SE445802B - Delbar tablett med kontrollerad och fordrojd avgivning av verksamt emne - Google Patents
Delbar tablett med kontrollerad och fordrojd avgivning av verksamt emneInfo
- Publication number
- SE445802B SE445802B SE8005759A SE8005759A SE445802B SE 445802 B SE445802 B SE 445802B SE 8005759 A SE8005759 A SE 8005759A SE 8005759 A SE8005759 A SE 8005759A SE 445802 B SE445802 B SE 445802B
- Authority
- SE
- Sweden
- Prior art keywords
- active substance
- tablet
- delayed
- height
- length
- Prior art date
Links
- 206010012186 Delayed delivery Diseases 0.000 title 1
- 239000013543 active substance Substances 0.000 claims description 56
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 22
- 230000003111 delayed effect Effects 0.000 claims description 16
- 229920001577 copolymer Polymers 0.000 claims description 13
- 239000000126 substance Substances 0.000 claims description 13
- 239000012634 fragment Substances 0.000 claims description 11
- 238000000576 coating method Methods 0.000 claims description 10
- 238000013270 controlled release Methods 0.000 claims description 10
- 230000000979 retarding effect Effects 0.000 claims description 9
- 239000011248 coating agent Substances 0.000 claims description 8
- 229920000642 polymer Polymers 0.000 claims description 8
- 230000001747 exhibiting effect Effects 0.000 claims description 2
- 239000004480 active ingredient Substances 0.000 claims 1
- 239000003826 tablet Substances 0.000 description 80
- 239000000203 mixture Substances 0.000 description 18
- 239000008187 granular material Substances 0.000 description 16
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 8
- 235000010980 cellulose Nutrition 0.000 description 7
- 229920002678 cellulose Polymers 0.000 description 7
- 239000001913 cellulose Substances 0.000 description 7
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 description 7
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 description 7
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 description 7
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 description 7
- -1 polyalkylenes Chemical compound 0.000 description 7
- 230000006835 compression Effects 0.000 description 6
- 238000007906 compression Methods 0.000 description 6
- JIVPVXMEBJLZRO-CQSZACIVSA-N 2-chloro-5-[(1r)-1-hydroxy-3-oxo-2h-isoindol-1-yl]benzenesulfonamide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC([C@@]2(O)C3=CC=CC=C3C(=O)N2)=C1 JIVPVXMEBJLZRO-CQSZACIVSA-N 0.000 description 5
- 229920002261 Corn starch Polymers 0.000 description 5
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 5
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 5
- 229960001523 chlortalidone Drugs 0.000 description 5
- 239000007888 film coating Substances 0.000 description 5
- 238000009501 film coating Methods 0.000 description 5
- 239000008101 lactose Substances 0.000 description 5
- 239000011159 matrix material Substances 0.000 description 5
- 229940016286 microcrystalline cellulose Drugs 0.000 description 5
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 5
- 239000008108 microcrystalline cellulose Substances 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 239000000454 talc Substances 0.000 description 5
- 229910052623 talc Inorganic materials 0.000 description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N 2-propanol Substances CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 4
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 4
- 229920002472 Starch Polymers 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 239000008119 colloidal silica Substances 0.000 description 4
- 235000019359 magnesium stearate Nutrition 0.000 description 4
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 4
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 4
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 239000008107 starch Substances 0.000 description 4
- 235000019698 starch Nutrition 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 239000001856 Ethyl cellulose Substances 0.000 description 3
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 3
- 229920001800 Shellac Polymers 0.000 description 3
- 235000021355 Stearic acid Nutrition 0.000 description 3
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000008120 corn starch Substances 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 235000019325 ethyl cellulose Nutrition 0.000 description 3
- 229920001249 ethyl cellulose Polymers 0.000 description 3
- 239000002360 explosive Substances 0.000 description 3
