DE1107356B - Verfahren zur Herstellung von wasserloeslichen Azofarbstoffen - Google Patents
Verfahren zur Herstellung von wasserloeslichen AzofarbstoffenInfo
- Publication number
- DE1107356B DE1107356B DEB50679A DEB0050679A DE1107356B DE 1107356 B DE1107356 B DE 1107356B DE B50679 A DEB50679 A DE B50679A DE B0050679 A DEB0050679 A DE B0050679A DE 1107356 B DE1107356 B DE 1107356B
- Authority
- DE
- Germany
- Prior art keywords
- parts
- water
- dye
- acid
- solution
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000987 azo dye Substances 0.000 title claims description 13
- 238000000034 method Methods 0.000 title claims description 7
- 238000004519 manufacturing process Methods 0.000 title description 2
- 239000002253 acid Substances 0.000 claims description 25
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims description 18
- 238000006193 diazotization reaction Methods 0.000 claims description 17
- 230000008878 coupling Effects 0.000 claims description 14
- 238000010168 coupling process Methods 0.000 claims description 14
- 238000005859 coupling reaction Methods 0.000 claims description 14
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 4
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 claims description 4
- 239000002243 precursor Substances 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 238000004040 coloring Methods 0.000 claims 1
- 239000000975 dye Substances 0.000 description 86
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 57
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 50
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 34
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 34
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 32
- 210000002268 wool Anatomy 0.000 description 27
- 229920000742 Cotton Polymers 0.000 description 22
- 239000000203 mixture Substances 0.000 description 19
- 235000011121 sodium hydroxide Nutrition 0.000 description 19
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 18
- 239000011780 sodium chloride Substances 0.000 description 17
- 229910000029 sodium carbonate Inorganic materials 0.000 description 15
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- 150000001989 diazonium salts Chemical class 0.000 description 9
- 235000010288 sodium nitrite Nutrition 0.000 description 9
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 7
- 238000004043 dyeing Methods 0.000 description 7
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 6
- -1 amino compound Chemical class 0.000 description 6
- HGWQOFDAUWCQDA-UHFFFAOYSA-N 4-hydroxynaphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(O)=CC=C(S(O)(=O)=O)C2=C1 HGWQOFDAUWCQDA-UHFFFAOYSA-N 0.000 description 5
- 206010039587 Scarlet Fever Diseases 0.000 description 5
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 5
- KFOZNPPBKHYHQD-UHFFFAOYSA-N ethenesulfonyl chloride Chemical compound ClS(=O)(=O)C=C KFOZNPPBKHYHQD-UHFFFAOYSA-N 0.000 description 5
- 239000004744 fabric Substances 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- DFPAKSUCGFBDDF-UHFFFAOYSA-N Nicotinamide Chemical group NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 description 4
- 239000007900 aqueous suspension Substances 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- VSANMHWDSONVEE-UHFFFAOYSA-N carbyl sulfate Chemical compound O=S1(=O)CCOS(=O)(=O)O1 VSANMHWDSONVEE-UHFFFAOYSA-N 0.000 description 3
- 150000008049 diazo compounds Chemical class 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 2
- LJGHYPLBDBRCRZ-UHFFFAOYSA-N 3-(3-aminophenyl)sulfonylaniline Chemical group NC1=CC=CC(S(=O)(=O)C=2C=C(N)C=CC=2)=C1 LJGHYPLBDBRCRZ-UHFFFAOYSA-N 0.000 description 2
- MCSXGCZMEPXKIW-UHFFFAOYSA-N 3-hydroxy-4-[(4-methyl-2-nitrophenyl)diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide Chemical compound Cc1ccc(N=Nc2c(O)c(cc3ccccc23)C(=O)Nc2cccc(c2)[N+]([O-])=O)c(c1)[N+]([O-])=O MCSXGCZMEPXKIW-UHFFFAOYSA-N 0.000 description 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 150000004982 aromatic amines Chemical class 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 239000001110 calcium chloride Substances 0.000 description 2
- 229910001628 calcium chloride Inorganic materials 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 2
- AFOSIXZFDONLBT-UHFFFAOYSA-N divinyl sulfone Chemical group C=CS(=O)(=O)C=C AFOSIXZFDONLBT-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000000542 sulfonic acid group Chemical group 0.000 description 2
- NLVXSWCKKBEXTG-UHFFFAOYSA-N vinylsulfonic acid Chemical compound OS(=O)(=O)C=C NLVXSWCKKBEXTG-UHFFFAOYSA-N 0.000 description 2
- ZYECOAILUNWEAL-NUDFZHEQSA-N (4z)-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]hydrazinylidene]-n-(3-nitrophenyl)-3-oxonaphthalene-2-carboxamide Chemical compound COC1=CC=C(C(=O)NC=2C=CC=CC=2)C=C1N\N=C(C1=CC=CC=C1C=1)/C(=O)C=1C(=O)NC1=CC=CC([N+]([O-])=O)=C1 ZYECOAILUNWEAL-NUDFZHEQSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- UONVFNLDGRWLKF-UHFFFAOYSA-N 2,5-diaminobenzoic acid Chemical compound NC1=CC=C(N)C(C(O)=O)=C1 UONVFNLDGRWLKF-UHFFFAOYSA-N 0.000 description 1
- LTASFWDWBYFZQQ-UHFFFAOYSA-N 2-amino-5-nitrobenzenesulfonic acid Chemical compound NC1=CC=C([N+]([O-])=O)C=C1S(O)(=O)=O LTASFWDWBYFZQQ-UHFFFAOYSA-N 0.000 description 1
- MGLZGLAFFOMWPB-UHFFFAOYSA-N 2-chloro-1,4-phenylenediamine Chemical compound NC1=CC=C(N)C(Cl)=C1 MGLZGLAFFOMWPB-UHFFFAOYSA-N 0.000 description 1
- NHLAPJMCARJFOG-UHFFFAOYSA-N 3-methyl-1,4-dihydropyrazol-5-one Chemical compound CC1=NNC(=O)C1 NHLAPJMCARJFOG-UHFFFAOYSA-N 0.000 description 1
- BOFVBIYTBGDQGY-UHFFFAOYSA-N 4-(4-nitrophenyl)aniline Chemical group C1=CC(N)=CC=C1C1=CC=C([N+]([O-])=O)C=C1 BOFVBIYTBGDQGY-UHFFFAOYSA-N 0.000 description 1
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 1
- TZBROGJRQUABOK-UHFFFAOYSA-N 4-hydroxynaphthalene-2,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC=C2C(O)=CC(S(O)(=O)=O)=CC2=C1 TZBROGJRQUABOK-UHFFFAOYSA-N 0.000 description 1
- VVPHSMHEYVOVLH-UHFFFAOYSA-N 6-hydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=CC2=CC(O)=CC=C21 VVPHSMHEYVOVLH-UHFFFAOYSA-N 0.000 description 1
- JJQNWTGYQREOAW-UHFFFAOYSA-N 8-hydroxyquinoline-4-sulfonic acid Chemical compound C1=CN=C2C(O)=CC=CC2=C1S(O)(=O)=O JJQNWTGYQREOAW-UHFFFAOYSA-N 0.000 description 1
- FXLHICBMTFOJIE-UHFFFAOYSA-N CC(C=CC(O)=C1)=C1NS(C=C)(=O)=O Chemical compound CC(C=CC(O)=C1)=C1NS(C=C)(=O)=O FXLHICBMTFOJIE-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000005392 carboxamide group Chemical group NC(=O)* 0.000 description 1
- 238000010411 cooking Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- ZZTCPWRAHWXWCH-UHFFFAOYSA-N diphenylmethanediamine Chemical compound C=1C=CC=CC=1C(N)(N)C1=CC=CC=C1 ZZTCPWRAHWXWCH-UHFFFAOYSA-N 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- CHMBIJAOCISYEW-UHFFFAOYSA-N n-(4-aminophenyl)acetamide Chemical compound CC(=O)NC1=CC=C(N)C=C1 CHMBIJAOCISYEW-UHFFFAOYSA-N 0.000 description 1
- NTNWKDHZTDQSST-UHFFFAOYSA-N naphthalene-1,2-diamine Chemical class C1=CC=CC2=C(N)C(N)=CC=C21 NTNWKDHZTDQSST-UHFFFAOYSA-N 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 229950000244 sulfanilic acid Drugs 0.000 description 1
- 125000001174 sulfone group Chemical group 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/44—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring
- C09B62/523—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring the reactive group being an esterified or non-esterified hydroxyalkyl sulfonyl amido or hydroxyalkyl amino sulfonyl group, a quaternised or non-quaternised amino alkyl sulfonyl amido group, or a substituted alkyl amino sulfonyl group, or a halogen alkyl sulfonyl amido or halogen alkyl amino sulfonyl group or a vinyl sulfonylamido or a substituted vinyl sulfonamido group
- C09B62/527—Azo dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL244175D NL244175A (OSRAM) | 1958-10-10 | ||
| BE583430D BE583430A (OSRAM) | 1958-10-10 | ||
| DEB50679A DE1107356B (de) | 1958-10-10 | 1958-10-10 | Verfahren zur Herstellung von wasserloeslichen Azofarbstoffen |
| CH7731459A CH397114A (de) | 1958-10-10 | 1959-08-24 | Verfahren zur Herstellung von wasserlöslichen Azofarbstoffen |
| GB3424159A GB875946A (en) | 1958-10-10 | 1959-10-09 | Water-soluble azo dyestuffs containing ethene sulphonic acid amide groups |
| FR807212A FR1241327A (fr) | 1958-10-10 | 1959-10-10 | Colorants azoïques solubles dans l'eau |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEB50679A DE1107356B (de) | 1958-10-10 | 1958-10-10 | Verfahren zur Herstellung von wasserloeslichen Azofarbstoffen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1107356B true DE1107356B (de) | 1961-05-25 |
Family
ID=6969282
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEB50679A Pending DE1107356B (de) | 1958-10-10 | 1958-10-10 | Verfahren zur Herstellung von wasserloeslichen Azofarbstoffen |
Country Status (6)
| Country | Link |
|---|---|
| BE (1) | BE583430A (OSRAM) |
| CH (1) | CH397114A (OSRAM) |
| DE (1) | DE1107356B (OSRAM) |
| FR (1) | FR1241327A (OSRAM) |
| GB (1) | GB875946A (OSRAM) |
| NL (1) | NL244175A (OSRAM) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1229213B (de) | 1961-08-26 | 1966-11-24 | Hoechst Ag | Verfahren zur Herstellung metallhaltiger Azofarbstoffe |
| DE1262475B (de) * | 1962-02-08 | 1968-03-07 | Hoechst Ag | Verfahren zur Herstellung von organischen Farbstoffen |
| DE1289207B (de) | 1962-10-26 | 1969-02-13 | Hoechst Ag | Verfahren zur Herstellung von wasserloeslichen Azofarbstoffen |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1235257B (de) * | 1961-02-24 | 1967-03-02 | Hoechst Ag | Verfahren zum Faerben oder Bedrucken von cellulosehaltigen Materialien faseriger Struktur |
| DE1289929B (de) * | 1963-06-10 | 1969-02-27 | Hoechst Ag | Verfahren zur Herstellung von faserreaktiven organischen Farbstoffen |
| DE1544500B2 (de) * | 1964-12-12 | 1973-08-16 | Metallhaltige disazoreaktivfarbstoffe und verfahren zu deren herstellung | |
| DE3902371A1 (de) * | 1989-01-27 | 1990-08-02 | Hoechst Ag | Wasserloesliche disazoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE925121C (de) * | 1952-02-20 | 1955-03-14 | Hoechst Ag | Verfahren zur Herstellung von Azofarbstoffen der Pyrazolon- und Pyrazolreihe |
| DE960534C (de) * | 1950-01-09 | 1957-03-21 | Hoechst Ag | Verfahren zur Herstellung echter Faerbungen und Drucke |
-
0
- BE BE583430D patent/BE583430A/xx unknown
- NL NL244175D patent/NL244175A/xx unknown
-
1958
- 1958-10-10 DE DEB50679A patent/DE1107356B/de active Pending
-
1959
- 1959-08-24 CH CH7731459A patent/CH397114A/de unknown
- 1959-10-09 GB GB3424159A patent/GB875946A/en not_active Expired
- 1959-10-10 FR FR807212A patent/FR1241327A/fr not_active Expired
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE960534C (de) * | 1950-01-09 | 1957-03-21 | Hoechst Ag | Verfahren zur Herstellung echter Faerbungen und Drucke |
| DE925121C (de) * | 1952-02-20 | 1955-03-14 | Hoechst Ag | Verfahren zur Herstellung von Azofarbstoffen der Pyrazolon- und Pyrazolreihe |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1229213B (de) | 1961-08-26 | 1966-11-24 | Hoechst Ag | Verfahren zur Herstellung metallhaltiger Azofarbstoffe |
| DE1262475B (de) * | 1962-02-08 | 1968-03-07 | Hoechst Ag | Verfahren zur Herstellung von organischen Farbstoffen |
| DE1289207B (de) | 1962-10-26 | 1969-02-13 | Hoechst Ag | Verfahren zur Herstellung von wasserloeslichen Azofarbstoffen |
Also Published As
| Publication number | Publication date |
|---|---|
| FR1241327A (fr) | 1960-09-16 |
| BE583430A (OSRAM) | |
| NL244175A (OSRAM) | |
| CH397114A (de) | 1965-08-15 |
| GB875946A (en) | 1961-08-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH471877A (de) | Verfahren zur Herstellung von wasserlöslichen Azofarbstoffen oder deren Metallkomplexverbindungen | |
| DE1923680B2 (de) | Disazofarbstoffe und ihre verwendung zum faerben und bedrucken von natuerlichen und synthetischen fasermaterialien | |
| DE1107356B (de) | Verfahren zur Herstellung von wasserloeslichen Azofarbstoffen | |
| DE2531445C3 (de) | Sulfogruppenfreie wasserlösliche Azofarbstoffe und deren Verwendung zum Färben und/oder Bedrucken von synthetischen Textilfasern | |
| EP0027887B1 (de) | Azofarbstoffe, deren Herstellung und Verwendung zum Färben von Synthesefasern | |
| DE1230152B (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| DE2154942B2 (de) | Faserreaktive Monoazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben oder Bedrucken von nativen oder regenerierten Cellulosefasern, natürlichen oder synthetischen Polyamidfasern oder von Polyurethanfasern | |
| AT214547B (de) | Verfahren zur Herstellung von neuen Azofarbstoffen | |
| DE1957115C3 (de) | Bis-azoverbindungen und ihre Verwendung als Farbstoffe für Polyamidfasern | |
| DE2126143C3 (de) | Wasserlösliche Monoazofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben oder Bedrucken | |
| DE2716503A1 (de) | Azofarbstoff-zwischenprodukt | |
| AT220741B (de) | Verfahren zur Herstellung neuer wasserlöslicher Azofarbstoffe | |
| DE879272C (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| DE2161698C3 (de) | Wasserlösliche, faserreaktive Azofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben oder Bedrucken von Leder, Wolle, Seide, Polyamidfasern, Polyurethanfasern, nativen oder regenerierten Cellulosefasern | |
| DE964975C (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| DE2065646C3 (de) | 1 zu 1-Kupferkomplexverbindungen von Monoazofarbstoffe^ Verfahren zu ihrer Herstellung und ihre Verwendung zum Färben oder Bedrucken von Leder oder Fasern aus Wolle, Seide, Polyamiden und/oder regenerierter Cellulose | |
| DE1066302B (de) | Verfahren zur Herstellung von Monoazofarbstoffe^ | |
| DE1644087C3 (de) | Verfahren zur Herstellung wasserlöslicher organischer Reaktivfarbstoffe | |
| DE812809C (de) | Verfahren zur Herstellung von sauren Disazofarbstoffen | |
| SU1022968A1 (ru) | Фенилимиды 1,4,5,6,7,7-гексахлорбицикло- (2,2,1) -5-гептен-2,3-дикарбоновой кислоты в качестве азокрасител дл придани белковым волокнистым материалам нар ду с окраской огне- и биостойкости | |
| DE318997C (de) | Verfahren zur Herstellung von beizenfaerbenden Leukotriarylmethanazofarbstoffen | |
| DE2107427C2 (de) | Monoazoverbindungen, deren Herstellung und Verwendung | |
| AT227852B (de) | Verfahren zur Herstellung neuer wasserunlöslicher Monoazofarbstoffe | |
| AT162592B (de) | Verfahren zur Herstellung von neuen Disazofarbstoffen | |
| DE2514856B2 (de) | Wasserloesliche disazofarbstoffe, verfahren zu ihrer herstellung und ihre verwendung zum faerben oder bedrucken von nativen und/oder synthetischen stickstoffhaltigen fasermaterialien |