CH650005A5 - Verfahren zur herstellung eines selektiv geschuetzten n-acylierten aminoglycosid-antibiotikums. - Google Patents
Verfahren zur herstellung eines selektiv geschuetzten n-acylierten aminoglycosid-antibiotikums. Download PDFInfo
- Publication number
- CH650005A5 CH650005A5 CH184/84A CH1848479A CH650005A5 CH 650005 A5 CH650005 A5 CH 650005A5 CH 184/84 A CH184/84 A CH 184/84A CH 1848479 A CH1848479 A CH 1848479A CH 650005 A5 CH650005 A5 CH 650005A5
- Authority
- CH
- Switzerland
- Prior art keywords
- amino
- kanamycin
- preparation
- group
- benzyloxycarbonyl
- Prior art date
Links
- 239000002647 aminoglycoside antibiotic agent Substances 0.000 title claims description 44
- 229940126574 aminoglycoside antibiotic Drugs 0.000 title claims description 38
- 238000004519 manufacturing process Methods 0.000 title description 5
- 238000002360 preparation method Methods 0.000 claims description 201
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 131
- 229960000318 kanamycin Drugs 0.000 claims description 128
- 150000001875 compounds Chemical class 0.000 claims description 101
- -1 fatty acid ester Chemical class 0.000 claims description 93
- 238000000034 method Methods 0.000 claims description 72
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 68
- 125000003277 amino group Chemical group 0.000 claims description 44
- SBUJHOSQTJFQJX-NOAMYHISSA-N kanamycin Chemical class O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O[C@@H]2[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O2)O)[C@H](N)C[C@@H]1N SBUJHOSQTJFQJX-NOAMYHISSA-N 0.000 claims description 43
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 36
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 35
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 32
- 238000005917 acylation reaction Methods 0.000 claims description 31
- STSCVKRWJPWALQ-UHFFFAOYSA-N TRIFLUOROACETIC ACID ETHYL ESTER Chemical compound CCOC(=O)C(F)(F)F STSCVKRWJPWALQ-UHFFFAOYSA-N 0.000 claims description 29
- 125000002252 acyl group Chemical group 0.000 claims description 24
- 239000003795 chemical substances by application Substances 0.000 claims description 24
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 19
- 125000006239 protecting group Chemical group 0.000 claims description 19
- 229940126575 aminoglycoside Drugs 0.000 claims description 18
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 18
- 229960001192 bekanamycin Drugs 0.000 claims description 17
- 230000008569 process Effects 0.000 claims description 15
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 14
- 239000000194 fatty acid Substances 0.000 claims description 14
- 229930195729 fatty acid Natural products 0.000 claims description 14
- 230000010933 acylation Effects 0.000 claims description 13
- JJCQSGDBDPYCEO-XVZSLQNASA-N dibekacin Chemical compound O1[C@H](CN)CC[C@@H](N)[C@H]1O[C@H]1[C@H](O)[C@@H](O[C@@H]2[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O2)O)[C@H](N)C[C@@H]1N JJCQSGDBDPYCEO-XVZSLQNASA-N 0.000 claims description 12
- SKKLOUVUUNMCJE-FQSMHNGLSA-N kanamycin B Chemical compound N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O[C@@H]2[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O2)O)[C@H](N)C[C@@H]1N SKKLOUVUUNMCJE-FQSMHNGLSA-N 0.000 claims description 10
- 229930182824 kanamycin B Natural products 0.000 claims description 10
- 239000003960 organic solvent Substances 0.000 claims description 10
- DTFAJAKTSMLKAT-JDCCYXBGSA-N 2-deoxystreptamine Chemical group N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O)[C@@H]1O DTFAJAKTSMLKAT-JDCCYXBGSA-N 0.000 claims description 9
- 230000003115 biocidal effect Effects 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 229960005456 sisomicin Drugs 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 claims description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 claims description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 6
- URWAJWIAIPFPJE-UHFFFAOYSA-N Rickamicin Natural products O1CC(O)(C)C(NC)C(O)C1OC1C(O)C(OC2C(CC=C(CN)O2)N)C(N)CC1N URWAJWIAIPFPJE-UHFFFAOYSA-N 0.000 claims description 6
- 229930192786 Sisomicin Natural products 0.000 claims description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 6
- JXTHNDFMNIQAHM-UHFFFAOYSA-N dichloroacetic acid Chemical compound OC(=O)C(Cl)Cl JXTHNDFMNIQAHM-UHFFFAOYSA-N 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- NLVFBUXFDBBNBW-PBSUHMDJSA-N tobramycin Chemical compound N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O[C@@H]2[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O2)O)[C@H](N)C[C@@H]1N NLVFBUXFDBBNBW-PBSUHMDJSA-N 0.000 claims description 6
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 claims description 5
- UYWQUFXKFGHYNT-UHFFFAOYSA-N Benzylformate Chemical compound O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 claims description 5
- XBECWGJPSXHFCS-UHFFFAOYSA-N imidazole-1-carbaldehyde Chemical compound O=CN1C=CN=C1 XBECWGJPSXHFCS-UHFFFAOYSA-N 0.000 claims description 5
- 229960000808 netilmicin Drugs 0.000 claims description 5
- URWAJWIAIPFPJE-YFMIWBNJSA-N sisomycin Chemical compound O1C[C@@](O)(C)[C@H](NC)[C@@H](O)[C@H]1O[C@@H]1[C@@H](O)[C@H](O[C@@H]2[C@@H](CC=C(CN)O2)N)[C@@H](N)C[C@H]1N URWAJWIAIPFPJE-YFMIWBNJSA-N 0.000 claims description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 4
- 229930182825 Kanamycin C Natural products 0.000 claims description 4
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 claims description 4
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 claims description 4
- NMJJFJNHVMGPGM-UHFFFAOYSA-N butyl formate Chemical compound CCCCOC=O NMJJFJNHVMGPGM-UHFFFAOYSA-N 0.000 claims description 4
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 claims description 4
- WZDRWYJKESFZMB-FQSMHNGLSA-N kanamycin C Chemical compound O([C@H]1[C@H](N)C[C@@H]([C@H]([C@@H]1O)O[C@@H]1[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O1)N)N)[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O WZDRWYJKESFZMB-FQSMHNGLSA-N 0.000 claims description 4
- TZIHFWKZFHZASV-UHFFFAOYSA-N methyl formate Chemical compound COC=O TZIHFWKZFHZASV-UHFFFAOYSA-N 0.000 claims description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 125000004104 aryloxy group Chemical group 0.000 claims description 3
- VHFUHRXYRYWELT-UHFFFAOYSA-N methyl 2,2,2-trichloroacetate Chemical compound COC(=O)C(Cl)(Cl)Cl VHFUHRXYRYWELT-UHFFFAOYSA-N 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- ZBGPYVZLYBDXKO-HILBYHGXSA-N netilmycin Chemical compound O([C@@H]1[C@@H](N)C[C@H]([C@@H]([C@H]1O)O[C@@H]1[C@]([C@H](NC)[C@@H](O)CO1)(C)O)NCC)[C@H]1OC(CN)=CC[C@H]1N ZBGPYVZLYBDXKO-HILBYHGXSA-N 0.000 claims description 3
- DVCMYAIUSOSIQP-UHFFFAOYSA-N phenyl 2,2,2-trifluoroacetate Chemical compound FC(F)(F)C(=O)OC1=CC=CC=C1 DVCMYAIUSOSIQP-UHFFFAOYSA-N 0.000 claims description 3
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 claims description 3
- XUSXOPRDIDWMFO-CTMSJIKGSA-N (2r,3r,4r,5r)-2-[(1s,2s,3r,4s,6r)-4,6-diamino-3-[[(2s,3r)-3-amino-6-[(1s)-1-aminoethyl]-3,4-dihydro-2h-pyran-2-yl]oxy]-2-hydroxycyclohexyl]oxy-5-methyl-4-(methylamino)oxane-3,5-diol Chemical compound O1C[C@@](O)(C)[C@H](NC)[C@@H](O)[C@H]1O[C@@H]1[C@@H](O)[C@H](O[C@@H]2[C@@H](CC=C(O2)[C@H](C)N)N)[C@@H](N)C[C@H]1N XUSXOPRDIDWMFO-CTMSJIKGSA-N 0.000 claims description 2
- XUSXOPRDIDWMFO-UHFFFAOYSA-N Verdamicin Natural products O1CC(O)(C)C(NC)C(O)C1OC1C(O)C(OC2C(CC=C(O2)C(C)N)N)C(N)CC1N XUSXOPRDIDWMFO-UHFFFAOYSA-N 0.000 claims description 2
- 125000004982 dihaloalkyl group Chemical group 0.000 claims description 2
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 claims description 2
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 claims description 2
- YKSMEBWOLIJQNM-UHFFFAOYSA-N phenyl 2,2,2-trichloroacetate Chemical compound ClC(Cl)(Cl)C(=O)OC1=CC=CC=C1 YKSMEBWOLIJQNM-UHFFFAOYSA-N 0.000 claims description 2
- LKKVGKXCMYHKSL-LLZRLKDCSA-N gentamycin A Chemical compound O[C@H]1[C@H](NC)[C@@H](O)CO[C@H]1O[C@@H]1[C@@H](O)[C@H](O[C@@H]2[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O2)N)[C@@H](N)C[C@H]1N LKKVGKXCMYHKSL-LLZRLKDCSA-N 0.000 claims 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 claims 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 claims 1
- 125000002102 aryl alkyloxo group Chemical group 0.000 claims 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims 1
- RHRAMPXHWHSKQB-GGEUKFTFSA-N betamicin Chemical compound O1C[C@@](O)(C)[C@H](NC)[C@@H](O)[C@H]1O[C@@H]1[C@@H](O)[C@H](O[C@@H]2[C@@H]([C@@H](O)[C@H](O)[C@@H](CN)O2)O)[C@@H](N)C[C@H]1N RHRAMPXHWHSKQB-GGEUKFTFSA-N 0.000 claims 1
- 229940120124 dichloroacetate Drugs 0.000 claims 1
- IWYBVQLPTCMVFO-UHFFFAOYSA-N ethyl 2,2-dichloroacetate Chemical compound CCOC(=O)C(Cl)Cl IWYBVQLPTCMVFO-UHFFFAOYSA-N 0.000 claims 1
- RHRAMPXHWHSKQB-UHFFFAOYSA-N gentamicin B Natural products O1CC(O)(C)C(NC)C(O)C1OC1C(O)C(OC2C(C(O)C(O)C(CN)O2)O)C(N)CC1N RHRAMPXHWHSKQB-UHFFFAOYSA-N 0.000 claims 1
- VEGXETMJINRLTH-BOZYPMBZSA-N gentamycin C1a Chemical compound O1C[C@@](O)(C)[C@H](NC)[C@@H](O)[C@H]1O[C@@H]1[C@@H](O)[C@H](O[C@@H]2[C@@H](CC[C@@H](CN)O2)N)[C@@H](N)C[C@H]1N VEGXETMJINRLTH-BOZYPMBZSA-N 0.000 claims 1
- 125000004385 trihaloalkyl group Chemical group 0.000 claims 1
- 239000000243 solution Substances 0.000 description 162
- 239000000203 mixture Substances 0.000 description 111
- 239000007787 solid Substances 0.000 description 103
- 239000000047 product Substances 0.000 description 83
- 238000006243 chemical reaction Methods 0.000 description 66
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 65
- WHQSYGRFZMUQGQ-UHFFFAOYSA-N n,n-dimethylformamide;hydrate Chemical compound O.CN(C)C=O WHQSYGRFZMUQGQ-UHFFFAOYSA-N 0.000 description 48
- 229930182823 kanamycin A Natural products 0.000 description 41
- 239000000126 substance Substances 0.000 description 39
- 229910052725 zinc Inorganic materials 0.000 description 38
- 239000011701 zinc Substances 0.000 description 38
- RNHDAKUGFHSZEV-UHFFFAOYSA-N 1,4-dioxane;hydrate Chemical compound O.C1COCCO1 RNHDAKUGFHSZEV-UHFFFAOYSA-N 0.000 description 36
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 32
- 239000012458 free base Substances 0.000 description 31
- 239000000463 material Substances 0.000 description 31
- 229960003807 dibekacin Drugs 0.000 description 29
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 27
- 239000011347 resin Substances 0.000 description 23
- 229920005989 resin Polymers 0.000 description 23
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 22
- 239000000908 ammonium hydroxide Substances 0.000 description 22
- YZYKBQUWMPUVEN-UHFFFAOYSA-N zafuleptine Chemical compound OC(=O)CCCCCC(C(C)C)NCC1=CC=C(F)C=C1 YZYKBQUWMPUVEN-UHFFFAOYSA-N 0.000 description 22
- 239000000725 suspension Substances 0.000 description 21
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 19
- 238000000921 elemental analysis Methods 0.000 description 19
- MJSHDCCLFGOEIK-UHFFFAOYSA-N benzyl (2,5-dioxopyrrolidin-1-yl) carbonate Chemical compound O=C1CCC(=O)N1OC(=O)OCC1=CC=CC=C1 MJSHDCCLFGOEIK-UHFFFAOYSA-N 0.000 description 18
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 18
- 229940006486 zinc cation Drugs 0.000 description 18
- PTFCDOFLOPIGGS-UHFFFAOYSA-N Zinc dication Chemical compound [Zn+2] PTFCDOFLOPIGGS-UHFFFAOYSA-N 0.000 description 16
- 239000011541 reaction mixture Substances 0.000 description 15
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 14
- 150000002148 esters Chemical class 0.000 description 14
- 239000012456 homogeneous solution Substances 0.000 description 14
- 229960000707 tobramycin Drugs 0.000 description 13
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 12
- 230000002378 acidificating effect Effects 0.000 description 12
- 239000002244 precipitate Substances 0.000 description 12
- 229910052723 transition metal Inorganic materials 0.000 description 12
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 11
- 229920001467 poly(styrenesulfonates) Polymers 0.000 description 11
- 239000002904 solvent Substances 0.000 description 11
- 239000007858 starting material Substances 0.000 description 11
- 238000004458 analytical method Methods 0.000 description 10
- 230000015572 biosynthetic process Effects 0.000 description 10
- BSCHIACBONPEOB-UHFFFAOYSA-N oxolane;hydrate Chemical compound O.C1CCOC1 BSCHIACBONPEOB-UHFFFAOYSA-N 0.000 description 10
- BDAGIHXWWSANSR-UHFFFAOYSA-N Formic acid Chemical class OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 229920005654 Sephadex Polymers 0.000 description 9
- 229920001429 chelating resin Polymers 0.000 description 9
- 238000010828 elution Methods 0.000 description 9
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 9
- NMHMNPHRMNGLLB-UHFFFAOYSA-N phloretic acid Chemical compound OC(=O)CCC1=CC=C(O)C=C1 NMHMNPHRMNGLLB-UHFFFAOYSA-N 0.000 description 9
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 8
- 239000012507 Sephadex™ Substances 0.000 description 8
- 239000003242 anti bacterial agent Substances 0.000 description 8
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 8
- 238000005755 formation reaction Methods 0.000 description 8
- 238000007327 hydrogenolysis reaction Methods 0.000 description 8
- 229930027917 kanamycin Natural products 0.000 description 8
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 7
- ZOIORXHNWRGPMV-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].CC(O)=O.CC(O)=O ZOIORXHNWRGPMV-UHFFFAOYSA-N 0.000 description 7
- 125000003282 alkyl amino group Chemical group 0.000 description 7
- 229940088710 antibiotic agent Drugs 0.000 description 7
- 239000012141 concentrate Substances 0.000 description 7
- 235000008504 concentrate Nutrition 0.000 description 7
- 230000009257 reactivity Effects 0.000 description 7
- 239000004246 zinc acetate Substances 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 125000000524 functional group Chemical group 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 6
- SOHCYNFHNYKSTM-UHFFFAOYSA-N methylsulfinylmethane;oxolane Chemical compound CS(C)=O.C1CCOC1 SOHCYNFHNYKSTM-UHFFFAOYSA-N 0.000 description 6
- FEMOMIGRRWSMCU-UHFFFAOYSA-N ninhydrin Chemical compound C1=CC=C2C(=O)C(O)(O)C(=O)C2=C1 FEMOMIGRRWSMCU-UHFFFAOYSA-N 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- 229920001661 Chitosan Polymers 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 230000000844 anti-bacterial effect Effects 0.000 description 5
- WPYMKLBDIGXBTP-UHFFFAOYSA-M benzoate Chemical compound [O-]C(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-M 0.000 description 5
- 150000001768 cations Chemical class 0.000 description 5
- XLJKHNWPARRRJB-UHFFFAOYSA-N cobalt(2+) Chemical compound [Co+2] XLJKHNWPARRRJB-UHFFFAOYSA-N 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 235000019253 formic acid Nutrition 0.000 description 5
- 229920006395 saturated elastomer Polymers 0.000 description 5
- 239000011343 solid material Substances 0.000 description 5
- 238000004809 thin layer chromatography Methods 0.000 description 5
- 150000003751 zinc Chemical class 0.000 description 5
- ULKOBRDRCYROKY-JTQLQIEISA-N (2s)-2-hydroxy-4-(phenylmethoxycarbonylamino)butanoic acid Chemical compound OC(=O)[C@@H](O)CCNC(=O)OCC1=CC=CC=C1 ULKOBRDRCYROKY-JTQLQIEISA-N 0.000 description 4
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 4
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- VEQPNABPJHWNSG-UHFFFAOYSA-N Nickel(2+) Chemical compound [Ni+2] VEQPNABPJHWNSG-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 4
- 150000001408 amides Chemical class 0.000 description 4
- 239000006227 byproduct Substances 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 4
- 239000003153 chemical reaction reagent Substances 0.000 description 4
- 230000009918 complex formation Effects 0.000 description 4
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 4
- 230000007246 mechanism Effects 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- IVUOMFWNDGNLBJ-VKHMYHEASA-N (2s)-4-amino-2-hydroxybutanoic acid Chemical compound NCC[C@H](O)C(O)=O IVUOMFWNDGNLBJ-VKHMYHEASA-N 0.000 description 3
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- HOSGXJWQVBHGLT-UHFFFAOYSA-N 6-hydroxy-3,4-dihydro-1h-quinolin-2-one Chemical group N1C(=O)CCC2=CC(O)=CC=C21 HOSGXJWQVBHGLT-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- 229930182566 Gentamicin Natural products 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 3
- VXAJKASSSZYKFA-UHFFFAOYSA-N azanium;oxolane;hydroxide Chemical compound N.O.C1CCOC1 VXAJKASSSZYKFA-UHFFFAOYSA-N 0.000 description 3
- 238000005976 benzyloxycarbonylation reaction Methods 0.000 description 3
- 230000000903 blocking effect Effects 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 239000003729 cation exchange resin Substances 0.000 description 3
- 238000011161 development Methods 0.000 description 3
- ZFTFAPZRGNKQPU-UHFFFAOYSA-N dicarbonic acid Chemical compound OC(=O)OC(O)=O ZFTFAPZRGNKQPU-UHFFFAOYSA-N 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 150000004665 fatty acids Chemical class 0.000 description 3
- CEAZRRDELHUEMR-UHFFFAOYSA-N gentamicin Chemical class O1C(C(C)NC)CCC(N)C1OC1C(O)C(OC2C(C(NC)C(C)(O)CO2)O)C(N)CC1N CEAZRRDELHUEMR-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N hydrochloric acid Substances Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- 238000011835 investigation Methods 0.000 description 3
- HKMLRUAPIDAGIE-UHFFFAOYSA-N methyl 2,2-dichloroacetate Chemical compound COC(=O)C(Cl)Cl HKMLRUAPIDAGIE-UHFFFAOYSA-N 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 238000005583 trifluoroacetylation reaction Methods 0.000 description 3
- GMWQKAHYINBSDJ-UHFFFAOYSA-N 2-hydroxy-3-(phenylmethoxycarbonylamino)propanoic acid Chemical compound OC(=O)C(O)CNC(=O)OCC1=CC=CC=C1 GMWQKAHYINBSDJ-UHFFFAOYSA-N 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 2
- KSPIHGBHKVISFI-UHFFFAOYSA-N Diphenylcarbazide Chemical compound C=1C=CC=CC=1NNC(=O)NNC1=CC=CC=C1 KSPIHGBHKVISFI-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- VIHYIVKEECZGOU-UHFFFAOYSA-N N-acetylimidazole Chemical compound CC(=O)N1C=CN=C1 VIHYIVKEECZGOU-UHFFFAOYSA-N 0.000 description 2
- ATHHXGZTWNVVOU-UHFFFAOYSA-N N-methylformamide Chemical compound CNC=O ATHHXGZTWNVVOU-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 229960004821 amikacin Drugs 0.000 description 2
- LKCWBDHBTVXHDL-RMDFUYIESA-N amikacin Chemical compound O([C@@H]1[C@@H](N)C[C@H]([C@@H]([C@H]1O)O[C@@H]1[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O1)O)NC(=O)[C@@H](O)CCN)[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O LKCWBDHBTVXHDL-RMDFUYIESA-N 0.000 description 2
- 239000003957 anion exchange resin Substances 0.000 description 2
- 125000005098 aryl alkoxy carbonyl group Chemical group 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 229910052793 cadmium Inorganic materials 0.000 description 2
- 229910017052 cobalt Inorganic materials 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- 230000000536 complexating effect Effects 0.000 description 2
- 238000010668 complexation reaction Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 150000004696 coordination complex Chemical class 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 229960005215 dichloroacetic acid Drugs 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- FCZCIXQGZOUIDN-UHFFFAOYSA-N ethyl 2-diethoxyphosphinothioyloxyacetate Chemical compound CCOC(=O)COP(=S)(OCC)OCC FCZCIXQGZOUIDN-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000006170 formylation reaction Methods 0.000 description 2
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000007791 liquid phase Substances 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- 229920001184 polypeptide Polymers 0.000 description 2
- 102000004196 processed proteins & peptides Human genes 0.000 description 2
- 108090000765 processed proteins & peptides Proteins 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011877 solvent mixture Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 150000003624 transition metals Chemical class 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- BEAZKUGSCHFXIQ-UHFFFAOYSA-L zinc;diacetate;dihydrate Chemical compound O.O.[Zn+2].CC([O-])=O.CC([O-])=O BEAZKUGSCHFXIQ-UHFFFAOYSA-L 0.000 description 2
- XVSUHPJUBCTHRA-ZDUSSCGKSA-N (2S)-2-amino-2-hydroxy-5-[(4-methoxyphenyl)methoxy]-5-oxopentanoic acid Chemical compound COC1=CC=C(COC(=O)CC[C@@](C(=O)O)(O)N)C=C1 XVSUHPJUBCTHRA-ZDUSSCGKSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UWTATZPHSA-N (2r)-3-azaniumyl-2-hydroxypropanoate Chemical compound [NH3+]C[C@@H](O)C([O-])=O BMYNFMYTOJXKLE-UWTATZPHSA-N 0.000 description 1
- BMYNFMYTOJXKLE-REOHCLBHSA-N (2s)-3-azaniumyl-2-hydroxypropanoate Chemical compound [NH3+]C[C@H](O)C([O-])=O BMYNFMYTOJXKLE-REOHCLBHSA-N 0.000 description 1
- AFENDNXGAFYKQO-VKHMYHEASA-N (S)-2-hydroxybutyric acid Chemical compound CC[C@H](O)C(O)=O AFENDNXGAFYKQO-VKHMYHEASA-N 0.000 description 1
- SPEUIVXLLWOEMJ-UHFFFAOYSA-N 1,1-dimethoxyethane Chemical compound COC(C)OC SPEUIVXLLWOEMJ-UHFFFAOYSA-N 0.000 description 1
- FRBJFEASMICLGH-UHFFFAOYSA-N 1-imidazol-1-ylbutan-1-one Chemical compound CCCC(=O)N1C=CN=C1 FRBJFEASMICLGH-UHFFFAOYSA-N 0.000 description 1
- WGDFMQPPAYDVMD-UHFFFAOYSA-N 3-amino-2-hydroxy-4-oxo-4-phenylmethoxybutanoic acid Chemical compound OC(=O)C(O)C(N)C(=O)OCC1=CC=CC=C1 WGDFMQPPAYDVMD-UHFFFAOYSA-N 0.000 description 1
- UGNSMKDDFAUGFT-UHFFFAOYSA-N 4,4-dimethyl-2-phenyl-5h-1,3-oxazole Chemical compound CC1(C)COC(C=2C=CC=CC=2)=N1 UGNSMKDDFAUGFT-UHFFFAOYSA-N 0.000 description 1
- OTLNPYWUJOZPPA-UHFFFAOYSA-M 4-nitrobenzoate Chemical compound [O-]C(=O)C1=CC=C([N+]([O-])=O)C=C1 OTLNPYWUJOZPPA-UHFFFAOYSA-M 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical class CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- GDBUORNHWAZSNU-UHFFFAOYSA-N N-propanoylimidazole Chemical compound CCC(=O)N1C=CN=C1 GDBUORNHWAZSNU-UHFFFAOYSA-N 0.000 description 1
- 235000016496 Panda oleosa Nutrition 0.000 description 1
- 240000000220 Panda oleosa Species 0.000 description 1
- 229910006069 SO3H Inorganic materials 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- XGRYDJSRYGHYOO-UHFFFAOYSA-N Thesine Natural products C1=CC(O)=CC=C1C1C(C(=O)OCC2C3CCCN3CC2)C(C=2C=CC(O)=CC=2)C1C(=O)OCC1C2CCCN2CC1 XGRYDJSRYGHYOO-UHFFFAOYSA-N 0.000 description 1
- 239000005083 Zinc sulfide Substances 0.000 description 1
- KQNKJJBFUFKYFX-UHFFFAOYSA-N acetic acid;trihydrate Chemical compound O.O.O.CC(O)=O KQNKJJBFUFKYFX-UHFFFAOYSA-N 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 238000005349 anion exchange Methods 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000005140 aralkylsulfonyl group Chemical group 0.000 description 1
- 125000003435 aroyl group Chemical group 0.000 description 1
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- OOMGRWNPCPICJN-UHFFFAOYSA-N benzyl (2,5-dioxopyrrolidin-3-yl) carbonate Chemical compound C1C(=O)NC(=O)C1OC(=O)OCC1=CC=CC=C1 OOMGRWNPCPICJN-UHFFFAOYSA-N 0.000 description 1
- LGUHADBEXWHGIZ-UHFFFAOYSA-N butyl n-diazocarbamate Chemical compound CCCCOC(=O)N=[N+]=[N-] LGUHADBEXWHGIZ-UHFFFAOYSA-N 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- WLZRMCYVCSSEQC-UHFFFAOYSA-N cadmium(2+) Chemical compound [Cd+2] WLZRMCYVCSSEQC-UHFFFAOYSA-N 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- JYYOBHFYCIDXHH-UHFFFAOYSA-N carbonic acid;hydrate Chemical compound O.OC(O)=O JYYOBHFYCIDXHH-UHFFFAOYSA-N 0.000 description 1
- 150000007942 carboxylates Chemical group 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical group 0.000 description 1
- 239000013522 chelant Substances 0.000 description 1
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 238000005352 clarification Methods 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- OYFJQPXVCSSHAI-QFPUQLAESA-N enalapril maleate Chemical compound OC(=O)\C=C/C(O)=O.C([C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(O)=O)CC1=CC=CC=C1 OYFJQPXVCSSHAI-QFPUQLAESA-N 0.000 description 1
- 238000003912 environmental pollution Methods 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- PUSKHXMZPOMNTQ-UHFFFAOYSA-N ethyl 2,1,3-benzoselenadiazole-5-carboxylate Chemical compound CCOC(=O)C1=CC=C2N=[Se]=NC2=C1 PUSKHXMZPOMNTQ-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000012847 fine chemical Substances 0.000 description 1
- QEWYKACRFQMRMB-UHFFFAOYSA-N fluoroacetic acid Chemical compound OC(=O)CF QEWYKACRFQMRMB-UHFFFAOYSA-N 0.000 description 1
- 230000022244 formylation Effects 0.000 description 1
- 238000002523 gelfiltration Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 229930182470 glycoside Natural products 0.000 description 1
- 150000002338 glycosides Chemical class 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 230000001404 mediated effect Effects 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- VMVNZNXAVJHNDJ-UHFFFAOYSA-N methyl 2,2,2-trifluoroacetate Chemical compound COC(=O)C(F)(F)F VMVNZNXAVJHNDJ-UHFFFAOYSA-N 0.000 description 1
- PGXWDLGWMQIXDT-UHFFFAOYSA-N methylsulfinylmethane;hydrate Chemical compound O.CS(C)=O PGXWDLGWMQIXDT-UHFFFAOYSA-N 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000002815 nickel Chemical class 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- AHWALFGBDFAJAI-UHFFFAOYSA-N phenyl carbonochloridate Chemical compound ClC(=O)OC1=CC=CC=C1 AHWALFGBDFAJAI-UHFFFAOYSA-N 0.000 description 1
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 1
- 125000000612 phthaloyl group Chemical group C(C=1C(C(=O)*)=CC=CC1)(=O)* 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 238000005476 soldering Methods 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- ISHLCKAQWKBMAU-UHFFFAOYSA-N tert-butyl n-diazocarbamate Chemical compound CC(C)(C)OC(=O)N=[N+]=[N-] ISHLCKAQWKBMAU-UHFFFAOYSA-N 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 229920003176 water-insoluble polymer Polymers 0.000 description 1
- 239000012608 weak cation exchange resin Substances 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- 229910052984 zinc sulfide Inorganic materials 0.000 description 1
- DRDVZXDWVBGGMH-UHFFFAOYSA-N zinc;sulfide Chemical compound [S-2].[Zn+2] DRDVZXDWVBGGMH-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07H—SUGARS; DERIVATIVES THEREOF; NUCLEOSIDES; NUCLEOTIDES; NUCLEIC ACIDS
- C07H23/00—Compounds containing boron, silicon or a metal, e.g. chelates or vitamin B12
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07H—SUGARS; DERIVATIVES THEREOF; NUCLEOSIDES; NUCLEOTIDES; NUCLEIC ACIDS
- C07H15/00—Compounds containing hydrocarbon or substituted hydrocarbon radicals directly attached to hetero atoms of saccharide radicals
- C07H15/20—Carbocyclic rings
- C07H15/22—Cyclohexane rings, substituted by nitrogen atoms
- C07H15/222—Cyclohexane rings substituted by at least two nitrogen atoms
- C07H15/226—Cyclohexane rings substituted by at least two nitrogen atoms with at least two saccharide radicals directly attached to the cyclohexane rings
- C07H15/234—Cyclohexane rings substituted by at least two nitrogen atoms with at least two saccharide radicals directly attached to the cyclohexane rings attached to non-adjacent ring carbon atoms of the cyclohexane rings, e.g. kanamycins, tobramycin, nebramycin, gentamicin A2
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Biochemistry (AREA)
- Biotechnology (AREA)
- General Health & Medical Sciences (AREA)
- Genetics & Genomics (AREA)
- Molecular Biology (AREA)
- Saccharide Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP13840278A JPS5564598A (en) | 1978-11-11 | 1978-11-11 | Preparation of aminoglycoside antibiotic having selectively protected amino group |
| JP7306479A JPS55164696A (en) | 1979-06-12 | 1979-06-12 | Preparation of protected derivative of aminoglycoside antibiotic substance wherein amino groups other than 1-position are selectively protected, and preparation of 1-n- alpha-hydroxy-omega-aminoalkanoyl -aminoglycoside antibiotic substance |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH650005A5 true CH650005A5 (de) | 1985-06-28 |
Family
ID=26414188
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH9682/79A CH650004A5 (de) | 1978-11-11 | 1979-10-29 | Verfahren zur herstellung eines selektiv geschuetzten n-acylierten aminoglycosid-antibiotikums. |
| CH184/84A CH650005A5 (de) | 1978-11-11 | 1979-10-29 | Verfahren zur herstellung eines selektiv geschuetzten n-acylierten aminoglycosid-antibiotikums. |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH9682/79A CH650004A5 (de) | 1978-11-11 | 1979-10-29 | Verfahren zur herstellung eines selektiv geschuetzten n-acylierten aminoglycosid-antibiotikums. |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4297485A (enExample) |
| AR (1) | AR241915A1 (enExample) |
| AT (1) | AT367066B (enExample) |
| AU (1) | AU529682B2 (enExample) |
| CA (1) | CA1118416A (enExample) |
| CH (2) | CH650004A5 (enExample) |
| DE (2) | DE2945010C2 (enExample) |
| DK (1) | DK476679A (enExample) |
| ES (2) | ES485830A1 (enExample) |
| FR (2) | FR2441631A1 (enExample) |
| GB (2) | GB2065123B (enExample) |
| IE (1) | IE48972B1 (enExample) |
| IN (1) | IN151454B (enExample) |
| IT (1) | IT1166021B (enExample) |
| LU (1) | LU81881A1 (enExample) |
| MX (1) | MX6181E (enExample) |
| NL (1) | NL7907892A (enExample) |
| PH (2) | PH16263A (enExample) |
| SE (2) | SE446632B (enExample) |
| YU (1) | YU44185B (enExample) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS55105699A (en) * | 1979-02-05 | 1980-08-13 | Microbial Chem Res Found | 3',4'-dideoxykanamycin a and its 1-n-aminoalkanoyl derivative |
| US4424344A (en) | 1980-09-22 | 1984-01-03 | Eli Lilly And Company | 2-N-Acylated and 2-N-alkylated derivatives of 4-O-substituted-2-deoxystreptamine aminoglycosides and process |
| US4468512A (en) * | 1980-09-22 | 1984-08-28 | Eli Lilly And Company | 1-N-Acylated and 1-N-alkylated derivatives of 4-O-substituted-2-deoxystreptamine aminoglycosides |
| US4424345A (en) | 1980-09-22 | 1984-01-03 | Eli Lilly And Company | 1-N-Acylated and 1-N-alkylated derivatives of 4-O-substituted-2-deoxystreptamine aminoglycosides and process |
| IT1200774B (it) * | 1985-10-10 | 1989-01-27 | Pierrel Spa | Procedimento di sentisi dell'amikacina |
| US4833232A (en) * | 1986-05-02 | 1989-05-23 | Exxon Research And Engineering Company | Synthesis of novel highly intrinsic conducting organic polymers |
| US5442047A (en) * | 1991-12-04 | 1995-08-15 | Schering Corporation | Process for preparing isepamicin |
| EP0547031B1 (en) * | 1989-06-21 | 1997-04-23 | Schering Corporation | N-protected-(S)-isoserine compounds |
| IT1237490B (it) * | 1989-09-22 | 1993-06-07 | Chementecno S R L Monza Milano | Procedimento per la sintesi della 1 n (s delta ammino alfa idrossibutirril)kamanycin a basato sul trattamento della 1 n (s delta benzilossicarbonilammino alfa idrossibutirril) 3,6' di n benzilossicarbonilkanamycin a con acido formico |
| DE69104092T2 (de) * | 1990-03-08 | 1995-01-26 | Opos Biochimica Srl | Verfahren zur Herstellung von Amikacin-Vorläufern. |
| US5488038A (en) | 1992-11-27 | 1996-01-30 | Zaidan Hojin Biseibutsu Kagaku Kenkyu Kai | Dibekacin derivatives and arbekacin derivatives active against resistant bacteria |
| KR0139021B1 (ko) * | 1995-02-09 | 1998-04-30 | 김은영 | 1-엔(n)-에틸시소마이신의 제조방법 |
| KR100927626B1 (ko) * | 2002-09-18 | 2009-11-20 | 쯔지앙 하이썬 파머슈티컬 컴퍼니, 리미티드 | 이세파마이신의 제조 방법 |
| KR100467506B1 (ko) * | 2002-10-01 | 2005-01-24 | 경동제약 주식회사 | 이세파마이신의 제조방법 |
| US7794713B2 (en) | 2004-04-07 | 2010-09-14 | Lpath, Inc. | Compositions and methods for the treatment and prevention of hyperproliferative diseases |
| US7862812B2 (en) | 2006-05-31 | 2011-01-04 | Lpath, Inc. | Methods for decreasing immune response and treating immune conditions |
| WO2010037179A1 (en) | 2008-10-03 | 2010-04-08 | Glycan Biosciences Pty Ltd | Anionic conjugates of glycosylated bacterial metabolite |
| CN101928310B (zh) * | 2010-03-26 | 2012-09-05 | 常州方圆制药有限公司 | 3,2’,6’-三-N-乙酰基庆大霉素C1a的制备方法 |
| CN102250166A (zh) * | 2010-05-21 | 2011-11-23 | 江西济民可信集团有限公司 | 一种依替米星硫酸盐的制备方法 |
| CN102746349B (zh) * | 2012-06-27 | 2014-07-30 | 常州方圆制药有限公司 | 一种硫酸依替米星中间体3,2’,6’-三-N-乙酰基庆大霉素Cla的合成方法 |
| CN111138505B (zh) * | 2020-02-17 | 2021-10-08 | 山东安信制药有限公司 | 一种阿米卡星的制备方法 |
| CN116333011B (zh) * | 2023-03-31 | 2025-11-11 | 江西师范大学 | 一种全脱乙酰化壳寡糖及其制备方法和应用 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FI52847C (fi) * | 1971-09-15 | 1977-12-12 | Suomen Sokeri Oy | Menetelmä ainakin kaksi hydroksyyliryhmää sisältävien yhdisteiden alky yli-, alkenyyli- tai asyylijohdannaisten valmistamiseksi |
| US3781268A (en) * | 1972-01-27 | 1973-12-25 | Bristol Myers Co | Antibiotic derivatives of kanamycin |
| GB1402427A (en) * | 1972-05-03 | 1975-08-06 | Ranks Hovis Mcdougall Ltd | Antibiotics |
| US4001208A (en) * | 1972-10-06 | 1977-01-04 | Zaidan Hojin Biseibutsu Kagaku Kenkyo Kai | 1-N-[(S)-α-hydroxy-ω-aminoacyl] |
| JPS5324415B2 (enExample) * | 1972-10-06 | 1978-07-20 | ||
| US4107424A (en) * | 1972-10-06 | 1978-08-15 | Zaidan Hojin Biseibutsu Kagaku Kenkyu Kai | 1-N-[(S)-α-hydroxy-ω-aminoacyl] derivatives of 3',4'-dideoxykanamycin B and 3'-deoxykanamycin B antibiotics |
| GB1441202A (en) * | 1973-05-15 | 1976-06-30 | Microbial Chem Res Found | 1-n-isoserylkanamycins and the production thereof |
| JPS554118B2 (enExample) * | 1973-08-29 | 1980-01-29 | ||
| JPS5635195B2 (enExample) * | 1974-01-24 | 1981-08-15 | ||
| US4136254A (en) * | 1976-06-17 | 1979-01-23 | Schering Corporation | Process of selectively blocking amino functions in aminoglycosides using transition metal salts and intermediates used thereby |
-
1979
- 1979-10-23 IE IE2026/79A patent/IE48972B1/en not_active IP Right Cessation
- 1979-10-24 IN IN1104/CAL/79A patent/IN151454B/en unknown
- 1979-10-25 SE SE7908850A patent/SE446632B/sv not_active IP Right Cessation
- 1979-10-26 NL NL7907892A patent/NL7907892A/nl not_active Application Discontinuation
- 1979-10-29 CH CH9682/79A patent/CH650004A5/de not_active IP Right Cessation
- 1979-10-29 CH CH184/84A patent/CH650005A5/de not_active IP Right Cessation
- 1979-11-02 US US06/090,591 patent/US4297485A/en not_active Expired - Lifetime
- 1979-11-02 AT AT0707979A patent/AT367066B/de not_active IP Right Cessation
- 1979-11-08 AU AU52622/79A patent/AU529682B2/en not_active Expired
- 1979-11-08 MX MX798478U patent/MX6181E/es unknown
- 1979-11-08 PH PH23263A patent/PH16263A/en unknown
- 1979-11-08 ES ES485830A patent/ES485830A1/es not_active Expired
- 1979-11-08 DE DE2945010A patent/DE2945010C2/de not_active Expired
- 1979-11-08 YU YU2743/79A patent/YU44185B/xx unknown
- 1979-11-08 DE DE2953878A patent/DE2953878C2/de not_active Expired
- 1979-11-08 FR FR7928015A patent/FR2441631A1/fr active Granted
- 1979-11-09 CA CA000339531A patent/CA1118416A/en not_active Expired
- 1979-11-09 AR AR79278828A patent/AR241915A1/es active
- 1979-11-09 DK DK476679A patent/DK476679A/da not_active Application Discontinuation
- 1979-11-09 GB GB8103076A patent/GB2065123B/en not_active Expired
- 1979-11-09 LU LU81881A patent/LU81881A1/fr unknown
- 1979-11-09 GB GB7938894A patent/GB2036020B/en not_active Expired
- 1979-11-12 IT IT09592/79A patent/IT1166021B/it active
-
1980
- 1980-06-16 ES ES492479A patent/ES8105747A1/es not_active Expired
- 1980-12-22 PH PH25015A patent/PH15906A/en unknown
-
1981
- 1981-06-03 FR FR8110968A patent/FR2482109A1/fr active Granted
-
1984
- 1984-12-13 SE SE8406344A patent/SE463264B/sv not_active IP Right Cessation
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH650005A5 (de) | Verfahren zur herstellung eines selektiv geschuetzten n-acylierten aminoglycosid-antibiotikums. | |
| DE2726712C2 (enExample) | ||
| DE2432644A1 (de) | Derivate von desoxystreptamin enthaltenden aminoglykosid-antibiotikumderivaten und verfahren zu ihrer herstellung | |
| DE2855148A1 (de) | 3-de-0-methyl-2'-n-acyl- und -alkylfortimicine a und b | |
| DE69322750T2 (de) | Dibekacin und Arbekacin Derivate wirksam gegen resistente Bakterien, und ihre Herstellung | |
| DE2716533A1 (de) | Neue verbindungen fuer die herstellung von aminoglykosid-antibiotica, verfahren zu ihrer herstellung und ihre verwendung | |
| DE2533985C2 (de) | Verfahren zur Herstellung von 3'-Desoxyneamin, kanamycin B, ribostamycin, -6'-N-methylkanamycin B und paromamin | |
| DE2724597A1 (de) | Verfahren zur herstellung von kanamycin c und dessen desoxyderivaten, die so hergestellten derivate und mittel, die diese derivate enthalten | |
| DE2818822C2 (enExample) | ||
| DE2534982C3 (de) | 1-N- [(L)-2-Hydroxy-5-aminovaleroylJ- und 1-N-[(L)-2-Hydroxy-6-aminocaproyl] -XK-62-2, deren pharmazeutisch verträgliche Säureadditionssalze und Verfahren zu deren Herstellung | |
| DE2366288C3 (de) | Verfahren zur Herstellung von 3' -Desoxykanamycin B und 3' -Desoxyneamin | |
| DE3641835A1 (de) | Zytostatisch wirksame anthracyclinderivate | |
| DE2825289A1 (de) | 1-n-(omega-aminoalkansulfonyl)-derivate von aminoglycosidischen antibiotika und verfahren zur herstellung derselben | |
| DE2423591A1 (de) | 1-n-isoserylkanamycine | |
| CH637402A5 (de) | Verfahren zur herstellung von 3',4'-dideoxykanamycin b. | |
| DE2855066A1 (de) | 2'-n-acyl- und -alkyl-6'-n-alkyl- und -6',6'-di-n-alkyl-derivate von fortimicin a und b | |
| DE2436694A1 (de) | Verfahren zur herstellung von 1-n(s)-alpha-hydroxy-omega-aminoacyl)-derivaten von 3',4'-dideoxyneamin oder 3', 4'-dideoxyribostamycin | |
| CH618180A5 (en) | Process for the preparation of a derivative of the antibiotic XK-62-2. | |
| DE2950020C2 (de) | Verfahren zur Herstellung von 1-N-Isoseryl- oder 1-N-(L-4-Amino-2-hydroxybutyryl)-3',4'-didesoxy-kanamycin B und hierbei eingesetzte Zwischenprodukte | |
| DE2720199A1 (de) | Neamin-derivate und verfahren zu deren herstellung | |
| DE69124700T2 (de) | 4-0-(aminoglycosyl)-oder 4,6-di-0-(aminoglycosyl)-2,5-dideoxy-5,5-difluorostreptaminderivat und seine herstellung | |
| DE2726113A1 (de) | Synthetische aminoglycoside und verfahren zu ihrer herstellung | |
| DE2631462C3 (de) | Derivate des Antibiotikums XK-62-2, deren Salze mit Säuren, Verfahren zu ihrer Herstellung und ihre Verwendung bei der Bekämpfung bakterieller Infektionen | |
| EP0000199B1 (de) | 4-O-Aminoglycosyl-1,3-diaminocyclitole und Verfahren zu deren Herstellung | |
| CH615685A5 (en) | Process for the preparation of 1-N-(alpha-hydroxy-omega-aminoalkanoyl)-6'-N-methyl-3',4'-dideoxykanam ycin B |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |