DE1145162B - Verfahren zur Herstellung von Carbaminsaeureestern - Google Patents
Verfahren zur Herstellung von CarbaminsaeureesternInfo
- Publication number
- DE1145162B DE1145162B DEF31711A DEF0031711A DE1145162B DE 1145162 B DE1145162 B DE 1145162B DE F31711 A DEF31711 A DE F31711A DE F0031711 A DEF0031711 A DE F0031711A DE 1145162 B DE1145162 B DE 1145162B
- Authority
- DE
- Germany
- Prior art keywords
- carbamic acid
- methyl
- dimethylamino
- acid esters
- dimethylaminophenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229940112021 centrally acting muscle relaxants carbamic acid ester Drugs 0.000 title claims description 4
- 238000000034 method Methods 0.000 title claims description 4
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 title claims description 4
- 238000004519 manufacturing process Methods 0.000 title description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 claims description 8
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 4
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 claims description 4
- AUABZJZJXPSZCN-UHFFFAOYSA-N 2-(dimethylamino)phenol Chemical class CN(C)C1=CC=CC=C1O AUABZJZJXPSZCN-UHFFFAOYSA-N 0.000 claims description 3
- SCWKRWCUMCMVPW-UHFFFAOYSA-N phenyl n-methylcarbamate Chemical compound CNC(=O)OC1=CC=CC=C1 SCWKRWCUMCMVPW-UHFFFAOYSA-N 0.000 claims description 3
- CJBMLIOCCUAUHX-UHFFFAOYSA-N [2-(dimethylamino)phenyl] carbonochloridate Chemical compound CN(C)C1=CC=CC=C1OC(Cl)=O CJBMLIOCCUAUHX-UHFFFAOYSA-N 0.000 claims description 2
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- GRRYSIXDUIAUGY-UHFFFAOYSA-N n-methylcarbamoyl chloride Chemical compound CNC(Cl)=O GRRYSIXDUIAUGY-UHFFFAOYSA-N 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims description 2
- DUWCIOMULCEXKQ-UHFFFAOYSA-N CN(C)C1=C(C=CC=C1)OC(OC1=C(C=CC=C1)N(C)C)=O Chemical compound CN(C)C1=C(C=CC=C1)OC(OC1=C(C=CC=C1)N(C)C)=O DUWCIOMULCEXKQ-UHFFFAOYSA-N 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 30
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- PBKONEOXTCPAFI-UHFFFAOYSA-N 1,2,4-trichlorobenzene Chemical compound ClC1=CC=C(Cl)C(Cl)=C1 PBKONEOXTCPAFI-UHFFFAOYSA-N 0.000 description 3
- ZQFUXWBKBSWKON-UHFFFAOYSA-N 3-(dimethylamino)-4-methylphenol Chemical compound CN(C)C1=CC(O)=CC=C1C ZQFUXWBKBSWKON-UHFFFAOYSA-N 0.000 description 3
- 241000500439 Plutella Species 0.000 description 3
- -1 dimethylaminophenyl ester Chemical class 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- 241001124076 Aphididae Species 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 241001454295 Tetranychidae Species 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 1
- SZBIKNXBDIVHKY-UHFFFAOYSA-N 4-(dimethylamino)-3-methylphenol Chemical compound CN(C)C1=CC=C(O)C=C1C SZBIKNXBDIVHKY-UHFFFAOYSA-N 0.000 description 1
- 241000255581 Drosophila <fruit fly, genus> Species 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- OHNQBQVDOMRFCJ-UHFFFAOYSA-N [3-(dimethylamino)phenyl]-methylcarbamic acid Chemical compound CN(C)C1=CC(=CC=C1)N(C)C(=O)O OHNQBQVDOMRFCJ-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- NQMRYBIKMRVZLB-UHFFFAOYSA-N methylamine hydrochloride Chemical compound [Cl-].[NH3+]C NQMRYBIKMRVZLB-UHFFFAOYSA-N 0.000 description 1
- UFEJKYYYVXYMMS-UHFFFAOYSA-N methylcarbamic acid Chemical compound CNC(O)=O UFEJKYYYVXYMMS-UHFFFAOYSA-N 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (15)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL285040D NL285040A (OSRAM) | 1960-07-20 | ||
| NL267254D NL267254A (OSRAM) | 1960-07-20 | ||
| BE606295D BE606295A (OSRAM) | 1960-07-20 | ||
| BE624305D BE624305A (OSRAM) | 1960-07-20 | ||
| FR82018D FR82018E (OSRAM) | 1960-07-20 | ||
| DEF31711A DE1145162B (de) | 1960-07-20 | 1960-07-20 | Verfahren zur Herstellung von Carbaminsaeureestern |
| CH806161A CH409919A (de) | 1960-07-20 | 1961-07-10 | Verfahren zur Herstellung von Carbaminsäureestern |
| US123621A US3134806A (en) | 1960-07-20 | 1961-07-13 | m-dimethylamino-p-methyl phenyl-n-methyl carbamate and p-dimethylamino m-methyl phenyl-n-methyl-carbamate |
| GB25692/61A GB913439A (en) | 1960-07-20 | 1961-07-14 | Carbamic acid esters |
| FR868419A FR1295700A (fr) | 1960-07-20 | 1961-07-19 | Procédé de fabrication d'esters de l'acide carbamique |
| DEF35278A DE1162353B (de) | 1960-07-20 | 1961-11-03 | Verfahren zur Herstellung von Carbaminsaeureestern |
| CH1268762A CH453332A (de) | 1960-07-20 | 1962-10-29 | Verfahren zur Herstellung von Carbaminsäureestern |
| BR144314/62A BR6244314D0 (pt) | 1960-07-20 | 1962-10-31 | Aperfeicoamento em processo para produzir esteres do acido carbamico e composicoes praguicidas contendo as mesmas |
| GB41546/62A GB956661A (en) | 1960-07-20 | 1962-11-02 | Carbamic acid esters |
| FR914245A FR91112E (fr) | 1960-07-20 | 1962-11-02 | Procédé de fabrication d'esters de l'acide carbamique |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF31711A DE1145162B (de) | 1960-07-20 | 1960-07-20 | Verfahren zur Herstellung von Carbaminsaeureestern |
| DEF35278A DE1162353B (de) | 1960-07-20 | 1961-11-03 | Verfahren zur Herstellung von Carbaminsaeureestern |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1145162B true DE1145162B (de) | 1963-03-14 |
Family
ID=25974733
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF31711A Pending DE1145162B (de) | 1960-07-20 | 1960-07-20 | Verfahren zur Herstellung von Carbaminsaeureestern |
| DEF35278A Pending DE1162353B (de) | 1960-07-20 | 1961-11-03 | Verfahren zur Herstellung von Carbaminsaeureestern |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF35278A Pending DE1162353B (de) | 1960-07-20 | 1961-11-03 | Verfahren zur Herstellung von Carbaminsaeureestern |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3134806A (OSRAM) |
| BE (2) | BE624305A (OSRAM) |
| BR (1) | BR6244314D0 (OSRAM) |
| CH (2) | CH409919A (OSRAM) |
| DE (2) | DE1145162B (OSRAM) |
| FR (1) | FR82018E (OSRAM) |
| GB (2) | GB913439A (OSRAM) |
| NL (2) | NL267254A (OSRAM) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2618632A1 (de) | 1975-05-02 | 1976-11-11 | Montedison Spa | Insekticid wirksame carbamate von n-(polychlorallyl)-amino-phenolen |
| US4113876A (en) | 1974-07-16 | 1978-09-12 | Bayer Aktiengesellschaft | Sulfonic acid-n-methylamido-n-sulfenyl-n-methyl-carbamic acid esters |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL6408165A (OSRAM) * | 1964-07-17 | 1966-01-18 | ||
| IT1051034B (it) * | 1975-12-03 | 1981-04-21 | Snam Progetti | Procedimento per la preparazione di uretani aromatici |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA446303A (en) * | 1948-01-20 | H. Beutel Ralph | Therapeutic substance | |
| US3060225A (en) * | 1959-11-04 | 1962-10-23 | Dow Chemical Co | Aminophenyl carbamates |
| US3053895A (en) * | 1959-11-04 | 1962-09-11 | Dow Chemical Co | Unsymmetrical dialkylaminophenols |
-
0
- NL NL285040D patent/NL285040A/xx unknown
- BE BE606295D patent/BE606295A/xx unknown
- FR FR82018D patent/FR82018E/fr not_active Expired
- NL NL267254D patent/NL267254A/xx unknown
- BE BE624305D patent/BE624305A/xx unknown
-
1960
- 1960-07-20 DE DEF31711A patent/DE1145162B/de active Pending
-
1961
- 1961-07-10 CH CH806161A patent/CH409919A/de unknown
- 1961-07-13 US US123621A patent/US3134806A/en not_active Expired - Lifetime
- 1961-07-14 GB GB25692/61A patent/GB913439A/en not_active Expired
- 1961-11-03 DE DEF35278A patent/DE1162353B/de active Pending
-
1962
- 1962-10-29 CH CH1268762A patent/CH453332A/de unknown
- 1962-10-31 BR BR144314/62A patent/BR6244314D0/pt unknown
- 1962-11-02 GB GB41546/62A patent/GB956661A/en not_active Expired
Non-Patent Citations (1)
| Title |
|---|
| None * |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4113876A (en) | 1974-07-16 | 1978-09-12 | Bayer Aktiengesellschaft | Sulfonic acid-n-methylamido-n-sulfenyl-n-methyl-carbamic acid esters |
| DE2618632A1 (de) | 1975-05-02 | 1976-11-11 | Montedison Spa | Insekticid wirksame carbamate von n-(polychlorallyl)-amino-phenolen |
Also Published As
| Publication number | Publication date |
|---|---|
| FR82018E (OSRAM) | 1964-03-16 |
| BR6244314D0 (pt) | 1973-05-10 |
| GB913439A (en) | 1962-12-19 |
| NL285040A (OSRAM) | |
| CH409919A (de) | 1966-03-31 |
| GB956661A (en) | 1964-04-29 |
| NL267254A (OSRAM) | |
| CH453332A (de) | 1968-06-14 |
| US3134806A (en) | 1964-05-26 |
| DE1162353B (de) | 1964-02-06 |
| BE624305A (OSRAM) | |
| BE606295A (OSRAM) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1162352B (de) | Verfahren zur Herstellung von Carbaminsaeureestern | |
| CH411849A (de) | Verfahren zur Herstellung von Hydrindensulfonylharnstoffen | |
| DE1145162B (de) | Verfahren zur Herstellung von Carbaminsaeureestern | |
| DE1240866B (de) | Verfahren zur Herstellung von Indolin-6-sulfonylharnstoffen | |
| DE1249261B (de) | Verfahren zur Herstellung von Indanyl-N-methylcarbaminsäureestern | |
| DE1057124B (de) | Verfahren zur Herstellung von Sydnonen | |
| DE1147573B (de) | Verfahren zur Herstellung von Aminomethylenverbindungen | |
| DE1095806B (de) | Verfahren zur Herstellung von Derivaten der N-Fluorsulfonylcarbamidsaeure | |
| AT234715B (de) | Verfahren zur Herstellung von neuen Carbaminsäureestern | |
| DE1119852B (de) | Verfahren zur Herstellung von Chlorameisensaeureamidinchloriden | |
| DE3022783A1 (de) | Verfahren zur herstellung von 4-acylamido-2-nitro-1-alkoxybenzol-verbindungen | |
| AT230896B (de) | Verfahren zur Herstellung von neuen Carbaminsäureestern | |
| AT203014B (de) | Verfahren zur Herstellung von neuen bis-Sulfonylharnstoffen | |
| DE830792C (de) | Verfahren zur Herstellung von Acylaminoacetessigestern | |
| DE1132140B (de) | Verfahren zur Herstellung von Nitrodiaminobenzolen | |
| DE960098C (de) | Verfahren zur Herstellung von 2-Benzolsulfonamido-4-methyl-6-oxy-pyrimidinen | |
| AT236980B (de) | Verfahren zur Herstellung von neuen, beispielsweise zur Schädlingsbekämpfung verwendbaren Carbaminsäureestern | |
| DE963058C (de) | Verfahren zur Herstellung von Harnstoffgruppen enthaltenden Sulfonamiden | |
| AT233584B (de) | Verfahren zur Herstellung von neuen Hydrindensulfonylharnstoffen | |
| DE947167C (de) | Verfahren zur Herstellung von 1-Aminobenzophenonsulfon-2-carbonsaeuren bzw. deren Estern | |
| DE879550C (de) | Verfahren zur Herstellung von Diphenylsulfonabkoemmlingen | |
| DE1020636B (de) | Verfahren zur Herstellung von 3-Phenyl-7-acylamino-cumarinen | |
| AT220626B (de) | Verfahren zur Herstellung neuer Benzolsulfonylharnstoffe | |
| DE1028114B (de) | Verfahren zur Herstellung von Sulfonylharnstoffen | |
| DE1962154A1 (de) | Basisch substituierte Cumarinderivate |