AT389813B - Verfahren zur herstellung von medikamenten mit hohem loeslichkeitsgrad - Google Patents
Verfahren zur herstellung von medikamenten mit hohem loeslichkeitsgrad Download PDFInfo
- Publication number
- AT389813B AT389813B AT0427282A AT427282A AT389813B AT 389813 B AT389813 B AT 389813B AT 0427282 A AT0427282 A AT 0427282A AT 427282 A AT427282 A AT 427282A AT 389813 B AT389813 B AT 389813B
- Authority
- AT
- Austria
- Prior art keywords
- active ingredient
- polymer
- drying
- pharmaceutically acceptable
- hydroflumethiazide
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title description 5
- 239000003814 drug Substances 0.000 claims description 18
- 229940079593 drug Drugs 0.000 claims description 12
- 239000004480 active ingredient Substances 0.000 claims description 11
- DMDGGSIALPNSEE-UHFFFAOYSA-N hydroflumethiazide Chemical compound C1=C(C(F)(F)F)C(S(=O)(=O)N)=CC2=C1NCNS2(=O)=O DMDGGSIALPNSEE-UHFFFAOYSA-N 0.000 claims description 10
- 229960003313 hydroflumethiazide Drugs 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 6
- 229920000642 polymer Polymers 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 239000002904 solvent Substances 0.000 claims description 6
- 238000001694 spray drying Methods 0.000 claims description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 4
- IZEKFCXSFNUWAM-UHFFFAOYSA-N dipyridamole Chemical compound C=12N=C(N(CCO)CCO)N=C(N3CCCCC3)C2=NC(N(CCO)CCO)=NC=1N1CCCCC1 IZEKFCXSFNUWAM-UHFFFAOYSA-N 0.000 claims description 4
- 229960002768 dipyridamole Drugs 0.000 claims description 4
- 238000001035 drying Methods 0.000 claims description 4
- -1 glaphencinomycin Chemical compound 0.000 claims description 4
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 claims description 4
- HEFNNWSXXWATRW-UHFFFAOYSA-N Ibuprofen Chemical compound CC(C)CC1=CC=C(C(C)C(O)=O)C=C1 HEFNNWSXXWATRW-UHFFFAOYSA-N 0.000 claims description 3
- 239000013543 active substance Substances 0.000 claims description 3
- 210000001035 gastrointestinal tract Anatomy 0.000 claims description 3
- VAOCPAMSLUNLGC-UHFFFAOYSA-N metronidazole Chemical compound CC1=NC=C([N+]([O-])=O)N1CCO VAOCPAMSLUNLGC-UHFFFAOYSA-N 0.000 claims description 3
- CMWTZPSULFXXJA-VIFPVBQESA-N naproxen Chemical compound C1=C([C@H](C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-VIFPVBQESA-N 0.000 claims description 3
- PFTAWBLQPZVEMU-DZGCQCFKSA-N (+)-catechin Chemical compound C1([C@H]2OC3=CC(O)=CC(O)=C3C[C@@H]2O)=CC=C(O)C(O)=C1 PFTAWBLQPZVEMU-DZGCQCFKSA-N 0.000 claims description 2
- YKFCISHFRZHKHY-NGQGLHOPSA-N (2s)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoic acid;trihydrate Chemical compound O.O.O.OC(=O)[C@](N)(C)CC1=CC=C(O)C(O)=C1.OC(=O)[C@](N)(C)CC1=CC=C(O)C(O)=C1 YKFCISHFRZHKHY-NGQGLHOPSA-N 0.000 claims description 2
- BKYKPTRYDKTTJY-UHFFFAOYSA-N 6-chloro-3-(cyclopentylmethyl)-1,1-dioxo-3,4-dihydro-2H-1$l^{6},2,4-benzothiadiazine-7-sulfonamide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(S(N2)(=O)=O)=C1NC2CC1CCCC1 BKYKPTRYDKTTJY-UHFFFAOYSA-N 0.000 claims description 2
- KBAFPSLPKGSANY-UHFFFAOYSA-N Naftidrofuryl Chemical compound C=1C=CC2=CC=CC=C2C=1CC(C(=O)OCCN(CC)CC)CC1CCCO1 KBAFPSLPKGSANY-UHFFFAOYSA-N 0.000 claims description 2
- CMWTZPSULFXXJA-UHFFFAOYSA-N Naproxen Natural products C1=C(C(C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-UHFFFAOYSA-N 0.000 claims description 2
- CYLWJCABXYDINA-UHFFFAOYSA-N Polythiazide Polymers ClC1=C(S(N)(=O)=O)C=C2S(=O)(=O)N(C)C(CSCC(F)(F)F)NC2=C1 CYLWJCABXYDINA-UHFFFAOYSA-N 0.000 claims description 2
- 229940083181 centrally acting adntiadrenergic agent methyldopa Drugs 0.000 claims description 2
- 229950001002 cianidanol Drugs 0.000 claims description 2
- LOUPRKONTZGTKE-UHFFFAOYSA-N cinchonine Natural products C1C(C(C2)C=C)CCN2C1C(O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-UHFFFAOYSA-N 0.000 claims description 2
- 229960003206 cyclopenthiazide Drugs 0.000 claims description 2
- BOCUKUHCLICSIY-QJWLJZLASA-N cyclothiazide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(S(N2)(=O)=O)=C1NC2C1[C@H](C=C2)C[C@H]2C1 BOCUKUHCLICSIY-QJWLJZLASA-N 0.000 claims description 2
- 229960003176 cyclothiazide Drugs 0.000 claims description 2
- 238000004090 dissolution Methods 0.000 claims description 2
- 229960000855 flavoxate Drugs 0.000 claims description 2
- SPIUTQOUKAMGCX-UHFFFAOYSA-N flavoxate Chemical compound C1=CC=C2C(=O)C(C)=C(C=3C=CC=CC=3)OC2=C1C(=O)OCCN1CCCCC1 SPIUTQOUKAMGCX-UHFFFAOYSA-N 0.000 claims description 2
- 229960003883 furosemide Drugs 0.000 claims description 2
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 claims description 2
- 229960001680 ibuprofen Drugs 0.000 claims description 2
- 229960000905 indomethacin Drugs 0.000 claims description 2
- DKYWVDODHFEZIM-UHFFFAOYSA-N ketoprofen Chemical compound OC(=O)C(C)C1=CC=CC(C(=O)C=2C=CC=CC=2)=C1 DKYWVDODHFEZIM-UHFFFAOYSA-N 0.000 claims description 2
- 229960000991 ketoprofen Drugs 0.000 claims description 2
- 229960000282 metronidazole Drugs 0.000 claims description 2
- 229960001132 naftidrofuryl Drugs 0.000 claims description 2
- 229960002009 naproxen Drugs 0.000 claims description 2
- NXFQHRVNIOXGAQ-YCRREMRBSA-N nitrofurantoin Chemical compound O1C([N+](=O)[O-])=CC=C1\C=N\N1C(=O)NC(=O)C1 NXFQHRVNIOXGAQ-YCRREMRBSA-N 0.000 claims description 2
- 229960000564 nitrofurantoin Drugs 0.000 claims description 2
- 239000008194 pharmaceutical composition Substances 0.000 claims description 2
- DDBREPKUVSBGFI-UHFFFAOYSA-N phenobarbital Chemical compound C=1C=CC=CC=1C1(CC)C(=O)NC(=O)NC1=O DDBREPKUVSBGFI-UHFFFAOYSA-N 0.000 claims description 2
- 229960002695 phenobarbital Drugs 0.000 claims description 2
- 229960005483 polythiazide Drugs 0.000 claims description 2
- 229920000046 polythiazide Polymers 0.000 claims description 2
- LXMSZDCAJNLERA-ZHYRCANASA-N spironolactone Chemical compound C([C@@H]1[C@]2(C)CC[C@@H]3[C@@]4(C)CCC(=O)C=C4C[C@H]([C@@H]13)SC(=O)C)C[C@@]21CCC(=O)O1 LXMSZDCAJNLERA-ZHYRCANASA-N 0.000 claims description 2
- 229960002256 spironolactone Drugs 0.000 claims description 2
- 229960003967 suloctidil Drugs 0.000 claims description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 2
- FNYLWPVRPXGIIP-UHFFFAOYSA-N Triamterene Chemical compound NC1=NC2=NC(N)=NC(N)=C2N=C1C1=CC=CC=C1 FNYLWPVRPXGIIP-UHFFFAOYSA-N 0.000 claims 2
- LOUPRKONTZGTKE-LHHVKLHASA-N quinidine Chemical compound C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@H]2[C@@H](O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-LHHVKLHASA-N 0.000 claims 2
- BFCDFTHTSVTWOG-YLJYHZDGSA-N (1S,2R)-2-(octylamino)-1-[4-(propan-2-ylthio)phenyl]-1-propanol Chemical compound CCCCCCCCN[C@H](C)[C@@H](O)C1=CC=C(SC(C)C)C=C1 BFCDFTHTSVTWOG-YLJYHZDGSA-N 0.000 claims 1
- JZUFKLXOESDKRF-UHFFFAOYSA-N Chlorothiazide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC2=C1NCNS2(=O)=O JZUFKLXOESDKRF-UHFFFAOYSA-N 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 claims 1
- WZHCOOQXZCIUNC-UHFFFAOYSA-N cyclandelate Chemical compound C1C(C)(C)CC(C)CC1OC(=O)C(O)C1=CC=CC=C1 WZHCOOQXZCIUNC-UHFFFAOYSA-N 0.000 claims 1
- 229960000729 cyclandelate Drugs 0.000 claims 1
- 229960002003 hydrochlorothiazide Drugs 0.000 claims 1
- 229960001404 quinidine Drugs 0.000 claims 1
- 229960001288 triamterene Drugs 0.000 claims 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 14
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 12
- 239000003112 inhibitor Substances 0.000 description 7
- 239000007788 liquid Substances 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 229940124530 sulfonamide Drugs 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000008186 active pharmaceutical agent Substances 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- ULGZDMOVFRHVEP-RWJQBGPGSA-N Erythromycin Chemical compound O([C@@H]1[C@@H](C)C(=O)O[C@@H]([C@@]([C@H](O)[C@@H](C)C(=O)[C@H](C)C[C@@](C)(O)[C@H](O[C@H]2[C@@H]([C@H](C[C@@H](C)O2)N(C)C)O)[C@H]1C)(C)O)CC)[C@H]1C[C@@](C)(OC)[C@@H](O)[C@H](C)O1 ULGZDMOVFRHVEP-RWJQBGPGSA-N 0.000 description 2
- 238000002441 X-ray diffraction Methods 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 238000000889 atomisation Methods 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229940088679 drug related substance Drugs 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 235000012431 wafers Nutrition 0.000 description 2
- BFCDFTHTSVTWOG-PXNSSMCTSA-N (1r,2s)-2-(octylamino)-1-(4-propan-2-ylsulfanylphenyl)propan-1-ol Chemical compound CCCCCCCCN[C@@H](C)[C@H](O)C1=CC=C(SC(C)C)C=C1 BFCDFTHTSVTWOG-PXNSSMCTSA-N 0.000 description 1
- IWYDHOAUDWTVEP-ZETCQYMHSA-N (S)-mandelic acid Chemical compound OC(=O)[C@@H](O)C1=CC=CC=C1 IWYDHOAUDWTVEP-ZETCQYMHSA-N 0.000 description 1
- 125000004206 2,2,2-trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 description 1
- BFCDFTHTSVTWOG-UHFFFAOYSA-N 2-(octylamino)-1-[4-(propan-2-ylthio)phenyl]-1-propanol Chemical compound CCCCCCCCNC(C)C(O)C1=CC=C(SC(C)C)C=C1 BFCDFTHTSVTWOG-UHFFFAOYSA-N 0.000 description 1
- KVQSUQONFOYHLJ-UHFFFAOYSA-N 2-chloro-4-(furan-2-ylmethylamino)benzenesulfonamide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC=C1NCC1=CC=CO1 KVQSUQONFOYHLJ-UHFFFAOYSA-N 0.000 description 1
- KMMBBZOSQNLLMN-UHFFFAOYSA-N 3-methylflavone-8-carboxylic acid Chemical compound O1C2=C(C(O)=O)C=CC=C2C(=O)C(C)=C1C1=CC=CC=C1 KMMBBZOSQNLLMN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- LOUPRKONTZGTKE-WZBLMQSHSA-N Quinine Chemical compound C([C@H]([C@H](C1)C=C)C2)C[N@@]1[C@@H]2[C@H](O)C1=CC=NC2=CC=C(OC)C=C21 LOUPRKONTZGTKE-WZBLMQSHSA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- CJCSPKMFHVPWAR-JTQLQIEISA-N alpha-methyl-L-dopa Chemical compound OC(=O)[C@](N)(C)CC1=CC=C(O)C(O)=C1 CJCSPKMFHVPWAR-JTQLQIEISA-N 0.000 description 1
- 238000007707 calorimetry Methods 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 description 1
- 238000000113 differential scanning calorimetry Methods 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 229960003276 erythromycin Drugs 0.000 description 1
- 239000000374 eutectic mixture Substances 0.000 description 1
- NWKFECICNXDNOQ-UHFFFAOYSA-N flavylium Chemical compound C1=CC=CC=C1C1=CC=C(C=CC=C2)C2=[O+]1 NWKFECICNXDNOQ-UHFFFAOYSA-N 0.000 description 1
- 210000001156 gastric mucosa Anatomy 0.000 description 1
- GWOFUCIGLDBNKM-UHFFFAOYSA-N glafenine Chemical compound OCC(O)COC(=O)C1=CC=CC=C1NC1=CC=NC2=CC(Cl)=CC=C12 GWOFUCIGLDBNKM-UHFFFAOYSA-N 0.000 description 1
- 229960001650 glafenine Drugs 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 210000004400 mucous membrane Anatomy 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- DCBSHORRWZKAKO-UHFFFAOYSA-N rac-1-monomyristoylglycerol Chemical compound CCCCCCCCCCCCCC(=O)OCC(O)CO DCBSHORRWZKAKO-UHFFFAOYSA-N 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/14—Particulate form, e.g. powders, Processes for size reducing of pure drugs or the resulting products, Pure drug nanoparticles
- A61K9/141—Intimate drug-carrier mixtures characterised by the carrier, e.g. ordered mixtures, adsorbates, solid solutions, eutectica, co-dried, co-solubilised, co-kneaded, co-milled, co-ground products, co-precipitates, co-evaporates, co-extrudates, co-melts; Drug nanoparticles with adsorbed surface modifiers
- A61K9/146—Intimate drug-carrier mixtures characterised by the carrier, e.g. ordered mixtures, adsorbates, solid solutions, eutectica, co-dried, co-solubilised, co-kneaded, co-milled, co-ground products, co-precipitates, co-evaporates, co-extrudates, co-melts; Drug nanoparticles with adsorbed surface modifiers with organic macromolecular compounds
Landscapes
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Animal Behavior & Ethology (AREA)
- Public Health (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical & Material Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Medicinal Preparation (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Saccharide Compounds (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR8206646A FR2525108B1 (fr) | 1982-04-19 | 1982-04-19 | Medicaments a haut degre de solubilite et procede pour leur obtention |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ATA427282A ATA427282A (de) | 1989-07-15 |
| AT389813B true AT389813B (de) | 1990-02-12 |
Family
ID=9273120
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT0427282A AT389813B (de) | 1982-04-19 | 1982-11-24 | Verfahren zur herstellung von medikamenten mit hohem loeslichkeitsgrad |
Country Status (18)
| Country | Link |
|---|---|
| US (2) | US4610875A (enExample) |
| JP (1) | JPS58183615A (enExample) |
| AR (1) | AR230183A1 (enExample) |
| AT (1) | AT389813B (enExample) |
| AU (1) | AU555579B2 (enExample) |
| BE (1) | BE894942A (enExample) |
| CA (1) | CA1225029A (enExample) |
| CH (1) | CH655003A5 (enExample) |
| DE (1) | DE3241097A1 (enExample) |
| ES (1) | ES8505249A1 (enExample) |
| FR (1) | FR2525108B1 (enExample) |
| GB (1) | GB2119784B (enExample) |
| IE (1) | IE54084B1 (enExample) |
| IT (1) | IT1153099B (enExample) |
| LU (1) | LU84468A1 (enExample) |
| NL (1) | NL8204461A (enExample) |
| PT (1) | PT75867B (enExample) |
| SE (1) | SE8206697L (enExample) |
Families Citing this family (44)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2525108B1 (fr) * | 1982-04-19 | 1989-05-12 | Elan Corp Ltd | Medicaments a haut degre de solubilite et procede pour leur obtention |
| JPS60139688A (ja) * | 1983-12-28 | 1985-07-24 | Tokyo Tanabe Co Ltd | 無定形ジヒドロピリジン粉末製剤 |
| EP0214092A1 (en) * | 1985-08-08 | 1987-03-11 | Ciba-Geigy Ag | Enhanced absorption of psychoactive 2-aryl-pyrazolo quinolines as a solid molecular dispersion in polyvinylpyrrolidone |
| US4772473A (en) * | 1986-06-16 | 1988-09-20 | Norwich Eaton Pharmaceuticals, Inc. | Nitrofurantoin dosage form |
| US4798725A (en) * | 1986-06-16 | 1989-01-17 | Norwich Eaton Pharmaceuticals, Inc. | Sustained release capsule |
| US4832953A (en) * | 1987-08-13 | 1989-05-23 | Alza Corporation | Method for preventing the formation of a crystalline hydrate in a dispersion of a liquid in a monaqueous matrix |
| US5264609A (en) * | 1989-11-18 | 1993-11-23 | Schering Agrochemicals Limited | Preparation of propenoic acid derivatives |
| IT1242642B (it) * | 1990-04-17 | 1994-05-16 | Alfa Wassermann Spa | Formulazioni iniettabili contenenti naproxen sale sodico. |
| JPH0648937A (ja) * | 1992-04-07 | 1994-02-22 | Seitai Kagaku Kenkyusho:Kk | 経口投与に適する薬剤およびその製造方法 |
| US5512300A (en) * | 1992-09-15 | 1996-04-30 | Warner-Lambert Company | Prevention of ibuprofen from forming low melting eutectics with other therapeutic agents in solid dosage forms |
| FR2722984B1 (fr) * | 1994-07-26 | 1996-10-18 | Effik Lab | Procede de preparation de formes pharmaceutiques seches et les compositions pharmaceutiques ainsi realisees |
| US5994348A (en) * | 1995-06-07 | 1999-11-30 | Sanofi | Pharmaceutical compositions containing irbesartan |
| BE1009856A5 (fr) * | 1995-07-14 | 1997-10-07 | Sandoz Sa | Composition pharmaceutique sous la forme d'une dispersion solide comprenant un macrolide et un vehicule. |
| US5686133A (en) * | 1996-01-31 | 1997-11-11 | Port Systems, L.L.C. | Water soluble pharmaceutical coating and method for producing coated pharmaceuticals |
| WO1997034601A1 (fr) * | 1996-03-18 | 1997-09-25 | Eisai Co., Ltd. | Compositions medicamenteuses a solubilite amelioree |
| US6066339A (en) * | 1997-10-17 | 2000-05-23 | Elan Corporation, Plc | Oral morphine multiparticulate formulation |
| US6086915A (en) * | 1998-04-01 | 2000-07-11 | Bioresponse L.L.C. | Compositions and methods of adjusting steroid hormone metabolism through phytochemicals |
| US6517871B1 (en) * | 1998-07-20 | 2003-02-11 | Smithkline Beecham Corporation | Bioenhanced formulations comprising eprosartan in oral solid dosage form |
| WO2000020033A1 (en) * | 1998-10-05 | 2000-04-13 | Eisai Co., Ltd. | Tablets immediately disintegrating in the oral cavity |
| ATE329579T1 (de) * | 1999-11-12 | 2006-07-15 | Abbott Lab | Feste dispersion mit ritonavir, fenofibrat oder griseofulvin |
| US7364752B1 (en) | 1999-11-12 | 2008-04-29 | Abbott Laboratories | Solid dispersion pharamaceutical formulations |
| IL144761A0 (en) * | 1999-12-08 | 2002-08-14 | Pharmacia Corp | Solid-state form of celecoxib having enhanced bioavailability |
| HRP20020531A2 (en) | 1999-12-23 | 2004-02-29 | Pfizer Prod Inc | Pharmaceutical compositions providing enhanced drug concentrations |
| IL134701A0 (en) * | 2000-02-23 | 2001-04-30 | J P M E D Ltd | Homogeneous solid matrix containing vegetable proteins |
| DE10026698A1 (de) | 2000-05-30 | 2001-12-06 | Basf Ag | Selbstemulgierende Wirkstoffformulierung und Verwendung dieser Formulierung |
| WO2001095912A1 (fr) | 2000-06-16 | 2001-12-20 | Mitsubishi Pharma Corporation | Compositions permettant de reguler la plage et/ou la vitesse de liberation du ph |
| CN100352432C (zh) * | 2000-10-24 | 2007-12-05 | 味之素株式会社 | 含有那格列奈的制剂 |
| DE60238193D1 (de) * | 2001-06-22 | 2010-12-16 | Pfizer Prod Inc | Pharmazeutische zusammensetzungen, enthaltend adsorbate eines arzneimittels in amorpher form |
| AU2002309172A1 (en) * | 2001-06-22 | 2003-01-08 | Pfizer Products Inc. | Pharmaceutical compositions containing polymer and drug assemblies |
| EP1269994A3 (en) * | 2001-06-22 | 2003-02-12 | Pfizer Products Inc. | Pharmaceutical compositions comprising drug and concentration-enhancing polymers |
| SI21223A (sl) * | 2002-06-19 | 2003-12-31 | Krka, Tovarna Zdravil, D.D., Novo Mesto | Farmacevtska formulacija s stabiliziranim amorfnim donepezilijevim kloridom |
| US20040132771A1 (en) * | 2002-12-20 | 2004-07-08 | Pfizer Inc | Compositions of choleseteryl ester transfer protein inhibitors and HMG-CoA reductase inhibitors |
| US20050152932A1 (en) * | 2003-06-12 | 2005-07-14 | Valery Normand | Non-crystalline perfume or flavor delivery system |
| US20050048112A1 (en) | 2003-08-28 | 2005-03-03 | Jorg Breitenbach | Solid pharmaceutical dosage form |
| US8377952B2 (en) | 2003-08-28 | 2013-02-19 | Abbott Laboratories | Solid pharmaceutical dosage formulation |
| US8025899B2 (en) | 2003-08-28 | 2011-09-27 | Abbott Laboratories | Solid pharmaceutical dosage form |
| WO2006069159A2 (en) * | 2004-12-20 | 2006-06-29 | Dr. Reddy's Laboratories Ltd. | Pharmaceutical compositions comprising amorphous benzimidazole compounds |
| MX2007012642A (es) * | 2005-04-11 | 2008-01-11 | Abbott Lab | Composiciones farmaceuticas que tienen perfiles mejorados de disolucion para farmacos poco solubles. |
| WO2006119779A2 (en) * | 2005-05-10 | 2006-11-16 | Lifecycle Pharma A/S | A pharmaceutical composition comprising an aldosterone antagonist in form of solid solution |
| CA2640165A1 (en) * | 2006-01-27 | 2007-08-02 | The Provost, Fellows And Scholars Of The College Of The Holy And Undivid Ed Trinity Of Queen Elizabeth Near Dublin | A method of producing porous microparticles |
| PT103743B (pt) * | 2007-05-16 | 2013-01-15 | Hovione Farmaciencia S A | Processo para preparar derivados de 21-disódio fosfato de pregnanos. |
| CA2742356A1 (en) * | 2008-11-04 | 2010-05-14 | Cipla Limited | Tiotropium bromide having a low degree of crystallinity |
| RU2013134339A (ru) * | 2010-12-23 | 2015-01-27 | Эбботт Гмбх Унд Ко. Кг | Твердые составы с замедленным действием на основе твердой дисперсии |
| WO2012164575A2 (en) | 2011-05-27 | 2012-12-06 | Hetero Research Foundation | Amorphous ritonavir co-precipitated |
Citations (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2634004B2 (de) * | 1976-07-29 | 1978-08-10 | Bernhard Dr. 8000 Muenchen Lippold | Verfahren zur Beschleunigung der Auflösung und Verbesserung der Löslichkeit von schlechtlöslichen zur peroralen Verabreichung bestimmten Arzneistoffen |
| DE2822882A1 (de) * | 1977-06-07 | 1978-12-21 | Yamanouchi Pharma Co Ltd | Nifedipine-enthaltende feste praeparatzusammensetzung, verfahren zu ihrer herstellung und ihre verwendung |
| EP0001247A1 (en) * | 1977-09-14 | 1979-04-04 | Kanebo, Ltd. | Pharmaceutical preparation containing nifedipine and a method for producing the same. |
| JPS55167219A (en) * | 1979-06-17 | 1980-12-26 | Furointo Sangyo Kk | Powder drug coating |
| JPS55167218A (en) * | 1979-06-16 | 1980-12-26 | Furointo Sangyo Kk | Preparation of activated drug |
| GB2050828A (en) * | 1979-04-13 | 1981-01-14 | Freunt Ind Co Ltd | Process for the preparations of finely divided pharmaceutical compositions |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4151273A (en) * | 1974-10-31 | 1979-04-24 | The Regents Of The University Of California | Increasing the absorption rate of insoluble drugs |
| JPS5163925A (ja) * | 1974-11-30 | 1976-06-02 | Kyowa Hakko Kogyo Kk | Muteikeikuroramufuenikooruno seizoho |
| JPS51118816A (en) * | 1975-04-08 | 1976-10-19 | Meiji Seika Kaisha Ltd | A process for stabilizing non-crystalloidal solid |
| US4127647A (en) * | 1975-04-08 | 1978-11-28 | Meiji Seika Kaisha, Ltd. | Process for preparation of stable amorphous macrolide antibiotic solids |
| US4128632A (en) * | 1978-02-13 | 1978-12-05 | Merck & Co., Inc. | Solubilization of Rafoxanide |
| US4344934A (en) * | 1978-11-20 | 1982-08-17 | American Home Products Corporation | Therapeutic compositions with enhanced bioavailability |
| JPS55139319A (en) * | 1979-04-13 | 1980-10-31 | Furointo Sangyo Kk | Activation of drug soluble in alkali and acid |
| CA1146866A (en) * | 1979-07-05 | 1983-05-24 | Yamanouchi Pharmaceutical Co. Ltd. | Process for the production of sustained release pharmaceutical composition of solid medical material |
| JPS5948810B2 (ja) * | 1980-03-22 | 1984-11-29 | 山之内製薬株式会社 | ニカルジピン持続性製剤用組成物 |
| JPS5646837A (en) * | 1979-09-27 | 1981-04-28 | Kowa Yakuhin Kogyo Kk | Preparation of ibuprofen clathrate compound |
| JPS5655370A (en) * | 1979-10-13 | 1981-05-15 | Kyorin Pharmaceut Co Ltd | Amorphous nicomol |
| US4327080A (en) * | 1981-07-13 | 1982-04-27 | E. R. Squibb & Sons, Inc. | Novel Bendroflumethiazide formulations and method |
| FR2525108B1 (fr) * | 1982-04-19 | 1989-05-12 | Elan Corp Ltd | Medicaments a haut degre de solubilite et procede pour leur obtention |
| DE3318649A1 (de) * | 1983-05-21 | 1984-11-22 | Bayer Ag, 5090 Leverkusen | Zweiphasenformulierung |
-
1982
- 1982-04-19 FR FR8206646A patent/FR2525108B1/fr not_active Expired
- 1982-11-01 IE IE2610/82A patent/IE54084B1/en not_active IP Right Cessation
- 1982-11-04 GB GB08231580A patent/GB2119784B/en not_active Expired
- 1982-11-05 CA CA000415001A patent/CA1225029A/en not_active Expired
- 1982-11-06 DE DE19823241097 patent/DE3241097A1/de active Granted
- 1982-11-08 BE BE1/10635A patent/BE894942A/fr unknown
- 1982-11-11 AR AR291268A patent/AR230183A1/es active
- 1982-11-12 AU AU90431/82A patent/AU555579B2/en not_active Expired
- 1982-11-12 LU LU84468A patent/LU84468A1/fr unknown
- 1982-11-17 ES ES517444A patent/ES8505249A1/es not_active Expired
- 1982-11-17 PT PT75867A patent/PT75867B/pt not_active IP Right Cessation
- 1982-11-18 NL NL8204461A patent/NL8204461A/nl active Search and Examination
- 1982-11-19 JP JP57204422A patent/JPS58183615A/ja active Granted
- 1982-11-23 IT IT24368/82A patent/IT1153099B/it active
- 1982-11-24 SE SE8206697A patent/SE8206697L/xx not_active Application Discontinuation
- 1982-11-24 AT AT0427282A patent/AT389813B/de not_active IP Right Cessation
- 1982-12-17 CH CH7389/82A patent/CH655003A5/fr not_active IP Right Cessation
-
1984
- 1984-08-31 US US06/646,485 patent/US4610875A/en not_active Expired - Lifetime
-
1986
- 1986-05-19 US US06/864,827 patent/US4769236A/en not_active Expired - Lifetime
Patent Citations (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2634004B2 (de) * | 1976-07-29 | 1978-08-10 | Bernhard Dr. 8000 Muenchen Lippold | Verfahren zur Beschleunigung der Auflösung und Verbesserung der Löslichkeit von schlechtlöslichen zur peroralen Verabreichung bestimmten Arzneistoffen |
| DE2822882A1 (de) * | 1977-06-07 | 1978-12-21 | Yamanouchi Pharma Co Ltd | Nifedipine-enthaltende feste praeparatzusammensetzung, verfahren zu ihrer herstellung und ihre verwendung |
| EP0001247A1 (en) * | 1977-09-14 | 1979-04-04 | Kanebo, Ltd. | Pharmaceutical preparation containing nifedipine and a method for producing the same. |
| GB2050828A (en) * | 1979-04-13 | 1981-01-14 | Freunt Ind Co Ltd | Process for the preparations of finely divided pharmaceutical compositions |
| JPS55167218A (en) * | 1979-06-16 | 1980-12-26 | Furointo Sangyo Kk | Preparation of activated drug |
| JPS55167219A (en) * | 1979-06-17 | 1980-12-26 | Furointo Sangyo Kk | Powder drug coating |
Also Published As
| Publication number | Publication date |
|---|---|
| US4769236A (en) | 1988-09-06 |
| FR2525108A1 (fr) | 1983-10-21 |
| GB2119784A (en) | 1983-11-23 |
| DE3241097C2 (enExample) | 1989-04-13 |
| ES517444A0 (es) | 1985-05-16 |
| IT1153099B (it) | 1987-01-14 |
| CH655003A5 (fr) | 1986-03-27 |
| DE3241097A1 (de) | 1983-10-20 |
| CA1225029A (en) | 1987-08-04 |
| AR230183A1 (es) | 1984-03-01 |
| JPH0341444B2 (enExample) | 1991-06-24 |
| IT8224368A1 (it) | 1984-05-23 |
| IE54084B1 (en) | 1989-06-07 |
| BE894942A (fr) | 1983-05-09 |
| LU84468A1 (fr) | 1983-06-13 |
| GB2119784B (en) | 1986-04-03 |
| SE8206697D0 (sv) | 1982-11-24 |
| IE822610L (en) | 1983-10-19 |
| FR2525108B1 (fr) | 1989-05-12 |
| US4610875A (en) | 1986-09-09 |
| AU555579B2 (en) | 1986-10-02 |
| PT75867B (fr) | 1986-01-21 |
| IT8224368A0 (it) | 1982-11-23 |
| PT75867A (fr) | 1982-12-01 |
| SE8206697L (sv) | 1983-10-20 |
| NL8204461A (nl) | 1983-11-16 |
| JPS58183615A (ja) | 1983-10-26 |
| ATA427282A (de) | 1989-07-15 |
| AU9043182A (en) | 1983-10-27 |
| ES8505249A1 (es) | 1985-05-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT389813B (de) | Verfahren zur herstellung von medikamenten mit hohem loeslichkeitsgrad | |
| DE69222847T2 (de) | Verfahren zur herstellung einer festen dispersion | |
| DE3119017C2 (enExample) | ||
| DE69430491T2 (de) | Verfahren zur verkapselung von nsaids | |
| DE60132230T2 (de) | Verfahren zur herstellung von partikeln und deren produkte | |
| DE69429119T2 (de) | Verfahren zur herstellung von gefriergetrockneten arzneistoffdosierungsformen | |
| DE69913138T2 (de) | Stabilisierte zusammensetzung mit nootropen wirkstoffen | |
| DE69819481T2 (de) | Formulierungen von clarithromycin mit verlängerter wirkstoff-freisetzung | |
| DE69105106T2 (de) | Im wasser schnell suspendierbare pharmazeutische zusammensetzung. | |
| DE2224534C3 (de) | Pharmazeutisches Präparat mit langsamer Wirkstoffabgabe | |
| DE3437599C2 (de) | Ibuprofen enthaltende Weichgelatinekapseln | |
| DE69426382T2 (de) | Bioadhesive pharmazeutische Zusammensetzung zur kontrollierten Freigabe von Wirkstoffen | |
| DE69226950T2 (de) | Kapsel mit Langzeitwirkung fuer die Adhäsion im Gastrointestinaltrakt | |
| DE69924710T2 (de) | Pharmazeutische zubereitung zur anwendung in der antiasthmatherapie | |
| DE60108154T2 (de) | Pharmazeutische Zubereitungen enthaltend Clavulansäure | |
| DE2903269A1 (de) | Metronidazolphosphorsaeure(salze), ihre herstellung und verwendung sowie diese enthaltende arzneimittel | |
| DE60008497T2 (de) | Arzneimittel zur oralen verabreichung | |
| EP0386440A1 (de) | Arzneimittel mit kontrollierter Wirkstoffabgabe | |
| EP0250648B1 (de) | Pharmazeutisches Präparat zur verzögerten Freigabe von Ibuprofen | |
| WO2004037264A1 (de) | Wasserlösliche meloxicam granulate | |
| DE69534283T2 (de) | Clonidinhaltiges arzneimittel mit verzögerter wirkstoffabgabe | |
| EP0185331B1 (de) | Theophyllin-Retardzubereitung | |
| DE60223382T2 (de) | Verfahren für die thermodynamische aktivierung von wasserlöslichen arzneimitteln, die in vernetzten polymeren geladen sind | |
| CH654004A5 (de) | Kristallmodifikationen des monohydrats und der wasserfreien form von (+)-catechin, verfahren zu deren herstellung und die sie enthaltenden pharmazeutischen zusammensetzungen. | |
| EP1469835B1 (de) | Stabile salze von o-acetylsalicylsäure mit basischen aminosäuren ii |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELJ | Ceased due to non-payment of the annual fee |