DD147234A5 - Verfahren zur herstellung eines alkenderivates - Google Patents
Verfahren zur herstellung eines alkenderivates Download PDFInfo
- Publication number
- DD147234A5 DD147234A5 DD79216741A DD21674179A DD147234A5 DD 147234 A5 DD147234 A5 DD 147234A5 DD 79216741 A DD79216741 A DD 79216741A DD 21674179 A DD21674179 A DD 21674179A DD 147234 A5 DD147234 A5 DD 147234A5
- Authority
- DD
- German Democratic Republic
- Prior art keywords
- group
- formula
- methyl
- ethyl
- trans
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title 1
- 238000002360 preparation method Methods 0.000 claims abstract description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 20
- 238000000034 method Methods 0.000 claims description 19
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 19
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 18
- -1 2-ethylphenyl Chemical group 0.000 claims description 15
- 239000002253 acid Substances 0.000 claims description 13
- 150000001344 alkene derivatives Chemical class 0.000 claims description 11
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 125000005843 halogen group Chemical group 0.000 claims description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 7
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 6
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 claims description 5
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 claims description 4
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 claims description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 125000000623 heterocyclic group Chemical group 0.000 claims description 4
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 4
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 claims description 4
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 claims description 3
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 3
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 239000011737 fluorine Substances 0.000 claims description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 3
- 125000001624 naphthyl group Chemical group 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- 239000007858 starting material Substances 0.000 claims description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 3
- 125000004801 4-cyanophenyl group Chemical group [H]C1=C([H])C(C#N)=C([H])C([H])=C1* 0.000 claims description 2
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 239000012458 free base Substances 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 239000012948 isocyanate Substances 0.000 claims description 2
- 150000002513 isocyanates Chemical class 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 229910052740 iodine Inorganic materials 0.000 claims 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 abstract description 37
- 230000001833 anti-estrogenic effect Effects 0.000 abstract description 11
- 239000000328 estrogen antagonist Substances 0.000 abstract description 6
- 208000026310 Breast neoplasm Diseases 0.000 abstract description 3
- 230000002513 anti-ovulatory effect Effects 0.000 abstract description 3
- 230000036512 infertility Effects 0.000 abstract description 3
- 208000000509 infertility Diseases 0.000 abstract description 3
- 231100000535 infertility Toxicity 0.000 abstract description 3
- 239000000203 mixture Substances 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 14
- 239000000243 solution Substances 0.000 description 13
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- 238000002844 melting Methods 0.000 description 9
- 230000008018 melting Effects 0.000 description 9
- NKANXQFJJICGDU-QPLCGJKRSA-N Tamoxifen Chemical compound C=1C=CC=CC=1C(/CC)=C(C=1C=CC(OCCN(C)C)=CC=1)/C1=CC=CC=C1 NKANXQFJJICGDU-QPLCGJKRSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 241000700159 Rattus Species 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000008065 acid anhydrides Chemical class 0.000 description 3
- 150000001263 acyl chlorides Chemical class 0.000 description 3
- 229940046836 anti-estrogen Drugs 0.000 description 3
- 230000001076 estrogenic effect Effects 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 229960001603 tamoxifen Drugs 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 2
- VXNZUUAINFGPBY-UHFFFAOYSA-N ethyl ethylene Natural products CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 150000002440 hydroxy compounds Chemical class 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 1
- SPZLGMDGJRFSAU-UHFFFAOYSA-N 1,2-diphenylbut-1-en-1-ol Chemical compound C=1C=CC=CC=1C(CC)=C(O)C1=CC=CC=C1 SPZLGMDGJRFSAU-UHFFFAOYSA-N 0.000 description 1
- OQURWGJAWSLGQG-UHFFFAOYSA-N 1-isocyanatopropane Chemical compound CCCN=C=O OQURWGJAWSLGQG-UHFFFAOYSA-N 0.000 description 1
- VOXZDWNPVJITMN-ZBRFXRBCSA-N 17β-estradiol Chemical compound OC1=CC=C2[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3CCC2=C1 VOXZDWNPVJITMN-ZBRFXRBCSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- PJGFNNXYKMSCCU-UHFFFAOYSA-N 2-ethylbenzoyl chloride Chemical compound CCC1=CC=CC=C1C(Cl)=O PJGFNNXYKMSCCU-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 102000002322 Egg Proteins Human genes 0.000 description 1
- 108010000912 Egg Proteins Proteins 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 206010067572 Oestrogenic effect Diseases 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- SQHOHKQMTHROSF-UHFFFAOYSA-N but-1-en-2-ylbenzene Chemical compound CCC(=C)C1=CC=CC=C1 SQHOHKQMTHROSF-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 230000006003 cornification Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 229930182833 estradiol Natural products 0.000 description 1
- 229940011871 estrogen Drugs 0.000 description 1
- 239000000262 estrogen Substances 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 230000002611 ovarian Effects 0.000 description 1
- 210000004681 ovum Anatomy 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 230000035935 pregnancy Effects 0.000 description 1
- 125000006308 propyl amino group Chemical group 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 210000004291 uterus Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/02—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C217/04—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C217/06—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted
- C07C217/14—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to a carbon atom of a six-membered aromatic ring
- C07C217/18—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one etherified hydroxy group and one amino group bound to the carbon skeleton, which is not further substituted the oxygen atom of the etherified hydroxy group being further bound to a carbon atom of a six-membered aromatic ring the six-membered aromatic ring or condensed ring system containing that ring being further substituted
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB7843430 | 1978-11-07 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DD147234A5 true DD147234A5 (de) | 1981-03-25 |
Family
ID=10500848
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DD79216741A DD147234A5 (de) | 1978-11-07 | 1979-11-07 | Verfahren zur herstellung eines alkenderivates |
Country Status (18)
| Country | Link |
|---|---|
| EP (1) | EP0011372B1 (enExample) |
| JP (1) | JPS5566547A (enExample) |
| AT (1) | ATE2423T1 (enExample) |
| AU (1) | AU533581B2 (enExample) |
| CA (1) | CA1120945A (enExample) |
| DD (1) | DD147234A5 (enExample) |
| DE (1) | DE2964736D1 (enExample) |
| DK (1) | DK471979A (enExample) |
| ES (1) | ES485733A1 (enExample) |
| FI (1) | FI793459A7 (enExample) |
| GR (1) | GR71202B (enExample) |
| HU (1) | HU179722B (enExample) |
| IL (1) | IL58587A (enExample) |
| NO (1) | NO793578L (enExample) |
| NZ (1) | NZ191916A (enExample) |
| PT (1) | PT70411A (enExample) |
| ZA (1) | ZA795658B (enExample) |
| ZW (1) | ZW21179A1 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0107208A1 (de) * | 1982-10-26 | 1984-05-02 | Klinge Pharma GmbH | Neue 1,1,2-Triphenyl-but-1-en-Derivate, sowie Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0221368A3 (de) * | 1985-10-31 | 1988-05-04 | ASTA Pharma Aktiengesellschaft | Substituierte 1,1,2-Triphenylbut-1-ene |
| US5204337A (en) * | 1988-10-31 | 1993-04-20 | Endorecherche Inc. | Estrogen nucleus derivatives for use in inhibition of sex steroid activity |
| US5364847A (en) * | 1989-03-10 | 1994-11-15 | Endorecherche | Inhibitors of sex steroid biosynthesis and methods for their production and use |
| ZA924811B (en) * | 1991-06-28 | 1993-12-29 | Endorecherche Inc | Controlled release systems and low dose androgens |
| GB9824207D0 (en) * | 1998-11-04 | 1998-12-30 | Zeneca Ltd | Neurological disorders |
| IL146284A0 (en) | 1999-05-04 | 2002-07-25 | Strakan Ltd | Androgen glycosides and pharmaceutical compositions containing the same |
| US7531578B2 (en) * | 2003-09-18 | 2009-05-12 | City Of Hope | Compounds and methods for treating breast cancer and other diseases |
| JP4940429B2 (ja) * | 2006-09-19 | 2012-05-30 | 国立大学法人 岡山大学 | トリアリールエチルエテン誘導体の製造方法 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2914564A (en) * | 1957-08-06 | 1959-11-24 | Wm S Merrell Co | Amine derivatives of 1, 1, 2-triphenylethane |
| GB916171A (en) * | 1959-02-25 | 1963-01-23 | Ferrosan Ab | Improvements in or relating to diphenyl ethylene compounds having oestrogenic activity and processes for their preparation |
| GB945864A (en) * | 1961-08-18 | 1964-01-08 | Richardson Merrell Inc | Substituted triphenylethane |
| GB1029221A (en) * | 1963-09-02 | 1966-05-11 | Ici Ltd | Triarylalkane derivatives |
| HU171269B (hu) * | 1976-02-05 | 1977-12-28 | Gyogyszerkutato Intezet | Sposob poluchenija novykh proizvodnykh trifenil-alkenov |
| GB1560274A (en) * | 1977-02-28 | 1980-02-06 | Ici Ltd | Phenylbut 1-ene derivatives having antiostrogenicactivity |
-
1979
- 1979-10-10 EP EP79302169A patent/EP0011372B1/en not_active Expired
- 1979-10-10 AT AT79302169T patent/ATE2423T1/de not_active IP Right Cessation
- 1979-10-10 DE DE7979302169T patent/DE2964736D1/de not_active Expired
- 1979-10-22 ZA ZA00795658A patent/ZA795658B/xx unknown
- 1979-10-24 NZ NZ191916A patent/NZ191916A/en unknown
- 1979-10-24 ZW ZW211/79A patent/ZW21179A1/xx unknown
- 1979-10-26 AU AU52232/79A patent/AU533581B2/en not_active Ceased
- 1979-10-30 IL IL58587A patent/IL58587A/xx unknown
- 1979-11-03 GR GR60409A patent/GR71202B/el unknown
- 1979-11-05 FI FI793459A patent/FI793459A7/fi not_active Application Discontinuation
- 1979-11-05 PT PT70411A patent/PT70411A/pt unknown
- 1979-11-05 HU HU79IE897A patent/HU179722B/hu unknown
- 1979-11-06 NO NO793578A patent/NO793578L/no unknown
- 1979-11-06 ES ES485733A patent/ES485733A1/es not_active Expired
- 1979-11-07 CA CA000339388A patent/CA1120945A/en not_active Expired
- 1979-11-07 DK DK471979A patent/DK471979A/da not_active Application Discontinuation
- 1979-11-07 JP JP14341479A patent/JPS5566547A/ja active Granted
- 1979-11-07 DD DD79216741A patent/DD147234A5/de unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0107208A1 (de) * | 1982-10-26 | 1984-05-02 | Klinge Pharma GmbH | Neue 1,1,2-Triphenyl-but-1-en-Derivate, sowie Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel |
Also Published As
| Publication number | Publication date |
|---|---|
| HU179722B (en) | 1982-11-29 |
| EP0011372B1 (en) | 1983-02-09 |
| AU5223279A (en) | 1980-05-15 |
| AU533581B2 (en) | 1983-12-01 |
| FI793459A7 (fi) | 1981-01-01 |
| DE2964736D1 (en) | 1983-03-17 |
| JPS5566547A (en) | 1980-05-20 |
| DK471979A (da) | 1980-05-08 |
| NZ191916A (en) | 1984-09-28 |
| GR71202B (enExample) | 1983-04-11 |
| ES485733A1 (es) | 1980-07-01 |
| JPS638934B2 (enExample) | 1988-02-25 |
| NO793578L (no) | 1980-05-08 |
| CA1120945A (en) | 1982-03-30 |
| ZW21179A1 (en) | 1981-05-27 |
| EP0011372A1 (en) | 1980-05-28 |
| PT70411A (en) | 1979-12-01 |
| IL58587A0 (en) | 1980-01-31 |
| ATE2423T1 (de) | 1983-03-15 |
| IL58587A (en) | 1983-03-31 |
| ZA795658B (en) | 1981-03-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH538447A (de) | Verfahren zur Herstellung der cis- oder trans-Isomeren von Alkenderivaten | |
| EP0287690B1 (de) | Stabile Lösungsmitteladdukte von Z-1-(p-beta-Dimethylamino-ethoxyphenyl)-1-(p-hydroxyphenyl)-2-phenylbut-1-en | |
| DD139844A5 (de) | Verfahren zur herstellung eines azylanilids | |
| DD205904A5 (de) | Verfahren zur herstellung von imidazo (4,5-c) pyridin-derivaten | |
| DD159071A5 (de) | Verfahren zur darstellung von pyridoxinderivaten und ihre verwendung in therapeutica | |
| DE2047658B2 (de) | 2-Styryl- und 2-Phenyläthinylbenzylaminderivate, Verfahren zu deren Herstellung und diese enthaltende Arzneimittel | |
| DE1645929A1 (de) | Verfahren zur Herstellung von Spiro-tetralinsuccinimiden | |
| DD147234A5 (de) | Verfahren zur herstellung eines alkenderivates | |
| DE2455353C3 (de) | Substituierte a -Aminooxvcarbonsäurehydrazidderivate und ihre Säureadditionssalze sowie ihre Verwendung vnd Verfahren zur Herstellung derselben | |
| DD202433A5 (de) | Verfahren zur herstellung von amidobenzamiden | |
| DE2234057A1 (de) | Alpha-(alkylsubstituierte benzyloder thenyl)-benzyloxyderivate von aminen und ihre saeureadditionssalze sowie arzneipraeparat | |
| DD209194A5 (de) | Verfahren zur herstellung von als histamin h tief 2-rezeptor-antagonisten wirkenden pyrimidon-derivaten | |
| DE69424816T2 (de) | N-Benzylpiperazinverbindungen, Verfahren zu ihrer Herstellung und sie enthaltende Zusammensetzungen | |
| DE2427272C3 (de) | 1-(2-(β-Naphthyloxy)-äthyl)-3-methyl -pyrazolon-(5), Verfahren sowie Verwendung als Antithrombotikum | |
| DE2406065A1 (de) | Neue isoindolinderivate, ihre herstellung und die zusammensetzungen, die sie enthalten | |
| DE3142559A1 (de) | "pyrimidin-derivate" | |
| DE1921049A1 (de) | Neue organische Verbindungen und Verfahren zu ihrer Herstellung | |
| DE2351292C3 (de) | 2,10-Dichlor-6-äthoxycarbonyl-12-methyl-12H-dibenzo[d,g][1,3]dioxocin und Verfahren zu dessen Herstellung sowie diese Verbindung enthaltende Arzneimittel | |
| DE2657950A1 (de) | Trifluormethylthioderivate von cyproheptadin | |
| DE1620151B1 (de) | 10-Piperazino-dibenzo(a,d)cycloheptadienderivate und Verfahren zu ihrer Herstellung | |
| DE1966587A1 (de) | Neue thioamide und verfahren zu ihrer herstellung | |
| DE3324727C2 (enExample) | ||
| DE2519077B2 (de) | 3-Amino-4^,6,7-tetrahydroindazole, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Zubereitungen | |
| CH615181A5 (en) | Process for the preparation of novel ergolene derivatives | |
| DE1695080A1 (de) | Verfahren zur Herstellung von neuen N-heterocyclischen Verbindungen |