CH625513A5 - - Google Patents
Download PDFInfo
- Publication number
- CH625513A5 CH625513A5 CH1499875A CH1499875A CH625513A5 CH 625513 A5 CH625513 A5 CH 625513A5 CH 1499875 A CH1499875 A CH 1499875A CH 1499875 A CH1499875 A CH 1499875A CH 625513 A5 CH625513 A5 CH 625513A5
- Authority
- CH
- Switzerland
- Prior art keywords
- cyanuric chloride
- hydrolysis
- water
- solvent
- acetone
- Prior art date
Links
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 105
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 64
- 239000000243 solution Substances 0.000 description 58
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 47
- 238000006460 hydrolysis reaction Methods 0.000 description 43
- 230000007062 hydrolysis Effects 0.000 description 42
- 239000000725 suspension Substances 0.000 description 42
- 239000002904 solvent Substances 0.000 description 36
- 239000007788 liquid Substances 0.000 description 33
- 238000003860 storage Methods 0.000 description 25
- 239000000203 mixture Substances 0.000 description 24
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 21
- 238000000034 method Methods 0.000 description 17
- 238000002156 mixing Methods 0.000 description 12
- 239000003125 aqueous solvent Substances 0.000 description 10
- 238000001816 cooling Methods 0.000 description 10
- 239000011521 glass Substances 0.000 description 9
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 8
- 238000004519 manufacturing process Methods 0.000 description 8
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 239000003960 organic solvent Substances 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- -1 herbicides Chemical class 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 4
- VVXOSJUBBAUVMI-UHFFFAOYSA-N propan-2-one;2,4,6-trichloro-1,3,5-triazine Chemical compound CC(C)=O.ClC1=NC(Cl)=NC(Cl)=N1 VVXOSJUBBAUVMI-UHFFFAOYSA-N 0.000 description 4
- 238000000935 solvent evaporation Methods 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- RGSFGYAAUTVSQA-UHFFFAOYSA-N Cyclopentane Chemical compound C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 2
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 2
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 2
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000001335 aliphatic alkanes Chemical class 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- NNBZCPXTIHJBJL-UHFFFAOYSA-N decalin Chemical compound C1CCCC2CCCCC21 NNBZCPXTIHJBJL-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- OVARTBFNCCXQKS-UHFFFAOYSA-N propan-2-one;hydrate Chemical compound O.CC(C)=O OVARTBFNCCXQKS-UHFFFAOYSA-N 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- BOSAWIQFTJIYIS-UHFFFAOYSA-N 1,1,1-trichloro-2,2,2-trifluoroethane Chemical compound FC(F)(F)C(Cl)(Cl)Cl BOSAWIQFTJIYIS-UHFFFAOYSA-N 0.000 description 1
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ZFWAHZCOKGWUIT-UHFFFAOYSA-N 1-anilino-3-phenyliminourea Chemical compound C=1C=CC=CC=1N=NC(=O)NNC1=CC=CC=C1 ZFWAHZCOKGWUIT-UHFFFAOYSA-N 0.000 description 1
- YTCGOUNVIAWCMG-UHFFFAOYSA-N 1-chloro-3-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC(Cl)=C1 YTCGOUNVIAWCMG-UHFFFAOYSA-N 0.000 description 1
- YKUDHBLDJYZZQS-UHFFFAOYSA-N 2,6-dichloro-1h-1,3,5-triazin-4-one Chemical compound OC1=NC(Cl)=NC(Cl)=N1 YKUDHBLDJYZZQS-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- YDHNHFNGJCKAIZ-UHFFFAOYSA-N 6-chloro-1,3,5-triazine-2,4-diol Chemical compound OC1=NC(O)=NC(Cl)=N1 YDHNHFNGJCKAIZ-UHFFFAOYSA-N 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical compound ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 235000011148 calcium chloride Nutrition 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 150000005288 chlorofluorobenzenes Chemical class 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- QPJDMGCKMHUXFD-UHFFFAOYSA-N cyanogen chloride Chemical compound ClC#N QPJDMGCKMHUXFD-UHFFFAOYSA-N 0.000 description 1
- 150000001924 cycloalkanes Chemical class 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- DMEGYFMYUHOHGS-UHFFFAOYSA-N heptamethylene Natural products C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000001139 pH measurement Methods 0.000 description 1
- 239000003586 protic polar solvent Substances 0.000 description 1
- 229910002059 quaternary alloy Inorganic materials 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- PXXNTAGJWPJAGM-UHFFFAOYSA-N vertaline Natural products C1C2C=3C=C(OC)C(OC)=CC=3OC(C=C3)=CC=C3CCC(=O)OC1CC1N2CCCC1 PXXNTAGJWPJAGM-UHFFFAOYSA-N 0.000 description 1
- 238000004073 vulcanization Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/28—Only halogen atoms, e.g. cyanuric chloride
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Paper (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Macromolecular Compounds Obtained By Forming Nitrogen-Containing Linkages In General (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2454910A DE2454910C3 (de) | 1974-11-20 | 1974-11-20 | Verfahren und Vorrichtung zum Herstellen von Lösungen oder Suspensionen von Cyanurchlorid in wasserhaltigen organischen Lösungsmitteln |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH625513A5 true CH625513A5 (enExample) | 1981-09-30 |
Family
ID=5931280
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1499875A CH625513A5 (enExample) | 1974-11-20 | 1975-11-19 |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US4017413A (enExample) |
| JP (1) | JPS5180879A (enExample) |
| AT (1) | AT345296B (enExample) |
| BE (1) | BE835743A (enExample) |
| CA (1) | CA1036160A (enExample) |
| CH (1) | CH625513A5 (enExample) |
| DD (1) | DD122383A5 (enExample) |
| DE (1) | DE2454910C3 (enExample) |
| FR (1) | FR2291972A1 (enExample) |
| GB (1) | GB1524537A (enExample) |
| NL (1) | NL7513237A (enExample) |
| RO (1) | RO70804A (enExample) |
| SU (1) | SU621318A3 (enExample) |
| YU (2) | YU41809B (enExample) |
| ZA (1) | ZA757296B (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1593543A (en) * | 1977-05-10 | 1981-07-15 | Agfa Gevaert | Hardening of proteinaceous materials |
| DE2850243C2 (de) * | 1978-11-20 | 1984-09-20 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung von Suspensionen von Cyanurchlorid in organischen Lösungsmitteln |
| DE2850339C2 (de) * | 1978-11-20 | 1981-02-26 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung von 2-Alkoxy-4,6-dichlor-s-triazinen |
| DE2850308C2 (de) * | 1978-11-20 | 1984-09-20 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung von Suspensionen oder Lösungen von Cyanurchlorid in wasserhaltigen organischen Lösungsmitteln |
| DE2850271C3 (de) | 1978-11-20 | 1981-10-01 | Degussa Ag, 6000 Frankfurt | Vorrichtung zur intensiven Mischung von Flüssigkeiten |
| DE2850242C2 (de) * | 1978-11-20 | 1984-10-04 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung von Suspensionen von Cyanurchlorid in Wasser |
| DE4232117A1 (de) * | 1992-09-25 | 1994-03-31 | Degussa | Verfahren zur Herstellung von Suspensionen von Cyanurchlorid in wäßrigen Flüssigkeiten |
| US5629528A (en) | 1996-01-16 | 1997-05-13 | Varian Associates, Inc. | Charged particle beam system having beam-defining slit formed by rotating cyclinders |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE390201C (de) * | 1921-05-30 | 1924-02-14 | Chemische Ind Ges | Verfahren zur Herstellung von Kondensationsprodukten der Anthrachinonreihe |
| FR1411816A (fr) * | 1964-08-11 | 1965-09-24 | Electro Chimie Soc D | Procédé d'obtention de chlorure de cyanuryle purifié à partir de mélanges gazeux le contenant |
| DE1670731B2 (de) * | 1966-08-11 | 1974-01-03 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung einer von Lösungsmitteln freien, wäßrigen, neutralen Cyanurchlorid-Suspension |
| CH510038A (de) * | 1967-02-17 | 1971-07-15 | Agripat Sa | Verfahren zur Herstellung einer Cyanurchloridlösung aus gasförmigem Cyanurchlorid |
| DE1670568A1 (de) * | 1967-07-07 | 1972-02-24 | Degussa | Verfahren zur Herstellung von substituierten 2-Mercapto-4,6-dichlor-s-triazinen |
| DE1670289B2 (de) * | 1967-11-28 | 1977-02-10 | Basf Ag, 6700 Ludwigshafen | S-triazinderivate |
| US3539565A (en) * | 1968-01-29 | 1970-11-10 | Geigy Chem Corp | Method for producing a solution of cyanuric chloride from gaseous cyanuric chloride |
| DE1695117C3 (de) * | 1968-02-09 | 1974-01-17 | Ciba-Geigy Ag, Basel (Schweiz) | Verfahren zur Herstellung von Chloramino-s-triazinen |
| SE346110B (enExample) * | 1968-03-20 | 1972-06-26 | Ciba Geigy Ag | |
| CH546247A (de) * | 1968-12-27 | 1974-02-28 | Agripat Sa | Adiabatisches verfahren zur herstellung von n-monosubstituierten 2,4-dichlor-6-amino-s-triazinen. |
| US3883515A (en) * | 1969-12-29 | 1975-05-13 | Ciba Geigy Corp | Adiabatic process for the production of 2,4-dichloro-6-amino-S-triazines |
| US3741729A (en) * | 1970-03-26 | 1973-06-26 | Ciba Geigy Corp | Apparatus for producing a solution of cyanuric chloride from gaseous cyanuric chloride |
| CH550546A (de) * | 1971-08-05 | 1974-06-28 | Ciba Geigy Ag | Herbizides mittel. |
| DE2162064A1 (de) * | 1971-12-14 | 1973-06-20 | Sueddeutsche Kalkstickstoff | Verfahren zur gewinnung von festem cyanurchlorid |
| BE793389A (fr) * | 1971-12-27 | 1973-06-27 | Degussa | Composes de phenylenediamine-s-triazine et leur utilisation |
| DD111378A5 (enExample) * | 1973-06-27 | 1975-02-12 |
-
1974
- 1974-11-20 DE DE2454910A patent/DE2454910C3/de not_active Expired
- 1974-11-20 RO RO7483987A patent/RO70804A/ro unknown
-
1975
- 1975-10-31 GB GB45253/75A patent/GB1524537A/en not_active Expired
- 1975-11-07 YU YU2814/75A patent/YU41809B/xx unknown
- 1975-11-12 NL NL7513237A patent/NL7513237A/xx not_active Application Discontinuation
- 1975-11-18 US US05/632,952 patent/US4017413A/en not_active Expired - Lifetime
- 1975-11-18 DD DD189531A patent/DD122383A5/xx unknown
- 1975-11-19 AT AT880575A patent/AT345296B/de not_active IP Right Cessation
- 1975-11-19 BE BE6045257A patent/BE835743A/xx not_active IP Right Cessation
- 1975-11-19 CH CH1499875A patent/CH625513A5/de not_active IP Right Cessation
- 1975-11-20 CA CA240,152A patent/CA1036160A/en not_active Expired
- 1975-11-20 FR FR7535496A patent/FR2291972A1/fr active Granted
- 1975-11-20 ZA ZA757296A patent/ZA757296B/xx unknown
- 1975-11-20 JP JP50139713A patent/JPS5180879A/ja active Pending
- 1975-11-20 SU SU752191013A patent/SU621318A3/ru active
-
1983
- 1983-02-09 YU YU00303/83A patent/YU30383A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| RO70804A (ro) | 1980-08-15 |
| NL7513237A (nl) | 1976-05-24 |
| YU30383A (en) | 1986-02-28 |
| DE2454910A1 (de) | 1976-08-12 |
| JPS5180879A (enExample) | 1976-07-15 |
| FR2291972A1 (fr) | 1976-06-18 |
| DD122383A5 (enExample) | 1976-10-05 |
| ZA757296B (en) | 1976-11-24 |
| GB1524537A (en) | 1978-09-13 |
| DE2454910B2 (de) | 1980-03-20 |
| BE835743A (fr) | 1976-05-19 |
| SU621318A3 (ru) | 1978-08-25 |
| DE2454910C3 (de) | 1985-11-21 |
| US4017413A (en) | 1977-04-12 |
| AT345296B (de) | 1978-09-11 |
| YU281475A (en) | 1984-02-29 |
| FR2291972B1 (enExample) | 1977-12-16 |
| YU41809B (en) | 1988-02-29 |
| ATA880575A (de) | 1978-01-15 |
| CA1036160A (en) | 1978-08-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0299577B1 (de) | Verfahren zur Herstellung von Alkoholaten | |
| DE2454910C3 (de) | Verfahren und Vorrichtung zum Herstellen von Lösungen oder Suspensionen von Cyanurchlorid in wasserhaltigen organischen Lösungsmitteln | |
| EP0020952B1 (de) | Verfahren zur Herstellung von Epsilon-Caprolacton aus Cyclohexanon und Perpropionsäure | |
| EP0238575A1 (de) | Verfahren zur gewinnung von vanillin. | |
| DE2608446A1 (de) | Verfahren zur herstellung von 1-hydroxy-aethyliden-1,1-diphosphonsaeure | |
| DE2551164A1 (de) | Verfahren und vorrichtung zum herstellen von loesungen oder suspensionen von cyanurchlorid in wasserhaltigen organischen loesungsmitteln | |
| DE3425907C2 (enExample) | ||
| DE2840554C2 (de) | Verfahren zur Herstellung von Aminoalkylschwefelsäurehalbestern | |
| EP0050290B1 (de) | Verfahren zur Herstellung von Alkalisalzen der Imidodisulfonsäure | |
| WO1997016409A1 (de) | Verfahren und vorrichtung zur kontinuierlichen herstellung von n-acylaminocarbonsäuren und n-acylaminosulfonsäuren sowie deren alkalimetallsalzen | |
| DE2033122A1 (de) | Verfahren zur Herstellung von omega Lactamen und deren m Lactame uberfuhrbaren Vorlaufern | |
| DE1088063B (de) | Verfahren zur Rueckgewinnung von Dicarbonsaeuren und Diaminen aus Polyamiden | |
| DE2428719C2 (de) | Verfahren zur Abtrennung von Trioxan aus wäßrigen Lösungen | |
| DE2729761C2 (de) | Methylierung von 4-Amino-tert.- butyl-3-mercapto-1,2,4-triazin-5-on | |
| EP0036406B1 (de) | Verfahren zur Extraktion von Essigsäure, Ameisensäure, gegebenenfalls Furfurol | |
| DE3916272A1 (de) | Verfahren zur herstellung von phosphorsaeure-tris(2-chlor(iso)-propyl)estern | |
| DE3137356C2 (de) | Verfahren zur Herstellung von konzentrierter Ameisensäure | |
| EP0168659B1 (de) | Verfahren zur Herstellung von Chlorisocyanursäuren | |
| AT226208B (de) | Verfahren zur kontinuierlichen Herstellung von Pentaerythrit | |
| DE1019288B (de) | Verfahren zur Herstellung von fester, granulierter, wasserloeslicher Oxyalkylstaerke | |
| DE2601091C3 (de) | Verfahren zur Herstellung von a-Resorcylsäure | |
| DE1910057C3 (de) | Verfahren zur kontinuierlichen Herstellung von Pentaerythrit | |
| DE2427268C3 (de) | Verfahren zur Herstellung von Dicyan | |
| DE1495465B2 (de) | Verfahren zum Herstellen von Paraformaldehyd« | |
| DE60200217T2 (de) | Verfahren zur herstellung von 2,3-dichlor-1-propanol und epichlorhydrin |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |