DE1106429B - Roentgenroehren-Drehanode - Google Patents
Roentgenroehren-DrehanodeInfo
- Publication number
- DE1106429B DE1106429B DEC14417A DEC0014417A DE1106429B DE 1106429 B DE1106429 B DE 1106429B DE C14417 A DEC14417 A DE C14417A DE C0014417 A DEC0014417 A DE C0014417A DE 1106429 B DE1106429 B DE 1106429B
- Authority
- DE
- Germany
- Prior art keywords
- rhenium
- layer
- anode
- temperature
- surface layer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229910052702 rhenium Inorganic materials 0.000 claims description 24
- WUAPFZMCVAUBPE-UHFFFAOYSA-N rhenium atom Chemical compound [Re] WUAPFZMCVAUBPE-UHFFFAOYSA-N 0.000 claims description 24
- 239000000463 material Substances 0.000 claims description 11
- 239000002344 surface layer Substances 0.000 claims description 9
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 9
- 229910052721 tungsten Inorganic materials 0.000 claims description 9
- 239000010937 tungsten Substances 0.000 claims description 9
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- 229910052750 molybdenum Inorganic materials 0.000 claims description 3
- 239000011733 molybdenum Substances 0.000 claims description 3
- 230000005855 radiation Effects 0.000 claims description 3
- 230000002349 favourable effect Effects 0.000 claims description 2
- 238000005338 heat storage Methods 0.000 claims description 2
- 239000010410 layer Substances 0.000 claims 11
- 238000000034 method Methods 0.000 claims 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 4
- 229910052739 hydrogen Inorganic materials 0.000 claims 4
- 239000001257 hydrogen Substances 0.000 claims 4
- QSHYGLAZPRJAEZ-UHFFFAOYSA-N 4-(chloromethyl)-2-(2-methylphenyl)-1,3-thiazole Chemical compound CC1=CC=CC=C1C1=NC(CCl)=CS1 QSHYGLAZPRJAEZ-UHFFFAOYSA-N 0.000 claims 2
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims 2
- 229910052796 boron Inorganic materials 0.000 claims 2
- 239000007788 liquid Substances 0.000 claims 2
- 238000004519 manufacturing process Methods 0.000 claims 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims 2
- 239000002244 precipitate Substances 0.000 claims 2
- 239000000758 substrate Substances 0.000 claims 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- 239000000853 adhesive Substances 0.000 claims 1
- 230000001070 adhesive effect Effects 0.000 claims 1
- OKTJSMMVPCPJKN-YPZZEJLDSA-N carbon-10 atom Chemical compound [10C] OKTJSMMVPCPJKN-YPZZEJLDSA-N 0.000 claims 1
- 230000001427 coherent effect Effects 0.000 claims 1
- 230000008021 deposition Effects 0.000 claims 1
- 238000005868 electrolysis reaction Methods 0.000 claims 1
- 238000005516 engineering process Methods 0.000 claims 1
- 229910002804 graphite Inorganic materials 0.000 claims 1
- 239000010439 graphite Substances 0.000 claims 1
- 150000004820 halides Chemical class 0.000 claims 1
- 239000011261 inert gas Substances 0.000 claims 1
- 229910052697 platinum Inorganic materials 0.000 claims 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 claims 1
- 230000002787 reinforcement Effects 0.000 claims 1
- 238000005245 sintering Methods 0.000 claims 1
- 239000011343 solid material Substances 0.000 claims 1
- 238000005507 spraying Methods 0.000 claims 1
- 210000002268 wool Anatomy 0.000 claims 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 230000032683 aging Effects 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 230000035882 stress Effects 0.000 description 1
- 230000025594 tube development Effects 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J35/00—X-ray tubes
- H01J35/02—Details
- H01J35/04—Electrodes ; Mutual position thereof; Constructional adaptations therefor
- H01J35/08—Anodes; Anti cathodes
- H01J35/10—Rotary anodes; Arrangements for rotating anodes; Cooling rotary anodes
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J2235/00—X-ray tubes
- H01J2235/08—Targets (anodes) and X-ray converters
- H01J2235/083—Bonding or fixing with the support or substrate
- H01J2235/084—Target-substrate interlayers or structures, e.g. to control or prevent diffusion or improve adhesion
Landscapes
- X-Ray Techniques (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR1148708T | 1956-03-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1106429B true DE1106429B (de) | 1961-05-10 |
Family
ID=9623945
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEC14417A Pending DE1106429B (de) | 1956-03-30 | 1957-02-20 | Roentgenroehren-Drehanode |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US2863083A (enExample) |
| CH (1) | CH353087A (enExample) |
| DE (1) | DE1106429B (enExample) |
| FR (1) | FR1148708A (enExample) |
| GB (1) | GB852734A (enExample) |
| NL (2) | NL215843A (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1764042B1 (de) * | 1968-03-26 | 1971-05-27 | Koch & Sterzel Kg | Roentgenroehren drehanode mit anodenkoerper aus graphit |
| AT392760B (de) * | 1989-05-26 | 1991-06-10 | Plansee Metallwerk | Verbundkoerper aus graphit und hochschmelzendem metall |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR93507E (fr) * | 1956-03-30 | 1969-04-11 | Radiologie Cie Gle | Perfectionnements aux anodes de tubes a décharge et en particulier aux anodes de tubes radiogenes. |
| NL122291C (enExample) * | 1959-10-12 | |||
| DE1270192B (de) * | 1960-07-30 | 1968-06-12 | Siemens Ag | Drehanoden-Verbundteller fuer Roentgenroehren |
| US3136907A (en) * | 1961-01-05 | 1964-06-09 | Plansee Metallwerk | Anticathodes for X-ray tubes |
| FR1363155A (fr) * | 1963-01-30 | 1964-06-12 | Tubix Sa | Anode tournante pour tubes à rayons x |
| NL136230C (enExample) * | 1963-09-02 | |||
| DE1458475B2 (de) * | 1964-02-26 | 1972-06-22 | Siemens AG, 1000 Berlin u 8000 München | Verwendung einer wolframlegierung fuer die dreh- bzw.stehanode einer roentgenroehre |
| JPS516517B1 (enExample) * | 1966-10-11 | 1976-02-28 | ||
| AT278184B (de) * | 1967-08-28 | 1970-01-26 | Plansee Metallwerk | Drehanode für Röntgenröhren |
| AT284978B (de) * | 1968-12-02 | 1970-10-12 | Plansee Metallwerk | Anode für Röntgenröhren |
| CH494520A (de) * | 1968-12-16 | 1970-07-31 | Siemens Ag | Röntgengerät |
| US3622824A (en) * | 1969-06-30 | 1971-11-23 | Picker Corp | Composite x-ray tube target |
| AT300971B (de) * | 1970-03-25 | 1972-08-10 | Metallwerk Plansee Ag & Co Kom | Drehanoden-Verbundteller für Röntgenröhren |
| US3631290A (en) * | 1970-08-17 | 1971-12-28 | Ibm | Thermionic cathode for electron beam apparatus |
| US3696977A (en) * | 1971-04-21 | 1972-10-10 | Johnson & Son Inc S C | Stretch elastomer valve |
| DE2201979C3 (de) * | 1972-01-17 | 1979-05-03 | Siemens Ag, 1000 Berlin Und 8000 Muenchen | Verfahren zur Herstellung einer geschwärzten Schicht auf Drehanoden von Röntgenröhren |
| DE2212058A1 (de) * | 1972-03-13 | 1973-09-20 | Siemens Ag | Drehanode fuer roentgenroehren |
| US3887723A (en) * | 1972-03-22 | 1975-06-03 | Richard B Kaplan | Method of fabrication of composite anode for rotating-anode x-ray tubes |
| DE2251656C3 (de) * | 1972-10-20 | 1979-04-19 | Siemens Ag, 1000 Berlin Und 8000 Muenchen | Verfahren zur Herstellung einer Röntgenröhren-Drehanode |
| NL158967B (nl) * | 1972-12-07 | 1978-12-15 | Philips Nv | Werkwijze voor de vervaardiging van een gelaagde roentgendraaianode, alsmede aldus verkregen gelaagde roentgendraaianode. |
| DE2430226A1 (de) * | 1974-06-24 | 1976-01-15 | Siemens Ag | Drehanode fuer roentgenroehren |
| DE2618235C3 (de) * | 1976-04-26 | 1983-01-13 | Siemens AG, 1000 Berlin und 8000 München | Röntgenröhren-Drehanode |
| US4227112A (en) * | 1978-11-20 | 1980-10-07 | The Machlett Laboratories, Inc. | Gradated target for X-ray tubes |
| US4335327A (en) * | 1978-12-04 | 1982-06-15 | The Machlett Laboratories, Incorporated | X-Ray tube target having pyrolytic amorphous carbon coating |
| DE2929136A1 (de) * | 1979-07-19 | 1981-02-05 | Philips Patentverwaltung | Drehanode fuer roentgenroehren |
| JP2955605B2 (ja) * | 1991-05-17 | 1999-10-04 | 東京タングステン株式会社 | X線管用回転陽極及びその製造方法 |
| DE69514221T2 (de) | 1994-03-28 | 2000-05-11 | Hitachi Medical Corp., Tokio/Tokyo | Röntgenröhre und anodentarget dafür |
| US7090893B1 (en) | 2003-03-24 | 2006-08-15 | The United States Of America As Represented By The Secretary Of The Navy | Rhenium composite |
| US7214306B1 (en) * | 2004-04-16 | 2007-05-08 | The United States Of America As Represented By The Secretary Of The Navy | Elevated potential deposition of rhenium on graphite substrates from a ReO2/H2O2 solution |
| US20070207338A1 (en) * | 2006-03-01 | 2007-09-06 | Plasma Processes, Inc. | X-ray target and method for manufacturing same |
| US20090086920A1 (en) * | 2007-09-30 | 2009-04-02 | Lee David S K | X-ray Target Manufactured Using Electroforming Process |
| WO2010070574A1 (en) | 2008-12-17 | 2010-06-24 | Koninklijke Philips Electronics N.V. | Attachment of a high-z focal track layer to a carbon-carbon composite substrate serving as a rotary anode target |
| AT14991U1 (de) * | 2015-05-08 | 2016-10-15 | Plansee Se | Röntgenanode |
| CN117364052B (zh) * | 2023-10-13 | 2024-03-12 | 贵研铂业股份有限公司 | 一种高发射率铼涂层及其制备方法 |
Citations (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR863681A (fr) * | 1939-03-06 | 1941-04-07 | Thomson Houston Comp Francaise | Générateurs de rayons x |
| US2243250A (en) * | 1940-11-22 | 1941-05-27 | Argus Mfg Corp | Electrical discharge device and anode therefor |
| CH231981A (de) * | 1940-12-02 | 1944-04-30 | C H F Mueller Aktiengesellscha | Röntgenröhre mit Drehanode. |
| FR942318A (fr) * | 1942-03-28 | 1949-02-04 | Thomson Houston Comp Francaise | Perfectionnements aux tubes à rayons chi |
| AT163155B (de) * | 1942-11-25 | 1949-05-25 | Philips Nv | Scheibenförmige Anode für Röntgenröhren |
| DE744208C (de) * | 1940-11-15 | 1952-06-09 | Telefunken Gmbh | Hochbelastbare Anode fuer elektrische Entladungsroehren, insbesondere solche ohne kuenstliche Kuehlung |
| DE844029C (de) * | 1941-03-15 | 1952-07-14 | Telefunken Gmbh | Nicht als Gluehkathode dienende Elektrode fuer ein elektrisches Entladungsgefaess |
| DE896234C (de) * | 1943-04-22 | 1953-11-09 | Peter Dr Kniepen | Roentgenroehre |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2490246A (en) * | 1945-11-13 | 1949-12-06 | Gen Electric X Ray Corp | Anode construction |
| US2482053A (en) * | 1945-11-13 | 1949-09-13 | Gen Electric X Ray Corp | Anode construction |
| US2762726A (en) * | 1952-03-14 | 1956-09-11 | Pittsburgh Plate Glass Co | Method of producing a metal film on a refractory base |
| US2762725A (en) * | 1952-03-14 | 1956-09-11 | Pittsburgh Plate Glass Co | Method of producing a metal film on a refractory base having a metal oxide film thereon |
-
0
- NL NL104093D patent/NL104093C/xx active
- NL NL215843D patent/NL215843A/xx unknown
-
1956
- 1956-03-30 FR FR1148708D patent/FR1148708A/fr not_active Expired
-
1957
- 1957-02-20 DE DEC14417A patent/DE1106429B/de active Pending
- 1957-03-25 US US648383A patent/US2863083A/en not_active Expired - Lifetime
- 1957-03-29 GB GB10383/57A patent/GB852734A/en not_active Expired
- 1957-07-17 CH CH353087D patent/CH353087A/de unknown
Patent Citations (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR863681A (fr) * | 1939-03-06 | 1941-04-07 | Thomson Houston Comp Francaise | Générateurs de rayons x |
| DE744208C (de) * | 1940-11-15 | 1952-06-09 | Telefunken Gmbh | Hochbelastbare Anode fuer elektrische Entladungsroehren, insbesondere solche ohne kuenstliche Kuehlung |
| US2243250A (en) * | 1940-11-22 | 1941-05-27 | Argus Mfg Corp | Electrical discharge device and anode therefor |
| CH231981A (de) * | 1940-12-02 | 1944-04-30 | C H F Mueller Aktiengesellscha | Röntgenröhre mit Drehanode. |
| DE844029C (de) * | 1941-03-15 | 1952-07-14 | Telefunken Gmbh | Nicht als Gluehkathode dienende Elektrode fuer ein elektrisches Entladungsgefaess |
| FR942318A (fr) * | 1942-03-28 | 1949-02-04 | Thomson Houston Comp Francaise | Perfectionnements aux tubes à rayons chi |
| AT163155B (de) * | 1942-11-25 | 1949-05-25 | Philips Nv | Scheibenförmige Anode für Röntgenröhren |
| DE896234C (de) * | 1943-04-22 | 1953-11-09 | Peter Dr Kniepen | Roentgenroehre |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1764042B1 (de) * | 1968-03-26 | 1971-05-27 | Koch & Sterzel Kg | Roentgenroehren drehanode mit anodenkoerper aus graphit |
| AT392760B (de) * | 1989-05-26 | 1991-06-10 | Plansee Metallwerk | Verbundkoerper aus graphit und hochschmelzendem metall |
| US5122422A (en) * | 1989-05-26 | 1992-06-16 | Schwarzkopf Technologies Corporation | Composite body made of graphite and high-melting metal |
Also Published As
| Publication number | Publication date |
|---|---|
| NL104093C (enExample) | |
| US2863083A (en) | 1958-12-02 |
| GB852734A (en) | 1960-11-02 |
| NL215843A (enExample) | |
| FR1148708A (fr) | 1957-12-13 |
| CH353087A (de) | 1961-03-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1106429B (de) | Roentgenroehren-Drehanode | |
| DE68908331T2 (de) | Amorphe Aluminiumlegierungen. | |
| EP0168868A1 (de) | Verfahren zum Aufbringen einer schutzoxydbildende Elemente enthaltenden Korrosionsschutzschicht auf den Grundkörper einer Gasturbinenschaufel und Korrosionssschutzschicht auf dem Grundkörper einer Gasturbinenschaufel | |
| DE2014480A1 (de) | Hochhitzebeständiger Schutzüberzug | |
| DE1764681A1 (de) | Drehanode fuer Roentgenroehren | |
| DE2621067A1 (de) | Roentgenanode | |
| EP0034391A1 (de) | Verwendung einer Blei-Legierung für Anoden bei der elektrolytischen Gewinnung von Zink | |
| DE1952526A1 (de) | Anode fuer Roentgenroehren | |
| DE69209139T2 (de) | Drehanoden-Röntgenröhre und Herstellungsmethode dafür | |
| DE2908151A1 (de) | Legierung, die metalle der platingruppe enthaelt | |
| EP0065534B1 (de) | Kathode für eine schmelzflusselektrolysezelle zur herstellung von aluminium | |
| DE2743119A1 (de) | Roentgenroehre fuer feinstrukturuntersuchung | |
| DE868026C (de) | Verfahren zur Herstellung einer nicht als Gluehkathode dienenden Elektrode fuer ein elektrisches Entladungsgefaess | |
| DE739251C (de) | Kohle- oder Graphitelektrode fuer elektrische Entladungsgefaesse mit einem UEberzug aus einem hochschmelzenden, bei hoeherer Temperatur auf chemischem Wege gasbindenden Metall auf wenigstens der der Elektronenquelle zugewandten Flaeche | |
| DE1546051A1 (de) | Verfahren zum Aufbringen von UEberzuegen auf Hochtemperatur-Legierungen | |
| DE467247C (de) | Verfahren zur Herstellung von metallischem Beryllium oder dessen Legierungen | |
| DE619415C (de) | Verfahren zur Erzeugung fluorhaltiger Schichten auf Leichtmetallen und deren Legierungen | |
| DE757222C (de) | Selentrockengleichrichter mit Schwermetall-Traegerelektrode | |
| DE851227C (de) | Selengleichrichter | |
| DE2122950A1 (de) | Verfahren zur Herstellung einer Antikathode für eine Röntgenröhre | |
| DE2413447C2 (de) | Verfahren zur Herstellung eines Supraleiters | |
| DE1521166C3 (de) | Verfahren zum Herstellen einer haftfesten Mischkristallschicht aus Karbiden auf Hartmetallkörpern | |
| DE971697C (de) | Verfahren zur Herstellung von Selengleichrichtern | |
| DE1259104B (de) | Verfahren zum Abscheiden dichter strukturell zusammenhaengender Niederschlaege | |
| DE974136C (de) | Verfahren zur Herstellung eines Verdampfers |