- 210000004051 gastric juice Anatomy 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 150000002734 metacrylic acid derivatives Chemical class 0.000 description 3
- 229920000609 methyl cellulose Polymers 0.000 description 3
- 239000001923 methylcellulose Substances 0.000 description 3
- 235000010981 methylcellulose Nutrition 0.000 description 3
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 3
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 3
- 229920002689 polyvinyl acetate Polymers 0.000 description 3
- 239000011118 polyvinyl acetate Substances 0.000 description 3
- 239000004208 shellac Substances 0.000 description 3
- 229940113147 shellac Drugs 0.000 description 3
- 235000013874 shellac Nutrition 0.000 description 3
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000008117 stearic acid Substances 0.000 description 3
- 239000002699 waste material Substances 0.000 description 3
- CEMAWMOMDPGJMB-UHFFFAOYSA-N (+-)-Oxprenolol Chemical compound CC(C)NCC(O)COC1=CC=CC=C1OCC=C CEMAWMOMDPGJMB-UHFFFAOYSA-N 0.000 description 2
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 2
- 241000283707 Capra Species 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 2
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 2
- 235000019759 Maize starch Nutrition 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- FUFJGUQYACFECW-UHFFFAOYSA-L calcium hydrogenphosphate Chemical compound [Ca+2].OP([O-])([O-])=O FUFJGUQYACFECW-UHFFFAOYSA-L 0.000 description 2
- 239000001506 calcium phosphate Substances 0.000 description 2
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 2
- 235000013539 calcium stearate Nutrition 0.000 description 2
- 239000008116 calcium stearate Substances 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 239000012876 carrier material Substances 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 239000008298 dragée Substances 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 2
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 2
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 150000002632 lipids Chemical class 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 229960002237 metoprolol Drugs 0.000 description 2
- IUBSYMUCCVWXPE-UHFFFAOYSA-N metoprolol Chemical compound COCCC1=CC=C(OCC(O)CNC(C)C)C=C1 IUBSYMUCCVWXPE-UHFFFAOYSA-N 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- GLDOVTGHNKAZLK-UHFFFAOYSA-N octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 description 2
- 229960004570 oxprenolol Drugs 0.000 description 2
- 238000004806 packaging method and process Methods 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 229950008882 polysorbate Drugs 0.000 description 2
- 229920000136 polysorbate Polymers 0.000 description 2
- 239000004800 polyvinyl chloride Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000005096 rolling process Methods 0.000 description 2
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 2
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 229940095064 tartrate Drugs 0.000 description 2
- 150000003626 triacylglycerols Chemical class 0.000 description 2
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical class [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 2
- 235000019731 tricalcium phosphate Nutrition 0.000 description 2
- 239000001993 wax Substances 0.000 description 2
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229920000623 Cellulose acetate phthalate Polymers 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 229920002907 Guar gum Polymers 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical class [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 229920001756 Polyvinyl chloride acetate Polymers 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 229920002433 Vinyl chloride-vinyl acetate copolymer Polymers 0.000 description 1
- SMEGJBVQLJJKKX-HOTMZDKISA-N [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4,6-trihydroxyoxan-2-yl]methyl acetate Chemical compound CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)OC(=O)C)O)O SMEGJBVQLJJKKX-HOTMZDKISA-N 0.000 description 1
- 229940081735 acetylcellulose Drugs 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- XTKDAFGWCDAMPY-UHFFFAOYSA-N azaperone Chemical compound C1=CC(F)=CC=C1C(=O)CCCN1CCN(C=2N=CC=CC=2)CC1 XTKDAFGWCDAMPY-UHFFFAOYSA-N 0.000 description 1
- 235000013871 bee wax Nutrition 0.000 description 1
- 239000012166 beeswax Substances 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 235000019658 bitter taste Nutrition 0.000 description 1
