AT250961B - Verfahren zur Herstellung von neuen Tetrahydroisochinolinderivaten - Google Patents
Verfahren zur Herstellung von neuen TetrahydroisochinolinderivatenInfo
- Publication number
- AT250961B AT250961B AT589164A AT589164A AT250961B AT 250961 B AT250961 B AT 250961B AT 589164 A AT589164 A AT 589164A AT 589164 A AT589164 A AT 589164A AT 250961 B AT250961 B AT 250961B
- Authority
- AT
- Austria
- Prior art keywords
- sep
- group
- alkylene
- preparation
- tetrahydro
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 7
- 125000003039 tetrahydroisoquinolinyl group Chemical class C1(NCCC2=CC=CC=C12)* 0.000 title claims 2
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 150000007513 acids Chemical class 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims 2
- 125000003917 carbamoyl group Chemical class [H]N([H])C(*)=O 0.000 claims 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 18
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 8
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 8
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- -1 methylene, trimethylene Chemical group 0.000 description 5
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 125000002947 alkylene group Chemical group 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 3
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 150000003526 tetrahydroisoquinolines Chemical class 0.000 description 3
- JQZAEUFPPSRDOP-UHFFFAOYSA-N 1-chloro-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C=C1 JQZAEUFPPSRDOP-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 235000019441 ethanol Nutrition 0.000 description 2
- 239000001530 fumaric acid Substances 0.000 description 2
- 235000011087 fumaric acid Nutrition 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 235000006408 oxalic acid Nutrition 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- KMXUKZCMNKLUTF-UHFFFAOYSA-N 1-chloro-4-(2-chloroethyl)benzene Chemical compound ClCCC1=CC=C(Cl)C=C1 KMXUKZCMNKLUTF-UHFFFAOYSA-N 0.000 description 1
- HEZZOBOIXZUSIY-UHFFFAOYSA-N 1-ethyl-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline Chemical compound COC1=C(OC)C=C2C(CC)NCCC2=C1 HEZZOBOIXZUSIY-UHFFFAOYSA-N 0.000 description 1
- FYWPHUYGVNYFIB-UHFFFAOYSA-N 2-[2-(4-chlorophenyl)ethyl]-6,7-dimethoxy-1-methyl-3,4-dihydro-1h-isoquinoline Chemical compound CC1C=2C=C(OC)C(OC)=CC=2CCN1CCC1=CC=C(Cl)C=C1 FYWPHUYGVNYFIB-UHFFFAOYSA-N 0.000 description 1
- VGNRGOGIWXMVLI-UHFFFAOYSA-N 3-(4-chlorophenyl)propanoyl chloride Chemical compound ClC(=O)CCC1=CC=C(Cl)C=C1 VGNRGOGIWXMVLI-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- OYRHPGPBJOZXOW-UHFFFAOYSA-N 3-methoxy-1-methylisoquinoline Chemical compound C1=CC=C2C(C)=NC(OC)=CC2=C1 OYRHPGPBJOZXOW-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000011287 therapeutic dose Methods 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
- C07D217/10—Quaternary compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
- C07D217/04—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines with hydrocarbon or substituted hydrocarbon radicals attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
- C07D217/06—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines with the ring nitrogen atom acylated by carboxylic or carbonic acids, or with sulfur or nitrogen analogues thereof, e.g. carbamates
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB2702263 | 1963-07-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AT250961B true AT250961B (de) | 1966-12-12 |
Family
ID=10252896
Family Applications (4)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT589164A AT250961B (de) | 1963-07-08 | 1964-07-08 | Verfahren zur Herstellung von neuen Tetrahydroisochinolinderivaten |
| AT836965A AT250963B (de) | 1963-07-08 | 1964-07-08 | Verfahren zur Herstellung von neuen Tetrahydroisochinolinderivaten |
| AT837065A AT250964B (de) | 1963-07-08 | 1964-07-08 | Verfahren zur Herstellung von neuen Tetrahydroisochinolinderivaten |
| AT836865A AT250962B (de) | 1963-07-08 | 1964-07-08 | Verfahren zur Herstellung von neuen Tetrahydroisochinolinderivaten |
Family Applications After (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT836965A AT250963B (de) | 1963-07-08 | 1964-07-08 | Verfahren zur Herstellung von neuen Tetrahydroisochinolinderivaten |
| AT837065A AT250964B (de) | 1963-07-08 | 1964-07-08 | Verfahren zur Herstellung von neuen Tetrahydroisochinolinderivaten |
| AT836865A AT250962B (de) | 1963-07-08 | 1964-07-08 | Verfahren zur Herstellung von neuen Tetrahydroisochinolinderivaten |
Country Status (5)
| Country | Link |
|---|---|
| AT (4) | AT250961B (enExample) |
| BE (1) | BE649952A (enExample) |
| ES (1) | ES301736A1 (enExample) |
| FR (1) | FR4637M (enExample) |
| NL (1) | NL6407478A (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN108484574B (zh) * | 2018-04-12 | 2020-06-19 | 广东医科大学 | 四氢异喹啉衍生物的制备及应用 |
-
1964
- 1964-07-01 NL NL6407478A patent/NL6407478A/xx unknown
- 1964-07-01 BE BE649952D patent/BE649952A/xx unknown
- 1964-07-06 ES ES0301736A patent/ES301736A1/es not_active Expired
- 1964-07-08 AT AT589164A patent/AT250961B/de active
- 1964-07-08 AT AT836965A patent/AT250963B/de active
- 1964-07-08 AT AT837065A patent/AT250964B/de active
- 1964-07-08 AT AT836865A patent/AT250962B/de active
- 1964-10-06 FR FR990446A patent/FR4637M/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| AT250963B (de) | 1966-12-12 |
| BE649952A (enExample) | 1965-01-04 |
| AT250962B (de) | 1966-12-12 |
| AT250964B (de) | 1966-12-12 |
| NL6407478A (enExample) | 1965-01-11 |
| FR4637M (enExample) | 1966-12-05 |
| ES301736A1 (es) | 1965-01-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2103576A1 (de) | 5 Azaspiro eckige Klammer auf 2,4 eckige Klammer zu heptan 4,6 dione und Verfahren zu deren Herstellung | |
| AT200578B (de) | Verfahren zur Herstellung von neuen N-Aminoalkylderivaten von Azepinen | |
| AT250961B (de) | Verfahren zur Herstellung von neuen Tetrahydroisochinolinderivaten | |
| DE1289845B (de) | 4-(4'-Hydroxy-4'-phenylpiperidino)-butyrophenone, deren Saeureadditionssalze sowie Verfahren zu deren Herstellung | |
| US2971955A (en) | Cyclohexylcarbinol derivatives of piperazine | |
| DE913178C (de) | Verfahren zur Herstellung therapeutisch wirksamer basischer Ester | |
| DE1668550C (enExample) | ||
| CH460773A (de) | Verfahren zur Herstellung von substituierten 3-(3-Hydroxyphenyl)-1-phenacyl-piperidinen | |
| DE1420041A1 (de) | Verfahren zur Herstellung von basisch alkylierten Acylpheonthiazinen | |
| DE927330C (de) | Verfahren zur Herstellung neuer Dioxopiperidine | |
| AT243445B (de) | Verfahren zur Herstellung von neuen, am Stickstoff substituierten 3-(Dibenzo-[a,d]-1, 4-cycloheptadien-5-yloxy)-nortropanen und von Salzen dieser Verbindungen | |
| DE933029C (de) | Verfahren zur Herstellung von Diphenylacetyldiaminen | |
| AT227249B (de) | Verfahren zur Herstellung neuer Hydrazinverbindungen und deren Salze und Acylierungs produkte | |
| AT235280B (de) | Verfahren zur Herstellung neuer Indolderivate | |
| AT233003B (de) | Verfahren zur Herstellung von neuen, basischen Estern von Phenylpyrazolincarbonsäuren bzw. deren quaternären Ammoniumverbindungen | |
| AT211823B (de) | Verfahren zur Herstellung von neuen Aryloxyessigsäureamiden | |
| AT200146B (de) | Verfahren zur Herstellung von neuen diquaternären 1-(Ammoniumalkyl)-aryl-piperidiniumverbindungen | |
| AT257605B (de) | Verfahren zur Herstellung von neuen 4-substituierten Pyridinverbindungen | |
| AT226696B (de) | Verfahren zur Herstellung von neuen Derivaten des Phthalimidins bzw. deren quaternären Ammoniumverbindungen | |
| AT235836B (de) | Verfahren zur Herstellung von neuen basisch substituierten Polymethylentetrahydrochinolinen | |
| AT267075B (de) | Verfahren zur Herstellung von neuen, am Stickstoff substituierten 3-(Dibenzo-[a,d]-1,4-cycloheptadien-5-yloxy)-nortropanen und von Salzen dieser Verbindungen | |
| AT204037B (de) | Verfahren zur Herstellung neuer 1-Halogenäthyl-diphenylmethyl-piperidinverbindungen und ihrer Salze | |
| CH581625A5 (en) | 2-dimethylallylbenzomorphans - analgesics | |
| DE1620496C (de) | l-Pyridyl-3,4-dihydroiso-chinoline und ein Verfahren zu ihrer Herstellung | |
| AT257577B (de) | Verfahren zur Herstellung von neuen α-sek. Aminoketonen und deren Säureadditionssalzen |