SE444941B - Derivat av nor-tropan och farmaceutisk komposition derav - Google Patents
Derivat av nor-tropan och farmaceutisk komposition deravInfo
- Publication number
- SE444941B SE444941B SE8000068A SE8000068A SE444941B SE 444941 B SE444941 B SE 444941B SE 8000068 A SE8000068 A SE 8000068A SE 8000068 A SE8000068 A SE 8000068A SE 444941 B SE444941 B SE 444941B
- Authority
- SE
- Sweden
- Prior art keywords
- ring
- formula
- methoxy
- amino
- methyl
- Prior art date
Links
- DGGKXQQCVPAUEA-UHFFFAOYSA-N 8-azabicyclo[3.2.1]octane Chemical class C1CCC2CCC1N2 DGGKXQQCVPAUEA-UHFFFAOYSA-N 0.000 title claims description 7
- 239000008194 pharmaceutical composition Substances 0.000 title claims 2
- -1 monosubstituted benzyl ring Chemical group 0.000 claims description 29
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 15
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 10
- 239000002253 acid Substances 0.000 claims description 9
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 8
- 125000003435 aroyl group Chemical group 0.000 claims description 7
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 7
- QENGPZGAWFQWCZ-UHFFFAOYSA-N Methylthiophene Natural products CC=1C=CSC=1 QENGPZGAWFQWCZ-UHFFFAOYSA-N 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 6
- 150000007513 acids Chemical class 0.000 claims description 5
- 229910052794 bromium Inorganic materials 0.000 claims description 5
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 125000004429 atom Chemical group 0.000 claims description 3
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 3
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- XQQBUAPQHNYYRS-UHFFFAOYSA-N 2-methylthiophene Chemical compound CC1=CC=CS1 XQQBUAPQHNYYRS-UHFFFAOYSA-N 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 125000001153 fluoro group Chemical group F* 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 208000020016 psychiatric disease Diseases 0.000 claims description 2
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 claims 2
- 125000003852 3-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Cl)=C1[H])C([H])([H])* 0.000 claims 1
- 125000006284 3-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(F)=C1[H])C([H])([H])* 0.000 claims 1
- 125000006281 4-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Br)C([H])([H])* 0.000 claims 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims 1
- 125000000714 pyrimidinyl group Chemical group 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 description 34
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 21
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 20
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- 238000000034 method Methods 0.000 description 14
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 12
- 239000000243 solution Substances 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 229910001868 water Inorganic materials 0.000 description 12
- 239000002904 solvent Substances 0.000 description 11
- XLRPYZSEQKXZAA-OCAPTIKFSA-N tropane Chemical compound C1CC[C@H]2CC[C@@H]1N2C XLRPYZSEQKXZAA-OCAPTIKFSA-N 0.000 description 11
- 101100298295 Drosophila melanogaster flfl gene Proteins 0.000 description 9
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 8
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- 238000000921 elemental analysis Methods 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 229910052938 sodium sulfate Inorganic materials 0.000 description 6
- 235000011152 sodium sulphate Nutrition 0.000 description 6
- 238000003786 synthesis reaction Methods 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 238000001228 spectrum Methods 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 241000699670 Mus sp. Species 0.000 description 4
- 238000009833 condensation Methods 0.000 description 4
- 230000005494 condensation Effects 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 3
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 3
- 239000012346 acetyl chloride Substances 0.000 description 3
- 230000007059 acute toxicity Effects 0.000 description 3
- 231100000403 acute toxicity Toxicity 0.000 description 3
- VMWNQDUVQKEIOC-CYBMUJFWSA-N apomorphine Chemical compound C([C@H]1N(C)CC2)C3=CC=C(O)C(O)=C3C3=C1C2=CC=C3 VMWNQDUVQKEIOC-CYBMUJFWSA-N 0.000 description 3
- 229960004046 apomorphine Drugs 0.000 description 3
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 3
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 229910052693 Europium Inorganic materials 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 231100000111 LD50 Toxicity 0.000 description 2
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 2
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- OGPBJKLSAFTDLK-UHFFFAOYSA-N europium atom Chemical compound [Eu] OGPBJKLSAFTDLK-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 231100000636 lethal dose Toxicity 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 210000004303 peritoneum Anatomy 0.000 description 2
- 229940072033 potash Drugs 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 235000015320 potassium carbonate Nutrition 0.000 description 2
- 235000011181 potassium carbonates Nutrition 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- PPKXEPBICJTCRU-XMZRARIVSA-N (R,R)-tramadol hydrochloride Chemical compound Cl.COC1=CC=CC([C@]2(O)[C@H](CCCC2)CN(C)C)=C1 PPKXEPBICJTCRU-XMZRARIVSA-N 0.000 description 1
- IZXWCDITFDNEBY-UHFFFAOYSA-N 1-(chloromethyl)-4-fluorobenzene Chemical compound FC1=CC=C(CCl)C=C1 IZXWCDITFDNEBY-UHFFFAOYSA-N 0.000 description 1
- JQZAEUFPPSRDOP-UHFFFAOYSA-N 1-chloro-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C=C1 JQZAEUFPPSRDOP-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 1
- 101100352919 Caenorhabditis elegans ppm-2 gene Proteins 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 101710161955 Mannitol-specific phosphotransferase enzyme IIA component Proteins 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 240000006571 Piper sanctum Species 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 241000269435 Rana <genus> Species 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 238000005377 adsorption chromatography Methods 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000012320 chlorinating reagent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- OMEGHMBBBTYRFT-UHFFFAOYSA-N chloromethylcyclohexane Chemical compound ClCC1CCCCC1 OMEGHMBBBTYRFT-UHFFFAOYSA-N 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229920001577 copolymer Chemical group 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- DZGCGKFAPXFTNM-UHFFFAOYSA-N ethanol;hydron;chloride Chemical compound Cl.CCO DZGCGKFAPXFTNM-UHFFFAOYSA-N 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- JOUIQRNQJGXQDC-AXTSPUMRSA-N namn Chemical compound O1[C@@H](COP(O)([O-])=O)[C@H](O)[C@@H](O)[C@@H]1[N+]1=CC=CC(C(O)=O)=C1 JOUIQRNQJGXQDC-AXTSPUMRSA-N 0.000 description 1
- 230000000701 neuroleptic effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- BGRJTUBHPOOWDU-UHFFFAOYSA-N sulpiride Chemical compound CCN1CCCC1CNC(=O)C1=CC(S(N)(=O)=O)=CC=C1OC BGRJTUBHPOOWDU-UHFFFAOYSA-N 0.000 description 1
- 229960004940 sulpiride Drugs 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 229930004006 tropane Natural products 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/47—One nitrogen atom and one oxygen or sulfur atom, e.g. cytosine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D451/00—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof
- C07D451/02—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof containing not further condensed 8-azabicyclo [3.2.1] octane or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane; Cyclic acetals thereof
- C07D451/04—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof containing not further condensed 8-azabicyclo [3.2.1] octane or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane; Cyclic acetals thereof with hetero atoms directly attached in position 3 of the 8-azabicyclo [3.2.1] octane or in position 7 of the 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring system
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Furan Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7900971A FR2446823A1 (fr) | 1979-01-16 | 1979-01-16 | Nouveaux derives du nor-tropane, leur procede de preparation et leur application en therapeutique |
| FR7931656A FR2476088A2 (fr) | 1979-01-16 | 1979-12-26 | Nouveaux derives du nor-tropane, leur procede de preparation et leur application en therapeutique |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE8000068L SE8000068L (sv) | 1980-07-17 |
| SE444941B true SE444941B (sv) | 1986-05-20 |
Family
ID=26220957
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE8000068A SE444941B (sv) | 1979-01-16 | 1980-01-04 | Derivat av nor-tropan och farmaceutisk komposition derav |
| SE8005674A SE431984B (sv) | 1979-01-16 | 1980-08-12 | Derivat av 3-beta-amiro-nortropan som mellanprodukter for framstellning av nortropanderivat |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE8005674A SE431984B (sv) | 1979-01-16 | 1980-08-12 | Derivat av 3-beta-amiro-nortropan som mellanprodukter for framstellning av nortropanderivat |
Country Status (14)
| Country | Link |
|---|---|
| US (2) | US4471120A (enExample) |
| AU (1) | AU542537B2 (enExample) |
| BE (1) | BE881134A (enExample) |
| CA (1) | CA1130286A (enExample) |
| CH (2) | CH647520A5 (enExample) |
| DE (2) | DE3001328A1 (enExample) |
| ES (1) | ES487721A1 (enExample) |
| FR (1) | FR2476088A2 (enExample) |
| GB (1) | GB2042522B (enExample) |
| GR (1) | GR66499B (enExample) |
| IT (2) | IT1148801B (enExample) |
| LU (1) | LU82083A1 (enExample) |
| NL (1) | NL8000277A (enExample) |
| SE (2) | SE444941B (enExample) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4350691A (en) * | 1979-12-20 | 1982-09-21 | Beecham Group Limited | Certain azabicyclocarboxamides and compositions containing same |
| FR2493848B2 (fr) * | 1980-11-07 | 1986-05-16 | Delalande Sa | Nouveaux derives des nor-tropane et granatane, leur procede de preparation et leur application en therapeutique |
| ZA818221B (en) * | 1980-12-12 | 1982-10-27 | Beecham Group Plc | Pharmaceutical compounds |
| EP0069481A1 (en) * | 1981-06-17 | 1983-01-12 | Beecham Group Plc | Azabicycloalkyl benzamides, process for their preparation and pharmaceutical compositions containing them |
| DE3268378D1 (en) * | 1981-06-17 | 1986-02-20 | Beecham Group Plc | Alkylthio derivatives of azabicyclobenzamides, their preparation and pharmaceutical compositions |
| EP0068700A1 (en) * | 1981-06-29 | 1983-01-05 | Beecham Group Plc | Azobicycloalkylbenzamides, process for their preparation and pharmaceutical compositions containing them |
| EP0069482A1 (en) * | 1981-06-29 | 1983-01-12 | Beecham Group Plc | Azabicycloalkyl benzamides, process for their preparation and pharmaceutical compositions containing them |
| EP0076592B1 (en) * | 1981-10-01 | 1987-01-28 | Beecham Group Plc | Azabicyclo-(3,3,1)-nonylbenzamide derivatives, processes for their preparation, and pharmaceutical compositions containing them |
| EP0083737A1 (en) * | 1981-12-15 | 1983-07-20 | Beecham Group Plc | N-azabicycloalkane benzamides, process for their preparation and pharmaceutical compositions containing them |
| DE3368061D1 (en) * | 1982-05-11 | 1987-01-15 | Beecham Group Plc | Azabicycloalkane derivatives, their preparation and medicaments containing them |
| FR2531083B1 (fr) * | 1982-06-29 | 1986-11-28 | Sandoz Sa | Nouveaux derives de la piperidine, leur preparation et leur utilisation comme medicaments |
| WO1984001151A1 (en) * | 1982-09-24 | 1984-03-29 | Beecham Group Plc | Amino-azabicycloalkyl derivatives as dopamine antagonists |
| CA1244028A (en) * | 1983-04-14 | 1988-11-01 | Hans Maag | Pyrimidine derivatives |
| FR2546169B1 (fr) * | 1983-05-20 | 1986-03-21 | Delalande Sa | N-oxydes de derives aminocycliques, leur procede de preparation et leur application en therapeutique |
| WO1985001048A1 (en) * | 1983-08-26 | 1985-03-14 | Sandoz Ag | Aromatic esters or amides of carboxylic acid and sulfonic acid |
| FR2557110B1 (fr) * | 1983-12-23 | 1989-11-24 | Sandoz Sa | Nouveaux derives d'amines cycliques, leur preparation et leur utilisation comme medicaments |
| US4997956A (en) * | 1989-06-14 | 1991-03-05 | Eli Lilly And Company | Certain 2,3-dihydro-2;2-dimethyl-benzothiophene carboxylic acids which are intermediates |
| US5364863A (en) * | 1987-09-08 | 1994-11-15 | Eli Lilly And Company | Specific 5-HT3 antagonists |
| US4921982A (en) * | 1988-07-21 | 1990-05-01 | Eli Lilly And Company | 5-halo-2,3-dihydro-2,2-dimethylbenzofuran-7-carboxylic acids useful as intermediates for 5-HT3 antagonists |
| US5070094A (en) * | 1989-09-05 | 1991-12-03 | G. D. Searle & Co. | N-benzyltropaneamides |
| GB9027487D0 (en) * | 1990-12-19 | 1991-02-06 | Beecham Group Plc | Pharmaceuticals |
| FR2831884B1 (fr) | 2001-11-02 | 2003-12-26 | Pf Medicament | Nouveaux derives amides heteroaromatiques de 3 beta-amino azabicyclooctane, leur procede de preparation et leurs applications en therapeutique |
| USD504918S1 (en) | 2003-06-05 | 2005-05-10 | Tombow Pencil Co., Ltd. | Adjusting button of a tape dispenser |
| WO2004113334A1 (en) | 2003-06-24 | 2004-12-29 | Neurosearch A/S | Novel 8-aza-bicyclo[3.2.1]octane derivatives and their use as monoamine neurotransmitter re-uptake inhibitors |
| DK2336125T3 (da) * | 2008-04-11 | 2013-04-08 | Janssen Pharmaceutica Nv | Thiazolopyridin-2-yloxy-phenyl- og thioazolopyrazin-2-yloxy-phenyl-aminer som modulatorer af leukotrien-A4-hydrolase |
| AU2010249041B2 (en) * | 2009-05-14 | 2014-11-13 | Janssen Pharmaceutica Nv | Compounds with two fused bicyclic heteroaryl moieties as modulators of leukotriene A4 hydrolase |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3134782A (en) * | 1964-05-26 | Chjxch- | ||
| GB774858A (en) * | 1954-10-20 | 1957-05-15 | Sandoz Ltd | Tropane and -Î-tropane derivatives and process for preparation thereof |
| FR1162129A (fr) * | 1954-10-20 | 1958-09-09 | Sandoz Ag | Dérivés amidés du tropane et leur préparation |
| CH374679A (de) * | 1958-11-26 | 1964-01-31 | Sandoz Ag | Verfahren zur Herstellung von neuen Tropan-Derivaten |
| DE2513136C3 (de) * | 1974-03-21 | 1981-04-30 | Anphar S.A., Madrid | N-(1-Benzylpiperid-4-yl)-benzamide, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Präparate |
| GB1593146A (en) * | 1976-11-05 | 1981-07-15 | Beecham Group Ltd | Octahydro-quinolizinyl benzamide derivatives |
| US4179567A (en) * | 1978-04-10 | 1979-12-18 | Sterling Drug Inc. | 2-Aryltropane compounds |
| IL59004A0 (en) * | 1978-12-30 | 1980-03-31 | Beecham Group Ltd | Substituted benzamides their preparation and pharmaceutical compositions containing them |
| US4329466A (en) * | 1979-01-16 | 1982-05-11 | Delalande S.A. | Certain nor-tropan-8-amine-3-aryl or heteroaryl derivatives |
| US4321378A (en) * | 1979-01-16 | 1982-03-23 | Delalande S.A. | 8-(5-Pyrimidinecarboxamide)nor-tropane derivatives |
-
1979
- 1979-12-26 FR FR7931656A patent/FR2476088A2/fr active Granted
-
1980
- 1980-01-04 SE SE8000068A patent/SE444941B/sv not_active IP Right Cessation
- 1980-01-05 GR GR60908A patent/GR66499B/el unknown
- 1980-01-07 US US06/110,067 patent/US4471120A/en not_active Expired - Lifetime
- 1980-01-08 CH CH111/80A patent/CH647520A5/fr not_active IP Right Cessation
- 1980-01-08 IT IT19071/80A patent/IT1148801B/it active
- 1980-01-08 CA CA343,219A patent/CA1130286A/en not_active Expired
- 1980-01-11 GB GB8001037A patent/GB2042522B/en not_active Expired
- 1980-01-14 BE BE0/198955A patent/BE881134A/fr not_active IP Right Cessation
- 1980-01-14 LU LU82083A patent/LU82083A1/fr unknown
- 1980-01-15 AU AU54610/80A patent/AU542537B2/en not_active Ceased
- 1980-01-15 ES ES487721A patent/ES487721A1/es not_active Expired
- 1980-01-16 DE DE19803001328 patent/DE3001328A1/de active Granted
- 1980-01-16 DE DE3049963A patent/DE3049963C2/de not_active Expired - Lifetime
- 1980-01-16 NL NL8000277A patent/NL8000277A/nl not_active Application Discontinuation
- 1980-08-12 SE SE8005674A patent/SE431984B/sv not_active IP Right Cessation
- 1980-08-18 CH CH622080A patent/CH646969A5/fr not_active IP Right Cessation
- 1980-09-17 IT IT8024713A patent/IT1235424B/it active
-
1982
- 1982-07-19 US US06/399,392 patent/US4536580A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| FR2476088B2 (enExample) | 1983-11-04 |
| SE431984B (sv) | 1984-03-12 |
| CA1130286A (en) | 1982-08-24 |
| GB2042522B (en) | 1983-04-13 |
| DE3001328A1 (de) | 1980-07-24 |
| GB2042522A (en) | 1980-09-24 |
| FR2476088A2 (fr) | 1981-08-21 |
| IT8019071A0 (it) | 1980-01-08 |
| NL8000277A (nl) | 1980-07-18 |
| DE3001328C2 (enExample) | 1989-06-08 |
| IT1235424B (it) | 1992-07-09 |
| CH646969A5 (fr) | 1984-12-28 |
| BE881134A (fr) | 1980-07-14 |
| IT1148801B (it) | 1986-12-03 |
| DE3049963C2 (de) | 1993-11-25 |
| US4471120A (en) | 1984-09-11 |
| ES487721A1 (es) | 1980-06-16 |
| IT8024713A0 (it) | 1980-09-17 |
| AU542537B2 (en) | 1985-02-28 |
| SE8000068L (sv) | 1980-07-17 |
| GR66499B (enExample) | 1981-03-24 |
| AU5461080A (en) | 1980-07-24 |
| US4536580A (en) | 1985-08-20 |
| CH647520A5 (fr) | 1985-01-31 |
| LU82083A1 (fr) | 1981-09-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE444941B (sv) | Derivat av nor-tropan och farmaceutisk komposition derav | |
| FI64154C (fi) | Foerfarande foer framstaellning av en terapeutiskt verkande 5-etyl-isoxazol-4-karboxylsyra-(4-trifluormetyl)-anilid | |
| CA1197843A (en) | Pyrido(2,1-b)quinazolin-ones and their methods of preparation | |
| DE2812625C2 (enExample) | ||
| DE3546658C2 (enExample) | ||
| Perron et al. | Derivatives of 6-aminopenicillanic acid. I. Partially synthetic penicillins prepared from α-aryloxyalkanoic acids | |
| SE454175B (sv) | /1-(2-bensoxazolyl, 2-benstiazolyl eller 2-indolyl)hydrazino/alkylnitrilderivat samt farmaceutiska kompositioner | |
| DE2537070C2 (enExample) | ||
| DE60022986T2 (de) | Pyridazin-3-on-derivate und sie enthaltende Arzneimittel | |
| SU812181A3 (ru) | Способ получени циклическихпРОизВОдНыХ 1,4-бЕНзОКСАзиНА или1,4-бЕНзТиАзиНА или иХ КиСлОТНО- АддиТиВНыХ СОлЕй | |
| US3268582A (en) | Phenylalkyl-carboxylic acid amides | |
| DE3804841A1 (de) | Cephalosporinderivate und verfahren zu ihrer herstellung | |
| PT93985B (pt) | Processo e produtos intermedios para a preparacao de acidos aceticos oxoftalazinilicos e seus analogos | |
| SU1681723A3 (ru) | Способ получени производных оксимов 1,2,5,6-тетрагидропиридин-3-карбоксальдегида | |
| Schweizer et al. | Reactions of azines. 12. Preparation and reactions of triphenyl [2-([phenyl (methoxycarbonyl) methylene] hydrazono) propyl] phosphonium bromide | |
| CN106916079A (zh) | 一种碳‑13标记的美沙西汀的合成方法 | |
| DE69131037T2 (de) | Benzo[c]phenanthridiniumderivaten | |
| PT92890A (pt) | Processo para a preparacao de derivados de cefalosporina e de composicoes farmaceuticas que os contem | |
| US4022780A (en) | Process for the manufacture of indole derivatives | |
| HU192876B (en) | Process for producing 5,10-dihydro-11h-dibenzo/b,e//1,4/ diazepin-11-one derivatives substitutes at the 5 position and pharmaceutical compositions containing them | |
| GB1569238A (en) | 2,5-dihdro-1,2-thiazino(5,6-b)indol-3-carboxamide-1,1-dioxide derivatives | |
| JPS632274B2 (enExample) | ||
| Bonner | Asymmetric Induction. II. Normal and Pseudo (-)-Menthyl Esters of o-Benzoylbenzoic Acid | |
| CN111559974B (zh) | 一种七元环并环戊[b]吲哚类衍生物及其合成方法和应用 | |
| EP0334281A2 (de) | Cephalosporinderivate und Verfahren zu ihrer Herstellung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NAL | Patent in force |
Ref document number: 8000068-0 Format of ref document f/p: F |
|
| NUG | Patent has lapsed |
Ref document number: 8000068-0 Format of ref document f/p: F |