CA1069517A - 4-(polyalkoxy-phenyl)-2-pyrrolidone - Google Patents
4-(polyalkoxy-phenyl)-2-pyrrolidoneInfo
- Publication number
- CA1069517A CA1069517A CA222,720A CA222720A CA1069517A CA 1069517 A CA1069517 A CA 1069517A CA 222720 A CA222720 A CA 222720A CA 1069517 A CA1069517 A CA 1069517A
- Authority
- CA
- Canada
- Prior art keywords
- pyrrolidone
- phenyl
- methoxy
- hydroxy
- produced
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 hydroxy, carboxy Chemical group 0.000 claims abstract description 211
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 50
- 150000001875 compounds Chemical class 0.000 claims abstract description 50
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 42
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 18
- 150000002430 hydrocarbons Chemical class 0.000 claims abstract description 16
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims abstract description 12
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 10
- 125000005843 halogen group Chemical group 0.000 claims abstract description 7
- 238000000034 method Methods 0.000 claims description 231
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 134
- 238000009835 boiling Methods 0.000 claims description 96
- 239000000126 substance Substances 0.000 claims description 89
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 79
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 54
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 52
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 claims description 48
- 239000000203 mixture Substances 0.000 claims description 40
- 238000010438 heat treatment Methods 0.000 claims description 36
- SYXYWTXQFUUWLP-UHFFFAOYSA-N sodium;butan-1-olate Chemical compound [Na+].CCCC[O-] SYXYWTXQFUUWLP-UHFFFAOYSA-N 0.000 claims description 35
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 33
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 33
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 28
- 239000002904 solvent Substances 0.000 claims description 27
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 26
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 25
- 229910052739 hydrogen Inorganic materials 0.000 claims description 25
- 239000001257 hydrogen Substances 0.000 claims description 25
- PAIFAXUSHBVXHY-UHFFFAOYSA-N 4-(3-hydroxy-4-methoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(O)C(OC)=CC=C1C1CC(=O)NC1 PAIFAXUSHBVXHY-UHFFFAOYSA-N 0.000 claims description 21
- 238000001816 cooling Methods 0.000 claims description 18
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 18
- 239000005662 Paraffin oil Substances 0.000 claims description 16
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 claims description 16
- 239000012312 sodium hydride Substances 0.000 claims description 16
- 229910000104 sodium hydride Inorganic materials 0.000 claims description 16
- 235000009518 sodium iodide Nutrition 0.000 claims description 16
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 claims description 14
- 239000002253 acid Substances 0.000 claims description 14
- 238000002156 mixing Methods 0.000 claims description 14
- 150000003839 salts Chemical class 0.000 claims description 14
- 230000008030 elimination Effects 0.000 claims description 13
- 238000003379 elimination reaction Methods 0.000 claims description 13
- 125000003118 aryl group Chemical group 0.000 claims description 10
- 230000007062 hydrolysis Effects 0.000 claims description 10
- 238000006460 hydrolysis reaction Methods 0.000 claims description 10
- 238000006798 ring closing metathesis reaction Methods 0.000 claims description 10
- AGQGSLHQIUKIEO-UHFFFAOYSA-N 4-[4-methoxy-3-(2-methylpropoxy)phenyl]pyrrolidin-2-one Chemical compound C1=C(OCC(C)C)C(OC)=CC=C1C1CC(=O)NC1 AGQGSLHQIUKIEO-UHFFFAOYSA-N 0.000 claims description 9
- 239000003513 alkali Substances 0.000 claims description 9
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 claims description 8
- 125000005518 carboxamido group Chemical group 0.000 claims description 8
- 238000007363 ring formation reaction Methods 0.000 claims description 8
- HJORMJIFDVBMOB-UHFFFAOYSA-N rolipram Chemical compound COC1=CC=C(C2CC(=O)NC2)C=C1OC1CCCC1 HJORMJIFDVBMOB-UHFFFAOYSA-N 0.000 claims description 8
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 7
- 238000006114 decarboxylation reaction Methods 0.000 claims description 7
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 claims description 7
- 235000017557 sodium bicarbonate Nutrition 0.000 claims description 7
- 229910000030 sodium bicarbonate Inorganic materials 0.000 claims description 7
- SIDOURMPNPMMGW-UHFFFAOYSA-N 4-[4-methoxy-3-(2,2,2-trifluoroethoxy)phenyl]pyrrolidin-2-one Chemical compound C1=C(OCC(F)(F)F)C(OC)=CC=C1C1CC(=O)NC1 SIDOURMPNPMMGW-UHFFFAOYSA-N 0.000 claims description 6
- 125000003277 amino group Chemical group 0.000 claims description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 6
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 6
- 150000004820 halides Chemical class 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 239000001301 oxygen Substances 0.000 claims description 6
- 125000002252 acyl group Chemical group 0.000 claims description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 5
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 5
- 239000003960 organic solvent Substances 0.000 claims description 5
- IGOHZKUKFQBTNU-UHFFFAOYSA-N 4-(3,4-diethoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(OCC)C(OCC)=CC=C1C1CC(=O)NC1 IGOHZKUKFQBTNU-UHFFFAOYSA-N 0.000 claims description 4
- BPRUNKGOYXLKFB-UHFFFAOYSA-N 4-(3-cyclohexyloxy-4-methoxyphenyl)pyrrolidin-2-one Chemical compound COC1=CC=C(C2CC(=O)NC2)C=C1OC1CCCCC1 BPRUNKGOYXLKFB-UHFFFAOYSA-N 0.000 claims description 4
- ZLQCJQXGXLTKBS-UHFFFAOYSA-N 4-(3-decoxy-4-methoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(OC)C(OCCCCCCCCCC)=CC(C2CC(=O)NC2)=C1 ZLQCJQXGXLTKBS-UHFFFAOYSA-N 0.000 claims description 4
- VTARTKPFBJOKKS-UHFFFAOYSA-N 4-(3-ethoxy-4-methoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(OC)C(OCC)=CC(C2CC(=O)NC2)=C1 VTARTKPFBJOKKS-UHFFFAOYSA-N 0.000 claims description 4
- VDRLVVYETISUEM-UHFFFAOYSA-N 4-(4-ethoxy-3-methoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(OC)C(OCC)=CC=C1C1CC(=O)NC1 VDRLVVYETISUEM-UHFFFAOYSA-N 0.000 claims description 4
