SK110198A3 - Il-8 receptor antagonists, method for the preparation thereof, pharmaceutical composition and use - Google Patents
Il-8 receptor antagonists, method for the preparation thereof, pharmaceutical composition and use Download PDFInfo
- Publication number
- SK110198A3 SK110198A3 SK1101-98A SK110198A SK110198A3 SK 110198 A3 SK110198 A3 SK 110198A3 SK 110198 A SK110198 A SK 110198A SK 110198 A3 SK110198 A3 SK 110198A3
- Authority
- SK
- Slovakia
- Prior art keywords
- alkyl
- urea
- hydroxy
- bromophenyl
- optionally substituted
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 189
- 238000000034 method Methods 0.000 title claims description 121
- 239000008194 pharmaceutical composition Substances 0.000 title claims description 15
- 102000010681 interleukin-8 receptors Human genes 0.000 title claims description 7
- 108010038415 interleukin-8 receptors Proteins 0.000 title claims description 6
- 239000002464 receptor antagonist Substances 0.000 title 1
- 229940044551 receptor antagonist Drugs 0.000 title 1
- -1 phenyl ureas Chemical class 0.000 claims abstract description 169
- 102000019034 Chemokines Human genes 0.000 claims abstract description 41
- 108010012236 Chemokines Proteins 0.000 claims abstract description 41
- 102000004890 Interleukin-8 Human genes 0.000 claims abstract description 29
- 108090001007 Interleukin-8 Proteins 0.000 claims abstract description 29
- 201000010099 disease Diseases 0.000 claims abstract description 25
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims abstract description 25
- 230000001404 mediated effect Effects 0.000 claims abstract description 21
- 125000000217 alkyl group Chemical group 0.000 claims description 432
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 166
- 229910052739 hydrogen Inorganic materials 0.000 claims description 150
- 125000001072 heteroaryl group Chemical group 0.000 claims description 148
- 150000001875 compounds Chemical class 0.000 claims description 139
- 239000001257 hydrogen Substances 0.000 claims description 136
- 125000003342 alkenyl group Chemical group 0.000 claims description 134
- 229910052736 halogen Inorganic materials 0.000 claims description 119
- 125000000623 heterocyclic group Chemical group 0.000 claims description 116
- 239000004202 carbamide Substances 0.000 claims description 114
- 125000003118 aryl group Chemical group 0.000 claims description 101
- 125000003545 alkoxy group Chemical group 0.000 claims description 96
- 150000002367 halogens Chemical class 0.000 claims description 93
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 84
- 239000000203 mixture Substances 0.000 claims description 80
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 77
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 58
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 57
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 53
- 229910052757 nitrogen Inorganic materials 0.000 claims description 50
- 125000003107 substituted aryl group Chemical group 0.000 claims description 49
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 48
- 125000004446 heteroarylalkyl group Chemical group 0.000 claims description 47
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 45
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 45
- 150000002431 hydrogen Chemical class 0.000 claims description 43
- 229910052760 oxygen Inorganic materials 0.000 claims description 40
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 38
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 38
- 239000001301 oxygen Substances 0.000 claims description 38
- 229910052717 sulfur Chemical group 0.000 claims description 35
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 31
- 125000005842 heteroatom Chemical group 0.000 claims description 31
- 150000003839 salts Chemical class 0.000 claims description 31
- 239000011593 sulfur Chemical group 0.000 claims description 31
- 125000004104 aryloxy group Chemical group 0.000 claims description 25
- 125000005843 halogen group Chemical group 0.000 claims description 25
- 125000006296 sulfonyl amino group Chemical group [H]N(*)S(*)(=O)=O 0.000 claims description 25
- 150000001540 azides Chemical class 0.000 claims description 23
- 230000003197 catalytic effect Effects 0.000 claims description 23
- GOOVAYJIVMBWPP-UHFFFAOYSA-N 1-bromo-2-isocyanatobenzene Chemical compound BrC1=CC=CC=C1N=C=O GOOVAYJIVMBWPP-UHFFFAOYSA-N 0.000 claims description 22
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 22
- 239000000126 substance Substances 0.000 claims description 21
- 125000004415 heterocyclylalkyl group Chemical group 0.000 claims description 17
- 238000004519 manufacturing process Methods 0.000 claims description 17
- 125000006374 C2-C10 alkenyl group Chemical group 0.000 claims description 16
- 125000006276 2-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C(*)C([H])=C1[H] 0.000 claims description 14
- 239000003814 drug Substances 0.000 claims description 14
- 125000000524 functional group Chemical group 0.000 claims description 14
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 14
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 13
- 241000124008 Mammalia Species 0.000 claims description 13
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 13
- 238000006243 chemical reaction Methods 0.000 claims description 12
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 12
- HKZPOGZBKIWMPO-UHFFFAOYSA-N 4-amino-3-hydroxybenzonitrile Chemical compound NC1=CC=C(C#N)C=C1O HKZPOGZBKIWMPO-UHFFFAOYSA-N 0.000 claims description 11
- DSSYKIVIOFKYAU-XCBNKYQSSA-N (R)-camphor Chemical compound C1C[C@@]2(C)C(=O)C[C@@H]1C2(C)C DSSYKIVIOFKYAU-XCBNKYQSSA-N 0.000 claims description 10
- 241000723346 Cinnamomum camphora Species 0.000 claims description 10
- 229960000846 camphor Drugs 0.000 claims description 10
- 229930008380 camphor Natural products 0.000 claims description 10
- 239000003085 diluting agent Substances 0.000 claims description 10
- VIKJECVSALYBJB-UHFFFAOYSA-N 1-(2-bromophenyl)-3-(4-cyano-2-hydroxyphenyl)urea Chemical group OC1=CC(C#N)=CC=C1NC(=O)NC1=CC=CC=C1Br VIKJECVSALYBJB-UHFFFAOYSA-N 0.000 claims description 8
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 8
- 150000001732 carboxylic acid derivatives Chemical group 0.000 claims description 7
- 125000006575 electron-withdrawing group Chemical group 0.000 claims description 7
- PICNBCJMPWKROU-UHFFFAOYSA-N 1-[2-(benzenesulfonamido)-4-nitrophenyl]-3-phenylurea Chemical compound C=1C=CC=CC=1S(=O)(=O)NC1=CC([N+](=O)[O-])=CC=C1NC(=O)NC1=CC=CC=C1 PICNBCJMPWKROU-UHFFFAOYSA-N 0.000 claims description 6
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 claims description 6
- 102000012740 beta Adrenergic Receptors Human genes 0.000 claims description 6
- 108010079452 beta Adrenergic Receptors Proteins 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 6
- 229910052794 bromium Inorganic materials 0.000 claims description 6
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 claims description 6
- 125000002950 monocyclic group Chemical group 0.000 claims description 6
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 6
- DNYOWRQDSNGAQQ-UHFFFAOYSA-N 1-(2-bromophenyl)-3-(3-cyano-2-hydroxy-4-methylphenyl)urea Chemical compound OC1=C(C#N)C(C)=CC=C1NC(=O)NC1=CC=CC=C1Br DNYOWRQDSNGAQQ-UHFFFAOYSA-N 0.000 claims description 5
- KNPLCJZGNRGZAN-UHFFFAOYSA-N 1-(2-hydroxy-4-nitrophenyl)-3-(2-methoxyphenyl)urea Chemical compound COC1=CC=CC=C1NC(=O)NC1=CC=C([N+]([O-])=O)C=C1O KNPLCJZGNRGZAN-UHFFFAOYSA-N 0.000 claims description 5
- 201000004681 Psoriasis Diseases 0.000 claims description 5
- 125000002102 aryl alkyloxo group Chemical group 0.000 claims description 5
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 5
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 5
- CHZCERSEMVWNHL-UHFFFAOYSA-N 2-hydroxybenzonitrile Chemical class OC1=CC=CC=C1C#N CHZCERSEMVWNHL-UHFFFAOYSA-N 0.000 claims description 4
- 125000004447 heteroarylalkenyl group Chemical group 0.000 claims description 4
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 4
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 claims description 4
- 150000003573 thiols Chemical group 0.000 claims description 4
- ZUSWDTWYONAOPH-UHFFFAOYSA-N [2-(trifluoromethyl)phenyl]hydrazine;hydrochloride Chemical group [Cl-].[NH3+]NC1=CC=CC=C1C(F)(F)F ZUSWDTWYONAOPH-UHFFFAOYSA-N 0.000 claims description 3
- 125000001246 bromo group Chemical group Br* 0.000 claims description 3
- 230000008569 process Effects 0.000 claims description 3
- IAIFWAOFGOIHNN-UHFFFAOYSA-N 1-(3-cyano-2-hydroxyphenyl)-3-(2,3-dichlorophenyl)urea Chemical compound C1=CC=C(C#N)C(O)=C1NC(=O)NC1=CC=CC(Cl)=C1Cl IAIFWAOFGOIHNN-UHFFFAOYSA-N 0.000 claims description 2
- 206010040070 Septic Shock Diseases 0.000 claims 9
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 9
- 239000003937 drug carrier Substances 0.000 claims 5
- 206010014824 Endotoxic shock Diseases 0.000 claims 4
- 208000006011 Stroke Diseases 0.000 claims 4
- 230000000747 cardiac effect Effects 0.000 claims 4
- 206010001052 Acute respiratory distress syndrome Diseases 0.000 claims 3
- 208000024827 Alzheimer disease Diseases 0.000 claims 3
- 208000006545 Chronic Obstructive Pulmonary Disease Diseases 0.000 claims 3
- 206010009900 Colitis ulcerative Diseases 0.000 claims 3
- 208000011231 Crohn disease Diseases 0.000 claims 3
- 206010012438 Dermatitis atopic Diseases 0.000 claims 3
- 208000022559 Inflammatory bowel disease Diseases 0.000 claims 3
- 208000013616 Respiratory Distress Syndrome Diseases 0.000 claims 3
- 206010040047 Sepsis Diseases 0.000 claims 3
- 208000007536 Thrombosis Diseases 0.000 claims 3
- 206010044248 Toxic shock syndrome Diseases 0.000 claims 3
- 231100000650 Toxic shock syndrome Toxicity 0.000 claims 3
- 201000006704 Ulcerative Colitis Diseases 0.000 claims 3
- 208000011341 adult acute respiratory distress syndrome Diseases 0.000 claims 3
- 201000000028 adult respiratory distress syndrome Diseases 0.000 claims 3
- 206010003246 arthritis Diseases 0.000 claims 3
- 208000006673 asthma Diseases 0.000 claims 3
- 201000008937 atopic dermatitis Diseases 0.000 claims 3
- 125000005000 thioaryl group Chemical group 0.000 claims 3
- 206010018364 Glomerulonephritis Diseases 0.000 claims 2
- 206010063837 Reperfusion injury Diseases 0.000 claims 2
- 230000010410 reperfusion Effects 0.000 claims 2
- 230000036303 septic shock Effects 0.000 claims 2
- 230000000699 topical effect Effects 0.000 claims 2
- HFUVFXNYPWFSQL-UHFFFAOYSA-N 1-(2,3-dichlorophenyl)-1-(2-hydroxy-5-nitrophenyl)urea Chemical compound C=1C=CC(Cl)=C(Cl)C=1N(C(=O)N)C1=CC([N+]([O-])=O)=CC=C1O HFUVFXNYPWFSQL-UHFFFAOYSA-N 0.000 claims 1
- QBNUCTNBXCODSF-UHFFFAOYSA-N 1-(2-bromophenyl)-3-(3-chloro-2-hydroxyphenyl)urea;1-(2-hydroxy-4-nitrophenyl)-3-(2-phenoxyphenyl)urea Chemical compound OC1=C(Cl)C=CC=C1NC(=O)NC1=CC=CC=C1Br.OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=CC=C1OC1=CC=CC=C1 QBNUCTNBXCODSF-UHFFFAOYSA-N 0.000 claims 1
- 201000004624 Dermatitis Diseases 0.000 claims 1
- AIGAMZDCIBQMQW-UHFFFAOYSA-N OC1=C(C=CC(=C1)[N+](=O)[O-])NC(=O)NC1=C(C(=CC=C1)Cl)OC.OC1=C(C=CC(=C1)[N+](=O)[O-])NC(=O)NC1=C2C(=CC=C1)OCO2.OC2=C(C=CC(=C2)[N+](=O)[O-])NC(=O)NC2=C(C=CC=C2)Cl Chemical compound OC1=C(C=CC(=C1)[N+](=O)[O-])NC(=O)NC1=C(C(=CC=C1)Cl)OC.OC1=C(C=CC(=C1)[N+](=O)[O-])NC(=O)NC1=C2C(=CC=C1)OCO2.OC2=C(C=CC(=C2)[N+](=O)[O-])NC(=O)NC2=C(C=CC=C2)Cl AIGAMZDCIBQMQW-UHFFFAOYSA-N 0.000 claims 1
- 230000033115 angiogenesis Effects 0.000 claims 1
- 206010009887 colitis Diseases 0.000 claims 1
- 239000007788 liquid Substances 0.000 claims 1
- 239000012669 liquid formulation Substances 0.000 claims 1
- 238000011200 topical administration Methods 0.000 claims 1
- 235000013877 carbamide Nutrition 0.000 abstract description 101
- XKTZWUACRZHVAN-VADRZIEHSA-N interleukin-8 Chemical compound C([C@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@@H](NC(C)=O)CCSC)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H]([C@@H](C)O)C(=O)NCC(=O)N[C@@H](CCSC)C(=O)N1[C@H](CCC1)C(=O)N1[C@H](CCC1)C(=O)N[C@@H](C)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CCC(O)=O)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC=1C=CC(O)=CC=1)C(=O)N[C@H](CO)C(=O)N1[C@H](CCC1)C(N)=O)C1=CC=CC=C1 XKTZWUACRZHVAN-VADRZIEHSA-N 0.000 abstract description 23
- 229940096397 interleukin-8 Drugs 0.000 abstract description 23
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 462
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 349
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 225
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 189
- 239000000047 product Substances 0.000 description 134
- 238000005481 NMR spectroscopy Methods 0.000 description 115
- 238000001556 precipitation Methods 0.000 description 94
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 92
- 238000002451 electron ionisation mass spectrometry Methods 0.000 description 92
- 239000007787 solid Substances 0.000 description 92
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 89
- 239000011541 reaction mixture Substances 0.000 description 79
- 238000003786 synthesis reaction Methods 0.000 description 78
- 230000015572 biosynthetic process Effects 0.000 description 77
- 239000000243 solution Substances 0.000 description 73
- 239000000741 silica gel Substances 0.000 description 70
- 229910002027 silica gel Inorganic materials 0.000 description 70
- 235000019439 ethyl acetate Nutrition 0.000 description 66
- 238000004587 chromatography analysis Methods 0.000 description 62
- 239000002904 solvent Substances 0.000 description 61
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 60
- 238000001914 filtration Methods 0.000 description 57
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 54
- 239000000460 chlorine Chemical group 0.000 description 54
- 238000007429 general method Methods 0.000 description 49
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 48
- 238000010790 dilution Methods 0.000 description 41
- 239000012895 dilution Substances 0.000 description 41
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 40
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 38
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 36
- 150000003672 ureas Chemical class 0.000 description 36
- VWDWKYIASSYTQR-UHFFFAOYSA-N sodium nitrate Chemical compound [Na+].[O-][N+]([O-])=O VWDWKYIASSYTQR-UHFFFAOYSA-N 0.000 description 34
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 32
- DOPJTDJKZNWLRB-UHFFFAOYSA-N 2-Amino-5-nitrophenol Chemical compound NC1=CC=C([N+]([O-])=O)C=C1O DOPJTDJKZNWLRB-UHFFFAOYSA-N 0.000 description 31
- 238000003756 stirring Methods 0.000 description 30
- 239000012044 organic layer Substances 0.000 description 29
- 239000012074 organic phase Substances 0.000 description 28
- 229910052786 argon Inorganic materials 0.000 description 27
- 239000007858 starting material Substances 0.000 description 26
- 239000012267 brine Substances 0.000 description 23
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 23
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 21
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 21
- 235000011150 stannous chloride Nutrition 0.000 description 21
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 20
- 239000001119 stannous chloride Substances 0.000 description 20
- 230000002829 reductive effect Effects 0.000 description 18
- 235000010288 sodium nitrite Nutrition 0.000 description 18
- 239000004317 sodium nitrate Substances 0.000 description 17
- 235000010344 sodium nitrate Nutrition 0.000 description 17
- 239000000463 material Substances 0.000 description 15
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 15
- 102000005962 receptors Human genes 0.000 description 13
- 108020003175 receptors Proteins 0.000 description 13
- 125000001424 substituent group Chemical group 0.000 description 13
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 12
- 229910052763 palladium Inorganic materials 0.000 description 12
- 210000000440 neutrophil Anatomy 0.000 description 11
- 229940124530 sulfonamide Drugs 0.000 description 11
- 150000003456 sulfonamides Chemical class 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 10
- 102000016950 Chemokine CXCL1 Human genes 0.000 description 9
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 9
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 9
- 239000010410 layer Substances 0.000 description 9
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 9
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 8
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- 239000012298 atmosphere Substances 0.000 description 8
- 229910052799 carbon Inorganic materials 0.000 description 8
- 238000001953 recrystallisation Methods 0.000 description 8
- LBKNLCXXJZQFHU-UHFFFAOYSA-N 6-amino-2,3-dichlorophenol Chemical compound NC1=CC=C(Cl)C(Cl)=C1O LBKNLCXXJZQFHU-UHFFFAOYSA-N 0.000 description 7
- 108010014419 Chemokine CXCL1 Proteins 0.000 description 7
- 239000000284 extract Substances 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- 238000003818 flash chromatography Methods 0.000 description 7
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 7
- 238000006467 substitution reaction Methods 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 6
- 102100039398 C-X-C motif chemokine 2 Human genes 0.000 description 6
- 101000889128 Homo sapiens C-X-C motif chemokine 2 Proteins 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 6
- 235000011054 acetic acid Nutrition 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 6
- 239000003921 oil Substances 0.000 description 6
- 235000019198 oils Nutrition 0.000 description 6
- 229910052938 sodium sulfate Inorganic materials 0.000 description 6
- 235000011152 sodium sulphate Nutrition 0.000 description 6
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 6
- QXEDXIJDCOADGG-UHFFFAOYSA-N (2-bromophenyl)urea Chemical compound NC(=O)NC1=CC=CC=C1Br QXEDXIJDCOADGG-UHFFFAOYSA-N 0.000 description 5
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 5
- CBPGTUOXTFTWTE-UHFFFAOYSA-N 1-(1,3-benzodioxol-4-yl)-3-(2-hydroxy-4-nitrophenyl)urea Chemical compound OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=CC2=C1OCO2 CBPGTUOXTFTWTE-UHFFFAOYSA-N 0.000 description 5
- IIDUNAVOCYMUFB-UHFFFAOYSA-N 2-amino-5-fluorophenol Chemical compound NC1=CC=C(F)C=C1O IIDUNAVOCYMUFB-UHFFFAOYSA-N 0.000 description 5
- MPLDLWHRQIVKLC-UHFFFAOYSA-N 2-bromo-3-methyl-6-nitrophenol Chemical compound CC1=CC=C([N+]([O-])=O)C(O)=C1Br MPLDLWHRQIVKLC-UHFFFAOYSA-N 0.000 description 5
- 101000973997 Homo sapiens Nucleosome assembly protein 1-like 4 Proteins 0.000 description 5
- 101000947178 Homo sapiens Platelet basic protein Proteins 0.000 description 5
- 102100036154 Platelet basic protein Human genes 0.000 description 5
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 5
- RMBPEFMHABBEKP-UHFFFAOYSA-N fluorene Chemical compound C1=CC=C2C3=C[CH]C=CC3=CC2=C1 RMBPEFMHABBEKP-UHFFFAOYSA-N 0.000 description 5
- 230000002401 inhibitory effect Effects 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- NIHNNTQXNPWCJQ-UHFFFAOYSA-N o-biphenylenemethane Natural products C1=CC=C2CC3=CC=CC=C3C2=C1 NIHNNTQXNPWCJQ-UHFFFAOYSA-N 0.000 description 5
- 238000000746 purification Methods 0.000 description 5
- JYYRLQNSIZPUPF-UHFFFAOYSA-N 1-(2-bromophenyl)-3-(2-hydroxy-4-nitrophenyl)thiourea Chemical compound OC1=CC([N+]([O-])=O)=CC=C1NC(=S)NC1=CC=CC=C1Br JYYRLQNSIZPUPF-UHFFFAOYSA-N 0.000 description 4
- SWZSLTLBOSGOGA-UHFFFAOYSA-N 1-(2-bromophenyl)-3-(2-hydroxy-4-phenylphenyl)urea Chemical compound OC1=CC(C=2C=CC=CC=2)=CC=C1NC(=O)NC1=CC=CC=C1Br SWZSLTLBOSGOGA-UHFFFAOYSA-N 0.000 description 4
- IFOKUNVJYFFYQT-UHFFFAOYSA-N 1-(2-bromophenyl)-3-(3,4-difluoro-2-hydroxyphenyl)urea Chemical compound OC1=C(F)C(F)=CC=C1NC(=O)NC1=CC=CC=C1Br IFOKUNVJYFFYQT-UHFFFAOYSA-N 0.000 description 4
- IGNKQJCDASZUBP-UHFFFAOYSA-N 1-(2-bromophenyl)-3-[2-hydroxy-3-(trifluoromethyl)phenyl]urea Chemical compound C1=CC=C(C(F)(F)F)C(O)=C1NC(=O)NC1=CC=CC=C1Br IGNKQJCDASZUBP-UHFFFAOYSA-N 0.000 description 4
- JFLMWUAMXJXUAG-UHFFFAOYSA-N 1-(2-chlorophenyl)-3-(2-hydroxy-4-nitrophenyl)urea Chemical compound OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=CC=C1Cl JFLMWUAMXJXUAG-UHFFFAOYSA-N 0.000 description 4
- UZWXETXUKFOJFK-UHFFFAOYSA-N 1-(2-hydroxy-4-nitrophenyl)-3-(2-methylsulfanylphenyl)urea Chemical compound CSC1=CC=CC=C1NC(=O)NC1=CC=C([N+]([O-])=O)C=C1O UZWXETXUKFOJFK-UHFFFAOYSA-N 0.000 description 4
- KACUYPOBOHDUPW-UHFFFAOYSA-N 1-(2-hydroxy-4-nitrophenyl)-3-phenylthiourea Chemical compound OC1=CC([N+]([O-])=O)=CC=C1NC(=S)NC1=CC=CC=C1 KACUYPOBOHDUPW-UHFFFAOYSA-N 0.000 description 4
- UFYKIHANBCVMKW-UHFFFAOYSA-N 1-(4-azido-2-hydroxyphenyl)-3-(2-methoxyphenyl)urea Chemical compound COC1=CC=CC=C1NC(=O)NC1=CC=C(N=[N+]=[N-])C=C1O UFYKIHANBCVMKW-UHFFFAOYSA-N 0.000 description 4
- CENOMWDZGNQIGT-UHFFFAOYSA-N 1-(5-bromo-3-fluoro-2-hydroxyphenyl)-3-(2-bromophenyl)urea Chemical compound OC1=C(F)C=C(Br)C=C1NC(=O)NC1=CC=CC=C1Br CENOMWDZGNQIGT-UHFFFAOYSA-N 0.000 description 4
- ZYQPVOZZWSDVQB-UHFFFAOYSA-N 1-[2-hydroxy-4-(trifluoromethyl)phenyl]-3-phenylurea Chemical compound OC1=CC(C(F)(F)F)=CC=C1NC(=O)NC1=CC=CC=C1 ZYQPVOZZWSDVQB-UHFFFAOYSA-N 0.000 description 4
- WAFUAYGNTDBHDS-UHFFFAOYSA-N 2-[tert-butyl(dimethyl)silyl]oxy-4-nitroaniline Chemical compound CC(C)(C)[Si](C)(C)OC1=CC([N+]([O-])=O)=CC=C1N WAFUAYGNTDBHDS-UHFFFAOYSA-N 0.000 description 4
- ILZRAAUVZAXXKZ-UHFFFAOYSA-N 2-amino-5-(trifluoromethyl)phenol Chemical compound NC1=CC=C(C(F)(F)F)C=C1O ILZRAAUVZAXXKZ-UHFFFAOYSA-N 0.000 description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 150000001448 anilines Chemical class 0.000 description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 4
- 235000015165 citric acid Nutrition 0.000 description 4
- 238000004440 column chromatography Methods 0.000 description 4
- 238000007865 diluting Methods 0.000 description 4
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 4
- 235000019341 magnesium sulphate Nutrition 0.000 description 4
- 230000001376 precipitating effect Effects 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- UUDFKBXAWIEQJG-UHFFFAOYSA-N 1-(2-bromophenyl)-3-(2-hydroxy-3-nitrophenyl)urea Chemical compound C1=CC=C([N+]([O-])=O)C(O)=C1NC(=O)NC1=CC=CC=C1Br UUDFKBXAWIEQJG-UHFFFAOYSA-N 0.000 description 3
- YPUIHNGFAQOMLY-UHFFFAOYSA-N 1-(2-bromophenyl)-3-(2-hydroxy-3-phenylmethoxyphenyl)urea Chemical compound C1=CC=C(OCC=2C=CC=CC=2)C(O)=C1NC(=O)NC1=CC=CC=C1Br YPUIHNGFAQOMLY-UHFFFAOYSA-N 0.000 description 3
- SEBYEVXUHHITRG-UHFFFAOYSA-N 1-(2-bromophenyl)-3-(2-hydroxy-3-propylphenyl)urea Chemical compound CCCC1=CC=CC(NC(=O)NC=2C(=CC=CC=2)Br)=C1O SEBYEVXUHHITRG-UHFFFAOYSA-N 0.000 description 3
- XJGIXEVHERZBQV-UHFFFAOYSA-N 1-(2-bromophenyl)-3-(3-cyano-2-hydroxyphenyl)urea Chemical compound C1=CC=C(C#N)C(O)=C1NC(=O)NC1=CC=CC=C1Br XJGIXEVHERZBQV-UHFFFAOYSA-N 0.000 description 3
- KYMGMLIJGMOCOG-UHFFFAOYSA-N 1-(2-bromophenyl)-3-(3-fluoro-2-hydroxyphenyl)urea Chemical compound OC1=C(F)C=CC=C1NC(=O)NC1=CC=CC=C1Br KYMGMLIJGMOCOG-UHFFFAOYSA-N 0.000 description 3
- ANTFJOTVFCVVAW-UHFFFAOYSA-N 1-(2-bromophenyl)-3-(3-hydroxynaphthalen-2-yl)urea Chemical compound OC1=CC2=CC=CC=C2C=C1NC(=O)NC1=CC=CC=C1Br ANTFJOTVFCVVAW-UHFFFAOYSA-N 0.000 description 3
- QWLSUPKOFQHSRW-UHFFFAOYSA-N 1-(2-bromophenyl)-3-(4-bromo-2-sulfanylphenyl)urea Chemical compound SC1=CC(Br)=CC=C1NC(=O)NC1=CC=CC=C1Br QWLSUPKOFQHSRW-UHFFFAOYSA-N 0.000 description 3
- DHXOJNFEHNIGMB-UHFFFAOYSA-N 1-(2-bromophenyl)-3-(4-fluoro-2-hydroxyphenyl)urea Chemical compound OC1=CC(F)=CC=C1NC(=O)NC1=CC=CC=C1Br DHXOJNFEHNIGMB-UHFFFAOYSA-N 0.000 description 3
- KPJZGZQNCRHCPT-UHFFFAOYSA-N 1-(2-bromophenyl)-3-(5-fluoro-2-hydroxyphenyl)urea Chemical compound OC1=CC=C(F)C=C1NC(=O)NC1=CC=CC=C1Br KPJZGZQNCRHCPT-UHFFFAOYSA-N 0.000 description 3
- YWKGOEOCYBFILN-UHFFFAOYSA-N 1-(2-bromophenyl)-3-[2-[[2-(trifluoromethyl)phenyl]sulfonylamino]phenyl]urea Chemical compound FC(F)(F)C1=CC=CC=C1S(=O)(=O)NC1=CC=CC=C1NC(=O)NC1=CC=CC=C1Br YWKGOEOCYBFILN-UHFFFAOYSA-N 0.000 description 3
- IHPOVFSDJQPNOC-BUHFOSPRSA-N 1-(2-bromophenyl)-3-[2-hydroxy-3-[(E)-2-phenylethenyl]phenyl]urea Chemical compound C1=CC=C(\C=C\C=2C=CC=CC=2)C(O)=C1NC(=O)NC1=CC=CC=C1Br IHPOVFSDJQPNOC-BUHFOSPRSA-N 0.000 description 3
- ZGBWDCCQBAHGGC-UHFFFAOYSA-N 1-(2-chloro-6-methylphenyl)-3-(2-hydroxy-4-nitrophenyl)urea Chemical compound CC1=CC=CC(Cl)=C1NC(=O)NC1=CC=C([N+]([O-])=O)C=C1O ZGBWDCCQBAHGGC-UHFFFAOYSA-N 0.000 description 3
- XXMZFIZXCJRLQC-UHFFFAOYSA-N 1-(2-ethoxyphenyl)-3-(2-hydroxy-4-nitrophenyl)urea Chemical compound CCOC1=CC=CC=C1NC(=O)NC1=CC=C([N+]([O-])=O)C=C1O XXMZFIZXCJRLQC-UHFFFAOYSA-N 0.000 description 3
- PZBLZIXURGLVNI-UHFFFAOYSA-N 1-(2-ethylphenyl)-3-(2-hydroxy-4-nitrophenyl)urea Chemical compound CCC1=CC=CC=C1NC(=O)NC1=CC=C([N+]([O-])=O)C=C1O PZBLZIXURGLVNI-UHFFFAOYSA-N 0.000 description 3
- PMMYTIINRJXKSU-UHFFFAOYSA-N 1-(2-hydroxy-4-nitrophenyl)-3-(2-iodophenyl)urea Chemical compound OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=CC=C1I PMMYTIINRJXKSU-UHFFFAOYSA-N 0.000 description 3
- MHEWCJHSRKVNIF-UHFFFAOYSA-N 1-(2-hydroxy-4-nitrophenyl)-3-(2-phenoxyphenyl)urea Chemical compound OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=CC=C1OC1=CC=CC=C1 MHEWCJHSRKVNIF-UHFFFAOYSA-N 0.000 description 3
- QZOTURNBPCCOPX-UHFFFAOYSA-N 1-(2-hydroxy-4-nitrophenyl)-3-(3-methoxyphenyl)urea Chemical compound COC1=CC=CC(NC(=O)NC=2C(=CC(=CC=2)[N+]([O-])=O)O)=C1 QZOTURNBPCCOPX-UHFFFAOYSA-N 0.000 description 3
- USGOTVZCMDLNGF-UHFFFAOYSA-N 1-(2-hydroxy-4-nitrophenyl)-3-(3-methoxythiophen-2-yl)urea Chemical compound C1=CSC(NC(=O)NC=2C(=CC(=CC=2)[N+]([O-])=O)O)=C1OC USGOTVZCMDLNGF-UHFFFAOYSA-N 0.000 description 3
- PQAXIHNOJWBTGN-UHFFFAOYSA-N 1-(2-hydroxy-5-nitrophenyl)-3-(3-methoxythiophen-2-yl)urea Chemical compound C1=CSC(NC(=O)NC=2C(=CC=C(C=2)[N+]([O-])=O)O)=C1OC PQAXIHNOJWBTGN-UHFFFAOYSA-N 0.000 description 3
- MHNNUSRLYWTBJF-UHFFFAOYSA-N 1-(2-hydroxy-5-nitrophenyl)-3-phenylurea Chemical compound OC1=CC=C([N+]([O-])=O)C=C1NC(=O)NC1=CC=CC=C1 MHNNUSRLYWTBJF-UHFFFAOYSA-N 0.000 description 3
- LYGPWVRHLXLGNP-UHFFFAOYSA-N 1-(3-bromophenyl)-3-(2-hydroxy-4-nitrophenyl)urea Chemical compound OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=CC(Br)=C1 LYGPWVRHLXLGNP-UHFFFAOYSA-N 0.000 description 3
- ZHFMJOHHDQGOTA-UHFFFAOYSA-N 1-(4-cyano-2-hydroxyphenyl)-3-(2-methoxyphenyl)urea Chemical compound COC1=CC=CC=C1NC(=O)NC1=CC=C(C#N)C=C1O ZHFMJOHHDQGOTA-UHFFFAOYSA-N 0.000 description 3
- WXLBSLQDYGMCGF-UHFFFAOYSA-N 1-(4-cyano-2-hydroxyphenyl)-3-(2-methylphenyl)urea Chemical compound CC1=CC=CC=C1NC(=O)NC1=CC=C(C#N)C=C1O WXLBSLQDYGMCGF-UHFFFAOYSA-N 0.000 description 3
- PSODDICKDGEFJX-UHFFFAOYSA-N 1-(4-cyano-2-hydroxyphenyl)-3-[2-(trifluoromethyl)phenyl]urea Chemical compound OC1=CC(C#N)=CC=C1NC(=O)NC1=CC=CC=C1C(F)(F)F PSODDICKDGEFJX-UHFFFAOYSA-N 0.000 description 3
- YGAGRJGVAXCRFI-UHFFFAOYSA-N 1-(4-fluoro-2-hydroxyphenyl)-3-phenylurea Chemical compound OC1=CC(F)=CC=C1NC(=O)NC1=CC=CC=C1 YGAGRJGVAXCRFI-UHFFFAOYSA-N 0.000 description 3
- IHHUGFJSEJSCGE-UHFFFAOYSA-N 1-isocyanato-2-phenylbenzene Chemical compound O=C=NC1=CC=CC=C1C1=CC=CC=C1 IHHUGFJSEJSCGE-UHFFFAOYSA-N 0.000 description 3
- VRVRGVPWCUEOGV-UHFFFAOYSA-N 2-aminothiophenol Chemical compound NC1=CC=CC=C1S VRVRGVPWCUEOGV-UHFFFAOYSA-N 0.000 description 3
- OSIJREAKAWRMJQ-UHFFFAOYSA-N 2-nitro-6-phenylmethoxyphenol Chemical compound C1=CC=C([N+]([O-])=O)C(O)=C1OCC1=CC=CC=C1 OSIJREAKAWRMJQ-UHFFFAOYSA-N 0.000 description 3
- BNWWISXBCWURFH-UHFFFAOYSA-N 3-[(2-bromophenyl)carbamoylamino]-2-hydroxy-n-phenylbenzamide Chemical compound C1=CC=C(C(=O)NC=2C=CC=CC=2)C(O)=C1NC(=O)NC1=CC=CC=C1Br BNWWISXBCWURFH-UHFFFAOYSA-N 0.000 description 3
- IUUXZDXFVTWINA-UHFFFAOYSA-N 3-[2-[(2-bromophenyl)carbamoylamino]phenyl]-2-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=CC(C=2C(=CC=CC=2)NC(=O)NC=2C(=CC=CC=2)Br)=C1O IUUXZDXFVTWINA-UHFFFAOYSA-N 0.000 description 3
- JHNIFYUIFUWEFO-UHFFFAOYSA-N 3-hydroxy-4-nitrobenzonitrile Chemical compound OC1=CC(C#N)=CC=C1[N+]([O-])=O JHNIFYUIFUWEFO-UHFFFAOYSA-N 0.000 description 3
- SGHBRHKBCLLVCI-UHFFFAOYSA-N 3-hydroxybenzonitrile Chemical compound OC1=CC=CC(C#N)=C1 SGHBRHKBCLLVCI-UHFFFAOYSA-N 0.000 description 3
- LSSMRBBQCHSDNS-UHFFFAOYSA-N 3-methoxythiophene-2-carboxylic acid Chemical compound COC=1C=CSC=1C(O)=O LSSMRBBQCHSDNS-UHFFFAOYSA-N 0.000 description 3
- FVKYLHATVWKUMW-UHFFFAOYSA-N 402-17-5 Chemical compound OC1=CC(C(F)(F)F)=CC=C1[N+]([O-])=O FVKYLHATVWKUMW-UHFFFAOYSA-N 0.000 description 3
- QQURWFRNETXFTN-UHFFFAOYSA-N 5-fluoro-2-nitrophenol Chemical compound OC1=CC(F)=CC=C1[N+]([O-])=O QQURWFRNETXFTN-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 210000003651 basophil Anatomy 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 229910052801 chlorine Chemical group 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 230000006870 function Effects 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 3
- MOMPWLMXIZNJGK-UHFFFAOYSA-N methyl 3-hydroxy-4-(phenylcarbamoylamino)benzoate Chemical compound OC1=CC(C(=O)OC)=CC=C1NC(=O)NC1=CC=CC=C1 MOMPWLMXIZNJGK-UHFFFAOYSA-N 0.000 description 3
- OCZXDVNSNDITBS-UHFFFAOYSA-N methyl 4-amino-3-hydroxybenzoate Chemical compound COC(=O)C1=CC=C(N)C(O)=C1 OCZXDVNSNDITBS-UHFFFAOYSA-N 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 238000010898 silica gel chromatography Methods 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 description 3
- AKCUGQGKWDRTGL-UHFFFAOYSA-N (2-hydroxy-3-nitrophenyl)-phenylmethanone Chemical compound C1=CC=C([N+]([O-])=O)C(O)=C1C(=O)C1=CC=CC=C1 AKCUGQGKWDRTGL-UHFFFAOYSA-N 0.000 description 2
- HJIAMFHSAAEUKR-UHFFFAOYSA-N (2-hydroxyphenyl)-phenylmethanone Chemical compound OC1=CC=CC=C1C(=O)C1=CC=CC=C1 HJIAMFHSAAEUKR-UHFFFAOYSA-N 0.000 description 2
- DRAKOGLGKMMYMG-UHFFFAOYSA-N (3-amino-2-hydroxyphenyl)-phenylmethanone Chemical compound NC1=CC=CC(C(=O)C=2C=CC=CC=2)=C1O DRAKOGLGKMMYMG-UHFFFAOYSA-N 0.000 description 2
- UIVHJEKZRQNSEB-UHFFFAOYSA-N (3-hydroxy-4-nitrophenyl)-phenylmethanone Chemical compound C1=C([N+]([O-])=O)C(O)=CC(C(=O)C=2C=CC=CC=2)=C1 UIVHJEKZRQNSEB-UHFFFAOYSA-N 0.000 description 2
- GTIBQOVZWUVLOF-UHFFFAOYSA-N (4-amino-3-hydroxyphenyl)-phenylmethanone Chemical compound C1=C(O)C(N)=CC=C1C(=O)C1=CC=CC=C1 GTIBQOVZWUVLOF-UHFFFAOYSA-N 0.000 description 2
- DBUAYOWCIUQXQW-UHFFFAOYSA-N 1,3-benzodioxole-4-carboxylic acid Chemical compound OC(=O)C1=CC=CC2=C1OCO2 DBUAYOWCIUQXQW-UHFFFAOYSA-N 0.000 description 2
- IDEIMXJJLMVTNN-UHFFFAOYSA-N 1,3-bis(2-hydroxy-4-nitrophenyl)urea Chemical compound OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=C([N+]([O-])=O)C=C1O IDEIMXJJLMVTNN-UHFFFAOYSA-N 0.000 description 2
- MGOABCWEOZZCDP-UHFFFAOYSA-N 1-(2,4-dibromophenyl)-3-(2-hydroxy-4-nitrophenyl)urea Chemical compound OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=C(Br)C=C1Br MGOABCWEOZZCDP-UHFFFAOYSA-N 0.000 description 2
- CWCZXUGASXHLMK-UHFFFAOYSA-N 1-(2,4-dichlorophenyl)-3-(2-hydroxy-4-nitrophenyl)urea Chemical compound OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=C(Cl)C=C1Cl CWCZXUGASXHLMK-UHFFFAOYSA-N 0.000 description 2
- XILFIFFHXSCDSI-UHFFFAOYSA-N 1-(2,4-dimethoxyphenyl)-3-(2-hydroxy-3-nitrophenyl)urea Chemical compound COC1=CC(OC)=CC=C1NC(=O)NC1=CC=CC([N+]([O-])=O)=C1O XILFIFFHXSCDSI-UHFFFAOYSA-N 0.000 description 2
- UHOSHUNGLMWKCU-UHFFFAOYSA-N 1-(2-anilinophenyl)-3-(2-hydroxy-4-nitrophenyl)urea Chemical compound OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=CC=C1NC1=CC=CC=C1 UHOSHUNGLMWKCU-UHFFFAOYSA-N 0.000 description 2
- OQVARPSTLHEQDV-UHFFFAOYSA-N 1-(2-bromophenyl)-3-(2-hydroxy-3-iodophenyl)urea Chemical compound OC1=C(I)C=CC=C1NC(=O)NC1=CC=CC=C1Br OQVARPSTLHEQDV-UHFFFAOYSA-N 0.000 description 2
- ZDQFTSZMJHUTNA-UHFFFAOYSA-N 1-(2-bromophenyl)-3-(2-hydroxy-4-methylphenyl)urea Chemical compound OC1=CC(C)=CC=C1NC(=O)NC1=CC=CC=C1Br ZDQFTSZMJHUTNA-UHFFFAOYSA-N 0.000 description 2
- MQBZVUNNWUIPMK-UHFFFAOYSA-N 1-(2-bromophenyl)-3-(2-hydroxy-4-nitrophenyl)urea Chemical compound OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=CC=C1Br MQBZVUNNWUIPMK-UHFFFAOYSA-N 0.000 description 2
- FWFSLMHCHRDAMD-UHFFFAOYSA-N 1-(2-bromophenyl)-3-(2-hydroxynaphthalen-1-yl)urea Chemical compound OC1=CC=C2C=CC=CC2=C1NC(=O)NC1=CC=CC=C1Br FWFSLMHCHRDAMD-UHFFFAOYSA-N 0.000 description 2
- AZKFSKBGJUVCLP-UHFFFAOYSA-N 1-(2-bromophenyl)-3-(4-carbamimidoyl-2-hydroxyphenyl)urea Chemical compound OC1=CC(C(=N)N)=CC=C1NC(=O)NC1=CC=CC=C1Br AZKFSKBGJUVCLP-UHFFFAOYSA-N 0.000 description 2
- GLAXMZMFLGMTKJ-UHFFFAOYSA-N 1-(2-bromophenyl)-3-[2-(quinolin-8-ylsulfonylamino)phenyl]urea Chemical compound BrC1=CC=CC=C1NC(=O)NC1=CC=CC=C1NS(=O)(=O)C1=CC=CC2=CC=CN=C12 GLAXMZMFLGMTKJ-UHFFFAOYSA-N 0.000 description 2
- MZFHJQMUHUVVLD-UHFFFAOYSA-N 1-(2-bromophenyl)-3-[2-hydroxy-5-(trifluoromethyl)phenyl]urea Chemical compound OC1=CC=C(C(F)(F)F)C=C1NC(=O)NC1=CC=CC=C1Br MZFHJQMUHUVVLD-UHFFFAOYSA-N 0.000 description 2
- MWODCLJTSRCRGB-UHFFFAOYSA-N 1-(2-bromophenyl)-3-[3-fluoro-2-hydroxy-4-(trifluoromethyl)phenyl]urea Chemical compound OC1=C(F)C(C(F)(F)F)=CC=C1NC(=O)NC1=CC=CC=C1Br MWODCLJTSRCRGB-UHFFFAOYSA-N 0.000 description 2
- MMAUESFMECKUNZ-UHFFFAOYSA-N 1-(2-hydroxy-3-nitrophenyl)-3-(2-methoxyphenyl)urea Chemical compound COC1=CC=CC=C1NC(=O)NC1=CC=CC([N+]([O-])=O)=C1O MMAUESFMECKUNZ-UHFFFAOYSA-N 0.000 description 2
- UVKMNMVUVHZSGN-UHFFFAOYSA-N 1-(2-hydroxy-3-nitrophenyl)-3-(2-phenylphenyl)urea Chemical compound C1=CC=C([N+]([O-])=O)C(O)=C1NC(=O)NC1=CC=CC=C1C1=CC=CC=C1 UVKMNMVUVHZSGN-UHFFFAOYSA-N 0.000 description 2
- PZAGGMAGNKZGNR-UHFFFAOYSA-N 1-(2-hydroxy-3-nitrophenyl)-3-(4-methoxyphenyl)urea Chemical compound C1=CC(OC)=CC=C1NC(=O)NC1=CC=CC([N+]([O-])=O)=C1O PZAGGMAGNKZGNR-UHFFFAOYSA-N 0.000 description 2
- DZLCFOMBBDNYIQ-UHFFFAOYSA-N 1-(2-hydroxy-3-nitrophenyl)-3-phenylurea Chemical compound C1=CC=C([N+]([O-])=O)C(O)=C1NC(=O)NC1=CC=CC=C1 DZLCFOMBBDNYIQ-UHFFFAOYSA-N 0.000 description 2
- JDKDJPABXADLJT-UHFFFAOYSA-N 1-(2-hydroxy-4-nitrophenyl)-3-(2-methylphenyl)urea Chemical compound CC1=CC=CC=C1NC(=O)NC1=CC=C([N+]([O-])=O)C=C1O JDKDJPABXADLJT-UHFFFAOYSA-N 0.000 description 2
- TVHIIIDDOHJFQT-UHFFFAOYSA-N 1-(2-hydroxy-4-nitrophenyl)-3-(2-nitrophenyl)urea Chemical compound OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=CC=C1[N+]([O-])=O TVHIIIDDOHJFQT-UHFFFAOYSA-N 0.000 description 2
- MPSVIJAQCVNHHQ-UHFFFAOYSA-N 1-(2-hydroxy-4-nitrophenyl)-3-(2-phenylphenyl)urea Chemical compound OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=CC=C1C1=CC=CC=C1 MPSVIJAQCVNHHQ-UHFFFAOYSA-N 0.000 description 2
- QRHHITAIKWZLND-UHFFFAOYSA-N 1-(2-hydroxy-4-nitrophenyl)-3-[2-(thiophen-2-ylsulfonylamino)phenyl]urea Chemical compound OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=CC=C1NS(=O)(=O)C1=CC=CS1 QRHHITAIKWZLND-UHFFFAOYSA-N 0.000 description 2
- ARLIDMNFLJKZDA-UHFFFAOYSA-N 1-(2-hydroxy-4-nitrophenyl)-3-[2-(trifluoromethyl)phenyl]urea Chemical compound OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=CC=C1C(F)(F)F ARLIDMNFLJKZDA-UHFFFAOYSA-N 0.000 description 2
- SBPFCKQEIYYHBN-UHFFFAOYSA-N 1-(2-hydroxy-4-nitrophenyl)-3-naphthalen-1-ylurea Chemical compound OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=CC2=CC=CC=C12 SBPFCKQEIYYHBN-UHFFFAOYSA-N 0.000 description 2
- WJGRUAQVAFBYOC-UHFFFAOYSA-N 1-(3,4-dichloro-2-hydroxyphenyl)-3-(2,3-dichlorophenyl)urea Chemical compound OC1=C(Cl)C(Cl)=CC=C1NC(=O)NC1=CC=CC(Cl)=C1Cl WJGRUAQVAFBYOC-UHFFFAOYSA-N 0.000 description 2
- PXEWTGQJHBTLOG-UHFFFAOYSA-N 1-(3,4-dichloro-2-hydroxyphenyl)-3-(2-methoxyphenyl)urea Chemical compound COC1=CC=CC=C1NC(=O)NC1=CC=C(Cl)C(Cl)=C1O PXEWTGQJHBTLOG-UHFFFAOYSA-N 0.000 description 2
- UAXAGWYQMOAGGL-UHFFFAOYSA-N 1-(3,4-dichloro-2-hydroxyphenyl)-3-[3-(trifluoromethyl)phenyl]urea Chemical compound OC1=C(Cl)C(Cl)=CC=C1NC(=O)NC1=CC=CC(C(F)(F)F)=C1 UAXAGWYQMOAGGL-UHFFFAOYSA-N 0.000 description 2
- IVTNMVXSFFOHJN-UHFFFAOYSA-N 1-(3-azido-2-hydroxyphenyl)-3-(2-bromophenyl)urea Chemical compound C1=CC=C(N=[N+]=[N-])C(O)=C1NC(=O)NC1=CC=CC=C1Br IVTNMVXSFFOHJN-UHFFFAOYSA-N 0.000 description 2
- GTJXCKKJNGSTCK-UHFFFAOYSA-N 1-(3-chloro-2-methoxyphenyl)-3-(2-hydroxy-4-nitrophenyl)urea Chemical compound COC1=C(Cl)C=CC=C1NC(=O)NC1=CC=C([N+]([O-])=O)C=C1O GTJXCKKJNGSTCK-UHFFFAOYSA-N 0.000 description 2
- QWZLDYXVOLMCAQ-UHFFFAOYSA-N 1-(3-chloro-2-methylphenyl)-3-[4-cyano-2-(2-sulfamoylphenyl)phenyl]urea Chemical compound CC1=C(Cl)C=CC=C1NC(=O)NC1=CC=C(C#N)C=C1C1=CC=CC=C1S(N)(=O)=O QWZLDYXVOLMCAQ-UHFFFAOYSA-N 0.000 description 2
- JFGPRCHQZYGZRH-UHFFFAOYSA-N 1-(3-cyano-2-hydroxyphenyl)-3-phenylurea Chemical compound C1=CC=C(C#N)C(O)=C1NC(=O)NC1=CC=CC=C1 JFGPRCHQZYGZRH-UHFFFAOYSA-N 0.000 description 2
- VLTYOEWMUZCCBG-UHFFFAOYSA-N 1-(3-fluoro-2-hydroxyphenyl)-3-phenylurea Chemical compound OC1=C(F)C=CC=C1NC(=O)NC1=CC=CC=C1 VLTYOEWMUZCCBG-UHFFFAOYSA-N 0.000 description 2
- WWGPATOURAKKMY-UHFFFAOYSA-N 1-(4-amino-2-hydroxyphenyl)-3-(2-methoxyphenyl)urea Chemical compound COC1=CC=CC=C1NC(=O)NC1=CC=C(N)C=C1O WWGPATOURAKKMY-UHFFFAOYSA-N 0.000 description 2
- QOMIBRVYULIIPL-UHFFFAOYSA-N 1-(4-azido-2-hydroxyphenyl)-3-(2-iodophenyl)urea Chemical compound OC1=CC(N=[N+]=[N-])=CC=C1NC(=O)NC1=CC=CC=C1I QOMIBRVYULIIPL-UHFFFAOYSA-N 0.000 description 2
- WRABKWBTESAPEL-UHFFFAOYSA-N 1-(4-bromophenyl)-3-(2-hydroxy-4-nitrophenyl)urea Chemical compound OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=C(Br)C=C1 WRABKWBTESAPEL-UHFFFAOYSA-N 0.000 description 2
- DQRKQLTUZBFHPB-UHFFFAOYSA-N 1-(4-cyano-2-hydroxyphenyl)-3-(2,3-dichlorophenyl)urea Chemical compound OC1=CC(C#N)=CC=C1NC(=O)NC1=CC=CC(Cl)=C1Cl DQRKQLTUZBFHPB-UHFFFAOYSA-N 0.000 description 2
- DUMLBLQIHLMJQY-UHFFFAOYSA-N 1-(4-cyano-2-hydroxyphenyl)-3-(4-methoxyphenyl)urea Chemical compound C1=CC(OC)=CC=C1NC(=O)NC1=CC=C(C#N)C=C1O DUMLBLQIHLMJQY-UHFFFAOYSA-N 0.000 description 2
- XMRINSFTUHMFOS-UHFFFAOYSA-N 1-(4-cyano-2-hydroxyphenyl)-3-[2-(pyridin-3-ylmethoxy)phenyl]urea Chemical compound OC1=CC(C#N)=CC=C1NC(=O)NC1=CC=CC=C1OCC1=CC=CN=C1 XMRINSFTUHMFOS-UHFFFAOYSA-N 0.000 description 2
- HGRXXAGRIICSQS-UHFFFAOYSA-N 1-(4-cyano-2-hydroxyphenyl)-3-[3-(trifluoromethyl)phenyl]urea Chemical compound OC1=CC(C#N)=CC=C1NC(=O)NC1=CC=CC(C(F)(F)F)=C1 HGRXXAGRIICSQS-UHFFFAOYSA-N 0.000 description 2
- BIMKTPJMZSGZJT-UHFFFAOYSA-N 1-(4-cyano-2-hydroxyphenyl)-3-[4-(trifluoromethyl)phenyl]urea Chemical compound OC1=CC(C#N)=CC=C1NC(=O)NC1=CC=C(C(F)(F)F)C=C1 BIMKTPJMZSGZJT-UHFFFAOYSA-N 0.000 description 2
- XRZHCICQICNYCB-UHFFFAOYSA-N 1-(4-cyano-2-hydroxyphenyl)-3-phenylurea Chemical compound OC1=CC(C#N)=CC=C1NC(=O)NC1=CC=CC=C1 XRZHCICQICNYCB-UHFFFAOYSA-N 0.000 description 2
- WQWZNSXJVUFVEA-UHFFFAOYSA-N 1-[2-(benzenesulfonamido)-4-cyanophenyl]-3-(2-chlorophenyl)urea Chemical compound ClC1=CC=CC=C1NC(=O)NC1=CC=C(C#N)C=C1NS(=O)(=O)C1=CC=CC=C1 WQWZNSXJVUFVEA-UHFFFAOYSA-N 0.000 description 2
- ZNBXRJLDMXLTMO-UHFFFAOYSA-N 1-[2-(benzenesulfonamido)-4-cyanophenyl]-3-(2-fluorophenyl)urea Chemical compound FC1=CC=CC=C1NC(=O)NC1=CC=C(C#N)C=C1NS(=O)(=O)C1=CC=CC=C1 ZNBXRJLDMXLTMO-UHFFFAOYSA-N 0.000 description 2
- VEGPUBIFKGOOQM-UHFFFAOYSA-N 1-[2-(benzenesulfonamido)-4-cyanophenyl]-3-(2-methoxyphenyl)urea Chemical compound COC1=CC=CC=C1NC(=O)NC1=CC=C(C#N)C=C1NS(=O)(=O)C1=CC=CC=C1 VEGPUBIFKGOOQM-UHFFFAOYSA-N 0.000 description 2
- ZVVIYSXVNYTRHB-UHFFFAOYSA-N 1-[2-(benzenesulfonamido)-4-cyanophenyl]-3-[2-(trifluoromethoxy)phenyl]urea Chemical compound FC(F)(F)OC1=CC=CC=C1NC(=O)NC1=CC=C(C#N)C=C1NS(=O)(=O)C1=CC=CC=C1 ZVVIYSXVNYTRHB-UHFFFAOYSA-N 0.000 description 2
- YYVYSIJYHXKDCP-UHFFFAOYSA-N 1-[2-(benzenesulfonamido)-4-nitrophenyl]-3-(2-bromophenyl)urea Chemical compound C=1C=CC=CC=1S(=O)(=O)NC1=CC([N+](=O)[O-])=CC=C1NC(=O)NC1=CC=CC=C1Br YYVYSIJYHXKDCP-UHFFFAOYSA-N 0.000 description 2
- WDUQWXBGIVITRM-UHFFFAOYSA-N 1-[2-(benzylsulfonylamino)phenyl]-3-(2-bromophenyl)urea Chemical compound BrC1=CC=CC=C1NC(=O)NC1=CC=CC=C1NS(=O)(=O)CC1=CC=CC=C1 WDUQWXBGIVITRM-UHFFFAOYSA-N 0.000 description 2
- SWIRMXTXRCDCJK-UHFFFAOYSA-N 1-[2-hydroxy-4-(trifluoromethyl)phenyl]-3-(2-phenylphenyl)urea Chemical compound OC1=CC(C(F)(F)F)=CC=C1NC(=O)NC1=CC=CC=C1C1=CC=CC=C1 SWIRMXTXRCDCJK-UHFFFAOYSA-N 0.000 description 2
- QAUYDNWQNRMCIU-UHFFFAOYSA-N 1-phenyl-3-(2-sulfanylphenyl)urea Chemical compound SC1=CC=CC=C1NC(=O)NC1=CC=CC=C1 QAUYDNWQNRMCIU-UHFFFAOYSA-N 0.000 description 2
- SJWMPHKDBJQBBJ-UHFFFAOYSA-N 2,3-dichloro-6-nitrophenol Chemical compound OC1=C(Cl)C(Cl)=CC=C1[N+]([O-])=O SJWMPHKDBJQBBJ-UHFFFAOYSA-N 0.000 description 2
- VLZVIIYRNMWPSN-UHFFFAOYSA-N 2-Amino-4-nitrophenol Chemical compound NC1=CC([N+]([O-])=O)=CC=C1O VLZVIIYRNMWPSN-UHFFFAOYSA-N 0.000 description 2
- PJIQDIIKISUDNK-UHFFFAOYSA-N 2-[(2-amino-5-bromophenyl)disulfanyl]-4-bromoaniline Chemical compound NC1=CC=C(Br)C=C1SSC1=CC(Br)=CC=C1N PJIQDIIKISUDNK-UHFFFAOYSA-N 0.000 description 2
- BOBATFKNMFWLFG-UHFFFAOYSA-N 2-amino-2-cyano-n-methylacetamide Chemical compound CNC(=O)C(N)C#N BOBATFKNMFWLFG-UHFFFAOYSA-N 0.000 description 2
- WASQBNCGNUTVNI-UHFFFAOYSA-N 2-amino-4,6-dichlorophenol Chemical compound NC1=CC(Cl)=CC(Cl)=C1O WASQBNCGNUTVNI-UHFFFAOYSA-N 0.000 description 2
- BHTKIYIEMXRHGL-UHFFFAOYSA-N 2-amino-4-(trifluoromethyl)phenol Chemical compound NC1=CC(C(F)(F)F)=CC=C1O BHTKIYIEMXRHGL-UHFFFAOYSA-N 0.000 description 2
- BXNQDUMAPNIZAG-UHFFFAOYSA-N 2-amino-4-bromo-6-fluorophenol Chemical compound NC1=CC(Br)=CC(F)=C1O BXNQDUMAPNIZAG-UHFFFAOYSA-N 0.000 description 2
- VBCFPAKCBOGUBW-UHFFFAOYSA-N 2-amino-5-ethylphenol Chemical compound CCC1=CC=C(N)C(O)=C1 VBCFPAKCBOGUBW-UHFFFAOYSA-N 0.000 description 2
- ILGJVPVZCNNBKI-UHFFFAOYSA-N 2-amino-5-phenylphenol Chemical compound C1=C(O)C(N)=CC=C1C1=CC=CC=C1 ILGJVPVZCNNBKI-UHFFFAOYSA-N 0.000 description 2
- XOXAZFFGKMIJKE-UHFFFAOYSA-N 2-amino-6-(trifluoromethyl)phenol Chemical compound NC1=CC=CC(C(F)(F)F)=C1O XOXAZFFGKMIJKE-UHFFFAOYSA-N 0.000 description 2
- APMAGJYKMMAXBU-MDZDMXLPSA-N 2-amino-6-[(E)-2-phenylethenyl]phenol Chemical compound NC1=CC=CC(\C=C\C=2C=CC=CC=2)=C1O APMAGJYKMMAXBU-MDZDMXLPSA-N 0.000 description 2
- ABKAJPLOOIISSW-UHFFFAOYSA-N 2-amino-6-propylphenol Chemical compound CCCC1=CC=CC(N)=C1O ABKAJPLOOIISSW-UHFFFAOYSA-N 0.000 description 2
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 2
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 2
- LFAHYSRYSVNIET-UHFFFAOYSA-N 2-hydroxy-3-nitro-1,2,3,4-tetrahydroinden-5-one Chemical compound [O-][N+](=O)C1C(O)CC2=C1CC(=O)C=C2 LFAHYSRYSVNIET-UHFFFAOYSA-N 0.000 description 2
- ZWZZWLBNEPKBAR-UHFFFAOYSA-N 2-hydroxy-3-nitro-n-phenylbenzamide Chemical compound C1=CC=C([N+]([O-])=O)C(O)=C1C(=O)NC1=CC=CC=C1 ZWZZWLBNEPKBAR-UHFFFAOYSA-N 0.000 description 2
- ZUOCMGGILLTISV-UHFFFAOYSA-N 2-hydroxy-3-nitrobenzonitrile Chemical compound OC1=C(C#N)C=CC=C1[N+]([O-])=O ZUOCMGGILLTISV-UHFFFAOYSA-N 0.000 description 2
- HYPKGPVDQYUOSV-UHFFFAOYSA-N 2-nitro-5-phenylphenol Chemical compound C1=C([N+]([O-])=O)C(O)=CC(C=2C=CC=CC=2)=C1 HYPKGPVDQYUOSV-UHFFFAOYSA-N 0.000 description 2
- QJJGPZTVVISLNI-UHFFFAOYSA-N 2-nitro-5-propan-2-ylphenol Chemical compound CC(C)C1=CC=C([N+]([O-])=O)C(O)=C1 QJJGPZTVVISLNI-UHFFFAOYSA-N 0.000 description 2
- FMPKXGYPBUWNNG-UHFFFAOYSA-N 2-nitro-6-(trifluoromethyl)phenol Chemical compound OC1=C([N+]([O-])=O)C=CC=C1C(F)(F)F FMPKXGYPBUWNNG-UHFFFAOYSA-N 0.000 description 2
- UZXYRUOSHRFKND-MDZDMXLPSA-N 2-nitro-6-[(E)-2-phenylethenyl]phenol Chemical compound C1=CC=C([N+]([O-])=O)C(O)=C1\C=C\C1=CC=CC=C1 UZXYRUOSHRFKND-MDZDMXLPSA-N 0.000 description 2
- SNIBPLNVBYUZKZ-UHFFFAOYSA-N 2-nitro-6-propylphenol Chemical compound CCCC1=CC=CC([N+]([O-])=O)=C1O SNIBPLNVBYUZKZ-UHFFFAOYSA-N 0.000 description 2
- NBECSRZXAMQLLS-UHFFFAOYSA-N 3-(2-hydroxy-3-nitrophenyl)prop-2-enoic acid Chemical compound OC(=O)C=CC1=CC=CC([N+]([O-])=O)=C1O NBECSRZXAMQLLS-UHFFFAOYSA-N 0.000 description 2
- LJGHYPLBDBRCRZ-UHFFFAOYSA-N 3-(3-aminophenyl)sulfonylaniline Chemical group NC1=CC=CC(S(=O)(=O)C=2C=C(N)C=CC=2)=C1 LJGHYPLBDBRCRZ-UHFFFAOYSA-N 0.000 description 2
- UCDHERSZARNKOB-UHFFFAOYSA-N 3-(3-hydroxy-4-nitrophenyl)prop-2-enoic acid Chemical compound OC(=O)C=CC1=CC=C([N+]([O-])=O)C(O)=C1 UCDHERSZARNKOB-UHFFFAOYSA-N 0.000 description 2
- UGEJOEBBMPOJMT-UHFFFAOYSA-N 3-(trifluoromethyl)phenol Chemical compound OC1=CC=CC(C(F)(F)F)=C1 UGEJOEBBMPOJMT-UHFFFAOYSA-N 0.000 description 2
- HMNKTRSOROOSPP-UHFFFAOYSA-N 3-Ethylphenol Chemical compound CCC1=CC=CC(O)=C1 HMNKTRSOROOSPP-UHFFFAOYSA-N 0.000 description 2
- CQFHTGIXWOGKOR-UHFFFAOYSA-N 3-[2-(hydroxymethyl)-3-nitrophenyl]prop-2-enoic acid Chemical compound OCC1=C(C=CC(O)=O)C=CC=C1[N+]([O-])=O CQFHTGIXWOGKOR-UHFFFAOYSA-N 0.000 description 2
- JJIHEKRAOZPTLG-UHFFFAOYSA-N 3-[3-(hydroxymethyl)-4-nitrophenyl]prop-2-enoic acid Chemical compound OCC1=CC(C=CC(O)=O)=CC=C1[N+]([O-])=O JJIHEKRAOZPTLG-UHFFFAOYSA-N 0.000 description 2
- JPPJUPXPQUNYOH-UHFFFAOYSA-N 3-amino-2-hydroxy-1,2,3,4-tetrahydroinden-5-one Chemical compound C1C(=O)C=CC2=C1C(N)C(O)C2 JPPJUPXPQUNYOH-UHFFFAOYSA-N 0.000 description 2
- NTUMBWHJAMGXFO-UHFFFAOYSA-N 3-amino-2-hydroxy-6-methylbenzonitrile Chemical compound CC1=CC=C(N)C(O)=C1C#N NTUMBWHJAMGXFO-UHFFFAOYSA-N 0.000 description 2
- PTGSDRFHFSNCIP-UHFFFAOYSA-N 3-amino-2-hydroxy-n-phenylbenzamide Chemical compound NC1=CC=CC(C(=O)NC=2C=CC=CC=2)=C1O PTGSDRFHFSNCIP-UHFFFAOYSA-N 0.000 description 2
- FMQVUWGTHZPXQU-UHFFFAOYSA-N 3-amino-2-hydroxybenzonitrile Chemical compound NC1=CC=CC(C#N)=C1O FMQVUWGTHZPXQU-UHFFFAOYSA-N 0.000 description 2
- ZEWCASRNRWXXSO-UHFFFAOYSA-N 3-amino-4-hydroxybenzonitrile Chemical compound NC1=CC(C#N)=CC=C1O ZEWCASRNRWXXSO-UHFFFAOYSA-N 0.000 description 2
- VLJSLTNSFSOYQR-UHFFFAOYSA-N 3-propan-2-ylphenol Chemical compound CC(C)C1=CC=CC(O)=C1 VLJSLTNSFSOYQR-UHFFFAOYSA-N 0.000 description 2
- DTCJNMRCEFYBHH-UHFFFAOYSA-N 4-[3-[(2-bromophenyl)carbamoylamino]-2-hydroxyphenyl]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C1=CC=CC(NC(=O)NC=2C(=CC=CC=2)Br)=C1O DTCJNMRCEFYBHH-UHFFFAOYSA-N 0.000 description 2
- YJIUQVPMLSGDMP-UHFFFAOYSA-N 5-ethyl-2-nitrophenol Chemical compound CCC1=CC=C([N+]([O-])=O)C(O)=C1 YJIUQVPMLSGDMP-UHFFFAOYSA-N 0.000 description 2
- NWRLEWDBRMESLI-UHFFFAOYSA-N 5-hydroxy-2-(phenylcarbamoylamino)benzoic acid Chemical compound OC(=O)C1=CC(O)=CC=C1NC(=O)NC1=CC=CC=C1 NWRLEWDBRMESLI-UHFFFAOYSA-N 0.000 description 2
- KRURHZHJEDNBCM-UHFFFAOYSA-N 6-amino-2,3-difluorophenol Chemical compound NC1=CC=C(F)C(F)=C1O KRURHZHJEDNBCM-UHFFFAOYSA-N 0.000 description 2
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 2
- 101001027327 Bos taurus Growth-regulated protein homolog alpha Proteins 0.000 description 2
- GWEHVDNNLFDJLR-UHFFFAOYSA-N Carbanilide Natural products C=1C=CC=CC=1NC(=O)NC1=CC=CC=C1 GWEHVDNNLFDJLR-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 241000790917 Dioxys <bee> Species 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- 101500025785 Homo sapiens IL-8(6-77) Proteins 0.000 description 2
- 101001055222 Homo sapiens Interleukin-8 Proteins 0.000 description 2
- 102400001232 IL-8(6-77) Human genes 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 2
- 210000001744 T-lymphocyte Anatomy 0.000 description 2
- 210000000662 T-lymphocyte subset Anatomy 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- ZZNCQTGLAPYNDN-UHFFFAOYSA-N anilino 4-[(2-bromophenyl)carbamoylamino]-3-hydroxybenzoate Chemical compound OC1=CC(C(=O)ONC=2C=CC=CC=2)=CC=C1NC(=O)NC1=CC=CC=C1Br ZZNCQTGLAPYNDN-UHFFFAOYSA-N 0.000 description 2
- 239000005557 antagonist Substances 0.000 description 2
- 239000000010 aprotic solvent Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000005018 aryl alkenyl group Chemical group 0.000 description 2
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 description 2
- CSKNSYBAZOQPLR-UHFFFAOYSA-N benzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CC=C1 CSKNSYBAZOQPLR-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- RROBIDXNTUAHFW-UHFFFAOYSA-N benzotriazol-1-yloxy-tris(dimethylamino)phosphanium Chemical compound C1=CC=C2N(O[P+](N(C)C)(N(C)C)N(C)C)N=NC2=C1 RROBIDXNTUAHFW-UHFFFAOYSA-N 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 125000000440 benzylamino group Chemical group [H]N(*)C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 235000011089 carbon dioxide Nutrition 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000002975 chemoattractant Substances 0.000 description 2
- 230000003399 chemotactic effect Effects 0.000 description 2
- 230000035605 chemotaxis Effects 0.000 description 2
- LPIQUOYDBNQMRZ-UHFFFAOYSA-N cyclopentene Chemical compound C1CC=CC1 LPIQUOYDBNQMRZ-UHFFFAOYSA-N 0.000 description 2
- 238000011161 development Methods 0.000 description 2
- 125000005442 diisocyanate group Chemical group 0.000 description 2
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 239000012948 isocyanate Substances 0.000 description 2
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- KKSDGJDHHZEWEP-UHFFFAOYSA-N m-hydroxycinnamic acid Natural products OC(=O)C=CC1=CC=CC(O)=C1 KKSDGJDHHZEWEP-UHFFFAOYSA-N 0.000 description 2
- HVSWRCHXFZIJMA-UHFFFAOYSA-N methyl 3-hydroxy-4-[(2-phenylphenyl)carbamoylamino]benzoate Chemical compound OC1=CC(C(=O)OC)=CC=C1NC(=O)NC1=CC=CC=C1C1=CC=CC=C1 HVSWRCHXFZIJMA-UHFFFAOYSA-N 0.000 description 2
- OOQWPJJYBUZOGS-UHFFFAOYSA-N methyl n-[2-[(2-hydroxy-4-nitrophenyl)carbamoylamino]phenyl]carbamate Chemical compound COC(=O)NC1=CC=CC=C1NC(=O)NC1=CC=C([N+]([O-])=O)C=C1O OOQWPJJYBUZOGS-UHFFFAOYSA-N 0.000 description 2
- KUJANOFPCPKYLF-UHFFFAOYSA-N n-(2-amino-5-nitrophenyl)benzenesulfonamide Chemical compound NC1=CC=C([N+]([O-])=O)C=C1NS(=O)(=O)C1=CC=CC=C1 KUJANOFPCPKYLF-UHFFFAOYSA-N 0.000 description 2
- WMWPOLBAWLJWPR-UHFFFAOYSA-N n-(2-aminophenyl)-1-phenylmethanesulfonamide Chemical compound NC1=CC=CC=C1NS(=O)(=O)CC1=CC=CC=C1 WMWPOLBAWLJWPR-UHFFFAOYSA-N 0.000 description 2
- GOYLVLYWQRBVRD-UHFFFAOYSA-N n-(2-aminophenyl)-3-methylbenzenesulfonamide Chemical compound CC1=CC=CC(S(=O)(=O)NC=2C(=CC=CC=2)N)=C1 GOYLVLYWQRBVRD-UHFFFAOYSA-N 0.000 description 2
- NFPKLXASODMBIP-UHFFFAOYSA-N n-(2-aminophenyl)quinoline-8-sulfonamide Chemical compound NC1=CC=CC=C1NS(=O)(=O)C1=CC=CC2=CC=CN=C12 NFPKLXASODMBIP-UHFFFAOYSA-N 0.000 description 2
- YKWIWSQBYJZDJU-UHFFFAOYSA-N n-(2-anilinophenyl)-3,4-dimethoxybenzenesulfonamide Chemical compound C1=C(OC)C(OC)=CC=C1S(=O)(=O)NC1=CC=CC=C1NC1=CC=CC=C1 YKWIWSQBYJZDJU-UHFFFAOYSA-N 0.000 description 2
- WLHJKINWCGVNEU-UHFFFAOYSA-N n-[4-[(2-anilinophenyl)sulfamoyl]phenyl]acetamide Chemical compound C1=CC(NC(=O)C)=CC=C1S(=O)(=O)NC1=CC=CC=C1NC1=CC=CC=C1 WLHJKINWCGVNEU-UHFFFAOYSA-N 0.000 description 2
- OTFMOOMWUNLLKQ-UHFFFAOYSA-N n-[4-[[2-[(2-bromophenyl)carbamoylamino]phenyl]sulfamoyl]phenyl]acetamide Chemical compound C1=CC(NC(=O)C)=CC=C1S(=O)(=O)NC1=CC=CC=C1NC(=O)NC1=CC=CC=C1Br OTFMOOMWUNLLKQ-UHFFFAOYSA-N 0.000 description 2
- AEURYAULWMMTBR-UHFFFAOYSA-N n-[5-[[2-[(2-bromophenyl)carbamoylamino]phenyl]sulfamoyl]-4-methyl-1,3-thiazol-2-yl]acetamide Chemical compound S1C(NC(=O)C)=NC(C)=C1S(=O)(=O)NC1=CC=CC=C1NC(=O)NC1=CC=CC=C1Br AEURYAULWMMTBR-UHFFFAOYSA-N 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 125000004957 naphthylene group Chemical group 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 150000002828 nitro derivatives Chemical class 0.000 description 2
- PMOWTIHVNWZYFI-UHFFFAOYSA-N o-Coumaric acid Natural products OC(=O)C=CC1=CC=CC=C1O PMOWTIHVNWZYFI-UHFFFAOYSA-N 0.000 description 2
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 2
- 230000003595 spectral effect Effects 0.000 description 2
- 238000010561 standard procedure Methods 0.000 description 2
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 2
- 150000003557 thiazoles Chemical class 0.000 description 2
- ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 description 2
- KKSDGJDHHZEWEP-SNAWJCMRSA-N trans-3-coumaric acid Chemical compound OC(=O)\C=C\C1=CC=CC(O)=C1 KKSDGJDHHZEWEP-SNAWJCMRSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- PEZPHMOCGURMEM-UHFFFAOYSA-N (2,3-dichlorophenyl)urea Chemical compound NC(=O)NC1=CC=CC(Cl)=C1Cl PEZPHMOCGURMEM-UHFFFAOYSA-N 0.000 description 1
- BQJBONTVMVGWPV-UHFFFAOYSA-N (2-hydroxyphenyl)urea Chemical compound NC(=O)NC1=CC=CC=C1O BQJBONTVMVGWPV-UHFFFAOYSA-N 0.000 description 1
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- SHULEACXTONYPS-UHFFFAOYSA-N (3-hydroxyphenyl)-phenylmethanone Chemical compound OC1=CC=CC(C(=O)C=2C=CC=CC=2)=C1 SHULEACXTONYPS-UHFFFAOYSA-N 0.000 description 1
- IQZBVVPYTDHTIP-UHFFFAOYSA-N (4-fluorophenyl)urea Chemical compound NC(=O)NC1=CC=C(F)C=C1 IQZBVVPYTDHTIP-UHFFFAOYSA-N 0.000 description 1
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- ONWRSBMOCIQLRK-VOTSOKGWSA-N (e)-2-phenylethenesulfonyl chloride Chemical compound ClS(=O)(=O)\C=C\C1=CC=CC=C1 ONWRSBMOCIQLRK-VOTSOKGWSA-N 0.000 description 1
- HAXYXBBIILZWIZ-HRNDJLQDSA-N (e)-3-[3-[(2-bromophenyl)carbamoylamino]-2-hydroxyphenyl]prop-2-enamide;(2-bromophenyl)urea Chemical compound NC(=O)NC1=CC=CC=C1Br.NC(=O)\C=C\C1=CC=CC(NC(=O)NC=2C(=CC=CC=2)Br)=C1O HAXYXBBIILZWIZ-HRNDJLQDSA-N 0.000 description 1
- ZSVYFOVBIDQOMP-WVLIHFOGSA-N (e)-3-[4-[(2-bromophenyl)carbamoylamino]-3-hydroxyphenyl]prop-2-enamide;(2-bromophenyl)urea Chemical compound NC(=O)NC1=CC=CC=C1Br.OC1=CC(/C=C/C(=O)N)=CC=C1NC(=O)NC1=CC=CC=C1Br ZSVYFOVBIDQOMP-WVLIHFOGSA-N 0.000 description 1
- FYWJWWMKCARWQG-UHFFFAOYSA-N 1,2-dichloro-3-isocyanatobenzene Chemical compound ClC1=CC=CC(N=C=O)=C1Cl FYWJWWMKCARWQG-UHFFFAOYSA-N 0.000 description 1
- FTNJQNQLEGKTGD-UHFFFAOYSA-N 1,3-benzodioxole Chemical compound C1=CC=C2OCOC2=C1 FTNJQNQLEGKTGD-UHFFFAOYSA-N 0.000 description 1
- YXHDLKWTPVMIOH-UHFFFAOYSA-N 1,3-difluoro-2-isocyanatobenzene Chemical compound FC1=CC=CC(F)=C1N=C=O YXHDLKWTPVMIOH-UHFFFAOYSA-N 0.000 description 1
- UYIAEMGEHXBVGY-UHFFFAOYSA-N 1-(1,3-benzodioxol-4-yl)-3-(4-cyano-2-hydroxyphenyl)urea Chemical compound OC1=CC(C#N)=CC=C1NC(=O)NC1=CC=CC2=C1OCO2 UYIAEMGEHXBVGY-UHFFFAOYSA-N 0.000 description 1
- QKGYADPERMMFMV-UHFFFAOYSA-N 1-(2,3-dichlorophenyl)-3-(2-hydroxy-3-nitrophenyl)urea Chemical compound C1=CC=C([N+]([O-])=O)C(O)=C1NC(=O)NC1=CC=CC(Cl)=C1Cl QKGYADPERMMFMV-UHFFFAOYSA-N 0.000 description 1
- WTBSKJMUSCALAE-UHFFFAOYSA-N 1-(2,3-dichlorophenyl)-3-(2-hydroxy-4-nitrophenyl)urea Chemical compound OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=CC(Cl)=C1Cl WTBSKJMUSCALAE-UHFFFAOYSA-N 0.000 description 1
- HZHMTGUPVKETDB-UHFFFAOYSA-N 1-(2,3-dichlorophenyl)-3-[4-nitro-2-(propylsulfonylamino)phenyl]urea Chemical compound CCCS(=O)(=O)NC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=CC(Cl)=C1Cl HZHMTGUPVKETDB-UHFFFAOYSA-N 0.000 description 1
- MEPMLKMUUNCMNM-UHFFFAOYSA-N 1-(2,3-dichlorophenyl)-3-[4-nitro-2-(pyridin-3-ylsulfonylamino)phenyl]urea Chemical compound C=1C=CN=CC=1S(=O)(=O)NC1=CC([N+](=O)[O-])=CC=C1NC(=O)NC1=CC=CC(Cl)=C1Cl MEPMLKMUUNCMNM-UHFFFAOYSA-N 0.000 description 1
- MIUZBQLHNFEROV-UHFFFAOYSA-N 1-(2,6-difluorophenyl)-3-(2-hydroxy-4-nitrophenyl)urea Chemical compound OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=C(F)C=CC=C1F MIUZBQLHNFEROV-UHFFFAOYSA-N 0.000 description 1
- ABYXJKNIXJCDTD-UHFFFAOYSA-N 1-(2-anilinophenyl)-3-(2-hydroxy-4-nitrophenyl)urea;1-(2-bromophenyl)-3-(2-hydroxy-4-methylphenyl)urea Chemical compound OC1=CC(C)=CC=C1NC(=O)NC1=CC=CC=C1Br.OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=CC=C1NC1=CC=CC=C1 ABYXJKNIXJCDTD-UHFFFAOYSA-N 0.000 description 1
- YTXDQYMEDCSFMP-UHFFFAOYSA-N 1-(2-bromophenyl)-1-(3-cyano-2-hydroxyphenyl)urea Chemical compound C=1C=CC(C#N)=C(O)C=1N(C(=O)N)C1=CC=CC=C1Br YTXDQYMEDCSFMP-UHFFFAOYSA-N 0.000 description 1
- XDJSETLIIYOAOI-UHFFFAOYSA-N 1-(2-bromophenyl)-3-(2-hydroxyphenyl)urea Chemical compound OC1=CC=CC=C1NC(=O)NC1=CC=CC=C1Br XDJSETLIIYOAOI-UHFFFAOYSA-N 0.000 description 1
- PEBCQTKZVQCXJP-UHFFFAOYSA-N 1-(2-bromophenyl)-3-(3,4-dichloro-2-hydroxyphenyl)urea Chemical compound OC1=C(Cl)C(Cl)=CC=C1NC(=O)NC1=CC=CC=C1Br PEBCQTKZVQCXJP-UHFFFAOYSA-N 0.000 description 1
- MPBMQOWOKKDSFC-UHFFFAOYSA-N 1-(2-bromophenyl)-3-(3-chloro-2-hydroxyphenyl)urea Chemical compound OC1=C(Cl)C=CC=C1NC(=O)NC1=CC=CC=C1Br MPBMQOWOKKDSFC-UHFFFAOYSA-N 0.000 description 1
- DBRVLDHXULWYPR-UHFFFAOYSA-N 1-(2-bromophenyl)-3-(3-chloro-4-cyano-2-hydroxyphenyl)urea Chemical compound OC1=C(Cl)C(C#N)=CC=C1NC(=O)NC1=CC=CC=C1Br DBRVLDHXULWYPR-UHFFFAOYSA-N 0.000 description 1
- MGACCYGHGSFOQC-UHFFFAOYSA-N 1-(2-bromophenyl)-3-(3-hydroxy-9,10-dioxoanthracen-2-yl)urea Chemical compound OC1=CC=2C(=O)C3=CC=CC=C3C(=O)C=2C=C1NC(=O)NC1=CC=CC=C1Br MGACCYGHGSFOQC-UHFFFAOYSA-N 0.000 description 1
- RPEYJVQVLVKTBY-UHFFFAOYSA-N 1-(2-bromophenyl)-3-(4-ethyl-2-hydroxyphenyl)urea Chemical compound OC1=CC(CC)=CC=C1NC(=O)NC1=CC=CC=C1Br RPEYJVQVLVKTBY-UHFFFAOYSA-N 0.000 description 1
- ZILKNQHGVMDEEV-UHFFFAOYSA-N 1-(2-bromophenyl)-3-(5-cyano-2-hydroxyphenyl)urea Chemical compound OC1=CC=C(C#N)C=C1NC(=O)NC1=CC=CC=C1Br ZILKNQHGVMDEEV-UHFFFAOYSA-N 0.000 description 1
- KHTGUBPZTDJRNE-UHFFFAOYSA-N 1-(2-bromophenyl)-3-[2-(2-phenyl-1-sulfamoylethenyl)phenyl]urea Chemical compound C=1C=CC=C(NC(=O)NC=2C(=CC=CC=2)Br)C=1C(S(=O)(=O)N)=CC1=CC=CC=C1 KHTGUBPZTDJRNE-UHFFFAOYSA-N 0.000 description 1
- JGHIGXYVAWUVLN-UHFFFAOYSA-N 1-(2-bromophenyl)-3-[2-(2-phenylethylsulfonylamino)phenyl]urea Chemical compound BrC1=CC=CC=C1NC(=O)NC1=CC=CC=C1NS(=O)(=O)CCC1=CC=CC=C1 JGHIGXYVAWUVLN-UHFFFAOYSA-N 0.000 description 1
- HJTAKPYPAXJAQZ-UHFFFAOYSA-N 1-(2-bromophenyl)-3-[2-(2-sulfamoylquinolin-8-yl)phenyl]urea Chemical compound C12=NC(S(=O)(=O)N)=CC=C2C=CC=C1C1=CC=CC=C1NC(=O)NC1=CC=CC=C1Br HJTAKPYPAXJAQZ-UHFFFAOYSA-N 0.000 description 1
- YXHMWUQABFOWFQ-UHFFFAOYSA-N 1-(2-bromophenyl)-3-[2-(methanesulfonamido)-4-nitrophenyl]urea Chemical compound CS(=O)(=O)NC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=CC=C1Br YXHMWUQABFOWFQ-UHFFFAOYSA-N 0.000 description 1
- KKBLAUFCLVADNC-UHFFFAOYSA-N 1-(2-bromophenyl)-3-[2-[phenyl(sulfamoyl)methyl]phenyl]urea Chemical compound C=1C=CC=C(NC(=O)NC=2C(=CC=CC=2)Br)C=1C(S(=O)(=O)N)C1=CC=CC=C1 KKBLAUFCLVADNC-UHFFFAOYSA-N 0.000 description 1
- JGLOHKYHPQNEJY-UHFFFAOYSA-N 1-(2-bromophenyl)-3-[2-hydroxy-4-(trifluoromethyl)phenyl]urea Chemical compound OC1=CC(C(F)(F)F)=CC=C1NC(=O)NC1=CC=CC=C1Br JGLOHKYHPQNEJY-UHFFFAOYSA-N 0.000 description 1
- WQJLTEZKWDKAGT-UHFFFAOYSA-N 1-(2-bromophenyl)-3-[4-cyano-2-hydroxy-3-(trifluoromethyl)phenyl]urea Chemical compound C1=CC(C#N)=C(C(F)(F)F)C(O)=C1NC(=O)NC1=CC=CC=C1Br WQJLTEZKWDKAGT-UHFFFAOYSA-N 0.000 description 1
- ZSBAJPOFOCDOFQ-UHFFFAOYSA-N 1-(2-chlorophenyl)-3-[2-hydroxy-3-(trifluoromethyl)phenyl]urea Chemical compound C1=CC=C(C(F)(F)F)C(O)=C1NC(=O)NC1=CC=CC=C1Cl ZSBAJPOFOCDOFQ-UHFFFAOYSA-N 0.000 description 1
- PPCPBEOXHRRPRQ-UHFFFAOYSA-N 1-(2-fluorophenyl)-3-(2-hydroxy-4-nitrophenyl)urea Chemical compound OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=CC=C1F PPCPBEOXHRRPRQ-UHFFFAOYSA-N 0.000 description 1
- FOKSFDPRFQOBSJ-UHFFFAOYSA-N 1-(2-fluorophenyl)-3-(2-hydroxy-4-nitrophenyl)urea;1-(2-hydroxy-4-nitrophenyl)-3-(2-nitrophenyl)urea Chemical compound OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=CC=C1F.OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=CC=C1[N+]([O-])=O FOKSFDPRFQOBSJ-UHFFFAOYSA-N 0.000 description 1
- MMWFGDQOTSUVEK-UHFFFAOYSA-N 1-(2-hydroxy-3-nitrophenyl)-3-(4-phenylphenyl)urea Chemical compound C1=CC=C([N+]([O-])=O)C(O)=C1NC(=O)NC1=CC=C(C=2C=CC=CC=2)C=C1 MMWFGDQOTSUVEK-UHFFFAOYSA-N 0.000 description 1
- SFPGWKLIBDXAON-UHFFFAOYSA-N 1-(2-hydroxy-4-nitrophenyl)-3-(2-phenylmethoxyphenyl)urea Chemical compound OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=CC=C1OCC1=CC=CC=C1 SFPGWKLIBDXAON-UHFFFAOYSA-N 0.000 description 1
- CLRDVEMJNUPVTM-UHFFFAOYSA-N 1-(2-hydroxy-4-nitrophenyl)-3-(4-nitrophenyl)urea Chemical compound OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=C([N+]([O-])=O)C=C1 CLRDVEMJNUPVTM-UHFFFAOYSA-N 0.000 description 1
- YOGROESZJQIPNW-UHFFFAOYSA-N 1-(2-hydroxy-4-nitrophenyl)-3-[2-(2-phenylethyl)phenyl]urea Chemical compound OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=CC=C1CCC1=CC=CC=C1 YOGROESZJQIPNW-UHFFFAOYSA-N 0.000 description 1
- QNKPAIRJYOJIHM-UHFFFAOYSA-N 1-(2-hydroxy-4-nitrophenyl)-3-[2-(phenylsulfanylmethyl)phenyl]urea Chemical compound OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=CC=C1CSC1=CC=CC=C1 QNKPAIRJYOJIHM-UHFFFAOYSA-N 0.000 description 1
- SMDJAVQJSYABRD-UHFFFAOYSA-N 1-(2-hydroxy-4-nitrophenyl)-3-[2-(pyridin-3-ylmethoxy)phenyl]urea Chemical compound OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=CC=C1OCC1=CC=CN=C1 SMDJAVQJSYABRD-UHFFFAOYSA-N 0.000 description 1
- OGTOIQDAKFXVIH-UHFFFAOYSA-N 1-(2-hydroxy-4-nitrophenyl)-3-[3-(trifluoromethyl)phenyl]urea Chemical compound OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=CC(C(F)(F)F)=C1 OGTOIQDAKFXVIH-UHFFFAOYSA-N 0.000 description 1
- DAJJRPMUKJGYSD-UHFFFAOYSA-N 1-(2-hydroxy-4-nitrophenyl)-3-[4-(trifluoromethyl)phenyl]urea Chemical compound OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=C(C(F)(F)F)C=C1 DAJJRPMUKJGYSD-UHFFFAOYSA-N 0.000 description 1
- SAUHQYBXEGARCC-UHFFFAOYSA-N 1-(2-hydroxy-4-nitrophenyl)-3-phenylurea Chemical compound OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=CC=C1 SAUHQYBXEGARCC-UHFFFAOYSA-N 0.000 description 1
- ZMKXBWMYQFYTGJ-UHFFFAOYSA-N 1-(2-hydroxy-4-propan-2-ylphenyl)-1-[3-(trifluoromethyl)phenyl]urea Chemical compound OC1=CC(C(C)C)=CC=C1N(C(N)=O)C1=CC=CC(C(F)(F)F)=C1 ZMKXBWMYQFYTGJ-UHFFFAOYSA-N 0.000 description 1
- PMCSLALTKXEXNQ-UHFFFAOYSA-N 1-(2-hydroxyethyl)-3-(2-hydroxy-4-nitrophenyl)urea Chemical compound OCCNC(=O)NC1=CC=C([N+]([O-])=O)C=C1O PMCSLALTKXEXNQ-UHFFFAOYSA-N 0.000 description 1
- UROHGCKFAXVYKN-UHFFFAOYSA-N 1-(3,4-dichloro-2-hydroxyphenyl)-3-(2-phenylphenyl)urea Chemical compound OC1=C(Cl)C(Cl)=CC=C1NC(=O)NC1=CC=CC=C1C1=CC=CC=C1 UROHGCKFAXVYKN-UHFFFAOYSA-N 0.000 description 1
- KSPGSKWILGYAFB-UHFFFAOYSA-N 1-(3,4-dichloro-2-hydroxyphenyl)-3-(4-methoxyphenyl)urea Chemical compound C1=CC(OC)=CC=C1NC(=O)NC1=CC=C(Cl)C(Cl)=C1O KSPGSKWILGYAFB-UHFFFAOYSA-N 0.000 description 1
- SXDDKYMVNSTNIY-UHFFFAOYSA-N 1-(3,4-dichloro-2-hydroxyphenyl)-3-(4-phenylphenyl)urea Chemical compound OC1=C(Cl)C(Cl)=CC=C1NC(=O)NC1=CC=C(C=2C=CC=CC=2)C=C1 SXDDKYMVNSTNIY-UHFFFAOYSA-N 0.000 description 1
- HANQFGSTHBDDLB-UHFFFAOYSA-N 1-(3,4-difluoro-2-hydroxyphenyl)-3-phenylurea Chemical compound OC1=C(F)C(F)=CC=C1NC(=O)NC1=CC=CC=C1 HANQFGSTHBDDLB-UHFFFAOYSA-N 0.000 description 1
- BVTAACJKFRRFJR-UHFFFAOYSA-N 1-(3-bromo-4-cyano-2-hydroxyphenyl)-3-(2,3-dichlorophenyl)urea Chemical compound C1=CC(C#N)=C(Br)C(O)=C1NC(=O)NC1=CC=CC(Cl)=C1Cl BVTAACJKFRRFJR-UHFFFAOYSA-N 0.000 description 1
- JZBNYZCKVBXHSV-UHFFFAOYSA-N 1-(3-bromo-4-cyano-2-hydroxyphenyl)-3-(2-bromophenyl)urea Chemical compound C1=CC(C#N)=C(Br)C(O)=C1NC(=O)NC1=CC=CC=C1Br JZBNYZCKVBXHSV-UHFFFAOYSA-N 0.000 description 1
- YHJMULJKVLDLHI-UHFFFAOYSA-N 1-(3-hydroxynaphthalen-2-yl)-3-[3-(trifluoromethyl)phenyl]urea Chemical compound OC1=CC2=CC=CC=C2C=C1NC(=O)NC1=CC=CC(C(F)(F)F)=C1 YHJMULJKVLDLHI-UHFFFAOYSA-N 0.000 description 1
- YZAZGBOPFBFDAC-UHFFFAOYSA-N 1-(4-cyano-2-hydroxyphenyl)-3-(2-phenylphenyl)urea Chemical compound OC1=CC(C#N)=CC=C1NC(=O)NC1=CC=CC=C1C1=CC=CC=C1 YZAZGBOPFBFDAC-UHFFFAOYSA-N 0.000 description 1
- OGRVRTFZEUPTGZ-UHFFFAOYSA-N 1-(4-cyano-2-hydroxyphenyl)-3-(3-methoxyphenyl)urea Chemical compound COC1=CC=CC(NC(=O)NC=2C(=CC(=CC=2)C#N)O)=C1 OGRVRTFZEUPTGZ-UHFFFAOYSA-N 0.000 description 1
- QIYGBMTTYPAFGZ-UHFFFAOYSA-N 1-(4-cyano-2-hydroxyphenyl)-3-(4-phenylphenyl)urea Chemical compound OC1=CC(C#N)=CC=C1NC(=O)NC1=CC=C(C=2C=CC=CC=2)C=C1 QIYGBMTTYPAFGZ-UHFFFAOYSA-N 0.000 description 1
- XKJVTFRSJNDOMV-UHFFFAOYSA-N 1-(4-cyano-2-hydroxyphenyl)-3-[2-(pyridin-4-ylmethoxy)phenyl]urea Chemical compound OC1=CC(C#N)=CC=C1NC(=O)NC1=CC=CC=C1OCC1=CC=NC=C1 XKJVTFRSJNDOMV-UHFFFAOYSA-N 0.000 description 1
- ASMCVDDUQQZBFK-UHFFFAOYSA-N 1-(5-chloro-2-hydroxy-4-nitrophenyl)-3-phenylurea Chemical compound OC1=CC([N+]([O-])=O)=C(Cl)C=C1NC(=O)NC1=CC=CC=C1 ASMCVDDUQQZBFK-UHFFFAOYSA-N 0.000 description 1
- LUBJCRLGQSPQNN-UHFFFAOYSA-N 1-Phenylurea Chemical class NC(=O)NC1=CC=CC=C1 LUBJCRLGQSPQNN-UHFFFAOYSA-N 0.000 description 1
- BJOKUALPLAMDEV-UHFFFAOYSA-N 1-[2-(2-cyanophenyl)sulfanylphenyl]-3-(2-hydroxy-4-nitrophenyl)urea Chemical compound OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=CC=C1SC1=CC=CC=C1C#N BJOKUALPLAMDEV-UHFFFAOYSA-N 0.000 description 1
- GLRSOWUQGPAHGM-UHFFFAOYSA-N 1-[2-(benzenesulfonamido)-4-cyanophenyl]-3-(2-methylphenyl)urea Chemical compound CC1=CC=CC=C1NC(=O)NC1=CC=C(C#N)C=C1NS(=O)(=O)C1=CC=CC=C1 GLRSOWUQGPAHGM-UHFFFAOYSA-N 0.000 description 1
- ONTIKVMKUHGFHJ-UHFFFAOYSA-N 1-[2-(benzenesulfonamido)-4-cyanophenyl]-3-(2-methylphenyl)urea 1-[2-(benzenesulfonamido)-4-cyanophenyl]-3-[2-(trifluoromethyl)phenyl]urea Chemical compound C1(=CC=CC=C1)S(=O)(=O)NC1=C(C=CC(=C1)C#N)NC(=O)NC1=C(C=CC=C1)C.C1(=CC=CC=C1)S(=O)(=O)NC1=C(C=CC(=C1)C#N)NC(=O)NC1=C(C=CC=C1)C(F)(F)F ONTIKVMKUHGFHJ-UHFFFAOYSA-N 0.000 description 1
- VMHOEXGGXBARQS-UHFFFAOYSA-N 1-[2-(benzenesulfonamido)-4-cyanophenyl]-3-(2-nitrophenyl)urea Chemical compound [O-][N+](=O)C1=CC=CC=C1NC(=O)NC1=CC=C(C#N)C=C1NS(=O)(=O)C1=CC=CC=C1 VMHOEXGGXBARQS-UHFFFAOYSA-N 0.000 description 1
- BZTOBGVHPDANRL-UHFFFAOYSA-N 1-[2-(benzenesulfonamido)-4-cyanophenyl]-3-(2-phenylphenyl)urea 1-[2-(benzenesulfonamido)-4-cyanophenyl]-3-[3-(trifluoromethyl)phenyl]urea Chemical compound C1(=CC=CC=C1)S(=O)(=O)NC1=C(C=CC(=C1)C#N)NC(=O)NC1=CC(=CC=C1)C(F)(F)F.C1(=CC=CC=C1)S(=O)(=O)NC1=C(C=CC(=C1)C#N)NC(=O)NC1=C(C=CC=C1)C1=CC=CC=C1 BZTOBGVHPDANRL-UHFFFAOYSA-N 0.000 description 1
- WROLSYZUXUKOKP-UHFFFAOYSA-N 1-[2-(benzenesulfonamido)-4-cyanophenyl]-3-(3-chloro-2-methoxyphenyl)urea Chemical compound COC1=C(Cl)C=CC=C1NC(=O)NC1=CC=C(C#N)C=C1NS(=O)(=O)C1=CC=CC=C1 WROLSYZUXUKOKP-UHFFFAOYSA-N 0.000 description 1
- ORHQSQGJUVDFGB-UHFFFAOYSA-N 1-[2-(benzenesulfonamido)-4-cyanophenyl]-3-[3-(trifluoromethyl)phenyl]urea Chemical compound FC(F)(F)C1=CC=CC(NC(=O)NC=2C(=CC(=CC=2)C#N)NS(=O)(=O)C=2C=CC=CC=2)=C1 ORHQSQGJUVDFGB-UHFFFAOYSA-N 0.000 description 1
- ZKSHAFJVXXBOPC-UHFFFAOYSA-N 1-[2-(benzenesulfonamido)-4-nitrophenyl]-3-(2,3-dichlorophenyl)urea Chemical compound C=1C=CC=CC=1S(=O)(=O)NC1=CC([N+](=O)[O-])=CC=C1NC(=O)NC1=CC=CC(Cl)=C1Cl ZKSHAFJVXXBOPC-UHFFFAOYSA-N 0.000 description 1
- WYNGFALUSZEHHD-UHFFFAOYSA-N 1-[2-(benzylsulfonylamino)-4-nitrophenyl]-3-(2,3-dichlorophenyl)urea Chemical compound C=1C=CC=CC=1CS(=O)(=O)NC1=CC([N+](=O)[O-])=CC=C1NC(=O)NC1=CC=CC(Cl)=C1Cl WYNGFALUSZEHHD-UHFFFAOYSA-N 0.000 description 1
- BWAQKFICINQHLY-UHFFFAOYSA-N 1-[2-(benzylsulfonylamino)-4-nitrophenyl]-3-(2-bromophenyl)urea Chemical compound C=1C=CC=CC=1CS(=O)(=O)NC1=CC([N+](=O)[O-])=CC=C1NC(=O)NC1=CC=CC=C1Br BWAQKFICINQHLY-UHFFFAOYSA-N 0.000 description 1
- NGJJLCDBMCYECX-UHFFFAOYSA-N 1-[2-(benzylsulfonylamino)-5-cyanophenyl]-3-(2,3-dichlorophenyl)urea Chemical compound ClC1=CC=CC(NC(=O)NC=2C(=CC=C(C=2)C#N)NS(=O)(=O)CC=2C=CC=CC=2)=C1Cl NGJJLCDBMCYECX-UHFFFAOYSA-N 0.000 description 1
- FLLYDYSIHJCMKD-UHFFFAOYSA-N 1-[2-[[3,5-bis(trifluoromethyl)phenyl]sulfonylamino]phenyl]-3-(2-bromophenyl)urea Chemical compound FC(F)(F)C1=CC(C(F)(F)F)=CC(S(=O)(=O)NC=2C(=CC=CC=2)NC(=O)NC=2C(=CC=CC=2)Br)=C1 FLLYDYSIHJCMKD-UHFFFAOYSA-N 0.000 description 1
- DVAWJTBZVQVMLL-UHFFFAOYSA-N 1-[2-[tert-butyl(dimethyl)silyl]oxy-4-nitrophenyl]-3-phenylthiourea Chemical compound CC(C)(C)[Si](C)(C)OC1=CC([N+]([O-])=O)=CC=C1NC(=S)NC1=CC=CC=C1 DVAWJTBZVQVMLL-UHFFFAOYSA-N 0.000 description 1
- CLEGFFHKELKXNH-UHFFFAOYSA-N 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-(2-hydroxy-3-nitrophenyl)urea Chemical compound C1=CC=C([N+]([O-])=O)C(O)=C1NC(=O)NC1=CC(C(F)(F)F)=CC=C1Cl CLEGFFHKELKXNH-UHFFFAOYSA-N 0.000 description 1
- NZHSVIMFJOAIMU-UHFFFAOYSA-N 1-[2-hydroxy-3-(trifluoromethyl)phenyl]-3-(2-phenylphenyl)urea Chemical compound C1=CC=C(C(F)(F)F)C(O)=C1NC(=O)NC1=CC=CC=C1C1=CC=CC=C1 NZHSVIMFJOAIMU-UHFFFAOYSA-N 0.000 description 1
- JOUCNJAIDGFKOE-UHFFFAOYSA-N 1-[3-amino-2-(2-sulfamoylphenyl)phenyl]-3-(2-bromophenyl)urea Chemical compound C=1C=CC=C(S(N)(=O)=O)C=1C=1C(N)=CC=CC=1NC(=O)NC1=CC=CC=C1Br JOUCNJAIDGFKOE-UHFFFAOYSA-N 0.000 description 1
- DHESFNLEPKSBTB-UHFFFAOYSA-N 1-[4-cyano-2-(pyridin-3-ylsulfonylamino)phenyl]-3-(2,3-dichlorophenyl)urea Chemical compound ClC1=CC=CC(NC(=O)NC=2C(=CC(=CC=2)C#N)NS(=O)(=O)C=2C=NC=CC=2)=C1Cl DHESFNLEPKSBTB-UHFFFAOYSA-N 0.000 description 1
- ONBUVGKXERJDEM-UHFFFAOYSA-N 1-[4-cyano-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]phenyl]-3-(2,3-dichlorophenyl)urea Chemical compound FC(F)(F)C1=CC=CC=C1S(=O)(=O)NC1=CC(C#N)=CC=C1NC(=O)NC1=CC=CC(Cl)=C1Cl ONBUVGKXERJDEM-UHFFFAOYSA-N 0.000 description 1
- FHMMQQXRSYSWCM-UHFFFAOYSA-N 1-aminonaphthalen-2-ol Chemical compound C1=CC=C2C(N)=C(O)C=CC2=C1 FHMMQQXRSYSWCM-UHFFFAOYSA-N 0.000 description 1
- JUGVFPHXQZCJAR-UHFFFAOYSA-N 1-benzyl-3-(3,4-dichloro-2-hydroxyphenyl)urea;1-(2-hydroxy-4-propan-2-ylphenyl)-3-[3-(trifluoromethyl)phenyl]urea Chemical compound OC1=C(Cl)C(Cl)=CC=C1NC(=O)NCC1=CC=CC=C1.OC1=CC(C(C)C)=CC=C1NC(=O)NC1=CC=CC(C(F)(F)F)=C1 JUGVFPHXQZCJAR-UHFFFAOYSA-N 0.000 description 1
- VQVBCZQTXSHJGF-UHFFFAOYSA-N 1-bromo-3-isocyanatobenzene Chemical compound BrC1=CC=CC(N=C=O)=C1 VQVBCZQTXSHJGF-UHFFFAOYSA-N 0.000 description 1
- CZQIJQFTRGDODI-UHFFFAOYSA-N 1-bromo-4-isocyanatobenzene Chemical compound BrC1=CC=C(N=C=O)C=C1 CZQIJQFTRGDODI-UHFFFAOYSA-N 0.000 description 1
- 125000004973 1-butenyl group Chemical group C(=CCC)* 0.000 description 1
- FBTQQNYGMICJQZ-UHFFFAOYSA-N 1-chloro-2-isocyanato-3-methylbenzene Chemical compound CC1=CC=CC(Cl)=C1N=C=O FBTQQNYGMICJQZ-UHFFFAOYSA-N 0.000 description 1
- NOHQUGRVHSJYMR-UHFFFAOYSA-N 1-chloro-2-isocyanatobenzene Chemical compound ClC1=CC=CC=C1N=C=O NOHQUGRVHSJYMR-UHFFFAOYSA-N 0.000 description 1
- BUIQXUQLYZPMLS-UHFFFAOYSA-N 1-ethoxy-2-isocyanatobenzene Chemical compound CCOC1=CC=CC=C1N=C=O BUIQXUQLYZPMLS-UHFFFAOYSA-N 0.000 description 1
- ZVFNUQWYLXXSJM-UHFFFAOYSA-N 1-ethyl-2-isocyanatobenzene Chemical compound CCC1=CC=CC=C1N=C=O ZVFNUQWYLXXSJM-UHFFFAOYSA-N 0.000 description 1
- VZNCSZQPNIEEMN-UHFFFAOYSA-N 1-fluoro-2-isocyanatobenzene Chemical compound FC1=CC=CC=C1N=C=O VZNCSZQPNIEEMN-UHFFFAOYSA-N 0.000 description 1
- LIKMAJRDDDTEIG-UHFFFAOYSA-N 1-hexene Chemical compound CCCCC=C LIKMAJRDDDTEIG-UHFFFAOYSA-N 0.000 description 1
- CTMGYQHKKIEXKF-UHFFFAOYSA-N 1-isocyanato-2-(trifluoromethoxy)benzene Chemical compound FC(F)(F)OC1=CC=CC=C1N=C=O CTMGYQHKKIEXKF-UHFFFAOYSA-N 0.000 description 1
- GZWGTVZRRFPVAS-UHFFFAOYSA-N 1-isocyanato-2-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC=C1N=C=O GZWGTVZRRFPVAS-UHFFFAOYSA-N 0.000 description 1
- SUVCZZADQDCIEQ-UHFFFAOYSA-N 1-isocyanato-2-methoxybenzene Chemical compound COC1=CC=CC=C1N=C=O SUVCZZADQDCIEQ-UHFFFAOYSA-N 0.000 description 1
- WQXASSKJZYKJSI-UHFFFAOYSA-N 1-isocyanato-2-methylsulfanylbenzene Chemical compound CSC1=CC=CC=C1N=C=O WQXASSKJZYKJSI-UHFFFAOYSA-N 0.000 description 1
- JRVZITODZAQRQM-UHFFFAOYSA-N 1-isocyanato-2-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1N=C=O JRVZITODZAQRQM-UHFFFAOYSA-N 0.000 description 1
- SXJYSIBLFGQAND-UHFFFAOYSA-N 1-isocyanato-3-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC(N=C=O)=C1 SXJYSIBLFGQAND-UHFFFAOYSA-N 0.000 description 1
- NPOVTGVGOBJZPY-UHFFFAOYSA-N 1-isocyanato-3-methoxybenzene Chemical compound COC1=CC=CC(N=C=O)=C1 NPOVTGVGOBJZPY-UHFFFAOYSA-N 0.000 description 1
- QZTWVDCKDWZCLV-UHFFFAOYSA-N 1-isocyanato-4-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=C(N=C=O)C=C1 QZTWVDCKDWZCLV-UHFFFAOYSA-N 0.000 description 1
- BDQNKCYCTYYMAA-UHFFFAOYSA-N 1-isocyanatonaphthalene Chemical compound C1=CC=C2C(N=C=O)=CC=CC2=C1 BDQNKCYCTYYMAA-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000006017 1-propenyl group Chemical group 0.000 description 1
- 238000005160 1H NMR spectroscopy Methods 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- UMPSXRYVXUPCOS-UHFFFAOYSA-N 2,3-dichlorophenol Chemical compound OC1=CC=CC(Cl)=C1Cl UMPSXRYVXUPCOS-UHFFFAOYSA-N 0.000 description 1
- KEGOHDCHURMFKX-UHFFFAOYSA-N 2,3-difluoro-6-nitrophenol Chemical compound OC1=C(F)C(F)=CC=C1[N+]([O-])=O KEGOHDCHURMFKX-UHFFFAOYSA-N 0.000 description 1
- CGEZHWIPFKRZBF-UHFFFAOYSA-N 2,4-dibromo-1-isocyanatobenzene Chemical compound BrC1=CC=C(N=C=O)C(Br)=C1 CGEZHWIPFKRZBF-UHFFFAOYSA-N 0.000 description 1
- OLBJNSPBWLCTOT-UHFFFAOYSA-N 2,4-dichloro-1-isocyanatobenzene Chemical compound ClC1=CC=C(N=C=O)C(Cl)=C1 OLBJNSPBWLCTOT-UHFFFAOYSA-N 0.000 description 1
- RQPVXOUSZLDZFI-UHFFFAOYSA-N 2-(phenylcarbamoylamino)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1NC(=O)NC1=CC=CC=C1 RQPVXOUSZLDZFI-UHFFFAOYSA-N 0.000 description 1
- ZIZGWNOAHUCACM-UHFFFAOYSA-N 2-(trifluoromethyl)benzenesulfonyl chloride Chemical compound FC(F)(F)C1=CC=CC=C1S(Cl)(=O)=O ZIZGWNOAHUCACM-UHFFFAOYSA-N 0.000 description 1
- ZOQOPXVJANRGJZ-UHFFFAOYSA-N 2-(trifluoromethyl)phenol Chemical compound OC1=CC=CC=C1C(F)(F)F ZOQOPXVJANRGJZ-UHFFFAOYSA-N 0.000 description 1
- HYNQTSZBTIOFKH-UHFFFAOYSA-N 2-Amino-5-hydroxybenzoic acid Natural products NC1=CC=C(O)C=C1C(O)=O HYNQTSZBTIOFKH-UHFFFAOYSA-N 0.000 description 1
- VSCVMMZCYHQJQD-UHFFFAOYSA-N 2-[(2,4-dichlorophenyl)carbamoylamino]benzoic acid Chemical compound OC(=O)C1=CC=CC=C1NC(=O)NC1=CC=C(Cl)C=C1Cl VSCVMMZCYHQJQD-UHFFFAOYSA-N 0.000 description 1
- HPIWUVVNMOAVQD-UHFFFAOYSA-N 2-[(2-methoxyphenyl)methylcarbamoylamino]benzoic acid Chemical compound COC1=CC=CC=C1CNC(=O)NC1=CC=CC=C1C(O)=O HPIWUVVNMOAVQD-UHFFFAOYSA-N 0.000 description 1
- MROIECGIYKVCQE-UHFFFAOYSA-N 2-[(3,4-dichlorophenyl)carbamoylamino]benzoic acid Chemical compound OC(=O)C1=CC=CC=C1NC(=O)NC1=CC=C(Cl)C(Cl)=C1 MROIECGIYKVCQE-UHFFFAOYSA-N 0.000 description 1
- LCZQWCSGKIRNIT-UHFFFAOYSA-N 2-[(3-chlorophenyl)carbamoylamino]benzoic acid Chemical compound OC(=O)C1=CC=CC=C1NC(=O)NC1=CC=CC(Cl)=C1 LCZQWCSGKIRNIT-UHFFFAOYSA-N 0.000 description 1
- WDEWMHZCLLLPCQ-UHFFFAOYSA-N 2-[(3-methoxyphenyl)methylcarbamoylamino]benzoic acid Chemical compound COC1=CC=CC(CNC(=O)NC=2C(=CC=CC=2)C(O)=O)=C1 WDEWMHZCLLLPCQ-UHFFFAOYSA-N 0.000 description 1
- GFSBFEFJWQVKFS-UHFFFAOYSA-N 2-[(4-chlorophenyl)carbamoylamino]benzoic acid Chemical compound OC(=O)C1=CC=CC=C1NC(=O)NC1=CC=C(Cl)C=C1 GFSBFEFJWQVKFS-UHFFFAOYSA-N 0.000 description 1
- ZFHPJWWTGIZRLR-UHFFFAOYSA-N 2-[(4-methoxyphenyl)carbamoylamino]benzoic acid Chemical compound C1=CC(OC)=CC=C1NC(=O)NC1=CC=CC=C1C(O)=O ZFHPJWWTGIZRLR-UHFFFAOYSA-N 0.000 description 1
- AYPZAZPOYROADP-ZHACJKMWSA-N 2-[(e)-2-phenylethenyl]phenol Chemical compound OC1=CC=CC=C1\C=C\C1=CC=CC=C1 AYPZAZPOYROADP-ZHACJKMWSA-N 0.000 description 1
- NNJHZWICFMKUOE-UHFFFAOYSA-N 2-amino-3,4,6-trifluorophenol Chemical compound NC1=C(O)C(F)=CC(F)=C1F NNJHZWICFMKUOE-UHFFFAOYSA-N 0.000 description 1
- JSHJJLQJRLNBBA-UHFFFAOYSA-N 2-amino-3-chlorophenol Chemical compound NC1=C(O)C=CC=C1Cl JSHJJLQJRLNBBA-UHFFFAOYSA-N 0.000 description 1
- QOZLOYKAFDTQNU-UHFFFAOYSA-N 2-amino-3-fluorophenol Chemical compound NC1=C(O)C=CC=C1F QOZLOYKAFDTQNU-UHFFFAOYSA-N 0.000 description 1
- CNWWMJSRHGXXAX-UHFFFAOYSA-N 2-amino-3-hydroxyanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=C(N)C(O)=C2 CNWWMJSRHGXXAX-UHFFFAOYSA-N 0.000 description 1
- ULDFRPKVIZMKJG-UHFFFAOYSA-N 2-amino-4-fluorophenol Chemical compound NC1=CC(F)=CC=C1O ULDFRPKVIZMKJG-UHFFFAOYSA-N 0.000 description 1
- ZAALERVZABQGIP-UHFFFAOYSA-N 2-amino-5-hydroxybenzoic acid Chemical compound NC1=CC=C(O)C=C1C(O)=O.NC1=CC=C(O)C=C1C(O)=O ZAALERVZABQGIP-UHFFFAOYSA-N 0.000 description 1
- HCPJEHJGFKWRFM-UHFFFAOYSA-N 2-amino-5-methylphenol Chemical compound CC1=CC=C(N)C(O)=C1 HCPJEHJGFKWRFM-UHFFFAOYSA-N 0.000 description 1
- IFCGVNYNIRTWNU-UHFFFAOYSA-N 2-amino-5-propan-2-ylphenol Chemical compound CC(C)C1=CC=C(N)C(O)=C1 IFCGVNYNIRTWNU-UHFFFAOYSA-N 0.000 description 1
- MDIAVSZFIQWYST-UHFFFAOYSA-N 2-amino-6-fluorophenol Chemical compound NC1=CC=CC(F)=C1O MDIAVSZFIQWYST-UHFFFAOYSA-N 0.000 description 1
- WKOJOGYKEWTXHX-UHFFFAOYSA-N 2-amino-6-iodophenol Chemical compound NC1=CC=CC(I)=C1O WKOJOGYKEWTXHX-UHFFFAOYSA-N 0.000 description 1
- AACMNEWXGKOJJK-UHFFFAOYSA-N 2-amino-6-nitrophenol Chemical compound NC1=CC=CC([N+]([O-])=O)=C1O AACMNEWXGKOJJK-UHFFFAOYSA-N 0.000 description 1
- OOHJKDQCYDJZJX-UHFFFAOYSA-N 2-amino-6-phenylmethoxyphenol Chemical compound NC1=CC=CC(OCC=2C=CC=CC=2)=C1O OOHJKDQCYDJZJX-UHFFFAOYSA-N 0.000 description 1
- UHGULLIUJBCTEF-UHFFFAOYSA-N 2-aminobenzothiazole Chemical compound C1=CC=C2SC(N)=NC2=C1 UHGULLIUJBCTEF-UHFFFAOYSA-N 0.000 description 1
- AOPBDRUWRLBSDB-UHFFFAOYSA-N 2-bromoaniline Chemical compound NC1=CC=CC=C1Br AOPBDRUWRLBSDB-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- JWHPQBAWKJSXAL-UHFFFAOYSA-N 2-chloro-1-isocyanato-3-methoxybenzene Chemical compound COC1=CC=CC(N=C=O)=C1Cl JWHPQBAWKJSXAL-UHFFFAOYSA-N 0.000 description 1
- KKEQNHBOGAURSN-UHFFFAOYSA-N 2-hydroxy-1,2,3,4-tetrahydroinden-5-one Chemical compound C1=CC(=O)CC2=C1CC(O)C2 KKEQNHBOGAURSN-UHFFFAOYSA-N 0.000 description 1
- YOOUJMFJLPLGEY-UHFFFAOYSA-N 2-hydroxy-6-methyl-3-nitrobenzonitrile Chemical compound CC1=CC=C([N+]([O-])=O)C(O)=C1C#N YOOUJMFJLPLGEY-UHFFFAOYSA-N 0.000 description 1
- YEDUAINPPJYDJZ-UHFFFAOYSA-N 2-hydroxybenzothiazole Chemical compound C1=CC=C2SC(O)=NC2=C1 YEDUAINPPJYDJZ-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- CJNZAXGUTKBIHP-UHFFFAOYSA-N 2-iodobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1I CJNZAXGUTKBIHP-UHFFFAOYSA-N 0.000 description 1
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 1
- 125000006020 2-methyl-1-propenyl group Chemical group 0.000 description 1
- NFCPRRWCTNLGSN-UHFFFAOYSA-N 2-n-phenylbenzene-1,2-diamine Chemical compound NC1=CC=CC=C1NC1=CC=CC=C1 NFCPRRWCTNLGSN-UHFFFAOYSA-N 0.000 description 1
- XZEDEVRSUANQEM-UHFFFAOYSA-N 2-nitro-4-(trifluoromethyl)phenol Chemical compound OC1=CC=C(C(F)(F)F)C=C1[N+]([O-])=O XZEDEVRSUANQEM-UHFFFAOYSA-N 0.000 description 1
- NKAYMSAPNXUYBD-UHFFFAOYSA-N 2-nitro-9h-fluoren-1-ol Chemical compound C1=CC=C2C3=CC=C([N+]([O-])=O)C(O)=C3CC2=C1 NKAYMSAPNXUYBD-UHFFFAOYSA-N 0.000 description 1
- PKRSYEPBQPFNRB-UHFFFAOYSA-N 2-phenoxybenzoic acid Chemical compound OC(=O)C1=CC=CC=C1OC1=CC=CC=C1 PKRSYEPBQPFNRB-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- CCZCXFHJMKINPE-UHFFFAOYSA-N 2-phenylmethoxyphenol Chemical compound OC1=CC=CC=C1OCC1=CC=CC=C1 CCZCXFHJMKINPE-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- LCHYEKKJCUJAKN-UHFFFAOYSA-N 2-propylphenol Chemical compound CCCC1=CC=CC=C1O LCHYEKKJCUJAKN-UHFFFAOYSA-N 0.000 description 1
- VAYMIYBJLRRIFR-UHFFFAOYSA-N 2-tolyl isocyanate Chemical compound CC1=CC=CC=C1N=C=O VAYMIYBJLRRIFR-UHFFFAOYSA-N 0.000 description 1
- JRBJSXQPQWSCCF-UHFFFAOYSA-N 3,3'-Dimethoxybenzidine Chemical compound C1=C(N)C(OC)=CC(C=2C=C(OC)C(N)=CC=2)=C1 JRBJSXQPQWSCCF-UHFFFAOYSA-N 0.000 description 1
- RSJSYCZYQNJQPY-UHFFFAOYSA-N 3,4-dimethoxybenzenesulfonyl chloride Chemical compound COC1=CC=C(S(Cl)(=O)=O)C=C1OC RSJSYCZYQNJQPY-UHFFFAOYSA-N 0.000 description 1
- IQGMRVWUTCYCST-UHFFFAOYSA-N 3-Aminosalicylic acid Chemical compound NC1=CC=CC(C(O)=O)=C1O IQGMRVWUTCYCST-UHFFFAOYSA-N 0.000 description 1
- CAHLKWGNFWVZRJ-UHFFFAOYSA-N 3-[(2-bromophenyl)carbamoylamino]-2-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=CC(NC(=O)NC=2C(=CC=CC=2)Br)=C1O CAHLKWGNFWVZRJ-UHFFFAOYSA-N 0.000 description 1
- NJXPYZHXZZCTNI-UHFFFAOYSA-N 3-aminobenzonitrile Chemical compound NC1=CC=CC(C#N)=C1 NJXPYZHXZZCTNI-UHFFFAOYSA-N 0.000 description 1
- ZHVPTERSBUMMHK-UHFFFAOYSA-N 3-aminonaphthalen-2-ol Chemical compound C1=CC=C2C=C(O)C(N)=CC2=C1 ZHVPTERSBUMMHK-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- DFMDAJMTLJGKFW-UHFFFAOYSA-N 3-chloro-2-nitrophenol Chemical compound OC1=CC=CC(Cl)=C1[N+]([O-])=O DFMDAJMTLJGKFW-UHFFFAOYSA-N 0.000 description 1
- HORNXRXVQWOLPJ-UHFFFAOYSA-N 3-chlorophenol Chemical compound OC1=CC=CC(Cl)=C1 HORNXRXVQWOLPJ-UHFFFAOYSA-N 0.000 description 1
- GAWNBKUTBVLIPL-UHFFFAOYSA-N 3-fluoro-2-nitrophenol Chemical compound OC1=CC=CC(F)=C1[N+]([O-])=O GAWNBKUTBVLIPL-UHFFFAOYSA-N 0.000 description 1
- SJTBRFHBXDZMPS-UHFFFAOYSA-N 3-fluorophenol Chemical compound OC1=CC=CC(F)=C1 SJTBRFHBXDZMPS-UHFFFAOYSA-N 0.000 description 1
- JELNXWUZFOQXGZ-UHFFFAOYSA-N 3-hydroxy-2-nitrobenzonitrile Chemical compound OC1=CC=CC(C#N)=C1[N+]([O-])=O JELNXWUZFOQXGZ-UHFFFAOYSA-N 0.000 description 1
- RFSKGCVUDQRZSD-UHFFFAOYSA-N 3-methoxythiophene Chemical compound COC=1C=CSC=1 RFSKGCVUDQRZSD-UHFFFAOYSA-N 0.000 description 1
- KFPMLWUKHQMEBU-UHFFFAOYSA-N 3-methylbenzenesulfonyl chloride Chemical compound CC1=CC=CC(S(Cl)(=O)=O)=C1 KFPMLWUKHQMEBU-UHFFFAOYSA-N 0.000 description 1
- RTZZCYNQPHTPPL-UHFFFAOYSA-N 3-nitrophenol Chemical compound OC1=CC=CC([N+]([O-])=O)=C1 RTZZCYNQPHTPPL-UHFFFAOYSA-N 0.000 description 1
- SIPAGAIYBSRGJB-UHFFFAOYSA-N 4-[(2-bromophenyl)carbamoylamino]-3-hydroxybenzamide Chemical compound OC1=CC(C(=O)N)=CC=C1NC(=O)NC1=CC=CC=C1Br SIPAGAIYBSRGJB-UHFFFAOYSA-N 0.000 description 1
- RNKSBOABAPKULM-UHFFFAOYSA-N 4-[2-[(2-bromophenyl)carbamoylamino]phenyl]-3-hydroxybenzoic acid Chemical compound OC1=CC(C(=O)O)=CC=C1C1=CC=CC=C1NC(=O)NC1=CC=CC=C1Br RNKSBOABAPKULM-UHFFFAOYSA-N 0.000 description 1
- GRDXCFKBQWDAJH-UHFFFAOYSA-N 4-acetamidobenzenesulfonyl chloride Chemical compound CC(=O)NC1=CC=C(S(Cl)(=O)=O)C=C1 GRDXCFKBQWDAJH-UHFFFAOYSA-N 0.000 description 1
- GLJFZIKVMDSXMY-UHFFFAOYSA-N 4-amino-3-hydroxybenzamide Chemical compound NC(=O)C1=CC=C(N)C(O)=C1 GLJFZIKVMDSXMY-UHFFFAOYSA-N 0.000 description 1
- NFPYJDZQOKCYIE-UHFFFAOYSA-N 4-amino-3-hydroxybenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1O NFPYJDZQOKCYIE-UHFFFAOYSA-N 0.000 description 1
- RXCMFQDTWCCLBL-UHFFFAOYSA-N 4-amino-3-hydroxynaphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(N)=C(O)C=C(S(O)(=O)=O)C2=C1 RXCMFQDTWCCLBL-UHFFFAOYSA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- ACQVEWFMUBXEMR-UHFFFAOYSA-N 4-bromo-2-fluoro-6-nitrophenol Chemical compound OC1=C(F)C=C(Br)C=C1[N+]([O-])=O ACQVEWFMUBXEMR-UHFFFAOYSA-N 0.000 description 1
- DNYRLBZBDGVLHF-UHFFFAOYSA-N 4-bromo-5-methyl-2-nitrophenol Chemical compound CC1=CC(O)=C([N+]([O-])=O)C=C1Br DNYRLBZBDGVLHF-UHFFFAOYSA-N 0.000 description 1
- WDFQBORIUYODSI-UHFFFAOYSA-N 4-bromoaniline Chemical compound NC1=CC=C(Br)C=C1 WDFQBORIUYODSI-UHFFFAOYSA-N 0.000 description 1
- ZHRLVDHMIJDWSS-UHFFFAOYSA-N 4-fluoro-2-nitrophenol Chemical compound OC1=CC=C(F)C=C1[N+]([O-])=O ZHRLVDHMIJDWSS-UHFFFAOYSA-N 0.000 description 1
- INBLGVOPOSGVTA-UHFFFAOYSA-N 4-hydroxy-3-nitrobenzonitrile Chemical compound OC1=CC=C(C#N)C=C1[N+]([O-])=O INBLGVOPOSGVTA-UHFFFAOYSA-N 0.000 description 1
- RAUWPNXIALNKQM-UHFFFAOYSA-N 4-nitro-1,2-phenylenediamine Chemical compound NC1=CC=C([N+]([O-])=O)C=C1N RAUWPNXIALNKQM-UHFFFAOYSA-N 0.000 description 1
- TYMLOMAKGOJONV-UHFFFAOYSA-N 4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1 TYMLOMAKGOJONV-UHFFFAOYSA-N 0.000 description 1
- 125000004199 4-trifluoromethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C(F)(F)F 0.000 description 1
- JBMHSKGUMDJIIU-UHFFFAOYSA-N 6-amino-2,3-diphenylphenol Chemical compound C=1C=CC=CC=1C1=C(O)C(N)=CC=C1C1=CC=CC=C1 JBMHSKGUMDJIIU-UHFFFAOYSA-N 0.000 description 1
- LIHORUAALZXMLT-UHFFFAOYSA-N 6-amino-2-fluoro-3-(trifluoromethyl)phenol Chemical compound NC1=CC=C(C(F)(F)F)C(F)=C1O LIHORUAALZXMLT-UHFFFAOYSA-N 0.000 description 1
- MVGYYGCFVPMJAQ-UHFFFAOYSA-N 6-amino-7-hydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C=C(O)C(N)=CC2=C1 MVGYYGCFVPMJAQ-UHFFFAOYSA-N 0.000 description 1
- LYPMXMBQPXPNIQ-UHFFFAOYSA-N 609-89-2 Chemical compound OC1=C(Cl)C=C(Cl)C=C1[N+]([O-])=O LYPMXMBQPXPNIQ-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 1
- 102000040717 Alpha family Human genes 0.000 description 1
- 108091071248 Alpha family Proteins 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical class N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 206010003645 Atopy Diseases 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- DOFLSRKXDWHVGP-UHFFFAOYSA-N C1(=CC=CC=C1)CCS(=O)(=O)NC1=C(N)C=CC=C1.C1(=CC=CC=C1)CCS(=O)(=O)NC1=C(C=CC=C1)NC(=O)NC1=C(C=CC=C1)Br Chemical compound C1(=CC=CC=C1)CCS(=O)(=O)NC1=C(N)C=CC=C1.C1(=CC=CC=C1)CCS(=O)(=O)NC1=C(C=CC=C1)NC(=O)NC1=C(C=CC=C1)Br DOFLSRKXDWHVGP-UHFFFAOYSA-N 0.000 description 1
- 101100289995 Caenorhabditis elegans mac-1 gene Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- AVWBZNMOTLUUFO-UHFFFAOYSA-N ClC=1C(=C(C=CC1)NC(=O)NC1=C(C=CC=C1)Br)O.OC1=C(C=CC(=C1)[N+](=O)[O-])NC(=O)NC1=C(C=CC=C1)OC1=CC=CC=C1.OC1=C(C=CC(=C1)[N+](=O)[O-])NC(=O)NC1=C(C(=CC=C1)Cl)OC Chemical compound ClC=1C(=C(C=CC1)NC(=O)NC1=C(C=CC=C1)Br)O.OC1=C(C=CC(=C1)[N+](=O)[O-])NC(=O)NC1=C(C=CC=C1)OC1=CC=CC=C1.OC1=C(C=CC(=C1)[N+](=O)[O-])NC(=O)NC1=C(C(=CC=C1)Cl)OC AVWBZNMOTLUUFO-UHFFFAOYSA-N 0.000 description 1
- 238000006969 Curtius rearrangement reaction Methods 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108091006027 G proteins Proteins 0.000 description 1
- 102000003688 G-Protein-Coupled Receptors Human genes 0.000 description 1
- 108090000045 G-Protein-Coupled Receptors Proteins 0.000 description 1
- 102000030782 GTP binding Human genes 0.000 description 1
- 108091000058 GTP-Binding Proteins 0.000 description 1
- 101001046686 Homo sapiens Integrin alpha-M Proteins 0.000 description 1
- 101000935040 Homo sapiens Integrin beta-2 Proteins 0.000 description 1
- 101000818522 Homo sapiens fMet-Leu-Phe receptor Proteins 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- WRYCSMQKUKOKBP-UHFFFAOYSA-N Imidazolidine Chemical compound C1CNCN1 WRYCSMQKUKOKBP-UHFFFAOYSA-N 0.000 description 1
- 101000668058 Infectious salmon anemia virus (isolate Atlantic salmon/Norway/810/9/99) RNA-directed RNA polymerase catalytic subunit Proteins 0.000 description 1
- 102100022338 Integrin alpha-M Human genes 0.000 description 1
- 102100025390 Integrin beta-2 Human genes 0.000 description 1
- 102100026236 Interleukin-8 Human genes 0.000 description 1
- 229910010082 LiAlH Inorganic materials 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- AZLKSJIRZRINDK-UHFFFAOYSA-N OC1=C(C=C(C=C1)[N+](=O)[O-])NC(=O)NC1=C(C(=CC=C1)Cl)Cl.OC1=C(C=CC(=C1Cl)Cl)NC(=O)NC1=C(C(=CC=C1)Cl)Cl.OC1=C(C=CC(=C1Cl)Cl)NC(=O)NC1=C(C=CC=C1)C1=CC=CC=C1 Chemical compound OC1=C(C=C(C=C1)[N+](=O)[O-])NC(=O)NC1=C(C(=CC=C1)Cl)Cl.OC1=C(C=CC(=C1Cl)Cl)NC(=O)NC1=C(C(=CC=C1)Cl)Cl.OC1=C(C=CC(=C1Cl)Cl)NC(=O)NC1=C(C=CC=C1)C1=CC=CC=C1 AZLKSJIRZRINDK-UHFFFAOYSA-N 0.000 description 1
- FHLWVCUAHJRKHS-UHFFFAOYSA-N OC1=C(C=CC(=C1)C#N)NC(=O)NC1=C(C=CC=C1)OCC1=NC=CC=C1.OC1=C(C=CC(=C1)C#N)NC(=O)NC1=C(C=CC=C1)OCC1=CC=CC=C1 Chemical compound OC1=C(C=CC(=C1)C#N)NC(=O)NC1=C(C=CC=C1)OCC1=NC=CC=C1.OC1=C(C=CC(=C1)C#N)NC(=O)NC1=C(C=CC=C1)OCC1=CC=CC=C1 FHLWVCUAHJRKHS-UHFFFAOYSA-N 0.000 description 1
- GUPJDNOWXSXVBJ-UHFFFAOYSA-N OC1=C(C=CC(=C1)C(=O)NCC1=CC=CC=C1)NC(=O)NC1=C(C=CC=C1)Br.OC1=C(C=CC(=C1)[N+](=O)[O-])NC(=O)NC1=C(C(=CC=C1)Cl)OC Chemical compound OC1=C(C=CC(=C1)C(=O)NCC1=CC=CC=C1)NC(=O)NC1=C(C=CC=C1)Br.OC1=C(C=CC(=C1)[N+](=O)[O-])NC(=O)NC1=C(C(=CC=C1)Cl)OC GUPJDNOWXSXVBJ-UHFFFAOYSA-N 0.000 description 1
- MRAUXHNMMZQWCU-UHFFFAOYSA-N OC1=C(C=CC(=C1)C(F)(F)F)NC(=O)NC1=CC=CC=C1.C(=O)(O)C1=C(C=CC(=C1)O)NC(=O)NC1=CC=CC=C1.C1(=CC=CC=C1)NC(=O)NC1=C(C=CC=C1)S Chemical compound OC1=C(C=CC(=C1)C(F)(F)F)NC(=O)NC1=CC=CC=C1.C(=O)(O)C1=C(C=CC(=C1)O)NC(=O)NC1=CC=CC=C1.C1(=CC=CC=C1)NC(=O)NC1=C(C=CC=C1)S MRAUXHNMMZQWCU-UHFFFAOYSA-N 0.000 description 1
- RZVYUDCPGKDPBU-UHFFFAOYSA-N OC1=C(C=CC(=C1)[N+](=O)[O-])NC(=O)NC1=C(C=C(C=C1)Br)Br.OC1=C(C=CC(=C1)[N+](=O)[O-])NC(=O)NC1=C(C=CC=C1)Cl.OC1=C(C=CC(=C1)[N+](=O)[O-])NC(=O)NC1=C(C=C(C=C1)Cl)Cl Chemical compound OC1=C(C=CC(=C1)[N+](=O)[O-])NC(=O)NC1=C(C=C(C=C1)Br)Br.OC1=C(C=CC(=C1)[N+](=O)[O-])NC(=O)NC1=C(C=CC=C1)Cl.OC1=C(C=CC(=C1)[N+](=O)[O-])NC(=O)NC1=C(C=C(C=C1)Cl)Cl RZVYUDCPGKDPBU-UHFFFAOYSA-N 0.000 description 1
- PZPWUGMPCBDUQP-UHFFFAOYSA-N OC1=C(C=CC(=C1)[N+](=O)[O-])NC(=O)NC1=C(C=CC=C1F)F.OC1=C(C=CC(=C1)[N+](=O)[O-])NC(=O)NC1=C(C=CC=C1)F.OC1=C(C=CC(=C1)[N+](=O)[O-])NC(=O)NC1=C(C=CC=C1)[N+](=O)[O-] Chemical compound OC1=C(C=CC(=C1)[N+](=O)[O-])NC(=O)NC1=C(C=CC=C1F)F.OC1=C(C=CC(=C1)[N+](=O)[O-])NC(=O)NC1=C(C=CC=C1)F.OC1=C(C=CC(=C1)[N+](=O)[O-])NC(=O)NC1=C(C=CC=C1)[N+](=O)[O-] PZPWUGMPCBDUQP-UHFFFAOYSA-N 0.000 description 1
- HWHHOPRHLGQTKE-UHFFFAOYSA-N OC1=C(C=CC(=C1)[N+](=O)[O-])NC(=O)NC=1SC=CC1OC.OC1=C(C=C(C=C1)[N+](=O)[O-])NC(=O)NC=1SC=CC1OC Chemical compound OC1=C(C=CC(=C1)[N+](=O)[O-])NC(=O)NC=1SC=CC1OC.OC1=C(C=C(C=C1)[N+](=O)[O-])NC(=O)NC=1SC=CC1OC HWHHOPRHLGQTKE-UHFFFAOYSA-N 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- 102100040247 Tumor necrosis factor Human genes 0.000 description 1
- 241000218220 Ulmaceae Species 0.000 description 1
- XDNPUKSYERACOF-UHFFFAOYSA-N [2-[(2-hydroxy-4-nitrophenyl)carbamoylamino]phenyl] acetate Chemical compound CC(=O)OC1=CC=CC=C1NC(=O)NC1=CC=C([N+]([O-])=O)C=C1O XDNPUKSYERACOF-UHFFFAOYSA-N 0.000 description 1
- SLVJLNZLOZPQID-UHFFFAOYSA-N [2-[(2-hydroxy-4-nitrophenyl)carbamoylamino]phenyl]methyl hydrogen sulfate Chemical compound OC1=CC([N+]([O-])=O)=CC=C1NC(=O)NC1=CC=CC=C1COS(O)(=O)=O SLVJLNZLOZPQID-UHFFFAOYSA-N 0.000 description 1
- JPCWPWWDILCKCA-UHFFFAOYSA-N [Si](C)(C)(C(C)(C)C)OC1=C(C=CC(=C1)[N+](=O)[O-])SN=C=O Chemical compound [Si](C)(C)(C(C)(C)C)OC1=C(C=CC(=C1)[N+](=O)[O-])SN=C=O JPCWPWWDILCKCA-UHFFFAOYSA-N 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000005024 alkenyl aryl group Chemical group 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- WUVCQOUWKXAJHS-UHFFFAOYSA-N anilino 4-amino-3-hydroxybenzoate Chemical compound C1=C(O)C(N)=CC=C1C(=O)ONC1=CC=CC=C1 WUVCQOUWKXAJHS-UHFFFAOYSA-N 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 229940121363 anti-inflammatory agent Drugs 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000012300 argon atmosphere Substances 0.000 description 1
- DMHZGJLWEIEBRK-UHFFFAOYSA-N argon methanol Chemical compound [Ar].OC DMHZGJLWEIEBRK-UHFFFAOYSA-N 0.000 description 1
- 150000001502 aryl halides Chemical class 0.000 description 1
- 239000005667 attractant Substances 0.000 description 1
- QYTOONVFPBUIJG-UHFFFAOYSA-N azane;cyanic acid Chemical compound [NH4+].[O-]C#N QYTOONVFPBUIJG-UHFFFAOYSA-N 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 230000002051 biphasic effect Effects 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- UBXYXCRCOKCZIT-UHFFFAOYSA-N biphenyl-3-ol Chemical compound OC1=CC=CC(C=2C=CC=CC=2)=C1 UBXYXCRCOKCZIT-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 210000004027 cell Anatomy 0.000 description 1
- 230000036978 cell physiology Effects 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 230000031902 chemoattractant activity Effects 0.000 description 1
- 239000005482 chemotactic factor Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 208000037976 chronic inflammation Diseases 0.000 description 1
- 208000037893 chronic inflammatory disorder Diseases 0.000 description 1
- 229940061631 citric acid acetate Drugs 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- IJKVHSBPTUYDLN-UHFFFAOYSA-N dihydroxy(oxo)silane Chemical compound O[Si](O)=O IJKVHSBPTUYDLN-UHFFFAOYSA-N 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 1
- 230000008034 disappearance Effects 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 210000002889 endothelial cell Anatomy 0.000 description 1
- 230000003511 endothelial effect Effects 0.000 description 1
- 210000002919 epithelial cell Anatomy 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 102100021145 fMet-Leu-Phe receptor Human genes 0.000 description 1
- 238000010265 fast atom bombardment Methods 0.000 description 1
- 210000002950 fibroblast Anatomy 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- IQECZGDVZMVJSH-UHFFFAOYSA-N furan 1H-pyrazole Chemical compound O1C=CC=C1.N1N=CC=C1 IQECZGDVZMVJSH-UHFFFAOYSA-N 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000005114 heteroarylalkoxy group Chemical group 0.000 description 1
- 125000005553 heteroaryloxy group Chemical group 0.000 description 1
- 125000004449 heterocyclylalkenyl group Chemical group 0.000 description 1
- VBZWSGALLODQNC-UHFFFAOYSA-N hexafluoroacetone Chemical compound FC(F)(F)C(=O)C(F)(F)F VBZWSGALLODQNC-UHFFFAOYSA-N 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 230000008595 infiltration Effects 0.000 description 1
- 238000001764 infiltration Methods 0.000 description 1
- 230000002757 inflammatory effect Effects 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 230000021995 interleukin-8 production Effects 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- NONOKGVFTBWRLD-UHFFFAOYSA-N isocyanatosulfanylimino(oxo)methane Chemical compound O=C=NSN=C=O NONOKGVFTBWRLD-UHFFFAOYSA-N 0.000 description 1
- 125000005956 isoquinolyl group Chemical group 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 230000002132 lysosomal effect Effects 0.000 description 1
- 210000002540 macrophage Anatomy 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 201000001441 melanoma Diseases 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- DDUNMNVFNVRLFB-VQHVLOKHSA-N methyl (e)-3-[4-[(2-bromophenyl)carbamoylamino]-3-hydroxyphenyl]prop-2-enoate Chemical compound OC1=CC(/C=C/C(=O)OC)=CC=C1NC(=O)NC1=CC=CC=C1Br DDUNMNVFNVRLFB-VQHVLOKHSA-N 0.000 description 1
- FGMISCVVYSYIAQ-UHFFFAOYSA-N methyl 4-[(2-bromophenyl)carbamoylamino]-3-hydroxybenzoate Chemical compound OC1=CC(C(=O)OC)=CC=C1NC(=O)NC1=CC=CC=C1Br FGMISCVVYSYIAQ-UHFFFAOYSA-N 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 210000001616 monocyte Anatomy 0.000 description 1
- JFCHSQDLLFJHOA-UHFFFAOYSA-N n,n-dimethylsulfamoyl chloride Chemical compound CN(C)S(Cl)(=O)=O JFCHSQDLLFJHOA-UHFFFAOYSA-N 0.000 description 1
- KKBCMONERKOXFP-UHFFFAOYSA-N n-(2-aminophenyl)thiophene-2-sulfonamide Chemical compound NC1=CC=CC=C1NS(=O)(=O)C1=CC=CS1 KKBCMONERKOXFP-UHFFFAOYSA-N 0.000 description 1
- NHDUIVOKCKQWEF-UHFFFAOYSA-N n-benzyl-4-[(2-bromophenyl)carbamoylamino]-3-hydroxybenzamide Chemical compound OC1=CC(C(=O)NCC=2C=CC=CC=2)=CC=C1NC(=O)NC1=CC=CC=C1Br NHDUIVOKCKQWEF-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 125000006501 nitrophenyl group Chemical group 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- FCJSHPDYVMKCHI-UHFFFAOYSA-N phenyl benzoate Chemical compound C=1C=CC=CC=1C(=O)OC1=CC=CC=C1 FCJSHPDYVMKCHI-UHFFFAOYSA-N 0.000 description 1
- 239000003279 phenylacetic acid Substances 0.000 description 1
- 229960003424 phenylacetic acid Drugs 0.000 description 1
- OAHKWDDSKCRNFE-UHFFFAOYSA-N phenylmethanesulfonyl chloride Chemical compound ClS(=O)(=O)CC1=CC=CC=C1 OAHKWDDSKCRNFE-UHFFFAOYSA-N 0.000 description 1
- 238000012746 preparative thin layer chromatography Methods 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000001243 protein synthesis Methods 0.000 description 1
- 239000003586 protic polar solvent Substances 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- JUYUYCIJACTHMK-UHFFFAOYSA-N quinoline-8-sulfonyl chloride Chemical compound C1=CN=C2C(S(=O)(=O)Cl)=CC=CC2=C1 JUYUYCIJACTHMK-UHFFFAOYSA-N 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 230000019254 respiratory burst Effects 0.000 description 1
- 230000000241 respiratory effect Effects 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 206010039073 rheumatoid arthritis Diseases 0.000 description 1
- WKEDVNSFRWHDNR-UHFFFAOYSA-N salicylanilide Chemical compound OC1=CC=CC=C1C(=O)NC1=CC=CC=C1 WKEDVNSFRWHDNR-UHFFFAOYSA-N 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 150000003384 small molecules Chemical class 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- OVYTZAASVAZITK-UHFFFAOYSA-M sodium;ethanol;hydroxide Chemical compound [OH-].[Na+].CCO OVYTZAASVAZITK-UHFFFAOYSA-M 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 230000004936 stimulating effect Effects 0.000 description 1
- 239000011550 stock solution Substances 0.000 description 1
- 125000005504 styryl group Chemical group 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- QCZNZEFAVZZKPE-UHFFFAOYSA-N tert-butyl-(2-isocyanato-5-nitrophenoxy)-dimethylsilane Chemical compound CC(C)(C)[Si](C)(C)OC1=CC([N+]([O-])=O)=CC=C1N=C=O QCZNZEFAVZZKPE-UHFFFAOYSA-N 0.000 description 1
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 1
- BCNZYOJHNLTNEZ-UHFFFAOYSA-N tert-butyldimethylsilyl chloride Chemical compound CC(C)(C)[Si](C)(C)Cl BCNZYOJHNLTNEZ-UHFFFAOYSA-N 0.000 description 1
- 125000001981 tert-butyldimethylsilyl group Chemical group [H]C([H])([H])[Si]([H])(C([H])([H])[H])[*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- VNNLHYZDXIBHKZ-UHFFFAOYSA-N thiophene-2-sulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=CS1 VNNLHYZDXIBHKZ-UHFFFAOYSA-N 0.000 description 1
- 150000003585 thioureas Chemical class 0.000 description 1
- GZNAASVAJNXPPW-UHFFFAOYSA-M tin(4+) chloride dihydrate Chemical compound O.O.[Cl-].[Sn+4] GZNAASVAJNXPPW-UHFFFAOYSA-M 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- FWPIDFUJEMBDLS-UHFFFAOYSA-L tin(II) chloride dihydrate Substances O.O.Cl[Sn]Cl FWPIDFUJEMBDLS-UHFFFAOYSA-L 0.000 description 1
- 230000014616 translation Effects 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- NTJBWZHVSJNKAD-UHFFFAOYSA-N triethylazanium;fluoride Chemical compound [F-].CC[NH+](CC)CC NTJBWZHVSJNKAD-UHFFFAOYSA-N 0.000 description 1
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 1
- JLTRXTDYQLMHGR-UHFFFAOYSA-N trimethylaluminium Chemical compound C[Al](C)C JLTRXTDYQLMHGR-UHFFFAOYSA-N 0.000 description 1
- UCPYLLCMEDAXFR-UHFFFAOYSA-N triphosgene Chemical compound ClC(Cl)(Cl)OC(=O)OC(Cl)(Cl)Cl UCPYLLCMEDAXFR-UHFFFAOYSA-N 0.000 description 1
- 210000003556 vascular endothelial cell Anatomy 0.000 description 1
- 238000004804 winding Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/30—Oxygen atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/16—Amides, e.g. hydroxamic acids
- A61K31/17—Amides, e.g. hydroxamic acids having the group >N—C(O)—N< or >N—C(S)—N<, e.g. urea, thiourea, carmustine
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/16—Amides, e.g. hydroxamic acids
- A61K31/18—Sulfonamides
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/21—Esters, e.g. nitroglycerine, selenocyanates
- A61K31/215—Esters, e.g. nitroglycerine, selenocyanates of carboxylic acids
- A61K31/22—Esters, e.g. nitroglycerine, selenocyanates of carboxylic acids of acyclic acids, e.g. pravastatin
- A61K31/223—Esters, e.g. nitroglycerine, selenocyanates of carboxylic acids of acyclic acids, e.g. pravastatin of alpha-aminoacids
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/275—Nitriles; Isonitriles
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/275—Nitriles; Isonitriles
- A61K31/277—Nitriles; Isonitriles having a ring, e.g. verapamil
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/335—Heterocyclic compounds having oxygen as the only ring hetero atom, e.g. fungichromin
- A61K31/357—Heterocyclic compounds having oxygen as the only ring hetero atom, e.g. fungichromin having two or more oxygen atoms in the same ring, e.g. crown ethers, guanadrel
- A61K31/36—Compounds containing methylenedioxyphenyl groups, e.g. sesamin
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/38—Heterocyclic compounds having sulfur as a ring hetero atom
- A61K31/381—Heterocyclic compounds having sulfur as a ring hetero atom having five-membered rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/41—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having five-membered rings with two or more ring hetero atoms, at least one of which being nitrogen, e.g. tetrazole
- A61K31/425—Thiazoles
- A61K31/426—1,3-Thiazoles
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/47—Quinolines; Isoquinolines
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
- A61P11/06—Antiasthmatics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P13/00—Drugs for disorders of the urinary system
- A61P13/12—Drugs for disorders of the urinary system of the kidneys
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P17/00—Drugs for dermatological disorders
- A61P17/06—Antipsoriatics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P19/00—Drugs for skeletal disorders
- A61P19/02—Drugs for skeletal disorders for joint disorders, e.g. arthritis, arthrosis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/28—Drugs for disorders of the nervous system for treating neurodegenerative disorders of the central nervous system, e.g. nootropic agents, cognition enhancers, drugs for treating Alzheimer's disease or other forms of dementia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/02—Local antiseptics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/02—Immunomodulators
- A61P37/06—Immunosuppressants, e.g. drugs for graft rejection
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/08—Antiallergic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/02—Antithrombotic agents; Anticoagulants; Platelet aggregation inhibitors
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/32—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms
- C07C275/34—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms having nitrogen atoms of urea groups and singly-bound oxygen atoms bound to carbon atoms of the same non-condensed six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/38—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by doubly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/40—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by nitrogen atoms not being part of nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/28—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C275/42—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups having nitrogen atoms of urea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C307/00—Amides of sulfuric acids, i.e. compounds having singly-bound oxygen atoms of sulfate groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C307/04—Diamides of sulfuric acids
- C07C307/10—Diamides of sulfuric acids having nitrogen atoms of the sulfamide groups bound to carbon atoms of six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/01—Sulfonic acids
- C07C309/02—Sulfonic acids having sulfo groups bound to acyclic carbon atoms
- C07C309/03—Sulfonic acids having sulfo groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton
- C07C309/13—Sulfonic acids having sulfo groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton containing nitrogen atoms, not being part of nitro or nitroso groups, bound to the carbon skeleton
- C07C309/14—Sulfonic acids having sulfo groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton containing nitrogen atoms, not being part of nitro or nitroso groups, bound to the carbon skeleton containing amino groups bound to the carbon skeleton
- C07C309/15—Sulfonic acids having sulfo groups bound to acyclic carbon atoms of an acyclic saturated carbon skeleton containing nitrogen atoms, not being part of nitro or nitroso groups, bound to the carbon skeleton containing amino groups bound to the carbon skeleton the nitrogen atom of at least one of the amino groups being part of any of the groups, X being a hetero atom, Y being any atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/01—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms
- C07C311/10—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of a saturated carbon skeleton containing rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/01—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms
- C07C311/12—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing rings
- C07C311/13—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing rings the carbon skeleton containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/15—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings
- C07C311/21—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/22—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound oxygen atoms
- C07C311/29—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound oxygen atoms having the sulfur atom of at least one of the sulfonamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/30—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/45—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound nitrogen atoms, not being part of nitro or nitroso groups at least one of the singly-bound nitrogen atoms being part of any of the groups, X being a hetero atom, Y being any atom, e.g. N-acylaminosulfonamides
- C07C311/46—Y being a hydrogen or a carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/26—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C317/32—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton with sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C317/34—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton with sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having sulfone or sulfoxide groups and amino groups bound to carbon atoms of six-membered aromatic rings being part of the same non-condensed ring or of a condensed ring system containing that ring
- C07C317/38—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton with sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having sulfone or sulfoxide groups and amino groups bound to carbon atoms of six-membered aromatic rings being part of the same non-condensed ring or of a condensed ring system containing that ring with the nitrogen atom of at least one amino group being part of any of the groups, X being a hetero atom, Y being any atom, e.g. N-acylaminosulfones
- C07C317/42—Y being a hetero atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/39—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton at least one of the nitrogen atoms being part of any of the groups, X being a hetero atom, Y being any atom
- C07C323/43—Y being a hetero atom
- C07C323/44—X or Y being nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C335/00—Thioureas, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C335/04—Derivatives of thiourea
- C07C335/16—Derivatives of thiourea having nitrogen atoms of thiourea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C335/18—Derivatives of thiourea having nitrogen atoms of thiourea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/70—Sulfur atoms
- C07D213/71—Sulfur atoms to which a second hetero atom is attached
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/36—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/36—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D277/38—Nitrogen atoms
- C07D277/44—Acylated amino or imino radicals
- C07D277/46—Acylated amino or imino radicals by carboxylic acids, or sulfur or nitrogen analogues thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/62—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to atoms of the carbocyclic ring
- C07D317/66—Nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/28—Halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/30—Hetero atoms other than halogen
- C07D333/34—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/26—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D333/30—Hetero atoms other than halogen
- C07D333/36—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2602/00—Systems containing two condensed rings
- C07C2602/02—Systems containing two condensed rings the rings having only two atoms in common
- C07C2602/04—One of the condensed rings being a six-membered aromatic ring
- C07C2602/08—One of the condensed rings being a six-membered aromatic ring the other ring being five-membered, e.g. indane
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2603/00—Systems containing at least three condensed rings
- C07C2603/02—Ortho- or ortho- and peri-condensed systems
- C07C2603/04—Ortho- or ortho- and peri-condensed systems containing three rings
- C07C2603/06—Ortho- or ortho- and peri-condensed systems containing three rings containing at least one ring with less than six ring members
- C07C2603/10—Ortho- or ortho- and peri-condensed systems containing three rings containing at least one ring with less than six ring members containing five-membered rings
- C07C2603/12—Ortho- or ortho- and peri-condensed systems containing three rings containing at least one ring with less than six ring members containing five-membered rings only one five-membered ring
- C07C2603/18—Fluorenes; Hydrogenated fluorenes
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02A—TECHNOLOGIES FOR ADAPTATION TO CLIMATE CHANGE
- Y02A50/00—TECHNOLOGIES FOR ADAPTATION TO CLIMATE CHANGE in human health protection, e.g. against extreme weather
- Y02A50/30—Against vector-borne diseases, e.g. mosquito-borne, fly-borne, tick-borne or waterborne diseases whose impact is exacerbated by climate change
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- Medicinal Chemistry (AREA)
- General Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Epidemiology (AREA)
- General Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Immunology (AREA)
- Pulmonology (AREA)
- Biomedical Technology (AREA)
- Neurosurgery (AREA)
- Emergency Medicine (AREA)
- Rheumatology (AREA)
- Neurology (AREA)
- Psychiatry (AREA)
- Physical Education & Sports Medicine (AREA)
- Pain & Pain Management (AREA)
- Hospice & Palliative Care (AREA)
- Communicable Diseases (AREA)
- Oncology (AREA)
- Transplantation (AREA)
- Urology & Nephrology (AREA)
- Orthopedic Medicine & Surgery (AREA)
- Hematology (AREA)
- Dermatology (AREA)
- Diabetes (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US39026095A | 1995-02-17 | 1995-02-17 | |
| PCT/US1996/002260 WO1996025157A1 (en) | 1995-02-17 | 1996-02-16 | Il-8 receptor antagonists |
| PCT/US1996/013632 WO1997029743A1 (en) | 1995-02-17 | 1996-08-21 | Il-8 receptor antagonists |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SK110198A3 true SK110198A3 (en) | 1999-02-11 |
Family
ID=23541762
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SK1101-98A SK110198A3 (en) | 1995-02-17 | 1996-08-21 | Il-8 receptor antagonists, method for the preparation thereof, pharmaceutical composition and use |
Country Status (19)
| Country | Link |
|---|---|
| US (2) | US5886044A (OSRAM) |
| EP (2) | EP0809492A4 (OSRAM) |
| JP (2) | JPH11503110A (OSRAM) |
| KR (1) | KR19990082622A (OSRAM) |
| CN (2) | CN1539816A (OSRAM) |
| AU (1) | AU725456B2 (OSRAM) |
| BG (1) | BG102690A (OSRAM) |
| BR (1) | BR9612779A (OSRAM) |
| CA (1) | CA2245927A1 (OSRAM) |
| EA (1) | EA001436B1 (OSRAM) |
| HU (1) | HUP0000467A3 (OSRAM) |
| IL (1) | IL125717A0 (OSRAM) |
| NO (1) | NO983737L (OSRAM) |
| NZ (1) | NZ316710A (OSRAM) |
| OA (1) | OA10840A (OSRAM) |
| PL (1) | PL328562A1 (OSRAM) |
| SK (1) | SK110198A3 (OSRAM) |
| TR (1) | TR199801592T2 (OSRAM) |
| WO (2) | WO1996025157A1 (OSRAM) |
Families Citing this family (174)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0809492A4 (en) * | 1995-02-17 | 2007-01-24 | Smithkline Beecham Corp | IL-8 RECEPTOR ANTAGONISTS |
| US6054472A (en) * | 1996-04-23 | 2000-04-25 | Vertex Pharmaceuticals, Incorporated | Inhibitors of IMPDH enzyme |
| US5807876A (en) | 1996-04-23 | 1998-09-15 | Vertex Pharmaceuticals Incorporated | Inhibitors of IMPDH enzyme |
| US6211373B1 (en) * | 1996-03-20 | 2001-04-03 | Smithkline Beecham Corporation | Phenyl urea antagonists of the IL-8 receptor |
| CA2256492C (en) | 1996-05-20 | 2006-04-04 | Teijin Limited | Diarylalkyl cyclic diamine derivatives as chemokine receptor antagonists |
| WO1997049399A1 (en) * | 1996-06-27 | 1997-12-31 | Smithkline Beecham Corporation | Il-8 receptor antagonists |
| WO1998005317A1 (en) * | 1996-08-06 | 1998-02-12 | Smithkline Beecham Corporation | Il-8 receptor antagonists |
| WO1998005329A1 (en) | 1996-08-06 | 1998-02-12 | Smithkline Beecham Corporation | Il-8 receptor antagonists |
| WO1998006398A1 (en) * | 1996-08-15 | 1998-02-19 | Smithkline Beecham Corporation | Il-8 receptor antagonists |
| CA2268085A1 (en) * | 1996-10-22 | 1998-04-30 | Go Wakabayashi | Sepsis remedy comprising anti-il-8 antibody as active ingredient |
| DE19651040C2 (de) * | 1996-12-09 | 1999-01-28 | Bayer Ag | Verfahren zur Herstellung von 2-Amino-5-alkyl-phenolen |
| KR20000070368A (ko) * | 1997-01-23 | 2000-11-25 | 스튜어트 알. 수터, 스티븐 베네티아너, 피터 존 기딩스 | 인터루킨-8 수용체 길항제 |
| US6436927B1 (en) | 1997-02-12 | 2002-08-20 | Smithkline Beecham Corporation | IL-8 receptor antagonists |
| ES2224365T3 (es) * | 1997-02-12 | 2005-03-01 | Smithkline Beecham Corporation | Antagonistas de receptores de il-8. |
| US6696475B2 (en) | 1997-04-22 | 2004-02-24 | Neurosearch A/S | Substituted phenyl derivatives, their preparation and use |
| US6344476B1 (en) * | 1997-05-23 | 2002-02-05 | Bayer Corporation | Inhibition of p38 kinase activity by aryl ureas |
| EP1014962A4 (en) * | 1997-06-26 | 2007-06-27 | Lilly Co Eli | ANTITHROMBOTIC AGENTS |
| AU8673198A (en) * | 1997-07-29 | 1999-02-22 | Smithkline Beecham Corporation | Il-8 receptor antagonists |
| US7067117B1 (en) | 1997-09-11 | 2006-06-27 | Cambridge University Technical Services, Ltd. | Compounds and methods to inhibit or augment an inflammatory response |
| US6989435B2 (en) | 1997-09-11 | 2006-01-24 | Cambridge University Technical Services Ltd. | Compounds and methods to inhibit or augment an inflammatory response |
| NZ505843A (en) * | 1997-12-22 | 2003-06-30 | Bayer Ag | Diphenyl ureas compounds for treating cancer and raf kinase related diseases |
| US7517880B2 (en) | 1997-12-22 | 2009-04-14 | Bayer Pharmaceuticals Corporation | Inhibition of p38 kinase using symmetrical and unsymmetrical diphenyl ureas |
| US7329670B1 (en) | 1997-12-22 | 2008-02-12 | Bayer Pharmaceuticals Corporation | Inhibition of RAF kinase using aryl and heteroaryl substituted heterocyclic ureas |
| JP4437270B2 (ja) * | 1997-12-22 | 2010-03-24 | バイエル コーポレイション | 置換複素環式尿素を用いたrafキナーゼの阻害 |
| US20080300281A1 (en) * | 1997-12-22 | 2008-12-04 | Jacques Dumas | Inhibition of p38 Kinase Activity Using Aryl and Heteroaryl Substituted Heterocyclic Ureas |
| AU2003204708B2 (en) * | 1997-12-22 | 2006-05-25 | Bayer Healthcare Llc | Inhibition of Raf Kinase using Substituted Heterocyclic Ureas |
| WO1999065310A1 (en) * | 1998-06-17 | 1999-12-23 | Smithkline Beecham Corporation | Il-8 receptor antagonists |
| BR9815951A (pt) * | 1998-07-23 | 2001-03-06 | Smithkline Beecham Corp | Antagonistas do receptor de il-8 |
| CA2341718A1 (en) * | 1998-08-28 | 2000-03-09 | Neil H. Baine | An improved synthesis of 3-hydroxy-4-amino-benzonitrile |
| PL198852B1 (pl) * | 1998-10-22 | 2008-07-31 | Neurosearch As | Podstawione pochodne fenylu, kompozycja farmaceutyczna je zawierająca oraz ich zastosowanie |
| US6262090B1 (en) | 1998-12-09 | 2001-07-17 | American Home Products Corporation | Aminopyridine-containing thiourea inhibitors of herpes viruses |
| US6207715B1 (en) | 1998-12-09 | 2001-03-27 | American Home Products Corporation | Alpha-methylbenzyl-containing thiourea inhibitors of herpes viruses containing a substituted phenylene-diamine group |
| US6255349B1 (en) | 1998-12-09 | 2001-07-03 | American Home Products Corporation | Alph-methylbenzyl-containing thiourea inhibitors of herpes viruses containing a phenylenediamine group |
| US6166028A (en) | 1998-12-09 | 2000-12-26 | American Home Products Corporation | Diaminopuridine-containing thiourea inhibitors of herpes viruses |
| US6197803B1 (en) | 1998-12-09 | 2001-03-06 | American Home Products Corporation | Heterocyclic carboxamide-containing thiourea inhibitors of herpes viruses containing phenylenediamine group |
| JP2002531545A (ja) * | 1998-12-09 | 2002-09-24 | ワイス | ヘルペスウイルスのチオ尿素インヒビター |
| US6335350B1 (en) | 1998-12-09 | 2002-01-01 | American Home Products Corporation | Acetamide and substituted acetamide-containing thiourea inhibitors of herpes viruses |
| JP2002531555A (ja) * | 1998-12-09 | 2002-09-24 | ワイス | フェニレンジアミン基を含む、アルファ−メチルベンジル−含有の、ヘルペスウイルスのチオ尿素インヒビター |
| US6201013B1 (en) | 1998-12-09 | 2001-03-13 | American Home Products Corporation | Heterocyclic carboxamide-containing thiourea inhibitors of herpes viruses containing a substituted phenylenediamine group |
| US20080269265A1 (en) * | 1998-12-22 | 2008-10-30 | Scott Miller | Inhibition Of Raf Kinase Using Symmetrical And Unsymmetrical Substituted Diphenyl Ureas |
| US8124630B2 (en) | 1999-01-13 | 2012-02-28 | Bayer Healthcare Llc | ω-carboxyaryl substituted diphenyl ureas as raf kinase inhibitors |
| US7928239B2 (en) | 1999-01-13 | 2011-04-19 | Bayer Healthcare Llc | Inhibition of RAF kinase using quinolyl, isoquinolyl or pyridyl ureas |
| US7351834B1 (en) | 1999-01-13 | 2008-04-01 | Bayer Pharmaceuticals Corporation | ω-Carboxyaryl substituted diphenyl ureas as raf kinase inhibitors |
| EP1140840B1 (en) | 1999-01-13 | 2006-03-22 | Bayer Pharmaceuticals Corp. | -g(v)-carboxyaryl substituted diphenyl ureas as raf kinase inhibitors |
| EP1158985B1 (en) | 1999-01-13 | 2011-12-28 | Bayer HealthCare LLC | OMEGA-CARBOXY ARYL SUBSTITUTED DIPHENYL UREAS AS p38 KINASE INHIBITORS |
| UA73492C2 (en) | 1999-01-19 | 2005-08-15 | Aromatic heterocyclic compounds as antiinflammatory agents | |
| MXPA01008440A (es) | 1999-02-22 | 2002-04-24 | Boehringer Ingelheim Pharma | Derivados heterociclicos policiclos como agentes anti-inflamatorios.. |
| DE60023853T2 (de) * | 1999-03-12 | 2006-05-24 | Boehringer Ingelheim Pharmaceuticals, Inc., Ridgefield | Aromatische heterozyklische verbindungen als antientzündungwirkstoffe |
| HUP0202248A3 (en) | 1999-03-12 | 2006-06-28 | Boehringer Ingelheim Pharma | Compounds useful as anti-inflammatory agents |
| SK13132001A3 (sk) * | 1999-03-17 | 2002-02-05 | Astrazeneca Ab | Amidové deriváty, spôsob ich prípravy, farmaceutická kompozícia, ktorá ich obsahuje, a ich použitie |
| AR029361A1 (es) * | 1999-05-28 | 2003-06-25 | Smithkline Beecham Corp | Compuestos de guanidina ciclicas antagonistas de los receptores de la il- 8, composicion farmaceutica que los comprende y el uso de los mismos para la manufactura de un medicamento |
| CO5190710A1 (es) * | 1999-06-15 | 2002-08-29 | Smithkline Beecham Corp | Antagonistas de un receptor de il-8 un receptor de il-8 |
| CO5200760A1 (es) * | 1999-06-16 | 2002-09-27 | Smithkline Beecham Corp | Antagonistas del receptor de la il-8 ceptor il-8 |
| ES2292461T3 (es) * | 1999-07-07 | 2008-03-16 | Astrazeneca Uk Limited | Derivados de quinazolina. |
| MXPA02000314A (es) | 1999-07-09 | 2004-06-22 | Boehringer Ingelheim Pharma | Proceso novedoso para la sintesis de compuestos de urea substituidos con heteroarilo. |
| WO2001007411A1 (en) | 1999-07-26 | 2001-02-01 | Banyu Pharmaceutical Co., Ltd. | Biarylurea derivatives |
| CO5271663A1 (es) * | 1999-11-09 | 2003-04-30 | Smithkline Beecham Corp | Antagonistas del receptor il-8 |
| CA2389360C (en) | 1999-11-16 | 2008-06-03 | Steffen Breitfelder | Urea derivatives as anti-inflammatory agents |
| US6525046B1 (en) | 2000-01-18 | 2003-02-25 | Boehringer Ingelheim Pharmaceuticals, Inc. | Aromatic heterocyclic compounds as antiinflammatory agents |
| US6608052B2 (en) | 2000-02-16 | 2003-08-19 | Boehringer Ingelheim Pharmaceuticals, Inc. | Compounds useful as anti-inflammatory agents |
| EP1274413A4 (en) * | 2000-03-01 | 2005-08-10 | Smithkline Beecham Corp | IL-8 RECEPTOR ANTAGONISTS |
| JP2004504270A (ja) * | 2000-03-10 | 2004-02-12 | スミスクライン・ビーチャム・コーポレイション | Il−8受容体アンタゴニスト |
| MY133845A (en) * | 2000-03-10 | 2007-11-30 | Smithkline Beecham Corp | Il-8 receptor antagonists |
| WO2001068569A2 (en) * | 2000-03-14 | 2001-09-20 | Smithkline Beecham Corporation | Il-8 receptor antagonists |
| AR031098A1 (es) * | 2000-03-16 | 2003-09-10 | Smithkline Beecham Corp | Compuestos de hidroxifenil urea sustituidos con sulfonamidas, composiciones farmaceuticas que los comprenden, y uso de los mismos en la fabricacion de medicamentos para tratar una enfermedad mediada por una quimioquina |
| UY26627A1 (es) * | 2000-03-24 | 2001-09-28 | Smithkline Beecham Corp | Antagonistas de receptores de il-8 |
| CA2405690A1 (en) * | 2000-04-14 | 2002-10-09 | Kureha Chemical Industry Company, Limited | Nitrogen-containing compounds and antiviral drugs containing the same |
| WO2001092202A1 (en) * | 2000-05-30 | 2001-12-06 | Smithkline Beecham Corporation | Il-8 receptor antagonists |
| CZ2003132A3 (cs) * | 2000-07-18 | 2003-09-17 | Smithkline Beecham Corporation | Farmaceutický prostředek pro léčení příznaků běžného nachlazení |
| AU2001290852A1 (en) * | 2000-09-15 | 2002-03-26 | Iconix Pharmaceuticals, Inc. | Inhibitors of rho c |
| US7235576B1 (en) | 2001-01-12 | 2007-06-26 | Bayer Pharmaceuticals Corporation | Omega-carboxyaryl substituted diphenyl ureas as raf kinase inhibitors |
| DE60230722D1 (de) * | 2001-01-16 | 2009-02-26 | Smithkline Beecham Corp | Il-8-rezeptor-antagonisten |
| WO2002057230A1 (en) * | 2001-01-16 | 2002-07-25 | Smithkline Beecham Corporation | Il-8 receptor antagonists |
| DE10109204A1 (de) * | 2001-02-26 | 2002-09-19 | 4Sc Ag | Verbindungen zur Behandlung von Protozoen-Erkrankungen |
| WO2002070467A1 (en) | 2001-02-26 | 2002-09-12 | 4Sc Ag | Derivatives of diphenylurea, diphenyloxalic acid diamide and diphenylsulfuric acid diamide and their use as medicaments |
| ITMI20010395A1 (it) | 2001-02-27 | 2002-08-27 | Dompe Spa | Omega-amminoalchilammidi di acidi r-2-aril-propionici come inibitori della chemiotassi di cellule polimorfonucleate e mononucleate |
| CA2439255C (en) | 2001-02-28 | 2011-01-04 | Temple University Of The Commonwealth System Of Higher Education | N-(aryl)-2-arylethenesulfonamides and therapeutic uses thereof |
| US7371763B2 (en) | 2001-04-20 | 2008-05-13 | Bayer Pharmaceuticals Corporation | Inhibition of raf kinase using quinolyl, isoquinolyl or pyridyl ureas |
| CN1630517A (zh) * | 2001-05-24 | 2005-06-22 | 吴羽化学工业株式会社 | 包含含氮化合物的具有cxcr4拮抗作用的药物 |
| US20040038854A1 (en) * | 2001-07-16 | 2004-02-26 | Dillon Susan B. | Use of il-8 receptor antagonists in the treatment of virus infections |
| US6791892B2 (en) * | 2001-07-18 | 2004-09-14 | Samsung Electronics Co., Ltd. | Method of generating an initializing signal during power-up of semiconductor memory device |
| ES2400070T3 (es) * | 2001-12-03 | 2013-04-05 | Bayer Healthcare Llc | Compuestos de aril-urea en combinación con otros agentes citostáticos o citotóxicos para tratamiento de cánceres humanos |
| US20080108672A1 (en) * | 2002-01-11 | 2008-05-08 | Bernd Riedl | Omega-Carboxyaryl Substituted Diphenyl Ureas As Raf Kinase Inhibitors |
| CA2475818C (en) * | 2002-02-11 | 2011-07-19 | Bayer Pharmaceuticals Corporation | Aryl ureas as kinase inhibitors |
| ES2425739T3 (es) * | 2002-02-11 | 2013-10-17 | Bayer Healthcare Llc | Sorafenib-tosilato para el tratamiento de enfermedades caracterizadas por angiogénesis anormal |
| US20040023961A1 (en) * | 2002-02-11 | 2004-02-05 | Bayer Corporation | Aryl ureas with raf kinase and angiogenisis inhibiting activity |
| AU2003209119A1 (en) * | 2002-02-11 | 2003-09-04 | Bayer Pharmaceuticals Corporation | Pyridine, quinoline, and isoquinoline n-oxides as kinase inhibitors |
| EP1480973B1 (en) | 2002-02-25 | 2008-02-13 | Boehringer Ingelheim Pharmaceuticals Inc. | 1,4-disubstituted benzofused cycloalkyl urea compounds useful in treating cytokine mediated diseases |
| IL163608A0 (en) * | 2002-02-28 | 2005-12-18 | Univ Temple | Amino-substituted sulfonanilides and derivatives thereof for treating proliferative disorders |
| KR20030080509A (ko) * | 2002-04-09 | 2003-10-17 | 주식회사 엘지생명과학 | 우레아, 티오우레아 및 설파마이드 유도체를 함유하는항균제 조성물 |
| US20030236287A1 (en) * | 2002-05-03 | 2003-12-25 | Piotrowski David W. | Positive allosteric modulators of the nicotinic acetylcholine receptor |
| ATE372770T1 (de) * | 2002-08-01 | 2007-09-15 | Neurosearch As | Verbindungen nützlich in der behandlung von erkrankungen die auf anti-angiogenertherapie antworten |
| JP3714948B2 (ja) * | 2002-09-11 | 2005-11-09 | 呉羽化学工業株式会社 | アミン化合物及びその用途 |
| EP1402887A1 (en) * | 2002-09-18 | 2004-03-31 | Jerini AG | New compounds for the inhibition of undesired cell proliferation and use thereof |
| TW200418812A (en) | 2002-10-29 | 2004-10-01 | Smithkline Beecham Corp | IL-8 receptor antagonists |
| DE10251830A1 (de) * | 2002-11-07 | 2004-05-19 | Wella Ag | 2-Amino-5-ethylphenol enthaltendes Mittel zum Färben von Keratinfasern |
| DE60327652D1 (de) * | 2002-11-21 | 2009-06-25 | Neurosearch As | Diarylureidoderivate und deren medizinische verwendung |
| WO2004058683A2 (en) * | 2002-12-20 | 2004-07-15 | Migenix Corp. | Ligands of adenine nucleotide translocase (ant) and compositions and methods related thereto |
| WO2004058722A1 (en) * | 2002-12-24 | 2004-07-15 | Arena Pharmaceuticals, Inc. | Diarylamine and arylheteroarylamine pyrazole derivatives as modulators of 5ht2a |
| US7220768B2 (en) * | 2003-02-11 | 2007-05-22 | Wyeth Holdings Corp. | Isoxazole-containing thiourea inhibitors useful for treatment of varicella zoster virus |
| AU2004212633B2 (en) * | 2003-02-21 | 2010-12-09 | ResMed Pty Ltd | Nasal assembly |
| US7557129B2 (en) | 2003-02-28 | 2009-07-07 | Bayer Healthcare Llc | Cyanopyridine derivatives useful in the treatment of cancer and other disorders |
| EP1457485A1 (en) * | 2003-03-14 | 2004-09-15 | Dompé S.P.A. | Sulfonic acids, their derivatives and pharmaceutical compositions containing them |
| WO2004089296A2 (en) * | 2003-04-03 | 2004-10-21 | The Regents Of The University Of California | Improved inhibitors for the soluble epoxide hydrolase |
| DE602004011340T2 (de) | 2003-05-20 | 2008-11-06 | Bayer Healthcare Llc | Diaryl-harnstoffe mit kinasehemmender wirkung |
| RS20060035A (sr) * | 2003-07-22 | 2008-08-07 | Arena Pharmaceuticals Inc., | Derivati diaril i arilheteroaril uree kao modulatori receptora 5-ht2a serotonina korisni u profilaksi i lečenju poremećaja u vezi sa njima |
| NZ544920A (en) | 2003-07-23 | 2009-11-27 | Bayer Healthcare Llc | 4{4-[3-(4-chloro-3-trifluoromethylphenyl)-ureido]-3-fluorophenoxy}-pyridine-2-carboxylic acid methylamide and metabolites for the treatment and prevention of diseases and conditions |
| US7851492B2 (en) | 2003-09-04 | 2010-12-14 | Neurosearch A/S | ERG channel openers for the treatment of cardiac arrhythmias |
| WO2005023238A1 (en) * | 2003-09-04 | 2005-03-17 | Poseidon Pharmaceuticals A/S | Erg channel openers for the treatment of hyperexcitability-related neuronal diseases |
| TW200530236A (en) | 2004-02-23 | 2005-09-16 | Chugai Pharmaceutical Co Ltd | Heteroaryl phenylurea |
| CA2558600C (en) * | 2004-03-10 | 2013-07-09 | Kureha Corporation | A substituted-trialkyl amine compound with anti-viral activity based on antagonism against a chemokine receptor cxcr4 |
| CA2559665A1 (en) | 2004-03-16 | 2005-09-29 | The Regents Of The University Of California | Reducing nephropathy with inhibitors of soluble epoxide hydrolase and epoxyeicosanoids |
| WO2005103011A1 (en) * | 2004-03-23 | 2005-11-03 | Arena Pharmaceuticals, Inc. | Processes for preparing substituted n-aryl-n’-[3-(1h-pyrazol-5-yl) phenyl] ureas and intermediates thereof |
| AU2005225559A1 (en) * | 2004-03-29 | 2005-10-06 | Neurosearch A/S | Novel urea derivatives and their medical use |
| JP2007535565A (ja) | 2004-04-30 | 2007-12-06 | バイエル ファーマシューティカルス コーポレーション | 癌の治療に有用な置換ピラゾリル尿素誘導体 |
| ES2340179T3 (es) * | 2004-05-12 | 2010-05-31 | Bristol-Myers Squibb Company | Antagonistas de urea del receptor p2y1 utiles en el tratamiento de afecciones tromboticas. |
| US7550499B2 (en) | 2004-05-12 | 2009-06-23 | Bristol-Myers Squibb Company | Urea antagonists of P2Y1 receptor useful in the treatment of thrombotic conditions |
| CN1984899B (zh) * | 2004-05-12 | 2011-07-27 | 先灵公司 | Cxcr1和cxcr2趋化因子拮抗剂 |
| FR2872159B1 (fr) * | 2004-06-28 | 2007-10-05 | Merck Sante Soc Par Actions Si | Nouveaux derives acides carboxyliques phenyliques et leur utilisation dans le traitement du diabete |
| HRP20080608T3 (hr) | 2004-08-12 | 2008-12-31 | Pfizer Inc. | Triazolopiridinilsulfanilni derivati kao inhibitori p38 map kinaze |
| AU2005277582A1 (en) * | 2004-08-16 | 2006-03-02 | The Procter & Gamble Company | 2-(amino or substituted amino)-5, 6-substituted phenol compounds, dyeing compositions containing them, and use thereof |
| EP1634573A1 (en) * | 2004-08-16 | 2006-03-15 | The Procter and Gamble Company | 2-(Amino or substituted Amino)-5,6-substituted Phenol compounds, dyeing compositions containing them, and use thereof |
| NZ554555A (en) * | 2004-10-20 | 2011-09-30 | Univ California | Cyclohexyl-urea derivatives as improved inhibitors for the soluble epoxide hydrolase |
| US20070249625A1 (en) * | 2004-10-20 | 2007-10-25 | Jakob Busch-Petersen | Il-8 Receptor Antagonists |
| CA2580690A1 (en) | 2004-10-21 | 2006-05-04 | Transtech Pharma, Inc. | Bissulfonamide compounds as agonists of galr1, compositions, and methods of use |
| PE20061130A1 (es) * | 2004-11-19 | 2007-01-05 | Arena Pharm Inc | Derivados de 3-fenil-pirazol como moduladores del receptor de serotonina 5-ht2a |
| US20080015223A1 (en) * | 2004-12-03 | 2008-01-17 | Arena Pharmaceuticals, Inc. | Pyrazole Derivatives as Modulators of the 5-Ht2a Serotonin Receptor Useful for the Treatment of Disorders Related Thereto |
| AU2006206611A1 (en) | 2005-01-19 | 2006-07-27 | Bristol-Myers Squibb Company | 2-phenoxy-N- (1, 3 , 4-thiadizol-2-yl) pyridin-3-amine derivatives and related compounds as P2Y1 receptor inhibitors for the treatment of thromboembolic disorders |
| EP1843762A1 (en) * | 2005-01-19 | 2007-10-17 | Arena Pharmaceuticals, Inc. | Diaryl and arylheteroaryl urea derivatives as modulators of the 5-ht2a serotonin receptor useful for the prophylaxis or treatment of progressive multifocal leukoencephalopathy |
| WO2006101439A1 (en) * | 2005-03-23 | 2006-09-28 | Astrazeneca Ab | Screen |
| US7714002B2 (en) | 2005-06-27 | 2010-05-11 | Bristol-Myers Squibb Company | Carbocycle and heterocycle antagonists of P2Y1 receptor useful in the treatment of thrombotic conditions |
| MX2007016501A (es) | 2005-06-27 | 2008-03-06 | Squibb Bristol Myers Co | Antagonistas heterociclicos n-enlazados del receptor de p2y1, utiles en el tratamiento de condiciones tromboticas. |
| EP1899299B1 (en) | 2005-06-27 | 2010-10-20 | Bristol-Myers Squibb Company | C-linked cyclic antagonists of p2y1 receptor useful in the treatment of thrombotic conditions |
| ES2360818T3 (es) | 2005-06-27 | 2011-06-09 | Bristol-Myers Squibb Company | Miméticos de urea lineal antagonistas del receptor p2y, útiles en el tratamiento de afecciones trombóticas. |
| GB0526255D0 (en) | 2005-12-22 | 2006-02-01 | Novartis Ag | Organic compounds |
| TW200806641A (en) * | 2006-01-25 | 2008-02-01 | Synta Pharmaceuticals Corp | Substituted aromatic compounds for inflammation and immune-related uses |
| MX2008013599A (es) * | 2006-04-21 | 2008-10-31 | Smithkline Beechman Corp | Antagonistas del receptor il-8. |
| EP2009992B1 (en) * | 2006-04-21 | 2012-06-27 | GlaxoSmithKline LLC | Il-8 receptor antagonists |
| WO2007127930A2 (en) * | 2006-04-28 | 2007-11-08 | Kansas State University Research Foundation | Compounds affecting gap junction activity |
| CN101479261A (zh) | 2006-05-18 | 2009-07-08 | 艾尼纳制药公司 | 3-吡唑基-苯甲酰胺-4-醚、其仲胺及其衍生物作为5-ht2a血清素受体的调节剂用于治疗与其相关的病症 |
| ES2536762T3 (es) | 2006-05-18 | 2015-05-28 | Arena Pharmaceuticals, Inc. | Aminas primarias y sus derivados como moduladores del receptor de la serotonina 5-HT2A útiles para el tratamiento de trastornos relacionados con este |
| MX349156B (es) | 2006-05-18 | 2017-07-14 | Arena Pharm Inc | Formas cristalinas y procesos para la preparacion de fenil-pirazoles utiles como moduladores del receptor de serotonina 5-ht2a. |
| TW200817006A (en) * | 2006-06-23 | 2008-04-16 | Smithkline Beecham Corp | IL-8 receptor antagonist |
| TWI415845B (zh) | 2006-10-03 | 2013-11-21 | Arena Pharm Inc | 用於治療與5-ht2a血清素受體相關聯病症之作為5-ht2a血清素受體之調節劑的吡唑衍生物 |
| US7960569B2 (en) | 2006-10-17 | 2011-06-14 | Bristol-Myers Squibb Company | Indole antagonists of P2Y1 receptor useful in the treatment of thrombotic conditions |
| WO2008047067A1 (en) * | 2006-10-20 | 2008-04-24 | University Court Of The University Of Edinburgh | Treatment of inflammatory disease |
| EP2190844B3 (en) | 2007-08-15 | 2013-07-17 | Arena Pharmaceuticals, Inc. | Imidazo[1,2-a]pyridine derivatives as modulators of the 5-ht2a serotonin receptor useful for the treatment of disorders related thereto |
| AU2008309003A1 (en) * | 2007-09-28 | 2009-04-09 | Glaxosmithkline Llc | Glycogen phosphorylase inhibitor compound and pharmaceutical composition thereof |
| WO2009123714A2 (en) | 2008-04-02 | 2009-10-08 | Arena Pharmaceuticals, Inc. | Processes for the preparation of pyrazole derivatives useful as modulators of the 5-ht2a serotonin receptor |
| RS57110B1 (sr) | 2008-10-28 | 2018-06-29 | Arena Pharm Inc | Sastavi modulatora 5-ht2a serotoninskog receptora korisni za tretiranje poremećaja povezanih sa njim |
| US9126946B2 (en) | 2008-10-28 | 2015-09-08 | Arena Pharmaceuticals, Inc. | Processes useful for the preparation of 1-[3-(4-bromo-2-methyl-2H-pyrazol-3-yl)-4-methoxy-phenyl]-3-(2,4-difluoro-phenyl)urea and crystalline forms related thereto |
| WO2010092440A1 (en) * | 2009-02-16 | 2010-08-19 | Inserm (Institut National De La Sante Et De La Recherche Medicale) | Cxcr2 receptor antagonists for the treatment or the prevention of insulin resistance |
| WO2011022028A2 (en) * | 2009-05-18 | 2011-02-24 | Tufts University | Small molecule antagonists of phosphatidylinositol-3, 4, 5-triphosphate (pip3) and uses thereof |
| WO2011073248A1 (en) * | 2009-12-17 | 2011-06-23 | Galderma Research & Development | Use of compounds in the treatment or prevention of skin disorders |
| US8980891B2 (en) | 2009-12-18 | 2015-03-17 | Arena Pharmaceuticals, Inc. | Crystalline forms of certain 3-phenyl-pyrazole derivatives as modulators of the 5-HT2A serotonin receptor useful for the treatment of disorders related thereto |
| BRPI1004176A2 (pt) * | 2010-10-25 | 2015-08-11 | Univ Rio De Janeiro | Compostos aril e/ou hetero aril uréias funcionalizados; processo de síntese desses composto; composição farmacêutica contendo tais compostos e usos |
| US8648118B2 (en) | 2010-12-17 | 2014-02-11 | Boehringer Ingelheim International Gmbh | Bicyclic ring system substituted amide functionalised phenols as medicaments |
| EP2712655B1 (en) | 2011-04-28 | 2019-12-18 | The Broad Institute, Inc. | Inhibitors of histone deacetylase |
| WO2014018979A1 (en) | 2012-07-27 | 2014-01-30 | The Broad Institute, Inc. | Inhibitors of histone deacetylase |
| US9518011B2 (en) | 2012-11-21 | 2016-12-13 | Nippon Soda Co., Ltd. | Recording material produced using non-phenol compound |
| WO2014100438A1 (en) | 2012-12-20 | 2014-06-26 | The Broad Institute, Inc. | Cycloalkenyl hydroxamic acid derivatives and their use as histone deacetylase inhibitors |
| CN104995033B (zh) * | 2013-02-13 | 2017-10-13 | 王子控股株式会社 | 热敏记录体 |
| WO2014189044A1 (ja) * | 2013-05-22 | 2014-11-27 | 王子ホールディングス株式会社 | 感熱記録体 |
| AU2016276966A1 (en) | 2015-06-12 | 2018-01-18 | Axovant Sciences Gmbh | Diaryl and arylheteroaryl urea derivatives useful for the prophylaxis and treatment of REM sleep behavior disorder |
| EP3117835A1 (en) * | 2015-07-14 | 2017-01-18 | Dompé farmaceutici s.p.a. | Il-8 inhibitors for use in the treatment of certain urological disorders |
| EP3322415A4 (en) | 2015-07-15 | 2019-03-13 | Axovant Sciences GmbH | DIARYL AND ARYLHETEROARYL UREA DERIVATIVES AS MODULATORS OF THE 5-HT2A SEROTONIN RECEPTOR FOR PROPHYLAXIS AND TREATMENT OF HALLUCINATIONS RELATED TO A NEUROGENERATIVE DISEASE |
| US10093617B1 (en) | 2015-10-30 | 2018-10-09 | Sumitomo Chemical Company, Limited | Method for producing 2-amino-4-substituted phenol |
| JP7092356B2 (ja) * | 2016-06-22 | 2022-06-28 | フーダン ユニヴァーシティ | ビアリール尿素誘導体またはそれらの塩、およびそれらの調製方法および使用 |
| CN107522641B (zh) * | 2016-06-22 | 2020-05-05 | 复旦大学 | 联芳基脲类衍生物或其盐及其制备方法和用途 |
| CN117503933A (zh) * | 2016-10-03 | 2024-02-06 | 儿童医疗中心公司 | 糖尿病肾病的预防和治疗 |
| US12128018B2 (en) | 2018-01-12 | 2024-10-29 | KDAc Therapeutics, Inc. | Combination of a selective histone deacetylase 3 (HDAC3) inhibitor and an immunotherapy agent for the treatment of cancer |
| CN110698373A (zh) * | 2019-11-07 | 2020-01-17 | 温州大学 | N-(2-(甲硫基)苯基)乙酰胺类化合物的制备方法及其净化提纯方法 |
| CN112321452B (zh) * | 2020-09-11 | 2022-11-29 | 北京红惠新医药科技有限公司 | 厚朴酚衍生物、和厚朴酚衍生物及其盐酸盐、制备方法及应用 |
| WO2025121190A1 (ja) * | 2023-12-08 | 2025-06-12 | 日産化学株式会社 | 重合体、樹脂組成物、液晶配向剤、樹脂被膜及び液晶配向膜 |
Family Cites Families (44)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2363074A (en) * | 1938-06-16 | 1944-11-21 | Geigy Ag J R | Halogen substituted acylamino sulphonic acids of the aromatic series and their manufacture |
| US3332981A (en) * | 1964-09-14 | 1967-07-25 | Gen Aniline & Film Corp | Urea stilbene brighteners |
| US3996253A (en) * | 1966-01-11 | 1976-12-07 | Minnesota Mining And Manufacturing Company | Process for the preparation of color images |
| GB1210596A (en) * | 1967-04-06 | 1970-10-28 | Armour Grocery Products Compan | Antiseptic compositions |
| SE370866B (OSRAM) * | 1968-03-21 | 1974-11-04 | Ciba Geigy Ag | |
| CH506240A (de) * | 1969-02-04 | 1971-04-30 | Ciba Geigy Ag | Verwendung von N-Hydroxyphenyl-N'-phenylharnstoffen zur Bekämpfung schädlicher Mikroorganismen ausserhalb der Textilindustrie |
| GB1281437A (en) * | 1970-07-23 | 1972-07-12 | Ici Ltd | Urea derivatives |
| US3855285A (en) * | 1971-06-21 | 1974-12-17 | Pfizer | Acylmethylthio-trifluoromethyl-benzoic acids |
| US3856951A (en) * | 1971-06-21 | 1974-12-24 | Co Pfizer Inc | Substituted benzoic acid hypoliphemic agents |
| FR2150834B1 (OSRAM) * | 1971-08-23 | 1975-10-17 | Medizinska Akad | |
| US4048333A (en) * | 1971-08-23 | 1977-09-13 | Medizinska Akademia | Method for treating a picorna virus infection |
| US3869553A (en) * | 1972-11-07 | 1975-03-04 | Pfizer | Substituted benzoic acid hypolipemic agents |
| US3882230A (en) * | 1972-11-07 | 1975-05-06 | Pfizer | Substituted benzoic acid hypolipemic agents |
| GB1393854A (en) * | 1973-02-26 | 1975-05-14 | Pfizer | Benzoic acid compounds and pharmaceutical compositions containing them |
| JPS5598152A (en) * | 1979-01-16 | 1980-07-25 | Hokko Chem Ind Co Ltd | Phenylurea derivative |
| DE2928485A1 (de) * | 1979-07-14 | 1981-01-29 | Bayer Ag | Verwendung von harnstoffderivaten als arzneimittel bei der behandlung von fettstoffwechselstoerungen |
| DE2942930A1 (de) * | 1979-10-24 | 1981-05-27 | Basf Ag, 6700 Ludwigshafen | Substituierte harnstoffe, deren herstellung und verwendung als herbizide |
| DE3006671A1 (de) * | 1980-02-22 | 1981-08-27 | Dr. Karl Thomae Gmbh, 7950 Biberach | Neue benzoxazole, deren herstellung und deren verwendung als arzneumittel |
| US4608205A (en) * | 1983-03-09 | 1986-08-26 | American Cyanamid Company | Polyanionic benzene ureas |
| JPS60126256A (ja) * | 1983-12-13 | 1985-07-05 | Hokko Chem Ind Co Ltd | Ν−アシルクロルアミノフエノ−ル誘導体 |
| US4591604A (en) * | 1984-03-28 | 1986-05-27 | American Cyanamid Company | Method of inhibiting the complement system by administering multisulfonated naphthalene ureas |
| DD253997A1 (de) * | 1986-11-26 | 1988-02-10 | Karl Marx Uni Buero Fuer Neuer | Verfahren zur herstellung von substituierten 2-arylureidophenolen |
| JP2684409B2 (ja) * | 1988-03-31 | 1997-12-03 | コニカ株式会社 | シアノ基および/またはハロゲン原子で置換されたアニリン類の製造方法およびその製造のために使用される化合物 |
| JP2835631B2 (ja) * | 1990-01-19 | 1998-12-14 | コニカ株式会社 | 色再現性の改良されたハロゲン化銀カラー写真感光材料 |
| US5276182A (en) * | 1990-07-09 | 1994-01-04 | The Dow Chemical Company | Process for preparing polyurea oligomers |
| JP2655384B2 (ja) * | 1991-11-08 | 1997-09-17 | 富士写真フイルム株式会社 | ポジ型レジスト組成物 |
| DE4200259A1 (de) * | 1992-01-08 | 1993-07-15 | Asta Medica Ag | Neue 1,2,4-triaminobenzol-derivate und verfahren zu deren herstellung |
| US5424063A (en) * | 1992-01-09 | 1995-06-13 | The Dow Chemical Company | Narrow poly- and mono-dispersed anionic oligomers, and their uses, formulations and process |
| WO1993014082A1 (en) * | 1992-01-13 | 1993-07-22 | Smithkline Beecham Corporation | Pyridyl substituted imidazoles |
| NZ249032A (en) * | 1992-02-20 | 1996-09-25 | Merrell Dow Pharma | Stilbene disulphonic acid derivatives substituted in the 4- and 4'-positions by thioureido, thiocarbonate ester, and thiocarbamate and thiocarbamoyloxy (and -omino) and thioamide groups; use in treating viral diseases |
| US5275932A (en) * | 1992-03-16 | 1994-01-04 | Minnesota Mining And Manufacturing Company | Thermal development accelerators for thermographic materials |
| KR950703347A (ko) * | 1992-09-28 | 1995-09-20 | 스티븐 엘. 네스비트 | 이노시톨 1,4,5-트리포스페이트의 길항 방법(Method for Antagonizing Inositol 1,4,5-Triphosphate) |
| US5384319A (en) * | 1993-01-06 | 1995-01-24 | Ciba-Geigy Corporation | Aminoalkylphenyl compounds |
| DK41193D0 (da) * | 1993-04-07 | 1993-04-07 | Neurosearch As | Ionkanalaabnere |
| JPH06313992A (ja) * | 1993-04-28 | 1994-11-08 | Canon Inc | 静電荷像現像用トナー |
| US5312831A (en) * | 1993-05-12 | 1994-05-17 | American Cyanamid Company | Urethanes and ureas that induce cytokine production |
| CA2123728A1 (en) * | 1993-05-21 | 1994-11-22 | Noriyoshi Sueda | Urea derivatives and their use as acat inhibitors |
| IL110296A (en) * | 1993-07-16 | 1999-12-31 | Smithkline Beecham Corp | Imidazole compounds process for their preparation and pharmaceutical compositions containing them |
| DE4413265A1 (de) * | 1994-04-16 | 1995-10-19 | Basf Ag | Hydroxyphenylharnstoffe |
| US5447957A (en) * | 1994-06-02 | 1995-09-05 | Smithkline Beecham Corp. | Anti-inflammatory compounds |
| US5470882A (en) * | 1994-06-02 | 1995-11-28 | Smithkline Beecham Corp. | Anti-inflammatory compounds |
| CA2197469A1 (en) * | 1994-09-27 | 1996-04-04 | Imation Corp. | Laser addressable thermographic elements |
| EP0809492A4 (en) * | 1995-02-17 | 2007-01-24 | Smithkline Beecham Corp | IL-8 RECEPTOR ANTAGONISTS |
| SE506240C2 (sv) | 1996-03-04 | 1997-11-24 | Laxo Mekan Ab | Sidofäste för snöplogsblad |
-
1996
- 1996-02-16 EP EP96906547A patent/EP0809492A4/en not_active Withdrawn
- 1996-02-16 WO PCT/US1996/002260 patent/WO1996025157A1/en not_active Ceased
- 1996-02-16 JP JP8525199A patent/JPH11503110A/ja not_active Withdrawn
- 1996-03-20 US US08/641,990 patent/US5886044A/en not_active Expired - Lifetime
- 1996-08-21 KR KR1019980706361A patent/KR19990082622A/ko not_active Ceased
- 1996-08-21 JP JP9529318A patent/JP2000504722A/ja not_active Withdrawn
- 1996-08-21 EA EA199800733A patent/EA001436B1/ru not_active IP Right Cessation
- 1996-08-21 CN CNA2004100324238A patent/CN1539816A/zh active Pending
- 1996-08-21 IL IL12571796A patent/IL125717A0/xx unknown
- 1996-08-21 PL PL96328562A patent/PL328562A1/xx unknown
- 1996-08-21 WO PCT/US1996/013632 patent/WO1997029743A1/en not_active Ceased
- 1996-08-21 SK SK1101-98A patent/SK110198A3/sk unknown
- 1996-08-21 AU AU69007/96A patent/AU725456B2/en not_active Ceased
- 1996-08-21 HU HU0000467A patent/HUP0000467A3/hu unknown
- 1996-08-21 CA CA002245927A patent/CA2245927A1/en not_active Abandoned
- 1996-08-21 CN CN96180245A patent/CN1215990A/zh active Pending
- 1996-08-21 EP EP96929723A patent/EP0896531A4/en not_active Withdrawn
- 1996-08-21 TR TR1998/01592T patent/TR199801592T2/xx unknown
- 1996-08-21 NZ NZ316710A patent/NZ316710A/xx not_active IP Right Cessation
- 1996-08-21 BR BR9612779-1A patent/BR9612779A/pt not_active Application Discontinuation
-
1998
- 1998-08-12 BG BG102690A patent/BG102690A/xx unknown
- 1998-08-14 OA OA9800145A patent/OA10840A/en unknown
- 1998-08-14 NO NO983737A patent/NO983737L/no unknown
-
1999
- 1999-01-29 US US09/240,354 patent/US6180675B1/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| NO983737L (no) | 1998-10-14 |
| BR9612779A (pt) | 2000-10-24 |
| EP0896531A1 (en) | 1999-02-17 |
| HUP0000467A3 (en) | 2000-06-28 |
| KR19990082622A (ko) | 1999-11-25 |
| AU725456B2 (en) | 2000-10-12 |
| JPH11503110A (ja) | 1999-03-23 |
| EA001436B1 (ru) | 2001-02-26 |
| EP0809492A4 (en) | 2007-01-24 |
| IL125717A0 (en) | 1999-04-11 |
| EA199800733A1 (ru) | 1999-04-29 |
| OA10840A (en) | 2003-02-05 |
| CN1539816A (zh) | 2004-10-27 |
| WO1997029743A1 (en) | 1997-08-21 |
| EP0896531A4 (en) | 2002-10-30 |
| NZ316710A (en) | 2000-05-26 |
| TR199801592T2 (xx) | 1999-05-21 |
| US5886044A (en) | 1999-03-23 |
| US6180675B1 (en) | 2001-01-30 |
| NO983737D0 (no) | 1998-08-14 |
| PL328562A1 (en) | 1999-02-01 |
| CN1215990A (zh) | 1999-05-05 |
| HUP0000467A2 (hu) | 2000-05-28 |
| JP2000504722A (ja) | 2000-04-18 |
| AU6900796A (en) | 1997-09-02 |
| WO1996025157A1 (en) | 1996-08-22 |
| BG102690A (en) | 1999-04-30 |
| EP0809492A1 (en) | 1997-12-03 |
| CA2245927A1 (en) | 1997-08-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SK110198A3 (en) | Il-8 receptor antagonists, method for the preparation thereof, pharmaceutical composition and use | |
| US6005008A (en) | IL-8 receptor antagonists | |
| US6262113B1 (en) | IL-8 receptor antagonists | |
| US5780483A (en) | IL-8 receptor antagonists | |
| US6211373B1 (en) | Phenyl urea antagonists of the IL-8 receptor | |
| US6271261B1 (en) | IL-8 receptor antagonists | |
| JP2000514049A (ja) | Il―8受容体拮抗薬 | |
| AU766083B2 (en) | IL-8 receptor antagonists | |
| WO1997049287A1 (en) | Il-8 receptor antagonists | |
| IL141121A (en) | Process for preparing cyano-phenol derivatives | |
| CZ256998A3 (cs) | Antagonista IL-8 receptoru | |
| CA2432662A1 (en) | Il-8 receptor antagonists | |
| CA2377397A1 (en) | Il-8 receptor antagonists | |
| CA2259008A1 (en) | Il-8 receptor antagonists |