DE1070029B - - Google Patents
Info
- Publication number
- DE1070029B DE1070029B DENDAT1070029D DE1070029DA DE1070029B DE 1070029 B DE1070029 B DE 1070029B DE NDAT1070029 D DENDAT1070029 D DE NDAT1070029D DE 1070029D A DE1070029D A DE 1070029DA DE 1070029 B DE1070029 B DE 1070029B
- Authority
- DE
- Germany
- Prior art keywords
- silver
- methyl
- developer
- image
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- -1 methylimino-bis-propyl- Chemical group 0.000 claims description 71
- 238000000034 method Methods 0.000 claims description 65
- 229910052709 silver Inorganic materials 0.000 claims description 62
- 239000004332 silver Substances 0.000 claims description 62
- 239000000839 emulsion Substances 0.000 claims description 56
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims description 49
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 claims description 41
- 239000003795 chemical substances by application Substances 0.000 claims description 37
- 150000001875 compounds Chemical class 0.000 claims description 34
- 150000003839 salts Chemical class 0.000 claims description 32
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 30
- 238000009792 diffusion process Methods 0.000 claims description 27
- 239000002904 solvent Substances 0.000 claims description 23
- 229910052736 halogen Inorganic materials 0.000 claims description 22
- 150000002367 halogens Chemical class 0.000 claims description 21
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 claims description 16
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims description 15
- 150000001412 amines Chemical class 0.000 claims description 14
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 claims description 14
- 235000019345 sodium thiosulphate Nutrition 0.000 claims description 14
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 12
- 125000004429 atom Chemical group 0.000 claims description 12
- 229920000233 poly(alkylene oxides) Polymers 0.000 claims description 11
- QLAJNZSPVITUCQ-UHFFFAOYSA-N 1,3,2-dioxathietane 2,2-dioxide Chemical compound O=S1(=O)OCO1 QLAJNZSPVITUCQ-UHFFFAOYSA-N 0.000 claims description 9
- 150000004010 onium ions Chemical class 0.000 claims description 9
- 230000007935 neutral effect Effects 0.000 claims description 8
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 8
- UKJRKKQWBUZLPP-UHFFFAOYSA-N 3-methyl-1,3-benzothiazol-3-ium Chemical compound C1=CC=C2[N+](C)=CSC2=C1 UKJRKKQWBUZLPP-UHFFFAOYSA-N 0.000 claims description 7
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical class C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 7
- 230000001376 precipitating effect Effects 0.000 claims description 7
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical group [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 claims description 7
- 235000010265 sodium sulphite Nutrition 0.000 claims description 7
- 239000000126 substance Substances 0.000 claims description 7
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 claims description 6
- 150000003863 ammonium salts Chemical class 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 claims description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 claims description 4
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 claims description 4
- 150000005324 oxide salts Chemical class 0.000 claims description 4
- NDGRWYRVNANFNB-UHFFFAOYSA-N pyrazolidin-3-one Chemical class O=C1CCNN1 NDGRWYRVNANFNB-UHFFFAOYSA-N 0.000 claims description 4
- CYXJEHCKVOQFOV-UHFFFAOYSA-N (4-amino-2-methylphenyl) hydrogen sulfate Chemical compound CC1=CC(N)=CC=C1OS(O)(=O)=O CYXJEHCKVOQFOV-UHFFFAOYSA-N 0.000 claims description 3
- ZZEYCGJAYIHIAZ-UHFFFAOYSA-N 4-methyl-1-phenylpyrazolidin-3-one Chemical compound N1C(=O)C(C)CN1C1=CC=CC=C1 ZZEYCGJAYIHIAZ-UHFFFAOYSA-N 0.000 claims description 3
- 239000004133 Sodium thiosulphate Substances 0.000 claims description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 150000001767 cationic compounds Chemical class 0.000 claims description 2
- 229910052708 sodium Inorganic materials 0.000 claims description 2
- 239000011734 sodium Substances 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 239000011593 sulfur Substances 0.000 claims description 2
- MDAXKAUIABOHTD-UHFFFAOYSA-N 1,4,8,11-tetraazacyclotetradecane Chemical compound C1CNCCNCCCNCCNC1 MDAXKAUIABOHTD-UHFFFAOYSA-N 0.000 claims 1
- MIJDSYMOBYNHOT-UHFFFAOYSA-N 2-(ethylamino)ethanol Chemical compound CCNCCO MIJDSYMOBYNHOT-UHFFFAOYSA-N 0.000 claims 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 claims 1
- RYKLPZKUOJMKPR-UHFFFAOYSA-N n,n-bis(propylamino)methanamine Chemical compound CCCNN(C)NCCC RYKLPZKUOJMKPR-UHFFFAOYSA-N 0.000 claims 1
- 150000002894 organic compounds Chemical class 0.000 claims 1
- 239000000243 solution Substances 0.000 description 71
- PUAQLLVFLMYYJJ-UHFFFAOYSA-N 2-aminopropiophenone Chemical compound CC(N)C(=O)C1=CC=CC=C1 PUAQLLVFLMYYJJ-UHFFFAOYSA-N 0.000 description 35
- 238000012546 transfer Methods 0.000 description 30
- RWSOTUBLDIXVET-UHFFFAOYSA-O sulfonium Chemical class [SH3+] RWSOTUBLDIXVET-UHFFFAOYSA-O 0.000 description 19
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 16
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 16
- 238000011161 development Methods 0.000 description 14
- 229920000159 gelatin Polymers 0.000 description 14
- 235000019322 gelatine Nutrition 0.000 description 14
- 108010010803 Gelatin Proteins 0.000 description 13
- 239000008273 gelatin Substances 0.000 description 13
- 235000011852 gelatine desserts Nutrition 0.000 description 13
- 230000000694 effects Effects 0.000 description 12
- 230000035945 sensitivity Effects 0.000 description 12
- 125000001453 quaternary ammonium group Chemical group 0.000 description 11
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 10
- 229910017464 nitrogen compound Inorganic materials 0.000 description 10
- 150000002830 nitrogen compounds Chemical group 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- JLKXXDAJGKKSNK-UHFFFAOYSA-N perchloric acid;pyridine Chemical compound OCl(=O)(=O)=O.C1=CC=NC=C1 JLKXXDAJGKKSNK-UHFFFAOYSA-N 0.000 description 9
- 238000007792 addition Methods 0.000 description 8
- ONDPHDOFVYQSGI-UHFFFAOYSA-N zinc nitrate Chemical compound [Zn+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ONDPHDOFVYQSGI-UHFFFAOYSA-N 0.000 description 8
- 125000000217 alkyl group Chemical group 0.000 description 7
- 125000004122 cyclic group Chemical group 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 7
- WSGURAYTCUVDQL-UHFFFAOYSA-N 5-nitro-1h-indazole Chemical compound [O-][N+](=O)C1=CC=C2NN=CC2=C1 WSGURAYTCUVDQL-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- PFRUBEOIWWEFOL-UHFFFAOYSA-N [N].[S] Chemical compound [N].[S] PFRUBEOIWWEFOL-UHFFFAOYSA-N 0.000 description 6
- 230000005540 biological transmission Effects 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 229940001482 sodium sulfite Drugs 0.000 description 6
- 125000000066 S-methyl group Chemical group [H]C([H])([H])S* 0.000 description 5
- 239000002253 acid Chemical group 0.000 description 5
- 229920003086 cellulose ether Polymers 0.000 description 5
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 5
- 229940046892 lead acetate Drugs 0.000 description 5
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 5
- 150000003378 silver Chemical class 0.000 description 5
- 239000003381 stabilizer Substances 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 4
- 239000000654 additive Substances 0.000 description 4
- 150000001450 anions Chemical group 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 4
- YKYOUMDCQGMQQO-UHFFFAOYSA-L cadmium dichloride Chemical compound Cl[Cd]Cl YKYOUMDCQGMQQO-UHFFFAOYSA-L 0.000 description 4
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 4
- 230000000052 comparative effect Effects 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- 229910020366 ClO 4 Inorganic materials 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000008051 alkyl sulfates Chemical class 0.000 description 3
- 125000002947 alkylene group Chemical group 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 235000011114 ammonium hydroxide Nutrition 0.000 description 3
- 229940101006 anhydrous sodium sulfite Drugs 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 125000002091 cationic group Chemical group 0.000 description 3
- 235000019441 ethanol Nutrition 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 229910017604 nitric acid Inorganic materials 0.000 description 3
- RRTTWJWQIJJPDG-UHFFFAOYSA-N pyridin-1-ium;diperchlorate Chemical compound [O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O.C1=CC=[NH+]C=C1.C1=CC=[NH+]C=C1 RRTTWJWQIJJPDG-UHFFFAOYSA-N 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 229910052979 sodium sulfide Inorganic materials 0.000 description 3
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 3
- YXIWHUQXZSMYRE-UHFFFAOYSA-N 1,3-benzothiazole-2-thiol Chemical compound C1=CC=C2SC(S)=NC2=C1 YXIWHUQXZSMYRE-UHFFFAOYSA-N 0.000 description 2
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 2
- JAAIPIWKKXCNOC-UHFFFAOYSA-N 1h-tetrazol-1-ium-5-thiolate Chemical class SC1=NN=NN1 JAAIPIWKKXCNOC-UHFFFAOYSA-N 0.000 description 2
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 2
- XSFHICWNEBCMNN-UHFFFAOYSA-N 2h-benzotriazol-5-amine Chemical compound NC1=CC=C2NN=NC2=C1 XSFHICWNEBCMNN-UHFFFAOYSA-N 0.000 description 2
- ZVNPWFOVUDMGRP-UHFFFAOYSA-N 4-methylaminophenol sulfate Chemical compound OS(O)(=O)=O.CNC1=CC=C(O)C=C1.CNC1=CC=C(O)C=C1 ZVNPWFOVUDMGRP-UHFFFAOYSA-N 0.000 description 2
- VRTMTWNUBYXFLQ-UHFFFAOYSA-N 4-methylbenzenesulfonic acid;sulfane Chemical compound [SH3+].CC1=CC=C(S([O-])(=O)=O)C=C1 VRTMTWNUBYXFLQ-UHFFFAOYSA-N 0.000 description 2
- PZBQVZFITSVHAW-UHFFFAOYSA-N 5-chloro-2h-benzotriazole Chemical compound C1=C(Cl)C=CC2=NNN=C21 PZBQVZFITSVHAW-UHFFFAOYSA-N 0.000 description 2
- FOHWXVBZGSVUGO-UHFFFAOYSA-N 5-phenyl-3h-1,3,4-oxadiazole-2-thione Chemical compound O1C(S)=NN=C1C1=CC=CC=C1 FOHWXVBZGSVUGO-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- PTKIRNFBVOPNCQ-UHFFFAOYSA-N Cc1nc2ncnn2c(S)c1Br Chemical compound Cc1nc2ncnn2c(S)c1Br PTKIRNFBVOPNCQ-UHFFFAOYSA-N 0.000 description 2
- 101150065749 Churc1 gene Proteins 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- OPKOKAMJFNKNAS-UHFFFAOYSA-N N-methylethanolamine Chemical compound CNCCO OPKOKAMJFNKNAS-UHFFFAOYSA-N 0.000 description 2
- 102100038239 Protein Churchill Human genes 0.000 description 2
- 239000005083 Zinc sulfide Substances 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000001931 aliphatic group Chemical group 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 229940027983 antiseptic and disinfectant quaternary ammonium compound Drugs 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- OTBHHUPVCYLGQO-UHFFFAOYSA-N bis(3-aminopropyl)amine Chemical compound NCCCNCCCN OTBHHUPVCYLGQO-UHFFFAOYSA-N 0.000 description 2
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- MQRJBSHKWOFOGF-UHFFFAOYSA-L disodium;carbonate;hydrate Chemical compound O.[Na+].[Na+].[O-]C([O-])=O MQRJBSHKWOFOGF-UHFFFAOYSA-L 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- XPROKLGQTCGPDN-UHFFFAOYSA-M dodecyl(dimethyl)sulfanium;4-methylbenzenesulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.CCCCCCCCCCCC[S+](C)C XPROKLGQTCGPDN-UHFFFAOYSA-M 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 235000011187 glycerol Nutrition 0.000 description 2
- KWIUHFFTVRNATP-UHFFFAOYSA-N glycine betaine Chemical compound C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 2
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 125000004430 oxygen atom Chemical group O* 0.000 description 2
- CMCWWLVWPDLCRM-UHFFFAOYSA-N phenidone Chemical compound N1C(=O)CCN1C1=CC=CC=C1 CMCWWLVWPDLCRM-UHFFFAOYSA-N 0.000 description 2
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 2
- 239000001397 quillaja saponaria molina bark Substances 0.000 description 2
- 230000033458 reproduction Effects 0.000 description 2
- 229930182490 saponin Natural products 0.000 description 2
- 150000007949 saponins Chemical class 0.000 description 2
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 2
- 229940001593 sodium carbonate Drugs 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 229940076133 sodium carbonate monohydrate Drugs 0.000 description 2
- 239000011550 stock solution Substances 0.000 description 2
- 150000003464 sulfur compounds Chemical class 0.000 description 2
- WGTYBPLFGIVFAS-UHFFFAOYSA-M tetramethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)C WGTYBPLFGIVFAS-UHFFFAOYSA-M 0.000 description 2
- YONPGGFAJWQGJC-UHFFFAOYSA-K titanium(iii) chloride Chemical compound Cl[Ti](Cl)Cl YONPGGFAJWQGJC-UHFFFAOYSA-K 0.000 description 2
- DRDVZXDWVBGGMH-UHFFFAOYSA-N zinc;sulfide Chemical compound [S-2].[Zn+2] DRDVZXDWVBGGMH-UHFFFAOYSA-N 0.000 description 2
- FUCFIYVMBLXYQY-UHFFFAOYSA-M 1,2-diethylquinolin-1-ium;iodide Chemical compound [I-].C1=CC=CC2=[N+](CC)C(CC)=CC=C21 FUCFIYVMBLXYQY-UHFFFAOYSA-M 0.000 description 1
- ZPFAVCIQZKRBGF-UHFFFAOYSA-N 1,3,2-dioxathiolane 2,2-dioxide Chemical compound O=S1(=O)OCCO1 ZPFAVCIQZKRBGF-UHFFFAOYSA-N 0.000 description 1
- WZRRRFSJFQTGGB-UHFFFAOYSA-N 1,3,5-triazinane-2,4,6-trithione Chemical compound S=C1NC(=S)NC(=S)N1 WZRRRFSJFQTGGB-UHFFFAOYSA-N 0.000 description 1
- YHMYGUUIMTVXNW-UHFFFAOYSA-N 1,3-dihydrobenzimidazole-2-thione Chemical compound C1=CC=C2NC(S)=NC2=C1 YHMYGUUIMTVXNW-UHFFFAOYSA-N 0.000 description 1
- XCWPBWWTGHQKDR-UHFFFAOYSA-N 1,3-dithiolane-2-thione Chemical compound S=C1SCCS1 XCWPBWWTGHQKDR-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- PWGJDPKCLMLPJW-UHFFFAOYSA-N 1,8-diaminooctane Chemical compound NCCCCCCCCN PWGJDPKCLMLPJW-UHFFFAOYSA-N 0.000 description 1
- LEOYJTSFZDZNJM-UHFFFAOYSA-N 1-(4,5-dihydro-1h-imidazol-2-yl)imidazolidine-2-thione Chemical compound S=C1NCCN1C1=NCCN1 LEOYJTSFZDZNJM-UHFFFAOYSA-N 0.000 description 1
- KCEQOESJQVRUBO-UHFFFAOYSA-M 1-dodecylpyridin-1-ium;4-methylbenzenesulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.CCCCCCCCCCCC[N+]1=CC=CC=C1 KCEQOESJQVRUBO-UHFFFAOYSA-M 0.000 description 1
- ROPDQUKCUSRCEO-UHFFFAOYSA-M 1-dodecylpyridin-1-ium;perchlorate Chemical compound [O-]Cl(=O)(=O)=O.CCCCCCCCCCCC[N+]1=CC=CC=C1 ROPDQUKCUSRCEO-UHFFFAOYSA-M 0.000 description 1
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical class CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 1
- DZKJAKICBLPNAH-UHFFFAOYSA-N 1-methylpiperidine;perchloric acid Chemical compound OCl(=O)(=O)=O.CN1CCCCC1 DZKJAKICBLPNAH-UHFFFAOYSA-N 0.000 description 1
- AHCJTMBRROLNHV-UHFFFAOYSA-N 1-methylsulfanyloctane Chemical compound CCCCCCCCSC AHCJTMBRROLNHV-UHFFFAOYSA-N 0.000 description 1
- AFBBKYQYNPNMAT-UHFFFAOYSA-N 1h-1,2,4-triazol-1-ium-3-thiolate Chemical compound SC=1N=CNN=1 AFBBKYQYNPNMAT-UHFFFAOYSA-N 0.000 description 1
- YTQQIHUQLOZOJI-UHFFFAOYSA-N 2,3-dihydro-1,2-thiazole Chemical compound C1NSC=C1 YTQQIHUQLOZOJI-UHFFFAOYSA-N 0.000 description 1
- VEUMBMHMMCOFAG-UHFFFAOYSA-N 2,3-dihydrooxadiazole Chemical compound N1NC=CO1 VEUMBMHMMCOFAG-UHFFFAOYSA-N 0.000 description 1
- BXHXGRWITCQYFW-UHFFFAOYSA-N 2-(1,3-benzoxazol-2-yldisulfanyl)-1,3-benzoxazole Chemical compound C1=CC=C2OC(SSC=3OC4=CC=CC=C4N=3)=NC2=C1 BXHXGRWITCQYFW-UHFFFAOYSA-N 0.000 description 1
- MZIWZDMEFARRSI-UHFFFAOYSA-N 2-(1,3-thiazol-2-yldisulfanyl)-1,3-thiazole Chemical compound N=1C=CSC=1SSC1=NC=CS1 MZIWZDMEFARRSI-UHFFFAOYSA-N 0.000 description 1
- XBEIANFIOZTEDE-UHFFFAOYSA-N 2-(benzenecarbonothioylsulfanyl)acetic acid Chemical compound OC(=O)CSC(=S)C1=CC=CC=C1 XBEIANFIOZTEDE-UHFFFAOYSA-N 0.000 description 1
- VMAFGJGSHYEHLN-UHFFFAOYSA-N 2-(dimethylamino)ethyl hydrogen sulfite Chemical compound CN(C)CCOS(O)=O VMAFGJGSHYEHLN-UHFFFAOYSA-N 0.000 description 1
- SIRDFLZSHLLVIP-UHFFFAOYSA-N 2-aminoethyl hydrogen sulfite Chemical compound NCCOS(O)=O SIRDFLZSHLLVIP-UHFFFAOYSA-N 0.000 description 1
- BFSVOASYOCHEOV-UHFFFAOYSA-N 2-diethylaminoethanol Chemical compound CCN(CC)CCO BFSVOASYOCHEOV-UHFFFAOYSA-N 0.000 description 1
- 229940013085 2-diethylaminoethanol Drugs 0.000 description 1
- CSDSSGBPEUDDEE-UHFFFAOYSA-N 2-formylpyridine Chemical compound O=CC1=CC=CC=N1 CSDSSGBPEUDDEE-UHFFFAOYSA-N 0.000 description 1
- UYGXWEHFLRVOQT-UHFFFAOYSA-N 2-hydroxysulfonothioyloxy-N-methylethanamine Chemical compound CNCCOS(O)(=O)=S UYGXWEHFLRVOQT-UHFFFAOYSA-N 0.000 description 1
- FLFWJIBUZQARMD-UHFFFAOYSA-N 2-mercapto-1,3-benzoxazole Chemical compound C1=CC=C2OC(S)=NC2=C1 FLFWJIBUZQARMD-UHFFFAOYSA-N 0.000 description 1
- QAADFMSZNUQFFO-UHFFFAOYSA-N 2-n,4-n,6-n-tris[2-(diethylamino)ethyl]-1,3,5-triazine-2,4,6-triamine Chemical compound CCN(CC)CCNC1=NC(NCCN(CC)CC)=NC(NCCN(CC)CC)=N1 QAADFMSZNUQFFO-UHFFFAOYSA-N 0.000 description 1
- LILPOSVDSDEBCD-UHFFFAOYSA-N 2-thiocyanatoethyl thiocyanate Chemical compound N#CSCCSC#N LILPOSVDSDEBCD-UHFFFAOYSA-N 0.000 description 1
- KLVQAIJZDCCJRZ-UHFFFAOYSA-N 2h-1,3,4-thiadiazine Chemical compound C1SC=CN=N1 KLVQAIJZDCCJRZ-UHFFFAOYSA-N 0.000 description 1
- ZDWPBMJZDNXTPG-UHFFFAOYSA-N 2h-benzotriazol-4-amine Chemical compound NC1=CC=CC2=C1NN=N2 ZDWPBMJZDNXTPG-UHFFFAOYSA-N 0.000 description 1
- GDDNTTHUKVNJRA-UHFFFAOYSA-N 3-bromo-3,3-difluoroprop-1-ene Chemical compound FC(F)(Br)C=C GDDNTTHUKVNJRA-UHFFFAOYSA-N 0.000 description 1
- DKIDEFUBRARXTE-UHFFFAOYSA-N 3-mercaptopropanoic acid Chemical compound OC(=O)CCS DKIDEFUBRARXTE-UHFFFAOYSA-N 0.000 description 1
- DVRWEKGUWZINTQ-UHFFFAOYSA-N 3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one Chemical compound O=C1CSC(=S)N1C1=CC=CC=C1 DVRWEKGUWZINTQ-UHFFFAOYSA-N 0.000 description 1
- SJSJAWHHGDPBOC-UHFFFAOYSA-N 4,4-dimethyl-1-phenylpyrazolidin-3-one Chemical compound N1C(=O)C(C)(C)CN1C1=CC=CC=C1 SJSJAWHHGDPBOC-UHFFFAOYSA-N 0.000 description 1
- REGFWZVTTFGQOJ-UHFFFAOYSA-N 4,5-dihydro-1,3-thiazol-2-amine Chemical compound NC1=NCCS1 REGFWZVTTFGQOJ-UHFFFAOYSA-N 0.000 description 1
- JYOQUFAUDMUWJB-UHFFFAOYSA-N 4-(aminomethyl)-1,3-dihydroimidazole-2-thione Chemical compound NCC1=CNC(=S)N1 JYOQUFAUDMUWJB-UHFFFAOYSA-N 0.000 description 1
- HMVWDRBTNXIJIX-UHFFFAOYSA-N 4-[2-(2-pyridin-4-ylethylsulfanyl)ethyl]pyridine Chemical compound C=1C=NC=CC=1CCSCCC1=CC=NC=C1 HMVWDRBTNXIJIX-UHFFFAOYSA-N 0.000 description 1
- DNJANJSHTMOQOV-UHFFFAOYSA-N 4-bromo-2h-benzotriazole Chemical compound BrC1=CC=CC2=C1N=NN2 DNJANJSHTMOQOV-UHFFFAOYSA-N 0.000 description 1
- XUEDGYZCOWRRAP-UHFFFAOYSA-N 4-phenyl-3-sulfanyl-2h-tetrazole Chemical compound SN1NN=CN1C1=CC=CC=C1 XUEDGYZCOWRRAP-UHFFFAOYSA-N 0.000 description 1
- DVGHKLUHJSFLIT-UHFFFAOYSA-N 5-(2-methoxyphenyl)-3h-1,3,4-oxadiazole-2-thione Chemical compound COC1=CC=CC=C1C1=NNC(=S)O1 DVGHKLUHJSFLIT-UHFFFAOYSA-N 0.000 description 1
- HNFIJWNVPWXSOL-UHFFFAOYSA-N 5-(2-methylphenyl)-3h-1,3,4-oxadiazole-2-thione Chemical compound CC1=CC=CC=C1C1=NNC(=S)O1 HNFIJWNVPWXSOL-UHFFFAOYSA-N 0.000 description 1
- ZWFUVAUYXCCMQQ-UHFFFAOYSA-N 5-(3-methylphenyl)-3h-1,3,4-oxadiazole-2-thione Chemical compound CC1=CC=CC(C=2OC(=S)NN=2)=C1 ZWFUVAUYXCCMQQ-UHFFFAOYSA-N 0.000 description 1
- WRBROPFHVKCQKV-UHFFFAOYSA-N 5-(3-nitrophenyl)-3h-1,3,4-oxadiazole-2-thione Chemical compound [O-][N+](=O)C1=CC=CC(C=2OC(=S)NN=2)=C1 WRBROPFHVKCQKV-UHFFFAOYSA-N 0.000 description 1
- UGHZJAXROLHKEH-UHFFFAOYSA-N 5-(4-methoxyphenyl)-3h-1,3,4-oxadiazole-2-thione Chemical compound C1=CC(OC)=CC=C1C1=NN=C(S)O1 UGHZJAXROLHKEH-UHFFFAOYSA-N 0.000 description 1
- ABSVCMBOXHMZPV-UHFFFAOYSA-N 5-(4-nitrophenyl)-3h-1,3,4-oxadiazole-2-thione Chemical compound C1=CC([N+](=O)[O-])=CC=C1C1=NN=C(S)O1 ABSVCMBOXHMZPV-UHFFFAOYSA-N 0.000 description 1
- LYYREIOKNBJBJL-UHFFFAOYSA-N 5-(furan-2-yl)-3h-1,3,4-thiadiazole-2-thione Chemical compound S1C(S)=NN=C1C1=CC=CO1 LYYREIOKNBJBJL-UHFFFAOYSA-N 0.000 description 1
- AKIIZMKNCSAUQP-UHFFFAOYSA-N 5-(imino-lambda4-sulfanylidene)-4-phenyl-1,2,4-triazolidin-3-one Chemical compound C1(=CC=CC=C1)N1C(NNC1=O)=S=N AKIIZMKNCSAUQP-UHFFFAOYSA-N 0.000 description 1
- NTSLROIKFLNUIJ-UHFFFAOYSA-N 5-Ethyl-2-methylpyridine Chemical compound CCC1=CC=C(C)N=C1 NTSLROIKFLNUIJ-UHFFFAOYSA-N 0.000 description 1
- WZUUZPAYWFIBDF-UHFFFAOYSA-N 5-amino-1,2-dihydro-1,2,4-triazole-3-thione Chemical compound NC1=NNC(S)=N1 WZUUZPAYWFIBDF-UHFFFAOYSA-N 0.000 description 1
- GDGIVSREGUOIJZ-UHFFFAOYSA-N 5-amino-3h-1,3,4-thiadiazole-2-thione Chemical compound NC1=NN=C(S)S1 GDGIVSREGUOIJZ-UHFFFAOYSA-N 0.000 description 1
- GAOXXCQGXVGDDU-UHFFFAOYSA-N 5-amino-4-sulfanyl-1h-pyrimidine-6-thione Chemical compound NC1=C(S)N=CN=C1S GAOXXCQGXVGDDU-UHFFFAOYSA-N 0.000 description 1
- BQCIJWPKDPZNHD-UHFFFAOYSA-N 5-bromo-2h-benzotriazole Chemical compound C1=C(Br)C=CC2=NNN=C21 BQCIJWPKDPZNHD-UHFFFAOYSA-N 0.000 description 1
- OUZCWDMJTKYHCA-UHFFFAOYSA-N 5-methyl-1h-1,2,4-triazol-1-ium-3-thiolate Chemical compound CC1=NNC(S)=N1 OUZCWDMJTKYHCA-UHFFFAOYSA-N 0.000 description 1
- PZFICWFDJJJRHG-UHFFFAOYSA-N 6,7-dihydroxy-5-(hydroxymethyl)-3,3a,5,6,7,7a-hexahydropyrano[2,3-d][1,3]oxazole-2-thione Chemical compound OC1C(O)C(CO)OC2NC(=S)OC21 PZFICWFDJJJRHG-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Natural products OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 1
- ZAEWACNKUPWUPP-UHFFFAOYSA-N C(C)C1=C(N2C=NN=C2N=C1C)S Chemical compound C(C)C1=C(N2C=NN=C2N=C1C)S ZAEWACNKUPWUPP-UHFFFAOYSA-N 0.000 description 1
- QQJPSPORCOIPIH-UHFFFAOYSA-N CS(=O)(=O)[O-].C(C)C=1C=CC(=[NH+]C1)C Chemical compound CS(=O)(=O)[O-].C(C)C=1C=CC(=[NH+]C1)C QQJPSPORCOIPIH-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- OUSKOJVVHXUPTP-UHFFFAOYSA-N Cc1nc2nc(C)cc(S)n2n1 Chemical compound Cc1nc2nc(C)cc(S)n2n1 OUSKOJVVHXUPTP-UHFFFAOYSA-N 0.000 description 1
- 241000251730 Chondrichthyes Species 0.000 description 1
- SZVOSVIRJCJZNS-UHFFFAOYSA-N Cl(=O)(=O)(=O)[O-].S1C(=[NH+]C2=C1C=CC=C2)CCCCCCCCCCC=2SC1=C([NH+]2)C=CC=C1.Cl(=O)(=O)(=O)[O-] Chemical compound Cl(=O)(=O)(=O)[O-].S1C(=[NH+]C2=C1C=CC=C2)CCCCCCCCCCC=2SC1=C([NH+]2)C=CC=C1.Cl(=O)(=O)(=O)[O-] SZVOSVIRJCJZNS-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Chemical group CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- PDQAZBWRQCGBEV-UHFFFAOYSA-N Ethylenethiourea Chemical compound S=C1NCCN1 PDQAZBWRQCGBEV-UHFFFAOYSA-N 0.000 description 1
- PNKUSGQVOMIXLU-UHFFFAOYSA-N Formamidine Chemical compound NC=N PNKUSGQVOMIXLU-UHFFFAOYSA-N 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- WJYIASZWHGOTOU-UHFFFAOYSA-N Heptylamine Chemical compound CCCCCCCN WJYIASZWHGOTOU-UHFFFAOYSA-N 0.000 description 1
- 239000004201 L-cysteine Substances 0.000 description 1
- OKIZCWYLBDKLSU-UHFFFAOYSA-M N,N,N-Trimethylmethanaminium chloride Chemical compound [Cl-].C[N+](C)(C)C OKIZCWYLBDKLSU-UHFFFAOYSA-M 0.000 description 1
- ROTYTCDISSSRIE-UHFFFAOYSA-N N-[10-(hexanoylamino)decyl]hexanamide Chemical compound CCCCCC(=O)NCCCCCCCCCCNC(=O)CCCCC ROTYTCDISSSRIE-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 229910021607 Silver chloride Inorganic materials 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- 208000003443 Unconsciousness Diseases 0.000 description 1
- ZZXDRXVIRVJQBT-UHFFFAOYSA-M Xylenesulfonate Chemical compound CC1=CC=CC(S([O-])(=O)=O)=C1C ZZXDRXVIRVJQBT-UHFFFAOYSA-M 0.000 description 1
- SJOOOZPMQAWAOP-UHFFFAOYSA-N [Ag].BrCl Chemical compound [Ag].BrCl SJOOOZPMQAWAOP-UHFFFAOYSA-N 0.000 description 1
- NGDDCFINDCHPTF-UHFFFAOYSA-N [Br].[Ag] Chemical compound [Br].[Ag] NGDDCFINDCHPTF-UHFFFAOYSA-N 0.000 description 1
- 229910052946 acanthite Inorganic materials 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 150000001414 amino alcohols Chemical class 0.000 description 1
- 229940051880 analgesics and antipyretics pyrazolones Drugs 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 1
- 239000012964 benzotriazole Substances 0.000 description 1
- DFIYWMMFWASAAZ-UHFFFAOYSA-N benzyl-dodecyl-ethylsulfanium Chemical compound C(C1=CC=CC=C1)[S+](CCCCCCCCCCCC)CC DFIYWMMFWASAAZ-UHFFFAOYSA-N 0.000 description 1
- 229960003237 betaine Drugs 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 239000000298 carbocyanine Substances 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- DVBJBNKEBPCGSY-UHFFFAOYSA-M cetylpyridinium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+]1=CC=CC=C1 DVBJBNKEBPCGSY-UHFFFAOYSA-M 0.000 description 1
- 239000013522 chelant Substances 0.000 description 1
- 239000002738 chelating agent Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- AJPXTSMULZANCB-UHFFFAOYSA-N chlorohydroquinone Chemical compound OC1=CC=C(O)C(Cl)=C1 AJPXTSMULZANCB-UHFFFAOYSA-N 0.000 description 1
- 230000000536 complexating effect Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- LKBMPSMLBVPIKO-UHFFFAOYSA-M decyl(dimethyl)sulfanium;4-methylbenzenesulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.CCCCCCCCCC[S+](C)C LKBMPSMLBVPIKO-UHFFFAOYSA-M 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- FQRPXALREFKNJX-UHFFFAOYSA-M dimethyl(nonyl)sulfanium;4-methylbenzenesulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.CCCCCCCCC[S+](C)C FQRPXALREFKNJX-UHFFFAOYSA-M 0.000 description 1
- MSPCNQNGAGDYPT-UHFFFAOYSA-M dimethyl(octadecyl)sulfanium;4-methylbenzenesulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.CCCCCCCCCCCCCCCCCC[S+](C)C MSPCNQNGAGDYPT-UHFFFAOYSA-M 0.000 description 1
- XPKKHLWELALBPN-UHFFFAOYSA-M dimethyl(tetradecyl)sulfanium;4-methylbenzenesulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.CCCCCCCCCCCCCC[S+](C)C XPKKHLWELALBPN-UHFFFAOYSA-M 0.000 description 1
- 230000003467 diminishing effect Effects 0.000 description 1
- FGRVOLIFQGXPCT-UHFFFAOYSA-L dipotassium;dioxido-oxo-sulfanylidene-$l^{6}-sulfane Chemical compound [K+].[K+].[O-]S([O-])(=O)=S FGRVOLIFQGXPCT-UHFFFAOYSA-L 0.000 description 1
- ICEXLMACENYGPP-UHFFFAOYSA-N dipropylcarbamothioylsulfanyl n,n-dipropylcarbamodithioate Chemical compound CCCN(CCC)C(=S)SSC(=S)N(CCC)CCC ICEXLMACENYGPP-UHFFFAOYSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- QFTYSVGGYOXFRQ-UHFFFAOYSA-N dodecane-1,12-diamine Chemical compound NCCCCCCCCCCCCN QFTYSVGGYOXFRQ-UHFFFAOYSA-N 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- LZHIDNDUHUIYKG-UHFFFAOYSA-M dodecyl(trimethyl)azanium;4-methylbenzenesulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.CCCCCCCCCCCC[N+](C)(C)C LZHIDNDUHUIYKG-UHFFFAOYSA-M 0.000 description 1
- 229960001484 edetic acid Drugs 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000000219 ethylidene group Chemical group [H]C(=[*])C([H])([H])[H] 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 229940083122 ganglion-blocking antiandrenergic bisquaternary ammonium compound Drugs 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000002343 gold Chemical class 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 150000002344 gold compounds Chemical class 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 125000000687 hydroquinonyl group Chemical group C1(O)=C(C=C(O)C=C1)* 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- TYQCGQRIZGCHNB-JLAZNSOCSA-N l-ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(O)=C(O)C1=O TYQCGQRIZGCHNB-JLAZNSOCSA-N 0.000 description 1
- 150000002731 mercury compounds Chemical class 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- GUFOVCVEWXVEGH-UHFFFAOYSA-N methane;pyridine Chemical compound C.C1=CC=NC=C1 GUFOVCVEWXVEGH-UHFFFAOYSA-N 0.000 description 1
- BLTAPEIEHGWKKN-UHFFFAOYSA-N methanesulfonate;pyridin-1-ium Chemical compound CS(O)(=O)=O.C1=CC=NC=C1 BLTAPEIEHGWKKN-UHFFFAOYSA-N 0.000 description 1
- PMRYVIKBURPHAH-UHFFFAOYSA-N methimazole Chemical compound CN1C=CNC1=S PMRYVIKBURPHAH-UHFFFAOYSA-N 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- KMBPCQSCMCEPMU-UHFFFAOYSA-N n'-(3-aminopropyl)-n'-methylpropane-1,3-diamine Chemical compound NCCCN(C)CCCN KMBPCQSCMCEPMU-UHFFFAOYSA-N 0.000 description 1
- KVKFRMCSXWQSNT-UHFFFAOYSA-N n,n'-dimethylethane-1,2-diamine Chemical compound CNCCNC KVKFRMCSXWQSNT-UHFFFAOYSA-N 0.000 description 1
- QAORMLJQCDFQBB-UHFFFAOYSA-N n,n-diethylethanamine;perchloric acid Chemical compound [O-]Cl(=O)(=O)=O.CC[NH+](CC)CC QAORMLJQCDFQBB-UHFFFAOYSA-N 0.000 description 1
- PNLVIPVKIAPZTP-UHFFFAOYSA-N n,n-dimethylmethanamine;perchloric acid Chemical compound C[NH+](C)C.[O-]Cl(=O)(=O)=O PNLVIPVKIAPZTP-UHFFFAOYSA-N 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- BOQKCADLPNLYCZ-UHFFFAOYSA-N n-phenylbenzenecarbothioamide Chemical compound C=1C=CC=CC=1C(=S)NC1=CC=CC=C1 BOQKCADLPNLYCZ-UHFFFAOYSA-N 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- FYWSTUCDSVYLPV-UHFFFAOYSA-N nitrooxythallium Chemical compound [Tl+].[O-][N+]([O-])=O FYWSTUCDSVYLPV-UHFFFAOYSA-N 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- NRNFFDZCBYOZJY-UHFFFAOYSA-N p-quinodimethane Chemical group C=C1C=CC(=C)C=C1 NRNFFDZCBYOZJY-UHFFFAOYSA-N 0.000 description 1
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- DPBLXKKOBLCELK-UHFFFAOYSA-N pentan-1-amine Chemical compound CCCCCN DPBLXKKOBLCELK-UHFFFAOYSA-N 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 125000001557 phthalyl group Chemical group C(=O)(O)C1=C(C(=O)*)C=CC=C1 0.000 description 1
- 125000005936 piperidyl group Chemical group 0.000 description 1
- 229920001748 polybutylene Polymers 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 150000003139 primary aliphatic amines Chemical class 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical class O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- YBBJKCMMCRQZMA-UHFFFAOYSA-N pyrithione Chemical compound ON1C=CC=CC1=S YBBJKCMMCRQZMA-UHFFFAOYSA-N 0.000 description 1
- 230000035807 sensation Effects 0.000 description 1
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 description 1
- 229910001961 silver nitrate Inorganic materials 0.000 description 1
- 229940056910 silver sulfide Drugs 0.000 description 1
- XUARKZBEFFVFRG-UHFFFAOYSA-N silver sulfide Chemical compound [S-2].[Ag+].[Ag+] XUARKZBEFFVFRG-UHFFFAOYSA-N 0.000 description 1
- 235000019795 sodium metasilicate Nutrition 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- VGTPCRGMBIAPIM-UHFFFAOYSA-M sodium thiocyanate Chemical compound [Na+].[S-]C#N VGTPCRGMBIAPIM-UHFFFAOYSA-M 0.000 description 1
- PODWXQQNRWNDGD-UHFFFAOYSA-L sodium thiosulfate pentahydrate Chemical compound O.O.O.O.O.[Na+].[Na+].[O-]S([S-])(=O)=O PODWXQQNRWNDGD-UHFFFAOYSA-L 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 150000005621 tetraalkylammonium salts Chemical group 0.000 description 1
- HWCKGOZZJDHMNC-UHFFFAOYSA-M tetraethylammonium bromide Chemical compound [Br-].CC[N+](CC)(CC)CC HWCKGOZZJDHMNC-UHFFFAOYSA-M 0.000 description 1
- 229940073455 tetraethylammonium hydroxide Drugs 0.000 description 1
- LRGJRHZIDJQFCL-UHFFFAOYSA-M tetraethylazanium;hydroxide Chemical compound [OH-].CC[N+](CC)(CC)CC LRGJRHZIDJQFCL-UHFFFAOYSA-M 0.000 description 1
- FBEVECUEMUUFKM-UHFFFAOYSA-M tetrapropylazanium;chloride Chemical compound [Cl-].CCC[N+](CCC)(CCC)CCC FBEVECUEMUUFKM-UHFFFAOYSA-M 0.000 description 1
- NFSGFYBDMKUQJA-UHFFFAOYSA-N thiatriazol-5-amine Chemical compound NC1=NN=NS1 NFSGFYBDMKUQJA-UHFFFAOYSA-N 0.000 description 1
- SRVJKTDHMYAMHA-WUXMJOGZSA-N thioacetazone Chemical compound CC(=O)NC1=CC=C(\C=N\NC(N)=S)C=C1 SRVJKTDHMYAMHA-WUXMJOGZSA-N 0.000 description 1
- UVZICZIVKIMRNE-UHFFFAOYSA-N thiodiacetic acid Chemical compound OC(=O)CSCC(O)=O UVZICZIVKIMRNE-UHFFFAOYSA-N 0.000 description 1
- DHCDFWKWKRSZHF-UHFFFAOYSA-L thiosulfate(2-) Chemical compound [O-]S([S-])(=O)=O DHCDFWKWKRSZHF-UHFFFAOYSA-L 0.000 description 1
- YXFVVABEGXRONW-UHFFFAOYSA-N toluene Substances CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 1
- CNHDIAIOKMXOLK-UHFFFAOYSA-N toluquinol Chemical compound CC1=CC(O)=CC=C1O CNHDIAIOKMXOLK-UHFFFAOYSA-N 0.000 description 1
- MQAYPFVXSPHGJM-UHFFFAOYSA-M trimethyl(phenyl)azanium;chloride Chemical compound [Cl-].C[N+](C)(C)C1=CC=CC=C1 MQAYPFVXSPHGJM-UHFFFAOYSA-M 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- 229940071104 xylenesulfonate Drugs 0.000 description 1
- 229910052984 zinc sulfide Inorganic materials 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C8/00—Diffusion transfer processes or agents therefor; Photosensitive materials for such processes
- G03C8/02—Photosensitive materials characterised by the image-forming section
- G03C8/04—Photosensitive materials characterised by the image-forming section the substances transferred by diffusion consisting of inorganic or organo-metallic compounds derived from photosensitive noble metals
- G03C8/06—Silver salt diffusion transfer
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C8/00—Diffusion transfer processes or agents therefor; Photosensitive materials for such processes
- G03C8/24—Photosensitive materials characterised by the image-receiving section
- G03C8/243—Toners for the silver image
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
- Photosensitive Polymer And Photoresist Processing (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US724828A US3017270A (en) | 1958-03-31 | 1958-03-31 | Photographic silver halide diffusion transfer process |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1070029B true DE1070029B (cg-RX-API-DMAC7.html) | 1959-11-26 |
Family
ID=24912080
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DENDAT1070029D Pending DE1070029B (cg-RX-API-DMAC7.html) | 1958-03-31 |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3017270A (cg-RX-API-DMAC7.html) |
| BE (1) | BE577256A (cg-RX-API-DMAC7.html) |
| DE (1) | DE1070029B (cg-RX-API-DMAC7.html) |
| FR (1) | FR1231095A (cg-RX-API-DMAC7.html) |
| GB (1) | GB912258A (cg-RX-API-DMAC7.html) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1167650B (de) * | 1960-08-22 | 1964-04-09 | Polaroid Corp | Mehrschichtiges, fuer Mehrfarben-Diffusionsverfahren geeignetes photographisches Material mit Entwicklersubstanzen in der Emulsionsschicht |
| DE1169779B (de) * | 1960-12-17 | 1964-05-06 | Gevaert Photo Prod Nv | Bildempfangsmaterial zur Durchfuehrung des Halogensilberdiffusionsuebertragungsverfahrens |
Families Citing this family (48)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL131667C (cg-RX-API-DMAC7.html) * | 1957-10-25 | |||
| BE594237A (cg-RX-API-DMAC7.html) * | 1959-08-24 | |||
| BE595323A (cg-RX-API-DMAC7.html) * | 1959-09-24 | |||
| GB888543A (en) * | 1959-10-16 | 1962-01-31 | Kodak Ltd | Improvements in processes of photographic reproduction |
| US3146102A (en) * | 1960-08-22 | 1964-08-25 | Eastman Kodak Co | Photographic multicolor diffusion transfer process using dye developers |
| US3260597A (en) * | 1960-12-02 | 1966-07-12 | Eastman Kodak Co | Photographic multicolor diffusion transfer process using dye developers and development arrestors |
| BE608384A (cg-RX-API-DMAC7.html) * | 1960-09-24 | |||
| BE596845A (cg-RX-API-DMAC7.html) * | 1960-11-08 | |||
| US3260598A (en) * | 1961-05-29 | 1966-07-12 | Eastman Kodak Co | Photographic element-developer system |
| BE605802A (cg-RX-API-DMAC7.html) * | 1961-07-06 | |||
| BE620828A (cg-RX-API-DMAC7.html) * | 1961-08-01 | |||
| BE621461A (cg-RX-API-DMAC7.html) * | 1961-08-17 | |||
| BE622239A (cg-RX-API-DMAC7.html) * | 1961-09-08 | |||
| BE624013A (cg-RX-API-DMAC7.html) * | 1961-10-26 | |||
| BE627760A (cg-RX-API-DMAC7.html) * | 1962-01-31 | |||
| BE629344A (cg-RX-API-DMAC7.html) * | 1962-03-10 | |||
| GB1052446A (cg-RX-API-DMAC7.html) * | 1962-09-13 | |||
| US3184313A (en) * | 1962-11-19 | 1965-05-18 | Eastman Kodak Co | Silver halide emulsion desensitized with a tetraalkyl thiuram disulfide |
| US3379529A (en) * | 1963-02-28 | 1968-04-23 | Eastman Kodak Co | Photographic inhibitor-releasing developers |
| US3330658A (en) * | 1963-12-20 | 1967-07-11 | Eastman Kodak Co | Photographic silver halide diffusion transfer process |
| GB1041415A (en) * | 1964-06-24 | 1966-09-07 | Ilford Ltd | Photographic print material and manufacture of photographic prints |
| US3314789A (en) * | 1964-07-24 | 1967-04-18 | Eastman Kodak Co | Quaternary ammonium salts in silver halide processing solutions |
| US3542554A (en) * | 1967-11-30 | 1970-11-24 | Eastman Kodak Co | Mercapto-substituted hydroquinone developing agents |
| US3642473A (en) * | 1968-01-18 | 1972-02-15 | Polaroid Corp | Silver diffusion transfer process with mercapto-purine antifoggant |
| US3650741A (en) * | 1968-03-25 | 1972-03-21 | Agfa Gevaert Nv | Silver complex diffusion transfer process |
| US3607291A (en) * | 1968-04-08 | 1971-09-21 | Eastman Kodak Co | Dimethylamine oxides as coating aids for photographic elements |
| JPS4826777B1 (cg-RX-API-DMAC7.html) * | 1969-08-18 | 1973-08-15 | ||
| US3715214A (en) * | 1970-05-18 | 1973-02-06 | Itek Corp | Rapid development process |
| JPS576092B2 (cg-RX-API-DMAC7.html) * | 1971-12-28 | 1982-02-03 | ||
| US3819378A (en) * | 1972-03-10 | 1974-06-25 | Gen Film Dev Corp | Fine grain high speed photographic processing monobath composition |
| US3857710A (en) * | 1972-12-22 | 1974-12-31 | Gen Film Dev Corp | High contrast, high capacity monobath processing method and composition for monochrome film |
| US3887375A (en) * | 1973-08-24 | 1975-06-03 | Minnesota Mining & Mfg | Restrainers for rapid access, air stable, regenerable, metal chelate developer solutions |
| GB1491902A (en) * | 1974-02-28 | 1977-11-16 | Agfa Gevaert | Development of exposed lith-emulsions |
| GB1548395A (en) * | 1975-05-29 | 1979-07-11 | Eastman Kodak Co | Photographic materials |
| JPS5344025A (en) * | 1976-08-27 | 1978-04-20 | Fuji Photo Film Co Ltd | Image formation method |
| JPS5284734A (en) * | 1976-10-04 | 1977-07-14 | Fuji Photo Film Co Ltd | Photographic image formation |
| CA1132826A (en) * | 1979-01-24 | 1982-10-05 | Frans Carael | Non-photosensitive receptor material containing an organic compound with a c-linked anionic group and an organic acid-dye mordanting compound |
| JPS55157738A (en) * | 1979-05-29 | 1980-12-08 | Mitsubishi Paper Mills Ltd | Silver complex salt diffusion transfer solution composition |
| US4378424A (en) * | 1980-12-12 | 1983-03-29 | Eastman Kodak Company | Mesoionic 1,2,4-triazolium-3-thiolates as silver halide stabilizers and fixing agents |
| US4443531A (en) * | 1981-12-18 | 1984-04-17 | Mitsubishi Paper Mills, Ltd. | Deleting agents for printing plates and method for deletion |
| JPH0612429B2 (ja) * | 1983-04-20 | 1994-02-16 | 富士写真フイルム株式会社 | 銀塩拡散転写用画像形成方法 |
| JPS6087322A (ja) * | 1983-10-20 | 1985-05-17 | Fuji Photo Film Co Ltd | ハロゲン化銀写真感光材料 |
| JPS6148832A (ja) * | 1984-08-16 | 1986-03-10 | Fuji Photo Film Co Ltd | ハロゲン化銀写真感光材料 |
| EP0208346B1 (en) * | 1985-06-11 | 1991-11-21 | Agfa-Gevaert N.V. | Diffusion transfer reversal process |
| JP2591616B2 (ja) | 1986-04-22 | 1997-03-19 | コニカ株式会社 | カブリの防止されたハロゲン化銀写真感光材料の処理方法 |
| US5306822A (en) * | 1988-05-25 | 1994-04-26 | Warner-Lambert Company | Arylmethylenyl derivatives of oxazolidinone |
| US20040018941A1 (en) * | 2002-07-17 | 2004-01-29 | Ishihara Sangyo Kaisha, Ltd. | Fused-benzene derivatives of thiouracil, herbicidal and desiccant compositions contaning them |
| EP2016069A4 (en) * | 2006-05-05 | 2011-01-26 | Univ Sydney | BISPYRIDINIUMVERBINDUNGEN |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2197809A (en) * | 1938-01-03 | 1940-04-23 | Du Pont Film Mfg Corp | Photographic process and emulsion utilizing cation-active surface active agents |
| BE466375A (cg-RX-API-DMAC7.html) * | 1939-03-30 | |||
| US2275727A (en) * | 1940-02-29 | 1942-03-10 | Eastman Kodak Co | Photographic emulsion |
| GB542502A (en) * | 1940-07-10 | 1942-01-13 | John David Kendall | Improvements in or relating to photographic development processes |
| BE502525A (cg-RX-API-DMAC7.html) * | 1950-04-15 | |||
| US2725298A (en) * | 1952-05-03 | 1955-11-29 | Eastman Kodak Co | Transfer process of photographic printing |
| BE553031A (cg-RX-API-DMAC7.html) * | 1955-12-01 | |||
| DE1048476B (cg-RX-API-DMAC7.html) * | 1955-12-01 |
-
0
- BE BE577256D patent/BE577256A/xx unknown
- DE DENDAT1070029D patent/DE1070029B/de active Pending
-
1958
- 1958-03-31 US US724828A patent/US3017270A/en not_active Expired - Lifetime
-
1959
- 1959-03-26 GB GB10503/59A patent/GB912258A/en not_active Expired
- 1959-03-27 FR FR790624A patent/FR1231095A/fr not_active Expired
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1167650B (de) * | 1960-08-22 | 1964-04-09 | Polaroid Corp | Mehrschichtiges, fuer Mehrfarben-Diffusionsverfahren geeignetes photographisches Material mit Entwicklersubstanzen in der Emulsionsschicht |
| DE1169779B (de) * | 1960-12-17 | 1964-05-06 | Gevaert Photo Prod Nv | Bildempfangsmaterial zur Durchfuehrung des Halogensilberdiffusionsuebertragungsverfahrens |
Also Published As
| Publication number | Publication date |
|---|---|
| US3017270A (en) | 1962-01-16 |
| BE577256A (cg-RX-API-DMAC7.html) | |
| GB912258A (en) | 1962-12-05 |
| FR1231095A (fr) | 1960-09-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1070029B (cg-RX-API-DMAC7.html) | ||
| DE1281845B (de) | Photographische Silberhalogenidemulsion | |
| DE1447632B2 (de) | Photographisches Aufzeichnungsmaterial | |
| DE2344563C2 (de) | Photographische Silberhalogenidemulsion und Verfahren zu ihrer chemischen Reifung | |
| DE2852288C2 (de) | Photographische Entwicklerlösung, Verfahren zur Entwicklung und Verwendung der Entwicklerlösung | |
| DE1772724A1 (de) | Photographisches Umkehrverfahren | |
| DE2708466A1 (de) | Emulsionsabmischungen fuer colorumkehr-(aufsichts-)material | |
| DE3343360A1 (de) | Verfahren zur entwicklung eines photographischen lichtempflindlichen silberhalogenidmaterials und photographisches lichtempflindliches silberhalogenidmaterial | |
| DE2321401A1 (de) | Entwicklungsverfahren und entwicklungsbad | |
| DE1150277B (de) | Verfahren zum Sensibilisieren einer photographischen Silbersalzemulsion mit einer schwefelhaltigen Substanz | |
| DE1032668B (de) | Stabilisiertes photographisches Material | |
| DE2439919A1 (de) | Verfahren zum entwickeln eines belichteten photographischen silberhalogenidmaterials | |
| DE3129921A1 (de) | Fotografisches, lichtempfindliches silberhalogenidmaterial und verfahren zur herstellung einer fotografischen silberhalogenid-emulsion | |
| DE2411820A1 (de) | Verfahren zum haerten von gelatine | |
| DE2803232C2 (de) | Lichtempfindliches photographisches Silberhalogenid-Aufzeichnungsmaterial vom Lith-Typ | |
| DE2932650A1 (de) | Verfahren zur herstellung von monodispersen photographischen silberhalogenidemulsionen mit verbesserter empfindlichkeit | |
| DE972720C (de) | Sensibilisiertes photographisches Material | |
| DE4310327A1 (de) | Verfahren zur Erzeugung von Negativbildern mit ultrasteilem Kontrast | |
| DE69122793T2 (de) | Photographisches Silberhalogenidmaterial | |
| DE69021193T2 (de) | Entwicklerflüssigkeit für die kontrastreiche Entwicklung. | |
| DE2040876A1 (de) | Lichtempfindliches,fotografisches silberhalogenidhaltiges Aufzeichnungsmaterial | |
| EP0001415B1 (de) | Photographisches Umkehrverfahren mit chemischer Verschleierung, chemische Verschleierungsbäder und ihre Verwendung zur Herstellung photographischer Bilder | |
| DE2344074C2 (de) | Photographischer Lithentwickler | |
| DE3439870C2 (de) | Verfahren zur Herstellung eines Bildes | |
| DE2711942C2 (cg-RX-API-DMAC7.html) |