- SVMQZOFDDYTGFC-UHFFFAOYSA-N 4-(4-hydroxy-3-methoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(O)C(OC)=CC(C2CC(=O)NC2)=C1 SVMQZOFDDYTGFC-UHFFFAOYSA-N 0.000 claims description 4
- RLSDHKWIWIHPJW-UHFFFAOYSA-N 4-(4-methoxy-3-octadecoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(OC)C(OCCCCCCCCCCCCCCCCCC)=CC(C2CC(=O)NC2)=C1 RLSDHKWIWIHPJW-UHFFFAOYSA-N 0.000 claims description 4
- YJLVXTXGBPWDEI-UHFFFAOYSA-N 4-(4-methoxy-3-phenoxyphenyl)pyrrolidin-2-one Chemical compound COC1=CC=C(C2CC(=O)NC2)C=C1OC1=CC=CC=C1 YJLVXTXGBPWDEI-UHFFFAOYSA-N 0.000 claims description 4
- QLIBRFKGUKUNLP-UHFFFAOYSA-N 4-(4-methoxy-3-phenylmethoxyphenyl)pyrrolidin-2-one Chemical compound COC1=CC=C(C2CC(=O)NC2)C=C1OCC1=CC=CC=C1 QLIBRFKGUKUNLP-UHFFFAOYSA-N 0.000 claims description 4
- BGAWKQALHPLHBL-UHFFFAOYSA-N 4-(4-methoxy-3-propan-2-yloxyphenyl)pyrrolidin-2-one Chemical compound C1=C(OC(C)C)C(OC)=CC=C1C1CC(=O)NC1 BGAWKQALHPLHBL-UHFFFAOYSA-N 0.000 claims description 4
- MHNKGZBTMAFGRH-UHFFFAOYSA-N 4-[3-(2,2-dimethylpropoxy)-4-methoxyphenyl]pyrrolidin-2-one Chemical compound C1=C(OCC(C)(C)C)C(OC)=CC=C1C1CC(=O)NC1 MHNKGZBTMAFGRH-UHFFFAOYSA-N 0.000 claims description 4
- UMIFSCOVIJEDCV-UHFFFAOYSA-N 4-[3-(2-hydroxyethoxy)-4-methoxyphenyl]pyrrolidin-2-one Chemical compound C1=C(OCCO)C(OC)=CC=C1C1CC(=O)NC1 UMIFSCOVIJEDCV-UHFFFAOYSA-N 0.000 claims description 4
- JOTUXENQTHUWLA-UHFFFAOYSA-N 4-[3-(cyclopentylmethoxy)-4-methoxyphenyl]pyrrolidin-2-one Chemical compound COC1=CC=C(C2CC(=O)NC2)C=C1OCC1CCCC1 JOTUXENQTHUWLA-UHFFFAOYSA-N 0.000 claims description 4
- MGZZYBSJWZKHES-UHFFFAOYSA-N 4-[3-(cyclopropylmethoxy)-4-methoxyphenyl]pyrrolidin-2-one Chemical compound COC1=CC=C(C2CC(=O)NC2)C=C1OCC1CC1 MGZZYBSJWZKHES-UHFFFAOYSA-N 0.000 claims description 4
- KDNPPNAWMGJQPI-UHFFFAOYSA-N 4-[4-methoxy-3-(2-methylcyclopentyl)oxyphenyl]pyrrolidin-2-one Chemical compound COC1=CC=C(C2CC(=O)NC2)C=C1OC1CCCC1C KDNPPNAWMGJQPI-UHFFFAOYSA-N 0.000 claims description 4
- DQDNZEFMICOUFX-UHFFFAOYSA-N 4-[4-methoxy-3-(3-methylbutoxy)phenyl]pyrrolidin-2-one Chemical compound C1=C(OCCC(C)C)C(OC)=CC=C1C1CC(=O)NC1 DQDNZEFMICOUFX-UHFFFAOYSA-N 0.000 claims description 4
- VYSCSHURSSZQNL-UHFFFAOYSA-N 4-[4-methoxy-3-(methoxymethoxy)phenyl]pyrrolidin-2-one Chemical compound C1=C(OC)C(OCOC)=CC(C2CC(=O)NC2)=C1 VYSCSHURSSZQNL-UHFFFAOYSA-N 0.000 claims description 4
- STKUGBHSNWILKY-UHFFFAOYSA-N 4-[4-methoxy-3-(oxolan-2-yloxy)phenyl]pyrrolidin-2-one Chemical compound COC1=CC=C(C2CC(=O)NC2)C=C1OC1CCCO1 STKUGBHSNWILKY-UHFFFAOYSA-N 0.000 claims description 4
- FKLJPTJMIBLJAV-UHFFFAOYSA-N Compound IV Chemical compound O1N=C(C)C=C1CCCCCCCOC1=CC=C(C=2OCCN=2)C=C1 FKLJPTJMIBLJAV-UHFFFAOYSA-N 0.000 claims description 4
- 241001061127 Thione Species 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- CRNQILQOPIFQCI-UHFFFAOYSA-N 4-(3-butan-2-yloxy-4-methoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(OC)C(OC(C)CC)=CC(C2CC(=O)NC2)=C1 CRNQILQOPIFQCI-UHFFFAOYSA-N 0.000 claims description 3
- VRBRFUIIINZKKW-UHFFFAOYSA-N 4-(3-butoxy-4-methoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(OC)C(OCCCC)=CC(C2CC(=O)NC2)=C1 VRBRFUIIINZKKW-UHFFFAOYSA-N 0.000 claims description 3
- MDXHIURCBXYOAC-UHFFFAOYSA-N 4-(3-cyclobutyloxy-4-methoxyphenyl)pyrrolidin-2-one Chemical compound COC1=CC=C(C2CC(=O)NC2)C=C1OC1CCC1 MDXHIURCBXYOAC-UHFFFAOYSA-N 0.000 claims description 3
- BTBZIFHFPOTMKR-UHFFFAOYSA-N 4-(4-butoxy-3-methoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(OC)C(OCCCC)=CC=C1C1CC(=O)NC1 BTBZIFHFPOTMKR-UHFFFAOYSA-N 0.000 claims description 3
- CHVNMUXAUGEMSU-UHFFFAOYSA-N 4-(4-cyclopentyloxy-3-methoxyphenyl)pyrrolidin-2-one Chemical compound COC1=CC(C2CC(=O)NC2)=CC=C1OC1CCCC1 CHVNMUXAUGEMSU-UHFFFAOYSA-N 0.000 claims description 3
- PBSUWVSCBKZZHH-UHFFFAOYSA-N 4-(4-methoxy-3-propoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(OC)C(OCCC)=CC(C2CC(=O)NC2)=C1 PBSUWVSCBKZZHH-UHFFFAOYSA-N 0.000 claims description 3
- FEHLYROWUSLMKU-UHFFFAOYSA-N 4-[3,4-bis(2-methylpropoxy)phenyl]pyrrolidin-2-one Chemical compound C1=C(OCC(C)C)C(OCC(C)C)=CC=C1C1CC(=O)NC1 FEHLYROWUSLMKU-UHFFFAOYSA-N 0.000 claims description 3
- IQEKPGGRSNMTNX-UHFFFAOYSA-N 4-[4-methoxy-3-(3-methylbut-2-enoxy)phenyl]pyrrolidin-2-one Chemical compound C1=C(OCC=C(C)C)C(OC)=CC=C1C1CC(=O)NC1 IQEKPGGRSNMTNX-UHFFFAOYSA-N 0.000 claims description 3
- 239000005864 Sulphur Substances 0.000 claims description 3
- TZUKLMVWKCEWDK-UHFFFAOYSA-N ethyl 4-amino-3-[4-methoxy-3-(2-methylpropoxy)phenyl]butanoate;hydrochloride Chemical compound Cl.CCOC(=O)CC(CN)C1=CC=C(OC)C(OCC(C)C)=C1 TZUKLMVWKCEWDK-UHFFFAOYSA-N 0.000 claims description 3
- SNHMUERNLJLMHN-UHFFFAOYSA-N iodobenzene Chemical compound IC1=CC=CC=C1 SNHMUERNLJLMHN-UHFFFAOYSA-N 0.000 claims description 3
- WHARVEMTFAGNFI-UHFFFAOYSA-N (2-methylcyclopentyl) 4-methylbenzenesulfonate Chemical compound CC1CCCC1OS(=O)(=O)C1=CC=C(C)C=C1 WHARVEMTFAGNFI-UHFFFAOYSA-N 0.000 claims description 2
- DRYYWFMMNCCJKU-UHFFFAOYSA-N 4-(3-hexoxy-4-methoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(OC)C(OCCCCCC)=CC(C2CC(=O)NC2)=C1 DRYYWFMMNCCJKU-UHFFFAOYSA-N 0.000 claims description 2
- MXHYVMDUWDIGLH-UHFFFAOYSA-N 4-[4-methoxy-3-(3-methylcyclopentyl)oxyphenyl]pyrrolidin-2-one Chemical compound COC1=CC=C(C2CC(=O)NC2)C=C1OC1CCC(C)C1 MXHYVMDUWDIGLH-UHFFFAOYSA-N 0.000 claims description 2
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 claims description 2
- WWCNXHYRAKUQDB-UHFFFAOYSA-N oxolan-3-yl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OC1COCC1 WWCNXHYRAKUQDB-UHFFFAOYSA-N 0.000 claims description 2
- NABPTQDXVWOITD-UHFFFAOYSA-N thiolan-2-yl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OC1SCCC1 NABPTQDXVWOITD-UHFFFAOYSA-N 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract description 65
- 125000004430 oxygen atom Chemical group O* 0.000 abstract description 8
- 125000004434 sulfur atom Chemical group 0.000 abstract description 8
- 239000004215 Carbon black (E152) Substances 0.000 abstract description 4
- 125000003282 alkyl amino group Chemical group 0.000 abstract description 4
- 125000004663 dialkyl amino group Chemical group 0.000 abstract description 4
- 125000005842 heteroatom Chemical group 0.000 abstract description 4
- 229930195733 hydrocarbon Natural products 0.000 abstract description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract description 4
- 229910052717 sulfur Chemical group 0.000 abstract description 4
- 230000003042 antagnostic effect Effects 0.000 abstract description 3
- 230000003502 anti-nociceptive effect Effects 0.000 abstract description 3
- 125000000623 heterocyclic group Chemical group 0.000 abstract description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 60
- 238000002844 melting Methods 0.000 description 46
- 230000008018 melting Effects 0.000 description 46
- 230000000875 corresponding effect Effects 0.000 description 45
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 36
- 235000019441 ethanol Nutrition 0.000 description 36
- 239000003795 chemical substances by application Substances 0.000 description 26
- 239000000243 solution Substances 0.000 description 26
- 150000002148 esters Chemical class 0.000 description 23
- 238000004809 thin layer chromatography Methods 0.000 description 22
- 238000003756 stirring Methods 0.000 description 20
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 19
- 238000006243 chemical reaction Methods 0.000 description 19
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 18
- 238000001953 recrystallisation Methods 0.000 description 18
- 239000012043 crude product Substances 0.000 description 15
- 235000011181 potassium carbonates Nutrition 0.000 description 15
- 239000002585 base Substances 0.000 description 14
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 13
- 239000007858 starting material Substances 0.000 description 13
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 12
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 10
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 8
- OUIGCOUMOAUQOK-UHFFFAOYSA-N 4-(3,4-dihydroxyphenyl)pyrrolidin-2-one Chemical compound C1=C(O)C(O)=CC=C1C1CC(=O)NC1 OUIGCOUMOAUQOK-UHFFFAOYSA-N 0.000 description 8
- 229960000583 acetic acid Drugs 0.000 description 8
- 238000001704 evaporation Methods 0.000 description 8
- 239000012362 glacial acetic acid Substances 0.000 description 8
- 229960000443 hydrochloric acid Drugs 0.000 description 8
- 235000011167 hydrochloric acid Nutrition 0.000 description 8
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 8
- 238000002360 preparation method Methods 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- 238000005804 alkylation reaction Methods 0.000 description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 7
- JNRKFSJWVCILHE-UHFFFAOYSA-N 4-(3,4-dimethoxyphenyl)pyrrolidin-2-one Chemical compound C1=C(OC)C(OC)=CC=C1C1CC(=O)NC1 JNRKFSJWVCILHE-UHFFFAOYSA-N 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 6
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- 230000029936 alkylation Effects 0.000 description 6
- 239000008346 aqueous phase Substances 0.000 description 6
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 229940113088 dimethylacetamide Drugs 0.000 description 6
- 230000008020 evaporation Effects 0.000 description 6
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 6
- 239000000825 pharmaceutical preparation Substances 0.000 description 6
- 239000002798 polar solvent Substances 0.000 description 6
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- 125000001424 substituent group Chemical group 0.000 description 6
- 238000005406 washing Methods 0.000 description 6
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 5
- 229920006395 saturated elastomer Polymers 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- JMVIVASFFKKFQK-UHFFFAOYSA-N 1-phenylpyrrolidin-2-one Chemical class O=C1CCCN1C1=CC=CC=C1 JMVIVASFFKKFQK-UHFFFAOYSA-N 0.000 description 4
- YJZMNJXUIXTKRD-UHFFFAOYSA-N 4-[4-methoxy-3-(2-methylpropoxy)phenyl]pyrrolidine-2-thione Chemical compound C1=C(OCC(C)C)C(OC)=CC=C1C1CC(=S)NC1 YJZMNJXUIXTKRD-UHFFFAOYSA-N 0.000 description 4
- VUGWJDGEPZNBKZ-UHFFFAOYSA-N 4-methoxy-3-(2-methylpropoxy)benzaldehyde Chemical compound COC1=CC=C(C=O)C=C1OCC(C)C VUGWJDGEPZNBKZ-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 4
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 4
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 4
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 4
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 4
- 229910000564 Raney nickel Inorganic materials 0.000 description 4
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 4
- YKIOKAURTKXMSB-UHFFFAOYSA-N adams's catalyst Chemical compound O=[Pt]=O YKIOKAURTKXMSB-UHFFFAOYSA-N 0.000 description 4
- 125000003710 aryl alkyl group Chemical group 0.000 description 4
- 150000003935 benzaldehydes Chemical class 0.000 description 4
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzenecarboxaldehyde Natural products O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 4
- SESFRYSPDFLNCH-UHFFFAOYSA-N benzyl benzoate Chemical compound C=1C=CC=CC=1C(=O)OCC1=CC=CC=C1 SESFRYSPDFLNCH-UHFFFAOYSA-N 0.000 description 4
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 4
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 4
- 238000002425 crystallisation Methods 0.000 description 4
- 230000008025 crystallization Effects 0.000 description 4
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 4
- 125000000753 cycloalkyl group Chemical group 0.000 description 4
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- 150000002367 halogens Chemical class 0.000 description 4
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 4
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 4
- 238000005984 hydrogenation reaction Methods 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- JVTZFYYHCGSXJV-UHFFFAOYSA-N isovanillin Chemical compound COC1=CC=C(C=O)C=C1O JVTZFYYHCGSXJV-UHFFFAOYSA-N 0.000 description 4
- 239000008101 lactose Substances 0.000 description 4
- 235000019359 magnesium stearate Nutrition 0.000 description 4
- 229940073584 methylene chloride Drugs 0.000 description 4
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 4
- FEMOMIGRRWSMCU-UHFFFAOYSA-N ninhydrin Chemical compound C1=CC=C2C(=O)C(O)(O)C(=O)C2=C1 FEMOMIGRRWSMCU-UHFFFAOYSA-N 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 230000020477 pH reduction Effects 0.000 description 4
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 4
- 238000007911 parenteral administration Methods 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- 239000000454 talc Substances 0.000 description 4
- 235000012222 talc Nutrition 0.000 description 4
- 229910052623 talc Inorganic materials 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical compound CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 3
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 3
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 125000004122 cyclic group Chemical group 0.000 description 3
- VUWPIBNKJSEYIN-UHFFFAOYSA-N diethyl 2-benzylidenepropanedioate Chemical compound CCOC(=O)C(C(=O)OCC)=CC1=CC=CC=C1 VUWPIBNKJSEYIN-UHFFFAOYSA-N 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 150000004678 hydrides Chemical class 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 3
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 3
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- NQOFYFRKWDXGJP-UHFFFAOYSA-N 1,1,2-trimethylguanidine Chemical compound CN=C(N)N(C)C NQOFYFRKWDXGJP-UHFFFAOYSA-N 0.000 description 2
- KYVBNYUBXIEUFW-UHFFFAOYSA-N 1,1,3,3-tetramethylguanidine Chemical compound CN(C)C(=N)N(C)C KYVBNYUBXIEUFW-UHFFFAOYSA-N 0.000 description 2
- HLVFKOKELQSXIQ-UHFFFAOYSA-N 1-bromo-2-methylpropane Chemical compound CC(C)CBr HLVFKOKELQSXIQ-UHFFFAOYSA-N 0.000 description 2
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 2
- ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 2,3-dimethylbutane Chemical group CC(C)C(C)C ZFFMLCVRJBZUDZ-UHFFFAOYSA-N 0.000 description 2
- KXTAOXNYQGASTA-UHFFFAOYSA-N 2-benzylidenepropanedioic acid Chemical compound OC(=O)C(C(O)=O)=CC1=CC=CC=C1 KXTAOXNYQGASTA-UHFFFAOYSA-N 0.000 description 2
- 125000003006 2-dimethylaminoethyl group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000006228 2-isobutoxyethyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 2
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 2
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 2
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 2
- WFBUIWLAOBZOOS-UHFFFAOYSA-N 4-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-2-thione Chemical compound COC1=CC=C(C2CC(=S)NC2)C=C1OC1CCCC1 WFBUIWLAOBZOOS-UHFFFAOYSA-N 0.000 description 2
- CTBFKVULAKMSGK-UHFFFAOYSA-N 4-[4-methoxy-3-(2-methylbutoxy)phenyl]pyrrolidin-2-one Chemical compound C1=C(OC)C(OCC(C)CC)=CC(C2CC(=O)NC2)=C1 CTBFKVULAKMSGK-UHFFFAOYSA-N 0.000 description 2
- LZXLMAKTQGXJOE-UHFFFAOYSA-N 4-[4-methoxy-3-(oxolan-3-yloxy)phenyl]pyrrolidin-2-one Chemical compound COC1=CC=C(C2CC(=O)NC2)C=C1OC1CCOC1 LZXLMAKTQGXJOE-UHFFFAOYSA-N 0.000 description 2
- SAPSUFQXMXHFCR-UHFFFAOYSA-N 4-amino-3-(3,4-dimethoxyphenyl)butanoic acid;hydrochloride Chemical compound Cl.COC1=CC=C(C(CN)CC(O)=O)C=C1OC SAPSUFQXMXHFCR-UHFFFAOYSA-N 0.000 description 2
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 2
- ODHCTXKNWHHXJC-VKHMYHEASA-N 5-oxo-L-proline Chemical compound OC(=O)[C@@H]1CCC(=O)N1 ODHCTXKNWHHXJC-VKHMYHEASA-N 0.000 description 2
- 244000215068 Acacia senegal Species 0.000 description 2
- 229910002012 Aerosil® Inorganic materials 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 229920002261 Corn starch Polymers 0.000 description 2
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- 239000001828 Gelatine Substances 0.000 description 2
- 229920000084 Gum arabic Polymers 0.000 description 2
- 238000004566 IR spectroscopy Methods 0.000 description 2
- 235000019759 Maize starch Nutrition 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 239000000205 acacia gum Substances 0.000 description 2
- 235000010489 acacia gum Nutrition 0.000 description 2
- 230000007059 acute toxicity Effects 0.000 description 2
- 231100000403 acute toxicity Toxicity 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 239000002168 alkylating agent Substances 0.000 description 2
- 229940100198 alkylating agent Drugs 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 150000001413 amino acids Chemical class 0.000 description 2
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 2
- 230000002082 anti-convulsion Effects 0.000 description 2
- 238000006254 arylation reaction Methods 0.000 description 2
- HUMNYLRZRPPJDN-KWCOIAHCSA-N benzaldehyde Chemical group O=[11CH]C1=CC=CC=C1 HUMNYLRZRPPJDN-KWCOIAHCSA-N 0.000 description 2
- 150000001555 benzenes Chemical class 0.000 description 2
- 229960002903 benzyl benzoate Drugs 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 230000000035 biogenic effect Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000001175 calcium sulphate Substances 0.000 description 2
- 235000011132 calcium sulphate Nutrition 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- ZPEIMTDSQAKGNT-UHFFFAOYSA-N chlorpromazine Chemical compound C1=C(Cl)C=C2N(CCCN(C)C)C3=CC=CC=C3SC2=C1 ZPEIMTDSQAKGNT-UHFFFAOYSA-N 0.000 description 2
- 229960001076 chlorpromazine Drugs 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 229910052681 coesite Inorganic materials 0.000 description 2
- 229910052906 cristobalite Inorganic materials 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 2
- GZNWYWCUAKQMRM-UHFFFAOYSA-N diethyl 2-[(3-acetyloxy-4-methoxyphenyl)methylidene]propanedioate Chemical compound CCOC(=O)C(C(=O)OCC)=CC1=CC=C(OC)C(OC(C)=O)=C1 GZNWYWCUAKQMRM-UHFFFAOYSA-N 0.000 description 2
- RKGDXSLYBJAUHD-UHFFFAOYSA-N diethyl 2-[(3-hydroxy-4-methoxyphenyl)methylidene]propanedioate Chemical compound CCOC(=O)C(C(=O)OCC)=CC1=CC=C(OC)C(O)=C1 RKGDXSLYBJAUHD-UHFFFAOYSA-N 0.000 description 2
- 125000001028 difluoromethyl group Chemical group [H]C(F)(F)* 0.000 description 2
- UXGNZZKBCMGWAZ-UHFFFAOYSA-N dimethylformamide dmf Chemical compound CN(C)C=O.CN(C)C=O UXGNZZKBCMGWAZ-UHFFFAOYSA-N 0.000 description 2
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000008298 dragée Substances 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- HJKJXWMIISKYGB-UHFFFAOYSA-N ethyl 3-cyano-3-phenylpropanoate Chemical compound CCOC(=O)CC(C#N)C1=CC=CC=C1 HJKJXWMIISKYGB-UHFFFAOYSA-N 0.000 description 2
- 239000002024 ethyl acetate extract Substances 0.000 description 2
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 229960003692 gamma aminobutyric acid Drugs 0.000 description 2
- 238000004817 gas chromatography Methods 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 150000002440 hydroxy compounds Chemical class 0.000 description 2
- 229940090044 injection Drugs 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- CIXSDMKDSYXUMJ-UHFFFAOYSA-N n,n-diethylcyclohexanamine Chemical compound CCN(CC)C1CCCCC1 CIXSDMKDSYXUMJ-UHFFFAOYSA-N 0.000 description 2
- 230000003533 narcotic effect Effects 0.000 description 2
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 230000000926 neurological effect Effects 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 235000019198 oils Nutrition 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 229910003446 platinum oxide Inorganic materials 0.000 description 2
- 229920001515 polyalkylene glycol Polymers 0.000 description 2
- 229920001021 polysulfide Polymers 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 150000004040 pyrrolidinones Chemical class 0.000 description 2
- 229940079889 pyrrolidonecarboxylic acid Drugs 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000009738 saturating Methods 0.000 description 2
- 230000001624 sedative effect Effects 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229910052682 stishovite Inorganic materials 0.000 description 2
- 125000000547 substituted alkyl group Chemical group 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 238000004448 titration Methods 0.000 description 2
- 230000009466 transformation Effects 0.000 description 2
- 238000000844 transformation Methods 0.000 description 2
- 125000005270 trialkylamine group Chemical group 0.000 description 2
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 2
- 229910052905 tridymite Inorganic materials 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000004417 unsaturated alkyl group Chemical group 0.000 description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 description 2
- 239000008158 vegetable oil Substances 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- YQTCQNIPQMJNTI-UHFFFAOYSA-N 2,2-dimethylpropan-1-one Chemical group CC(C)(C)[C]=O YQTCQNIPQMJNTI-UHFFFAOYSA-N 0.000 description 1
- QQNCKWXXHNJAQX-UHFFFAOYSA-N 2-[(4-hydroxy-3-methoxyphenyl)methylidene]propanedioic acid Chemical compound COC1=CC(C=C(C(O)=O)C(O)=O)=CC=C1O QQNCKWXXHNJAQX-UHFFFAOYSA-N 0.000 description 1
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- GMPNSKPTQXVWAF-UHFFFAOYSA-N 3-cyano-3-phenylpropanoic acid Chemical compound OC(=O)CC(C#N)C1=CC=CC=C1 GMPNSKPTQXVWAF-UHFFFAOYSA-N 0.000 description 1
- OVRPDYOZYMCTAK-UHFFFAOYSA-N 4-(4-chlorophenyl)pyrrolidin-2-one Chemical compound C1=CC(Cl)=CC=C1C1CC(=O)NC1 OVRPDYOZYMCTAK-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 101100513046 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) eth-1 gene Proteins 0.000 description 1
- 238000010934 O-alkylation reaction Methods 0.000 description 1
- PQLVXDKIJBQVDF-UHFFFAOYSA-N acetic acid;hydrate Chemical compound O.CC(O)=O PQLVXDKIJBQVDF-UHFFFAOYSA-N 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- YCOXTKKNXUZSKD-UHFFFAOYSA-N as-o-xylenol Natural products CC1=CC=C(O)C=C1C YCOXTKKNXUZSKD-UHFFFAOYSA-N 0.000 description 1
- OBNCKNCVKJNDBV-UHFFFAOYSA-N butanoic acid ethyl ester Natural products CCCC(=O)OCC OBNCKNCVKJNDBV-UHFFFAOYSA-N 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- PQCRPXRLLDACRS-UHFFFAOYSA-N ethyl 4-(3,4-dimethoxyphenyl)-2-oxopyrrolidine-3-carboxylate Chemical compound C1NC(=O)C(C(=O)OCC)C1C1=CC=C(OC)C(OC)=C1 PQCRPXRLLDACRS-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical compound [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 241000894007 species Species 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
- C07D207/273—2-Pyrrolidones with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to other ring carbon atoms
- C07D207/277—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/18—Antipsychotics, i.e. neuroleptics; Drugs for mania or schizophrenia
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/67—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton
- C07C45/68—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
- C07C45/70—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form
- C07C45/71—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms by reaction with functional groups containing oxygen only in singly bound form being hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/52—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings
- C07C47/575—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings containing ether groups, groups, groups, or groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Animal Behavior & Ethology (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Psychiatry (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biomedical Technology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pyrrole Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2413935A DE2413935A1 (de) | 1974-03-20 | 1974-03-20 | 4-(polyalkoxy-phenyl)-2-pyrrolidone |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1069517A true CA1069517A (en) | 1980-01-08 |
Family
ID=5910915
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA222,720A Expired CA1069517A (en) | 1974-03-20 | 1975-03-20 | 4-(polyalkoxy-phenyl)-2-pyrrolidone |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4012495A (enExample) |
| JP (1) | JPS6011028B2 (enExample) |
| AT (1) | AT347931B (enExample) |
| BE (1) | BE826923A (enExample) |
| CA (1) | CA1069517A (enExample) |
| CH (1) | CH621338A5 (enExample) |
| CS (1) | CS214738B2 (enExample) |
| DD (1) | DD119229A5 (enExample) |
| DE (1) | DE2413935A1 (enExample) |
| DK (1) | DK139965C (enExample) |
| ES (1) | ES435750A1 (enExample) |
| FR (1) | FR2264531B1 (enExample) |
| GB (1) | GB1498705A (enExample) |
| HU (1) | HU174074B (enExample) |
| IE (1) | IE40865B1 (enExample) |
| IL (1) | IL46883A (enExample) |
| NL (1) | NL7503367A (enExample) |
| SE (1) | SE402010B (enExample) |
| SU (1) | SU649312A3 (enExample) |
| YU (1) | YU40258B (enExample) |
Families Citing this family (114)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4193926A (en) | 1974-03-20 | 1980-03-18 | Schering Aktiengesellschaft | 4-(Polyalkoxy phenyl)-2-pyrrolidones |
| DE2541855A1 (de) * | 1975-09-18 | 1977-03-31 | Schering Ag | 4-(polyalkoxy-phenyl)-2-pyrrolidone ii |
| CU21107A3 (es) | 1978-02-10 | 1988-02-01 | Hoffmann La Roche | Pyrrolidines derivatives |
| IL57266A (en) | 1978-06-12 | 1982-12-31 | Mundipharma Ag | Production of pyrrolidin-2-ones and of 3-pyrrolin-2-ones |
| IT1131959B (it) * | 1979-08-09 | 1986-06-25 | Hoffmann La Roche | Derivati pirrolidinici |
| GB2123288A (en) * | 1982-07-16 | 1984-02-01 | Wellcome Found | Anti-thrombotic agent |
| US4548947A (en) * | 1984-05-07 | 1985-10-22 | Warner-Lambert Company | 1-(Substituted-aryl)-dihydro-1H-pyrrolizine-3,5-[2H,6H-]diones and use for reversing amnesia |
| US4584313A (en) * | 1984-05-07 | 1986-04-22 | Warner-Lambert Company | (Substituted-phenyl)-5-oxo-2-pyrrolidinepropanoic acids and esters thereof, and use for reversing electroconvulsive shock-induced amnesia |
| DE3438839A1 (de) * | 1984-10-19 | 1986-04-24 | Schering AG, 1000 Berlin und 4709 Bergkamen | Pharmazeutische praeparate |
| US5783591A (en) * | 1984-10-19 | 1998-07-21 | Schering Aktiengesellschaft | Administration of oxazolidinone and pyrolidinone compounds for the treatment of inflammation |
| HU215433B (hu) * | 1986-04-29 | 2000-05-28 | Pfizer Inc. | Eljárás új 2-oxo-5-fenil-pirimidin-származékok előállítására |
| US5459145A (en) * | 1988-01-19 | 1995-10-17 | Pfizer Inc. | Calcium independent camp phosphodiesterase inhibitor antidepressant |
| FI875101L (fi) * | 1986-12-03 | 1988-06-04 | Tanabe Seiyaku Co | Laktamderivat och preparat innehaollande dessa. |
| US5274002A (en) * | 1987-04-14 | 1993-12-28 | Warner-Lambert Company | Trisubstituted phenyl analogs having activity for congestive heart failure |
| US4971959A (en) * | 1987-04-14 | 1990-11-20 | Warner-Lambert Company | Trisubstituted phenyl analogs having activity for congestive heart failure |
| US4960457A (en) * | 1988-12-27 | 1990-10-02 | Ici Americas Inc. | Substituted 1,3-diphenyl pyrrolidones and their use as herbicides |
| DE3921593A1 (de) * | 1989-06-28 | 1991-01-10 | Schering Ag | Verfahren zur racemattrennung von 4-aryl-2-oxo-pyrrolidin-3-carbonsaeure-ester |
| JP2578001B2 (ja) * | 1989-12-11 | 1997-02-05 | 明治製菓株式会社 | 抗痴呆薬 |
| DE3943385A1 (de) * | 1989-12-27 | 1991-07-04 | Schering Ag | Mittel zur transdermalen applikation enthaltend rolipram |
| DD299058A5 (de) * | 1990-01-31 | 1992-03-26 | Arzneimittelwerk Dresden Gmbh,De | Verfahren zur herstellung von n-acyl-4-phenyl-pyrrolidin-2-onen mit cerebroprotektiver wirkung |
| GB9009395D0 (en) * | 1990-04-26 | 1990-06-20 | Orion Yhtymae Oy | Cyclic hydroxamic acids and their use |
| AU8292091A (en) * | 1990-08-03 | 1992-03-02 | Smithkline Beecham Corporation | Tnf inhibitors |
| DE4032055A1 (de) * | 1990-10-05 | 1992-04-09 | Schering Ag | Verfahren zur herstellung von optisch aktiven 4-aryl-2-pyrrolidinonen |
| US5547979A (en) * | 1992-03-30 | 1996-08-20 | Smithkline Beecham | TNF inhibition |
| US5395935A (en) * | 1992-05-08 | 1995-03-07 | Pfizer Inc. | Endo-bicyclo[2.2.1]heptan-2-ol and derived pharmaceutical agents |
| GB9212673D0 (en) * | 1992-06-15 | 1992-07-29 | Celltech Ltd | Chemical compounds |
| GB9222253D0 (en) * | 1992-10-23 | 1992-12-09 | Celltech Ltd | Chemical compounds |
| GB9226830D0 (en) * | 1992-12-23 | 1993-02-17 | Celltech Ltd | Chemical compounds |
| US5622977A (en) * | 1992-12-23 | 1997-04-22 | Celltech Therapeutics Limited | Tri-substituted (aryl or heteroaryl) derivatives and pharmaceutical compositions containing the same |
| GB9304919D0 (en) * | 1993-03-10 | 1993-04-28 | Celltech Ltd | Chemical compounds |
| GB9304920D0 (en) * | 1993-03-10 | 1993-04-28 | Celltech Ltd | Chemical compounds |
| GB9312853D0 (en) | 1993-06-22 | 1993-08-04 | Euro Celtique Sa | Chemical compounds |
| US5477611A (en) * | 1993-09-20 | 1995-12-26 | Tessera, Inc. | Method of forming interface between die and chip carrier |
| US5665754A (en) * | 1993-09-20 | 1997-09-09 | Glaxo Wellcome Inc. | Substituted pyrrolidines |
| EP0738268B1 (en) * | 1993-12-22 | 2004-03-03 | Celltech R&D Limited | Trisubstituted phenyl derivatives, processes for their preparation and their use as phosphodiesterase (type iv) inhibitors |
| GB9326173D0 (en) * | 1993-12-22 | 1994-02-23 | Celltech Ltd | Chemical compounds and process |
| CA2143143A1 (en) * | 1994-03-08 | 1995-09-09 | Toshihiko Tanaka | 3-phenylpyrrolidine derivatives |
| US5338739A (en) * | 1994-03-10 | 1994-08-16 | Hoechst-Roussel Pharmaceuticals Inc. | (Pyrrolidinyl)phenyl carbamates, compositions and use |
| US6245774B1 (en) | 1994-06-21 | 2001-06-12 | Celltech Therapeutics Limited | Tri-substituted phenyl or pyridine derivatives |
| US5786354A (en) * | 1994-06-21 | 1998-07-28 | Celltech Therapeutics, Limited | Tri-substituted phenyl derivatives and processes for their preparation |
| GB9412573D0 (en) | 1994-06-22 | 1994-08-10 | Celltech Ltd | Chemical compounds |
| GB9412571D0 (en) | 1994-06-22 | 1994-08-10 | Celltech Ltd | Chemical compounds |
| GB9412672D0 (en) * | 1994-06-23 | 1994-08-10 | Celltech Ltd | Chemical compounds |
| US5591776A (en) * | 1994-06-24 | 1997-01-07 | Euro-Celtique, S.A. | Pheynl or benzyl-substituted rolipram-based compounds for and method of inhibiting phosphodiesterase IV |
| US5922751A (en) | 1994-06-24 | 1999-07-13 | Euro-Celtique, S.A. | Aryl pyrazole compound for inhibiting phosphodiesterase IV and methods of using same |
| US5665737B1 (en) * | 1994-10-12 | 1999-02-16 | Euro Celtique Sa | Substituted benzoxazoles |
| ATE247116T1 (de) | 1994-12-13 | 2003-08-15 | Euro Celtique Sa | Arylthioxanthine |
| US6025361A (en) | 1994-12-13 | 2000-02-15 | Euro-Celtique, S.A. | Trisubstituted thioxanthines |
| JPH11500110A (ja) * | 1995-02-10 | 1999-01-06 | シエーリング アクチエンゲゼルシヤフト | Tnf−抑制用製剤 |
| US6268373B1 (en) | 1995-06-07 | 2001-07-31 | Euro-Celtique S.A. | Trisubstituted thioxanthines |
| US6166041A (en) | 1995-10-11 | 2000-12-26 | Euro-Celtique, S.A. | 2-heteroaryl and 2-heterocyclic benzoxazoles as PDE IV inhibitors for the treatment of asthma |
| DE19540475A1 (de) * | 1995-10-20 | 1997-04-24 | Schering Ag | Chirale Methylphenyloxazolidinone |
| GB9523675D0 (en) | 1995-11-20 | 1996-01-24 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9526246D0 (en) * | 1995-12-21 | 1996-02-21 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9526243D0 (en) * | 1995-12-21 | 1996-02-21 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9526245D0 (en) * | 1995-12-21 | 1996-02-21 | Celltech Therapeutics Ltd | Chemical compounds |
| US6075016A (en) | 1996-04-10 | 2000-06-13 | Euro-Celtique S.A. | 6,5-fused aromatic ring systems having enhanced phosphodiesterase IV inhibitory activity |
| GB9608435D0 (en) * | 1996-04-24 | 1996-06-26 | Celltech Therapeutics Ltd | Chemical compounds |
| US5864037A (en) | 1996-06-06 | 1999-01-26 | Euro-Celtique, S.A. | Methods for the synthesis of chemical compounds having PDE-IV inhibitory activity |
| JP4017214B2 (ja) | 1996-06-11 | 2007-12-05 | 興和創薬株式会社 | 5−フェニル−3−ピリダジノン誘導体 |
| WO1998004534A1 (en) | 1996-07-31 | 1998-02-05 | Nikken Chemicals Co., Ltd. | 6-phenyltetrahydro-1,3-oxazin-2-one derivatives and medicinal compositions containing the same |
| WO1998008828A1 (en) | 1996-08-27 | 1998-03-05 | Nikken Chemicals Co., Ltd. | 2-phenylmorpholin-5-one derivatives and pharmaceutical composition comprising the same |
| GB9619284D0 (en) * | 1996-09-16 | 1996-10-30 | Celltech Therapeutics Ltd | Chemical compounds |
| US5744473A (en) * | 1996-09-16 | 1998-04-28 | Euro-Celtique, S.A. | PDE IV inhibitors: "bis-compounds" |
| GB9622363D0 (en) | 1996-10-28 | 1997-01-08 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9625184D0 (en) * | 1996-12-04 | 1997-01-22 | Celltech Therapeutics Ltd | Chemical compounds |
| US6057329A (en) * | 1996-12-23 | 2000-05-02 | Celltech Therapeutics Limited | Fused polycyclic 2-aminopyrimidine derivatives |
| GB9705361D0 (en) | 1997-03-14 | 1997-04-30 | Celltech Therapeutics Ltd | Chemical compounds |
| GB9713087D0 (en) * | 1997-06-20 | 1997-08-27 | Celltech Therapeutics Ltd | Chemical compounds |
| EP0994100B1 (en) | 1997-06-24 | 2006-08-30 | Nikken Chemicals Company, Limited | 3-anilino-2-cycloalkenone derivates |
| CA2309350C (en) | 1997-11-12 | 2007-04-03 | Mitsubishi Chemical Corporation | Purine derivatives and medicaments comprising the same as active ingredient |
| US7214665B2 (en) | 2001-10-01 | 2007-05-08 | University Of Virginia Patent Foundation | 2-propynyl adenosine analogs having A2A agonist activity and compositions thereof |
| US6232297B1 (en) * | 1999-02-01 | 2001-05-15 | University Of Virginia Patent Foundation | Methods and compositions for treating inflammatory response |
| US7427606B2 (en) | 1999-02-01 | 2008-09-23 | University Of Virginia Patent Foundation | Method to reduce inflammatory response in transplanted tissue |
| US7378400B2 (en) | 1999-02-01 | 2008-05-27 | University Of Virginia Patent Foundation | Method to reduce an inflammatory response from arthritis |
| CN1160355C (zh) * | 1999-05-11 | 2004-08-04 | 三菱化学株式会社 | 嘌呤衍生物二水合物、含有该化合物作为有效成分的药物及其制备中间体 |
| GB9914258D0 (en) * | 1999-06-18 | 1999-08-18 | Celltech Therapeutics Ltd | Chemical compounds |
| CA2715683A1 (en) | 1999-08-21 | 2001-03-01 | Nycomed Gmbh | Synergistic combination |
| GB9924862D0 (en) * | 1999-10-20 | 1999-12-22 | Celltech Therapeutics Ltd | Chemical compounds |
| CA2404226A1 (en) * | 2000-03-23 | 2001-09-27 | Takeda Chemical Industries, Ltd. | Furoisoquinoline derivatives, process for producing the same and use thereof |
| JP4291135B2 (ja) * | 2001-05-29 | 2009-07-08 | バイエル・シエーリング・ファーマ アクチエンゲゼルシャフト | Cdk阻害性ピリミジン、それらの製造および薬剤としての使用 |
| EP1406582B1 (en) * | 2001-07-16 | 2006-10-25 | MERCK PATENT GmbH | Photostable organic sunscreen compounds with antioxidant properties and compositions obtained therefrom |
| EP1435944B1 (en) * | 2001-10-16 | 2009-09-30 | Memory Pharmaceutical Corporation | 4(4-alkoxy-3-hydroxyphenyl)-2-pyrrolidone derivatives as pde-4 inhibitors for the treatment of neurological syndromes |
| WO2003086408A1 (en) * | 2002-04-10 | 2003-10-23 | University Of Virginia Patent Foundation | Use of a2a adenosine receptor agonists for the treatment of inflammatory diseases |
| WO2004011470A1 (ja) * | 2002-07-26 | 2004-02-05 | Takeda Pharmaceutical Company Limited | フロイソキノリン誘導体およびその用途 |
| WO2004037784A2 (en) * | 2002-10-21 | 2004-05-06 | Irm Llc | Pyrrolidones with anti-hiv activity |
| US7772188B2 (en) | 2003-01-28 | 2010-08-10 | Ironwood Pharmaceuticals, Inc. | Methods and compositions for the treatment of gastrointestinal disorders |
| EA200501548A1 (ru) | 2003-04-01 | 2006-02-24 | Апплайд Резеч Системз Арс Холдинг Н.В. | Ингибиторы фосфодиэстераз при бесплодии |
| SG169900A1 (en) * | 2003-04-16 | 2011-04-29 | Memory Pharm Corp | 4 - (3,4 - disubstituted phenyl) - pyrrolidin-2-one compounds as phosphodiesterase 4 inhibitors |
| EP1631568A1 (en) * | 2003-04-18 | 2006-03-08 | Memory Pharmaceuticals Corporation | Pyrazole derivatives as phosphodiesterase 4 inhibitors |
| EP1618089A1 (en) * | 2003-04-25 | 2006-01-25 | Icos Corporation | Method of preparing a ring compound having two adjacent chiral centers |
| US7655680B2 (en) * | 2004-05-17 | 2010-02-02 | Otsuka Pharmaceutical Co., Ltd. | Thiazole compound and use thereof |
| US7442687B2 (en) | 2004-08-02 | 2008-10-28 | The University Of Virginia Patent Foundation | 2-polycyclic propynyl adenosine analogs having A2A agonist activity |
| WO2006028618A1 (en) | 2004-08-02 | 2006-03-16 | University Of Virginia Patent Foundation | 2-polycyclic propynyl adenosine analogs with modified 5'-ribose groups having a2a agonist activity |
| NZ553288A (en) | 2004-08-02 | 2010-12-24 | Univ Virginia | 2-propynyl adenosine analogs with modified 5'-ribose groups having A2A agonist activity |
| CA2584317A1 (en) | 2004-10-15 | 2006-04-27 | Memory Pharmaceuticals Corporation | Pyrazole derivatives as phosphodiesterase 4 inhibitors |
| US7585882B2 (en) * | 2004-10-20 | 2009-09-08 | Memory Pharmaceuticals Corporation | Phosphodiesterase 4 inhibitors |
| US8178509B2 (en) * | 2006-02-10 | 2012-05-15 | University Of Virginia Patent Foundation | Method to treat sickle cell disease |
| US8188063B2 (en) * | 2006-06-19 | 2012-05-29 | University Of Virginia Patent Foundation | Use of adenosine A2A modulators to treat spinal cord injury |
| CN101772513B (zh) | 2007-06-04 | 2013-11-13 | 协同医药品公司 | 有效用于胃肠功能紊乱、炎症、癌症和其他疾病治疗的鸟苷酸环化酶激动剂 |
| US8969514B2 (en) | 2007-06-04 | 2015-03-03 | Synergy Pharmaceuticals, Inc. | Agonists of guanylate cyclase useful for the treatment of hypercholesterolemia, atherosclerosis, coronary heart disease, gallstone, obesity and other cardiovascular diseases |
| US8058259B2 (en) | 2007-12-20 | 2011-11-15 | University Of Virginia Patent Foundation | Substituted 4-{3-[6-amino-9-(3,4-dihydroxy-tetrahydro-furan-2-yl)-9H-purin-2-yl]-prop-2-ynyl}-piperidine-1-carboxylic acid esters as A2AR agonists |
| CA2726917C (en) | 2008-06-04 | 2018-06-26 | Synergy Pharmaceuticals Inc. | Agonists of guanylate cyclase useful for the treatment of gastrointestinal disorders, inflammation, cancer and other disorders |
| WO2010009319A2 (en) | 2008-07-16 | 2010-01-21 | Synergy Pharmaceuticals Inc. | Agonists of guanylate cyclase useful for the treatment of gastrointestinal, inflammation, cancer and other disorders |
| US20100159034A1 (en) * | 2008-12-15 | 2010-06-24 | Auspex Pharmaceuticals, Inc. | Pyrrolidinone inhibitors of pde-4 |
| US9616097B2 (en) | 2010-09-15 | 2017-04-11 | Synergy Pharmaceuticals, Inc. | Formulations of guanylate cyclase C agonists and methods of use |
| CN108676076A (zh) | 2011-03-01 | 2018-10-19 | 辛纳吉制药公司 | 制备鸟苷酸环化酶c激动剂的方法 |
| ES2395801B1 (es) | 2011-06-23 | 2014-06-06 | María Carmen PARDINA PALLEJÀ | "pentoxifilina por vía transvaginal para el tratamiento de la infertilidad" |
| CA2902348C (en) | 2013-02-25 | 2021-11-30 | Synergy Pharmaceuticals Inc. | Agonists of guanylate cyclase and their uses |
| AU2014235215A1 (en) | 2013-03-15 | 2015-10-01 | Synergy Pharmaceuticals Inc. | Agonists of guanylate cyclase and their uses |
| HK1220611A1 (zh) | 2013-03-15 | 2017-05-12 | Bausch Health Ireland Limited | 用於治疗胃肠道病症的组成物 |
| HRP20240805T1 (hr) | 2013-06-05 | 2024-09-27 | Bausch Health Ireland Limited | Ultra-pročišćeni agonisti guanilat-ciklaze c, postupak njihove pripreme i uporabe |
| KR20220147691A (ko) | 2013-08-09 | 2022-11-03 | 알데릭스, 인코포레이티드 | 인산염 수송을 억제하기 위한 화합물 및 방법 |
| EP3972599B1 (en) | 2019-05-21 | 2025-10-22 | Ardelyx, Inc. | Combination for lowering serum phosphate in a patient |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1516776A (fr) | 1966-07-21 | 1968-03-15 | Rhone Poulenc Sa | Nouveaux dérivés du pyrrole et leur préparation |
| GB1350582A (en) * | 1970-07-24 | 1974-04-18 | Ucb Sa | Cerivatives of 2-pyrrolidinone |
-
1974
- 1974-03-20 DE DE2413935A patent/DE2413935A1/de active Granted
-
1975
- 1975-03-10 SU SU752111302A patent/SU649312A3/ru active
- 1975-03-17 YU YU632/75A patent/YU40258B/xx unknown
- 1975-03-18 DD DD184858A patent/DD119229A5/xx unknown
- 1975-03-18 DK DK110675A patent/DK139965C/da not_active IP Right Cessation
- 1975-03-18 CH CH345775A patent/CH621338A5/de not_active IP Right Cessation
- 1975-03-18 ES ES435750A patent/ES435750A1/es not_active Expired
- 1975-03-19 AT AT210975A patent/AT347931B/de not_active IP Right Cessation
- 1975-03-19 HU HU75SCHE514A patent/HU174074B/hu unknown
- 1975-03-19 CS CS751860A patent/CS214738B2/cs unknown
- 1975-03-19 SE SE7503157A patent/SE402010B/xx not_active IP Right Cessation
- 1975-03-20 NL NL7503367A patent/NL7503367A/xx not_active Application Discontinuation
- 1975-03-20 JP JP50034220A patent/JPS6011028B2/ja not_active Expired
- 1975-03-20 IE IE611/75A patent/IE40865B1/xx unknown
- 1975-03-20 CA CA222,720A patent/CA1069517A/en not_active Expired
- 1975-03-20 GB GB11686/75A patent/GB1498705A/en not_active Expired
- 1975-03-20 US US05/560,193 patent/US4012495A/en not_active Expired - Lifetime
- 1975-03-20 IL IL46883A patent/IL46883A/xx unknown
- 1975-03-20 FR FR7508701A patent/FR2264531B1/fr not_active Expired
- 1975-03-20 BE BE154536A patent/BE826923A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| ATA210975A (de) | 1978-06-15 |
| ES435750A1 (es) | 1976-12-16 |
| YU40258B (en) | 1985-10-31 |
| DK139965C (da) | 1979-10-29 |
| SE7503157L (sv) | 1975-11-28 |
| DK110675A (enExample) | 1975-09-21 |
| YU63275A (en) | 1982-06-30 |
| SU649312A3 (ru) | 1979-02-25 |
| CH621338A5 (enExample) | 1981-01-30 |
| DE2413935C2 (enExample) | 1988-05-26 |
| GB1498705A (en) | 1978-01-25 |
| CS214738B2 (en) | 1982-05-28 |
| SE402010B (sv) | 1978-06-12 |
| DE2413935A1 (de) | 1975-10-16 |
| FR2264531A1 (enExample) | 1975-10-17 |
| IE40865B1 (en) | 1979-08-29 |
| IL46883A (en) | 1979-09-30 |
| BE826923A (fr) | 1975-09-22 |
| IE40865L (en) | 1975-09-20 |
| US4012495A (en) | 1977-03-15 |
| NL7503367A (nl) | 1975-09-23 |
| HU174074B (hu) | 1979-10-28 |
| DK139965B (da) | 1979-05-28 |
| AU7931075A (en) | 1976-09-23 |
| JPS50157360A (enExample) | 1975-12-19 |
| AT347931B (de) | 1979-01-25 |
| FR2264531B1 (enExample) | 1978-07-28 |
| DD119229A5 (enExample) | 1976-04-12 |
| JPS6011028B2 (ja) | 1985-03-22 |
| IL46883A0 (en) | 1975-05-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1069517A (en) | 4-(polyalkoxy-phenyl)-2-pyrrolidone | |
| CA1077496A (en) | 4-(polyalkoxy-phenyl)-2-pyrrolidone ii | |
| US4193926A (en) | 4-(Polyalkoxy phenyl)-2-pyrrolidones | |
| US3865840A (en) | Process of preparing 1,4-diloweralkyl-3-loweralkoxy-carbonyl-2-acetates | |
| FI103506B (fi) | Menetelmä syklisten aminohappojohdannaisten valmistamiseksi ja menetel mässä käytettävä välituote | |
| Paragamian et al. | A study of the synthesis and some reactions of perimidines | |
| Prill et al. | A Study of the Cyclization of a Series of ι, ι'-Dicarbethoxydialkylmethylamines through the Acetoacetic Ester Condensation | |
| US4110331A (en) | Method of producing the hydrochloride of N-methyl piperidine-2-carboxylic acid-2,6-xylidide | |
| US4243805A (en) | 3 Fluoro-10-piperazino-8-substituted 10,11-dihydrodibenzo-(bf) thiepins and method for the preparation thereof | |
| US3515731A (en) | Antibacterial agents | |
| US4075346A (en) | CNS depressant γ-(secondary amino)-ortho-nitro-butyrophenones | |
| US3308121A (en) | 3-morpholinones, thiones and 5, 6 oxazines | |
| US4198514A (en) | Lactam compounds | |
| Todd et al. | The Synthesis of Analogs of Penicillin. 1a I | |
| NO136713B (enExample) | ||
| US4587356A (en) | Process for the production of nuclear substituted cinnamoylanthranilic acid derivatives | |
| US4041079A (en) | Bicyclic compounds | |
| Adams et al. | Senecio Alkaloids: Mikanoidine, the Alkaloid from Senecio mikanoides | |
| Phillips | Ethanolamides of Some Mono-and Dicarboxylic Acids | |
| US4276294A (en) | Benzofurylpiperazines | |
| Clezy et al. | The chemistry of pyrrolic compounds. XXV. The chemistry of acetal and thioacetal derivatives of pyrrolic systems | |
| DE69312085T2 (de) | Verfarhen zur herstellung von alpha-aryl-gamma-butyrolactonen | |
| Burtner et al. | Antispasmodics. III. Diarylacetic Acid Esters of Some Pyridyl and Piperidyl Alkanols1 | |
| CA1044239A (en) | 6-alkoxy-7-hydroxyquinoline-3-carboxylic acids and derivatives thereof | |
| US3655667A (en) | 1-(2-benzoylcyclopropylmethyl)-4-phenylpiperazines |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |