL (2) | NL6414066A (https=) |
| SE (2) | SE316187B (https=) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3423459A (en) * | 1966-04-19 | 1969-01-21 | American Home Prod | Acetanilido derivatives and method for preparing same |
| US3903103A (en) * | 1971-09-15 | 1975-09-02 | Upjohn Co | 4-Amino-s-triazolo-{8 4,3-a{9 {8 1,4{9 benzodiazepine |
| CA1332410C (en) * | 1984-06-26 | 1994-10-11 | Roger M. Freidinger | Benzodiazepine analogs |
| US4820834A (en) * | 1984-06-26 | 1989-04-11 | Merck & Co., Inc. | Benzodiazepine analogs |
| US4628084A (en) * | 1986-01-02 | 1986-12-09 | Merck & Co., Inc. | Process for 3-acylamino benzodiazepines |
| US5428157A (en) * | 1993-11-22 | 1995-06-27 | Merck & Co., Inc. | 3-acylaminobenzodiazepines |
| NZ538870A (en) * | 2002-09-20 | 2007-04-27 | Arrow Therapeutics Ltd | Benzodiazepine derivatives and pharmaceutical compositions containing them |
| BRPI0520554A2 (pt) * | 2005-09-19 | 2009-06-13 | Arrow Therapeutics Ltd | uso de uma benzodiazepina ou um sal farmaceuticamente aceitável do mesmo, método para tratar ou prevenir uma infecção por hcv em um paciente, derivado de benzodiazepina ou um sal famaceuticamente aceitável do mesmo, e, composição farmacêutica |
-
0
- BE BE656606D patent/BE656606A/xx unknown
- NL NL134421D patent/NL134421C/xx active
-
1964
- 1964-11-25 GB GB47870/64A patent/GB1082212A/en not_active Expired
- 1964-11-25 GB GB32984/66A patent/GB1082213A/en not_active Expired
- 1964-11-27 DE DE19641445467 patent/DE1445467A1/de active Pending
- 1964-11-27 DE DE19641645920 patent/DE1645920A1/de active Pending
- 1964-11-27 CH CH1535864A patent/CH451173A/de unknown
- 1964-11-28 IT IT25679/64A patent/IT1044774B/it active
- 1964-11-30 SE SE14437/64A patent/SE316187B/xx unknown
- 1964-11-30 US US414583A patent/US3344136A/en not_active Expired - Lifetime
- 1964-12-02 BR BR164985/64A patent/BR6464985D0/pt unknown
- 1964-12-02 IL IL22545A patent/IL22545A/xx unknown
- 1964-12-02 DK DK593464AA patent/DK120492B/da unknown
- 1964-12-02 FI FI642542A patent/FI47487C/fi active
- 1964-12-03 NL NL6414066A patent/NL6414066A/xx unknown
-
1967
- 1967-01-11 SE SE37967A patent/SE317978B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SE316187B (https=) | 1969-10-20 |
| IT1044774B (it) | 1980-04-21 |
| NL6414066A (https=) | 1965-06-04 |
| BE656606A (https=) | |
| CH451173A (de) | 1968-05-15 |
| FI47487B (https=) | 1973-08-31 |
| DK120492B (da) | 1971-06-07 |
| GB1082212A (en) | 1967-09-06 |
| FI47487C (fi) | 1973-12-10 |
| DE1645920A1 (de) | 1970-09-24 |
| US3344136A (en) | 1967-09-26 |
| IL22545A (en) | 1968-09-26 |
| BR6464985D0 (pt) | 1973-08-02 |
| SE317978B (https=) | 1969-12-01 |
| GB1082213A (en) | 1967-09-06 |
| NL134421C (https=) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1644306B2 (de) | Basische anthrachinon- und nitrofarbstoffe und verfahren zu deren herstellung | |
| DE1545952C3 (de) | 7-ChIoM ,3-dlhydro-i -(2-hydroxyäthyl)-5-phenyl-2H-1,4-benzodiazepin-2-on | |
| DE1445467A1 (de) | Verfahren zur Herstellung von Benzodiazepinen | |
| DE1620442C3 (de) | Verfahren zur Herstellung von 1-Acylindolverbindungen | |
| EP0017181A1 (de) | Neues Verfahren zur Herstellung von Imidazobenzodiazepinderivaten sowie Zwischenprodukte zu deren Herstellung | |
| DE1695162A1 (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| DE1901497A1 (de) | Neue heterocyclische Verbindungen und Verfahren zu ihrer Herstellung | |
| DE812316C (de) | Verfahren zur Herstellung von 2-(p-Aminobenzolsulfonamido)-4-methylpyrimidin | |
| DE2427272A1 (de) | 1-(2-(beta-naphthyloxy)-aethyl)-3-methyl -pyrazolon-(5), verfahren sowie verwendung als antithrombotikum | |
| DE1795231C3 (de) | Verfahren zur Herstellung von 5-Aryl-1,2-dihydro -3H-1,4-benzodiazepin-2-on-4-oxyden | |
| DE1812231B2 (de) | Verfahren zur herstellung von 3alkyl-5-phenyl-1,3-dihydro-2h-1,4benzodiazepin-2-onderivaten | |
| DE1545957A1 (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| DE2417917A1 (de) | Verfahren zur herstellung von indolderivaten mit ankondensiertem ringsystem | |
| DE1817791C3 (de) | 2-Aminomethyl-3-phenylindole und ihre Salze mit Säuren | |
| AT296316B (de) | Verfahren zur Herstellung von neuen Benzodiazepin-Derivaten und deren N-4-Oxyden | |
| DE1644306C3 (de) | Basische Anthrachinon- und Nitrofarbstoffe und Verfahren zu deren Herstellung | |
| AT276380B (de) | Verfahren zur Herstellung von neuen Phenylisoindolderivaten und deren Salzen | |
| AT242705B (de) | Verfahren zur Herstellung von neuen Benzodiazepin-Derivaten | |
| AT264529B (de) | Verfahren zur Herstellung von neuen Benzodiazepin-Derivaten, 4-Oxyden davon und Säureadditionssalzen solcher Verbindungen | |
| AT220621B (de) | Verfahren zur Herstellung neuer 4-Oxo-1,2,3,4-tetrahydro-naphthalin-carbonsäureamide | |
| AT275535B (de) | Verfahren zur Herstellung von 4,1,5-Benzoxadiazocinen | |
| DE1795372C3 (de) | 10.01.68 Japan 1501-68 Verfahren zur Herstellung von 5-(o-Halogenphenyl)-7-halogen-1,3-dihydro-2H-1,4-benzodiazepin-2-onen und 2-Aminomethylindole und ihre Salze | |
| AT257590B (de) | Verfahren zur Herstellung von neuen 2-Nitroimidazolderivaten und ihren Säureadditionssalzen | |
| AT275528B (de) | Verfahren zur Herstellung von neuen 1,4-Benzodiazepinen, ihrer 4-Oxyde sowie Salzen dieser Verbindungen | |
| EP0041627B1 (de) | 3H-2-Benzazepine, Zwischenprodukte und Verfahren zu ihrer Herstellung, sowie diese enthaltende Präparate |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| E77 | Valid patent as to the heymanns-index 1977 |