- LHMHCLYDBQOYTO-UHFFFAOYSA-N bromofluoromethane Chemical compound FCBr LHMHCLYDBQOYTO-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000004203 carnauba wax Substances 0.000 description 1
- 235000013869 carnauba wax Nutrition 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- 229940081734 cellulose acetate phthalate Drugs 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- 229960000541 cetyl alcohol Drugs 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- JIVPVXMEBJLZRO-UHFFFAOYSA-N chlorthalidone Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C2(O)C3=CC=CC=C3C(=O)N2)=C1 JIVPVXMEBJLZRO-UHFFFAOYSA-N 0.000 description 1
- 238000005056 compaction Methods 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- LDHQCZJRKDOVOX-NSCUHMNNSA-N crotonic acid Chemical compound C\C=C\C(O)=O LDHQCZJRKDOVOX-NSCUHMNNSA-N 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 238000005115 demineralization Methods 0.000 description 1
- 230000002328 demineralizing effect Effects 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- 235000019700 dicalcium phosphate Nutrition 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 238000004049 embossing Methods 0.000 description 1
- 230000003628 erosive effect Effects 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000007941 film coated tablet Substances 0.000 description 1
- 230000037406 food intake Effects 0.000 description 1
- 235000011389 fruit/vegetable juice Nutrition 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- YQEMORVAKMFKLG-UHFFFAOYSA-N glycerine monostearate Natural products CCCCCCCCCCCCCCCCCC(=O)OC(CO)CO YQEMORVAKMFKLG-UHFFFAOYSA-N 0.000 description 1
- SVUQHVRAGMNPLW-UHFFFAOYSA-N glycerol monostearate Natural products CCCCCCCCCCCCCCCCC(=O)OCC(O)CO SVUQHVRAGMNPLW-UHFFFAOYSA-N 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- 239000000665 guar gum Substances 0.000 description 1
- 235000010417 guar gum Nutrition 0.000 description 1
- 229960002154 guar gum Drugs 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 239000010514 hydrogenated cottonseed oil Substances 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 229920003132 hydroxypropyl methylcellulose phthalate Polymers 0.000 description 1
- 229940031704 hydroxypropyl methylcellulose phthalate Drugs 0.000 description 1
- 239000008384 inner phase Substances 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- 239000004922 lacquer Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000000873 masking effect Effects 0.000 description 1
- 229960001300 metoprolol tartrate Drugs 0.000 description 1
- 210000003097 mucus Anatomy 0.000 description 1
- GOQYKNQRPGWPLP-UHFFFAOYSA-N n-heptadecyl alcohol Natural products CCCCCCCCCCCCCCCCCO GOQYKNQRPGWPLP-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000008385 outer phase Substances 0.000 description 1
- 229960001834 oxprenolol hydrochloride Drugs 0.000 description 1
- 238000010422 painting Methods 0.000 description 1
- 238000007591 painting process Methods 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920001281 polyalkylene Polymers 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 230000000750 progressive effect Effects 0.000 description 1
- 238000004080 punching Methods 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- WUBVEMGCQRSBBT-UHFFFAOYSA-N tert-butyl 4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2h-pyridine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCC(OS(=O)(=O)C(F)(F)F)=CC1 WUBVEMGCQRSBBT-UHFFFAOYSA-N 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- LDHQCZJRKDOVOX-UHFFFAOYSA-N trans-crotonic acid Natural products CC=CC(O)=O LDHQCZJRKDOVOX-UHFFFAOYSA-N 0.000 description 1
- 229940078499 tricalcium phosphate Drugs 0.000 description 1
- 229910000391 tricalcium phosphate Inorganic materials 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61J—CONTAINERS SPECIALLY ADAPTED FOR MEDICAL OR PHARMACEUTICAL PURPOSES; DEVICES OR METHODS SPECIALLY ADAPTED FOR BRINGING PHARMACEUTICAL PRODUCTS INTO PARTICULAR PHYSICAL OR ADMINISTERING FORMS; DEVICES FOR ADMINISTERING FOOD OR MEDICINES ORALLY; BABY COMFORTERS; DEVICES FOR RECEIVING SPITTLE
- A61J3/00—Devices or methods specially adapted for bringing pharmaceutical products into particular physical or administering forms
- A61J3/10—Devices or methods specially adapted for bringing pharmaceutical products into particular physical or administering forms into the form of compressed tablets
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/20—Pills, tablets, discs, rods
- A61K9/2072—Pills, tablets, discs, rods characterised by shape, structure or size; Tablets with holes, special break lines or identification marks; Partially coated tablets; Disintegrating flat shaped forms
Landscapes
- Health & Medical Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical & Material Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Epidemiology (AREA)
- Medicinal Preparation (AREA)
- Pyrane Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH7514/79A CH648754A5 (en) | 1979-08-16 | 1979-08-16 | Pharmaceutical slow release tablet |
| CH395980A CH646330A5 (en) | 1980-05-21 | 1980-05-21 | Divisible slow-release pharmaceutical tablets |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE8005759L SE8005759L (sv) | 1981-02-17 |
| SE445802B true SE445802B (sv) | 1986-07-21 |
Family
ID=25694276
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE8005759A SE445802B (sv) | 1979-08-16 | 1980-08-15 | Delbar tablett med kontrollerad och fordrojd avgivning av verksamt emne |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4353887A (no) |
| AU (1) | AU531058B2 (no) |
| CA (1) | CA1158555A (no) |
| DE (1) | DE3030622C2 (no) |
| DK (1) | DK153772C (no) |
| ES (1) | ES494274A0 (no) |
| FI (1) | FI76691C (no) |
| FR (1) | FR2462908A1 (no) |
| GB (1) | GB2057878B (no) |
| GR (1) | GR69943B (no) |
| IE (1) | IE50108B1 (no) |
| IL (1) | IL60839A (no) |
| IT (1) | IT1145285B (no) |
| LU (1) | LU82718A1 (no) |
| MY (1) | MY8700198A (no) |
| NL (1) | NL8004616A (no) |
| NO (1) | NO156274C (no) |
| NZ (1) | NZ194681A (no) |
| PT (1) | PT71706B (no) |
| SE (1) | SE445802B (no) |
Families Citing this family (111)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IN158328B (no) * | 1981-03-09 | 1986-10-18 | Ici Plc | |
| JPS5839618A (ja) * | 1981-09-04 | 1983-03-08 | Chugai Pharmaceut Co Ltd | 持続性積層錠剤 |
| JPS58152813A (ja) * | 1982-03-08 | 1983-09-10 | Sumitomo Chem Co Ltd | 鮮明な刻印を有する錠剤およびその製法 |
| DK151608C (da) * | 1982-08-13 | 1988-06-20 | Benzon As Alfred | Fremgangsmaade til fremstilling af et farmaceutisk peroralt polydepotpraeparat med kontrolleret afgivelse |
| DK152744C (da) * | 1982-08-13 | 1988-10-31 | Benzon As Alfred | Fremgangsmaade til fremstilling af et farmaceutisk peroralt polydepotpraeparat |
| US4503031A (en) * | 1982-12-17 | 1985-03-05 | Glassman Jacob A | Super-fast-starting-sustained release tablet |
| DE3314003A1 (de) * | 1983-04-18 | 1984-10-18 | Boehringer Ingelheim KG, 6507 Ingelheim | Teilbare tablette mit verzoegerter wirkstofffreigabe und verfahren zu deren herstellung |
| US4591500A (en) * | 1983-04-25 | 1986-05-27 | Microencapsulation S.A. | Tablet having the shape of a capsule, process and device for its preparation |
| JPS604120A (ja) * | 1983-06-22 | 1985-01-10 | Shionogi & Co Ltd | 作用持続型ピナシジル製剤 |
| DE3505433A1 (de) * | 1985-02-16 | 1986-08-21 | Basf Ag, 6700 Ludwigshafen | Direkttablettierhilfsmittel |
| US4631305A (en) * | 1985-03-22 | 1986-12-23 | The Upjohn Company | Polymeric material as a disintegrant in a compressed tablet |
| ES2041336T3 (es) * | 1987-11-20 | 1993-11-16 | Greither, Peter | Capsula y procedimiento para su fabricacion. |
| US5051261A (en) * | 1987-11-24 | 1991-09-24 | Fmc Corporation | Method for preparing a solid sustained release form of a functionally active composition |
| KR940000280Y1 (ko) * | 1987-12-17 | 1994-01-19 | 디 엎죤 캄파니 | 3중 스코어(score)를 가진 약 정제 |
| USD315223S (en) | 1989-05-03 | 1991-03-05 | Warner-Lambert Company | Tablet |
| ATE114472T1 (de) * | 1989-09-21 | 1994-12-15 | American Cyanamid Co | System des typs ''einmal täglich'' zur gepulsten minocyclinabgabe. |
| EP0418596A3 (en) * | 1989-09-21 | 1991-10-23 | American Cyanamid Company | Controlled release pharmaceutical compositions from spherical granules in tabletted oral dosage unit form |
| US5009896A (en) * | 1989-10-04 | 1991-04-23 | Akzo N.V. | Multi-fractionable tablet structure |
| US5213738A (en) * | 1990-05-15 | 1993-05-25 | L. Perrigo Company | Method for making a capsule-shaped tablet |
| US5061494A (en) * | 1990-06-14 | 1991-10-29 | The Upjohn Comany | Tri-scored drug tablet |
| DE4100920A1 (de) * | 1991-01-15 | 1992-07-16 | Degussa | Wirkstoffzubereitung zur oralen verabreichung an wiederkaeuer |
| GB9101502D0 (en) * | 1991-01-23 | 1991-03-06 | Controlled Therapeutics Sct | Controlled release compositions |
| US5262173A (en) * | 1992-03-02 | 1993-11-16 | American Cyanamid Company | Pulsatile once-a-day delivery systems for minocycline |
| USD361837S (en) | 1993-06-28 | 1995-08-29 | Solvay-Duphar B.V. | Breakable tablet |
| US5571261A (en) * | 1993-08-06 | 1996-11-05 | River Medical, Inc | Liquid delivery device |
