CH621338A5 - - Google Patents
Download PDFInfo
- Publication number
- CH621338A5 CH621338A5 CH345775A CH345775A CH621338A5 CH 621338 A5 CH621338 A5 CH 621338A5 CH 345775 A CH345775 A CH 345775A CH 345775 A CH345775 A CH 345775A CH 621338 A5 CH621338 A5 CH 621338A5
- Authority
- CH
- Switzerland
- Prior art keywords
- pyrrolidone
- prepared
- phenyl
- methoxyphenyl
- methoxy
- Prior art date
Links
- 238000000034 method Methods 0.000 claims description 34
- -1 3-methyl-2-propenyl Chemical group 0.000 claims description 33
- 150000001875 compounds Chemical class 0.000 claims description 27
- 125000000217 alkyl group Chemical group 0.000 claims description 17
- 125000004432 carbon atom Chemical group C* 0.000 claims description 16
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 7
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 5
- 239000007858 starting material Substances 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 150000002148 esters Chemical class 0.000 claims description 4
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 3
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 claims description 3
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 claims description 3
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 claims description 3
- 125000005958 tetrahydrothienyl group Chemical group 0.000 claims description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 3
- 229920002554 vinyl polymer Polymers 0.000 claims description 3
- VRBRFUIIINZKKW-UHFFFAOYSA-N 4-(3-butoxy-4-methoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(OC)C(OCCCC)=CC(C2CC(=O)NC2)=C1 VRBRFUIIINZKKW-UHFFFAOYSA-N 0.000 claims description 2
- MDXHIURCBXYOAC-UHFFFAOYSA-N 4-(3-cyclobutyloxy-4-methoxyphenyl)pyrrolidin-2-one Chemical compound COC1=CC=C(C2CC(=O)NC2)C=C1OC1CCC1 MDXHIURCBXYOAC-UHFFFAOYSA-N 0.000 claims description 2
- BPRUNKGOYXLKFB-UHFFFAOYSA-N 4-(3-cyclohexyloxy-4-methoxyphenyl)pyrrolidin-2-one Chemical compound COC1=CC=C(C2CC(=O)NC2)C=C1OC1CCCCC1 BPRUNKGOYXLKFB-UHFFFAOYSA-N 0.000 claims description 2
- VTARTKPFBJOKKS-UHFFFAOYSA-N 4-(3-ethoxy-4-methoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(OC)C(OCC)=CC(C2CC(=O)NC2)=C1 VTARTKPFBJOKKS-UHFFFAOYSA-N 0.000 claims description 2
- DRYYWFMMNCCJKU-UHFFFAOYSA-N 4-(3-hexoxy-4-methoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(OC)C(OCCCCCC)=CC(C2CC(=O)NC2)=C1 DRYYWFMMNCCJKU-UHFFFAOYSA-N 0.000 claims description 2
- BGAWKQALHPLHBL-UHFFFAOYSA-N 4-(4-methoxy-3-propan-2-yloxyphenyl)pyrrolidin-2-one Chemical compound C1=C(OC(C)C)C(OC)=CC=C1C1CC(=O)NC1 BGAWKQALHPLHBL-UHFFFAOYSA-N 0.000 claims description 2
- PBSUWVSCBKZZHH-UHFFFAOYSA-N 4-(4-methoxy-3-propoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(OC)C(OCCC)=CC(C2CC(=O)NC2)=C1 PBSUWVSCBKZZHH-UHFFFAOYSA-N 0.000 claims description 2
- MHNKGZBTMAFGRH-UHFFFAOYSA-N 4-[3-(2,2-dimethylpropoxy)-4-methoxyphenyl]pyrrolidin-2-one Chemical compound C1=C(OCC(C)(C)C)C(OC)=CC=C1C1CC(=O)NC1 MHNKGZBTMAFGRH-UHFFFAOYSA-N 0.000 claims description 2
- AGQGSLHQIUKIEO-UHFFFAOYSA-N 4-[4-methoxy-3-(2-methylpropoxy)phenyl]pyrrolidin-2-one Chemical compound C1=C(OCC(C)C)C(OC)=CC=C1C1CC(=O)NC1 AGQGSLHQIUKIEO-UHFFFAOYSA-N 0.000 claims description 2
- 238000006266 etherification reaction Methods 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims 2
- JOTUXENQTHUWLA-UHFFFAOYSA-N 4-[3-(cyclopentylmethoxy)-4-methoxyphenyl]pyrrolidin-2-one Chemical compound COC1=CC=C(C2CC(=O)NC2)C=C1OCC1CCCC1 JOTUXENQTHUWLA-UHFFFAOYSA-N 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 39
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 33
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 24
- 238000002844 melting Methods 0.000 description 20
- 230000008018 melting Effects 0.000 description 20
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 10
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- 239000000243 solution Substances 0.000 description 10
- 239000002904 solvent Substances 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 238000009835 boiling Methods 0.000 description 9
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 238000001953 recrystallisation Methods 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- JNRKFSJWVCILHE-UHFFFAOYSA-N 4-(3,4-dimethoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C1CC(=O)NC1 JNRKFSJWVCILHE-UHFFFAOYSA-N 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- 239000003795 chemical substances by application Substances 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 239000003513 alkali Substances 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 150000004820 halides Chemical class 0.000 description 4
- 239000002798 polar solvent Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- OUIGCOUMOAUQOK-UHFFFAOYSA-N 4-(3,4-dihydroxyphenyl)pyrrolidin-2-one Chemical compound C1=C(O)C(O)=CC=C1C1CC(=O)NC1 OUIGCOUMOAUQOK-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- 230000029936 alkylation Effects 0.000 description 3
