DE1032091B - Lichtempfindliches photographisches Material und photographisches Diffusionsuebertragungsverfahren - Google Patents
Lichtempfindliches photographisches Material und photographisches DiffusionsuebertragungsverfahrenInfo
- Publication number
- DE1032091B DE1032091B DEE14012A DEE0014012A DE1032091B DE 1032091 B DE1032091 B DE 1032091B DE E14012 A DEE14012 A DE E14012A DE E0014012 A DEE0014012 A DE E0014012A DE 1032091 B DE1032091 B DE 1032091B
- Authority
- DE
- Germany
- Prior art keywords
- silver
- layer
- mercapto
- image
- soluble
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000463 material Substances 0.000 title claims description 72
- 238000000034 method Methods 0.000 title claims description 70
- 238000009792 diffusion process Methods 0.000 title claims description 15
- 230000008569 process Effects 0.000 title description 27
- 238000012546 transfer Methods 0.000 title description 13
- 229910052709 silver Inorganic materials 0.000 claims description 194
- 239000004332 silver Substances 0.000 claims description 194
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims description 170
- 239000000839 emulsion Substances 0.000 claims description 126
- 239000000243 solution Substances 0.000 claims description 47
- 229910052736 halogen Inorganic materials 0.000 claims description 46
- 150000002367 halogens Chemical class 0.000 claims description 46
- 238000001556 precipitation Methods 0.000 claims description 43
- -1 silver halide Chemical class 0.000 claims description 43
- 230000001376 precipitating effect Effects 0.000 claims description 29
- 229920002678 cellulose Polymers 0.000 claims description 24
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 claims description 24
- 239000001913 cellulose Substances 0.000 claims description 23
- 238000011161 development Methods 0.000 claims description 19
- 235000019325 ethyl cellulose Nutrition 0.000 claims description 15
- 239000003795 chemical substances by application Substances 0.000 claims description 14
- 239000002904 solvent Substances 0.000 claims description 13
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 claims description 12
- 150000002148 esters Chemical class 0.000 claims description 12
- 150000004820 halides Chemical class 0.000 claims description 12
- 229910001385 heavy metal Inorganic materials 0.000 claims description 11
- 125000001557 phthalyl group Chemical group C(=O)(O)C1=C(C(=O)*)C=CC=C1 0.000 claims description 10
- 229920001249 ethyl cellulose Polymers 0.000 claims description 9
- YXIWHUQXZSMYRE-UHFFFAOYSA-N 1,3-benzothiazole-2-thiol Chemical compound C1=CC=C2SC(S)=NC2=C1 YXIWHUQXZSMYRE-UHFFFAOYSA-N 0.000 claims description 8
- 239000001856 Ethyl cellulose Substances 0.000 claims description 8
- 230000002378 acidificating effect Effects 0.000 claims description 7
- 239000006185 dispersion Substances 0.000 claims description 6
- JLAMDELLBBZOOX-UHFFFAOYSA-N 3h-1,3,4-thiadiazole-2-thione Chemical compound SC1=NN=CS1 JLAMDELLBBZOOX-UHFFFAOYSA-N 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 claims description 4
- 125000005498 phthalate group Chemical class 0.000 claims description 4
- 239000002244 precipitate Substances 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- GDGIVSREGUOIJZ-UHFFFAOYSA-N 5-amino-3h-1,3,4-thiadiazole-2-thione Chemical compound NC1=NN=C(S)S1 GDGIVSREGUOIJZ-UHFFFAOYSA-N 0.000 claims description 3
- 239000007864 aqueous solution Substances 0.000 claims description 3
- 229920002301 cellulose acetate Polymers 0.000 claims description 3
- GGZHVNZHFYCSEV-UHFFFAOYSA-N 1-Phenyl-5-mercaptotetrazole Chemical compound SC1=NN=NN1C1=CC=CC=C1 GGZHVNZHFYCSEV-UHFFFAOYSA-N 0.000 claims description 2
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 claims description 2
- 238000004049 embossing Methods 0.000 claims description 2
- 150000007524 organic acids Chemical class 0.000 claims description 2
- 150000003346 selenoethers Chemical class 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims 4
- CHZLVSBMXZSPNN-UHFFFAOYSA-N 2,4-dimethylbenzenesulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C(C)=C1 CHZLVSBMXZSPNN-UHFFFAOYSA-N 0.000 claims 3
- RUBRCWOFANAOTP-UHFFFAOYSA-N 3h-1,3,4-oxadiazole-2-thione Chemical group S=C1NN=CO1 RUBRCWOFANAOTP-UHFFFAOYSA-N 0.000 claims 2
- 238000009826 distribution Methods 0.000 claims 2
- VEUMBMHMMCOFAG-UHFFFAOYSA-N 2,3-dihydrooxadiazole Chemical compound N1NC=CO1 VEUMBMHMMCOFAG-UHFFFAOYSA-N 0.000 claims 1
- 208000000260 Warts Diseases 0.000 claims 1
- 230000001464 adherent effect Effects 0.000 claims 1
- 229910052976 metal sulfide Inorganic materials 0.000 claims 1
- 238000013508 migration Methods 0.000 claims 1
- 230000005012 migration Effects 0.000 claims 1
- 201000010153 skin papilloma Diseases 0.000 claims 1
- 229920000159 gelatin Polymers 0.000 description 27
- 239000008273 gelatin Substances 0.000 description 26
- 235000019322 gelatine Nutrition 0.000 description 26
- 108010010803 Gelatin Proteins 0.000 description 25
- 235000011852 gelatine desserts Nutrition 0.000 description 25
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 23
- 150000001875 compounds Chemical class 0.000 description 22
- 235000010980 cellulose Nutrition 0.000 description 18
- 229920003086 cellulose ether Polymers 0.000 description 16
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N 1,4-Benzenediol Natural products OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 15
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 14
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 12
- 230000033458 reproduction Effects 0.000 description 11
- 239000000126 substance Substances 0.000 description 9
- 239000012876 carrier material Substances 0.000 description 8
- 235000010265 sodium sulphite Nutrition 0.000 description 7
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- ONDPHDOFVYQSGI-UHFFFAOYSA-N zinc nitrate Inorganic materials [Zn+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ONDPHDOFVYQSGI-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 5
- 230000008901 benefit Effects 0.000 description 5
- 230000007935 neutral effect Effects 0.000 description 5
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 description 5
- 239000011593 sulfur Substances 0.000 description 5
- 229910052717 sulfur Inorganic materials 0.000 description 5
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 4
- 229910052783 alkali metal Inorganic materials 0.000 description 4
- 230000006872 improvement Effects 0.000 description 4
- 230000006911 nucleation Effects 0.000 description 4
- 238000010899 nucleation Methods 0.000 description 4
- 238000004382 potting Methods 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 229920000623 Cellulose acetate phthalate Polymers 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- 229910021607 Silver chloride Inorganic materials 0.000 description 3
- 241001061127 Thione Species 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- ZZXDRXVIRVJQBT-UHFFFAOYSA-M Xylenesulfonate Chemical compound CC1=CC=CC(S([O-])(=O)=O)=C1C ZZXDRXVIRVJQBT-UHFFFAOYSA-M 0.000 description 3
- SJOOOZPMQAWAOP-UHFFFAOYSA-N [Ag].BrCl Chemical compound [Ag].BrCl SJOOOZPMQAWAOP-UHFFFAOYSA-N 0.000 description 3
- 150000003851 azoles Chemical class 0.000 description 3
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 3
- 239000012964 benzotriazole Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000001246 colloidal dispersion Methods 0.000 description 3
- 239000008098 formaldehyde solution Substances 0.000 description 3
- 239000001397 quillaja saponaria molina bark Substances 0.000 description 3
- 229930182490 saponin Natural products 0.000 description 3
- 150000007949 saponins Chemical class 0.000 description 3
- 150000003378 silver Chemical class 0.000 description 3
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 150000004763 sulfides Chemical class 0.000 description 3
- 229920001059 synthetic polymer Polymers 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- 229940071104 xylenesulfonate Drugs 0.000 description 3
- CYXJEHCKVOQFOV-UHFFFAOYSA-N (4-amino-2-methylphenyl) hydrogen sulfate Chemical compound CC1=CC(N)=CC=C1OS(O)(=O)=O CYXJEHCKVOQFOV-UHFFFAOYSA-N 0.000 description 2
- MBIZXFATKUQOOA-UHFFFAOYSA-N 1,3,4-thiadiazole Chemical compound C1=NN=CS1 MBIZXFATKUQOOA-UHFFFAOYSA-N 0.000 description 2
- UMDLZFVODZABIP-UHFFFAOYSA-N 3-methyl-1-sulfanylidene-2H-1,3-benzothiazole Chemical compound CN1CS(=S)C2=CC=CC=C12 UMDLZFVODZABIP-UHFFFAOYSA-N 0.000 description 2
- FOHWXVBZGSVUGO-UHFFFAOYSA-N 5-phenyl-3h-1,3,4-oxadiazole-2-thione Chemical compound O1C(S)=NN=C1C1=CC=CC=C1 FOHWXVBZGSVUGO-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- FKLJPTJMIBLJAV-UHFFFAOYSA-N Compound IV Chemical compound O1N=C(C)C=C1CCCCCCCOC1=CC=C(C=2OCCN=2)C=C1 FKLJPTJMIBLJAV-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 239000000084 colloidal system Substances 0.000 description 2
- 239000013068 control sample Substances 0.000 description 2
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- CBEQRNSPHCCXSH-UHFFFAOYSA-N iodine monobromide Chemical compound IBr CBEQRNSPHCCXSH-UHFFFAOYSA-N 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical compound C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- ZUNKMNLKJXRCDM-UHFFFAOYSA-N silver bromoiodide Chemical compound [Ag].IBr ZUNKMNLKJXRCDM-UHFFFAOYSA-N 0.000 description 2
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 2
- 229910052979 sodium sulfide Inorganic materials 0.000 description 2
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 2
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 2
- 235000019345 sodium thiosulphate Nutrition 0.000 description 2
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical class [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- 150000003536 tetrazoles Chemical class 0.000 description 2
- URAYPUMNDPQOKB-UHFFFAOYSA-N triacetin Chemical class CC(=O)OCC(OC(C)=O)COC(C)=O URAYPUMNDPQOKB-UHFFFAOYSA-N 0.000 description 2
- 238000004804 winding Methods 0.000 description 2
- HSYFJDYGOJKZCL-UHFFFAOYSA-L zinc;sulfite Chemical compound [Zn+2].[O-]S([O-])=O HSYFJDYGOJKZCL-UHFFFAOYSA-L 0.000 description 2
- GFQJZSIWWOBJKT-UHFFFAOYSA-N 2-(2-sulfanylidene-1,3-benzothiazol-3-yl)acetic acid Chemical compound C1=CC=C2SC(=S)N(CC(=O)O)C2=C1 GFQJZSIWWOBJKT-UHFFFAOYSA-N 0.000 description 1
- ORIHZIZPTZTNCU-VMPITWQZSA-N 2-[(E)-hydroxyiminomethyl]phenol Chemical compound O\N=C\C1=CC=CC=C1O ORIHZIZPTZTNCU-VMPITWQZSA-N 0.000 description 1
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 1
- ZEOMRHKTIYBETG-UHFFFAOYSA-N 2-phenyl-1,3,4-oxadiazole Chemical compound O1C=NN=C1C1=CC=CC=C1 ZEOMRHKTIYBETG-UHFFFAOYSA-N 0.000 description 1
- IRNRNPNZAKHEAW-UHFFFAOYSA-N 3-methyl-1,3-benzothiazole-2-thione Chemical compound C1=CC=C2SC(=S)N(C)C2=C1 IRNRNPNZAKHEAW-UHFFFAOYSA-N 0.000 description 1
- NGKNMHFWZMHABQ-UHFFFAOYSA-N 4-chloro-2h-benzotriazole Chemical compound ClC1=CC=CC2=NNN=C12 NGKNMHFWZMHABQ-UHFFFAOYSA-N 0.000 description 1
- HFGHRUCCKVYFKL-UHFFFAOYSA-N 4-ethoxy-2-piperazin-1-yl-7-pyridin-4-yl-5h-pyrimido[5,4-b]indole Chemical compound C1=C2NC=3C(OCC)=NC(N4CCNCC4)=NC=3C2=CC=C1C1=CC=NC=C1 HFGHRUCCKVYFKL-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- 241001131696 Eurystomus Species 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- NPKSPKHJBVJUKB-UHFFFAOYSA-N N-phenylglycine Chemical compound OC(=O)CNC1=CC=CC=C1 NPKSPKHJBVJUKB-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000002202 Polyethylene glycol Chemical class 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- 239000004133 Sodium thiosulphate Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 239000005083 Zinc sulfide Substances 0.000 description 1
- ZYDVNTYVDVZMKF-UHFFFAOYSA-N [Cl].[Ag] Chemical compound [Cl].[Ag] ZYDVNTYVDVZMKF-UHFFFAOYSA-N 0.000 description 1
- 229910052946 acanthite Inorganic materials 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- GAMPNQJDUFQVQO-UHFFFAOYSA-N acetic acid;phthalic acid Chemical compound CC(O)=O.OC(=O)C1=CC=CC=C1C(O)=O GAMPNQJDUFQVQO-UHFFFAOYSA-N 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- CODNYICXDISAEA-UHFFFAOYSA-N bromine monochloride Chemical compound BrCl CODNYICXDISAEA-UHFFFAOYSA-N 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- JIRRNZWTWJGJCT-UHFFFAOYSA-N carbamothioylthiourea Chemical compound NC(=S)NC(N)=S JIRRNZWTWJGJCT-UHFFFAOYSA-N 0.000 description 1
- XQUMHSCNAWJBLV-UHFFFAOYSA-N carbamoyl(sulfido)azanium Chemical class NC(=O)[NH2+][S-] XQUMHSCNAWJBLV-UHFFFAOYSA-N 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 229940081734 cellulose acetate phthalate Drugs 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 125000001142 dicarboxylic acid group Chemical group 0.000 description 1
- OAEGRYMCJYIXQT-UHFFFAOYSA-N dithiooxamide Chemical compound NC(=S)C(N)=S OAEGRYMCJYIXQT-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 235000019441 ethanol Nutrition 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 239000001087 glyceryl triacetate Substances 0.000 description 1
- 235000013773 glyceryl triacetate Nutrition 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229940046892 lead acetate Drugs 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 150000004866 oxadiazoles Chemical class 0.000 description 1
- AICOOMRHRUFYCM-ZRRPKQBOSA-N oxazine, 1 Chemical compound C([C@@H]1[C@H](C(C[C@]2(C)[C@@H]([C@H](C)N(C)C)[C@H](O)C[C@]21C)=O)CC1=CC2)C[C@H]1[C@@]1(C)[C@H]2N=C(C(C)C)OC1 AICOOMRHRUFYCM-ZRRPKQBOSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920001223 polyethylene glycol Chemical class 0.000 description 1
- 229920001021 polysulfide Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 229920001290 polyvinyl ester Polymers 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000010970 precious metal Substances 0.000 description 1
- NDGRWYRVNANFNB-UHFFFAOYSA-N pyrazolidin-3-one Chemical compound O=C1CCNN1 NDGRWYRVNANFNB-UHFFFAOYSA-N 0.000 description 1
- 239000000837 restrainer Substances 0.000 description 1
- 230000000979 retarding effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910001961 silver nitrate Inorganic materials 0.000 description 1
- 229940056910 silver sulfide Drugs 0.000 description 1
- XUARKZBEFFVFRG-UHFFFAOYSA-N silver sulfide Chemical compound [S-2].[Ag+].[Ag+] XUARKZBEFFVFRG-UHFFFAOYSA-N 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- VGTPCRGMBIAPIM-UHFFFAOYSA-M sodium thiocyanate Chemical compound [Na+].[S-]C#N VGTPCRGMBIAPIM-UHFFFAOYSA-M 0.000 description 1
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- RBWFXUOHBJGAMO-UHFFFAOYSA-N sulfanylidenebismuth Chemical class [Bi]=S RBWFXUOHBJGAMO-UHFFFAOYSA-N 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003464 sulfur compounds Chemical class 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 239000008399 tap water Substances 0.000 description 1
- 235000020679 tap water Nutrition 0.000 description 1
- UJMBCXLDXJUMFB-GLCFPVLVSA-K tartrazine Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)C1=NN(C=2C=CC(=CC=2)S([O-])(=O)=O)C(=O)C1\N=N\C1=CC=C(S([O-])(=O)=O)C=C1 UJMBCXLDXJUMFB-GLCFPVLVSA-K 0.000 description 1
- 229960000943 tartrazine Drugs 0.000 description 1
- 239000004149 tartrazine Substances 0.000 description 1
- 235000012756 tartrazine Nutrition 0.000 description 1
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 1
- YUKQRDCYNOVPGJ-UHFFFAOYSA-N thioacetamide Chemical compound CC(N)=S YUKQRDCYNOVPGJ-UHFFFAOYSA-N 0.000 description 1
- DLFVBJFMPXGRIB-UHFFFAOYSA-N thioacetamide Natural products CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 229960002622 triacetin Drugs 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008207 working material Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052984 zinc sulfide Inorganic materials 0.000 description 1
- DRDVZXDWVBGGMH-UHFFFAOYSA-N zinc;sulfide Chemical compound [S-2].[Zn+2] DRDVZXDWVBGGMH-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C8/00—Diffusion transfer processes or agents therefor; Photosensitive materials for such processes
- G03C8/24—Photosensitive materials characterised by the image-receiving section
- G03C8/243—Toners for the silver image
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C8/00—Diffusion transfer processes or agents therefor; Photosensitive materials for such processes
- G03C8/02—Photosensitive materials characterised by the image-forming section
- G03C8/04—Photosensitive materials characterised by the image-forming section the substances transferred by diffusion consisting of inorganic or organo-metallic compounds derived from photosensitive noble metals
- G03C8/06—Silver salt diffusion transfer
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Photosensitive Polymer And Photoresist Processing (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US586705A US3020155A (en) | 1956-05-23 | 1956-05-23 | Photographic diffusion transfer process |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1032091B true DE1032091B (de) | 1958-06-12 |
Family
ID=24346824
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEE14012A Pending DE1032091B (de) | 1956-05-23 | 1957-04-18 | Lichtempfindliches photographisches Material und photographisches Diffusionsuebertragungsverfahren |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3020155A (enExample) |
| BE (1) | BE557693A (enExample) |
| DE (1) | DE1032091B (enExample) |
| FR (1) | FR1192179A (enExample) |
| GB (2) | GB868241A (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE551270A (enExample) * | 1957-01-22 | |||
| NL131667C (enExample) * | 1957-10-25 | |||
| BE606550A (enExample) * | 1960-07-27 | |||
| US3260597A (en) * | 1960-12-02 | 1966-07-12 | Eastman Kodak Co | Photographic multicolor diffusion transfer process using dye developers and development arrestors |
| US3173789A (en) * | 1962-01-29 | 1965-03-16 | Eastman Kodak Co | Method and composition for inhibiting silver sludge in thiosulfate monobaths |
| US3265505A (en) * | 1962-04-02 | 1966-08-09 | Eastman Kodak Co | Photographic products |
| FR1370436A (fr) * | 1962-10-04 | 1964-08-21 | Kodak Pathe | Capsule à compartiments multiples et produit photographique la contenant |
| GB1053074A (enExample) * | 1963-04-09 | |||
| US3291608A (en) * | 1964-02-03 | 1966-12-13 | Eastman Kodak Co | Enhanced activity of nuclei for physical development |
| US3424580A (en) * | 1965-09-07 | 1969-01-28 | Horizons Inc | Photographic process for the direct production of positive images on metal |
| US3518160A (en) * | 1968-02-16 | 1970-06-30 | Eastman Kodak Co | Chemical transfer receiving sheets and a method of preparing such sheets |
| BR7000485D0 (pt) * | 1970-01-26 | 1973-04-26 | Eastman Kodak Co | Elemento de transferencia fotografica por difusao |
| JPS5436495B2 (enExample) * | 1971-11-09 | 1979-11-09 | ||
| GB1453932A (en) * | 1972-12-04 | 1976-10-27 | Minnesota Mining & Mfg | Lithographic plates and their preparation |
| US4093462A (en) * | 1976-11-11 | 1978-06-06 | Eastman Kodak Company | 2,5-Bis(secondary amino) oxa- and thiadiazole photographic developing agents |
| JPS56110927A (en) * | 1980-02-07 | 1981-09-02 | Mitsubishi Paper Mills Ltd | Manufacture of silver halide photographic material |
| JPS63271257A (ja) * | 1987-04-30 | 1988-11-09 | Fuji Photo Film Co Ltd | 銀塩拡散転写による画像形成方法 |
| US5272041A (en) * | 1990-10-19 | 1993-12-21 | Agfa-Gevaert, N.V. | Negative type lithographic printing plate |
| DE69413574T2 (de) * | 1993-02-09 | 1999-05-12 | Agfa-Gevaert N.V., Mortsel | Eine Verarbeitungslösung und Verfahren zur Herstellung einer lithographischen Offsetdruckplatte nach dem Silbersalz-Diffusionsübertragungsverfahren |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE352388A (enExample) * | 1927-07-16 | |||
| US1954337A (en) * | 1932-10-01 | 1934-04-10 | Eastman Kodak Co | Superficial coating for photographic elements |
| US2030860A (en) * | 1935-03-02 | 1936-02-18 | Eastman Kodak Co | Print-out emulsion |
| US2692830A (en) * | 1944-11-03 | 1954-10-26 | Polaroid Corp | Photographic silver halide transfer process |
| GB583648A (en) * | 1944-11-13 | 1946-12-23 | John David Kendall | Improvements in photographic materials |
| US2616805A (en) * | 1946-02-21 | 1952-11-04 | Polaroid Corp | Photographic film assembly comprising a photosensitive layer and another layer hingedly connected together |
| BE476512A (enExample) * | 1946-10-07 | |||
| FR960188A (enExample) * | 1947-01-28 | 1950-04-14 | ||
| US2698798A (en) * | 1949-05-21 | 1955-01-04 | Polaroid Corp | Color photographic process and product |
| BE502525A (enExample) * | 1950-04-15 | |||
| US2725296A (en) * | 1951-09-14 | 1955-11-29 | Eastman Kodak Co | Two-layer integral negative positive photographic material |
| US2688601A (en) * | 1951-09-27 | 1954-09-07 | Eastman Kodak Co | Preparation of silver dispersions |
| US2685510A (en) * | 1951-11-14 | 1954-08-03 | Eastman Kodak Co | Sensitive photographic element for use in the silk screen process |
| BE514019A (enExample) * | 1952-01-08 | |||
| US2725293A (en) * | 1952-04-01 | 1955-11-29 | Eastman Kodak Co | Photographic emulsion compositions and their preparation |
| BE521429A (enExample) * | 1952-07-16 | |||
| US2846309A (en) * | 1952-07-17 | 1958-08-05 | Polaroid Corp | Photographic products |
| US2704721A (en) * | 1954-04-22 | 1955-03-22 | Polaroid Corp | Photographic diffusion transfer reversal processes |
-
0
- BE BE557693D patent/BE557693A/xx unknown
-
1956
- 1956-05-23 US US586705A patent/US3020155A/en not_active Expired - Lifetime
-
1957
- 1957-04-18 DE DEE14012A patent/DE1032091B/de active Pending
- 1957-05-21 FR FR1192179D patent/FR1192179A/fr not_active Expired
- 1957-05-23 GB GB16445/57A patent/GB868241A/en not_active Expired
- 1957-05-23 GB GB37966/60A patent/GB868243A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR1192179A (fr) | 1959-10-23 |
| GB868243A (en) | 1961-05-17 |
| GB868241A (en) | 1961-05-17 |
| US3020155A (en) | 1962-02-06 |
| BE557693A (enExample) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1032091B (de) | Lichtempfindliches photographisches Material und photographisches Diffusionsuebertragungsverfahren | |
| DE927307C (de) | Verfahren zur photographischen Reproduktion von Druckschriften od. dgl. | |
| DE1547700A1 (de) | Verwendung von Schiff'schen Basen zur Entwicklung von belichtetem,photographischem Material | |
| DE850383C (de) | Verfahren zur Herstellung eines direktpositiven Bildes in einer Silberhalogenid-Emulsion | |
| DE2332802C2 (de) | Direktpositives photographisches Aufzeichnungsmaterial | |
| DE3343360A1 (de) | Verfahren zur entwicklung eines photographischen lichtempflindlichen silberhalogenidmaterials und photographisches lichtempflindliches silberhalogenidmaterial | |
| DE1233724B (de) | Verwendung von 5-Mercaptotetrazol-verbindungen als Antischleiermittel bei der Entwicklung photographischer Silberhalogenidemulsionen | |
| DE2429557C2 (de) | Verfahren zur Reproduktion von Halbtonbildern | |
| DE2302676A1 (de) | Photographisches mehrschichten-silberhalogenidmaterial fuer die verwendung in der farbphotographie | |
| DE1073306B (de) | Bildempfangsmaterial zur Verwendung im photographischen Silbersalzdiffusions-Ubertragungsverfahren und Verfahren zu dessen Herstellung | |
| DE1472757B2 (de) | Verfahren zur herstellung photographischer bilder | |
| DE1173798B (de) | Photographisches Silbersalzdiffusions-uebertragungsverfahren und hierfuer geeignetesBildempfangsmaterial | |
| DE2040801B2 (de) | Fixierentwickler- oder Aktivatorlösung für das Silbersalzdiffusionsverfahren, bei welchen keine Bildung von gefärbtem Schlamm auftritt | |
| DE1173338B (de) | Photographisches Silbersalzdiffusions-uebertragungsverfahren | |
| DE1447621A1 (de) | Photographisches Reproduktionsverfahren und Material zur Durchfuehrung des Verfahrens | |
| DE69227305T2 (de) | Verfahren und materiel zur photographischen verarbeitung | |
| DE859711C (de) | Verfahren zur direkten Herstellung von positiven photographischen Bildern | |
| DE3020262C2 (de) | Behandlungslösung für das Silbersalz-Diffusionsübertragungsverfahren | |
| DE1547902A1 (de) | Lichtempfindliche photographische Zubereitung | |
| DE1166000B (de) | Photographisches Aufnahme- und Bilduebertragungsverfahren | |
| DE1797388A1 (de) | Verfahren zur Herstellung photographischer Bilder | |
| DE2018063A1 (de) | Diffusionsübertragungsverfahren | |
| DE1124355B (de) | Verfahren zur Herstellung direkter Positive nach dem Silbersalzdiffusionsverfahren | |
| DE1547986C (de) | Verfahren zur Herstellung von photographischen Bildern, insbesondere nach dem Silbersalzdiffusionsverfahren | |
| DE1447621C (de) | Verfahren zur Herstellung von Silberbildern in einer bildmäßig photopolymerisierten Schicht |