| US5398851A (en) * | 1993-08-06 | 1995-03-21 | River Medical, Inc. | Liquid delivery device |
| US5398850A (en) * | 1993-08-06 | 1995-03-21 | River Medical, Inc. | Gas delivery apparatus for infusion |
| FR2709420B1 (fr) * | 1993-09-01 | 1995-11-17 | Sogeval | Comprimé vétérinaire plus spécialement destiné aux chats. |
| US6129930A (en) * | 1993-09-20 | 2000-10-10 | Bova; David J. | Methods and sustained release nicotinic acid compositions for treating hyperlipidemia at night |
| US6818229B1 (en) | 1993-09-20 | 2004-11-16 | Kos Pharmaceuticals, Inc. | Intermediate release nicotinic acid compositions for treating hyperlipidemia |
| US6676967B1 (en) | 1993-09-20 | 2004-01-13 | Kos Pharmaceuticals, Inc. | Methods for reducing flushing in individuals being treated with nicotinic acid for hyperlipidemia |
| US6080428A (en) | 1993-09-20 | 2000-06-27 | Bova; David J. | Nicotinic acid compositions for treating hyperlipidemia and related methods therefor |
| US6746691B2 (en) | 1993-09-20 | 2004-06-08 | Kos Pharmaceuticals, Inc. | Intermediate release nicotinic acid compositions for treating hyperlipidemia having unique biopharmaceutical characteristics |
| US5700245A (en) * | 1995-07-13 | 1997-12-23 | Winfield Medical | Apparatus for the generation of gas pressure for controlled fluid delivery |
| US5756124A (en) * | 1995-08-07 | 1998-05-26 | Invamed, Inc. | Multi-scored pharmaceutical tablets |
| GB9613470D0 (en) | 1996-06-27 | 1996-08-28 | Ciba Geigy Ag | Small solid oral dosage form |
| GB9624563D0 (en) * | 1996-11-27 | 1997-01-15 | Smithkline Beecham Plc | Product |
| ES2302364T3 (es) * | 1998-04-03 | 2008-07-01 | Kyowa Hakko Kogyo Co., Ltd. | Tableta divisible y paquete perforado por presion. |
| US6602521B1 (en) * | 1998-09-29 | 2003-08-05 | Impax Pharmaceuticals, Inc. | Multiplex drug delivery system suitable for oral administration |
| DE19856147A1 (de) | 1998-12-04 | 2000-06-08 | Knoll Ag | Teilbare feste Dosierungsformen und Verfahren zu ihrer Herstellung |
| GB9914620D0 (en) * | 1999-06-23 | 1999-08-25 | Eu Pharma Ltd | Divisible tablets |
| WO2001000176A1 (en) * | 1999-06-23 | 2001-01-04 | Eu Pharma Ltd. | Divisible tablets |
| USD440650S1 (en) | 2000-01-27 | 2001-04-17 | Watson Pharmaceuticals, Inc. | Tablet |
| SE0100200D0 (sv) * | 2001-01-24 | 2001-01-24 | Astrazeneca Ab | New film coating |
| US7776314B2 (en) | 2002-06-17 | 2010-08-17 | Grunenthal Gmbh | Abuse-proofed dosage system |
| TW200502000A (en) * | 2003-03-28 | 2005-01-16 | Kyowa Hakko Kogyo Kk | Dividing tablet |
| DE102005005446A1 (de) | 2005-02-04 | 2006-08-10 | Grünenthal GmbH | Bruchfeste Darreichungsformen mit retardierter Freisetzung |
| US8075872B2 (en) | 2003-08-06 | 2011-12-13 | Gruenenthal Gmbh | Abuse-proofed dosage form |
| US20070048228A1 (en) | 2003-08-06 | 2007-03-01 | Elisabeth Arkenau-Maric | Abuse-proofed dosage form |
| DE10336400A1 (de) | 2003-08-06 | 2005-03-24 | Grünenthal GmbH | Gegen Missbrauch gesicherte Darreichungsform |
| DE102004032051A1 (de) | 2004-07-01 | 2006-01-19 | Grünenthal GmbH | Verfahren zur Herstellung einer gegen Missbrauch gesicherten, festen Darreichungsform |
| DE10361596A1 (de) | 2003-12-24 | 2005-09-29 | Grünenthal GmbH | Verfahren zur Herstellung einer gegen Missbrauch gesicherten Darreichungsform |
| RU2369393C2 (ru) | 2003-09-03 | 2009-10-10 | Новартис Аг | Применение окскарбазепина для лечения диабетической нейропатической боли и для улучшения сна |
| FR2859632B1 (fr) * | 2003-09-15 | 2005-11-18 | Arrow Generiques | Comprime multisecable a observance amelioree. |
| DE202004002700U1 (de) * | 2004-02-20 | 2004-04-29 | Desitin Arzneimittel Gmbh | Viertelbare Tablette |
| WO2005112897A2 (en) * | 2004-05-21 | 2005-12-01 | Accu-Break Technologies, Inc. | Immediate release pharmaceutical tablets with height greater than width |
| CN1997331A (zh) * | 2004-05-21 | 2007-07-11 | 阿库-伯雷克技术公司 | 在药片一面上含有分离标记的药片 |
| US7838031B2 (en) * | 2004-05-21 | 2010-11-23 | Lawrence Solomon | Method of administering a partial dose using a segmented pharmaceutical tablet |
| DE102004032049A1 (de) | 2004-07-01 | 2006-01-19 | Grünenthal GmbH | Gegen Missbrauch gesicherte, orale Darreichungsform |
| GB0423964D0 (en) * | 2004-10-28 | 2004-12-01 | Jagotec Ag | Dosage form |
| DE102005005449A1 (de) | 2005-02-04 | 2006-08-10 | Grünenthal GmbH | Verfahren zur Herstellung einer gegen Missbrauch gesicherten Darreichungsform |
| EP1712224A1 (en) * | 2005-04-12 | 2006-10-18 | Alexander von Mérey | Divisible rectangular flat tablet |
| AU2006308448A1 (en) | 2005-09-09 | 2007-05-03 | Labopharm (Barbados) Limited | Sustained drug release composition |
| TWI274889B (en) * | 2005-10-06 | 2007-03-01 | Elan Microelectronics Corp | Resistive touch screen measurement system |
| US20070160960A1 (en) * | 2005-10-21 | 2007-07-12 | Laser Shot, Inc. | System and method for calculating a projectile impact coordinates |
| US7985419B1 (en) | 2006-12-22 | 2011-07-26 | Watson Laboratories, Inc. | Divisible tablet and associated methods |
| DE102007011485A1 (de) | 2007-03-07 | 2008-09-11 | Grünenthal GmbH | Darreichungsform mit erschwertem Missbrauch |
| US20080286343A1 (en) * | 2007-05-16 | 2008-11-20 | Dzenana Cengic | Solid form |
| US20080286344A1 (en) * | 2007-05-16 | 2008-11-20 | Olivia Darmuzey | Solid form |
| US20080311162A1 (en) * | 2007-05-16 | 2008-12-18 | Olivia Darmuzey | Solid form |
| WO2008140461A1 (en) * | 2007-05-16 | 2008-11-20 | Fmc Corporation | Solid form |
| WO2008140460A1 (en) * | 2007-05-16 | 2008-11-20 | Fmc Corporation | Solid form |
| WO2008140459A1 (en) * | 2007-05-16 | 2008-11-20 | Fmc Corporation | Solid form |
| CA2713128C (en) | 2008-01-25 | 2016-04-05 | Gruenenthal Gmbh | Pharmaceutical dosage form |
| FR2928836B1 (fr) * | 2008-03-21 | 2011-08-26 | Servier Lab | Forme galenique secable permettant une liberation modifiee du principe actif |
| PT2273983T (pt) | 2008-05-09 | 2016-10-28 | Gruenenthal Gmbh | Processo para a preparação de uma formulação em pó intermediária e uma forma de dosagem sólida final sob utilização de uma etapa de congelamento por atomização |
| USD589606S1 (en) | 2008-06-03 | 2009-03-31 | Solvay Pharmaceuticals B.V. | Pharmaceutical tablet |
| TW201006473A (en) * | 2008-08-13 | 2010-02-16 | Orient Pharma Co Ltd | Bi-layer medicine tablet containing Zaleplon |
| US20100104687A1 (en) * | 2008-10-24 | 2010-04-29 | Kaplan Allan S | Segmented confectionery products |
| BR112012001547A2 (pt) | 2009-07-22 | 2016-03-08 | Gruenenthal Gmbh | forma de dosagem farmacêutica extrusada por fusão a quente |
| PE20120572A1 (es) | 2009-07-22 | 2012-06-06 | Gruenenthal Chemie | Forma de dosificacion de oxidacion estabilizada resistente a la manipulacion |
| EP2531176B1 (en) | 2010-02-03 | 2016-09-07 | Grünenthal GmbH | Preparation of a powdery pharmaceutical composition by means of an extruder |
| AU2011297892B2 (en) | 2010-09-02 | 2014-05-29 | Grunenthal Gmbh | Tamper resistant dosage form comprising an anionic polymer |
| MX2013002377A (es) | 2010-09-02 | 2013-04-29 | Gruenenthal Gmbh | Forma de dosificacion resistente a manipulacion que comprende una sal inorganica. |
| JO3283B1 (ar) | 2011-04-26 | 2018-09-16 | Sanofi Sa | تركيب يتضمن أفليبيرسيبت, حمض فولينيك, 5- فلورويوراسيل (5- Fu) وإرينوسيتان (FOLFIRI) |
| NO2736495T3 (no) | 2011-07-29 | 2018-01-20 | ||
| MX348054B (es) | 2011-07-29 | 2017-05-25 | Gruenenthal Gmbh | Tableta a prueba de alteracion que proporciona liberacion inmediata del farmaco. |
| CA2864949A1 (en) | 2012-02-28 | 2013-09-06 | Grunenthal Gmbh | Tamper-resistant dosage form comprising pharmacologically active compound and anionic polymer |
| PT2838512T (pt) | 2012-04-18 | 2018-11-09 | Gruenenthal Gmbh | Forma farmacêutica resistente à adulteração e resistente à libertação inesperada de alta quantidade (dose-dumping) |
| US10064945B2 (en) | 2012-05-11 | 2018-09-04 | Gruenenthal Gmbh | Thermoformed, tamper-resistant pharmaceutical dosage form containing zinc |
| US20140141078A1 (en) * | 2012-09-15 | 2014-05-22 | Jeffery K. Slaboden | Dissolvable TableT |
| JP6466417B2 (ja) | 2013-05-29 | 2019-02-06 | グリュネンタール・ゲゼルシャフト・ミト・ベシュレンクテル・ハフツング | 二峰性放出プロファイルを有する改変防止(tamper−resistant)剤形 |
| WO2014191397A1 (en) | 2013-05-29 | 2014-12-04 | Grünenthal GmbH | Tamper-resistant dosage form containing one or more particles |
| BR112016000194A8 (pt) | 2013-07-12 | 2019-12-31 | Gruenenthal Gmbh | forma de dosagem resistente à violação contendo o polímero de acetato de etileno-vinila |
| MX371372B (es) | 2013-11-26 | 2020-01-28 | Gruenenthal Gmbh | Preparacion de una composicion farmaceutica en polvo por medio de criomolienda. |
| USD723155S1 (en) | 2014-02-11 | 2015-02-24 | Pharmavite Llc | Tablet |
| CN106572980A (zh) | 2014-05-12 | 2017-04-19 | 格吕伦塔尔有限公司 | 包含他喷他多的防篡改即释胶囊制剂 |
| MX2016015417A (es) | 2014-05-26 | 2017-02-22 | Gruenenthal Gmbh | Multiparticulas protegidas contra vertido de dosis etanolico. |
| HUE043951T2 (hu) | 2014-07-18 | 2019-09-30 | Sanofi Sa | Eljárás rákgyanús beteg aflibercepttel történõ kezelése kimenetének elõrejelzésére |
| AU2016251854A1 (en) | 2015-04-24 | 2017-10-19 | Grunenthal Gmbh | Tamper-resistant dosage form with immediate release and resistance against solvent extraction |
| JP2018526414A (ja) | 2015-09-10 | 2018-09-13 | グリュネンタール・ゲゼルシャフト・ミト・ベシュレンクテル・ハフツング | 乱用抑止性の即放性製剤を用いた経口過剰摂取に対する保護 |
| USD805726S1 (en) * | 2016-03-11 | 2017-12-26 | Mars, Incorporated | Pet food |
| US20200060218A1 (en) | 2018-08-22 | 2020-02-27 | Land O'lakes, Inc. | Extruded, multi-portioned butter products and system and methods of producing same |
| USD869117S1 (en) | 2018-08-22 | 2019-12-10 | Land O'lakes, Inc. | Butter stick |
| USD909825S1 (en) | 2018-08-22 | 2021-02-09 | Land O'lakes, Inc. | Die |
| USD909148S1 (en) | 2018-08-22 | 2021-02-02 | Land O'lakes, Inc. | Die |
| USD869116S1 (en) | 2018-08-22 | 2019-12-10 | Land O'lakes, Inc. | Butter stick |
| USD871016S1 (en) | 2019-05-10 | 2019-12-31 | Land O'lakes, Inc. | Butter stick |
| USD918526S1 (en) | 2019-11-12 | 2021-05-11 | Land O'lakes, Inc. | Butter stick |
| BR112022018572A2 (pt) | 2020-03-16 | 2022-11-01 | Gruenenthal Gmbh | Comprimido sulcado |
| US20210378968A1 (en) * | 2020-05-28 | 2021-12-09 | Johnson & Johnson Consumer Inc. | Multi-cavity customizable dosage forms |
Family Cites Families (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE104533C1 (no) * | ||||
| GB189400A (en) * | 1922-05-02 | 1922-11-30 | Fred William Walton | Improvements in the manufacture of chocolate cakes |
| GB238264A (en) * | 1924-04-09 | 1925-08-10 | Henry Charles Clark | Improvements relating to table jellies |
| US1836604A (en) * | 1929-06-01 | 1931-12-15 | Simon M Meyer | Sugar unit |
| US2052376A (en) * | 1933-05-18 | 1936-08-25 | Edgar G Zellers | Insoluble pill or tablet for internal medicinal uses |
| USD91644S (en) | 1933-12-22 | 1934-03-06 | Alex Blackstone | Design for a proprietary medicine bar |
| US2132690A (en) * | 1937-06-03 | 1938-10-11 | Perley A Hilliard | Edible material in ribbon form |
| US2410110A (en) * | 1943-01-14 | 1946-10-29 | Brewer & Company Inc | Method of making tablets |
| US2410417A (en) * | 1944-03-04 | 1946-11-05 | Lever Brothers Ltd | Vitamin and mineral dietary supplement and method of making |
| US2953497A (en) * | 1953-06-03 | 1960-09-20 | Howard A Press | Therapeutic tablets |
| US2996431A (en) * | 1953-12-16 | 1961-08-15 | Barry Richard Henry | Friable tablet and process for manufacturing same |
| US2811483A (en) * | 1954-12-09 | 1957-10-29 | Pfizer & Co C | Pharmaceutical composition and process for preparing the same |
| US2853420A (en) * | 1956-01-25 | 1958-09-23 | Lowey Hans | Ethyl cellulose coatings for shaped medicinal preparations |
| GB1022171A (en) * | 1961-06-15 | 1966-03-09 | Wellcome Found | Prolonged release oral pharmaceutical tablets and their manufacture |
| US3166476A (en) * | 1961-09-01 | 1965-01-19 | Lowey Hans | Powder based tablets |
| GB993291A (en) * | 1961-12-06 | 1965-05-26 | Thomas Lee Cooper | Tablets, pills, pellets and the like |
| US3115441A (en) * | 1962-06-06 | 1963-12-24 | Victor M Hermelin | Timed release pharmaceutical preparations and method of making the same |
| US3336200A (en) * | 1963-05-28 | 1967-08-15 | Warner Lambert Pharmaceutical | Tablet structure |
| BE632692A (no) * | 1963-05-28 | |||
| FI44458B (no) * | 1963-06-18 | 1971-08-02 | Ucb Sa | |
| USD202467S (en) | 1963-10-07 | 1965-10-05 | Jacques Guilmot | Pharmaceutical tablets |
| USD201497S (en) | 1964-09-28 | 1965-06-29 | Warner Lambert Co | Tablet |
| FR1603314A (en) * | 1965-02-23 | 1971-04-05 | Pharmaceutical tablets - having a core and a matrix material | |
| CH502891A (de) * | 1967-11-21 | 1971-02-15 | Ciba Geigy Ag | Technische, gekerbte Tablette |
| GB1368574A (en) * | 1971-02-12 | 1974-10-02 | Ives Lab Inc | Divisible tablet |
| GB1387643A (en) * | 1971-03-16 | 1975-03-19 | Ives Lab Inc | Divisible tablet |
| US3883647A (en) * | 1972-12-06 | 1975-05-13 | Ives Lab | Tablet formulation |
| US4258027A (en) * | 1979-03-26 | 1981-03-24 | Mead Johnson & Company | Multi-fractionable tablet structure |
| US4215104A (en) * | 1979-03-26 | 1980-07-29 | Mead Johnson & Company | Multi-fractionable tablet structure |
-
1980
- 1980-08-11 US US06/177,028 patent/US4353887A/en not_active Expired - Lifetime
- 1980-08-13 FI FI802542A patent/FI76691C/fi not_active IP Right Cessation
- 1980-08-13 DE DE3030622A patent/DE3030622C2/de not_active Expired - Lifetime
- 1980-08-13 FR FR8017858A patent/FR2462908A1/fr active Granted
- 1980-08-14 CA CA000358243A patent/CA1158555A/en not_active Expired
- 1980-08-14 GR GR62678A patent/GR69943B/el unknown
- 1980-08-14 IT IT49501/80A patent/IT1145285B/it active
- 1980-08-14 PT PT71706A patent/PT71706B/pt unknown
- 1980-08-14 GB GB8026549A patent/GB2057878B/en not_active Expired
- 1980-08-14 IL IL60839A patent/IL60839A/xx unknown
- 1980-08-14 NL NL8004616A patent/NL8004616A/nl unknown
- 1980-08-14 LU LU82718A patent/LU82718A1/de unknown
- 1980-08-14 ES ES494274A patent/ES494274A0/es active Granted
- 1980-08-15 NO NO802447A patent/NO156274C/no unknown
- 1980-08-15 DK DK354580A patent/DK153772C/da not_active IP Right Cessation
- 1980-08-15 SE SE8005759A patent/SE445802B/sv not_active IP Right Cessation
- 1980-08-15 IE IE1727/80A patent/IE50108B1/en not_active IP Right Cessation
- 1980-08-15 NZ NZ194681A patent/NZ194681A/xx unknown
- 1980-08-15 AU AU61481/80A patent/AU531058B2/en not_active Expired
-
1987
- 1987-12-30 MY MY198/87A patent/MY8700198A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NO802447L (no) | 1981-02-17 |
| DK153772C (da) | 1989-01-23 |
| DK354580A (da) | 1981-02-17 |
| NL8004616A (nl) | 1981-02-18 |
| FR2462908B1 (no) | 1983-07-08 |
| IT8049501A0 (it) | 1980-08-14 |
| IT1145285B (it) | 1986-11-05 |
| AU6148180A (en) | 1981-02-19 |
| FR2462908A1 (fr) | 1981-02-20 |
| PT71706A (en) | 1980-09-01 |
| AU531058B2 (en) | 1983-08-11 |
| IE801727L (en) | 1981-02-16 |
| NO156274B (no) | 1987-05-18 |
| DE3030622C2 (de) | 1996-05-30 |
| DE3030622A1 (de) | 1981-03-26 |
| GR69943B (no) | 1982-07-21 |
| DK153772B (da) | 1988-09-05 |
| IL60839A0 (en) | 1980-10-26 |
| NO156274C (no) | 1987-08-26 |
| GB2057878A (en) | 1981-04-08 |
| FI76691B (fi) | 1988-08-31 |
| NZ194681A (en) | 1983-06-17 |
| US4353887A (en) | 1982-10-12 |
| FI76691C (fi) | 1988-12-12 |
| PT71706B (en) | 1981-06-17 |
| MY8700198A (en) | 1987-12-31 |
| IL60839A (en) | 1983-11-30 |
| CA1158555A (en) | 1983-12-13 |
| FI802542A7 (fi) | 1981-02-17 |
| SE8005759L (sv) | 1981-02-17 |
| IE50108B1 (en) | 1986-02-19 |
| GB2057878B (en) | 1983-07-20 |
| LU82718A1 (de) | 1981-03-24 |
| ES8106231A1 (es) | 1981-08-01 |
| ES494274A0 (es) | 1981-08-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE445802B (sv) | Delbar tablett med kontrollerad och fordrojd avgivning av verksamt emne | |
| JPS6361928B2 (no) | ||
| FI97686B (fi) | Menetelmä helmien valmistamiseksi tarkoituksena tuottaa hallitusti vapauttavia tuotteita | |
| RU1831337C (ru) | Способ получени таблеток с непрерывным выделением лекарственного средства | |
| KR102243349B1 (ko) | 아세틸살리실산 및 클로피도그렐을 포함하는 약학적 정제 | |
| US20050020671A1 (en) | Pharmaceutical formulation | |
| RS55174B2 (sr) | Formulacija i metod obložene tablete | |
| DE10014588A1 (de) | Wirkstoffhaltige Schwimmformen enthaltend Polyvinylacetat und Polyvinylpyrrolidon, deren Verwendung und Herstellung | |
| KR100713234B1 (ko) | 메트포민을 함유하는 지속방출형 약학 조성물 및 이의제조방법 | |
| JP5644495B2 (ja) | 被覆固形製剤 | |
| DE602006000819T2 (de) | Dipyridamol enthaltende Zusammensetzungen mit verlängerter Freisetzung und Verfahren zu deren Herstellung | |
| EP2679216B1 (de) | Arzneiform zur modifizierten Freisetzung von Betahistin | |
| CA1063024A (en) | Preparations containing n-(2-furfuryl)-4-chloro-5-sulfamoylanthranilic acid and process for their manufacture | |
| TW200950820A (en) | Film coating composition | |
| MX2008015487A (es) | Proceso para la elaboracion de multiparticulados utilizando un compactador de rodillos. | |
| DE4310963A1 (de) | Retardtablette von beta-Phenylpropiophenonderivaten | |
| KR20160076928A (ko) | 푸마르산 에스테르를 함유하는 미니-정제 형태의 약제학적 제제 | |
| MXPA05006203A (es) | Formulaciones estables de topiramato. | |
| US20050266082A1 (en) | Preparation of stable paroxetine HC1 ER tablets using a melt granulation process | |
| Annapurna et al. | Bilayer Tablets-A Review | |
| AU2010270976B2 (en) | Sodium ibuprofen tablets and methods of manufacturing pharmaceutical compositions including sodium ibuprofen | |
| RU2214242C1 (ru) | Способ получения таблеток, содержащих симвастатин | |
| KR20160140567A (ko) | 오셀타미비어 유리염기를 포함하는 약학 조성물 | |
| BR112023008880B1 (pt) | Formas de dosagem de liberação sustentada de um sal de tapentadol com ácido l-(+)-tartárico | |
| AU2015264861B2 (en) | Sodium ibuprofen tablets and methods of manufacturing pharmaceutical compositions including sodium ibuprofen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| SPCF | Application for supplementary protection certificate filed |
Free format text: 8005759 |
|
| NAL | Patent in force |
Ref document number: 8005759-9 Format of ref document f/p: F |
|
| NUG | Patent has lapsed |
Ref document number: 8005759-9 Format of ref document f/p: F |