- 238000005804 alkylation reaction Methods 0.000 description 3
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzenecarboxaldehyde Natural products O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 3
- ZPEIMTDSQAKGNT-UHFFFAOYSA-N chlorpromazine Chemical compound C1=C(Cl)C=C2N(CCCN(C)C)C3=CC=CC=C3SC2=C1 ZPEIMTDSQAKGNT-UHFFFAOYSA-N 0.000 description 3
- 229960001076 chlorpromazine Drugs 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- 238000010626 work up procedure Methods 0.000 description 3
- KYVBNYUBXIEUFW-UHFFFAOYSA-N 1,1,3,3-tetramethylguanidine Chemical compound CN(C)C(=N)N(C)C KYVBNYUBXIEUFW-UHFFFAOYSA-N 0.000 description 2
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 2
- ZCKTZHJPWNRWGC-UHFFFAOYSA-N 4-(3,4-dimethoxyphenyl)-1-methylpyrrolidin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C1CC(=O)N(C)C1 ZCKTZHJPWNRWGC-UHFFFAOYSA-N 0.000 description 2
- XDGPXVGLRZEIGQ-UHFFFAOYSA-N 4-(3,4-dimethoxyphenyl)-1-phenylpyrrolidin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C1CC(=O)N(C=2C=CC=CC=2)C1 XDGPXVGLRZEIGQ-UHFFFAOYSA-N 0.000 description 2
- ZYGZOBCBEYNOLS-UHFFFAOYSA-N 4-(3,4-dimethoxyphenyl)pyrrolidine-2-thione Chemical compound C1=C(OC)C(OC)=CC=C1C1CC(=S)NC1 ZYGZOBCBEYNOLS-UHFFFAOYSA-N 0.000 description 2
- YJZMNJXUIXTKRD-UHFFFAOYSA-N 4-[4-methoxy-3-(2-methylpropoxy)phenyl]pyrrolidine-2-thione Chemical compound C1=C(OCC(C)C)C(OC)=CC=C1C1CC(=S)NC1 YJZMNJXUIXTKRD-UHFFFAOYSA-N 0.000 description 2
- VUGWJDGEPZNBKZ-UHFFFAOYSA-N 4-methoxy-3-(2-methylpropoxy)benzaldehyde Chemical compound COC1=CC=C(C=O)C=C1OCC(C)C VUGWJDGEPZNBKZ-UHFFFAOYSA-N 0.000 description 2
- FTOAOBMCPZCFFF-UHFFFAOYSA-N 5,5-diethylbarbituric acid Chemical compound CCC1(CC)C(=O)NC(=O)NC1=O FTOAOBMCPZCFFF-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- NOTFZGFABLVTIG-UHFFFAOYSA-N Cyclohexylethyl acetate Chemical compound CC(=O)OCCC1CCCCC1 NOTFZGFABLVTIG-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 2
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- YCOXTKKNXUZSKD-UHFFFAOYSA-N as-o-xylenol Natural products CC1=CC=C(O)C=C1C YCOXTKKNXUZSKD-UHFFFAOYSA-N 0.000 description 2
- 150000003935 benzaldehydes Chemical class 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 2
- VUWPIBNKJSEYIN-UHFFFAOYSA-N diethyl 2-benzylidenepropanedioate Chemical compound CCOC(=O)C(C(=O)OCC)=CC1=CC=CC=C1 VUWPIBNKJSEYIN-UHFFFAOYSA-N 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 125000001841 imino group Chemical group [H]N=* 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- SNHMUERNLJLMHN-UHFFFAOYSA-N iodobenzene Chemical compound IC1=CC=CC=C1 SNHMUERNLJLMHN-UHFFFAOYSA-N 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- JVTZFYYHCGSXJV-UHFFFAOYSA-N isovanillin Chemical compound COC1=CC=C(C=O)C=C1O JVTZFYYHCGSXJV-UHFFFAOYSA-N 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 238000007127 saponification reaction Methods 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 description 1
- HLVFKOKELQSXIQ-UHFFFAOYSA-N 1-bromo-2-methylpropane Chemical compound CC(C)CBr HLVFKOKELQSXIQ-UHFFFAOYSA-N 0.000 description 1
- JMVIVASFFKKFQK-UHFFFAOYSA-N 1-phenylpyrrolidin-2-one Chemical class O=C1CCCN1C1=CC=CC=C1 JMVIVASFFKKFQK-UHFFFAOYSA-N 0.000 description 1
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 1
- ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 2,3-dimethylbutane Chemical group CC(C)C(C)C ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 0.000 description 1
- FCFSAOPUPHLNEJ-UHFFFAOYSA-N 2-(4-hydroxy-3-methoxyphenyl)-1,3-dioxane-4,6-dione Chemical compound C1=C(O)C(OC)=CC(C2OC(=O)CC(=O)O2)=C1 FCFSAOPUPHLNEJ-UHFFFAOYSA-N 0.000 description 1
- XVLQFVLIZDFPSU-UHFFFAOYSA-N 2-[2-methoxy-5-(5-oxopyrrolidin-3-yl)phenoxy]acetonitrile Chemical compound C1=C(OCC#N)C(OC)=CC=C1C1CC(=O)NC1 XVLQFVLIZDFPSU-UHFFFAOYSA-N 0.000 description 1
- VHINIYSOMLMFTG-UHFFFAOYSA-N 2-[4-(3,4-dimethoxyphenyl)-2-oxopyrrolidin-1-yl]acetamide Chemical class C1=C(OC)C(OC)=CC=C1C1CC(=O)N(CC(N)=O)C1 VHINIYSOMLMFTG-UHFFFAOYSA-N 0.000 description 1
- KXTAOXNYQGASTA-UHFFFAOYSA-N 2-benzylidenepropanedioic acid Chemical class OC(=O)C(C(O)=O)=CC1=CC=CC=C1 KXTAOXNYQGASTA-UHFFFAOYSA-N 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- ISDGWTZFJKFKMO-UHFFFAOYSA-N 2-phenyl-1,3-dioxane-4,6-dione Chemical compound O1C(=O)CC(=O)OC1C1=CC=CC=C1 ISDGWTZFJKFKMO-UHFFFAOYSA-N 0.000 description 1
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 1
- VRLUBPOLSMSINR-UHFFFAOYSA-N 4-(2,3,4-trimethoxyphenyl)pyrrolidin-2-one Chemical compound COC1=C(OC)C(OC)=CC=C1C1CC(=O)NC1 VRLUBPOLSMSINR-UHFFFAOYSA-N 0.000 description 1
- FCQMUIUTCVVQGJ-UHFFFAOYSA-N 4-(2,4,5-trimethoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(OC)C(OC)=CC(OC)=C1C1CC(=O)NC1 FCQMUIUTCVVQGJ-UHFFFAOYSA-N 0.000 description 1
- IGOHZKUKFQBTNU-UHFFFAOYSA-N 4-(3,4-diethoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(OCC)C(OCC)=CC=C1C1CC(=O)NC1 IGOHZKUKFQBTNU-UHFFFAOYSA-N 0.000 description 1
- WFBUIWLAOBZOOS-UHFFFAOYSA-N 4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-2-thione Chemical compound COC1=CC=C(C2CC(=S)NC2)C=C1OC1CCCC1 WFBUIWLAOBZOOS-UHFFFAOYSA-N 0.000 description 1
- PAIFAXUSHBVXHY-UHFFFAOYSA-N 4-(3-hydroxy-4-methoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(O)C(OC)=CC=C1C1CC(=O)NC1 PAIFAXUSHBVXHY-UHFFFAOYSA-N 0.000 description 1
- BTBZIFHFPOTMKR-UHFFFAOYSA-N 4-(4-butoxy-3-methoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(OC)C(OCCCC)=CC=C1C1CC(=O)NC1 BTBZIFHFPOTMKR-UHFFFAOYSA-N 0.000 description 1
- OVRPDYOZYMCTAK-UHFFFAOYSA-N 4-(4-chlorophenyl)pyrrolidin-2-one Chemical compound C1=CC(Cl)=CC=C1C1CC(=O)NC1 OVRPDYOZYMCTAK-UHFFFAOYSA-N 0.000 description 1
- VDRLVVYETISUEM-UHFFFAOYSA-N 4-(4-ethoxy-3-methoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(OC)C(OCC)=CC=C1C1CC(=O)NC1 VDRLVVYETISUEM-UHFFFAOYSA-N 0.000 description 1
- SVMQZOFDDYTGFC-UHFFFAOYSA-N 4-(4-hydroxy-3-methoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(O)C(OC)=CC(C2CC(=O)NC2)=C1 SVMQZOFDDYTGFC-UHFFFAOYSA-N 0.000 description 1
- RLSDHKWIWIHPJW-UHFFFAOYSA-N 4-(4-methoxy-3-octadecoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(OC)C(OCCCCCCCCCCCCCCCCCC)=CC(C2CC(=O)NC2)=C1 RLSDHKWIWIHPJW-UHFFFAOYSA-N 0.000 description 1
- YJLVXTXGBPWDEI-UHFFFAOYSA-N 4-(4-methoxy-3-phenoxyphenyl)pyrrolidin-2-one Chemical compound COC1=CC=C(C2CC(=O)NC2)C=C1OC1=CC=CC=C1 YJLVXTXGBPWDEI-UHFFFAOYSA-N 0.000 description 1
- ATZYNFBZYFJVNY-UHFFFAOYSA-N 4-(4-methoxy-3-prop-2-ynoxyphenyl)pyrrolidin-2-one Chemical compound C(C#C)OC=1C=C(C=CC=1OC)C1CC(NC1)=O ATZYNFBZYFJVNY-UHFFFAOYSA-N 0.000 description 1
- FEHLYROWUSLMKU-UHFFFAOYSA-N 4-[3,4-bis(2-methylpropoxy)phenyl]pyrrolidin-2-one Chemical compound C1=C(OCC(C)C)C(OCC(C)C)=CC=C1C1CC(=O)NC1 FEHLYROWUSLMKU-UHFFFAOYSA-N 0.000 description 1
- UMIFSCOVIJEDCV-UHFFFAOYSA-N 4-[3-(2-hydroxyethoxy)-4-methoxyphenyl]pyrrolidin-2-one Chemical compound C1=C(OCCO)C(OC)=CC=C1C1CC(=O)NC1 UMIFSCOVIJEDCV-UHFFFAOYSA-N 0.000 description 1
- SIDOURMPNPMMGW-UHFFFAOYSA-N 4-[4-methoxy-3-(2,2,2-trifluoroethoxy)phenyl]pyrrolidin-2-one Chemical compound C1=C(OCC(F)(F)F)C(OC)=CC=C1C1CC(=O)NC1 SIDOURMPNPMMGW-UHFFFAOYSA-N 0.000 description 1
- KDNPPNAWMGJQPI-UHFFFAOYSA-N 4-[4-methoxy-3-(2-methylcyclopentyl)oxyphenyl]pyrrolidin-2-one Chemical compound COC1=CC=C(C2CC(=O)NC2)C=C1OC1CCCC1C KDNPPNAWMGJQPI-UHFFFAOYSA-N 0.000 description 1
- IQEKPGGRSNMTNX-UHFFFAOYSA-N 4-[4-methoxy-3-(3-methylbut-2-enoxy)phenyl]pyrrolidin-2-one Chemical compound C1=C(OCC=C(C)C)C(OC)=CC=C1C1CC(=O)NC1 IQEKPGGRSNMTNX-UHFFFAOYSA-N 0.000 description 1
- STKUGBHSNWILKY-UHFFFAOYSA-N 4-[4-methoxy-3-(oxolan-2-yloxy)phenyl]pyrrolidin-2-one Chemical compound COC1=CC=C(C2CC(=O)NC2)C=C1OC1CCCO1 STKUGBHSNWILKY-UHFFFAOYSA-N 0.000 description 1
- ODHCTXKNWHHXJC-VKHMYHEASA-N 5-oxo-L-proline Chemical compound OC(=O)[C@@H]1CCC(=O)N1 ODHCTXKNWHHXJC-VKHMYHEASA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- MPGYNIYMEVILPA-UHFFFAOYSA-N C(#CC)OC1=C(C=C(C=C1)C1CC(NC1)=O)OC Chemical compound C(#CC)OC1=C(C=C(C=C1)C1CC(NC1)=O)OC MPGYNIYMEVILPA-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 208000027776 Extrapyramidal disease Diseases 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- 208000012902 Nervous system disease Diseases 0.000 description 1
- 208000025966 Neurological disease Diseases 0.000 description 1
- 239000005662 Paraffin oil Substances 0.000 description 1
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 1
- 241000978776 Senegalia senegal Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- PQLVXDKIJBQVDF-UHFFFAOYSA-N acetic acid;hydrate Chemical compound O.CC(O)=O PQLVXDKIJBQVDF-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229940095564 anhydrous calcium sulfate Drugs 0.000 description 1
- 230000003042 antagnostic effect Effects 0.000 description 1
- 230000001773 anti-convulsant effect Effects 0.000 description 1
- 230000003502 anti-nociceptive effect Effects 0.000 description 1
- 239000001961 anticonvulsive agent Substances 0.000 description 1
- 229960003965 antiepileptics Drugs 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000001502 aryl halides Chemical class 0.000 description 1
- 238000006254 arylation reaction Methods 0.000 description 1
- 229960002319 barbital Drugs 0.000 description 1
- HUMNYLRZRPPJDN-KWCOIAHCSA-N benzaldehyde Chemical group O=[11CH]C1=CC=CC=C1 HUMNYLRZRPPJDN-KWCOIAHCSA-N 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- VXIVSQZSERGHQP-UHFFFAOYSA-N chloroacetamide Chemical compound NC(=O)CCl VXIVSQZSERGHQP-UHFFFAOYSA-N 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 230000003001 depressive effect Effects 0.000 description 1
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 description 1
- VQKSJEVJSPWVIE-UHFFFAOYSA-N diethyl 2-(2-nitro-1-phenylethyl)propanedioate Chemical compound CCOC(=O)C(C(=O)OCC)C(C[N+]([O-])=O)C1=CC=CC=C1 VQKSJEVJSPWVIE-UHFFFAOYSA-N 0.000 description 1
- RKGDXSLYBJAUHD-UHFFFAOYSA-N diethyl 2-[(3-hydroxy-4-methoxyphenyl)methylidene]propanedioate Chemical compound CCOC(=O)C(C(=O)OCC)=CC1=CC=C(OC)C(O)=C1 RKGDXSLYBJAUHD-UHFFFAOYSA-N 0.000 description 1
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 1
- UXGNZZKBCMGWAZ-UHFFFAOYSA-N dimethylformamide dmf Chemical compound CN(C)C=O.CN(C)C=O UXGNZZKBCMGWAZ-UHFFFAOYSA-N 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 235000019441 ethanol Nutrition 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 125000003106 haloaryl group Chemical group 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- QDGPDPYUDAGVNV-UHFFFAOYSA-N n,n-diethyl-2-[2-methoxy-4-(5-oxopyrrolidin-3-yl)phenoxy]acetamide Chemical compound C1=C(OC)C(OCC(=O)N(CC)CC)=CC=C1C1CC(=O)NC1 QDGPDPYUDAGVNV-UHFFFAOYSA-N 0.000 description 1
- DLUNNVIHLDUEKK-UHFFFAOYSA-N n,n-diethyl-2-[2-methoxy-5-(5-oxopyrrolidin-3-yl)phenoxy]acetamide Chemical compound C1=C(OC)C(OCC(=O)N(CC)CC)=CC(C2CC(=O)NC2)=C1 DLUNNVIHLDUEKK-UHFFFAOYSA-N 0.000 description 1
- 230000003533 narcotic effect Effects 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000000926 neurological effect Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 238000005457 optimization Methods 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229920001515 polyalkylene glycol Polymers 0.000 description 1
- 229920001021 polysulfide Polymers 0.000 description 1
- 239000005077 polysulfide Substances 0.000 description 1
- 150000008117 polysulfides Polymers 0.000 description 1
- CUQOHAYJWVTKDE-UHFFFAOYSA-N potassium;butan-1-olate Chemical compound [K+].CCCC[O-] CUQOHAYJWVTKDE-UHFFFAOYSA-N 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 208000020016 psychiatric disease Diseases 0.000 description 1
- 229940079889 pyrrolidonecarboxylic acid Drugs 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000011514 reflex Effects 0.000 description 1
- HJORMJIFDVBMOB-UHFFFAOYSA-N rolipram Chemical compound COC1=CC=C(C2CC(=O)NC2)C=C1OC1CCCC1 HJORMJIFDVBMOB-UHFFFAOYSA-N 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 230000004623 sleep-prolonging effect Effects 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 1
- SYXYWTXQFUUWLP-UHFFFAOYSA-N sodium;butan-1-olate Chemical compound [Na+].CCCC[O-] SYXYWTXQFUUWLP-UHFFFAOYSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 238000002211 ultraviolet spectrum Methods 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
- C07D207/273—2-Pyrrolidones with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to other ring carbon atoms
- C07D207/277—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/18—Antipsychotics, i.e. neuroleptics; Drugs for mania or schizophrenia
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/70—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form
- C07C45/71—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form being hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/52—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings
- C07C47/575—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings containing ether groups, groups, groups, or groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Animal Behavior & Ethology (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Psychiatry (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biomedical Technology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pyrrole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2413935A DE2413935A1 (de) | 1974-03-20 | 1974-03-20 | 4-(polyalkoxy-phenyl)-2-pyrrolidone |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH621338A5 true CH621338A5 (enExample) | 1981-01-30 |
Family
ID=5910915
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH345775A CH621338A5 (enExample) | 1974-03-20 | 1975-03-18 |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4012495A (enExample) |
| JP (1) | JPS6011028B2 (enExample) |
| AT (1) | AT347931B (enExample) |
| BE (1) | BE826923A (enExample) |
| CA (1) | CA1069517A (enExample) |
| CH (1) | CH621338A5 (enExample) |
| CS (1) | CS214738B2 (enExample) |
| DD (1) | DD119229A5 (enExample) |
| DE (1) | DE2413935A1 (enExample) |
| DK (1) | DK139965C (enExample) |
| ES (1) | ES435750A1 (enExample) |
| FR (1) | FR2264531B1 (enExample) |
| GB (1) | GB1498705A (enExample) |
| HU (1) | HU174074B (enExample) |
| IE (1) | IE40865B1 (enExample) |
| IL (1) | IL46883A (enExample) |
| NL (1) | NL7503367A (enExample) |
| SE (1) | SE402010B (enExample) |
| SU (1) | SU649312A3 (enExample) |
| YU (1) | YU40258B (enExample) |
Families Citing this family (114)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4193926A (en) | 1974-03-20 | 1980-03-18 | Schering Aktiengesellschaft | 4-(Polyalkoxy phenyl)-2-pyrrolidones |
| DE2541855A1 (de) * | 1975-09-18 | 1977-03-31 | Schering Ag | 4-(polyalkoxy-phenyl)-2-pyrrolidone ii |
| CU21107A3 (es) * | 1978-02-10 | 1988-02-01 | Hoffmann La Roche | Pyrrolidines derivatives |
| IL57266A (en) * | 1978-06-12 | 1982-12-31 | Mundipharma Ag | Production of pyrrolidin-2-ones and of 3-pyrrolin-2-ones |
| NL8004025A (nl) * | 1979-08-09 | 1981-02-11 | Hoffmann La Roche | Pyrrolidinederivaten en werkwijze voor het bereiden daarvan alsmede geneesmiddel. |
| GB2123288A (en) * | 1982-07-16 | 1984-02-01 | Wellcome Found | Anti-thrombotic agent |
| US4584313A (en) * | 1984-05-07 | 1986-04-22 | Warner-Lambert Company | (Substituted-phenyl)-5-oxo-2-pyrrolidinepropanoic acids and esters thereof, and use for reversing electroconvulsive shock-induced amnesia |
| US4548947A (en) * | 1984-05-07 | 1985-10-22 | Warner-Lambert Company | 1-(Substituted-aryl)-dihydro-1H-pyrrolizine-3,5-[2H,6H-]diones and use for reversing amnesia |
| US5783591A (en) * | 1984-10-19 | 1998-07-21 | Schering Aktiengesellschaft | Administration of oxazolidinone and pyrolidinone compounds for the treatment of inflammation |
| DE3438839A1 (de) * | 1984-10-19 | 1986-04-24 | Schering AG, 1000 Berlin und 4709 Bergkamen | Pharmazeutische praeparate |
| WO1987006576A1 (en) * | 1986-04-29 | 1987-11-05 | Pfizer Inc. | Calcium independent camp phosphodiesterase inhibitor antidepressant |
| US5459145A (en) * | 1988-01-19 | 1995-10-17 | Pfizer Inc. | Calcium independent camp phosphodiesterase inhibitor antidepressant |
| FI875101A7 (fi) * | 1986-12-03 | 1988-06-04 | Tanabe Seiyaku Co | Laktaamijohdannaiset ja niitä sisältävät valmisteet. |
| US5274002A (en) * | 1987-04-14 | 1993-12-28 | Warner-Lambert Company | Trisubstituted phenyl analogs having activity for congestive heart failure |
| US4971959A (en) * | 1987-04-14 | 1990-11-20 | Warner-Lambert Company | Trisubstituted phenyl analogs having activity for congestive heart failure |
| US4960457A (en) * | 1988-12-27 | 1990-10-02 | Ici Americas Inc. | Substituted 1,3-diphenyl pyrrolidones and their use as herbicides |
| DE3921593A1 (de) * | 1989-06-28 | 1991-01-10 | Schering Ag | Verfahren zur racemattrennung von 4-aryl-2-oxo-pyrrolidin-3-carbonsaeure-ester |
| JP2578001B2 (ja) * | 1989-12-11 | 1997-02-05 | 明治製菓株式会社 | 抗痴呆薬 |
| DE3943385A1 (de) * | 1989-12-27 | 1991-07-04 | Schering Ag | Mittel zur transdermalen applikation enthaltend rolipram |
| DD299058A5 (de) * | 1990-01-31 | 1992-03-26 | Arzneimittelwerk Dresden Gmbh,De | Verfahren zur herstellung von n-acyl-4-phenyl-pyrrolidin-2-onen mit cerebroprotektiver wirkung |
| GB9009395D0 (en) * | 1990-04-26 | 1990-06-20 | Orion Yhtymae Oy | Cyclic hydroxamic acids and their use |
| DE69128627T2 (de) * | 1990-08-03 | 1998-07-02 | Smithkline Beecham Corp Philad | Tnf-inhibitoren |
| DE4032055A1 (de) * | 1990-10-05 | 1992-04-09 | Schering Ag | Verfahren zur herstellung von optisch aktiven 4-aryl-2-pyrrolidinonen |
| US5547979A (en) * | 1992-03-30 | 1996-08-20 | Smithkline Beecham | TNF inhibition |
| US5395935A (en) * | 1992-05-08 | 1995-03-07 | Pfizer Inc. | Endo-bicyclo[2.2.1]heptan-2-ol and derived pharmaceutical agents |
| GB9212673D0 (en) * | 1992-06-15 | 1992-07-29 | Celltech Ltd | Chemical compounds |
| GB9222253D0 (en) * | 1992-10-23 | 1992-12-09 | Celltech Ltd | Chemical compounds |
| US5622977A (en) * | 1992-12-23 | 1997-04-22 | Celltech Therapeutics Limited | Tri-substituted (aryl or heteroaryl) derivatives and pharmaceutical compositions containing the same |
| GB9226830D0 (en) * | 1992-12-23 | 1993-02-17 | Celltech Ltd | Chemical compounds |
| GB9304920D0 (en) * | 1993-03-10 | 1993-04-28 | Celltech Ltd | Chemical compounds |
| GB9304919D0 (en) * | 1993-03-10 | 1993-04-28 | Celltech Ltd | Chemical compounds |
| GB9312853D0 (en) | 1993-06-22 | 1993-08-04 | Euro Celtique Sa | Chemical compounds |
| US5665754A (en) * | 1993-09-20 | 1997-09-09 | Glaxo Wellcome Inc. | Substituted pyrrolidines |
| US5477611A (en) * | 1993-09-20 | 1995-12-26 | Tessera, Inc. | Method of forming interface between die and chip carrier |
| ATE260911T1 (de) * | 1993-12-22 | 2004-03-15 | Celltech R&D Ltd | Trisubstituierte phenyl-derivate, verfahren zu deren herstellung und deren verwendung als phosphodiesterase (typ iv) hemmstoffe |
| GB9326173D0 (en) * | 1993-12-22 | 1994-02-23 | Celltech Ltd | Chemical compounds and process |
| CA2143143A1 (en) * | 1994-03-08 | 1995-09-09 | Toshihiko Tanaka | 3-phenylpyrrolidine derivatives |
| US5338739A (en) * | 1994-03-10 | 1994-08-16 | Hoechst-Roussel Pharmaceuticals Inc. | (Pyrrolidinyl)phenyl carbamates, compositions and use |
| US6245774B1 (en) | 1994-06-21 | 2001-06-12 | Celltech Therapeutics Limited | Tri-substituted phenyl or pyridine derivatives |
| US5786354A (en) * | 1994-06-21 | 1998-07-28 | Celltech Therapeutics, Limited | Tri-substituted phenyl derivatives and processes for their preparation |
| GB9412571D0 (en) | 1994-06-22 | 1994-08-10 | Celltech Ltd | Chemical compounds |
| GB9412573D0 (en) * | 1994-06-22 | 1994-08-10 | Celltech Ltd | Chemical compounds |
| GB9412672D0 (en) * | 1994-06-23 | 1994-08-10 | Celltech Ltd | Chemical compounds |
| US5922751A (en) | 1994-06-24 | 1999-07-13 | Euro-Celtique, S.A. | Aryl pyrazole compound for inhibiting phosphodiesterase IV and methods of using same |
| US5591776A (en) * | 1994-06-24 | 1997-01-07 | Euro-Celtique, S.A. | Pheynl or benzyl-substituted rolipram-based compounds for and method of inhibiting phosphodiesterase IV |
| US5665737B1 (en) * | 1994-10-12 | 1999-02-16 | Euro Celtique Sa | Substituted benzoxazoles |
| US6025361A (en) | 1994-12-13 | 2000-02-15 | Euro-Celtique, S.A. | Trisubstituted thioxanthines |
| DE69531506T2 (de) | 1994-12-13 | 2004-06-24 | Euroceltique S.A. | Arylthioxanthine |
| CN1173818A (zh) * | 1995-02-10 | 1998-02-18 | 舍林股份公司 | 用于tnf抑制的药物制剂 |
| US6268373B1 (en) | 1995-06-07 | 2001-07-31 | Euro-Celtique S.A. | Trisubstituted thioxanthines |
| US6166041A (en) | 1995-10-11 | 2000-12-26 | Euro-Celtique, S.A. | 2-heteroaryl and 2-heterocyclic benzoxazoles as PDE IV inhibitors for the treatment of asthma |
| DE19540475A1 (de) * | 1995-10-20 | 1997-04-24 | Schering Ag | Chirale Methylphenyloxazolidinone |
| GB9523675D0 (en) | 1995-11-20 | 1996-01-24 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9526246D0 (en) * | 1995-12-21 | 1996-02-21 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9526243D0 (en) * | 1995-12-21 | 1996-02-21 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9526245D0 (en) * | 1995-12-21 | 1996-02-21 | Celltech Therapeutics Ltd | Chemical compounds |
| US6075016A (en) | 1996-04-10 | 2000-06-13 | Euro-Celtique S.A. | 6,5-fused aromatic ring systems having enhanced phosphodiesterase IV inhibitory activity |
| GB9608435D0 (en) * | 1996-04-24 | 1996-06-26 | Celltech Therapeutics Ltd | Chemical compounds |
| US5864037A (en) | 1996-06-06 | 1999-01-26 | Euro-Celtique, S.A. | Methods for the synthesis of chemical compounds having PDE-IV inhibitory activity |
| JP4017214B2 (ja) | 1996-06-11 | 2007-12-05 | 興和創薬株式会社 | 5−フェニル−3−ピリダジノン誘導体 |
| CA2262502C (en) | 1996-07-31 | 2002-11-26 | Nikken Chemicals Co., Ltd. | 6-phenyltetrahydro-1,3-oxazin-2-one derivatives and pharmaceutical composition containing the same |
| US6265402B1 (en) | 1996-08-27 | 2001-07-24 | Nikken Chemicals Co., Ltd. | Use of 2-phenylmorpholin-5-one derivatives |
| GB9619284D0 (en) * | 1996-09-16 | 1996-10-30 | Celltech Therapeutics Ltd | Chemical compounds |
| US5744473A (en) * | 1996-09-16 | 1998-04-28 | Euro-Celtique, S.A. | PDE IV inhibitors: "bis-compounds" |
| GB9622363D0 (en) | 1996-10-28 | 1997-01-08 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9625184D0 (en) * | 1996-12-04 | 1997-01-22 | Celltech Therapeutics Ltd | Chemical compounds |
| WO1998028281A1 (en) | 1996-12-23 | 1998-07-02 | Celltech Therapeutics Limited | Fused polycyclic 2-aminopyrimidine derivatives, their preparation and their use as protein tyrosine kinase inhibitors |
| GB9705361D0 (en) * | 1997-03-14 | 1997-04-30 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9713087D0 (en) * | 1997-06-20 | 1997-08-27 | Celltech Therapeutics Ltd | Chemical compounds |
| WO1998058901A1 (en) | 1997-06-24 | 1998-12-30 | Nikken Chemicals Co., Ltd. | 3-anilino-2-cycloalkenone derivates |
| WO1999024432A1 (fr) | 1997-11-12 | 1999-05-20 | Mitsubishi Chemical Corporation | Derives de purine et medicament les renfermant en tant qu'ingredient actif |
| US6232297B1 (en) | 1999-02-01 | 2001-05-15 | University Of Virginia Patent Foundation | Methods and compositions for treating inflammatory response |
| US7378400B2 (en) | 1999-02-01 | 2008-05-27 | University Of Virginia Patent Foundation | Method to reduce an inflammatory response from arthritis |
| US7427606B2 (en) | 1999-02-01 | 2008-09-23 | University Of Virginia Patent Foundation | Method to reduce inflammatory response in transplanted tissue |
| WO2000068231A1 (en) * | 1999-05-11 | 2000-11-16 | Mitsubishi Chemical Corporation | Purine derivative dihydrate, drugs containing the same as the active ingredient and intermediate in the production thereof |
| GB9914258D0 (en) * | 1999-06-18 | 1999-08-18 | Celltech Therapeutics Ltd | Chemical compounds |
| CZ302882B6 (cs) | 1999-08-21 | 2012-01-04 | Nycomed Gmbh | Farmaceutický prostredek |
| GB9924862D0 (en) * | 1999-10-20 | 1999-12-22 | Celltech Therapeutics Ltd | Chemical compounds |
| DE60125026T2 (de) * | 2000-03-23 | 2007-06-28 | Takeda Pharmaceutical Co. Ltd. | Fluorisochinolinderivate, verfahren zu ihrer herstellung und ihre anwendung |
| MEP13408A (en) * | 2001-05-29 | 2010-06-10 | Bayer Schering Pharma Ag | Cdk inhibiting pyrimidines, production thereof and their use as medicaments |
| WO2003007906A1 (en) * | 2001-07-16 | 2003-01-30 | Merck Patent Gmbh | Photostable organic sunscreen compounds with antioxidant properties and compositions obtained therefrom |
| NZ532062A (en) | 2001-10-01 | 2006-09-29 | Univ Virginia | 2-propynyl adenosine analogues having A2 adenosine recepter agonist activity and compositions thereof to treat inflammatory responses |
| BR0213660A (pt) * | 2001-10-16 | 2004-08-24 | Memory Pharm Corp | Composto, composição farmacêutica e método para tratar pacientes |
| EP1496911B1 (en) * | 2002-04-10 | 2007-12-19 | University Of Virginia Patent Foundation | Use of a combination comprising a2a adenosine receptor agonists and anti-pathogenic agents for the treatment of inflammatory diseases |
| AU2003281691A1 (en) * | 2002-07-26 | 2004-02-16 | Takeda Pharmaceutical Company Limited | Furoisoquinoline derivative and use thereof |
| WO2004037784A2 (en) * | 2002-10-21 | 2004-05-06 | Irm Llc | Pyrrolidones with anti-hiv activity |
| US7772188B2 (en) | 2003-01-28 | 2010-08-10 | Ironwood Pharmaceuticals, Inc. | Methods and compositions for the treatment of gastrointestinal disorders |
| US7153824B2 (en) | 2003-04-01 | 2006-12-26 | Applied Research Systems Ars Holding N.V. | Inhibitors of phosphodiesterases in infertility |
| KR20060039392A (ko) | 2003-04-16 | 2006-05-08 | 메모리 파마슈티칼스 코포레이션 | 포스포디에스테라제 4 억제제 |
| BRPI0409888A (pt) * | 2003-04-18 | 2006-05-23 | Memory Pharm Corp | derivados de pirazol como inibidores de fosfodiesterase 4, composto, composição farmacêutica, método para efetuar a inibição da enzima pde4, incrementar a cognição e/ou tratar a psicose em um paciente, método para o tratamento de um paciente que tem uma doença que envolve nìveis de camp diminuìdos, método para o tratamento de um paciente que sofre de uma doença alérgica ou inflamatória e método para o tratamento de um paciente que sofre de neurodegeneração resultante de uma doença ou de um ferimento |
| CA2523356A1 (en) * | 2003-04-25 | 2004-11-11 | Icos Corporation | Method of preparing a ring compound having two adjacent chiral centers |
| CA2566625C (en) * | 2004-05-17 | 2014-01-07 | Otsuka Pharmaceutical Co., Ltd. | Thiazole compound and use thereof |
| US7576069B2 (en) | 2004-08-02 | 2009-08-18 | University Of Virginia Patent Foundation | 2-polycyclic propynyl adenosine analogs having A2A agonist activity |
| AU2005267706B2 (en) | 2004-08-02 | 2011-12-08 | University Of Virginia Patent Foundation | 2-propynyl adenosine analogs with modified 5'-ribose groups having A2A agonist activity |
| US7442687B2 (en) | 2004-08-02 | 2008-10-28 | The University Of Virginia Patent Foundation | 2-polycyclic propynyl adenosine analogs having A2A agonist activity |
| JP2008516964A (ja) * | 2004-10-15 | 2008-05-22 | メモリー ファーマシューティカルス コーポレーション | ホスホジエステラーゼ4阻害剤としてのピラゾール誘導体 |
| US7585882B2 (en) * | 2004-10-20 | 2009-09-08 | Memory Pharmaceuticals Corporation | Phosphodiesterase 4 inhibitors |
| WO2007120972A2 (en) * | 2006-02-10 | 2007-10-25 | University Of Virginia Patent Foundation | Method to treat sickle cell disease |
| US8188063B2 (en) * | 2006-06-19 | 2012-05-29 | University Of Virginia Patent Foundation | Use of adenosine A2A modulators to treat spinal cord injury |
| MX354786B (es) | 2007-06-04 | 2018-03-21 | Synergy Pharmaceuticals Inc | Agonistas de guanilato ciclasa utiles para el tratamiento de trastornos gastrointestinales, inflamacion, cancer y otros trastornos. |
| US8969514B2 (en) | 2007-06-04 | 2015-03-03 | Synergy Pharmaceuticals, Inc. | Agonists of guanylate cyclase useful for the treatment of hypercholesterolemia, atherosclerosis, coronary heart disease, gallstone, obesity and other cardiovascular diseases |
| US8058259B2 (en) | 2007-12-20 | 2011-11-15 | University Of Virginia Patent Foundation | Substituted 4-{3-[6-amino-9-(3,4-dihydroxy-tetrahydro-furan-2-yl)-9H-purin-2-yl]-prop-2-ynyl}-piperidine-1-carboxylic acid esters as A2AR agonists |
| CA2726917C (en) | 2008-06-04 | 2018-06-26 | Synergy Pharmaceuticals Inc. | Agonists of guanylate cyclase useful for the treatment of gastrointestinal disorders, inflammation, cancer and other disorders |
| EP2321341B1 (en) | 2008-07-16 | 2017-02-22 | Synergy Pharmaceuticals Inc. | Agonists of guanylate cyclase useful for the treatment of gastrointestinal, inflammation, cancer and other disorders |
| US20100159034A1 (en) * | 2008-12-15 | 2010-06-24 | Auspex Pharmaceuticals, Inc. | Pyrrolidinone inhibitors of pde-4 |
| US9616097B2 (en) | 2010-09-15 | 2017-04-11 | Synergy Pharmaceuticals, Inc. | Formulations of guanylate cyclase C agonists and methods of use |
| EA201391254A1 (ru) | 2011-03-01 | 2014-02-28 | Синерджи Фармасьютикалз Инк. | Способ получения агонистов гуанилатциклазы c |
| ES2395801B1 (es) | 2011-06-23 | 2014-06-06 | María Carmen PARDINA PALLEJÀ | "pentoxifilina por vía transvaginal para el tratamiento de la infertilidad" |
| JP6499591B2 (ja) | 2013-02-25 | 2019-04-10 | シナジー ファーマシューティカルズ インコーポレイテッド | 結腸洗浄において用いるためのグアニル酸シクラーゼ受容体アゴニスト |
| JP2016514671A (ja) | 2013-03-15 | 2016-05-23 | シナジー ファーマシューティカルズ インコーポレイテッド | グアニル酸シクラーゼのアゴニストおよびその使用 |
| WO2014151200A2 (en) | 2013-03-15 | 2014-09-25 | Synergy Pharmaceuticals Inc. | Compositions useful for the treatment of gastrointestinal disorders |
| CN105764916B (zh) | 2013-06-05 | 2021-05-18 | 博士医疗爱尔兰有限公司 | 鸟苷酸环化酶c的超纯激动剂、制备和使用所述激动剂的方法 |
| EP3492106B1 (en) | 2013-08-09 | 2021-02-17 | Ardelyx, Inc. | Compounds and methods for inhibiting phosphate transport |
| EP3972599B1 (en) | 2019-05-21 | 2025-10-22 | Ardelyx, Inc. | Combination for lowering serum phosphate in a patient |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1516776A (fr) | 1966-07-21 | 1968-03-15 | Rhone Poulenc Sa | Nouveaux dérivés du pyrrole et leur préparation |
| GB1350582A (en) * | 1970-07-24 | 1974-04-18 | Ucb Sa | Cerivatives of 2-pyrrolidinone |
-
1974
- 1974-03-20 DE DE2413935A patent/DE2413935A1/de active Granted
-
1975
- 1975-03-10 SU SU752111302A patent/SU649312A3/ru active
- 1975-03-17 YU YU632/75A patent/YU40258B/xx unknown
- 1975-03-18 CH CH345775A patent/CH621338A5/de not_active IP Right Cessation
- 1975-03-18 DD DD184858A patent/DD119229A5/xx unknown
- 1975-03-18 ES ES435750A patent/ES435750A1/es not_active Expired
- 1975-03-18 DK DK110675A patent/DK139965C/da not_active IP Right Cessation
- 1975-03-19 CS CS751860A patent/CS214738B2/cs unknown
- 1975-03-19 HU HU75SCHE514A patent/HU174074B/hu unknown
- 1975-03-19 AT AT210975A patent/AT347931B/de not_active IP Right Cessation
- 1975-03-19 SE SE7503157A patent/SE402010B/xx not_active IP Right Cessation
- 1975-03-20 BE BE154536A patent/BE826923A/xx not_active IP Right Cessation
- 1975-03-20 CA CA222,720A patent/CA1069517A/en not_active Expired
- 1975-03-20 NL NL7503367A patent/NL7503367A/xx not_active Application Discontinuation
- 1975-03-20 IE IE611/75A patent/IE40865B1/xx unknown
- 1975-03-20 FR FR7508701A patent/FR2264531B1/fr not_active Expired
- 1975-03-20 GB GB11686/75A patent/GB1498705A/en not_active Expired
- 1975-03-20 IL IL46883A patent/IL46883A/xx unknown
- 1975-03-20 JP JP50034220A patent/JPS6011028B2/ja not_active Expired
- 1975-03-20 US US05/560,193 patent/US4012495A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| ATA210975A (de) | 1978-06-15 |
| GB1498705A (en) | 1978-01-25 |
| AT347931B (de) | 1979-01-25 |
| CA1069517A (en) | 1980-01-08 |
| CS214738B2 (en) | 1982-05-28 |
| AU7931075A (en) | 1976-09-23 |
| DD119229A5 (enExample) | 1976-04-12 |
| SE7503157L (sv) | 1975-11-28 |
| HU174074B (hu) | 1979-10-28 |
| SE402010B (sv) | 1978-06-12 |
| JPS50157360A (enExample) | 1975-12-19 |
| BE826923A (fr) | 1975-09-22 |
| FR2264531A1 (enExample) | 1975-10-17 |
| DE2413935C2 (enExample) | 1988-05-26 |
| NL7503367A (nl) | 1975-09-23 |
| IE40865L (en) | 1975-09-20 |
| IL46883A0 (en) | 1975-05-22 |
| US4012495A (en) | 1977-03-15 |
| YU40258B (en) | 1985-10-31 |
| DK139965B (da) | 1979-05-28 |
| FR2264531B1 (enExample) | 1978-07-28 |
| DE2413935A1 (de) | 1975-10-16 |
| JPS6011028B2 (ja) | 1985-03-22 |
| SU649312A3 (ru) | 1979-02-25 |
| IL46883A (en) | 1979-09-30 |
| ES435750A1 (es) | 1976-12-16 |
| IE40865B1 (en) | 1979-08-29 |
| YU63275A (en) | 1982-06-30 |
| DK139965C (da) | 1979-10-29 |
| DK110675A (enExample) | 1975-09-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH621338A5 (enExample) | ||
| DE2541855A1 (de) | 4-(polyalkoxy-phenyl)-2-pyrrolidone ii | |
| DD207713A1 (de) | Substituierte imidazolabkoemmlinge, ihre herstellung und verwendung | |
| DE2755752A1 (de) | Piperazinderivate, verfahren zu ihrer herstellung und ihre verwendung | |
| DE2716943A1 (de) | Organische verbindungen, ihre verwendung und herstellung | |
| DE69101141T2 (de) | Neue Guanidinderivate, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Zusammensetzungen. | |
| DE1795841C3 (de) | H2'-Chlor)-benzyl-2-di-sec.-butylamino-acetyl-pyrrol, seine Salze und Verfahren zu deren Herstellung | |
| DE2044172A1 (de) | Neue Pyrroldenvate, ein Verfahren zu ihrer Herstellung und ihre Verwendung in Arzneimittelzubereitungen | |
| DE1770372A1 (de) | Neue Indolinderivate und Verfahren zu ihrer Herstellung | |
| DE2332707A1 (de) | Tricyclische tetrahydronaphthalinderivate, ihre salze, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| CH628048A5 (de) | Verfahren zur herstellung neuer benzopyron-derivate. | |
| DE1104965B (de) | Verfahren zur Herstellung von Derivaten des Urazols | |
| DE3520104A1 (de) | Naphthoxazine, ihre herstellung und verwendung | |
| DE2914166A1 (de) | Arylsubstituierte furane und verfahren zu ihrer herstellung | |
| DE1695963A1 (de) | Cycloalkenamin-p-benzochinonaddukte und Verfahren zu ihrer Herstellung | |
| DE2509797C2 (de) | Phthalimidine, deren physiologisch verträgliche Säureadditionssalze, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| DE1618643A1 (de) | Aryloxysubstituierte Carbonsaeuren und Verfahren zu deren Herstellung | |
| DE1543250A1 (de) | Naphthyloxyalkansaeuren und Verfahren zu ihrer Herstellung | |
| DE3003323A1 (de) | 4-amino-2-piperidinochinazolin-derivate, verfahren zu ihrer herstellung und solche derivate enthaltende arzneimittel | |
| AT338811B (de) | Verfahren zur herstellung von neuen 2-amino-5-sulfamoylbenzoesaureamiden und ihren salzen sowie optischen isomeren | |
| DE2740852A1 (de) | Basische 1-acylindol-3-acetocyessigsaeureester, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel | |
| AT253485B (de) | Verfahren zur Herstellung von neuen Acrylylnaphthyloxymonocarbonsäuren und deren Derivaten | |
| AT334341B (de) | Verfahren zur herstellung von neuen alpha- (1-bis-arylalkylaminoalkyl) -aralkoxybenzylalkoholen | |
| CH634313A5 (en) | Piperazine derivatives | |
| DE1169450B (de) | Verfahren zur Herstellung von Indolinderivaten und deren Salzen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |