SE446632B - Sett att framstella ett selektivt skyddat n-acylerat derivat av ett aminoglykosidantibiotikum - Google Patents
Sett att framstella ett selektivt skyddat n-acylerat derivat av ett aminoglykosidantibiotikumInfo
- Publication number
- SE446632B SE446632B SE7908850A SE7908850A SE446632B SE 446632 B SE446632 B SE 446632B SE 7908850 A SE7908850 A SE 7908850A SE 7908850 A SE7908850 A SE 7908850A SE 446632 B SE446632 B SE 446632B
- Authority
- SE
- Sweden
- Prior art keywords
- zinc
- acylated
- amino
- aminoglycoside antibiotic
- complex
- Prior art date
Links
- 239000002647 aminoglycoside antibiotic agent Substances 0.000 title claims description 78
- 229940126574 aminoglycoside antibiotic Drugs 0.000 title claims description 70
- 238000000034 method Methods 0.000 claims description 89
- 239000011701 zinc Substances 0.000 claims description 86
- 229910052725 zinc Inorganic materials 0.000 claims description 86
- -1 zinc cations Chemical class 0.000 claims description 75
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 70
- 239000000203 mixture Substances 0.000 claims description 66
- 229940006486 zinc cation Drugs 0.000 claims description 46
- PTFCDOFLOPIGGS-UHFFFAOYSA-N Zinc dication Chemical compound [Zn+2] PTFCDOFLOPIGGS-UHFFFAOYSA-N 0.000 claims description 40
- 125000003277 amino group Chemical group 0.000 claims description 40
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 37
- 229940126575 aminoglycoside Drugs 0.000 claims description 37
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 35
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 34
- 238000006243 chemical reaction Methods 0.000 claims description 34
- 239000003960 organic solvent Substances 0.000 claims description 30
- 239000003153 chemical reaction reagent Substances 0.000 claims description 28
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 23
- 125000002252 acyl group Chemical group 0.000 claims description 22
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 21
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 17
- 239000003795 chemical substances by application Substances 0.000 claims description 16
- 230000015572 biosynthetic process Effects 0.000 claims description 11
- 125000006239 protecting group Chemical group 0.000 claims description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 8
- ZOIORXHNWRGPMV-UHFFFAOYSA-N acetic acid;zinc Chemical compound [Zn].CC(O)=O.CC(O)=O ZOIORXHNWRGPMV-UHFFFAOYSA-N 0.000 claims description 8
- 239000004246 zinc acetate Substances 0.000 claims description 8
- DTFAJAKTSMLKAT-JDCCYXBGSA-N 2-deoxystreptamine Chemical group N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O)[C@@H]1O DTFAJAKTSMLKAT-JDCCYXBGSA-N 0.000 claims description 5
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 claims description 4
- 239000011592 zinc chloride Substances 0.000 claims description 2
- 235000005074 zinc chloride Nutrition 0.000 claims description 2
- 238000010668 complexation reaction Methods 0.000 claims 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 claims 1
- 230000000276 sedentary effect Effects 0.000 claims 1
- 239000000243 solution Substances 0.000 description 87
- SBUJHOSQTJFQJX-NOAMYHISSA-N kanamycin Chemical class O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O[C@@H]2[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O2)O)[C@H](N)C[C@@H]1N SBUJHOSQTJFQJX-NOAMYHISSA-N 0.000 description 74
- 229960000318 kanamycin Drugs 0.000 description 64
- 229930182823 kanamycin A Natural products 0.000 description 61
- 150000003751 zinc Chemical class 0.000 description 60
- 239000007787 solid Substances 0.000 description 58
- 238000005917 acylation reaction Methods 0.000 description 57
- 150000001875 compounds Chemical class 0.000 description 44
- 239000000047 product Substances 0.000 description 44
- RNHDAKUGFHSZEV-UHFFFAOYSA-N 1,4-dioxane;hydrate Chemical compound O.C1COCCO1 RNHDAKUGFHSZEV-UHFFFAOYSA-N 0.000 description 40
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 40
- 238000002360 preparation method Methods 0.000 description 38
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 30
- 239000011347 resin Substances 0.000 description 30
- 229920005989 resin Polymers 0.000 description 30
- 230000010933 acylation Effects 0.000 description 29
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 28
- 239000012458 free base Substances 0.000 description 26
- 239000000463 material Substances 0.000 description 26
- 239000011541 reaction mixture Substances 0.000 description 24
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 21
- WHQSYGRFZMUQGQ-UHFFFAOYSA-N n,n-dimethylformamide;hydrate Chemical compound O.CN(C)C=O WHQSYGRFZMUQGQ-UHFFFAOYSA-N 0.000 description 20
- 230000008569 process Effects 0.000 description 20
- 239000002253 acid Substances 0.000 description 18
- 229930027917 kanamycin Natural products 0.000 description 18
- 239000000725 suspension Substances 0.000 description 17
- YZYKBQUWMPUVEN-UHFFFAOYSA-N zafuleptine Chemical compound OC(=O)CCCCCC(C(C)C)NCC1=CC=C(F)C=C1 YZYKBQUWMPUVEN-UHFFFAOYSA-N 0.000 description 17
- 229910052751 metal Inorganic materials 0.000 description 15
- 239000002184 metal Substances 0.000 description 15
- MJSHDCCLFGOEIK-UHFFFAOYSA-N benzyl (2,5-dioxopyrrolidin-1-yl) carbonate Chemical compound O=C1CCC(=O)N1OC(=O)OCC1=CC=CC=C1 MJSHDCCLFGOEIK-UHFFFAOYSA-N 0.000 description 14
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 14
- 229960001192 bekanamycin Drugs 0.000 description 13
- 238000010828 elution Methods 0.000 description 12
- SKKLOUVUUNMCJE-FQSMHNGLSA-N kanamycin B Chemical compound N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CN)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O[C@@H]2[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O2)O)[C@H](N)C[C@@H]1N SKKLOUVUUNMCJE-FQSMHNGLSA-N 0.000 description 12
- 229930182824 kanamycin B Natural products 0.000 description 12
- 239000002244 precipitate Substances 0.000 description 12
- 239000000126 substance Substances 0.000 description 12
- 229910052723 transition metal Inorganic materials 0.000 description 12
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 11
- 150000001413 amino acids Chemical class 0.000 description 11
- 235000011114 ammonium hydroxide Nutrition 0.000 description 11
- 239000012456 homogeneous solution Substances 0.000 description 11
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 11
- 239000003495 polar organic solvent Substances 0.000 description 11
- 239000003957 anion exchange resin Substances 0.000 description 10
- 230000003115 biocidal effect Effects 0.000 description 10
- 239000003729 cation exchange resin Substances 0.000 description 10
- 230000008030 elimination Effects 0.000 description 10
- 238000003379 elimination reaction Methods 0.000 description 10
- 238000005755 formation reaction Methods 0.000 description 10
- 239000002904 solvent Substances 0.000 description 10
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000003242 anti bacterial agent Substances 0.000 description 9
- 229940088710 antibiotic agent Drugs 0.000 description 8
- 150000001768 cations Chemical class 0.000 description 8
- 239000013522 chelant Substances 0.000 description 8
- 230000009918 complex formation Effects 0.000 description 8
- 229930182470 glycoside Natural products 0.000 description 8
- 150000002338 glycosides Chemical class 0.000 description 8
- 150000003839 salts Chemical class 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- 239000002585 base Substances 0.000 description 7
- 229920001429 chelating resin Polymers 0.000 description 7
- 230000000536 complexating effect Effects 0.000 description 7
- 125000000524 functional group Chemical group 0.000 description 7
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- 229920001661 Chitosan Polymers 0.000 description 6
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 6
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 229930182825 Kanamycin C Natural products 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 6
- 229910021529 ammonia Inorganic materials 0.000 description 6
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- 239000012141 concentrate Substances 0.000 description 6
- 230000006870 function Effects 0.000 description 6
- WZDRWYJKESFZMB-FQSMHNGLSA-N kanamycin C Chemical compound O([C@H]1[C@H](N)C[C@@H]([C@H]([C@@H]1O)O[C@@H]1[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O1)N)N)[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O WZDRWYJKESFZMB-FQSMHNGLSA-N 0.000 description 6
- 238000003786 synthesis reaction Methods 0.000 description 6
- VEQPNABPJHWNSG-UHFFFAOYSA-N Nickel(2+) Chemical compound [Ni+2] VEQPNABPJHWNSG-UHFFFAOYSA-N 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 239000005083 Zinc sulfide Substances 0.000 description 5
- 230000002378 acidificating effect Effects 0.000 description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 5
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 5
- 230000008878 coupling Effects 0.000 description 5
- 238000010168 coupling process Methods 0.000 description 5
- 238000005859 coupling reaction Methods 0.000 description 5
- 239000003085 diluting agent Substances 0.000 description 5
- 238000000921 elemental analysis Methods 0.000 description 5
- 239000003480 eluent Substances 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 5
- 229920000642 polymer Polymers 0.000 description 5
- 230000001376 precipitating effect Effects 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- DRDVZXDWVBGGMH-UHFFFAOYSA-N zinc;sulfide Chemical compound [S-2].[Zn+2] DRDVZXDWVBGGMH-UHFFFAOYSA-N 0.000 description 5
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 4
- 230000006181 N-acylation Effects 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- URWAJWIAIPFPJE-UHFFFAOYSA-N Rickamicin Natural products O1CC(O)(C)C(NC)C(O)C1OC1C(O)C(OC2C(CC=C(CN)O2)N)C(N)CC1N URWAJWIAIPFPJE-UHFFFAOYSA-N 0.000 description 4
- 125000003282 alkyl amino group Chemical group 0.000 description 4
- 230000000844 anti-bacterial effect Effects 0.000 description 4
- 229910052793 cadmium Inorganic materials 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- XLJKHNWPARRRJB-UHFFFAOYSA-N cobalt(2+) Chemical compound [Co+2] XLJKHNWPARRRJB-UHFFFAOYSA-N 0.000 description 4
- 150000004696 coordination complex Chemical class 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- 230000007246 mechanism Effects 0.000 description 4
- SOHCYNFHNYKSTM-UHFFFAOYSA-N methylsulfinylmethane;oxolane Chemical compound CS(C)=O.C1CCOC1 SOHCYNFHNYKSTM-UHFFFAOYSA-N 0.000 description 4
- 238000002156 mixing Methods 0.000 description 4
- FEMOMIGRRWSMCU-UHFFFAOYSA-N ninhydrin Chemical compound C1=CC=C2C(=O)C(O)(O)C(=O)C2=C1 FEMOMIGRRWSMCU-UHFFFAOYSA-N 0.000 description 4
- BSCHIACBONPEOB-UHFFFAOYSA-N oxolane;hydrate Chemical compound O.C1CCOC1 BSCHIACBONPEOB-UHFFFAOYSA-N 0.000 description 4
- NMHMNPHRMNGLLB-UHFFFAOYSA-N phloretic acid Chemical compound OC(=O)CCC1=CC=C(O)C=C1 NMHMNPHRMNGLLB-UHFFFAOYSA-N 0.000 description 4
- 238000011084 recovery Methods 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- 238000000926 separation method Methods 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- URWAJWIAIPFPJE-YFMIWBNJSA-N sisomycin Chemical compound O1C[C@@](O)(C)[C@H](NC)[C@@H](O)[C@H]1O[C@@H]1[C@@H](O)[C@H](O[C@@H]2[C@@H](CC=C(CN)O2)N)[C@@H](N)C[C@H]1N URWAJWIAIPFPJE-YFMIWBNJSA-N 0.000 description 4
- 150000003624 transition metals Chemical class 0.000 description 4
- 241000894006 Bacteria Species 0.000 description 3
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 229930182566 Gentamicin Natural products 0.000 description 3
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 3
- 239000000908 ammonium hydroxide Substances 0.000 description 3
- 238000005976 benzyloxycarbonylation reaction Methods 0.000 description 3
- 230000000903 blocking effect Effects 0.000 description 3
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 229910017052 cobalt Inorganic materials 0.000 description 3
- 239000010941 cobalt Substances 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 239000010949 copper Substances 0.000 description 3
- 150000004683 dihydrates Chemical class 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- CEAZRRDELHUEMR-UHFFFAOYSA-N gentamicin Chemical class O1C(C(C)NC)CCC(N)C1OC1C(O)C(OC2C(C(NC)C(C)(O)CO2)O)C(N)CC1N CEAZRRDELHUEMR-UHFFFAOYSA-N 0.000 description 3
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- 238000005304 joining Methods 0.000 description 3
- ZBGPYVZLYBDXKO-HILBYHGXSA-N netilmycin Chemical compound O([C@@H]1[C@@H](N)C[C@H]([C@@H]([C@H]1O)O[C@@H]1[C@]([C@H](NC)[C@@H](O)CO1)(C)O)NCC)[C@H]1OC(CN)=CC[C@H]1N ZBGPYVZLYBDXKO-HILBYHGXSA-N 0.000 description 3
- 235000017281 sodium acetate Nutrition 0.000 description 3
- 150000003462 sulfoxides Chemical class 0.000 description 3
- 238000004809 thin layer chromatography Methods 0.000 description 3
- 229960000707 tobramycin Drugs 0.000 description 3
- NLVFBUXFDBBNBW-PBSUHMDJSA-N tobramycin Chemical compound N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O[C@@H]2[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O2)O)[C@H](N)C[C@@H]1N NLVFBUXFDBBNBW-PBSUHMDJSA-N 0.000 description 3
- 229920003176 water-insoluble polymer Polymers 0.000 description 3
- UGZADUVQMDAIAO-UHFFFAOYSA-L zinc hydroxide Chemical compound [OH-].[OH-].[Zn+2] UGZADUVQMDAIAO-UHFFFAOYSA-L 0.000 description 3
- 229940007718 zinc hydroxide Drugs 0.000 description 3
- 229910021511 zinc hydroxide Inorganic materials 0.000 description 3
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 description 2
- OTLNPYWUJOZPPA-UHFFFAOYSA-M 4-nitrobenzoate Chemical compound [O-]C(=O)C1=CC=C([N+]([O-])=O)C=C1 OTLNPYWUJOZPPA-UHFFFAOYSA-M 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 229920002101 Chitin Polymers 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 229930192786 Sisomicin Natural products 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910052977 alkali metal sulfide Inorganic materials 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- ZFTFAPZRGNKQPU-UHFFFAOYSA-N dicarbonic acid Chemical compound OC(=O)OC(O)=O ZFTFAPZRGNKQPU-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000012847 fine chemical Substances 0.000 description 2
- LKKVGKXCMYHKSL-LLZRLKDCSA-N gentamycin A Chemical compound O[C@H]1[C@H](NC)[C@@H](O)CO[C@H]1O[C@@H]1[C@@H](O)[C@H](O[C@@H]2[C@@H]([C@@H](O)[C@H](O)[C@@H](CO)O2)N)[C@@H](N)C[C@H]1N LKKVGKXCMYHKSL-LLZRLKDCSA-N 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 229960000808 netilmicin Drugs 0.000 description 2
- 230000003472 neutralizing effect Effects 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- AHWALFGBDFAJAI-UHFFFAOYSA-N phenyl carbonochloridate Chemical compound ClC(=O)OC1=CC=CC=C1 AHWALFGBDFAJAI-UHFFFAOYSA-N 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 230000000704 physical effect Effects 0.000 description 2
- 229920001184 polypeptide Polymers 0.000 description 2
- 102000004196 processed proteins & peptides Human genes 0.000 description 2
- 108090000765 processed proteins & peptides Proteins 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 229960005456 sisomicin Drugs 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 238000001179 sorption measurement Methods 0.000 description 2
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 2
- ISHLCKAQWKBMAU-UHFFFAOYSA-N tert-butyl n-diazocarbamate Chemical compound CC(C)(C)OC(=O)N=[N+]=[N-] ISHLCKAQWKBMAU-UHFFFAOYSA-N 0.000 description 2
- ILJSQTXMGCGYMG-UHFFFAOYSA-N triacetic acid Chemical compound CC(=O)CC(=O)CC(O)=O ILJSQTXMGCGYMG-UHFFFAOYSA-N 0.000 description 2
- 150000003752 zinc compounds Chemical class 0.000 description 2
- XUSXOPRDIDWMFO-CTMSJIKGSA-N (2r,3r,4r,5r)-2-[(1s,2s,3r,4s,6r)-4,6-diamino-3-[[(2s,3r)-3-amino-6-[(1s)-1-aminoethyl]-3,4-dihydro-2h-pyran-2-yl]oxy]-2-hydroxycyclohexyl]oxy-5-methyl-4-(methylamino)oxane-3,5-diol Chemical compound O1C[C@@](O)(C)[C@H](NC)[C@@H](O)[C@H]1O[C@@H]1[C@@H](O)[C@H](O[C@@H]2[C@@H](CC=C(O2)[C@H](C)N)N)[C@@H](N)C[C@H]1N XUSXOPRDIDWMFO-CTMSJIKGSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- BDKLKNJTMLIAFE-UHFFFAOYSA-N 2-(3-fluorophenyl)-1,3-oxazole-4-carbaldehyde Chemical compound FC1=CC=CC(C=2OC=C(C=O)N=2)=C1 BDKLKNJTMLIAFE-UHFFFAOYSA-N 0.000 description 1
- GMWQKAHYINBSDJ-UHFFFAOYSA-N 2-hydroxy-3-(phenylmethoxycarbonylamino)propanoic acid Chemical compound OC(=O)C(O)CNC(=O)OCC1=CC=CC=C1 GMWQKAHYINBSDJ-UHFFFAOYSA-N 0.000 description 1
- WGDFMQPPAYDVMD-UHFFFAOYSA-N 3-amino-2-hydroxy-4-oxo-4-phenylmethoxybutanoic acid Chemical compound OC(=O)C(O)C(N)C(=O)OCC1=CC=CC=C1 WGDFMQPPAYDVMD-UHFFFAOYSA-N 0.000 description 1
- UGNSMKDDFAUGFT-UHFFFAOYSA-N 4,4-dimethyl-2-phenyl-5h-1,3-oxazole Chemical compound CC1(C)COC(C=2C=CC=CC=2)=N1 UGNSMKDDFAUGFT-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- 229920002307 Dextran Polymers 0.000 description 1
- KSPIHGBHKVISFI-UHFFFAOYSA-N Diphenylcarbazide Chemical compound C=1C=CC=CC=1NNC(=O)NNC1=CC=CC=C1 KSPIHGBHKVISFI-UHFFFAOYSA-N 0.000 description 1
- 101100298295 Drosophila melanogaster flfl gene Proteins 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- OKIZCWYLBDKLSU-UHFFFAOYSA-M N,N,N-Trimethylmethanaminium chloride Chemical compound [Cl-].C[N+](C)(C)C OKIZCWYLBDKLSU-UHFFFAOYSA-M 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- 229910006069 SO3H Inorganic materials 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- STSCVKRWJPWALQ-UHFFFAOYSA-N TRIFLUOROACETIC ACID ETHYL ESTER Chemical compound CCOC(=O)C(F)(F)F STSCVKRWJPWALQ-UHFFFAOYSA-N 0.000 description 1
- XUSXOPRDIDWMFO-UHFFFAOYSA-N Verdamicin Natural products O1CC(O)(C)C(NC)C(O)C1OC1C(O)C(OC2C(CC=C(O2)C(C)N)N)C(N)CC1N XUSXOPRDIDWMFO-UHFFFAOYSA-N 0.000 description 1
- FMRLDPWIRHBCCC-UHFFFAOYSA-L Zinc carbonate Chemical compound [Zn+2].[O-]C([O-])=O FMRLDPWIRHBCCC-UHFFFAOYSA-L 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 229960004821 amikacin Drugs 0.000 description 1
- LKCWBDHBTVXHDL-RMDFUYIESA-N amikacin Chemical compound O([C@@H]1[C@@H](N)C[C@H]([C@@H]([C@H]1O)O[C@@H]1[C@@H]([C@@H](N)[C@H](O)[C@@H](CO)O1)O)NC(=O)[C@@H](O)CCN)[C@H]1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1O LKCWBDHBTVXHDL-RMDFUYIESA-N 0.000 description 1
- 230000006229 amino acid addition Effects 0.000 description 1
- UYJXRRSPUVSSMN-UHFFFAOYSA-P ammonium sulfide Chemical compound [NH4+].[NH4+].[S-2] UYJXRRSPUVSSMN-UHFFFAOYSA-P 0.000 description 1
- 229940124350 antibacterial drug Drugs 0.000 description 1
- 125000005140 aralkylsulfonyl group Chemical group 0.000 description 1
- 125000003435 aroyl group Chemical group 0.000 description 1
- 125000005098 aryl alkoxy carbonyl group Chemical group 0.000 description 1
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- VCJIGSOOIYBSFA-UHFFFAOYSA-N azido formate Chemical compound [N-]=[N+]=NOC=O VCJIGSOOIYBSFA-UHFFFAOYSA-N 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- QHZNYGVZDCMWKX-UHFFFAOYSA-N benzyl (1,3-dioxoisoindol-2-yl) carbonate Chemical compound O=C1C2=CC=CC=C2C(=O)N1OC(=O)OCC1=CC=CC=C1 QHZNYGVZDCMWKX-UHFFFAOYSA-N 0.000 description 1
- RHRAMPXHWHSKQB-GGEUKFTFSA-N betamicin Chemical compound O1C[C@@](O)(C)[C@H](NC)[C@@H](O)[C@H]1O[C@@H]1[C@@H](O)[C@H](O[C@@H]2[C@@H]([C@@H](O)[C@H](O)[C@@H](CN)O2)O)[C@@H](N)C[C@H]1N RHRAMPXHWHSKQB-GGEUKFTFSA-N 0.000 description 1
- ACBQROXDOHKANW-UHFFFAOYSA-N bis(4-nitrophenyl) carbonate Chemical compound C1=CC([N+](=O)[O-])=CC=C1OC(=O)OC1=CC=C([N+]([O-])=O)C=C1 ACBQROXDOHKANW-UHFFFAOYSA-N 0.000 description 1
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 1
- 239000002981 blocking agent Substances 0.000 description 1
- 150000004652 butanoic acids Chemical class 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229940006463 cadmium cation Drugs 0.000 description 1
- WLZRMCYVCSSEQC-UHFFFAOYSA-N cadmium(2+) Chemical compound [Cd+2] WLZRMCYVCSSEQC-UHFFFAOYSA-N 0.000 description 1
- JGIATAMCQXIDNZ-UHFFFAOYSA-N calcium sulfide Chemical compound [Ca]=S JGIATAMCQXIDNZ-UHFFFAOYSA-N 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000007942 carboxylates Chemical group 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 229940023913 cation exchange resins Drugs 0.000 description 1
- 239000002738 chelating agent Substances 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 230000000593 degrading effect Effects 0.000 description 1
- 229960003807 dibekacin Drugs 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000012156 elution solvent Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 238000003912 environmental pollution Methods 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 230000022244 formylation Effects 0.000 description 1
- 238000006170 formylation reaction Methods 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- RHRAMPXHWHSKQB-UHFFFAOYSA-N gentamicin B Natural products O1CC(O)(C)C(NC)C(O)C1OC1C(O)C(OC2C(C(O)C(O)C(CN)O2)O)C(N)CC1N RHRAMPXHWHSKQB-UHFFFAOYSA-N 0.000 description 1
- VEGXETMJINRLTH-BOZYPMBZSA-N gentamycin C1a Chemical compound O1C[C@@](O)(C)[C@H](NC)[C@@H](O)[C@H]1O[C@@H]1[C@@H](O)[C@H](O[C@@H]2[C@@H](CC[C@@H](CN)O2)N)[C@@H](N)C[C@H]1N VEGXETMJINRLTH-BOZYPMBZSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 159000000011 group IA salts Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- MYWUZJCMWCOHBA-VIFPVBQESA-N methamphetamine Chemical compound CN[C@@H](C)CC1=CC=CC=C1 MYWUZJCMWCOHBA-VIFPVBQESA-N 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 150000002815 nickel Chemical class 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 125000003884 phenylalkyl group Chemical group 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 1
- 230000006289 propionylation Effects 0.000 description 1
- 238000010515 propionylation reaction Methods 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 229910052705 radium Inorganic materials 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 238000006884 silylation reaction Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229940087562 sodium acetate trihydrate Drugs 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 238000007070 tosylation reaction Methods 0.000 description 1
- 238000005583 trifluoroacetylation reaction Methods 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
- 239000012608 weak cation exchange resin Substances 0.000 description 1
- 239000011667 zinc carbonate Substances 0.000 description 1
- 235000004416 zinc carbonate Nutrition 0.000 description 1
- 229910000010 zinc carbonate Inorganic materials 0.000 description 1
- 229910052984 zinc sulfide Inorganic materials 0.000 description 1
- BEAZKUGSCHFXIQ-UHFFFAOYSA-L zinc;diacetate;dihydrate Chemical compound O.O.[Zn+2].CC([O-])=O.CC([O-])=O BEAZKUGSCHFXIQ-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07H—SUGARS; DERIVATIVES THEREOF; NUCLEOSIDES; NUCLEOTIDES; NUCLEIC ACIDS
- C07H23/00—Compounds containing boron, silicon or a metal, e.g. chelates or vitamin B12
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07H—SUGARS; DERIVATIVES THEREOF; NUCLEOSIDES; NUCLEOTIDES; NUCLEIC ACIDS
- C07H15/00—Compounds containing hydrocarbon or substituted hydrocarbon radicals directly attached to hetero atoms of saccharide radicals
- C07H15/20—Carbocyclic rings
- C07H15/22—Cyclohexane rings, substituted by nitrogen atoms
- C07H15/222—Cyclohexane rings substituted by at least two nitrogen atoms
- C07H15/226—Cyclohexane rings substituted by at least two nitrogen atoms with at least two saccharide radicals directly attached to the cyclohexane rings
- C07H15/234—Cyclohexane rings substituted by at least two nitrogen atoms with at least two saccharide radicals directly attached to the cyclohexane rings attached to non-adjacent ring carbon atoms of the cyclohexane rings, e.g. kanamycins, tobramycin, nebramycin, gentamicin A2
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Biochemistry (AREA)
- Biotechnology (AREA)
- General Health & Medical Sciences (AREA)
- Genetics & Genomics (AREA)
- Molecular Biology (AREA)
- Saccharide Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP13840278A JPS5564598A (en) | 1978-11-11 | 1978-11-11 | Preparation of aminoglycoside antibiotic having selectively protected amino group |
| JP7306479A JPS55164696A (en) | 1979-06-12 | 1979-06-12 | Preparation of protected derivative of aminoglycoside antibiotic substance wherein amino groups other than 1-position are selectively protected, and preparation of 1-n- alpha-hydroxy-omega-aminoalkanoyl -aminoglycoside antibiotic substance |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7908850L SE7908850L (sv) | 1980-05-12 |
| SE446632B true SE446632B (sv) | 1986-09-29 |
Family
ID=26414188
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7908850A SE446632B (sv) | 1978-11-11 | 1979-10-25 | Sett att framstella ett selektivt skyddat n-acylerat derivat av ett aminoglykosidantibiotikum |
| SE8406344A SE463264B (sv) | 1978-11-11 | 1984-12-13 | Saett att framstaella 1-n-oskyddat men i oevrigt n-acylerat derivat av ett aminoglykosidantibiotikum |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE8406344A SE463264B (sv) | 1978-11-11 | 1984-12-13 | Saett att framstaella 1-n-oskyddat men i oevrigt n-acylerat derivat av ett aminoglykosidantibiotikum |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4297485A (enExample) |
| AR (1) | AR241915A1 (enExample) |
| AT (1) | AT367066B (enExample) |
| AU (1) | AU529682B2 (enExample) |
| CA (1) | CA1118416A (enExample) |
| CH (2) | CH650005A5 (enExample) |
| DE (2) | DE2953878C2 (enExample) |
| DK (1) | DK476679A (enExample) |
| ES (2) | ES485830A1 (enExample) |
| FR (2) | FR2441631A1 (enExample) |
| GB (2) | GB2065123B (enExample) |
| IE (1) | IE48972B1 (enExample) |
| IN (1) | IN151454B (enExample) |
| IT (1) | IT1166021B (enExample) |
| LU (1) | LU81881A1 (enExample) |
| MX (1) | MX6181E (enExample) |
| NL (1) | NL7907892A (enExample) |
| PH (2) | PH16263A (enExample) |
| SE (2) | SE446632B (enExample) |
| YU (1) | YU44185B (enExample) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS55105699A (en) * | 1979-02-05 | 1980-08-13 | Microbial Chem Res Found | 3',4'-dideoxykanamycin a and its 1-n-aminoalkanoyl derivative |
| US4424344A (en) | 1980-09-22 | 1984-01-03 | Eli Lilly And Company | 2-N-Acylated and 2-N-alkylated derivatives of 4-O-substituted-2-deoxystreptamine aminoglycosides and process |
| US4424345A (en) | 1980-09-22 | 1984-01-03 | Eli Lilly And Company | 1-N-Acylated and 1-N-alkylated derivatives of 4-O-substituted-2-deoxystreptamine aminoglycosides and process |
| US4468512A (en) * | 1980-09-22 | 1984-08-28 | Eli Lilly And Company | 1-N-Acylated and 1-N-alkylated derivatives of 4-O-substituted-2-deoxystreptamine aminoglycosides |
| IT1200774B (it) * | 1985-10-10 | 1989-01-27 | Pierrel Spa | Procedimento di sentisi dell'amikacina |
| US4833232A (en) * | 1986-05-02 | 1989-05-23 | Exxon Research And Engineering Company | Synthesis of novel highly intrinsic conducting organic polymers |
| DK0405820T3 (da) * | 1989-06-21 | 1994-05-16 | Schering Corp | Fremgangsmåde til fremstilling af isepamicin |
| US5442047A (en) * | 1991-12-04 | 1995-08-15 | Schering Corporation | Process for preparing isepamicin |
| IT1237490B (it) * | 1989-09-22 | 1993-06-07 | Chementecno S R L Monza Milano | Procedimento per la sintesi della 1 n (s delta ammino alfa idrossibutirril)kamanycin a basato sul trattamento della 1 n (s delta benzilossicarbonilammino alfa idrossibutirril) 3,6' di n benzilossicarbonilkanamycin a con acido formico |
| EP0446670B1 (en) * | 1990-03-08 | 1994-09-21 | Biochimica Opos Spa | Method of preparation of amikacin precursors |
| US5488038A (en) | 1992-11-27 | 1996-01-30 | Zaidan Hojin Biseibutsu Kagaku Kenkyu Kai | Dibekacin derivatives and arbekacin derivatives active against resistant bacteria |
| KR0139021B1 (ko) * | 1995-02-09 | 1998-04-30 | 김은영 | 1-엔(n)-에틸시소마이신의 제조방법 |
| KR100927626B1 (ko) * | 2002-09-18 | 2009-11-20 | 쯔지앙 하이썬 파머슈티컬 컴퍼니, 리미티드 | 이세파마이신의 제조 방법 |
| KR100467506B1 (ko) * | 2002-10-01 | 2005-01-24 | 경동제약 주식회사 | 이세파마이신의 제조방법 |
| US7794713B2 (en) | 2004-04-07 | 2010-09-14 | Lpath, Inc. | Compositions and methods for the treatment and prevention of hyperproliferative diseases |
| US7862812B2 (en) | 2006-05-31 | 2011-01-04 | Lpath, Inc. | Methods for decreasing immune response and treating immune conditions |
| US8791245B2 (en) * | 2008-10-03 | 2014-07-29 | Glycan Bioscience LLC | Anionic conjugates of glycosylated bacterial metabolite |
| CN101928310B (zh) * | 2010-03-26 | 2012-09-05 | 常州方圆制药有限公司 | 3,2’,6’-三-N-乙酰基庆大霉素C1a的制备方法 |
| CN102250166A (zh) * | 2010-05-21 | 2011-11-23 | 江西济民可信集团有限公司 | 一种依替米星硫酸盐的制备方法 |
| CN102746349B (zh) * | 2012-06-27 | 2014-07-30 | 常州方圆制药有限公司 | 一种硫酸依替米星中间体3,2’,6’-三-N-乙酰基庆大霉素Cla的合成方法 |
| CN111138505B (zh) * | 2020-02-17 | 2021-10-08 | 山东安信制药有限公司 | 一种阿米卡星的制备方法 |
| CN116333011B (zh) * | 2023-03-31 | 2025-11-11 | 江西师范大学 | 一种全脱乙酰化壳寡糖及其制备方法和应用 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FI52847C (fi) * | 1971-09-15 | 1977-12-12 | Suomen Sokeri Oy | Menetelmä ainakin kaksi hydroksyyliryhmää sisältävien yhdisteiden alky yli-, alkenyyli- tai asyylijohdannaisten valmistamiseksi |
| US3781268A (en) * | 1972-01-27 | 1973-12-25 | Bristol Myers Co | Antibiotic derivatives of kanamycin |
| GB1402427A (en) * | 1972-05-03 | 1975-08-06 | Ranks Hovis Mcdougall Ltd | Antibiotics |
| US4001208A (en) * | 1972-10-06 | 1977-01-04 | Zaidan Hojin Biseibutsu Kagaku Kenkyo Kai | 1-N-[(S)-α-hydroxy-ω-aminoacyl] |
| JPS5324415B2 (enExample) * | 1972-10-06 | 1978-07-20 | ||
| US4107424A (en) * | 1972-10-06 | 1978-08-15 | Zaidan Hojin Biseibutsu Kagaku Kenkyu Kai | 1-N-[(S)-α-hydroxy-ω-aminoacyl] derivatives of 3',4'-dideoxykanamycin B and 3'-deoxykanamycin B antibiotics |
| GB1441202A (en) * | 1973-05-15 | 1976-06-30 | Microbial Chem Res Found | 1-n-isoserylkanamycins and the production thereof |
| JPS554118B2 (enExample) * | 1973-08-29 | 1980-01-29 | ||
| JPS5635195B2 (enExample) * | 1974-01-24 | 1981-08-15 | ||
| US4136254A (en) * | 1976-06-17 | 1979-01-23 | Schering Corporation | Process of selectively blocking amino functions in aminoglycosides using transition metal salts and intermediates used thereby |
-
1979
- 1979-10-23 IE IE2026/79A patent/IE48972B1/en not_active IP Right Cessation
- 1979-10-24 IN IN1104/CAL/79A patent/IN151454B/en unknown
- 1979-10-25 SE SE7908850A patent/SE446632B/sv not_active IP Right Cessation
- 1979-10-26 NL NL7907892A patent/NL7907892A/nl not_active Application Discontinuation
- 1979-10-29 CH CH184/84A patent/CH650005A5/de not_active IP Right Cessation
- 1979-10-29 CH CH9682/79A patent/CH650004A5/de not_active IP Right Cessation
- 1979-11-02 AT AT0707979A patent/AT367066B/de not_active IP Right Cessation
- 1979-11-02 US US06/090,591 patent/US4297485A/en not_active Expired - Lifetime
- 1979-11-08 FR FR7928015A patent/FR2441631A1/fr active Granted
- 1979-11-08 AU AU52622/79A patent/AU529682B2/en not_active Expired
- 1979-11-08 DE DE2953878A patent/DE2953878C2/de not_active Expired
- 1979-11-08 PH PH23263A patent/PH16263A/en unknown
- 1979-11-08 YU YU2743/79A patent/YU44185B/xx unknown
- 1979-11-08 ES ES485830A patent/ES485830A1/es not_active Expired
- 1979-11-08 MX MX798478U patent/MX6181E/es unknown
- 1979-11-08 DE DE2945010A patent/DE2945010C2/de not_active Expired
- 1979-11-09 AR AR79278828A patent/AR241915A1/es active
- 1979-11-09 CA CA000339531A patent/CA1118416A/en not_active Expired
- 1979-11-09 LU LU81881A patent/LU81881A1/fr unknown
- 1979-11-09 GB GB8103076A patent/GB2065123B/en not_active Expired
- 1979-11-09 DK DK476679A patent/DK476679A/da not_active Application Discontinuation
- 1979-11-09 GB GB7938894A patent/GB2036020B/en not_active Expired
- 1979-11-12 IT IT09592/79A patent/IT1166021B/it active
-
1980
- 1980-06-16 ES ES492479A patent/ES8105747A1/es not_active Expired
- 1980-12-22 PH PH25015A patent/PH15906A/en unknown
-
1981
- 1981-06-03 FR FR8110968A patent/FR2482109A1/fr active Granted
-
1984
- 1984-12-13 SE SE8406344A patent/SE463264B/sv not_active IP Right Cessation
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE446632B (sv) | Sett att framstella ett selektivt skyddat n-acylerat derivat av ett aminoglykosidantibiotikum | |
| KR840001622B1 (ko) | 3-0-데메틸 이스타마이신 b의 제조방법 | |
| DK172543B1 (da) | Fremgangsmåde til fremstilling af 1-N-(omega-amino-alfa-hydroxyalkanoyl)aminoglucosider samt polysilyleret aminoglycosid so | |
| KR920003838B1 (ko) | I-N-(ω-아미노-α-히드록시알카노일)-2', 3'-디데옥시가나마이신 A의 제조방법 | |
| CA1175818A (en) | Derivatives of istamycins a and b and their preparation | |
| EP0040764B1 (en) | Novel aminoglycosides, and antibiotic use thereof | |
| US4298727A (en) | 3',4'-Dideoxykanamycin A and 1-N-(S)-α-hydroxy-ω-aminoalkanoyl) derivatives thereof | |
| HK51584A (en) | Process for the preparation of 1-n-acyl-aminoglycosides | |
| CA1131628A (en) | Production of a selectively protected n-acylated derivative of an aminoglycosidic antibiotic | |
| CS261853B2 (en) | Method of aminoglycoside antibiotic's selectively acylated n-protected derivative production | |
| JPS631954B2 (enExample) | ||
| EP0259014A2 (en) | 5-Deoxy-5-fluorokanamycin B derivatives and processes for the production thereof | |
| KR830001613B1 (ko) | 아미노기를 선택적으로 보호한 아미노글리코사이드 항생물질의 제조방법 | |
| US4268664A (en) | Process for the preparation of 1-N-isoseryl- or 1-N-(L-4-amino-2-hydroxybutyryl)-3',4'-dideoxykanamycin B and intermediates thereof | |
| CA1152063A (en) | 3',4'-DIDEOXYKANAMYCIN A AND 1-N-((S)-.alpha.- HYDROXY-.omega.-AMINOALKANOLY) DERIVATIVES THEREOF | |
| US4008218A (en) | 1-N-((S)-α-substituted-ω-aminoacyl)-neamine or -ribostamycin and the production thereof | |
| EP0185323B1 (en) | 2',3'-dideoxy-2'-fluorokanamycin a and 1-n-(alpha-hydroxy-omega-aminoalkanoyl) derivatives thereof | |
| CA1081693A (en) | Kanamycin c derivatives | |
| JPH0631296B2 (ja) | 2′,3′−ジデオキシ−2′−フルオロカナマイシンa誘導体、およびその製造法 | |
| CA1188309A (en) | 3-0-demethyl derivatives of the istamycin b series of compounds and their preparation | |
| US4357466A (en) | Processes for the production of 3'-deoxykanamycin A and intermediates | |
| CA1175816A (en) | 1-N-(.alpha.-HYDROXY-.omega.-AMINOALKANOYL) DERIVATIVES OF 5, 3',4'-TRIDEOXY- OR 5,3',4'-TRIDEOXY-6'-N-METHYL- OR 5,3',4',6"-TETRADEOXY-KANAMYCIN B AND PRODUCTION THEREOF | |
| JPS6310959B2 (enExample) | ||
| JPH0134230B2 (enExample) | ||
| JPS63225393A (ja) | 1位以外のアミノ基が選択的に保護されたアミノグリコシド抗生物質保護誘導体 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NAL | Patent in force |
Ref document number: 7908850-6 Format of ref document f/p: F |
|
| NUG | Patent has lapsed |
Ref document number: 7908850-6 Format of ref document f/p: F |