DE1175986B - Lichtempfindliche Schicht zur Herstellung photographischer Bilder - Google Patents
Lichtempfindliche Schicht zur Herstellung photographischer BilderInfo
- Publication number
- DE1175986B DE1175986B DEH40531A DEH0040531A DE1175986B DE 1175986 B DE1175986 B DE 1175986B DE H40531 A DEH40531 A DE H40531A DE H0040531 A DEH0040531 A DE H0040531A DE 1175986 B DE1175986 B DE 1175986B
- Authority
- DE
- Germany
- Prior art keywords
- photosensitive layer
- layer according
- weight
- binder
- artificial
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000004519 manufacturing process Methods 0.000 title claims description 5
- 239000011230 binding agent Substances 0.000 claims description 32
- HJUGFYREWKUQJT-UHFFFAOYSA-N tetrabromomethane Chemical compound BrC(Br)(Br)Br HJUGFYREWKUQJT-UHFFFAOYSA-N 0.000 claims description 19
- 150000001875 compounds Chemical class 0.000 claims description 18
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 claims description 18
- UYMKPFRHYYNDTL-UHFFFAOYSA-N ethenamine Chemical compound NC=C UYMKPFRHYYNDTL-UHFFFAOYSA-N 0.000 claims description 18
- 229910052736 halogen Inorganic materials 0.000 claims description 17
- 150000002367 halogens Chemical class 0.000 claims description 17
- 239000000463 material Substances 0.000 claims description 17
- 239000001856 Ethyl cellulose Substances 0.000 claims description 15
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 claims description 15
- 229920001249 ethyl cellulose Polymers 0.000 claims description 15
- 235000019325 ethyl cellulose Nutrition 0.000 claims description 15
- 238000010438 heat treatment Methods 0.000 claims description 15
- 150000004982 aromatic amines Chemical class 0.000 claims description 13
- 229910052757 nitrogen Inorganic materials 0.000 claims description 11
- 239000000203 mixture Substances 0.000 claims description 10
- KKFHAJHLJHVUDM-UHFFFAOYSA-N n-vinylcarbazole Chemical compound C1=CC=C2N(C=C)C3=CC=CC=C3C2=C1 KKFHAJHLJHVUDM-UHFFFAOYSA-N 0.000 claims description 10
- 239000004800 polyvinyl chloride Substances 0.000 claims description 8
- 229920000915 polyvinyl chloride Polymers 0.000 claims description 8
- 239000002904 solvent Substances 0.000 claims description 8
- 239000004014 plasticizer Substances 0.000 claims description 7
- 239000000020 Nitrocellulose Substances 0.000 claims description 6
- FJWGYAHXMCUOOM-QHOUIDNNSA-N [(2s,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6s)-4,5-dinitrooxy-2-(nitrooxymethyl)-6-[(2r,3r,4s,5r,6s)-4,5,6-trinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-3,5-dinitrooxy-6-(nitrooxymethyl)oxan-4-yl] nitrate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O)O[C@H]1[C@@H]([C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@@H](CO[N+]([O-])=O)O1)O[N+]([O-])=O)CO[N+](=O)[O-])[C@@H]1[C@@H](CO[N+]([O-])=O)O[C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O FJWGYAHXMCUOOM-QHOUIDNNSA-N 0.000 claims description 6
- 229920002301 cellulose acetate Polymers 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 6
- 229920001220 nitrocellulos Polymers 0.000 claims description 6
- 229920002689 polyvinyl acetate Polymers 0.000 claims description 6
- 239000011118 polyvinyl acetate Substances 0.000 claims description 6
- RCSKFKICHQAKEZ-UHFFFAOYSA-N 1-ethenylindole Chemical compound C1=CC=C2N(C=C)C=CC2=C1 RCSKFKICHQAKEZ-UHFFFAOYSA-N 0.000 claims description 5
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 claims description 5
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 claims description 5
- 239000004793 Polystyrene Substances 0.000 claims description 5
- -1 compound Compound Chemical class 0.000 claims description 5
- 238000000354 decomposition reaction Methods 0.000 claims description 5
- 229920002223 polystyrene Polymers 0.000 claims description 5
- IGDLZDCWMRPMGL-UHFFFAOYSA-N 2-ethenylisoindole-1,3-dione Chemical compound C1=CC=C2C(=O)N(C=C)C(=O)C2=C1 IGDLZDCWMRPMGL-UHFFFAOYSA-N 0.000 claims description 4
- 229920001971 elastomer Polymers 0.000 claims description 4
- OKJPEAGHQZHRQV-UHFFFAOYSA-N iodoform Chemical compound IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 claims description 4
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 claims description 4
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 claims description 4
- 239000005060 rubber Substances 0.000 claims description 4
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 claims description 4
- 239000005083 Zinc sulfide Substances 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- VHHHONWQHHHLTI-UHFFFAOYSA-N hexachloroethane Chemical compound ClC(Cl)(Cl)C(Cl)(Cl)Cl VHHHONWQHHHLTI-UHFFFAOYSA-N 0.000 claims description 3
- ODHXBMXNKOYIBV-UHFFFAOYSA-N triphenylamine Chemical compound C1=CC=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 ODHXBMXNKOYIBV-UHFFFAOYSA-N 0.000 claims description 3
- 229910052984 zinc sulfide Inorganic materials 0.000 claims description 3
- DRDVZXDWVBGGMH-UHFFFAOYSA-N zinc;sulfide Chemical compound [S-2].[Zn+2] DRDVZXDWVBGGMH-UHFFFAOYSA-N 0.000 claims description 3
- HGRZLIGHKHRTRE-UHFFFAOYSA-N 1,2,3,4-tetrabromobutane Chemical compound BrCC(Br)C(Br)CBr HGRZLIGHKHRTRE-UHFFFAOYSA-N 0.000 claims description 2
- FUPAJKKAHDLPAZ-UHFFFAOYSA-N 1,2,3-triphenylguanidine Chemical compound C=1C=CC=CC=1NC(=NC=1C=CC=CC=1)NC1=CC=CC=C1 FUPAJKKAHDLPAZ-UHFFFAOYSA-N 0.000 claims description 2
- OWRCNXZUPFZXOS-UHFFFAOYSA-N 1,3-diphenylguanidine Chemical compound C=1C=CC=CC=1NC(=N)NC1=CC=CC=C1 OWRCNXZUPFZXOS-UHFFFAOYSA-N 0.000 claims description 2
- VOCDJQSAMZARGX-UHFFFAOYSA-N 1-ethenylpyrrolidine-2,5-dione Chemical compound C=CN1C(=O)CCC1=O VOCDJQSAMZARGX-UHFFFAOYSA-N 0.000 claims description 2
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 claims description 2
- FFQQYHBEGNDDQH-UHFFFAOYSA-N N-methyl-N-[(N-methylanilino)diazenyl]-2-phenylaniline Chemical compound CN(C1=CC=CC=C1)N=NN(C1=C(C=CC=C1)C1=CC=CC=C1)C FFQQYHBEGNDDQH-UHFFFAOYSA-N 0.000 claims description 2
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methyl-N-phenylamine Natural products CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 claims description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 2
- CKAPSXZOOQJIBF-UHFFFAOYSA-N hexachlorobenzene Chemical compound ClC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl CKAPSXZOOQJIBF-UHFFFAOYSA-N 0.000 claims description 2
- ZJLPWPKOCBMIFP-UHFFFAOYSA-N n-ethenyl-n-phenylnaphthalen-1-amine Chemical compound C=1C=CC2=CC=CC=C2C=1N(C=C)C1=CC=CC=C1 ZJLPWPKOCBMIFP-UHFFFAOYSA-N 0.000 claims description 2
- 229920003229 poly(methyl methacrylate) Polymers 0.000 claims description 2
- 239000004926 polymethyl methacrylate Substances 0.000 claims description 2
- 229920000131 polyvinylidene Polymers 0.000 claims description 2
- IDWXQRMUCRXFAK-UHFFFAOYSA-N (2-phenyldiazenylhydrazinyl)benzene Chemical compound C=1C=CC=CC=1N=NNNC1=CC=CC=C1 IDWXQRMUCRXFAK-UHFFFAOYSA-N 0.000 claims 1
- HDYTUPZMASQMOH-UHFFFAOYSA-N 4-ethenylmorpholine-3,5-dione Chemical compound C=CN1C(=O)COCC1=O HDYTUPZMASQMOH-UHFFFAOYSA-N 0.000 claims 1
- GDHVPEPUKLVABX-UHFFFAOYSA-N C1CC2=CC=CC=C2CC1.Cl.Cl.Cl.Cl Chemical compound C1CC2=CC=CC=C2CC1.Cl.Cl.Cl.Cl GDHVPEPUKLVABX-UHFFFAOYSA-N 0.000 claims 1
- LJTFFORYSFGNCT-UHFFFAOYSA-N Thiocarbohydrazide Chemical compound NNC(=S)NN LJTFFORYSFGNCT-UHFFFAOYSA-N 0.000 claims 1
- AEOCXXJPGCBFJA-UHFFFAOYSA-N ethionamide Chemical compound CCC1=CC(C(N)=S)=CC=N1 AEOCXXJPGCBFJA-UHFFFAOYSA-N 0.000 claims 1
- 230000003595 spectral effect Effects 0.000 claims 1
- 239000000758 substrate Substances 0.000 claims 1
- 150000003573 thiols Chemical class 0.000 claims 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 16
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- ISAOCJYIOMOJEB-UHFFFAOYSA-N benzoin Chemical compound C=1C=CC=CC=1C(O)C(=O)C1=CC=CC=C1 ISAOCJYIOMOJEB-UHFFFAOYSA-N 0.000 description 10
- 231100000489 sensitizer Toxicity 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 6
- 229910052782 aluminium Inorganic materials 0.000 description 6
- 239000011521 glass Substances 0.000 description 6
- 229910052724 xenon Inorganic materials 0.000 description 6
- FHNFHKCVQCLJFQ-UHFFFAOYSA-N xenon atom Chemical compound [Xe] FHNFHKCVQCLJFQ-UHFFFAOYSA-N 0.000 description 6
- 244000028419 Styrax benzoin Species 0.000 description 5
- 235000000126 Styrax benzoin Nutrition 0.000 description 5
- 235000008411 Sumatra benzointree Nutrition 0.000 description 5
- 229960002130 benzoin Drugs 0.000 description 5
- 235000019382 gum benzoic Nutrition 0.000 description 5
- 229940075065 polyvinyl acetate Drugs 0.000 description 5
- 150000003464 sulfur compounds Chemical class 0.000 description 5
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 229920002554 vinyl polymer Polymers 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000007792 addition Methods 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 229920002678 cellulose Polymers 0.000 description 3
- 239000001913 cellulose Substances 0.000 description 3
- 239000003973 paint Substances 0.000 description 3
- 229920003023 plastic Polymers 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 230000005855 radiation Effects 0.000 description 3
- 230000035945 sensitivity Effects 0.000 description 3
- YUKQRDCYNOVPGJ-UHFFFAOYSA-N thioacetamide Chemical compound CC(N)=S YUKQRDCYNOVPGJ-UHFFFAOYSA-N 0.000 description 3
- DLFVBJFMPXGRIB-UHFFFAOYSA-N thioacetamide Natural products CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 3
- WHHKXBGHEPIYII-UHFFFAOYSA-N 5,6,7,8-tetrachloro-1,2,3,4-tetrahydronaphthalene Chemical compound C1CCCC2=C(Cl)C(Cl)=C(Cl)C(Cl)=C21 WHHKXBGHEPIYII-UHFFFAOYSA-N 0.000 description 2
- UJOBWOGCFQCDNV-UHFFFAOYSA-N 9H-carbazole Chemical compound C1=CC=C2C3=CC=CC=C3NC2=C1 UJOBWOGCFQCDNV-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- MQIUGAXCHLFZKX-UHFFFAOYSA-N Di-n-octyl phthalate Natural products CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC MQIUGAXCHLFZKX-UHFFFAOYSA-N 0.000 description 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical group COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 2
- YSMRWXYRXBRSND-UHFFFAOYSA-N TOTP Chemical compound CC1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)C)OC1=CC=CC=C1C YSMRWXYRXBRSND-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 235000019441 ethanol Nutrition 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 229910052709 silver Inorganic materials 0.000 description 2
- 239000004332 silver Substances 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- CTXUTPWZJZHRJC-UHFFFAOYSA-N 1-ethenylpyrrole Chemical compound C=CN1C=CC=C1 CTXUTPWZJZHRJC-UHFFFAOYSA-N 0.000 description 1
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 1
- OSQKVVOKMXMIBV-UHFFFAOYSA-N 2-methylprop-2-enoic acid;propan-2-one Chemical compound CC(C)=O.CC(=C)C(O)=O OSQKVVOKMXMIBV-UHFFFAOYSA-N 0.000 description 1
- KXHSILBWMLDNGL-UHFFFAOYSA-N C1(=CC=CC=C1)NC1=CC=CC=C1.C(=C)N1C2=CC=CC=C2C=2C=CC=CC12 Chemical compound C1(=CC=CC=C1)NC1=CC=CC=C1.C(=C)N1C2=CC=CC=C2C=2C=CC=CC12 KXHSILBWMLDNGL-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- FCSHMCFRCYZTRQ-UHFFFAOYSA-N N,N'-diphenylthiourea Chemical compound C=1C=CC=CC=1NC(=S)NC1=CC=CC=C1 FCSHMCFRCYZTRQ-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- GTVWRXDRKAHEAD-UHFFFAOYSA-N Tris(2-ethylhexyl) phosphate Chemical compound CCCCC(CC)COP(=O)(OCC(CC)CCCC)OCC(CC)CCCC GTVWRXDRKAHEAD-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- UIWQZDKINVCVRN-UHFFFAOYSA-N [(2,2-diphenylhydrazinyl)diazenyl]benzene Chemical compound C=1C=CC=CC=1N(C=1C=CC=CC=1)NN=NC1=CC=CC=C1 UIWQZDKINVCVRN-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- WURBFLDFSFBTLW-UHFFFAOYSA-N benzil Chemical compound C=1C=CC=CC=1C(=O)C(=O)C1=CC=CC=C1 WURBFLDFSFBTLW-UHFFFAOYSA-N 0.000 description 1
- 150000008366 benzophenones Chemical class 0.000 description 1
- ROPXFXOUUANXRR-YPKPFQOOSA-N bis(2-ethylhexyl) (z)-but-2-enedioate Chemical compound CCCCC(CC)COC(=O)\C=C/C(=O)OCC(CC)CCCC ROPXFXOUUANXRR-YPKPFQOOSA-N 0.000 description 1
- ZVPBHZIVOWGPMT-UHFFFAOYSA-N bis(2-ethylhexyl) cyclohexene-1,2-dicarboxylate Chemical compound CCCCC(CC)COC(=O)C1=C(C(=O)OCC(CC)CCCC)CCCC1 ZVPBHZIVOWGPMT-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 229940125773 compound 10 Drugs 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- WNAHIZMDSQCWRP-UHFFFAOYSA-N dodecane-1-thiol Chemical compound CCCCCCCCCCCCS WNAHIZMDSQCWRP-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000834 fixative Substances 0.000 description 1
- 229940083124 ganglion-blocking antiadrenergic secondary and tertiary amines Drugs 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- GUAWMXYQZKVRCW-UHFFFAOYSA-N n,2-dimethylaniline Chemical compound CNC1=CC=CC=C1C GUAWMXYQZKVRCW-UHFFFAOYSA-N 0.000 description 1
- VZUGBLTVBZJZOE-KRWDZBQOSA-N n-[3-[(4s)-2-amino-1,4-dimethyl-6-oxo-5h-pyrimidin-4-yl]phenyl]-5-chloropyrimidine-2-carboxamide Chemical compound N1=C(N)N(C)C(=O)C[C@@]1(C)C1=CC=CC(NC(=O)C=2N=CC(Cl)=CN=2)=C1 VZUGBLTVBZJZOE-KRWDZBQOSA-N 0.000 description 1
- IQVLNQNLISXIOS-UHFFFAOYSA-N n-ethenyl-2-phenylacetamide Chemical compound C=CNC(=O)CC1=CC=CC=C1 IQVLNQNLISXIOS-UHFFFAOYSA-N 0.000 description 1
- PNLUGRYDUHRLOF-UHFFFAOYSA-N n-ethenyl-n-methylacetamide Chemical compound C=CN(C)C(C)=O PNLUGRYDUHRLOF-UHFFFAOYSA-N 0.000 description 1
- WUIIRPAMGBRKCV-UHFFFAOYSA-N n-ethenyl-n-phenylacetamide Chemical compound CC(=O)N(C=C)C1=CC=CC=C1 WUIIRPAMGBRKCV-UHFFFAOYSA-N 0.000 description 1
- SRFLQIDBOUXPFK-UHFFFAOYSA-N n-ethenyl-n-phenylaniline Chemical compound C=1C=CC=CC=1N(C=C)C1=CC=CC=C1 SRFLQIDBOUXPFK-UHFFFAOYSA-N 0.000 description 1
- 229910001120 nichrome Inorganic materials 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000003504 photosensitizing agent Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 238000006862 quantum yield reaction Methods 0.000 description 1
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- PJANXHGTPQOBST-UHFFFAOYSA-N stilbene Chemical class C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F291/00—Macromolecular compounds obtained by polymerising monomers on to macromolecular compounds according to more than one of the groups C08F251/00 - C08F289/00
- C08F291/18—Macromolecular compounds obtained by polymerising monomers on to macromolecular compounds according to more than one of the groups C08F251/00 - C08F289/00 on to irradiated or oxidised macromolecules
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B41—PRINTING; LINING MACHINES; TYPEWRITERS; STAMPS
- B41M—PRINTING, DUPLICATING, MARKING, OR COPYING PROCESSES; COLOUR PRINTING
- B41M5/00—Duplicating or marking methods; Sheet materials for use therein
- B41M5/26—Thermography ; Marking by high energetic means, e.g. laser otherwise than by burning, and characterised by the material used
- B41M5/30—Thermography ; Marking by high energetic means, e.g. laser otherwise than by burning, and characterised by the material used using chemical colour formers
- B41M5/323—Organic colour formers, e.g. leuco dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- General Chemical & Material Sciences (AREA)
- Physics & Mathematics (AREA)
- Optics & Photonics (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US842569A US3042517A (en) | 1959-09-28 | 1959-09-28 | Latent image photographic system |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1175986B true DE1175986B (de) | 1964-08-13 |
Family
ID=25287668
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEH40531A Pending DE1175986B (de) | 1959-09-28 | 1960-09-27 | Lichtempfindliche Schicht zur Herstellung photographischer Bilder |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3042517A (forum.php) |
| DE (1) | DE1175986B (forum.php) |
| FR (1) | FR1303075A (forum.php) |
| GB (1) | GB959034A (forum.php) |
| NL (1) | NL256340A (forum.php) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1213736B (de) * | 1960-01-08 | 1966-03-31 | Horizons Inc | Lichtempfindliche Schicht zur Herstellung von photographischen Bildern |
| DE1283093B (de) * | 1965-11-10 | 1968-11-14 | Kalle Ag | Lichtempfindliche Schicht |
| DE1289737B (de) * | 1965-01-30 | 1969-02-20 | Kalle Ag | Lichtempfindliche Schicht |
| DE1298414B (de) * | 1967-11-09 | 1969-06-26 | Kalle Ag | Lichtempfindliches Gemisch |
| DE1572137B1 (de) * | 1965-06-03 | 1970-09-24 | Du Pont | Fotopolymerisierbares Aufzeichnungsmaterial |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3194659A (en) * | 1961-03-06 | 1965-07-13 | Kalvar Corp | Reflex copying method using heat developable light scattering materials |
| US3147117A (en) * | 1961-05-26 | 1964-09-01 | Horizons Inc | Process of forming print-out images from light sensitive organic amine compositions |
| US3194660A (en) * | 1961-06-26 | 1965-07-13 | Ibm | Reflex copying method |
| US3155513A (en) * | 1961-10-30 | 1964-11-03 | Minnesota Mining & Mfg | Heat sensitive sheet material and method of making |
| US3476562A (en) * | 1963-05-06 | 1969-11-04 | Bell & Howell Co | Light sensitive composition comprising an organic amine and an organic halogen compound in a hydrophilic binder |
| NL141658B (nl) * | 1963-05-06 | 1974-03-15 | Bell & Howell Co | Werkwijze voor het vervaardigen van fotografisch materiaal, aldus vervaardigd fotografisch materiaal, fotografische registreerwerkwijze en belicht fotografisch materiaal. |
| GB1055025A (en) * | 1963-05-06 | 1967-01-11 | Bell & Howell Co | Improvements in or relating to the preparation and use of photographic compositions |
| US3650755A (en) * | 1963-05-06 | 1972-03-21 | Bell & Howell Co | Positive-mode photographic process and composition |
| US3503745A (en) * | 1963-05-06 | 1970-03-31 | Bell & Howell Co | Dye sensitization of light sensitive systems |
| US3275443A (en) * | 1963-08-14 | 1966-09-27 | Horizons Inc | Anti-fogging agents for an n-vinyl, organic halogen, dye former system |
| DE1214084B (de) * | 1963-09-28 | 1966-04-07 | Kalle Ag | Aufzeichnungsmaterial zur Herstellung von Bildern oder Flachdruckformen |
| US3268333A (en) * | 1963-12-30 | 1966-08-23 | Ibm | High gain dry photographic system |
| DE1447747A1 (de) * | 1964-12-10 | 1969-01-09 | Kalle Ag | Negativ arbeitendes Kopiermaterial |
| NL6516580A (forum.php) * | 1964-12-30 | 1966-07-01 | ||
| US3495987A (en) * | 1965-09-03 | 1970-02-17 | Du Pont | Photopolymerizable products |
| US3450532A (en) * | 1965-09-15 | 1969-06-17 | Horizons Inc | Process for increasing the opacity of a dye image and correcting said image for reproduction by a diazo process |
| DE1242449B (de) * | 1965-09-30 | 1967-06-15 | Kalle Ag | Lichtempfindliches Reproduktionsmaterial |
| US3443945A (en) * | 1965-10-22 | 1969-05-13 | Horizons Research Inc | Photosensitive color-forming composition |
| US3988159A (en) * | 1967-07-28 | 1976-10-26 | American Can Company | Light-sensitive material containing nitrone for forming heat-fixed images |
| US3879197A (en) * | 1969-09-03 | 1975-04-22 | Itek Corp | Electrophotographic copying process |
| US3816139A (en) * | 1970-04-13 | 1974-06-11 | Nashua Corp | Thermographic copy sheet containing phthalimide |
| US3970602A (en) * | 1973-03-19 | 1976-07-20 | Limburg William W | Copolymers of N-vinylcarbazole and N-vinylphthalimide and derivatives thereof |
| US3994728A (en) * | 1975-02-24 | 1976-11-30 | Horizons Incorporated, A Division Of Horizons Research Incorporated | Fog monitor |
| US4092164A (en) * | 1975-05-27 | 1978-05-30 | Horizons Incorporated A Division Of Horizons Research Incorporated | Reflectance probe |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2789053A (en) * | 1953-05-11 | 1957-04-16 | Ferro Corp | Photographic process using a light sensitive resin composition |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1658510A (en) * | 1926-03-15 | 1928-02-07 | Wadsworth Watch Case Co | Photogrpahic medium and process |
| DE664231C (de) * | 1934-07-25 | 1938-08-23 | I G Farbenindustrie Akt Ges | Verfahren zur Herstellung von Polyvinylverbindungen |
| US2276840A (en) * | 1939-07-18 | 1942-03-17 | Du Pont | Polymeric vinylimides |
-
0
- NL NL256340D patent/NL256340A/xx unknown
-
1959
- 1959-09-28 US US842569A patent/US3042517A/en not_active Expired - Lifetime
-
1960
- 1960-09-23 GB GB32826/60A patent/GB959034A/en not_active Expired
- 1960-09-27 DE DEH40531A patent/DE1175986B/de active Pending
-
1961
- 1961-07-25 FR FR868955A patent/FR1303075A/fr not_active Expired
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2789053A (en) * | 1953-05-11 | 1957-04-16 | Ferro Corp | Photographic process using a light sensitive resin composition |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1213736B (de) * | 1960-01-08 | 1966-03-31 | Horizons Inc | Lichtempfindliche Schicht zur Herstellung von photographischen Bildern |
| DE1289737B (de) * | 1965-01-30 | 1969-02-20 | Kalle Ag | Lichtempfindliche Schicht |
| DE1572137B1 (de) * | 1965-06-03 | 1970-09-24 | Du Pont | Fotopolymerisierbares Aufzeichnungsmaterial |
| DE1283093B (de) * | 1965-11-10 | 1968-11-14 | Kalle Ag | Lichtempfindliche Schicht |
| DE1298414B (de) * | 1967-11-09 | 1969-06-26 | Kalle Ag | Lichtempfindliches Gemisch |
Also Published As
| Publication number | Publication date |
|---|---|
| NL256340A (forum.php) | |
| GB959034A (en) | 1964-05-27 |
| US3042517A (en) | 1962-07-03 |
| FR1303075A (fr) | 1962-09-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1175986B (de) | Lichtempfindliche Schicht zur Herstellung photographischer Bilder | |
| DE1572203A1 (de) | Kopierblatt und Verfahren zur Herstellung desselben | |
| DE1258265B (de) | Lichtempfindliche photographische Schicht | |
| DE1268492B (de) | Lichtempfindliche Schicht | |
| DE1228142B (de) | Lichtempfindliches photographisches Kopiermaterial | |
| DE1199614B (de) | Filmmaterial fuer Farbenphotographie | |
| DE2049700A1 (de) | Silberfreies photographisches Auf zeichnungsmatenal | |
| DE2300344A1 (de) | Farbbildende trockenphotographische blaetter | |
| DE2440639A1 (de) | Fotografisches aufzeichnungsmaterial | |
| DE1597623C3 (de) | Verfahren zur Herstellung eines Bildes | |
| DE2226292C3 (de) | Verfahren zur Herstellung von Kopien | |
| DE1283092B (de) | Lichtempfindliche Schicht | |
| DE1243016B (de) | Photographisches Verfahren zur Herstellung von Bildern | |
| DE1772979B1 (de) | Photographisches Aufzeichnungsmaterial fuer das Vesicularverfahren | |
| AT225529B (de) | Lichtempfindliches Material | |
| DE2706532C3 (de) | Silberfreies, photolytisch Radikale bildendes lichtempfindliches Aufzeichnungsmaterial | |
| DE1447596A1 (de) | Photomaterial | |
| DE2425359C2 (de) | Lichtempfindliches Gemisch und dessen Verwendung für die Bilderzeugung auf trockenem Wege ohne Fixiervorgang | |
| DE1283093B (de) | Lichtempfindliche Schicht | |
| AT230194B (de) | Verfahren und Material zur Herstellung beständiger, färbiger photographischer Bilder | |
| DE1772979C (de) | Photographisches Aufzeichnungsmaterial für das Vesicularverfahren | |
| DE2155108A1 (de) | Lichtempfindliche Masse, Verfahren zur Herstellung eines lichtempfindlichen Materials und seine Verwendung | |
| DE1572081A1 (de) | Reprographisches Verfahren | |
| DE2219360A1 (de) | Trockenverfahren zur Erzeugung eines Bildes | |
| DE831803C (de) | Lichtempfindliche Schichten fuer die Diazotypie |