CH646052A5 - Verfahren zur herstellung einer aktivierten pharmazeutischen zusammensetzung. - Google Patents
Verfahren zur herstellung einer aktivierten pharmazeutischen zusammensetzung. Download PDFInfo
- Publication number
- CH646052A5 CH646052A5 CH281080A CH281080A CH646052A5 CH 646052 A5 CH646052 A5 CH 646052A5 CH 281080 A CH281080 A CH 281080A CH 281080 A CH281080 A CH 281080A CH 646052 A5 CH646052 A5 CH 646052A5
- Authority
- CH
- Switzerland
- Prior art keywords
- water
- soluble
- drug
- solution
- gelling agent
- Prior art date
Links
- 239000008194 pharmaceutical composition Substances 0.000 title claims description 28
- 238000004519 manufacturing process Methods 0.000 title description 12
- 239000003814 drug Substances 0.000 claims description 128
- 229940079593 drug Drugs 0.000 claims description 112
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 104
- 238000000034 method Methods 0.000 claims description 59
- 239000000243 solution Substances 0.000 claims description 56
- 238000002360 preparation method Methods 0.000 claims description 52
- 239000000126 substance Substances 0.000 claims description 50
- 239000002245 particle Substances 0.000 claims description 49
- 239000003960 organic solvent Substances 0.000 claims description 43
- 239000007787 solid Substances 0.000 claims description 29
- 239000000499 gel Substances 0.000 claims description 28
- -1 hydroxypropyl ethyl Chemical group 0.000 claims description 28
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 26
- CXOFVDLJLONNDW-UHFFFAOYSA-N Phenytoin Chemical compound N1C(=O)NC(=O)C1(C=1C=CC=CC=1)C1=CC=CC=C1 CXOFVDLJLONNDW-UHFFFAOYSA-N 0.000 claims description 25
- 229960002036 phenytoin Drugs 0.000 claims description 24
- 239000000203 mixture Substances 0.000 claims description 22
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 claims description 21
- 230000002209 hydrophobic effect Effects 0.000 claims description 21
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 claims description 21
- 239000001863 hydroxypropyl cellulose Substances 0.000 claims description 21
- 230000008569 process Effects 0.000 claims description 18
- 239000007921 spray Substances 0.000 claims description 17
- 239000010419 fine particle Substances 0.000 claims description 16
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 15
- PXKHGMGELZGJQE-ILBGXUMGSA-N chloramphenicol palmitate Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@@H](NC(=O)C(Cl)Cl)[C@H](O)C1=CC=C([N+]([O-])=O)C=C1 PXKHGMGELZGJQE-ILBGXUMGSA-N 0.000 claims description 15
- 229960001805 chloramphenicol palmitate Drugs 0.000 claims description 15
- 239000012670 alkaline solution Substances 0.000 claims description 11
- 239000007864 aqueous solution Substances 0.000 claims description 11
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 11
- 239000000194 fatty acid Substances 0.000 claims description 11
- 229930195729 fatty acid Natural products 0.000 claims description 11
- 239000008187 granular material Substances 0.000 claims description 10
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 claims description 10
- 229920000609 methyl cellulose Polymers 0.000 claims description 10
- 235000010981 methylcellulose Nutrition 0.000 claims description 10
- 239000001923 methylcellulose Substances 0.000 claims description 10
- 239000003929 acidic solution Substances 0.000 claims description 9
- 239000007791 liquid phase Substances 0.000 claims description 9
- 244000215068 Acacia senegal Species 0.000 claims description 8
- ULGZDMOVFRHVEP-RWJQBGPGSA-N Erythromycin Chemical compound O([C@@H]1[C@@H](C)C(=O)O[C@@H]([C@@]([C@H](O)[C@@H](C)C(=O)[C@H](C)C[C@@](C)(O)[C@H](O[C@H]2[C@@H]([C@H](C[C@@H](C)O2)N(C)C)O)[C@H]1C)(C)O)CC)[C@H]1C[C@@](C)(OC)[C@@H](O)[C@H](C)O1 ULGZDMOVFRHVEP-RWJQBGPGSA-N 0.000 claims description 8
- 229920000084 Gum arabic Polymers 0.000 claims description 8
- 235000010489 acacia gum Nutrition 0.000 claims description 8
- 239000000205 acacia gum Substances 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 8
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 claims description 8
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 claims description 8
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 claims description 8
- HYIMSNHJOBLJNT-UHFFFAOYSA-N nifedipine Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1C1=CC=CC=C1[N+]([O-])=O HYIMSNHJOBLJNT-UHFFFAOYSA-N 0.000 claims description 8
- 229960001597 nifedipine Drugs 0.000 claims description 8
- PRAKJMSDJKAYCZ-UHFFFAOYSA-N squalane Chemical compound CC(C)CCCC(C)CCCC(C)CCCCC(C)CCCC(C)CCCC(C)C PRAKJMSDJKAYCZ-UHFFFAOYSA-N 0.000 claims description 8
- 238000003756 stirring Methods 0.000 claims description 7
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 claims description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 claims description 6
- 229920002472 Starch Polymers 0.000 claims description 6
- NHUHCSRWZMLRLA-UHFFFAOYSA-N Sulfisoxazole Chemical compound CC1=NOC(NS(=O)(=O)C=2C=CC(N)=CC=2)=C1C NHUHCSRWZMLRLA-UHFFFAOYSA-N 0.000 claims description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 6
- 238000009835 boiling Methods 0.000 claims description 6
- 230000000694 effects Effects 0.000 claims description 6
- MHWLWQUZZRMNGJ-UHFFFAOYSA-N nalidixic acid Chemical compound C1=C(C)N=C2N(CC)C=C(C(O)=O)C(=O)C2=C1 MHWLWQUZZRMNGJ-UHFFFAOYSA-N 0.000 claims description 6
- 229960000210 nalidixic acid Drugs 0.000 claims description 6
- 239000008107 starch Substances 0.000 claims description 6
- 229960000654 sulfafurazole Drugs 0.000 claims description 6
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 claims description 6
- 238000001238 wet grinding Methods 0.000 claims description 6
- CJDRUOGAGYHKKD-RQBLFBSQSA-N 1pon08459r Chemical compound CN([C@H]1[C@@]2(C[C@@]3([H])[C@@H]([C@@H](O)N42)CC)[H])C2=CC=CC=C2[C@]11C[C@@]4([H])[C@H]3[C@H]1O CJDRUOGAGYHKKD-RQBLFBSQSA-N 0.000 claims description 5
- CJDRUOGAGYHKKD-UHFFFAOYSA-N Iso-ajmalin Natural products CN1C2=CC=CC=C2C2(C(C34)O)C1C1CC3C(CC)C(O)N1C4C2 CJDRUOGAGYHKKD-UHFFFAOYSA-N 0.000 claims description 5
- 244000061121 Rauvolfia serpentina Species 0.000 claims description 5
- 229960004332 ajmaline Drugs 0.000 claims description 5
- 239000002612 dispersion medium Substances 0.000 claims description 5
- 229960003276 erythromycin Drugs 0.000 claims description 5
- 229960000905 indomethacin Drugs 0.000 claims description 5
- FTOAOBMCPZCFFF-UHFFFAOYSA-N 5,5-diethylbarbituric acid Chemical compound CCC1(CC)C(=O)NC(=O)NC1=O FTOAOBMCPZCFFF-UHFFFAOYSA-N 0.000 claims description 4
- ACTIUHUUMQJHFO-UHFFFAOYSA-N Coenzym Q10 Natural products COC1=C(OC)C(=O)C(CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)=C(C)C1=O ACTIUHUUMQJHFO-UHFFFAOYSA-N 0.000 claims description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 4
- LOUPRKONTZGTKE-WZBLMQSHSA-N Quinine Chemical compound C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@@H]2[C@H](O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-WZBLMQSHSA-N 0.000 claims description 4
- AUNGANRZJHBGPY-SCRDCRAPSA-N Riboflavin Chemical compound OC[C@@H](O)[C@@H](O)[C@@H](O)CN1C=2C=C(C)C(C)=CC=2N=C2C1=NC(=O)NC2=O AUNGANRZJHBGPY-SCRDCRAPSA-N 0.000 claims description 4
- VIROVYVQCGLCII-UHFFFAOYSA-N amobarbital Chemical compound CC(C)CCC1(CC)C(=O)NC(=O)NC1=O VIROVYVQCGLCII-UHFFFAOYSA-N 0.000 claims description 4
- 230000015572 biosynthetic process Effects 0.000 claims description 4
- ACTIUHUUMQJHFO-UPTCCGCDSA-N coenzyme Q10 Chemical compound COC1=C(OC)C(=O)C(C\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(/C)CCC=C(C)C)=C(C)C1=O ACTIUHUUMQJHFO-UPTCCGCDSA-N 0.000 claims description 4
- 235000017471 coenzyme Q10 Nutrition 0.000 claims description 4
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 claims description 4
- XOJVVFBFDXDTEG-UHFFFAOYSA-N pristane Chemical compound CC(C)CCCC(C)CCCC(C)CCCC(C)C XOJVVFBFDXDTEG-UHFFFAOYSA-N 0.000 claims description 4
- 238000001694 spray drying Methods 0.000 claims description 4
- 238000005507 spraying Methods 0.000 claims description 4
- 229960004747 ubidecarenone Drugs 0.000 claims description 4
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 claims description 3
- 239000001856 Ethyl cellulose Substances 0.000 claims description 3
- 108010010803 Gelatin Proteins 0.000 claims description 3
- 239000004372 Polyvinyl alcohol Substances 0.000 claims description 3
- 229930006000 Sucrose Natural products 0.000 claims description 3
- 229920001615 Tragacanth Polymers 0.000 claims description 3
- 239000003513 alkali Substances 0.000 claims description 3
- 239000001913 cellulose Substances 0.000 claims description 3
- 235000019325 ethyl cellulose Nutrition 0.000 claims description 3
- 229920001249 ethyl cellulose Polymers 0.000 claims description 3
- 239000008273 gelatin Substances 0.000 claims description 3
- 229920000159 gelatin Polymers 0.000 claims description 3
- 235000019322 gelatine Nutrition 0.000 claims description 3
- 235000011852 gelatine desserts Nutrition 0.000 claims description 3
- 229950007634 kitasamycin Drugs 0.000 claims description 3
- XYJOGTQLTFNMQG-KJHBSLKPSA-N leucomycin V Chemical compound CO[C@H]1[C@H](O)CC(=O)O[C@H](C)C\C=C\C=C\[C@H](O)[C@H](C)C[C@H](CC=O)[C@@H]1O[C@H]1[C@H](O)[C@@H](N(C)C)[C@H](O[C@@H]2O[C@@H](C)[C@H](O)[C@](C)(O)C2)[C@@H](C)O1 XYJOGTQLTFNMQG-KJHBSLKPSA-N 0.000 claims description 3
- 229940126601 medicinal product Drugs 0.000 claims description 3
- JXTPJDDICSTXJX-UHFFFAOYSA-N n-Triacontane Natural products CCCCCCCCCCCCCCCCCCCCCCCCCCCCCC JXTPJDDICSTXJX-UHFFFAOYSA-N 0.000 claims description 3
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 3
- 229920002451 polyvinyl alcohol Polymers 0.000 claims description 3
- 239000001267 polyvinylpyrrolidone Substances 0.000 claims description 3
- 229920000036 polyvinylpyrrolidone Polymers 0.000 claims description 3
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 claims description 3
- 229940032094 squalane Drugs 0.000 claims description 3
- 239000005720 sucrose Substances 0.000 claims description 3
- YKFCISHFRZHKHY-NGQGLHOPSA-N (2s)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoic acid;trihydrate Chemical compound O.O.O.OC(=O)[C@](N)(C)CC1=CC=C(O)C(O)=C1.OC(=O)[C@](N)(C)CC1=CC=C(O)C(O)=C1 YKFCISHFRZHKHY-NGQGLHOPSA-N 0.000 claims description 2
- YYGNTYWPHWGJRM-UHFFFAOYSA-N (6E,10E,14E,18E)-2,6,10,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaene Chemical compound CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)C YYGNTYWPHWGJRM-UHFFFAOYSA-N 0.000 claims description 2
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 claims description 2
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 claims description 2
- 241000416162 Astragalus gummifer Species 0.000 claims description 2
- RKWGIWYCVPQPMF-UHFFFAOYSA-N Chloropropamide Chemical compound CCCNC(=O)NS(=O)(=O)C1=CC=C(Cl)C=C1 RKWGIWYCVPQPMF-UHFFFAOYSA-N 0.000 claims description 2
- JZUFKLXOESDKRF-UHFFFAOYSA-N Chlorothiazide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC2=C1NCNS2(=O)=O JZUFKLXOESDKRF-UHFFFAOYSA-N 0.000 claims description 2
- 235000001258 Cinchona calisaya Nutrition 0.000 claims description 2
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 claims description 2
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 claims description 2
- AUNGANRZJHBGPY-UHFFFAOYSA-N D-Lyxoflavin Natural products OCC(O)C(O)C(O)CN1C=2C=C(C)C(C)=CC=2N=C2C1=NC(=O)NC2=O AUNGANRZJHBGPY-UHFFFAOYSA-N 0.000 claims description 2
- WDJUZGPOPHTGOT-OAXVISGBSA-N Digitoxin Natural products O([C@H]1[C@@H](C)O[C@@H](O[C@@H]2C[C@@H]3[C@@](C)([C@@H]4[C@H]([C@]5(O)[C@@](C)([C@H](C6=CC(=O)OC6)CC5)CC4)CC3)CC2)C[C@H]1O)[C@H]1O[C@@H](C)[C@H](O[C@H]2O[C@@H](C)[C@@H](O)[C@@H](O)C2)[C@@H](O)C1 WDJUZGPOPHTGOT-OAXVISGBSA-N 0.000 claims description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 claims description 2
- KIWBPDUYBMNFTB-UHFFFAOYSA-N Ethyl hydrogen sulfate Chemical compound CCOS(O)(=O)=O KIWBPDUYBMNFTB-UHFFFAOYSA-N 0.000 claims description 2
- OIRFJRBSRORBCM-UHFFFAOYSA-N Iopanoic acid Chemical compound CCC(C(O)=O)CC1=C(I)C=C(I)C(N)=C1I OIRFJRBSRORBCM-UHFFFAOYSA-N 0.000 claims description 2
- UXIGWFXRQKWHHA-UHFFFAOYSA-N Iotalamic acid Chemical compound CNC(=O)C1=C(I)C(NC(C)=O)=C(I)C(C(O)=O)=C1I UXIGWFXRQKWHHA-UHFFFAOYSA-N 0.000 claims description 2
- WTDRDQBEARUVNC-LURJTMIESA-N L-DOPA Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C(O)=C1 WTDRDQBEARUVNC-LURJTMIESA-N 0.000 claims description 2
- WTDRDQBEARUVNC-UHFFFAOYSA-N L-Dopa Natural products OC(=O)C(N)CC1=CC=C(O)C(O)=C1 WTDRDQBEARUVNC-UHFFFAOYSA-N 0.000 claims description 2
- HWGBHCRJGXAGEU-UHFFFAOYSA-N Methylthiouracil Chemical compound CC1=CC(=O)NC(=S)N1 HWGBHCRJGXAGEU-UHFFFAOYSA-N 0.000 claims description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 2
- KNAHARQHSZJURB-UHFFFAOYSA-N Propylthiouracile Chemical compound CCCC1=CC(=O)NC(=S)N1 KNAHARQHSZJURB-UHFFFAOYSA-N 0.000 claims description 2
- 239000004373 Pullulan Substances 0.000 claims description 2
- 229920001218 Pullulan Polymers 0.000 claims description 2
- 239000004098 Tetracycline Substances 0.000 claims description 2
- BHEOSNUKNHRBNM-UHFFFAOYSA-N Tetramethylsqualene Natural products CC(=C)C(C)CCC(=C)C(C)CCC(C)=CCCC=C(C)CCC(C)C(=C)CCC(C)C(C)=C BHEOSNUKNHRBNM-UHFFFAOYSA-N 0.000 claims description 2
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 claims description 2
- 229960001301 amobarbital Drugs 0.000 claims description 2
- 229960002319 barbital Drugs 0.000 claims description 2
- BLFLLBZGZJTVJG-UHFFFAOYSA-N benzocaine Chemical compound CCOC(=O)C1=CC=C(N)C=C1 BLFLLBZGZJTVJG-UHFFFAOYSA-N 0.000 claims description 2
- 229960005274 benzocaine Drugs 0.000 claims description 2
- 239000002775 capsule Substances 0.000 claims description 2
- 235000010980 cellulose Nutrition 0.000 claims description 2
- 229920002678 cellulose Polymers 0.000 claims description 2
- 229940083181 centrally acting adntiadrenergic agent methyldopa Drugs 0.000 claims description 2
- WEQAYVWKMWHEJO-UHFFFAOYSA-N chlormezanone Chemical compound O=S1(=O)CCC(=O)N(C)C1C1=CC=C(Cl)C=C1 WEQAYVWKMWHEJO-UHFFFAOYSA-N 0.000 claims description 2
- 229960001761 chlorpropamide Drugs 0.000 claims description 2
- LOUPRKONTZGTKE-UHFFFAOYSA-N cinchonine Natural products C1C(C(C2)C=C)CCN2C1C(O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-UHFFFAOYSA-N 0.000 claims description 2
- ALEXXDVDDISNDU-JZYPGELDSA-N cortisol 21-acetate Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(=O)COC(=O)C)(O)[C@@]1(C)C[C@@H]2O ALEXXDVDDISNDU-JZYPGELDSA-N 0.000 claims description 2
- 229960004397 cyclophosphamide Drugs 0.000 claims description 2
- AAOVKJBEBIDNHE-UHFFFAOYSA-N diazepam Chemical compound N=1CC(=O)N(C)C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 AAOVKJBEBIDNHE-UHFFFAOYSA-N 0.000 claims description 2
- 229960003529 diazepam Drugs 0.000 claims description 2
- WDJUZGPOPHTGOT-XUDUSOBPSA-N digitoxin Chemical compound C1[C@H](O)[C@H](O)[C@@H](C)O[C@H]1O[C@@H]1[C@@H](C)O[C@@H](O[C@@H]2[C@H](O[C@@H](O[C@@H]3C[C@@H]4[C@]([C@@H]5[C@H]([C@]6(CC[C@@H]([C@@]6(C)CC5)C=5COC(=O)C=5)O)CC4)(C)CC3)C[C@@H]2O)C)C[C@@H]1O WDJUZGPOPHTGOT-XUDUSOBPSA-N 0.000 claims description 2
- 229960000648 digitoxin Drugs 0.000 claims description 2
- SBNKFTQSBPKMBZ-UHFFFAOYSA-N ethenzamide Chemical compound CCOC1=CC=CC=C1C(N)=O SBNKFTQSBPKMBZ-UHFFFAOYSA-N 0.000 claims description 2
- 229960000514 ethenzamide Drugs 0.000 claims description 2
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 claims description 2
- 229960003883 furosemide Drugs 0.000 claims description 2
- 125000005456 glyceride group Chemical group 0.000 claims description 2
- 229960002003 hydrochlorothiazide Drugs 0.000 claims description 2
- 229960001067 hydrocortisone acetate Drugs 0.000 claims description 2
- 239000001341 hydroxy propyl starch Substances 0.000 claims description 2
- 235000013828 hydroxypropyl starch Nutrition 0.000 claims description 2
- 229960002979 iopanoic acid Drugs 0.000 claims description 2
- 229960000929 iotalamic acid Drugs 0.000 claims description 2
- XJSFLOJWULLJQS-NGVXBBESSA-N josamycin Chemical compound CO[C@H]1[C@H](OC(C)=O)CC(=O)O[C@H](C)C\C=C\C=C\[C@H](O)[C@H](C)C[C@H](CC=O)[C@@H]1O[C@H]1[C@H](O)[C@@H](N(C)C)[C@H](O[C@@H]2O[C@@H](C)[C@H](OC(=O)CC(C)C)[C@](C)(O)C2)[C@@H](C)O1 XJSFLOJWULLJQS-NGVXBBESSA-N 0.000 claims description 2
- 229960004144 josamycin Drugs 0.000 claims description 2
- 235000010445 lecithin Nutrition 0.000 claims description 2
- 239000000787 lecithin Substances 0.000 claims description 2
- 229940067606 lecithin Drugs 0.000 claims description 2
- 229960004502 levodopa Drugs 0.000 claims description 2
- 229940057995 liquid paraffin Drugs 0.000 claims description 2
- 229960002545 methylthiouracil Drugs 0.000 claims description 2
- DDBREPKUVSBGFI-UHFFFAOYSA-N phenobarbital Chemical compound C=1C=CC=CC=1C1(CC)C(=O)NC(=O)NC1=O DDBREPKUVSBGFI-UHFFFAOYSA-N 0.000 claims description 2
- 229960002695 phenobarbital Drugs 0.000 claims description 2
- 229960002895 phenylbutazone Drugs 0.000 claims description 2
- VYMDGNCVAMGZFE-UHFFFAOYSA-N phenylbutazonum Chemical compound O=C1C(CCCC)C(=O)N(C=2C=CC=CC=2)N1C1=CC=CC=C1 VYMDGNCVAMGZFE-UHFFFAOYSA-N 0.000 claims description 2
- 229920000223 polyglycerol Polymers 0.000 claims description 2
- 235000019422 polyvinyl alcohol Nutrition 0.000 claims description 2
- 229960002662 propylthiouracil Drugs 0.000 claims description 2
- PXWLVJLKJGVOKE-UHFFFAOYSA-N propyphenazone Chemical compound O=C1C(C(C)C)=C(C)N(C)N1C1=CC=CC=C1 PXWLVJLKJGVOKE-UHFFFAOYSA-N 0.000 claims description 2
- 229960002189 propyphenazone Drugs 0.000 claims description 2
- 235000019423 pullulan Nutrition 0.000 claims description 2
- 229960000948 quinine Drugs 0.000 claims description 2
- 239000011347 resin Substances 0.000 claims description 2
- 229920005989 resin Polymers 0.000 claims description 2
- 229960002477 riboflavin Drugs 0.000 claims description 2
- 235000019192 riboflavin Nutrition 0.000 claims description 2
- 239000002151 riboflavin Substances 0.000 claims description 2
- 239000000600 sorbitol Substances 0.000 claims description 2
- LXMSZDCAJNLERA-ZHYRCANASA-N spironolactone Chemical compound C([C@@H]1[C@]2(C)CC[C@@H]3[C@@]4(C)CCC(=O)C=C4C[C@H]([C@@H]13)SC(=O)C)C[C@@]21CCC(=O)O1 LXMSZDCAJNLERA-ZHYRCANASA-N 0.000 claims description 2
- 229960002256 spironolactone Drugs 0.000 claims description 2
- 229940031439 squalene Drugs 0.000 claims description 2
- TUHBEKDERLKLEC-UHFFFAOYSA-N squalene Natural products CC(=CCCC(=CCCC(=CCCC=C(/C)CCC=C(/C)CC=C(C)C)C)C)C TUHBEKDERLKLEC-UHFFFAOYSA-N 0.000 claims description 2
- 229960005404 sulfamethoxazole Drugs 0.000 claims description 2
- JLKIGFTWXXRPMT-UHFFFAOYSA-N sulphamethoxazole Chemical compound O1C(C)=CC(NS(=O)(=O)C=2C=CC(N)=CC=2)=N1 JLKIGFTWXXRPMT-UHFFFAOYSA-N 0.000 claims description 2
- 239000003826 tablet Substances 0.000 claims description 2
- 229960002180 tetracycline Drugs 0.000 claims description 2
- 229930101283 tetracycline Natural products 0.000 claims description 2
- 235000019364 tetracycline Nutrition 0.000 claims description 2
- 150000003522 tetracyclines Chemical class 0.000 claims description 2
- 235000010487 tragacanth Nutrition 0.000 claims description 2
- 239000000196 tragacanth Substances 0.000 claims description 2
- 229940116362 tragacanth Drugs 0.000 claims description 2
- LMJSLTNSBFUCMU-UHFFFAOYSA-N trichlormethiazide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC2=C1NC(C(Cl)Cl)NS2(=O)=O LMJSLTNSBFUCMU-UHFFFAOYSA-N 0.000 claims description 2
- 229960004813 trichlormethiazide Drugs 0.000 claims description 2
- 239000008096 xylene Substances 0.000 claims description 2
- 239000003349 gelling agent Substances 0.000 claims 11
- 239000002270 dispersing agent Substances 0.000 claims 3
- OVBPIULPVIDEAO-LBPRGKRZSA-N folic acid Chemical compound C=1N=C2NC(N)=NC(=O)C2=NC=1CNC1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 OVBPIULPVIDEAO-LBPRGKRZSA-N 0.000 claims 2
- OHXPGWPVLFPUSM-KLRNGDHRSA-N 3,7,12-trioxo-5beta-cholanic acid Chemical compound C1CC(=O)C[C@H]2CC(=O)[C@H]3[C@@H]4CC[C@H]([C@@H](CCC(O)=O)C)[C@@]4(C)C(=O)C[C@@H]3[C@]21C OHXPGWPVLFPUSM-KLRNGDHRSA-N 0.000 claims 1
- FBOZXECLQNJBKD-ZDUSSCGKSA-N L-methotrexate Chemical compound C=1N=C2N=C(N)N=C(N)C2=NC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 FBOZXECLQNJBKD-ZDUSSCGKSA-N 0.000 claims 1
- HSHXDCVZWHOWCS-UHFFFAOYSA-N N'-hexadecylthiophene-2-carbohydrazide Chemical compound CCCCCCCCCCCCCCCCNNC(=O)c1cccs1 HSHXDCVZWHOWCS-UHFFFAOYSA-N 0.000 claims 1
- OVBPIULPVIDEAO-UHFFFAOYSA-N N-Pteroyl-L-glutaminsaeure Natural products C=1N=C2NC(N)=NC(=O)C2=NC=1CNC1=CC=C(C(=O)NC(CCC(O)=O)C(O)=O)C=C1 OVBPIULPVIDEAO-UHFFFAOYSA-N 0.000 claims 1
- QIVBCDIJIAJPQS-UHFFFAOYSA-N Tryptophan Natural products C1=CC=C2C(CC(N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-UHFFFAOYSA-N 0.000 claims 1
- 229960002997 dehydrocholic acid Drugs 0.000 claims 1
- 239000008298 dragée Substances 0.000 claims 1
- MJEMIOXXNCZZFK-UHFFFAOYSA-N ethylone Chemical compound CCNC(C)C(=O)C1=CC=C2OCOC2=C1 MJEMIOXXNCZZFK-UHFFFAOYSA-N 0.000 claims 1
- 229960000304 folic acid Drugs 0.000 claims 1
- 235000019152 folic acid Nutrition 0.000 claims 1
- 239000011724 folic acid Substances 0.000 claims 1
- 229910052740 iodine Inorganic materials 0.000 claims 1
- 239000011630 iodine Substances 0.000 claims 1
- 229960002358 iodine Drugs 0.000 claims 1
- 229960000485 methotrexate Drugs 0.000 claims 1
- 239000007940 sugar coated tablet Substances 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 30
- 239000000843 powder Substances 0.000 description 30
- 239000006185 dispersion Substances 0.000 description 22
- 239000004094 surface-active agent Substances 0.000 description 18
- 238000012360 testing method Methods 0.000 description 16
- 239000008280 blood Substances 0.000 description 15
- 210000004369 blood Anatomy 0.000 description 15
- 239000000839 emulsion Substances 0.000 description 15
- 229960005091 chloramphenicol Drugs 0.000 description 14
- 239000002244 precipitate Substances 0.000 description 14
- WIIZWVCIJKGZOK-RKDXNWHRSA-N chloramphenicol Chemical compound ClC(Cl)C(=O)N[C@H](CO)[C@H](O)C1=CC=C([N+]([O-])=O)C=C1 WIIZWVCIJKGZOK-RKDXNWHRSA-N 0.000 description 13
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 238000001914 filtration Methods 0.000 description 12
- 239000002904 solvent Substances 0.000 description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 8
- 238000004090 dissolution Methods 0.000 description 8
- 238000001879 gelation Methods 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- 238000001035 drying Methods 0.000 description 7
- 238000002474 experimental method Methods 0.000 description 7
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- 210000001035 gastrointestinal tract Anatomy 0.000 description 6
- 238000010521 absorption reaction Methods 0.000 description 5
- 230000037396 body weight Effects 0.000 description 5
- 238000010586 diagram Methods 0.000 description 5
- 210000000813 small intestine Anatomy 0.000 description 5
- 210000002784 stomach Anatomy 0.000 description 5
- CDOUZKKFHVEKRI-UHFFFAOYSA-N 3-bromo-n-[(prop-2-enoylamino)methyl]propanamide Chemical compound BrCCC(=O)NCNC(=O)C=C CDOUZKKFHVEKRI-UHFFFAOYSA-N 0.000 description 4
- YAVZHCFFUATPRK-YZPBMOCRSA-N Erythromycin stearate Chemical compound CCCCCCCCCCCCCCCCCC(O)=O.O([C@@H]1[C@@H](C)C(=O)O[C@@H]([C@@]([C@H](O)[C@@H](C)C(=O)[C@H](C)C[C@@](C)(O)[C@H](O[C@H]2[C@@H]([C@H](C[C@@H](C)O2)N(C)C)O)[C@H]1C)(C)O)CC)[C@H]1C[C@@](C)(OC)[C@@H](O)[C@H](C)O1 YAVZHCFFUATPRK-YZPBMOCRSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 4
- 241000700159 Rattus Species 0.000 description 4
- 235000019329 dioctyl sodium sulphosuccinate Nutrition 0.000 description 4
- 229960004142 erythromycin stearate Drugs 0.000 description 4
- 238000007602 hot air drying Methods 0.000 description 4
- 210000004347 intestinal mucosa Anatomy 0.000 description 4
- 239000008101 lactose Substances 0.000 description 4
- 238000005259 measurement Methods 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- 229920001223 polyethylene glycol Polymers 0.000 description 4
- 235000019698 starch Nutrition 0.000 description 4
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000009826 distribution Methods 0.000 description 3
- 230000001804 emulsifying effect Effects 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 239000000825 pharmaceutical preparation Substances 0.000 description 3
- 229910002012 Aerosil® Inorganic materials 0.000 description 2
- ITRJWOMZKQRYTA-RFZYENFJSA-N Cortisone acetate Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@@](C(=O)COC(=O)C)(O)[C@@]1(C)CC2=O ITRJWOMZKQRYTA-RFZYENFJSA-N 0.000 description 2
- IIUZTXTZRGLYTI-UHFFFAOYSA-N Dihydrogriseofulvin Natural products COC1CC(=O)CC(C)C11C(=O)C(C(OC)=CC(OC)=C2Cl)=C2O1 IIUZTXTZRGLYTI-UHFFFAOYSA-N 0.000 description 2
- UXWOXTQWVMFRSE-UHFFFAOYSA-N Griseoviridin Natural products O=C1OC(C)CC=C(C(NCC=CC=CC(O)CC(O)C2)=O)SCC1NC(=O)C1=COC2=N1 UXWOXTQWVMFRSE-UHFFFAOYSA-N 0.000 description 2
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 2
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 2
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 2
- DDUHZTYCFQRHIY-UHFFFAOYSA-N Negwer: 6874 Natural products COC1=CC(=O)CC(C)C11C(=O)C(C(OC)=CC(OC)=C2Cl)=C2O1 DDUHZTYCFQRHIY-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 238000005054 agglomeration Methods 0.000 description 2
- 230000002776 aggregation Effects 0.000 description 2
- 230000004071 biological effect Effects 0.000 description 2
- 229940075614 colloidal silicon dioxide Drugs 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 229960003290 cortisone acetate Drugs 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 238000007922 dissolution test Methods 0.000 description 2
- 238000004945 emulsification Methods 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 235000011389 fruit/vegetable juice Nutrition 0.000 description 2
- 230000002496 gastric effect Effects 0.000 description 2
- 210000004051 gastric juice Anatomy 0.000 description 2
- DDUHZTYCFQRHIY-RBHXEPJQSA-N griseofulvin Chemical compound COC1=CC(=O)C[C@@H](C)[C@@]11C(=O)C(C(OC)=CC(OC)=C2Cl)=C2O1 DDUHZTYCFQRHIY-RBHXEPJQSA-N 0.000 description 2
- 229960002867 griseofulvin Drugs 0.000 description 2
- IPCSVZSSVZVIGE-UHFFFAOYSA-M hexadecanoate Chemical compound CCCCCCCCCCCCCCCC([O-])=O IPCSVZSSVZVIGE-UHFFFAOYSA-M 0.000 description 2
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 2
- 230000000968 intestinal effect Effects 0.000 description 2
- 238000011835 investigation Methods 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 2
- 229940016286 microcrystalline cellulose Drugs 0.000 description 2
- 239000008108 microcrystalline cellulose Substances 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 2
- 239000000244 polyoxyethylene sorbitan monooleate Substances 0.000 description 2
- 229940068968 polysorbate 80 Drugs 0.000 description 2
- 239000011164 primary particle Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 229910001220 stainless steel Inorganic materials 0.000 description 2
- 239000010935 stainless steel Substances 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- SFLSHLFXELFNJZ-QMMMGPOBSA-N (-)-norepinephrine Chemical compound NC[C@H](O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-QMMMGPOBSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 229920000856 Amylose Polymers 0.000 description 1
- QBNJRYQPWVUYKA-UHFFFAOYSA-N C(C1)N1C1=CC1 Chemical compound C(C1)N1C1=CC1 QBNJRYQPWVUYKA-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- 229920005682 EO-PO block copolymer Polymers 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 206010018910 Haemolysis Diseases 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- FQISKWAFAHGMGT-SGJOWKDISA-M Methylprednisolone sodium succinate Chemical compound [Na+].C([C@@]12C)=CC(=O)C=C1[C@@H](C)C[C@@H]1[C@@H]2[C@@H](O)C[C@]2(C)[C@@](O)(C(=O)COC(=O)CCC([O-])=O)CC[C@H]21 FQISKWAFAHGMGT-SGJOWKDISA-M 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- WMPXPUYPYQKQCX-UHFFFAOYSA-N Sulfamonomethoxine Chemical compound C1=NC(OC)=CC(NS(=O)(=O)C=2C=CC(N)=CC=2)=N1 WMPXPUYPYQKQCX-UHFFFAOYSA-N 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 238000012644 addition polymerization Methods 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000000305 astragalus gummifer gum Substances 0.000 description 1
- 229940125717 barbiturate Drugs 0.000 description 1
- QXJJQWWVWRCVQT-UHFFFAOYSA-K calcium;sodium;phosphate Chemical compound [Na+].[Ca+2].[O-]P([O-])([O-])=O QXJJQWWVWRCVQT-UHFFFAOYSA-K 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 229940105329 carboxymethylcellulose Drugs 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- 239000011362 coarse particle Substances 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000009837 dry grinding Methods 0.000 description 1
- 238000010894 electron beam technology Methods 0.000 description 1
- HQPMKSGTIOYHJT-UHFFFAOYSA-N ethane-1,2-diol;propane-1,2-diol Chemical compound OCCO.CC(O)CO HQPMKSGTIOYHJT-UHFFFAOYSA-N 0.000 description 1
- AEOCXXJPGCBFJA-UHFFFAOYSA-N ethionamide Chemical compound CCC1=CC(C(N)=S)=CC=N1 AEOCXXJPGCBFJA-UHFFFAOYSA-N 0.000 description 1
- 229960002001 ethionamide Drugs 0.000 description 1
- 229960004667 ethyl cellulose Drugs 0.000 description 1
- 238000000855 fermentation Methods 0.000 description 1
- 230000004151 fermentation Effects 0.000 description 1
- LPEPZBJOKDYZAD-UHFFFAOYSA-N flufenamic acid Chemical compound OC(=O)C1=CC=CC=C1NC1=CC=CC(C(F)(F)F)=C1 LPEPZBJOKDYZAD-UHFFFAOYSA-N 0.000 description 1
- 229960004369 flufenamic acid Drugs 0.000 description 1
- 230000030136 gastric emptying Effects 0.000 description 1
- 210000003736 gastrointestinal content Anatomy 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000008588 hemolysis Effects 0.000 description 1
- 230000002949 hemolytic effect Effects 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 210000000936 intestine Anatomy 0.000 description 1
- 238000004898 kneading Methods 0.000 description 1
- 229960001375 lactose Drugs 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 229960004584 methylprednisolone Drugs 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 239000004570 mortar (masonry) Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 239000000346 nonvolatile oil Substances 0.000 description 1
- 229960002748 norepinephrine Drugs 0.000 description 1
- SFLSHLFXELFNJZ-UHFFFAOYSA-N norepinephrine Natural products NCC(O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-UHFFFAOYSA-N 0.000 description 1
- HYYMPXVEPSKZOU-SPIKMXEPSA-N perphenazine maleate Chemical compound [H+].[H+].[H+].[H+].[O-]C(=O)\C=C/C([O-])=O.[O-]C(=O)\C=C/C([O-])=O.C1CN(CCO)CCN1CCCN1C2=CC(Cl)=CC=C2SC2=CC=CC=C21 HYYMPXVEPSKZOU-SPIKMXEPSA-N 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 229940102703 phenytoin 50 mg Drugs 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920001993 poloxamer 188 Polymers 0.000 description 1
- 229920000053 polysorbate 80 Polymers 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 235000019814 powdered cellulose Nutrition 0.000 description 1
- 229920003124 powdered cellulose Polymers 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 238000010298 pulverizing process Methods 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000003549 soybean oil Substances 0.000 description 1
- 235000012424 soybean oil Nutrition 0.000 description 1
- 229940032147 starch Drugs 0.000 description 1
- 150000003431 steroids Chemical class 0.000 description 1
- 229950003874 sulfamonomethoxine Drugs 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- RSPCKAHMRANGJZ-UHFFFAOYSA-N thiohydroxylamine Chemical class SN RSPCKAHMRANGJZ-UHFFFAOYSA-N 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 210000001835 viscera Anatomy 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/48—Preparations in capsules, e.g. of gelatin, of chocolate
- A61K9/50—Microcapsules having a gas, liquid or semi-solid filling; Solid microparticles or pellets surrounded by a distinct coating layer, e.g. coated microspheres, coated drug crystals
- A61K9/5005—Wall or coating material
- A61K9/5021—Organic macromolecular compounds
- A61K9/5036—Polysaccharides, e.g. gums, alginate; Cyclodextrin
- A61K9/5042—Cellulose; Cellulose derivatives, e.g. phthalate or acetate succinate esters of hydroxypropyl methylcellulose
- A61K9/5047—Cellulose ethers containing no ester groups, e.g. hydroxypropyl methylcellulose
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/14—Particulate form, e.g. powders, Processes for size reducing of pure drugs or the resulting products, Pure drug nanoparticles
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/48—Preparations in capsules, e.g. of gelatin, of chocolate
- A61K9/50—Microcapsules having a gas, liquid or semi-solid filling; Solid microparticles or pellets surrounded by a distinct coating layer, e.g. coated microspheres, coated drug crystals
- A61K9/5005—Wall or coating material
- A61K9/5021—Organic macromolecular compounds
- A61K9/5031—Organic macromolecular compounds obtained otherwise than by reactions only involving carbon-to-carbon unsaturated bonds, e.g. polyethylene glycol, poly(lactide-co-glycolide)
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/48—Preparations in capsules, e.g. of gelatin, of chocolate
- A61K9/50—Microcapsules having a gas, liquid or semi-solid filling; Solid microparticles or pellets surrounded by a distinct coating layer, e.g. coated microspheres, coated drug crystals
- A61K9/5005—Wall or coating material
- A61K9/5021—Organic macromolecular compounds
- A61K9/5036—Polysaccharides, e.g. gums, alginate; Cyclodextrin
Landscapes
- Health & Medical Sciences (AREA)
- Epidemiology (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Medicinal Preparation (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP4426179A JPS55139319A (en) | 1979-04-13 | 1979-04-13 | Activation of drug soluble in alkali and acid |
| JP7577479A JPS6024768B2 (ja) | 1979-06-16 | 1979-06-16 | 活性化薬剤の製法 |
| JP54076203A JPS587609B2 (ja) | 1979-06-17 | 1979-06-17 | 粉体薬剤のコ−テング法 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH646052A5 true CH646052A5 (de) | 1984-11-15 |
Family
ID=27291836
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH281080A CH646052A5 (de) | 1979-04-13 | 1980-04-11 | Verfahren zur herstellung einer aktivierten pharmazeutischen zusammensetzung. |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4540602A (enExample) |
| CH (1) | CH646052A5 (enExample) |
| DE (1) | DE3013839A1 (enExample) |
| GB (2) | GB2050828B (enExample) |
| IT (1) | IT1143089B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT397914B (de) * | 1986-12-19 | 1994-08-25 | Sandoz Ag | Pharmazeutisches präparat für die intravenöse wirkstoffapplikation mit hydrosolen im nanometerbereich |
Families Citing this family (175)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2525108B1 (fr) * | 1982-04-19 | 1989-05-12 | Elan Corp Ltd | Medicaments a haut degre de solubilite et procede pour leur obtention |
| DE3318649A1 (de) * | 1983-05-21 | 1984-11-22 | Bayer Ag, 5090 Leverkusen | Zweiphasenformulierung |
| DE3320583A1 (de) * | 1983-06-08 | 1984-12-13 | Dr. Karl Thomae Gmbh, 7950 Biberach | Neue galenische zubereitungsformen von oralen antidiabetika und verfahren zu ihrer herstellung |
| EP0130160B1 (en) * | 1983-06-22 | 1988-01-07 | The Ohio State University Research Foundation | Small particle formation |
| EP0130162B1 (en) * | 1983-06-22 | 1987-09-09 | The Ohio State University Research Foundation | Small particle formation and encapsulation |
| JPS6038322A (ja) * | 1983-08-11 | 1985-02-27 | Fujisawa Pharmaceut Co Ltd | ジヒドロピリジンa物質含有易溶性固形製剤 |
| DE3437599C2 (de) * | 1984-10-13 | 1987-04-16 | Dolorgiet GmbH & Co KG, 5205 St Augustin | Ibuprofen enthaltende Weichgelatinekapseln |
| DE3440288C2 (de) * | 1984-11-05 | 1987-03-12 | Gergely, Gerhard, Dr.-Ing., Wien | Pharmazeutische Zubereitung mit einem Gehalt an Ibuprofen sowie Verfahren zu ihrer Herstellung |
| US4639458A (en) * | 1985-01-22 | 1987-01-27 | Merck & Co., Inc. | Tablet and formulation |
| US4851392A (en) * | 1985-02-05 | 1989-07-25 | Warner-Lambert Company | Ingestible aggregate and delivery system prepared therefrom |
| US4747881A (en) * | 1985-02-05 | 1988-05-31 | Warner-Lambert Company | Ingestible aggregate and delivery system prepared therefrom |
| US4843098A (en) * | 1985-02-05 | 1989-06-27 | Warner-Lambert Company | Ingestible aggregate and delivery system prepared therefrom |
| US4818539A (en) * | 1985-02-05 | 1989-04-04 | Warner-Lambert Company | Ingestible aggregate and delivery system prepared therefrom |
| US4790991A (en) * | 1985-02-05 | 1988-12-13 | Warner-Lambert Company | Ingestible aggregate and delivery system prepared therefrom |
| SE459005B (sv) * | 1985-07-12 | 1989-05-29 | Aake Rikard Lindahl | Saett att framstaella sfaeriska polymerpartiklar |
| EP0214092A1 (en) * | 1985-08-08 | 1987-03-11 | Ciba-Geigy Ag | Enhanced absorption of psychoactive 2-aryl-pyrazolo quinolines as a solid molecular dispersion in polyvinylpyrrolidone |
| GB8608080D0 (en) * | 1986-04-02 | 1986-05-08 | Fujisawa Pharmaceutical Co | Solid dispersion composition |
| EP0256611A1 (en) * | 1986-08-08 | 1988-02-24 | Squibb Japan Inc. | Oral drug delivery systems |
| GB8628359D0 (en) * | 1986-11-27 | 1986-12-31 | Zyma Sa | Galenical formulation |
| US4867970A (en) | 1987-05-21 | 1989-09-19 | E. R. Squibb & Sons, Inc. | Moistureless oral drug delivery formulation and method for preparing same |
| IL83715A0 (en) * | 1987-08-31 | 1988-01-31 | Yeda Res & Dev | Pharmaceutical anti-protozoal compositions |
| SE8705136D0 (sv) * | 1987-12-22 | 1987-12-22 | Pharmacia Ab | Oral doseringsenhet for lekemedel och dess anvendning och framstellning |
| US4938968A (en) * | 1988-07-26 | 1990-07-03 | Norjec Development Associates, Inc. | Controlled release indomethacin |
| US4948580A (en) * | 1988-12-08 | 1990-08-14 | E. R. Squibb & Sons, Inc. | Muco-bioadhesive composition |
| HU201869B (en) * | 1988-12-30 | 1991-01-28 | Egyt Gyogyszervegyeszeti Gyar | Process for producing microcapsules of quick dissolving active component |
| HU203041B (en) * | 1989-03-14 | 1991-05-28 | Egyt Gyogyszervegyeszeti Gyar | Process for producing pharmaceutical compositions of controlled releasing factor containing nifedipin |
| DK546289D0 (da) * | 1989-11-02 | 1989-11-02 | Danochemo As | Carotenoidpulvere |
| EP0452862B1 (en) * | 1990-04-18 | 1995-07-19 | Asahi Kasei Kogyo Kabushiki Kaisha | Spherical seed cores, spherical granules and process for production thereof |
| US4994458A (en) * | 1990-04-30 | 1991-02-19 | Basf Corporation | Process for rotary fluid bed granulation of riboflavin |
| JPH04230625A (ja) * | 1990-12-27 | 1992-08-19 | Standard Chem & Pharmaceut Corp Ltd | 噴霧乾燥したジクロフェナクナトリウムを含み腸溶性の被覆を有するマイクロカプセルからなる微分散した錠剤組成物の製造方法 |
| US5399363A (en) * | 1991-01-25 | 1995-03-21 | Eastman Kodak Company | Surface modified anticancer nanoparticles |
| US5145684A (en) * | 1991-01-25 | 1992-09-08 | Sterling Drug Inc. | Surface modified drug nanoparticles |
| AU642066B2 (en) * | 1991-01-25 | 1993-10-07 | Nanosystems L.L.C. | X-ray contrast compositions useful in medical imaging |
| AU653026B2 (en) * | 1991-06-07 | 1994-09-15 | Teikoku Seiyaku Kabushiki Kaisha | Physiologically active polypeptide-containing pharmaceutical composition |
| US5213811A (en) * | 1991-09-13 | 1993-05-25 | Sterling Drug Inc. | Oral sustained-release drug compositions |
| US5876754A (en) * | 1992-01-17 | 1999-03-02 | Alfatec-Pharma Gmbh | Solid bodies containing active substances and a structure consisting of hydrophilic macromolecules, plus a method of producing such bodies |
| ES2086229T3 (es) * | 1992-05-22 | 1996-06-16 | Goedecke Ag | Procedimiento para la obtencion de preparados medicinales de accion retardada. |
| DE4220782A1 (de) * | 1992-06-25 | 1994-01-05 | Basf Ag | Verfahren zur Herstellung von festen pharmazeutischen Retardformen |
| US5298262A (en) * | 1992-12-04 | 1994-03-29 | Sterling Winthrop Inc. | Use of ionic cloud point modifiers to prevent particle aggregation during sterilization |
| US5340564A (en) * | 1992-12-10 | 1994-08-23 | Sterling Winthrop Inc. | Formulations comprising olin 10-G to prevent particle aggregation and increase stability |
| US5326552A (en) * | 1992-12-17 | 1994-07-05 | Sterling Winthrop Inc. | Formulations for nanoparticulate x-ray blood pool contrast agents using high molecular weight nonionic surfactants |
| US5981719A (en) * | 1993-03-09 | 1999-11-09 | Epic Therapeutics, Inc. | Macromolecular microparticles and methods of production and use |
| US6090925A (en) | 1993-03-09 | 2000-07-18 | Epic Therapeutics, Inc. | Macromolecular microparticles and methods of production and use |
| US5389297A (en) * | 1993-06-09 | 1995-02-14 | Isp Investments Inc. | Inert matrix composition microemulsifiable concentrate and aqueous microemulsion |
| DE4327063A1 (de) * | 1993-08-12 | 1995-02-16 | Kirsten Dr Westesen | Ubidecarenon-Partikel mit modifizierten physikochemischen Eigenschaften |
| DE4329446A1 (de) * | 1993-09-01 | 1995-03-02 | Basf Ag | Verfahren zur Herstellung von feinteiligen Farb- oder Wirkstoffzubereitungen |
| US6051256A (en) | 1994-03-07 | 2000-04-18 | Inhale Therapeutic Systems | Dispersible macromolecule compositions and methods for their preparation and use |
| SE9403846D0 (sv) * | 1994-11-09 | 1994-11-09 | Univ Ohio State Res Found | Small particle formation |
| US5662883A (en) * | 1995-01-10 | 1997-09-02 | Nanosystems L.L.C. | Microprecipitation of micro-nanoparticulate pharmaceutical agents |
| US5560932A (en) * | 1995-01-10 | 1996-10-01 | Nano Systems L.L.C. | Microprecipitation of nanoparticulate pharmaceutical agents |
| US5665331A (en) * | 1995-01-10 | 1997-09-09 | Nanosystems L.L.C. | Co-microprecipitation of nanoparticulate pharmaceutical agents with crystal growth modifiers |
| US5716642A (en) * | 1995-01-10 | 1998-02-10 | Nano Systems L.L.C. | Microprecipitation of nanoparticulate pharmaceutical agents using surface active material derived from similar pharmaceutical agents |
| US5503723A (en) * | 1995-02-08 | 1996-04-02 | Eastman Kodak Company | Isolation of ultra small particles |
| US5622938A (en) * | 1995-02-09 | 1997-04-22 | Nano Systems L.L.C. | Sugar base surfactant for nanocrystals |
| US5510118A (en) * | 1995-02-14 | 1996-04-23 | Nanosystems Llc | Process for preparing therapeutic compositions containing nanoparticles |
| US5543133A (en) * | 1995-02-14 | 1996-08-06 | Nanosystems L.L.C. | Process of preparing x-ray contrast compositions containing nanoparticles |
| EP0810853B1 (en) * | 1995-02-24 | 2004-08-25 | Elan Pharma International Limited | Aerosols containing nanoparticle dispersions |
| US6391338B1 (en) | 1995-09-07 | 2002-05-21 | Biovail Technologies Ltd. | System for rendering substantially non-dissoluble bio-affecting agents bio-available |
| US5686133A (en) * | 1996-01-31 | 1997-11-11 | Port Systems, L.L.C. | Water soluble pharmaceutical coating and method for producing coated pharmaceuticals |
| TWI225402B (en) * | 1996-03-13 | 2004-12-21 | Biochemie Gmbh | Auxiliary-free agglomerates |
| US5993858A (en) * | 1996-06-14 | 1999-11-30 | Port Systems L.L.C. | Method and formulation for increasing the bioavailability of poorly water-soluble drugs |
| US20030203036A1 (en) | 2000-03-17 | 2003-10-30 | Gordon Marc S. | Systems and processes for spray drying hydrophobic drugs with hydrophilic excipients |
| JP2001507701A (ja) * | 1996-12-31 | 2001-06-12 | インヘイル・セラピューティック・システムズ・インコーポレーテッド | 親水性賦形剤を有する疎水性薬剤の溶液を噴霧乾燥するための方法及びその方法によって作製された組成物 |
| GB9703673D0 (en) * | 1997-02-21 | 1997-04-09 | Bradford Particle Design Ltd | Method and apparatus for the formation of particles |
| CA2289618A1 (en) * | 1997-05-14 | 1998-11-19 | Shin-Ichi Yasueda | Aqueous suspension preparations with excellent redispersibility |
| KR100904931B1 (ko) * | 1997-06-27 | 2009-06-29 | 아브락시스 바이오사이언스, 엘엘씨 | 나노 입자 및 그의 제조 방법 |
| ZA991922B (en) * | 1998-03-11 | 1999-09-13 | Smithkline Beecham Corp | Novel compositions of eprosartan. |
| US20040013613A1 (en) * | 2001-05-18 | 2004-01-22 | Jain Rajeev A | Rapidly disintegrating solid oral dosage form |
| US8293277B2 (en) * | 1998-10-01 | 2012-10-23 | Alkermes Pharma Ireland Limited | Controlled-release nanoparticulate compositions |
| US8236352B2 (en) | 1998-10-01 | 2012-08-07 | Alkermes Pharma Ireland Limited | Glipizide compositions |
| EP2266542A3 (en) * | 1998-10-01 | 2013-07-31 | Elan Pharma International Limited | Controlled release nanoparticulate compositions |
| US20080213378A1 (en) * | 1998-10-01 | 2008-09-04 | Elan Pharma International, Ltd. | Nanoparticulate statin formulations and novel statin combinations |
| US6969529B2 (en) * | 2000-09-21 | 2005-11-29 | Elan Pharma International Ltd. | Nanoparticulate compositions comprising copolymers of vinyl pyrrolidone and vinyl acetate as surface stabilizers |
| US7521068B2 (en) | 1998-11-12 | 2009-04-21 | Elan Pharma International Ltd. | Dry powder aerosols of nanoparticulate drugs |
| US6428814B1 (en) * | 1999-10-08 | 2002-08-06 | Elan Pharma International Ltd. | Bioadhesive nanoparticulate compositions having cationic surface stabilizers |
| US20040115134A1 (en) * | 1999-06-22 | 2004-06-17 | Elan Pharma International Ltd. | Novel nifedipine compositions |
| US6555139B2 (en) | 1999-06-28 | 2003-04-29 | Wockhardt Europe Limited | Preparation of micron-size pharmaceutical particles by microfluidization |
| US6656504B1 (en) | 1999-09-09 | 2003-12-02 | Elan Pharma International Ltd. | Nanoparticulate compositions comprising amorphous cyclosporine and methods of making and using such compositions |
| AU2001233174A1 (en) * | 2000-01-31 | 2001-08-07 | Engelhard Corporation | Surfactant free topical compositions and method for rapid preparation thereof |
| GB0003935D0 (en) * | 2000-02-08 | 2000-04-12 | King S College London | Formulation for dry powder inhaler |
| CA2407154A1 (en) | 2000-04-27 | 2001-11-01 | Verion, Inc | Zero order release and temperature-controlled microcapsules and process for the preparation thereof |
| US20040156872A1 (en) * | 2000-05-18 | 2004-08-12 | Elan Pharma International Ltd. | Novel nimesulide compositions |
| DE10026698A1 (de) | 2000-05-30 | 2001-12-06 | Basf Ag | Selbstemulgierende Wirkstoffformulierung und Verwendung dieser Formulierung |
| US7575761B2 (en) | 2000-06-30 | 2009-08-18 | Novartis Pharma Ag | Spray drying process control of drying kinetics |
| WO2002009669A2 (en) * | 2000-08-01 | 2002-02-07 | Inhale Therapeutic Systems, Inc. | Apparatus and process to produce particles having a narrow size distribution and particles made thereby |
| AU8847101A (en) | 2000-08-31 | 2002-03-13 | Rtp Pharma Inc | Milled particles |
| US7276249B2 (en) * | 2002-05-24 | 2007-10-02 | Elan Pharma International, Ltd. | Nanoparticulate fibrate formulations |
| US7198795B2 (en) | 2000-09-21 | 2007-04-03 | Elan Pharma International Ltd. | In vitro methods for evaluating the in vivo effectiveness of dosage forms of microparticulate of nanoparticulate active agent compositions |
| US6541030B2 (en) | 2000-09-27 | 2003-04-01 | Verion Inc. | Instant water dissolvable encapsulate and process |
| GB0027357D0 (en) | 2000-11-09 | 2000-12-27 | Bradford Particle Design Plc | Particle formation methods and their products |
| US20040022862A1 (en) * | 2000-12-22 | 2004-02-05 | Kipp James E. | Method for preparing small particles |
| US20050048126A1 (en) | 2000-12-22 | 2005-03-03 | Barrett Rabinow | Formulation to render an antimicrobial drug potent against organisms normally considered to be resistant to the drug |
| US9700866B2 (en) | 2000-12-22 | 2017-07-11 | Baxter International Inc. | Surfactant systems for delivery of organic compounds |
| US7193084B2 (en) * | 2000-12-22 | 2007-03-20 | Baxter International Inc. | Polymorphic form of itraconazole |
| US7037528B2 (en) * | 2000-12-22 | 2006-05-02 | Baxter International Inc. | Microprecipitation method for preparing submicron suspensions |
| US6951656B2 (en) * | 2000-12-22 | 2005-10-04 | Baxter International Inc. | Microprecipitation method for preparing submicron suspensions |
| US20030072807A1 (en) * | 2000-12-22 | 2003-04-17 | Wong Joseph Chung-Tak | Solid particulate antifungal compositions for pharmaceutical use |
| US20030096013A1 (en) * | 2000-12-22 | 2003-05-22 | Jane Werling | Preparation of submicron sized particles with polymorph control |
| US6977085B2 (en) * | 2000-12-22 | 2005-12-20 | Baxter International Inc. | Method for preparing submicron suspensions with polymorph control |
| US6884436B2 (en) * | 2000-12-22 | 2005-04-26 | Baxter International Inc. | Method for preparing submicron particle suspensions |
| US8067032B2 (en) * | 2000-12-22 | 2011-11-29 | Baxter International Inc. | Method for preparing submicron particles of antineoplastic agents |
| GB0107106D0 (en) * | 2001-03-21 | 2001-05-09 | Boehringer Ingelheim Pharma | Powder inhaler formulations |
| US6730319B2 (en) | 2001-06-06 | 2004-05-04 | Hoffmann-La Roche Inc. | Pharmaceutical compositions having depressed melting points |
| PL368587A1 (en) * | 2001-06-22 | 2005-04-04 | Pfizer Products Inc. | Pharmaceutical compositions comprising low-solubility and/or acid-sensitive drugs and neutralized acidic polymers |
| JP2004534811A (ja) * | 2001-06-22 | 2004-11-18 | ファイザー・プロダクツ・インク | ポリマーと薬剤の集合体を含む医薬組成物 |
| ES2333645T3 (es) * | 2001-06-22 | 2010-02-25 | Bend Research, Inc. | Composiciones farmaceuticas de dispersiones de medicamentos y polimeros neutros. |
| US20080305173A1 (en) * | 2001-07-31 | 2008-12-11 | Beuford Arlie Bogue | Amorphous drug beads |
| US7163700B2 (en) * | 2001-07-31 | 2007-01-16 | Capricorn Pharma, Inc. | Amorphous drug beads |
| JP3549197B2 (ja) * | 2001-08-10 | 2004-08-04 | 日清ファルマ株式会社 | ユビキノン含有製剤 |
| US20030054042A1 (en) * | 2001-09-14 | 2003-03-20 | Elaine Liversidge | Stabilization of chemical compounds using nanoparticulate formulations |
| CN1558755A (zh) | 2001-09-26 | 2004-12-29 | ���ع��ʹ�˾ | 通过分散和除去溶剂或液相制备亚微米大小的纳米颗粒 |
| US20060003012A9 (en) | 2001-09-26 | 2006-01-05 | Sean Brynjelsen | Preparation of submicron solid particle suspensions by sonication of multiphase systems |
| US7112340B2 (en) * | 2001-10-19 | 2006-09-26 | Baxter International Inc. | Compositions of and method for preparing stable particles in a frozen aqueous matrix |
| EP1992335A1 (en) | 2001-11-01 | 2008-11-19 | Nektar Therapeutics | Spray drying methods and compositions thereof |
| GB0127805D0 (en) * | 2001-11-20 | 2002-01-09 | Smithkline Beecham Plc | Pharmaceutical composition |
| US20030129242A1 (en) * | 2002-01-04 | 2003-07-10 | Bosch H. William | Sterile filtered nanoparticulate formulations of budesonide and beclomethasone having tyloxapol as a surface stabilizer |
| US20040101566A1 (en) * | 2002-02-04 | 2004-05-27 | Elan Pharma International Limited | Novel benzoyl peroxide compositions |
| JP4598399B2 (ja) * | 2002-02-04 | 2010-12-15 | エラン ファーマ インターナショナル,リミティド | 表面安定剤としてリゾチームを有するナノ粒子組成物 |
| US7008644B2 (en) * | 2002-03-20 | 2006-03-07 | Advanced Inhalation Research, Inc. | Method and apparatus for producing dry particles |
| AU2003218306B2 (en) * | 2002-03-20 | 2006-09-14 | Advanced Inhalation Research, Inc. | Method for administration of growth hormone via pulmonary delivery |
| ATE343376T1 (de) * | 2002-03-20 | 2006-11-15 | Elan Pharma Int Ltd | Nanopartikelzusammensetzungen von angiogeneseinhibitoren |
| GB0216562D0 (en) | 2002-04-25 | 2002-08-28 | Bradford Particle Design Ltd | Particulate materials |
| US9339459B2 (en) | 2003-04-24 | 2016-05-17 | Nektar Therapeutics | Particulate materials |
| US20070264348A1 (en) * | 2002-05-24 | 2007-11-15 | Elan Pharma International, Ltd. | Nanoparticulate fibrate formulations |
| CA2492488A1 (en) * | 2002-07-16 | 2004-01-22 | Elan Pharma International, Ltd. | Liquid dosage compositions of stable nanoparticulate active agents |
| US20030017208A1 (en) * | 2002-07-19 | 2003-01-23 | Francis Ignatious | Electrospun pharmaceutical compositions |
| AU2003276688A1 (en) * | 2002-09-02 | 2004-03-19 | Sun Pharmaceutical Industries Limited | Pharmaceutical composition of metaxalone with enhanced oral bioavailability |
| CA2508870C (en) | 2002-12-30 | 2012-10-16 | Novartis Ag | Prefilming atomizer |
| AU2004220556B2 (en) | 2003-03-07 | 2009-05-07 | Alnylam Pharmaceuticals, Inc. | Therapeutic compositions |
| EP2669377A3 (en) | 2003-04-17 | 2015-10-14 | Alnylam Pharmaceuticals Inc. | Modified iRNA agents |
| WO2004103346A1 (en) * | 2003-05-20 | 2004-12-02 | Ranbaxy Laboratories Limited | Pharmaceutical compositions of acitretin |
| EP1652515A1 (en) * | 2003-08-06 | 2006-05-03 | Eisai Co., Ltd. | Process for producing drug ultramicroparticle and apparatus therefor |
| US8377952B2 (en) | 2003-08-28 | 2013-02-19 | Abbott Laboratories | Solid pharmaceutical dosage formulation |
| US8025899B2 (en) | 2003-08-28 | 2011-09-27 | Abbott Laboratories | Solid pharmaceutical dosage form |
| WO2005020933A2 (en) * | 2003-09-02 | 2005-03-10 | University Of South Florida | Nanoparticles for drug-delivery |
| EP1688169A4 (en) * | 2003-11-28 | 2008-10-01 | Mitsubishi Chem Corp | PROCESS FOR PRODUCING FINE PARTICLES OF AN ORGANIC COMPOUND |
| US20050196416A1 (en) * | 2004-02-05 | 2005-09-08 | Kipp James E. | Dispersions prepared by use of self-stabilizing agents |
| US8551512B2 (en) * | 2004-03-22 | 2013-10-08 | Advanced Cardiovascular Systems, Inc. | Polyethylene glycol/poly(butylene terephthalate) copolymer coated devices including EVEROLIMUS |
| GB0501835D0 (en) * | 2005-01-28 | 2005-03-09 | Unilever Plc | Improvements relating to spray dried compositions |
| CN101583620B (zh) | 2005-11-28 | 2016-08-17 | 马里纳斯医药公司 | 加奈索酮组合物及其制备和使用方法 |
| US20070286814A1 (en) * | 2006-06-12 | 2007-12-13 | Medispray Laboratories Pvt. Ltd. | Stable aerosol pharmaceutical formulations |
| EP2051696A2 (en) * | 2006-08-18 | 2009-04-29 | Morton Grove Pharmaceuticals, Inc. | Stable liquid levetiracetam compositions and methods |
| US8946200B2 (en) * | 2006-11-02 | 2015-02-03 | Southwest Research Institute | Pharmaceutically active nanosuspensions |
| AU2007325628A1 (en) | 2006-11-28 | 2008-06-05 | Marinus Pharmaceuticals | Nanoparticulate formulations and methods for the making and use thereof |
| US20100151035A1 (en) * | 2007-03-13 | 2010-06-17 | Sandoz Ag | Pharmaceutical compositions of poorly soluble drugs |
| US8722736B2 (en) | 2007-05-22 | 2014-05-13 | Baxter International Inc. | Multi-dose concentrate esmolol with benzyl alcohol |
| US8426467B2 (en) | 2007-05-22 | 2013-04-23 | Baxter International Inc. | Colored esmolol concentrate |
| CA2910760C (en) | 2007-12-04 | 2019-07-09 | Muthiah Manoharan | Targeting lipids |
| US8404850B2 (en) * | 2008-03-13 | 2013-03-26 | Southwest Research Institute | Bis-quaternary pyridinium-aldoxime salts and treatment of exposure to cholinesterase inhibitors |
| WO2009126933A2 (en) | 2008-04-11 | 2009-10-15 | Alnylam Pharmaceuticals, Inc. | Site-specific delivery of nucleic acids by combining targeting ligands with endosomolytic components |
| US8722706B2 (en) * | 2008-08-15 | 2014-05-13 | Southwest Research Institute | Two phase bioactive formulations of bis-quaternary pyridinium oxime sulfonate salts |
| WO2010030821A2 (en) | 2008-09-10 | 2010-03-18 | Biochemics, Inc. | Ibuprofen for topical administration |
| US8309134B2 (en) * | 2008-10-03 | 2012-11-13 | Southwest Research Institute | Modified calcium phosphate nanoparticle formation |
| ES2530049T3 (es) | 2009-05-18 | 2015-02-26 | Sigmoid Pharma Limited | Composición que comprende gotas de aceite |
| PL2952191T3 (pl) | 2009-06-12 | 2019-02-28 | Sunovion Pharmaceuticals Inc. | Apomorfina w postaci do podawania podjęzykowego |
| US9028873B2 (en) * | 2010-02-08 | 2015-05-12 | Southwest Research Institute | Nanoparticles for drug delivery to the central nervous system |
| WO2011109427A2 (en) | 2010-03-01 | 2011-09-09 | Alnylam Pharmaceuticals, Inc. | Improving the biological activity of sirna through modulation of its thermodynamic profile |
| EA031156B1 (ru) | 2010-12-16 | 2018-11-30 | Суновион Фармасьютикалз Инк. | Сублингвальные пленки |
| EP2468258A1 (en) * | 2010-12-22 | 2012-06-27 | LEK Pharmaceuticals d.d. | Process for the preparation of a pharmaceutical composition comprising a low soluble pharmaceutically active ingredient |
| ES2645769T3 (es) | 2011-01-05 | 2017-12-07 | Hospira, Inc. | Secado por pulverización de la vancomicina |
| MX350838B (es) | 2011-02-11 | 2017-09-18 | Grain Proc Corporation * | Composicion de sal. |
| US9732068B1 (en) | 2013-03-15 | 2017-08-15 | GenSyn Technologies, Inc. | System for crystalizing chemical compounds and methodologies for utilizing the same |
| CN104043104B (zh) | 2013-03-15 | 2018-07-10 | 浙江创新生物有限公司 | 含盐酸万古霉素的喷雾干粉及其工业化制备方法 |
| WO2015071841A1 (en) | 2013-11-12 | 2015-05-21 | Druggability Technologies Holdings Limited | Complexes of dabigatran and its derivatives, process for the preparation thereof and pharmaceutical compositions containing them |
| GB2527555B (en) | 2014-06-25 | 2018-09-19 | Norbrook Lab Ltd | Stable methimazole liquid compositions |
| WO2016057693A1 (en) | 2014-10-10 | 2016-04-14 | Alnylam Pharmaceuticals, Inc. | Methods and compositions for inhalation delivery of conjugated oligonucleotide |
| EP3285771B1 (en) | 2015-04-21 | 2025-02-12 | Sunovion Pharmaceuticals Inc. | Methods of treating parkinson's disease by administration of apomorphine to an oral mucosa |
| WO2018031748A1 (en) | 2016-08-11 | 2018-02-15 | Ovid Therapeutics Inc. | Methods and compositions for treatment of epileptic disorders |
| US10391105B2 (en) | 2016-09-09 | 2019-08-27 | Marinus Pharmaceuticals Inc. | Methods of treating certain depressive disorders and delirium tremens |
| EP3840754A4 (en) | 2018-08-23 | 2022-09-14 | Sunovion Pharmaceuticals Inc. | ACID ADDITIONAL SALTS OF APOMORPHINE, PHARMACEUTICAL COMPOSITIONS THEREOF AND METHODS OF USE THEREOF |
| WO2020118142A1 (en) | 2018-12-07 | 2020-06-11 | Marinus Pharmaceuticals, Inc. | Ganaxolone for use in prophylaxis and treatment of pospartum depression |
| CA3145923A1 (en) | 2019-08-05 | 2021-02-11 | David Czekai | Ganaxolone for use in treatment of status epilepticus |
| US20230339880A1 (en) | 2019-10-11 | 2023-10-26 | Corbus Pharmaceuticals, Inc. | Compositions of ajulemic acid and uses thereof |
| WO2021113834A1 (en) | 2019-12-06 | 2021-06-10 | Marinus Pharmaceuticals, Inc. | Ganaxolone for use in treating tuberous sclerosis complex |
| WO2026015623A2 (en) | 2024-07-09 | 2026-01-15 | Farmastar Llc | Pharmaceutical formulations comprising dydrogesterone and methods of preparation thereof |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2650895A (en) * | 1947-02-24 | 1953-09-01 | Mead Johnson & Co | Spray dried vitamin a and d emulsion |
| US2805977A (en) * | 1955-01-04 | 1957-09-10 | Smith Kline French Lab | Sustained release pharmaceutical preparation |
| US2875130A (en) * | 1956-11-20 | 1959-02-24 | Smith Kline French Lab | Method of preparing sustained release particles and the product of the method |
| US2897119A (en) * | 1957-11-12 | 1959-07-28 | Camp Sea Food Company Inc Van | Stable powdered oil soluble vitamins and method of preparing stable powdered oil soluble vitamins |
| US3056728A (en) * | 1958-10-14 | 1962-10-02 | Ohtaki Shinshiro | Process for manufacturing powdered preparations containing fat-soluble vitamins, essential oils, and mixtures thereof |
| US3493652A (en) * | 1962-09-14 | 1970-02-03 | Charles W Hartman | Controlled release medicament |
| US3594326A (en) * | 1964-12-03 | 1971-07-20 | Ncr Co | Method of making microscopic capsules |
| GB1142147A (en) * | 1965-05-28 | 1969-02-05 | Glaxo Lab Ltd | A process for making free-flowing gel particles |
| US3565559A (en) * | 1968-03-11 | 1971-02-23 | Sumitomo Chemical Co | Process for making microcapsules |
| US3577514A (en) * | 1968-06-10 | 1971-05-04 | Pfizer | Sustained release pharmaceutical tablets |
| BE744162A (fr) * | 1969-01-16 | 1970-06-15 | Fuji Photo Film Co Ltd | Procede d'encapsulage |
| GB1413186A (en) * | 1973-06-27 | 1975-11-12 | Toyo Jozo Kk | Process for encapsulation of medicaments |
-
1980
- 1980-04-10 DE DE19803013839 patent/DE3013839A1/de active Granted
- 1980-04-11 IT IT48394/80A patent/IT1143089B/it active
- 1980-04-11 CH CH281080A patent/CH646052A5/de not_active IP Right Cessation
- 1980-04-14 GB GB8012248A patent/GB2050828B/en not_active Expired
-
1982
- 1982-09-20 US US06/420,384 patent/US4540602A/en not_active Expired - Fee Related
-
1983
- 1983-06-08 GB GB08315756A patent/GB2122085B/en not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT397914B (de) * | 1986-12-19 | 1994-08-25 | Sandoz Ag | Pharmazeutisches präparat für die intravenöse wirkstoffapplikation mit hydrosolen im nanometerbereich |
Also Published As
| Publication number | Publication date |
|---|---|
| GB2122085B (en) | 1984-05-23 |
| GB2050828A (en) | 1981-01-14 |
| GB2122085A (en) | 1984-01-11 |
| DE3013839A1 (de) | 1980-10-30 |
| IT1143089B (it) | 1986-10-22 |
| GB8315756D0 (en) | 1983-07-13 |
| DE3013839C2 (enExample) | 1990-10-04 |
| US4540602A (en) | 1985-09-10 |
| GB2050828B (en) | 1983-11-16 |
| IT8048394A0 (it) | 1980-04-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3013839C2 (enExample) | ||
| DE69311800T2 (de) | Verfahren zur herstellung von pellets mit verzögerter freisetzung | |
| DE60019741T2 (de) | Nanopartikelzusammensetzungen enthaltend eplerenon | |
| DE60020732T2 (de) | Verfahren zur herstellung von nanometer partikeln durch fliessbett- sprühtrocknung | |
| DE60020343T2 (de) | Cilostazol enthaltende zubereitung | |
| DE69811233T2 (de) | Feste lösungen und dispersionen von eines schlecht wasserlöslichen wirkstoffes | |
| DE3586600T2 (de) | Dosierungsform eine vielzahl mit einer diffusionshuelle ueberzogener einheiten enthaltend. | |
| AT396425B (de) | Verfahren zur herstellung von zusammensetzungen, die stoffe anhaltend abgeben und so erhaltene zusammensetzungen | |
| DE69107767T2 (de) | Mikroeinkapselung für ein System zur kontrollierten oralen Wirkstoffabgabe. | |
| DE69731847T2 (de) | Nach einer definierten zeitspanne freisetzende dosisformulierungen und verfahren zu deren herstellung | |
| DE60128261T2 (de) | Verfahren umfassend einen induzierten phasenübergang zur herstellung von hydrophobe wirkstoffe enthaltenden mikropartikeln | |
| DE69521406T2 (de) | Apparat und verfahren zur herstellung fester formen mit gesteuerter freisetzung des wirkstoffs | |
| DE60033040T2 (de) | Emulsionsverfahren zur herstellung von mikropartikeln | |
| EP1073426B1 (de) | Pharmazeutische ciclosporin-formulierung mit verbesserten biopharmazeutischen eigenschaften, erhöhter physikalischer qualität & stabilität sowie verfahren zur herstellung | |
| DE69023183T2 (de) | Rotogranulate und geschmacksabdeckende Überzüge zur Herstellung pharmazeutischer Kautabletten. | |
| DE3503681C2 (enExample) | ||
| DE60214012T2 (de) | Verfahren zur herstellung kristalliner arzneimittelteilchen durch ausfällung | |
| DE69123075T2 (de) | Ueberzogene Zusammensetzung sowie Verfahren zu ihrer Herstellung | |
| DE69427466T2 (de) | Bisacodyl dosierungsform | |
| DE69812078T2 (de) | Agglomerate oder sphärische teilchen aus polyvalenten metall-alginaten, an die agglomerate gebundene zusammensetzungen für die kontrollierte freisetzung, die schwerlösliche medikamente enthalten, und verfahren für ihre herstellung | |
| CH668553A5 (de) | Arzneimittel mit verzoegerter wirkstofffreisetzung. | |
| CH652307A5 (de) | Pharmazeutische zusammensetzung fuer die orale anwendung. | |
| DE29825080U1 (de) | Pharmazeutische Fenofibratzusammensetzung mit erhöhter Bioverfügbarkeit | |
| WO2000033820A2 (de) | Nanopartikuläre kern-schale systeme sowie deren verwendung in pharmazeutischen und kosmetischen zubereitungen | |
| DE69715191T2 (de) | Verfahren zur Herstellung von Mikropartikeln |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |