DE1024746B - Mittel zur Unkrautbekaempfung und Beeinflussung des Pflanzenwachstums - Google Patents
Mittel zur Unkrautbekaempfung und Beeinflussung des PflanzenwachstumsInfo
- Publication number
- DE1024746B DE1024746B DEF22179A DEF0022179A DE1024746B DE 1024746 B DE1024746 B DE 1024746B DE F22179 A DEF22179 A DE F22179A DE F0022179 A DEF0022179 A DE F0022179A DE 1024746 B DE1024746 B DE 1024746B
- Authority
- DE
- Germany
- Prior art keywords
- oxime
- agent
- plant growth
- chlorophenyl
- ethyl ketone
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 241000196324 Embryophyta Species 0.000 title claims description 12
- 230000008635 plant growth Effects 0.000 title claims description 3
- 150000002923 oximes Chemical class 0.000 claims description 6
- -1 carbamide oximes Chemical class 0.000 claims description 5
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 4
- 239000004202 carbamide Substances 0.000 claims description 4
- 235000013877 carbamide Nutrition 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 239000004480 active ingredient Substances 0.000 claims 1
- 230000006735 deficit Effects 0.000 claims 1
- 230000035613 defoliation Effects 0.000 claims 1
- 238000003306 harvesting Methods 0.000 claims 1
- 238000000034 method Methods 0.000 claims 1
- 239000004009 herbicide Substances 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 235000007319 Avena orientalis Nutrition 0.000 description 3
- 244000075850 Avena orientalis Species 0.000 description 3
- 241000219198 Brassica Species 0.000 description 3
- 235000003351 Brassica cretica Nutrition 0.000 description 3
- 235000003343 Brassica rupestris Nutrition 0.000 description 3
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 235000010460 mustard Nutrition 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical group N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- RGSFGYAAUTVSQA-UHFFFAOYSA-N Cyclopentane Chemical compound C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 244000286177 Raphanus raphanistrum Species 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000003337 fertilizer Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 125000005842 heteroatom Chemical group 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical group C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 244000211187 Lepidium sativum Species 0.000 description 1
- 235000007849 Lepidium sativum Nutrition 0.000 description 1
- 241001300479 Macroptilium Species 0.000 description 1
- 235000000245 Raphanus raphanistrum subsp raphanistrum Nutrition 0.000 description 1
- 235000011380 Raphanus sativus Nutrition 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- DMEGYFMYUHOHGS-UHFFFAOYSA-N heptamethylene Natural products C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 230000007226 seed germination Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 125000004417 unsaturated alkyl group Chemical group 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/44—Radicals substituted by doubly-bound oxygen, sulfur, or nitrogen atoms, or by two such atoms singly-bound to the same carbon atom
- C07D213/53—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL106827D NL106827C (OSRAM) | 1957-01-21 | ||
| NL224194D NL224194A (OSRAM) | 1957-01-21 | ||
| BE564131D BE564131A (OSRAM) | 1957-01-21 | ||
| DEF22179A DE1024746B (de) | 1957-01-21 | 1957-01-21 | Mittel zur Unkrautbekaempfung und Beeinflussung des Pflanzenwachstums |
| CH5460158A CH366690A (de) | 1957-01-21 | 1958-01-13 | Mittel zur Unkrautbekämpfung und Beeinflussung des Pflanzenwachstums |
| US709169A US3063823A (en) | 1957-01-21 | 1958-01-16 | Method of killing weeds and influencing plant growth |
| GB2094/58A GB824534A (en) | 1957-01-21 | 1958-01-21 | Agents for killing weeds and influencing plant growth |
| FR1190302D FR1190302A (fr) | 1957-01-21 | 1958-01-21 | Agents pour la lutte contre les manuvaises herbes et pour influencer la croissance des plantes |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF22179A DE1024746B (de) | 1957-01-21 | 1957-01-21 | Mittel zur Unkrautbekaempfung und Beeinflussung des Pflanzenwachstums |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1024746B true DE1024746B (de) | 1958-02-20 |
Family
ID=7090346
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF22179A Pending DE1024746B (de) | 1957-01-21 | 1957-01-21 | Mittel zur Unkrautbekaempfung und Beeinflussung des Pflanzenwachstums |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3063823A (OSRAM) |
| BE (1) | BE564131A (OSRAM) |
| CH (1) | CH366690A (OSRAM) |
| DE (1) | DE1024746B (OSRAM) |
| FR (1) | FR1190302A (OSRAM) |
| GB (1) | GB824534A (OSRAM) |
| NL (2) | NL106827C (OSRAM) |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1174757B (de) * | 1962-12-22 | 1964-07-30 | Bayer Ag | Verfahren zur Herstellung von chlorierten Carbamidbenzaldoximen |
| DE1221840B (de) * | 1963-09-21 | 1966-07-28 | Bayer Ag | Mittel zur Bekaempfung von Wasserunkraeutern |
| DE1293147B (de) * | 1963-03-14 | 1969-04-24 | African Explosives & Chem | Phenylcarbamyloximverbindungen und deren Verwendung als insektizide Mittel |
| DE1299294B (de) * | 1962-09-25 | 1969-07-17 | Union Carbide Corp | Carbamoyloxime und Verfahren zu ihrer Herstellung |
| DE2216838A1 (de) * | 1971-04-08 | 1972-11-02 | Diamond Shamrock Corp., Cleveland, Ohio (V.StA.) | Ketoximcarbamate, Verfahren zu ihrer Herstellung und ihre Verwendung als Pesticide und in pesticiden Mitteln |
| DE2837204A1 (de) * | 1978-08-31 | 1980-03-06 | Ciba Geigy Ag | Oxim-carbamate und -carbonate zum schuetzen von pflanzenkulturen |
| US4315768A (en) | 1978-08-25 | 1982-02-16 | Sumitomo Chemical Company, Limited | Oximecarbamate derivatives, and their production and use |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH399823A (de) * | 1959-04-28 | 1965-09-30 | Philips Nv | Mittel zur Beeinflussung des Wachstums von Pflanzen |
| US3299137A (en) * | 1962-09-25 | 1967-01-17 | Union Carbide Corp | Acyclic hydrocarbon aldehyde carbamoyl oximes |
| US3400153A (en) * | 1964-09-23 | 1968-09-03 | Union Carbide Corp | Nitroalkyl carbamoyloximes |
| US3483246A (en) * | 1966-12-05 | 1969-12-09 | Mobil Oil Corp | Aromatic glyoxynitrile oximino carbanates |
| US3454642A (en) * | 1966-12-22 | 1969-07-08 | Upjohn Co | Alkyl 2-methylpropenyl ketoxime carbamates |
| US3493426A (en) * | 1967-01-03 | 1970-02-03 | Gen Mills Inc | Process of treating leather and fibrous material with polyisocyanate derivatives |
| US3547621A (en) * | 1967-05-29 | 1970-12-15 | Gulf Research Development Co | Method of combating weeds |
| US3541150A (en) * | 1968-05-15 | 1970-11-17 | Stauffer Chemical Co | Certain aldoxime substituted carbamates and their use as insecticides and acaricides |
| US3515536A (en) * | 1968-07-15 | 1970-06-02 | Fmc Corp | Phenyl-glyoxime as a novel plant growth regulator |
| US3880926A (en) * | 1968-07-17 | 1975-04-29 | Velsicol Chemical Corp | New compositions of matter |
| US3495968A (en) * | 1969-04-17 | 1970-02-17 | Mobil Oil Corp | Herbicidal composition and method of use |
| US3932509A (en) * | 1970-03-23 | 1976-01-13 | Ciba-Geigy Corporation | Carbamoyloximes derivatives |
| US3708590A (en) * | 1970-07-02 | 1973-01-02 | Stauffer Chemical Co | Method of controlling acarids with certain oxime esters |
| US3903303A (en) * | 1970-07-06 | 1975-09-02 | Stauffer Chemical Co | Controlling fungi and bacteria with certain oxime esters |
| US3819358A (en) * | 1971-02-23 | 1974-06-25 | Chemagro Corp | Retarding plant growth with cyclohexenone oximes |
| US4030912A (en) * | 1973-04-11 | 1977-06-21 | Hercules Incorporated | Certain oximinyl allophanates and their use as herbicides |
| US4115093A (en) * | 1975-10-28 | 1978-09-19 | Hercules Incorporated | Certain oximinyl allophanates and their use as herbicides |
| US4347372A (en) * | 1978-09-01 | 1982-08-31 | Ciba-Geigy Corporation | Benzoxazolyl-glyoxylonitrile-2-oxime ether derivatives |
| US4348414A (en) * | 1980-04-24 | 1982-09-07 | Ciba-Geigy Corporation | Cyclobutanone oxime carbamates, and use thereof in pest control |
| US4336199A (en) * | 1981-07-10 | 1982-06-22 | Morton-Norwich Products, Inc. | 5-(2,4-Dichlorophenyl)-3-furancarboxaldehyde-O-[(methylamino)carbonyl]oxime |
| WO2012047416A2 (en) * | 2010-10-05 | 2012-04-12 | Nahum Shpak | Plant growth medium |
| US8174931B2 (en) | 2010-10-08 | 2012-05-08 | HJ Laboratories, LLC | Apparatus and method for providing indoor location, position, or tracking of a mobile computer using building information |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2416198A (en) * | 1943-04-08 | 1947-02-18 | Staley Mfg Co A E | Growth promoting substances |
| US2769702A (en) * | 1952-02-09 | 1956-11-06 | Frank J Sowa | Herbicidal composition |
-
0
- NL NL224194D patent/NL224194A/xx unknown
- BE BE564131D patent/BE564131A/xx unknown
- NL NL106827D patent/NL106827C/xx active
-
1957
- 1957-01-21 DE DEF22179A patent/DE1024746B/de active Pending
-
1958
- 1958-01-13 CH CH5460158A patent/CH366690A/de unknown
- 1958-01-16 US US709169A patent/US3063823A/en not_active Expired - Lifetime
- 1958-01-21 GB GB2094/58A patent/GB824534A/en not_active Expired
- 1958-01-21 FR FR1190302D patent/FR1190302A/fr not_active Expired
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1299294B (de) * | 1962-09-25 | 1969-07-17 | Union Carbide Corp | Carbamoyloxime und Verfahren zu ihrer Herstellung |
| DE1174757B (de) * | 1962-12-22 | 1964-07-30 | Bayer Ag | Verfahren zur Herstellung von chlorierten Carbamidbenzaldoximen |
| DE1293147B (de) * | 1963-03-14 | 1969-04-24 | African Explosives & Chem | Phenylcarbamyloximverbindungen und deren Verwendung als insektizide Mittel |
| DE1221840B (de) * | 1963-09-21 | 1966-07-28 | Bayer Ag | Mittel zur Bekaempfung von Wasserunkraeutern |
| DE2216838A1 (de) * | 1971-04-08 | 1972-11-02 | Diamond Shamrock Corp., Cleveland, Ohio (V.StA.) | Ketoximcarbamate, Verfahren zu ihrer Herstellung und ihre Verwendung als Pesticide und in pesticiden Mitteln |
| US4315768A (en) | 1978-08-25 | 1982-02-16 | Sumitomo Chemical Company, Limited | Oximecarbamate derivatives, and their production and use |
| DE2837204A1 (de) * | 1978-08-31 | 1980-03-06 | Ciba Geigy Ag | Oxim-carbamate und -carbonate zum schuetzen von pflanzenkulturen |
Also Published As
| Publication number | Publication date |
|---|---|
| BE564131A (OSRAM) | |
| CH366690A (de) | 1963-01-15 |
| US3063823A (en) | 1962-11-13 |
| NL106827C (OSRAM) | |
| FR1190302A (fr) | 1959-10-12 |
| GB824534A (en) | 1959-12-02 |
| NL224194A (OSRAM) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1024746B (de) | Mittel zur Unkrautbekaempfung und Beeinflussung des Pflanzenwachstums | |
| DE1013302B (de) | Mittel zum voruebergehenden Sterilisieren von landwirtschaftlichen Kulturboeden | |
| DE1032595B (de) | Unkrautbekämpfungsmittel | |
| DE1039779B (de) | Unkrautbekaempfungsmittel | |
| DE1695989B2 (de) | 2-(3', 4'-dichlorphenyl)-4-methyl- 1,2,4-oxydiazolidin-3,5-dion, verfahren zu seiner herstellung und seine verwendung als herbizides mittel | |
| DE1302707B (OSRAM) | ||
| DE1135238B (de) | Mittel zur Hemmung des Pflanzenwachstums, insbesondere Unkrautvertilgungsmittel | |
| DE1148807B (de) | Maleinsaeurehydrazidderivate enthaltende Mittel zur Regulierung, insbesondere Hemmung, des Pflanzenwachstums | |
| DE2044735C3 (de) | Phenylharnstoffe, Verfahren zu ihrer Herstellung und diese enthaltende Schädlingsbekämpfungsmittel | |
| DE1249003B (de) | Herbizide Mittel | |
| DE1116469B (de) | Selektive herbicide Mittel | |
| DE2524880A1 (de) | Herbicides mittel | |
| DE1567009A1 (de) | Herbizide | |
| DE1107999B (de) | Unkrautbekaempfungsmittel | |
| DE2349970C2 (de) | N-Benzoyl-N-(3-chlor-4-fluorphenyl)-alanin-methylester und -isopropylester, Verfahren zu deren Herstellung und deren Verwendung | |
| DE1084078B (de) | Herbicide Mittel | |
| DE1542896A1 (de) | Selektives Herbizid | |
| DE1567153B2 (de) | Neue N-Carbamoyloxydicarbonsäureimide | |
| DD231979A5 (de) | Synergistische herbizide zusammensetzungen | |
| DE2541237A1 (de) | Herbizide zusammensetzungen | |
| DE2150107C3 (de) | Herbizide Mittel enthaltend Benzothiazolverbindungen | |
| AT254611B (de) | Mittel zur Beeinflussung des Pflanzenwachstums | |
| DE2361504A1 (de) | Regulatoren fuer das pflanzenwachstum | |
| AT227019B (de) | Herbizide Mittel | |
| AT243567B (de) | Bekämpfung des Wachstums von Pilsen |