CH451371A - Verfahren zur Herstellung von Gemischen wasserunlöslicher Anthrachinonfarbstoffe - Google Patents
Verfahren zur Herstellung von Gemischen wasserunlöslicher AnthrachinonfarbstoffeInfo
- Publication number
- CH451371A CH451371A CH1371164A CH1371164A CH451371A CH 451371 A CH451371 A CH 451371A CH 1371164 A CH1371164 A CH 1371164A CH 1371164 A CH1371164 A CH 1371164A CH 451371 A CH451371 A CH 451371A
- Authority
- CH
- Switzerland
- Prior art keywords
- parts
- water
- anthraquinone
- mixture
- dihydroxy
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 41
- 238000000034 method Methods 0.000 title claims description 12
- 238000002360 preparation method Methods 0.000 title claims description 4
- 239000001000 anthraquinone dye Substances 0.000 title description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 45
- -1 anthraquinone compound Chemical class 0.000 claims description 34
- 239000000975 dye Substances 0.000 claims description 27
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 claims description 7
- NOGFHTGYPKWWRX-UHFFFAOYSA-N 2,2,6,6-tetramethyloxan-4-one Chemical compound CC1(C)CC(=O)CC(C)(C)O1 NOGFHTGYPKWWRX-UHFFFAOYSA-N 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 150000001875 compounds Chemical class 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- 150000005840 aryl radicals Chemical class 0.000 claims description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 claims description 2
- 150000008065 acid anhydrides Chemical class 0.000 claims description 2
- 125000001931 aliphatic group Chemical group 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 48
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 31
- 239000000047 product Substances 0.000 description 28
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 24
- 229920000139 polyethylene terephthalate Polymers 0.000 description 17
- 239000005020 polyethylene terephthalate Substances 0.000 description 17
- 150000008064 anhydrides Chemical class 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- MOLVDYADKVCUCB-UHFFFAOYSA-N 4,8-diamino-1,5-dihydroxy-2-(4-hydroxyphenyl)anthracene-9,10-dione Chemical compound OC1=C2C(=O)C=3C(N)=CC=C(O)C=3C(=O)C2=C(N)C=C1C1=CC=C(O)C=C1 MOLVDYADKVCUCB-UHFFFAOYSA-N 0.000 description 7
- 239000000463 material Substances 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 239000003086 colorant Substances 0.000 description 6
- 239000002270 dispersing agent Substances 0.000 description 6
- 230000010933 acylation Effects 0.000 description 5
- 238000005917 acylation reaction Methods 0.000 description 5
- 238000000227 grinding Methods 0.000 description 5
- 239000011343 solid material Substances 0.000 description 5
- 239000012065 filter cake Substances 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 238000000859 sublimation Methods 0.000 description 4
- 230000008022 sublimation Effects 0.000 description 4
- 239000004753 textile Substances 0.000 description 4
- 238000005406 washing Methods 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 239000004698 Polyethylene Substances 0.000 description 3
- UTKGUAAJNFVYMR-UHFFFAOYSA-N [4-(4,8-diamino-1,5-dihydroxy-9,10-dioxoanthracen-2-yl)phenyl] benzoate Chemical compound OC1=C2C(=O)C=3C(N)=CC=C(O)C=3C(=O)C2=C(N)C=C1C(C=C1)=CC=C1OC(=O)C1=CC=CC=C1 UTKGUAAJNFVYMR-UHFFFAOYSA-N 0.000 description 3
- 150000004056 anthraquinones Chemical class 0.000 description 3
- 238000004043 dyeing Methods 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 229920000573 polyethylene Polymers 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- ILJSQTXMGCGYMG-UHFFFAOYSA-N triacetic acid Chemical compound CC(=O)CC(=O)CC(O)=O ILJSQTXMGCGYMG-UHFFFAOYSA-N 0.000 description 3
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- 229920002284 Cellulose triacetate Polymers 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- 125000003047 N-acetyl group Chemical group 0.000 description 2
- NNLVGZFZQQXQNW-ADJNRHBOSA-N [(2r,3r,4s,5r,6s)-4,5-diacetyloxy-3-[(2s,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6s)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@H]1[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)OC(C)=O)COC(=O)C)[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O NNLVGZFZQQXQNW-ADJNRHBOSA-N 0.000 description 2
- ODMIJAPLDKMEPD-UHFFFAOYSA-N [4-(4,8-diamino-1,5-dihydroxy-9,10-dioxoanthracen-2-yl)phenyl] acetate Chemical compound C1=CC(OC(=O)C)=CC=C1C1=CC(N)=C(C(=O)C=2C(=C(N)C=CC=2O)C2=O)C2=C1O ODMIJAPLDKMEPD-UHFFFAOYSA-N 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- YHASWHZGWUONAO-UHFFFAOYSA-N butanoyl butanoate Chemical compound CCCC(=O)OC(=O)CCC YHASWHZGWUONAO-UHFFFAOYSA-N 0.000 description 2
- 229920002301 cellulose acetate Polymers 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- NZNMSOFKMUBTKW-UHFFFAOYSA-N cyclohexanecarboxylic acid Chemical compound OC(=O)C1CCCCC1 NZNMSOFKMUBTKW-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- LSACYLWPPQLVSM-UHFFFAOYSA-N isobutyric acid anhydride Chemical compound CC(C)C(=O)OC(=O)C(C)C LSACYLWPPQLVSM-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- LCPDWSOZIOUXRV-UHFFFAOYSA-N phenoxyacetic acid Chemical compound OC(=O)COC1=CC=CC=C1 LCPDWSOZIOUXRV-UHFFFAOYSA-N 0.000 description 2
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- WFZFMHDDZRBTFH-CZEFNJPISA-N 2-[(e)-2-(5-carbamimidoyl-1-benzofuran-2-yl)ethenyl]-1-benzofuran-5-carboximidamide;dihydrochloride Chemical compound Cl.Cl.NC(=N)C1=CC=C2OC(/C=C/C=3OC4=CC=C(C=C4C=3)C(=N)N)=CC2=C1 WFZFMHDDZRBTFH-CZEFNJPISA-N 0.000 description 1
- VMZCDNSFRSVYKQ-UHFFFAOYSA-N 2-phenylacetyl chloride Chemical compound ClC(=O)CC1=CC=CC=C1 VMZCDNSFRSVYKQ-UHFFFAOYSA-N 0.000 description 1
- ALRHLSYJTWAHJZ-UHFFFAOYSA-N 3-hydroxypropionic acid Chemical compound OCCC(O)=O ALRHLSYJTWAHJZ-UHFFFAOYSA-N 0.000 description 1
- DXPPIPWXPIZBTD-UHFFFAOYSA-N 4,8-diamino-2-(5-cyclohexyl-2-hydroxyphenyl)-1,5-dihydroxyanthracene-9,10-dione Chemical compound OC1=C(C=C(C=2C(C3=C(C=CC(=C3C(C12)=O)N)O)=O)N)C1=C(C=CC(=C1)C1CCCCC1)O DXPPIPWXPIZBTD-UHFFFAOYSA-N 0.000 description 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 description 1
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- UXEKZJHRGXJUMW-UHFFFAOYSA-N CC(OC(C=C1)=C(C)C=C1C(C=C(C(C(C(C1=C(C=C2)N)=C2O)=O)=C2C1=O)N)=C2O)=O Chemical compound CC(OC(C=C1)=C(C)C=C1C(C=C(C(C(C(C1=C(C=C2)N)=C2O)=O)=C2C1=O)N)=C2O)=O UXEKZJHRGXJUMW-UHFFFAOYSA-N 0.000 description 1
- MNLWBCWLYUUXSM-UHFFFAOYSA-N CC(OC(C=CC(C(C=C(C(C(C(C1=C(C=C2)N)=C2O)=O)=C2C1=O)N)=C2O)=C1)=C1OC(C)=O)=O Chemical compound CC(OC(C=CC(C(C=C(C(C(C(C1=C(C=C2)N)=C2O)=O)=C2C1=O)N)=C2O)=C1)=C1OC(C)=O)=O MNLWBCWLYUUXSM-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- YYCXHAHDXULECM-UHFFFAOYSA-N NC(C(C(C(C1=C(C=C2)NC(CC3=CC=CC=C3)=O)=C2O)=O)=C2C1=O)=CC(C(C=C1)=CC=C1OC(CC1=CC=CC=C1)=O)=C2O Chemical compound NC(C(C(C(C1=C(C=C2)NC(CC3=CC=CC=C3)=O)=C2O)=O)=C2C1=O)=CC(C(C=C1)=CC=C1OC(CC1=CC=CC=C1)=O)=C2O YYCXHAHDXULECM-UHFFFAOYSA-N 0.000 description 1
- JPXADWNIZNSPNX-UHFFFAOYSA-N NC(C=CC(O)=C1C(C(C(N)=C2)=C3C(O)=C2C(C=C2O)=CC(O)=C2O)=O)=C1C3=O Chemical compound NC(C=CC(O)=C1C(C(C(N)=C2)=C3C(O)=C2C(C=C2O)=CC(O)=C2O)=O)=C1C3=O JPXADWNIZNSPNX-UHFFFAOYSA-N 0.000 description 1
- KJSMWTXEIOQAIE-UHFFFAOYSA-N OC1=C(C=C(C=2C(C3=C(C=CC(=C3C(C12)=O)N)O)=O)N)C1=CC(=C(C=C1)O)O Chemical compound OC1=C(C=C(C=2C(C3=C(C=CC(=C3C(C12)=O)N)O)=O)N)C1=CC(=C(C=C1)O)O KJSMWTXEIOQAIE-UHFFFAOYSA-N 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000001045 blue dye Substances 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- RMIODHQZRUFFFF-UHFFFAOYSA-N methoxyacetic acid Chemical compound COCC(O)=O RMIODHQZRUFFFF-UHFFFAOYSA-N 0.000 description 1
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- ZWLPBLYKEWSWPD-UHFFFAOYSA-N o-toluic acid Chemical compound CC1=CC=CC=C1C(O)=O ZWLPBLYKEWSWPD-UHFFFAOYSA-N 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 229960003424 phenylacetic acid Drugs 0.000 description 1
- 239000003279 phenylacetic acid Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- ARJOQCYCJMAIFR-UHFFFAOYSA-N prop-2-enoyl prop-2-enoate Chemical compound C=CC(=O)OC(=O)C=C ARJOQCYCJMAIFR-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- WXMKPNITSTVMEF-UHFFFAOYSA-M sodium benzoate Chemical compound [Na+].[O-]C(=O)C1=CC=CC=C1 WXMKPNITSTVMEF-UHFFFAOYSA-M 0.000 description 1
- 239000004299 sodium benzoate Substances 0.000 description 1
- 235000010234 sodium benzoate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B1/00—Dyes with anthracene nucleus not condensed with any other ring
- C09B1/50—Amino-hydroxy-anthraquinones; Ethers and esters thereof
- C09B1/51—N-substituted amino-hydroxy anthraquinone
- C09B1/516—N-acylated derivatives
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B1/00—Dyes with anthracene nucleus not condensed with any other ring
- C09B1/50—Amino-hydroxy-anthraquinones; Ethers and esters thereof
- C09B1/503—Amino-hydroxy-anthraquinones; Ethers and esters thereof unsubstituted amino-hydroxy anthraquinone
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B1/00—Dyes with anthracene nucleus not condensed with any other ring
- C09B1/50—Amino-hydroxy-anthraquinones; Ethers and esters thereof
- C09B1/51—N-substituted amino-hydroxy anthraquinone
- C09B1/515—N-alkyl, N-aralkyl or N-cycloalkyl derivatives
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S8/00—Bleaching and dyeing; fluid treatment and chemical modification of textiles and fibers
- Y10S8/92—Synthetic fiber dyeing
- Y10S8/922—Polyester fiber
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3098462A GB998858A (en) | 1963-05-08 | 1962-08-13 | Water-insoluble dyestuffs of the anthraquinone series and a process for dyeing textile materials therewith |
| GB1820363 | 1963-05-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH451371A true CH451371A (de) | 1968-05-15 |
Family
ID=26253235
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1371164A CH451371A (de) | 1962-08-13 | 1963-08-12 | Verfahren zur Herstellung von Gemischen wasserunlöslicher Anthrachinonfarbstoffe |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3349104A (instruction) |
| BE (1) | BE636100A (instruction) |
| CH (1) | CH451371A (instruction) |
| DE (1) | DE1284544B (instruction) |
| FR (1) | FR1373758A (instruction) |
| NL (2) | NL296569A (instruction) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1317281A (en) * | 1970-03-04 | 1973-05-16 | Ici Ltd | Colouration of polyesters |
| NL7204838A (instruction) * | 1971-04-14 | 1972-10-17 | ||
| US3900472A (en) * | 1971-12-20 | 1975-08-19 | Gaf Corp | Anthraquinone dyes containing a 2-aryloxy alkoxy carbamate moiety, their intermediates, and a process for their preparation |
| US4080369A (en) * | 1976-03-25 | 1978-03-21 | Imperial Chemical Industries Limited | Disperse anthraquinone dyestuffs |
| DE2846229A1 (de) * | 1978-10-24 | 1980-05-08 | Bayer Ag | Verfahren zum faerben und bedrucken von cellulosefasern |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2411148A (en) * | 1943-10-23 | 1946-11-19 | Eastman Kodak Co | Anthraquinone dyestuffs |
| CH351253A (de) * | 1958-03-19 | 1961-01-15 | Sandoz Ag | Haltbares Dispersionsfarbstoffpräparat |
| US3265460A (en) * | 1960-03-22 | 1966-08-09 | Allied Chem | Dyeing of synthetic fibers |
-
0
- NL NL126021D patent/NL126021C/xx active
- NL NL296569D patent/NL296569A/xx unknown
- BE BE636100D patent/BE636100A/xx unknown
-
1963
- 1963-08-05 US US300047A patent/US3349104A/en not_active Expired - Lifetime
- 1963-08-09 DE DEJ24221A patent/DE1284544B/de active Pending
- 1963-08-12 CH CH1371164A patent/CH451371A/de unknown
- 1963-08-13 FR FR944659A patent/FR1373758A/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE1284544B (de) | 1968-12-05 |
| BE636100A (instruction) | |
| NL296569A (instruction) | |
| NL126021C (instruction) | |
| FR1373758A (fr) | 1964-10-02 |
| US3349104A (en) | 1967-10-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH451371A (de) | Verfahren zur Herstellung von Gemischen wasserunlöslicher Anthrachinonfarbstoffe | |
| CH624436A5 (instruction) | ||
| DE1117243B (de) | Verfahren zur Herstellung blauer Dispersionsfarbstoffe der Anthrachinonreihe | |
| DE929568C (de) | Verfahren zur Herstellung von Monoazofarbstoffen | |
| DE709690C (de) | Verfahren zur Herstellung von N-substituierten Pyrazolanthronen | |
| DE922480C (de) | Verfahren zur Herstellung von Kuepenfarbstoffen | |
| DE844451C (de) | Verfahren zur Herstellung von Halogenaminoanthrachinonen | |
| CH506588A (de) | Verfahren zur Herstellung von in Wasser schwerlöslichen Anthrachinonfarbstoffen | |
| DE1266903B (de) | Verfahren zur Herstellung von wasserunloeslichen Anthrachinonfarbstoffen | |
| DE855290C (de) | Verfahren zur Herstellung von Kuepenfarbstoffen | |
| AT200688B (de) | Verfahren zur Herstellung von neuen Küpenfarbstoffender Anthrachinon-naphthcarbazolreihe und deren Halogenierungsprodukten | |
| DE701187C (de) | Verfahren zur Herstellung von Carbonsaeureestern hochmolekularer, ringfoermiger Oxyverbindungen | |
| DE863968C (de) | Verfahren zur Herstellung neuer, esterartiger Azofarbstoffderivate | |
| DE2306843B2 (de) | In wasser schwer loesliche cumarinverbindungen, ihre herstellung und verwendung | |
| DE733702C (de) | Verfahren zur Herstellung indigoider Farbstoffe | |
| DE1644146C (de) | Von o-Hydroxy-O-dialkyl-benzotriazoliumsalzen abgeleitete Azofarbstoffe | |
| DE1113772B (de) | Verfahren zur Herstellung von Monoazofarbstoffen der Benzothiazolreihe | |
| DE2036136C (de) | Verfahren zur Herstellung von kationischen Farbstoffen der Naphthoylenbenzimidazol-Reihe | |
| DE825577C (de) | Verfahren zur Herstellung von Kuepenfarbstoffen | |
| DE504240C (de) | Verfahren zur Darstellung von Abkoemmlingen des Pyrazolanthrons | |
| AT163181B (de) | Verfahren zur Herstellung neuer Monoazofarbstoffe | |
| CH383529A (de) | Verfahren zur Herstellung von basischen Methinfarbstoffen | |
| DE946733C (de) | Verfahren zur Herstellung neuer metallhaltiger Azofarbstoffe | |
| DE1695817A1 (de) | Verfahren zur Herstellung neuer fluoreszierender 1,2,3-Triazolverbindungen des 3-Phenylcumarins | |
| AT166463B (de) | Verfahren zur Herstellung von Küpenfarbstoffen |