CH526553A - Procédé de fabrication de dérivés d'imidazole - Google Patents
Procédé de fabrication de dérivés d'imidazoleInfo
- Publication number
- CH526553A CH526553A CH1730370A CH1730370A CH526553A CH 526553 A CH526553 A CH 526553A CH 1730370 A CH1730370 A CH 1730370A CH 1730370 A CH1730370 A CH 1730370A CH 526553 A CH526553 A CH 526553A
- Authority
- CH
- Switzerland
- Prior art keywords
- methyl
- parts
- imidazolyl
- acetophenone
- compound
- Prior art date
Links
- 150000001412 amines Chemical class 0.000 title claims abstract description 10
- 230000000855 fungicidal effect Effects 0.000 title abstract description 3
- 230000000749 insecticidal effect Effects 0.000 title abstract description 3
- PQAMFDRRWURCFQ-UHFFFAOYSA-N 2-ethyl-1h-imidazole Chemical compound CCC1=NC=CN1 PQAMFDRRWURCFQ-UHFFFAOYSA-N 0.000 title 1
- -1 ethylimidazole ethers Chemical class 0.000 claims abstract description 53
- 150000003839 salts Chemical class 0.000 claims abstract description 18
- 239000002253 acid Substances 0.000 claims abstract description 17
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 13
- 125000001544 thienyl group Chemical group 0.000 claims abstract description 8
- 150000001875 compounds Chemical class 0.000 claims description 81
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims description 40
- 238000002844 melting Methods 0.000 claims description 38
- 230000008018 melting Effects 0.000 claims description 38
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 35
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 33
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 30
- 239000000203 mixture Substances 0.000 claims description 29
- 239000002904 solvent Substances 0.000 claims description 27
- 238000000034 method Methods 0.000 claims description 24
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 24
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 21
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 21
- 238000002360 preparation method Methods 0.000 claims description 21
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims description 19
- 150000002576 ketones Chemical class 0.000 claims description 19
- 229910017604 nitric acid Inorganic materials 0.000 claims description 19
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 18
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 15
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 claims description 14
- 239000000047 product Substances 0.000 claims description 13
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 12
- 125000005843 halogen group Chemical group 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 229910002651 NO3 Inorganic materials 0.000 claims description 9
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 claims description 9
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- 238000001914 filtration Methods 0.000 claims description 9
- 238000004519 manufacturing process Methods 0.000 claims description 8
- 239000011541 reaction mixture Substances 0.000 claims description 8
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 6
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical group [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 6
- 229910052794 bromium Inorganic materials 0.000 claims description 6
- 150000004862 dioxolanes Chemical class 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- 238000001704 evaporation Methods 0.000 claims description 5
- 230000008020 evaporation Effects 0.000 claims description 5
- 150000003254 radicals Chemical class 0.000 claims description 5
- XKXPROBTEJTMQK-UHFFFAOYSA-N 2-(bromomethyl)-2-(4-chlorophenyl)-1,3-dioxolane Chemical group C1=CC(Cl)=CC=C1C1(CBr)OCCO1 XKXPROBTEJTMQK-UHFFFAOYSA-N 0.000 claims description 4
- SHEJGDJNVFQCBT-UHFFFAOYSA-N ClC1=CC=C(C=C1)C1(OCCO1)CN1C=NC=C1C Chemical compound ClC1=CC=C(C=C1)C1(OCCO1)CN1C=NC=C1C SHEJGDJNVFQCBT-UHFFFAOYSA-N 0.000 claims description 4
- RPHNOTDRBMNATD-UHFFFAOYSA-N bis(5-methyl-1h-imidazol-2-yl)methanone Chemical class N1C(C)=CN=C1C(=O)C1=NC=C(C)N1 RPHNOTDRBMNATD-UHFFFAOYSA-N 0.000 claims description 4
- 239000000706 filtrate Substances 0.000 claims description 4
- 239000001569 carbon dioxide Substances 0.000 claims description 3
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- XLSZMDLNRCVEIJ-UHFFFAOYSA-N methylimidazole Natural products CC1=CNC=N1 XLSZMDLNRCVEIJ-UHFFFAOYSA-N 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 3
- 230000002829 reductive effect Effects 0.000 claims description 3
- IXNPPUZMZUWSEV-UHFFFAOYSA-N 2-(5-methylimidazol-1-yl)-1-phenylethanone Chemical compound CC1=CN=CN1CC(=O)C1=CC=CC=C1 IXNPPUZMZUWSEV-UHFFFAOYSA-N 0.000 claims description 2
- LXBGSDVWAMZHDD-UHFFFAOYSA-N 2-methyl-1h-imidazole Chemical compound CC1=NC=CN1 LXBGSDVWAMZHDD-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- MVCLVHRPWBBNGY-UHFFFAOYSA-N ClC1=CC=C(C=C1)C(CN1C=NC=C1C)=O Chemical compound ClC1=CC=C(C=C1)C(CN1C=NC=C1C)=O MVCLVHRPWBBNGY-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- YECIFGHRMFEPJK-UHFFFAOYSA-N lidocaine hydrochloride monohydrate Chemical compound O.[Cl-].CC[NH+](CC)CC(=O)NC1=C(C)C=CC=C1C YECIFGHRMFEPJK-UHFFFAOYSA-N 0.000 claims description 2
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims description 2
- 239000010690 paraffinic oil Substances 0.000 claims description 2
- 125000005059 halophenyl group Chemical group 0.000 claims 2
- 150000002431 hydrogen Chemical class 0.000 claims 1
- 125000006501 nitrophenyl group Chemical group 0.000 claims 1
- 230000000361 pesticidal effect Effects 0.000 claims 1
- 239000000243 solution Substances 0.000 description 30
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 24
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 18
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 18
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 14
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 14
- 239000002585 base Substances 0.000 description 13
- 244000005700 microbiome Species 0.000 description 12
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- 241000894006 Bacteria Species 0.000 description 9
- 238000010992 reflux Methods 0.000 description 9
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 8
- 238000009835 boiling Methods 0.000 description 8
- 239000007788 liquid Substances 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- 238000001816 cooling Methods 0.000 description 7
- 239000012458 free base Substances 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 6
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 6
- 239000004480 active ingredient Substances 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000012153 distilled water Substances 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- 238000010790 dilution Methods 0.000 description 4
- 239000012895 dilution Substances 0.000 description 4
- 238000010410 dusting Methods 0.000 description 4
- 239000000839 emulsion Substances 0.000 description 4
- VLDUBDZWWNLZCU-UHFFFAOYSA-N ethyl 5-methyl-1h-imidazole-4-carboxylate Chemical compound CCOC(=O)C=1NC=NC=1C VLDUBDZWWNLZCU-UHFFFAOYSA-N 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 4
- 239000012442 inert solvent Substances 0.000 description 4
- 239000002674 ointment Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 239000008096 xylene Substances 0.000 description 4
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 3
- CVJNXVLQSKPUGP-UHFFFAOYSA-N 2-imidazol-1-yl-1-phenylethanone Chemical compound C=1C=CC=CC=1C(=O)CN1C=CN=C1 CVJNXVLQSKPUGP-UHFFFAOYSA-N 0.000 description 3
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 235000011941 Tilia x europaea Nutrition 0.000 description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000002270 dispersing agent Substances 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 239000004571 lime Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 150000002790 naphthalenes Chemical class 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 description 3
- 239000012279 sodium borohydride Substances 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- WUHGMWIWIMMDKW-UHFFFAOYSA-N 1-(4-fluorophenyl)-2-imidazol-1-ylethanone Chemical compound C1=CC(F)=CC=C1C(=O)CN1C=NC=C1 WUHGMWIWIMMDKW-UHFFFAOYSA-N 0.000 description 2
- ZDPAWHACYDRYIW-UHFFFAOYSA-N 1-(4-fluorophenyl)ethanone Chemical compound CC(=O)C1=CC=C(F)C=C1 ZDPAWHACYDRYIW-UHFFFAOYSA-N 0.000 description 2
- UHXOPEQREFAOFO-UHFFFAOYSA-N 2-(5-chlorothiophen-2-yl)acetyl bromide Chemical compound ClC1=CC=C(S1)CC(=O)Br UHXOPEQREFAOFO-UHFFFAOYSA-N 0.000 description 2
- FNKRZIYNMUJMHA-UHFFFAOYSA-N 2-(bromomethyl)-2-(4-chlorophenyl)-4-methyl-1,3-dioxolane Chemical compound BrCC1(OCC(O1)C)C1=CC=C(C=C1)Cl FNKRZIYNMUJMHA-UHFFFAOYSA-N 0.000 description 2
- WYJOVVXUZNRJQY-UHFFFAOYSA-N 2-Acetylthiophene Chemical compound CC(=O)C1=CC=CS1 WYJOVVXUZNRJQY-UHFFFAOYSA-N 0.000 description 2
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 2
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- 125000005036 alkoxyphenyl group Chemical group 0.000 description 2
- 238000005576 amination reaction Methods 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 125000005997 bromomethyl group Chemical group 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000001408 fungistatic effect Effects 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 208000015181 infectious disease Diseases 0.000 description 2
- 238000011081 inoculation Methods 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 239000000575 pesticide Substances 0.000 description 2
- LIGACIXOYTUXAW-UHFFFAOYSA-N phenacyl bromide Chemical compound BrCC(=O)C1=CC=CC=C1 LIGACIXOYTUXAW-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000006268 reductive amination reaction Methods 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N thiocyanic acid Chemical compound SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 239000002023 wood Substances 0.000 description 2
- XINQFOMFQFGGCQ-UHFFFAOYSA-L (2-dodecoxy-2-oxoethyl)-[6-[(2-dodecoxy-2-oxoethyl)-dimethylazaniumyl]hexyl]-dimethylazanium;dichloride Chemical compound [Cl-].[Cl-].CCCCCCCCCCCCOC(=O)C[N+](C)(C)CCCCCC[N+](C)(C)CC(=O)OCCCCCCCCCCCC XINQFOMFQFGGCQ-UHFFFAOYSA-L 0.000 description 1
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- FMCAFXHLMUOIGG-IWFBPKFRSA-N (2s)-2-[[(2s)-2-[[(2s)-2-[[(2r)-2-formamido-3-sulfanylpropanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxy-2,5-dimethylphenyl)propanoyl]amino]-4-methylsulfanylbutanoic acid Chemical compound O=CN[C@@H](CS)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(O)=O)CC1=CC(C)=C(O)C=C1C FMCAFXHLMUOIGG-IWFBPKFRSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- QSEPGCLJFUCIRC-UHFFFAOYSA-N 1,3-bis(1h-imidazol-2-yl)propan-2-one Chemical compound N=1C=CNC=1CC(=O)CC1=NC=CN1 QSEPGCLJFUCIRC-UHFFFAOYSA-N 0.000 description 1
- ZWVJLGSRDFLDDU-UHFFFAOYSA-N 1-(2-chlorophenyl)-2-imidazol-1-ylethanone Chemical compound ClC1=CC=CC=C1C(=O)CN1C=NC=C1 ZWVJLGSRDFLDDU-UHFFFAOYSA-N 0.000 description 1
- OIYLDDCLASRHEZ-UHFFFAOYSA-N 1-(5-chlorothiophen-2-yl)-2-(1h-imidazol-2-yl)ethanone Chemical compound S1C(Cl)=CC=C1C(=O)CC1=NC=CN1 OIYLDDCLASRHEZ-UHFFFAOYSA-N 0.000 description 1
- WLXGQMVCYPUOLM-UHFFFAOYSA-N 1-hydroxyethanesulfonic acid Chemical compound CC(O)S(O)(=O)=O WLXGQMVCYPUOLM-UHFFFAOYSA-N 0.000 description 1
- YRLFVDXWOHCNGN-UHFFFAOYSA-N 2-(bromomethyl)-2-thiophen-2-yl-1,3-dioxolane Chemical compound C=1C=CSC=1C1(CBr)OCCO1 YRLFVDXWOHCNGN-UHFFFAOYSA-N 0.000 description 1
- YXZGXAFUODARQY-UHFFFAOYSA-N 2-imidazol-1-yl-1-(4-methylphenyl)ethanone Chemical compound C1=CC(C)=CC=C1C(=O)CN1C=NC=C1 YXZGXAFUODARQY-UHFFFAOYSA-N 0.000 description 1
- BSMGLVDZZMBWQB-UHFFFAOYSA-N 2-methyl-1-phenylpropan-1-one Chemical compound CC(C)C(=O)C1=CC=CC=C1 BSMGLVDZZMBWQB-UHFFFAOYSA-N 0.000 description 1
- PKRSYEPBQPFNRB-UHFFFAOYSA-N 2-phenoxybenzoic acid Chemical compound OC(=O)C1=CC=CC=C1OC1=CC=CC=C1 PKRSYEPBQPFNRB-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- WUBBRNOQWQTFEX-UHFFFAOYSA-N 4-aminosalicylic acid Chemical compound NC1=CC=C(C(O)=O)C(O)=C1 WUBBRNOQWQTFEX-UHFFFAOYSA-N 0.000 description 1
- FCSKOFQQCWLGMV-UHFFFAOYSA-N 5-{5-[2-chloro-4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]pentyl}-3-methylisoxazole Chemical compound O1N=C(C)C=C1CCCCCOC1=CC=C(C=2OCCN=2)C=C1Cl FCSKOFQQCWLGMV-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241001225321 Aspergillus fumigatus Species 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 241000222122 Candida albicans Species 0.000 description 1
- 241000222178 Candida tropicalis Species 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- BXGJOUWYIUOCTR-UHFFFAOYSA-N Cl.ClC1=C(C=CC=C1)C(CN1C=NC=C1)=O Chemical compound Cl.ClC1=C(C=CC=C1)C(CN1C=NC=C1)=O BXGJOUWYIUOCTR-UHFFFAOYSA-N 0.000 description 1
- FKLJPTJMIBLJAV-UHFFFAOYSA-N Compound IV Chemical compound O1N=C(C)C=C1CCCCCCCOC1=CC=C(C=2OCCN=2)C=C1 FKLJPTJMIBLJAV-UHFFFAOYSA-N 0.000 description 1
- 201000007336 Cryptococcosis Diseases 0.000 description 1
- 241000221204 Cryptococcus neoformans Species 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000893980 Microsporum canis Species 0.000 description 1
- 241000235395 Mucor Species 0.000 description 1
- VIHYIVKEECZGOU-UHFFFAOYSA-N N-acetylimidazole Chemical compound CC(=O)N1C=CN=C1 VIHYIVKEECZGOU-UHFFFAOYSA-N 0.000 description 1
- BHHGXPLMPWCGHP-UHFFFAOYSA-N Phenethylamine Chemical compound NCCC1=CC=CC=C1 BHHGXPLMPWCGHP-UHFFFAOYSA-N 0.000 description 1
- BELBBZDIHDAJOR-UHFFFAOYSA-N Phenolsulfonephthalein Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2S(=O)(=O)O1 BELBBZDIHDAJOR-UHFFFAOYSA-N 0.000 description 1
- 241001531356 Phialophora verrucosa Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 241000233667 Saprolegnia Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 241001149963 Sporothrix schenckii Species 0.000 description 1
- 241000193996 Streptococcus pyogenes Species 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 241001045770 Trichophyton mentagrophytes Species 0.000 description 1
- 241000223229 Trichophyton rubrum Species 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 229960004909 aminosalicylic acid Drugs 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 229940091771 aspergillus fumigatus Drugs 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- SUMDYPCJJOFFON-UHFFFAOYSA-N beta-hydroxyethanesulfonic acid Natural products OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 230000001680 brushing effect Effects 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229940095731 candida albicans Drugs 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000007799 cork Substances 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000004802 cyanophenyl group Chemical group 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 230000004927 fusion Effects 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 238000005470 impregnation Methods 0.000 description 1
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000009965 odorless effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- 229960003531 phenolsulfonphthalein Drugs 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- KRIOVPPHQSLHCZ-UHFFFAOYSA-N propiophenone Chemical compound CCC(=O)C1=CC=CC=C1 KRIOVPPHQSLHCZ-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229940107700 pyruvic acid Drugs 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 229940078499 tricalcium phosphate Drugs 0.000 description 1
- 229910000391 tricalcium phosphate Inorganic materials 0.000 description 1
- 235000019731 tricalcium phosphate Nutrition 0.000 description 1
- PHYFQTYBJUILEZ-IUPFWZBJSA-N triolein Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC(OC(=O)CCCCCCC\C=C/CCCCCCCC)COC(=O)CCCCCCC\C=C/CCCCCCCC PHYFQTYBJUILEZ-IUPFWZBJSA-N 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/90—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/10—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings
- C07D317/14—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D317/16—Radicals substituted by halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/10—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings
- C07D317/14—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D317/18—Radicals substituted by singly bound oxygen or sulfur atoms
- C07D317/22—Radicals substituted by singly bound oxygen or sulfur atoms etherified
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/06—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US75372968A | 1968-08-19 | 1968-08-19 | |
| US84876769A | 1969-07-23 | 1969-07-23 | |
| CH1254269A CH511238A (fr) | 1968-08-19 | 1969-08-19 | Procédé de fabrication de dérivés d'imidazole |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH526553A true CH526553A (fr) | 1972-08-15 |
Family
ID=27115803
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1730370A CH526553A (fr) | 1968-08-19 | 1969-08-19 | Procédé de fabrication de dérivés d'imidazole |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US3717655A (enExample) |
| JP (2) | JPS5039664B1 (enExample) |
| AT (2) | AT296289B (enExample) |
| BE (1) | BE737575A (enExample) |
| BR (1) | BR6911658D0 (enExample) |
| CH (1) | CH526553A (enExample) |
| CS (3) | CS184771B2 (enExample) |
| DE (1) | DE1940388C3 (enExample) |
| DK (1) | DK135769B (enExample) |
| ES (3) | ES370593A1 (enExample) |
| FI (2) | FI52858C (enExample) |
| FR (1) | FR2015913A1 (enExample) |
| GB (1) | GB1244530A (enExample) |
| IE (1) | IE33297B1 (enExample) |
| IL (1) | IL32840A (enExample) |
| IT (1) | IT974527B (enExample) |
| LU (1) | LU59301A1 (enExample) |
| NL (1) | NL159662B (enExample) |
| NO (1) | NO126180B (enExample) |
| RO (1) | RO56625A (enExample) |
| SE (3) | SE395690B (enExample) |
| SU (1) | SU557755A3 (enExample) |
| YU (1) | YU34194B (enExample) |
Families Citing this family (139)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3658813A (en) * | 1970-01-13 | 1972-04-25 | Janssen Pharmaceutica Nv | 1-(beta-aryl-beta-(r-oxy)-ethyl)-imidazoles |
| DE2037610A1 (de) * | 1970-07-29 | 1972-02-03 | Bayer Ag | Neue alpha-substituierte Benzyl-azole, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel |
| DE2041771C3 (de) * | 1970-08-22 | 1979-07-26 | Bayer Ag, 5090 Leverkusen | derivate |
| US3892764A (en) * | 1970-08-22 | 1975-07-01 | Bayer Ag | Phenyl-imidazolyl-alkanyl derivatives, their production and use |
| DE2105490C3 (de) * | 1971-02-05 | 1979-06-13 | Bayer Ag, 5090 Leverkusen | 1 -Imidazolylketonderivate |
| DE2242454A1 (de) * | 1972-08-29 | 1974-03-07 | Bayer Ag | 1-aethyl-imidazole, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| DE2333354C2 (de) * | 1973-06-30 | 1983-12-15 | Bayer Ag, 5090 Leverkusen | 2-Aryloxy-2-(imidazol-1-yl)-äthanole sowie deren Salze, Verfahren zu ihrer Herstellung und ihre Verwendung als Fungizide |
| JPS5347105B2 (enExample) * | 1973-07-06 | 1978-12-19 | ||
| US3873539A (en) * | 1973-10-03 | 1975-03-25 | Sandoz Ag | Substituted-4-aminoacetyl alkanoylphenones |
| DE2350123C2 (de) * | 1973-10-05 | 1983-04-14 | Bayer Ag, 5090 Leverkusen | 1-Propyl-imidazol-Derivate und deren Salze, Verfahren zu ihrer Herstellung und ihre Verwendung als Fungizide |
| US3991202A (en) * | 1974-01-31 | 1976-11-09 | Janssen Pharmaceutica N.V. | Imidazolium salts |
| US3927017A (en) * | 1974-06-27 | 1975-12-16 | Janssen Pharmaceutica Nv | 1-({62 -Aryl-{62 -R-ethyl)imidazoles |
| DE2431407C2 (de) * | 1974-06-29 | 1982-12-02 | Bayer Ag, 5090 Leverkusen | 1,2,4-Triazol-1-yl-alkanone und -alkanole, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide |
| IL47885A (en) * | 1974-09-23 | 1979-01-31 | Syntex Inc | Imidazole derivatives,their preparation and antifungal and antibacterial compositions containing them |
| US4017631A (en) * | 1974-11-19 | 1977-04-12 | Janssen Pharmaceutica N.V. | Imidazolium salts |
| CA1065873A (en) * | 1975-01-27 | 1979-11-06 | Janssen Pharmaceutica Naamloze Vennootschap | Imidazole derivatives |
| US3936470A (en) * | 1975-01-27 | 1976-02-03 | Janssen Pharmaceutica N.V. | 1,3-Dioxolan-2-ylmethylimidazoles |
| GB1475271A (en) * | 1975-04-30 | 1977-06-01 | Pfizer Ltd | 1-aryl-2-1-imidazolyl-alkyl ethers and thioethers and their use as antifungal agents |
| US3949076A (en) * | 1975-05-29 | 1976-04-06 | Smithkline Corporation | N-(Heterocycl ic-alkyl)-9-xanthenylamines |
| US4055652A (en) * | 1975-07-07 | 1977-10-25 | Syntex (U.S.A.) Inc. | 1-[β(R-thio)phenethyl]imidazoles and derivatives thereof |
| US4045568A (en) * | 1975-07-28 | 1977-08-30 | Syntex (U.S.A.) Inc. | Derivatives of substituted N-alkyl imidazoles |
| MX3866E (es) * | 1975-07-28 | 1981-08-26 | Syntex Inc | Metodo mejorado para preparar derivados de imidazoles n-alquil sustituidos |
| US4078071A (en) * | 1976-03-08 | 1978-03-07 | Syntex (U.S.A.) Inc. | Derivatives of substituted N-alkyl imidazoles |
| US4079143A (en) * | 1975-08-26 | 1978-03-14 | Imperial Chemical Industries Limited | Fungicidal 1H-1,2,4-triazoles |
| NZ181916A (en) * | 1975-09-10 | 1979-01-11 | Ici Ltd | 1-substituted-1,2,4-triazoles and fungicidal compositions |
| US4101665A (en) * | 1975-10-06 | 1978-07-18 | Janssen Pharmaceutica N.V. | 1-(2-Ar-4-aryloxymethyl-1,3-dioxolan-2-ylmethyl)imidazoles |
| DE2547953A1 (de) * | 1975-10-27 | 1977-04-28 | Bayer Ag | (1-phenyl-2-triazolyl-aethyl)-aether- derivate, verfahren zu ihrer herstellung und ihre verwendung als fungizide |
| IE44186B1 (en) * | 1975-12-03 | 1981-09-09 | Ici Ltd | 1,2,4-triazolyl alkanols and their use as pesticides |
| GB1511390A (en) * | 1975-12-04 | 1978-05-17 | Pfizer Ltd | Imidazolylalkyl sulphide antifungal agents |
| US4038409A (en) * | 1976-03-01 | 1977-07-26 | Syntex (U.S.A.) Inc. | 1-phenethylimidazoles |
| US4039677A (en) * | 1976-03-01 | 1977-08-02 | Syntex (U.S.A.) Inc. | Novel 1-phenethylimidazoles |
| US4172141A (en) * | 1976-03-17 | 1979-10-23 | Syntex (U.S.A.) Inc. | N-(naphthylethyl)imidazole derivatives |
| DE2623129C3 (de) * | 1976-05-22 | 1980-04-10 | Nordmark-Werke Gmbh, 2000 Hamburg | U-Diphenyl-3-(imidazol-l-yl) -propan-2-ole, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel |
| DE2628421A1 (de) * | 1976-06-24 | 1978-01-05 | Bayer Ag | Antimikrobielle mittel |
| AU515134B2 (en) * | 1976-08-10 | 1981-03-19 | Janssen Pharmaceutica N.V. | 1-(2-aryl-2-r-ethyl)-1h-1,2,4-triazoles |
| IE45765B1 (en) * | 1976-08-19 | 1982-11-17 | Ici Ltd | Triazoles and imidazoles useful as plant fungicides and growth regulating agents |
| GB1567431A (en) * | 1977-01-10 | 1980-05-14 | Syntex Inc | 1-(2-(halophenylthio)-4-(p-chloro- or-flrorophenyl)-n-butyl) imidazoles |
| US4123542A (en) * | 1977-01-19 | 1978-10-31 | Syntex (U.S.A.) Inc. | Derivatives of N-alkyl imidazoles |
| US4598085A (en) * | 1977-04-27 | 1986-07-01 | Janssen Pharmaceutica N.V. | Fungicidal 1-(2-aryl-2-R-ethyl)-1H-1,2,4-triazoles |
| US4413003A (en) | 1977-07-29 | 1983-11-01 | Rohm And Haas Company | β-Hydroxyarylethylimidazoles |
| DE2860862D1 (en) * | 1977-10-13 | 1981-10-29 | Siegfried Ag | Imidazolylethylene-oxyalkyloxy derivatives and their thio analogues, methods for their preparation and pharmaceutical compositions containing them |
| IT1096361B (it) * | 1978-05-18 | 1985-08-26 | Recordati Chem Pharm | Dibenzileteri sostituiti terapeuticamente attivi |
| IL57440A0 (en) * | 1978-06-12 | 1979-09-30 | Erba Farmitalia | N-phenethylimidazole derivatives and process for their preparation |
| US4159380A (en) * | 1978-07-10 | 1979-06-26 | E. R. Squibb & Sons, Inc. | Imidazolylethoxy derivatives of pyrazolo[3,4-b]pyridine-5-methanols |
| US4215220A (en) * | 1978-09-11 | 1980-07-29 | Cilag-Chemie A.G. | 1-(2-Oxysubstituted-3-anilinopropyl)-imidazoles |
| US4272545A (en) * | 1979-02-02 | 1981-06-09 | Syntex (U.S.A.) Inc. | Derivatives of thienyl- and furyl-substituted N-butyl and N-phenyl imidazoles |
| US4221803A (en) * | 1979-05-09 | 1980-09-09 | Recordati, S.A. | Substituted dibenzyl ethers and pharmaceutical compositions containing said ethers for the treatment of infections |
| EP0023103A1 (en) * | 1979-07-04 | 1981-01-28 | Pfizer Limited | Antifungal imidazole derivatives, process for their preparation and pharmaceutical compositions thereof |
| DE3042303A1 (de) * | 1979-11-13 | 1981-08-27 | Sandoz-Patent-GmbH, 7850 Lörrach | Organische verbindungen, deren herstellung und verwendung |
| US4282230A (en) * | 1979-11-15 | 1981-08-04 | E. R. Squibb & Sons, Inc. | Imidazolylethoxy derivatives of quinoline-2- or 4-methanols, antimicrobial compositions containing them and method for treating bacterial or fungal infections with them |
| DE2946957A1 (de) * | 1979-11-21 | 1981-06-04 | Bayer Ag, 5090 Leverkusen | Antimikrobielle mittel |
| US4248881A (en) * | 1979-12-20 | 1981-02-03 | E. R. Squibb & Sons, Inc. | Imidazolylethoxymethyl derivatives of pyrazole |
| NZ196075A (en) * | 1980-02-04 | 1982-12-07 | Janssen Pharmaceutica Nv | Agent to protect wood coatings and detergents from micro-organisms using a triazole |
| US4458079A (en) * | 1980-08-08 | 1984-07-03 | Bristol-Myers Company | Sulfur-containing imidazoles |
| CA1189857A (en) * | 1981-03-27 | 1985-07-02 | Janssen Pharmaceutica Naamloze Vennootschap | Antimicrobial triazole derivatives |
| JPS5815909A (ja) * | 1981-07-22 | 1983-01-29 | Toko Yakuhin Kogyo Kk | 抗真菌外用剤 |
| DE3208194A1 (de) * | 1982-03-06 | 1983-09-08 | Bayer Ag, 5090 Leverkusen | Substituierte azolylethyl-oximinoalkyl-ether, verfahren zu ihrer herstellung und ihre verwendung als fungizide |
| AT376436B (de) * | 1982-11-05 | 1984-11-26 | Laevosan Gmbh & Co Kg | Verfahren zur herstellung neuer thiophen-2carbons[urederivate und pharmazeutisch vertraeglicher saeure- oder basenadditionssalze davon |
| DE3307218A1 (de) * | 1983-03-02 | 1984-09-06 | Bayer Ag, 5090 Leverkusen | Substituierte diazolylalkyl-carbinole, verfahren zu ihrer herstellung und ihre verwendung als antimykotische mittel |
| CH655103A5 (de) * | 1983-03-11 | 1986-03-27 | Sandoz Ag | Azolderivate, verfahren zu ihrer herstellung und ihre verwendung. |
| US4518607A (en) * | 1983-07-18 | 1985-05-21 | Syntex (U.S.A.) Inc. | Male oral contraceptive N-alkylimidazole derivatives, compositions, and method of use therefor |
| DE3401694A1 (de) * | 1984-01-19 | 1985-07-25 | Basf Ag, 6700 Ludwigshafen | Azolylmethylcycloacetale, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel |
| CA1250586A (en) * | 1984-02-02 | 1989-02-28 | Manuel Raga | 1h-imidazole derivatives and process for their production |
| CA1241602A (en) * | 1984-02-23 | 1988-09-06 | Ortho Pharmaceutical Corporation | Antifungal aerosol solution |
| US4912124A (en) * | 1984-02-23 | 1990-03-27 | Ortho Pharmaceutical Corporation | Antifungal dermatological solution |
| DE3413365A1 (de) * | 1984-04-09 | 1985-12-19 | Merz + Co GmbH & Co, 6000 Frankfurt | Substituierte phenylethylderivate, verfahren zu ihrer herstellung und pharmazeutische mittel |
| JPS61130272A (ja) * | 1984-11-30 | 1986-06-18 | Nippon Tokushu Noyaku Seizo Kk | β―置換アミノ―フェネチルアゾール誘導体、その製法及び農園芸用殺菌剤 |
| DK8503352A (enExample) * | 1985-09-05 | 1987-01-24 | ||
| DE3644616A1 (de) * | 1986-12-29 | 1988-07-07 | Lentia Gmbh | Imidazolderivate, verfahren zur herstellung und deren verwendung |
| DE3644615A1 (de) * | 1986-12-29 | 1988-07-07 | Lentia Gmbh | Imidazol- und triazolderivate zur verwendung als antimykotische mittel |
| NZ229783A (en) * | 1988-07-22 | 1990-12-21 | Cl Pharma | Allylaminoethylazoles; fungicidal and antimycotic compositions, methods for preparation and combating fungi |
| DE3932552A1 (de) * | 1989-09-29 | 1991-04-11 | Basf Ag | Verfahren zur herstellung von 1-hydroxyimidazol |
| GB9127304D0 (en) * | 1991-12-23 | 1992-02-19 | Boots Co Plc | Therapeutic agents |
| GB9226581D0 (en) * | 1992-12-21 | 1993-02-17 | Merck Sharp & Dohme | Therapeutic agents |
| GB9312893D0 (en) * | 1993-06-22 | 1993-08-04 | Boots Co Plc | Therapeutic agents |
| JP2875140B2 (ja) * | 1993-08-16 | 1999-03-24 | 明治製菓株式会社 | 抗mrsa組成物 |
| US5461068A (en) * | 1993-09-29 | 1995-10-24 | Corwood Laboratories, Inc. | Imidazole derivative tincture and method of manufacture |
| ATE199215T1 (de) * | 1993-12-23 | 2001-03-15 | Procter & Gamble | Antimikrobielle zusammensetzungen für abwischtücher |
| EP0735861A1 (en) * | 1993-12-23 | 1996-10-09 | The Procter & Gamble Company | Tissue moisturizing and antimicrobial compositions |
| US5565478A (en) * | 1994-03-14 | 1996-10-15 | The United States Of America As Represented By The Department Of Health & Human Services | Combination therapy using signal transduction inhibitors with paclitaxel and other taxane analogs |
| US5591726A (en) * | 1994-09-26 | 1997-01-07 | American Cyanamid Company | Heterocyclylalkyl diarylboron ester and thioester fungicidal agents |
| WO1997036886A1 (en) * | 1996-04-03 | 1997-10-09 | Merck & Co., Inc. | Inhibitors of farnesyl-protein transferase |
| PT1140857E (pt) | 1998-12-23 | 2008-10-06 | Maxim Pharm Inc | Síntese de dicloridrato de histamina |
| US6080744A (en) * | 1999-02-10 | 2000-06-27 | Ayon-Covarrubias; Blas | Topical antifungal treatment |
| US6793678B2 (en) | 2002-06-27 | 2004-09-21 | Depuy Acromed, Inc. | Prosthetic intervertebral motion disc having dampening |
| DE60317691T2 (de) * | 2002-08-09 | 2008-10-30 | Central Glass Co., Ltd., Ube | Verfahren zur herstellung von trifluormethylsubstituierten 2-alkoxyacetophenonderivaten |
| CA2515862A1 (en) | 2003-02-14 | 2004-09-02 | Depuy Spine, Inc. | In-situ formed intervertebral fusion device |
| US20040267367A1 (en) | 2003-06-30 | 2004-12-30 | Depuy Acromed, Inc | Intervertebral implant with conformable endplate |
| US20050250709A1 (en) * | 2003-12-19 | 2005-11-10 | Bionaut Pharmaceuticals | Anti-neoplastic agents, combination therapies and related methods |
| US20080027010A1 (en) * | 2004-09-02 | 2008-01-31 | Bionaut Pharmaceuticals, Inc. | Treatment of refractory cancers using Na+/K+-ATPase inhibitors |
| US20070105790A1 (en) * | 2004-09-02 | 2007-05-10 | Bionaut Pharmaceuticals, Inc. | Pancreatic cancer treatment using Na+/K+ ATPase inhibitors |
| US20060135441A1 (en) * | 2004-09-02 | 2006-06-22 | Bionaut Pharmaceuticals, Inc. | Combinatorial chemotherapy treatment using Na+/K+ ATPase inhibitors |
| WO2006028969A1 (en) * | 2004-09-02 | 2006-03-16 | Bionaut Pharmaceuticals, Inc. | Pancreatic cancer treatment using na+/k+ atpase inhibitors |
| US20060135468A1 (en) * | 2004-09-02 | 2006-06-22 | Bionaut Pharmaceuticals, Inc. | Treatment of refractory cancers using NA+/K+ ATPase inhibitors |
| WO2006044916A2 (en) * | 2004-10-18 | 2006-04-27 | Bionaut Pharmaceuticals, Inc. | Use of na+/ k+-atpase inhibitors and antagonists thereof |
| US8034110B2 (en) | 2006-07-31 | 2011-10-11 | Depuy Spine, Inc. | Spinal fusion implant |
| JP2010510248A (ja) * | 2006-11-21 | 2010-04-02 | ビアメト ファーマシューティカルズ,インク. | 金属結合部分をターゲティング部分と組み合わせて使用する金属酸化還元酵素阻害剤 |
| WO2008070863A2 (en) | 2006-12-07 | 2008-06-12 | Interventional Spine, Inc. | Intervertebral implant |
| US8900307B2 (en) | 2007-06-26 | 2014-12-02 | DePuy Synthes Products, LLC | Highly lordosed fusion cage |
| AU2009205896A1 (en) | 2008-01-17 | 2009-07-23 | Synthes Gmbh | An expandable intervertebral implant and associated method of manufacturing the same |
| KR20110003475A (ko) | 2008-04-05 | 2011-01-12 | 신세스 게엠바하 | 팽창성 추간 임플란트 |
| AR072297A1 (es) * | 2008-06-27 | 2010-08-18 | Novartis Ag | Derivados de indol-2-il-piridin-3-ilo, composicion farmaceutica que los comprende y su uso en medicamentos para el tratamiento de enfermedades mediadas por la sintasa aldosterona. |
| US9526620B2 (en) | 2009-03-30 | 2016-12-27 | DePuy Synthes Products, Inc. | Zero profile spinal fusion cage |
| BRPI0904249B1 (pt) * | 2009-08-28 | 2018-03-06 | Biolab Sanus Farmacêutica Ltda. | Compostos éteres aralquil benzílicos, processo de preparação dos mesmos, uso dos referidos compostos, composição farmacêutica |
| US9168138B2 (en) | 2009-12-09 | 2015-10-27 | DePuy Synthes Products, Inc. | Aspirating implants and method of bony regeneration |
| US9393129B2 (en) | 2009-12-10 | 2016-07-19 | DePuy Synthes Products, Inc. | Bellows-like expandable interbody fusion cage |
| US8979860B2 (en) | 2010-06-24 | 2015-03-17 | DePuy Synthes Products. LLC | Enhanced cage insertion device |
| US9592063B2 (en) | 2010-06-24 | 2017-03-14 | DePuy Synthes Products, Inc. | Universal trial for lateral cages |
| TW201215379A (en) | 2010-06-29 | 2012-04-16 | Synthes Gmbh | Distractible intervertebral implant |
| TWI579007B (zh) | 2010-07-02 | 2017-04-21 | 艾格諾福斯保健公司 | 骨再生材料之用途 |
| US9402732B2 (en) | 2010-10-11 | 2016-08-02 | DePuy Synthes Products, Inc. | Expandable interspinous process spacer implant |
| EP2551351A1 (en) | 2011-07-29 | 2013-01-30 | Interquim, S.A. | Process for production of optically active (R)-(-)-1-(2,4-dichloro-phenyl)-2-imidazole-1-yl-ethanol |
| US9717601B2 (en) | 2013-02-28 | 2017-08-01 | DePuy Synthes Products, Inc. | Expandable intervertebral implant, system, kit and method |
| US9522070B2 (en) | 2013-03-07 | 2016-12-20 | Interventional Spine, Inc. | Intervertebral implant |
| TWI651103B (zh) | 2013-12-13 | 2019-02-21 | 萊特醫技股份有限公司 | 多相骨移植替代材料 |
| US11426290B2 (en) | 2015-03-06 | 2022-08-30 | DePuy Synthes Products, Inc. | Expandable intervertebral implant, system, kit and method |
| US11596523B2 (en) | 2016-06-28 | 2023-03-07 | Eit Emerging Implant Technologies Gmbh | Expandable and angularly adjustable articulating intervertebral cages |
| CN109688981A (zh) | 2016-06-28 | 2019-04-26 | Eit 新兴移植技术股份有限公司 | 可扩张的、角度可调整的椎间笼 |
| EP3519390A1 (en) | 2016-09-29 | 2019-08-07 | Bayer CropScience Aktiengesellschaft | 1,5-substituted imidazole derivatives as fungicides for crop protection. |
| EP3519408A1 (en) | 2016-09-29 | 2019-08-07 | Bayer CropScience Aktiengesellschaft | 1 -[2-(1 -chlorocyclopropyl)-2-hydroxy-3-(3-phenyl-1,2-oxazol-5-yl)propyl]-1h-imidazole-5-carbonitrile derivatives and related compounds as fungicides for crop protection |
| BR112019006445A2 (pt) | 2016-09-29 | 2019-10-01 | Bayer Ag | novos derivados de 5-imidazolilmetil substituídos |
| MX2019003712A (es) | 2016-09-29 | 2019-06-24 | Bayer Cropscience Ag | Novedosos derivados de imidazolilmetildioxolano 5-sustituidos. |
| EP3519391A1 (en) | 2016-09-29 | 2019-08-07 | Bayer CropScience Aktiengesellschaft | Novel 5-substituted imidazolylmethyl derivatives |
| AU2017363973B2 (en) * | 2016-11-28 | 2022-03-03 | Cellix Bio Private Limited | Compositions and methods for the treatment of oral infectious diseases |
| IL287621B (en) * | 2016-11-28 | 2022-07-01 | Cellix Bio Private Ltd | Preparations and methods for treating fungal infections |
| US10888433B2 (en) | 2016-12-14 | 2021-01-12 | DePuy Synthes Products, Inc. | Intervertebral implant inserter and related methods |
| EP3558304A2 (en) | 2016-12-23 | 2019-10-30 | Helmholtz Zentrum München - Deutsches Forschungszentrum für Gesundheit und Umwelt (GmbH) | Inhibitors of cytochrome p450 family 7 subfamily b member 1 (cyp7b1) for use in treating diseases |
| US10398563B2 (en) | 2017-05-08 | 2019-09-03 | Medos International Sarl | Expandable cage |
| US11344424B2 (en) | 2017-06-14 | 2022-05-31 | Medos International Sarl | Expandable intervertebral implant and related methods |
| US10940016B2 (en) | 2017-07-05 | 2021-03-09 | Medos International Sarl | Expandable intervertebral fusion cage |
| CN108047147A (zh) * | 2017-12-08 | 2018-05-18 | 长江大学 | 一类三唑类化合物以及作为杀菌剂的用途 |
| CN109320458B (zh) * | 2018-10-12 | 2022-05-31 | 中国药科大学 | 一类含二芳基咪唑类化合物及其制备方法和医药用途 |
| US11446156B2 (en) | 2018-10-25 | 2022-09-20 | Medos International Sarl | Expandable intervertebral implant, inserter instrument, and related methods |
| EP4013405A4 (en) * | 2019-08-16 | 2023-08-09 | Purdue Research Foundation | SMALL MOLECULAR STIMULATORS OF THE NUCLEAR PARTICLE OF A PROTEASOME |
| CN115461093A (zh) | 2020-01-31 | 2022-12-09 | 瑞特医疗技术公司 | 改进的骨移植替代配制物 |
| US11426286B2 (en) | 2020-03-06 | 2022-08-30 | Eit Emerging Implant Technologies Gmbh | Expandable intervertebral implant |
| US11850160B2 (en) | 2021-03-26 | 2023-12-26 | Medos International Sarl | Expandable lordotic intervertebral fusion cage |
| US11752009B2 (en) | 2021-04-06 | 2023-09-12 | Medos International Sarl | Expandable intervertebral fusion cage |
| US12090064B2 (en) | 2022-03-01 | 2024-09-17 | Medos International Sarl | Stabilization members for expandable intervertebral implants, and related systems and methods |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1486817A (fr) * | 1965-07-22 | 1967-06-30 | Basf Ag | Insecticides |
-
1968
- 1968-08-19 SU SU1365544A patent/SU557755A3/ru active
-
1969
- 1969-07-23 US US00848767A patent/US3717655A/en not_active Expired - Lifetime
- 1969-08-08 DE DE1940388A patent/DE1940388C3/de not_active Expired
- 1969-08-13 SE SE7300408A patent/SE395690B/xx unknown
- 1969-08-13 SE SE11255/69A patent/SE363330B/xx unknown
- 1969-08-13 NL NL6912331.A patent/NL159662B/xx not_active IP Right Cessation
- 1969-08-13 SE SE7300409A patent/SE394432B/xx unknown
- 1969-08-18 YU YU212669A patent/YU34194B/xx unknown
- 1969-08-18 AT AT1089170A patent/AT296289B/de active
- 1969-08-18 LU LU59301D patent/LU59301A1/xx unknown
- 1969-08-18 FI FI692401A patent/FI52858C/fi active
- 1969-08-18 ES ES370593A patent/ES370593A1/es not_active Expired
- 1969-08-18 IL IL32840A patent/IL32840A/xx unknown
- 1969-08-18 IT IT39438/69A patent/IT974527B/it active
- 1969-08-18 FR FR6928273A patent/FR2015913A1/fr active Pending
- 1969-08-18 NO NO03340/69A patent/NO126180B/no unknown
- 1969-08-18 AT AT791269A patent/AT291249B/de not_active IP Right Cessation
- 1969-08-18 BE BE737575D patent/BE737575A/xx not_active IP Right Cessation
- 1969-08-19 CS CS7400007400A patent/CS184771B2/cs unknown
- 1969-08-19 CS CS6900005725A patent/CS184753B2/cs unknown
- 1969-08-19 JP JP44065607A patent/JPS5039664B1/ja active Pending
- 1969-08-19 GB GB41391/69A patent/GB1244530A/en not_active Expired
- 1969-08-19 CH CH1730370A patent/CH526553A/fr not_active IP Right Cessation
- 1969-08-19 DK DK442069AA patent/DK135769B/da not_active IP Right Cessation
- 1969-08-19 RO RO60831A patent/RO56625A/ro unknown
- 1969-08-19 CS CS7400007401A patent/CS184772B2/cs unknown
- 1969-08-19 IE IE1179/69A patent/IE33297B1/xx unknown
- 1969-08-19 BR BR211658/69A patent/BR6911658D0/pt unknown
-
1971
- 1971-04-30 ES ES390807A patent/ES390807A1/es not_active Expired
- 1971-07-10 ES ES393167A patent/ES393167A2/es not_active Expired
-
1972
- 1972-05-22 JP JP47050648A patent/JPS51115B1/ja active Pending
-
1975
- 1975-06-25 FI FI751886A patent/FI55434C/fi not_active IP Right Cessation
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH526553A (fr) | Procédé de fabrication de dérivés d'imidazole | |
| EP0113640B1 (de) | 1-Azolyl-2-aryl-3-fluoralkan-2-ole als Mikrobizide | |
| LU85066A1 (fr) | Nouveaux derives de ethanol,leur preparation et leur utilisation comme fongicides | |
| EP0011769B1 (de) | Hydroxyethyl-azole, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel | |
| LU85237A1 (fr) | Nouveaux derives de l'ethanol,leur preparation et leur utilisation comme fongicides | |
| US3991201A (en) | 1-(β-Aryl-β-R-ethyl)imidazoles as antimicrobial agents | |
| FR2458545A1 (fr) | Procede de preparation de derives de benzylimidazole, nouveaux produits ainsi obtenus, et leur utilisation pour leurs activites antimycotique et fongicide | |
| MC1170A1 (fr) | Composes heterocycliques | |
| EP0237962A2 (de) | 2-Azolylmethyl-2-aryl-1,3-dioxolane und deren Salze, Verfahren zu ihrer Herstellung, sie enthaltende Mittel und ihre Verwendung | |
| US3991202A (en) | Imidazolium salts | |
| CH644348A5 (fr) | Amino-ethers oxydes, leur procede de preparation et medicament les contenant. | |
| LU85551A1 (fr) | Nouveaux composes azoliques,leur preparation et leur utilisation comme antifongiques et fongicides | |
| HU179414B (en) | Process for producing hydroxy-propyl-triasole derivatives and pharmaceutical compositions containing them as active agents | |
| PT100942B (pt) | Agentes antifungicos de triazole, processo para a sua preparacao e composicoes farmaceuticas que os contem | |
| FR2551438A1 (fr) | Nouveaux derives de l'ethanol, leur preparation et leur utilisation comme fongicides | |
| EP0019131B1 (de) | Fluorierte 1-Triazolyl-butan-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Fungizide | |
| JPS62201849A (ja) | ベンジルアミン誘導体、その製造法およびその用途 | |
| EP0005250A2 (de) | Hydroxypropyl-imidazole, Verfahren zu ihrer Herstellung sowie diese enthaltende Arzneimittel | |
| US4017631A (en) | Imidazolium salts | |
| EP0011770B1 (de) | Fluorenyl-azolylmethyl-carbinole, Verfahren zu ihrer Herstellung, Arzneimittel, die diese Verbindungen enthalten und Verfahren zur Herstellung dieser Arzneimittel | |
| JPS6030673B2 (ja) | 抗かび活性を有するエテニルイミダゾ−ル誘導体、その製造法、およびそれを含む製薬組成物その製造に有用な中間物、およびこの中間物の製造法 | |
| DE3609597A1 (de) | 2-azolylmethyl-2-aryl-1,3-dioxolane und deren salze, verfahren zu ihrer herstellung, sie enthaltende mittel und ihre verwendung | |
| EP0220112B1 (fr) | Dérivés aromatiques substitués par un groupement (oméga-amino) alcanol à activité antimicrobienne, leur préparation et les compositions les contenant | |
| CH639075A5 (fr) | Ethers dibenzyliques substitues actifs sur le plan therapeutique. | |
| CH511238A (fr) | Procédé de fabrication de dérivés d'imidazole |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |