CA1130286A - Derivates of nor-tropane, a process for preparing same and their application in therapeutics - Google Patents
Derivates of nor-tropane, a process for preparing same and their application in therapeuticsInfo
- Publication number
- CA1130286A CA1130286A CA343,219A CA343219A CA1130286A CA 1130286 A CA1130286 A CA 1130286A CA 343219 A CA343219 A CA 343219A CA 1130286 A CA1130286 A CA 1130286A
- Authority
- CA
- Canada
- Prior art keywords
- amino
- methoxy
- benzoyl
- formula
- benzyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- DGGKXQQCVPAUEA-UHFFFAOYSA-N 8-azabicyclo[3.2.1]octane Chemical compound C1CCC2CCC1N2 DGGKXQQCVPAUEA-UHFFFAOYSA-N 0.000 title claims abstract description 10
- 238000004519 manufacturing process Methods 0.000 title claims description 12
- 239000003814 drug Substances 0.000 title description 3
- 150000003839 salts Chemical class 0.000 claims abstract description 23
- 238000000034 method Methods 0.000 claims abstract description 22
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 68
- -1 5-pyrimidinyl carbonyl Chemical class 0.000 claims description 46
- 150000001875 compounds Chemical class 0.000 claims description 42
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 24
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 22
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 14
- 239000000460 chlorine Substances 0.000 claims description 13
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 12
- WHXLHIGUTBQVOF-UHFFFAOYSA-N 4-amino-5-bromo-2-methoxybenzoic acid Chemical compound COC1=CC(N)=C(Br)C=C1C(O)=O WHXLHIGUTBQVOF-UHFFFAOYSA-N 0.000 claims description 8
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 7
- 125000004429 atom Chemical group 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- 229910052731 fluorine Inorganic materials 0.000 claims description 7
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 claims description 6
- 125000003435 aroyl group Chemical group 0.000 claims description 6
- 229910052794 bromium Inorganic materials 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 4
- 150000008064 anhydrides Chemical class 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 4
- 239000011737 fluorine Substances 0.000 claims description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- XQQBUAPQHNYYRS-UHFFFAOYSA-N 2-methylthiophene Chemical group CC1=CC=CS1 XQQBUAPQHNYYRS-UHFFFAOYSA-N 0.000 claims description 3
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 claims description 3
- 239000012279 sodium borohydride Substances 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000001153 fluoro group Chemical group F* 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- QENGPZGAWFQWCZ-UHFFFAOYSA-N 3-Methylthiophene Chemical group CC=1C=CSC=1 QENGPZGAWFQWCZ-UHFFFAOYSA-N 0.000 claims 5
- 125000006281 4-bromobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Br)C([H])([H])* 0.000 claims 3
- 125000006512 3,4-dichlorobenzyl group Chemical group [H]C1=C(Cl)C(Cl)=C([H])C(=C1[H])C([H])([H])* 0.000 claims 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims 2
- VQKFNUFAXTZWDK-UHFFFAOYSA-N 2-Methylfuran Chemical group CC1=CC=CO1 VQKFNUFAXTZWDK-UHFFFAOYSA-N 0.000 claims 1
- 125000003852 3-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(Cl)=C1[H])C([H])([H])* 0.000 claims 1
- 125000006284 3-fluorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C(F)=C1[H])C([H])([H])* 0.000 claims 1
- PPFLOLZEHGQVQM-UHFFFAOYSA-N 3-methylthiophen-2-amine Chemical compound CC=1C=CSC=1N PPFLOLZEHGQVQM-UHFFFAOYSA-N 0.000 claims 1
- GOXCIWMHHSVOKW-UHFFFAOYSA-N 4-acetamido-5-chloro-2-methoxybenzoic acid Chemical compound COC1=CC(NC(C)=O)=C(Cl)C=C1C(O)=O GOXCIWMHHSVOKW-UHFFFAOYSA-N 0.000 claims 1
- 125000006283 4-chlorobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1Cl)C([H])([H])* 0.000 claims 1
- 229940073608 benzyl chloride Drugs 0.000 claims 1
- OMEGHMBBBTYRFT-UHFFFAOYSA-N chloromethylcyclohexane Chemical compound ClCC1CCCCC1 OMEGHMBBBTYRFT-UHFFFAOYSA-N 0.000 claims 1
- 238000009833 condensation Methods 0.000 abstract description 3
- 230000005494 condensation Effects 0.000 abstract description 3
- 230000000701 neuroleptic effect Effects 0.000 abstract description 2
- 235000013350 formula milk Nutrition 0.000 description 53
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 24
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 21
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 15
- 239000000243 solution Substances 0.000 description 14
- 238000002844 melting Methods 0.000 description 11
- 230000008018 melting Effects 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 10
- 239000011734 sodium Substances 0.000 description 10
- 229910052708 sodium Inorganic materials 0.000 description 10
- 239000002904 solvent Substances 0.000 description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 238000004458 analytical method Methods 0.000 description 9
- 230000000875 corresponding effect Effects 0.000 description 9
- 210000004940 nucleus Anatomy 0.000 description 9
- UFTHHGMNOOJODQ-UHFFFAOYSA-N methyl 2-amino-4-methoxypyrimidine-5-carboxylate Chemical compound COC(=O)C1=CN=C(N)N=C1OC UFTHHGMNOOJODQ-UHFFFAOYSA-N 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 7
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- 238000003786 synthesis reaction Methods 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- 229940022682 acetone Drugs 0.000 description 5
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 5
- 239000003153 chemical reaction reagent Substances 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 235000011152 sodium sulphate Nutrition 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 241000699670 Mus sp. Species 0.000 description 4
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 4
- 238000007912 intraperitoneal administration Methods 0.000 description 4
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 3
- 239000012346 acetyl chloride Substances 0.000 description 3
- VMWNQDUVQKEIOC-CYBMUJFWSA-N apomorphine Chemical compound C([C@H]1N(C)CC2)C3=CC=C(O)C(O)=C3C3=C1C2=CC=C3 VMWNQDUVQKEIOC-CYBMUJFWSA-N 0.000 description 3
- 229960004046 apomorphine Drugs 0.000 description 3
- 229940093499 ethyl acetate Drugs 0.000 description 3
- 235000019439 ethyl acetate Nutrition 0.000 description 3
- 229940072033 potash Drugs 0.000 description 3
- 235000015320 potassium carbonate Nutrition 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 239000012429 reaction media Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- 229910052693 Europium Inorganic materials 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 230000007059 acute toxicity Effects 0.000 description 2
- 231100000403 acute toxicity Toxicity 0.000 description 2
- 238000007792 addition Methods 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000012320 chlorinating reagent Substances 0.000 description 2
- 235000017168 chlorine Nutrition 0.000 description 2
- 229940060038 chlorine Drugs 0.000 description 2
- OGPBJKLSAFTDLK-UHFFFAOYSA-N europium atom Chemical compound [Eu] OGPBJKLSAFTDLK-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 229930192474 thiophene Natural products 0.000 description 2
- AIPJZPPOFWCJRC-UHFFFAOYSA-N 1,2-dichloro-3-(chloromethyl)benzene Chemical compound ClCC1=CC=CC(Cl)=C1Cl AIPJZPPOFWCJRC-UHFFFAOYSA-N 0.000 description 1
- DNCYBUMDUBHIJZ-UHFFFAOYSA-N 1h-pyrimidin-6-one Chemical compound O=C1C=CN=CN1 DNCYBUMDUBHIJZ-UHFFFAOYSA-N 0.000 description 1
- GANBJDIOIDQSGI-UHFFFAOYSA-N 2-(chloromethyl)furan Chemical compound ClCC1=CC=CO1 GANBJDIOIDQSGI-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 1
- 101150041968 CDC13 gene Proteins 0.000 description 1
- 101100352919 Caenorhabditis elegans ppm-2 gene Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 241000861718 Chloris <Aves> Species 0.000 description 1
- JZUFKLXOESDKRF-UHFFFAOYSA-N Chlorothiazide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC2=C1NCNS2(=O)=O JZUFKLXOESDKRF-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 101150107341 RERE gene Proteins 0.000 description 1
- 101100129590 Schizosaccharomyces pombe (strain 972 / ATCC 24843) mcp5 gene Proteins 0.000 description 1
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 1
- TUCNEACPLKLKNU-UHFFFAOYSA-N acetyl Chemical compound C[C]=O TUCNEACPLKLKNU-UHFFFAOYSA-N 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical compound [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- RCJVRSBWZCNNQT-UHFFFAOYSA-N dichloridooxygen Chemical compound ClOCl RCJVRSBWZCNNQT-UHFFFAOYSA-N 0.000 description 1
- MCWXGJITAZMZEV-UHFFFAOYSA-N dimethoate Chemical compound CNC(=O)CSP(=S)(OC)OC MCWXGJITAZMZEV-UHFFFAOYSA-N 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- HRRHGLKNOJHIGY-UHFFFAOYSA-N ethyl 2-amino-4-hydroxypyrimidine-5-carboxylate Chemical compound CCOC(=O)C1=CN=C(N)N=C1O HRRHGLKNOJHIGY-UHFFFAOYSA-N 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 231100000636 lethal dose Toxicity 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- XMVNUAHPLDBEJH-UHFFFAOYSA-N methyl pyrimidine-5-carboxylate Chemical compound COC(=O)C1=CN=CN=C1 XMVNUAHPLDBEJH-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- LMAZKPOSWVOFGY-FBAUPLQOSA-N orine Natural products CO[C@H]1C[C@H](O[C@H]2CC[C@]3(C)[C@H]4C[C@@H](OC(=O)C=Cc5ccccc5)[C@]6(C)[C@@](O)(CC[C@]6(O)[C@]4(O)CC=C3C2)[C@H](C)OC(=O)C=Cc7ccccc7)O[C@H](C)[C@H]1O LMAZKPOSWVOFGY-FBAUPLQOSA-N 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- BGRJTUBHPOOWDU-UHFFFAOYSA-N sulpiride Chemical compound CCN1CCCC1CNC(=O)C1=CC(S(N)(=O)=O)=CC=C1OC BGRJTUBHPOOWDU-UHFFFAOYSA-N 0.000 description 1
- 229960004940 sulpiride Drugs 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 229960002447 thiram Drugs 0.000 description 1
- 238000011282 treatment Methods 0.000 description 1
- JCMLRUNDSXARRW-UHFFFAOYSA-N trioxouranium Chemical group O=[U](=O)=O JCMLRUNDSXARRW-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/47—One nitrogen atom and one oxygen or sulfur atom, e.g. cytosine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D451/00—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof
- C07D451/02—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof containing not further condensed 8-azabicyclo [3.2.1] octane or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane; Cyclic acetals thereof
- C07D451/04—Heterocyclic compounds containing 8-azabicyclo [3.2.1] octane, 9-azabicyclo [3.3.1] nonane, or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane or granatane alkaloids, scopolamine; Cyclic acetals thereof containing not further condensed 8-azabicyclo [3.2.1] octane or 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring systems, e.g. tropane; Cyclic acetals thereof with hetero atoms directly attached in position 3 of the 8-azabicyclo [3.2.1] octane or in position 7 of the 3-oxa-9-azatricyclo [3.3.1.0<2,4>] nonane ring system
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Furan Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CA000409952A CA1160227A (en) | 1979-01-16 | 1982-08-23 | DERIVATIVES OF .beta.-3-AMINO-N-NOR-TROPANES |
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7900971A FR2446823A1 (fr) | 1979-01-16 | 1979-01-16 | Nouveaux derives du nor-tropane, leur procede de preparation et leur application en therapeutique |
| FR79.00971 | 1979-01-16 | ||
| FR79.31656 | 1979-12-26 | ||
| FR7931656A FR2476088A2 (fr) | 1979-01-16 | 1979-12-26 | Nouveaux derives du nor-tropane, leur procede de preparation et leur application en therapeutique |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1130286A true CA1130286A (en) | 1982-08-24 |
Family
ID=26220957
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA343,219A Expired CA1130286A (en) | 1979-01-16 | 1980-01-08 | Derivates of nor-tropane, a process for preparing same and their application in therapeutics |
Country Status (14)
| Country | Link |
|---|---|
| US (2) | US4471120A (enExample) |
| AU (1) | AU542537B2 (enExample) |
| BE (1) | BE881134A (enExample) |
| CA (1) | CA1130286A (enExample) |
| CH (2) | CH647520A5 (enExample) |
| DE (2) | DE3001328A1 (enExample) |
| ES (1) | ES487721A1 (enExample) |
| FR (1) | FR2476088A2 (enExample) |
| GB (1) | GB2042522B (enExample) |
| GR (1) | GR66499B (enExample) |
| IT (2) | IT1148801B (enExample) |
| LU (1) | LU82083A1 (enExample) |
| NL (1) | NL8000277A (enExample) |
| SE (2) | SE444941B (enExample) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4350691A (en) * | 1979-12-20 | 1982-09-21 | Beecham Group Limited | Certain azabicyclocarboxamides and compositions containing same |
| FR2493848B2 (fr) * | 1980-11-07 | 1986-05-16 | Delalande Sa | Nouveaux derives des nor-tropane et granatane, leur procede de preparation et leur application en therapeutique |
| ZA818221B (en) * | 1980-12-12 | 1982-10-27 | Beecham Group Plc | Pharmaceutical compounds |
| EP0067615B1 (en) * | 1981-06-17 | 1986-01-08 | Beecham Group Plc | Alkylthio derivatives of azabicyclobenzamides, their preparation and pharmaceutical compositions |
| EP0069481A1 (en) * | 1981-06-17 | 1983-01-12 | Beecham Group Plc | Azabicycloalkyl benzamides, process for their preparation and pharmaceutical compositions containing them |
| EP0069482A1 (en) * | 1981-06-29 | 1983-01-12 | Beecham Group Plc | Azabicycloalkyl benzamides, process for their preparation and pharmaceutical compositions containing them |
| EP0068700A1 (en) * | 1981-06-29 | 1983-01-05 | Beecham Group Plc | Azobicycloalkylbenzamides, process for their preparation and pharmaceutical compositions containing them |
| GB2111479A (en) * | 1981-10-01 | 1983-07-06 | Beecham Group Plc | Benzamides |
| EP0083737A1 (en) * | 1981-12-15 | 1983-07-20 | Beecham Group Plc | N-azabicycloalkane benzamides, process for their preparation and pharmaceutical compositions containing them |
| DE3368061D1 (en) * | 1982-05-11 | 1987-01-15 | Beecham Group Plc | Azabicycloalkane derivatives, their preparation and medicaments containing them |
| FR2531083B1 (fr) * | 1982-06-29 | 1986-11-28 | Sandoz Sa | Nouveaux derives de la piperidine, leur preparation et leur utilisation comme medicaments |
| EP0126087A1 (en) * | 1982-09-24 | 1984-11-28 | Beecham Group Plc | Amino-azabicycloalkyl derivatives as dopamine antagonists |
| CA1244028A (en) * | 1983-04-14 | 1988-11-01 | Hans Maag | Pyrimidine derivatives |
| FR2546169B1 (fr) * | 1983-05-20 | 1986-03-21 | Delalande Sa | N-oxydes de derives aminocycliques, leur procede de preparation et leur application en therapeutique |
| CH664567A5 (de) * | 1983-08-26 | 1988-03-15 | Sandoz Ag | Aromatische carbonsaeure- und sulfonsaeureester oder -amide. |
| DE3445377A1 (de) * | 1983-12-23 | 1985-07-04 | Sandoz-Patent-GmbH, 7850 Lörrach | Carbocylische und heterocyclische carbonsaeureester und -amide von ueberbrueckten und nicht ueberbrueckten cyclischen stickstoffhaltigen aminen oder alkoholen |
| US4921982A (en) * | 1988-07-21 | 1990-05-01 | Eli Lilly And Company | 5-halo-2,3-dihydro-2,2-dimethylbenzofuran-7-carboxylic acids useful as intermediates for 5-HT3 antagonists |
| US4997956A (en) * | 1989-06-14 | 1991-03-05 | Eli Lilly And Company | Certain 2,3-dihydro-2;2-dimethyl-benzothiophene carboxylic acids which are intermediates |
| US5364863A (en) * | 1987-09-08 | 1994-11-15 | Eli Lilly And Company | Specific 5-HT3 antagonists |
| US5070094A (en) * | 1989-09-05 | 1991-12-03 | G. D. Searle & Co. | N-benzyltropaneamides |
| GB9027487D0 (en) * | 1990-12-19 | 1991-02-06 | Beecham Group Plc | Pharmaceuticals |
| FR2831884B1 (fr) | 2001-11-02 | 2003-12-26 | Pf Medicament | Nouveaux derives amides heteroaromatiques de 3 beta-amino azabicyclooctane, leur procede de preparation et leurs applications en therapeutique |
| USD504918S1 (en) | 2003-06-05 | 2005-05-10 | Tombow Pencil Co., Ltd. | Adjusting button of a tape dispenser |
| JP2009513491A (ja) | 2003-06-24 | 2009-04-02 | ノイロサーチ アクティーゼルスカブ | 新規な8−アザ−ビシクロ[3.2.1]オクタン誘導体、及びモノアミン神経伝達物質の再取り込み阻害剤としてのその使用 |
| PT2336125E (pt) | 2008-04-11 | 2013-03-18 | Janssen Pharmaceutica Nv | Tiazolopiridina-2-iloxi-fenil e tiazolopirazin-2-iloxifenil aminas como moduladores de leucotrieno a4 hidrolase |
| WO2010132599A1 (en) * | 2009-05-14 | 2010-11-18 | Janssen Pharmaceutica Nv | Compounds with two fused bicyclic heteroaryl moieties as modulators of leukotriene a4 hydrolase |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3134782A (en) * | 1964-05-26 | Chjxch- | ||
| GB774858A (en) * | 1954-10-20 | 1957-05-15 | Sandoz Ltd | Tropane and -Î-tropane derivatives and process for preparation thereof |
| FR1162129A (fr) * | 1954-10-20 | 1958-09-09 | Sandoz Ag | Dérivés amidés du tropane et leur préparation |
| CH374679A (de) * | 1958-11-26 | 1964-01-31 | Sandoz Ag | Verfahren zur Herstellung von neuen Tropan-Derivaten |
| DE2513136C3 (de) * | 1974-03-21 | 1981-04-30 | Anphar S.A., Madrid | N-(1-Benzylpiperid-4-yl)-benzamide, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Präparate |
| GB1593146A (en) * | 1976-11-05 | 1981-07-15 | Beecham Group Ltd | Octahydro-quinolizinyl benzamide derivatives |
| US4179567A (en) * | 1978-04-10 | 1979-12-18 | Sterling Drug Inc. | 2-Aryltropane compounds |
| IL59004A0 (en) * | 1978-12-30 | 1980-03-31 | Beecham Group Ltd | Substituted benzamides their preparation and pharmaceutical compositions containing them |
| US4329466A (en) * | 1979-01-16 | 1982-05-11 | Delalande S.A. | Certain nor-tropan-8-amine-3-aryl or heteroaryl derivatives |
| US4321378A (en) * | 1979-01-16 | 1982-03-23 | Delalande S.A. | 8-(5-Pyrimidinecarboxamide)nor-tropane derivatives |
-
1979
- 1979-12-26 FR FR7931656A patent/FR2476088A2/fr active Granted
-
1980
- 1980-01-04 SE SE8000068A patent/SE444941B/sv not_active IP Right Cessation
- 1980-01-05 GR GR60908A patent/GR66499B/el unknown
- 1980-01-07 US US06/110,067 patent/US4471120A/en not_active Expired - Lifetime
- 1980-01-08 IT IT19071/80A patent/IT1148801B/it active
- 1980-01-08 CH CH111/80A patent/CH647520A5/fr not_active IP Right Cessation
- 1980-01-08 CA CA343,219A patent/CA1130286A/en not_active Expired
- 1980-01-11 GB GB8001037A patent/GB2042522B/en not_active Expired
- 1980-01-14 BE BE0/198955A patent/BE881134A/fr not_active IP Right Cessation
- 1980-01-14 LU LU82083A patent/LU82083A1/fr unknown
- 1980-01-15 ES ES487721A patent/ES487721A1/es not_active Expired
- 1980-01-15 AU AU54610/80A patent/AU542537B2/en not_active Ceased
- 1980-01-16 NL NL8000277A patent/NL8000277A/nl not_active Application Discontinuation
- 1980-01-16 DE DE19803001328 patent/DE3001328A1/de active Granted
- 1980-01-16 DE DE3049963A patent/DE3049963C2/de not_active Expired - Lifetime
- 1980-08-12 SE SE8005674A patent/SE431984B/sv not_active IP Right Cessation
- 1980-08-18 CH CH622080A patent/CH646969A5/fr not_active IP Right Cessation
- 1980-09-17 IT IT8024713A patent/IT1235424B/it active
-
1982
- 1982-07-19 US US06/399,392 patent/US4536580A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| CH646969A5 (fr) | 1984-12-28 |
| GB2042522A (en) | 1980-09-24 |
| IT1235424B (it) | 1992-07-09 |
| IT8019071A0 (it) | 1980-01-08 |
| GB2042522B (en) | 1983-04-13 |
| AU5461080A (en) | 1980-07-24 |
| DE3001328A1 (de) | 1980-07-24 |
| IT1148801B (it) | 1986-12-03 |
| US4536580A (en) | 1985-08-20 |
| US4471120A (en) | 1984-09-11 |
| DE3049963C2 (de) | 1993-11-25 |
| FR2476088B2 (enExample) | 1983-11-04 |
| GR66499B (enExample) | 1981-03-24 |
| SE431984B (sv) | 1984-03-12 |
| DE3001328C2 (enExample) | 1989-06-08 |
| BE881134A (fr) | 1980-07-14 |
| CH647520A5 (fr) | 1985-01-31 |
| LU82083A1 (fr) | 1981-09-10 |
| SE8000068L (sv) | 1980-07-17 |
| IT8024713A0 (it) | 1980-09-17 |
| AU542537B2 (en) | 1985-02-28 |
| SE444941B (sv) | 1986-05-20 |
| NL8000277A (nl) | 1980-07-18 |
| ES487721A1 (es) | 1980-06-16 |
| FR2476088A2 (fr) | 1981-08-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1130286A (en) | Derivates of nor-tropane, a process for preparing same and their application in therapeutics | |
| CA1142520A (en) | Pyrano- and thiopyrano quinoline, and quinazoline, and quinoxaline carboxylic acid derivatives | |
| KR900004587B1 (ko) | 페닐나프티리딘의 제조방법 | |
| US2569801A (en) | Preparation of azlactones of phenylacetamino acrylic acids | |
| Sinsky et al. | The reactions of some ortho‐substituted anilines with various α, β‐acetylenic ketones. A route to substituted quinolines | |
| US4528367A (en) | Method and intermediates for preparing high purity 3,3'-azo-bis-(6-hydroxy benzoic acid) | |
| JPS6252A (ja) | イソプレノイドアミン誘導体および抗潰瘍剤 | |
| KR880002289B1 (ko) | 2-아미노-3-(할로벤조일)-메틸페닐아세트산 및 그 유도체의 제조방법 | |
| US3975432A (en) | Process for preparing 2-(6-methoxy-2-naphthyl)propionic acid | |
| JPS61109767A (ja) | オキシンドール抗炎症剤 | |
| US4025644A (en) | Tyrosine derivatives and use | |
| US3631177A (en) | 3-phenacyl-2-oxoindolines | |
| US4027023A (en) | Cinnolin-3-yl carboxylic acids and derivatives | |
| US3201414A (en) | New 1-heteroacyl-3-indolyl aliphatic acids | |
| US4000186A (en) | Erythrodiol derivatives | |
| US3465002A (en) | (succinimidoaryloxy)alkanoic acids,esters and amides thereof | |
| US4057629A (en) | Tyrosine derivatives and process for preparing the same | |
| PL96806B1 (pl) | Sposob wytwarzania nowych pochodnych aminopirolu | |
| CA1140124A (en) | Process for the preparation of nitrogen bridgehead condensed pyrimidine compounds, the salt, hydrates and isomers thereof, certain representatives of the compounds prepared and pharmaceutical compositions containing them | |
| US3535334A (en) | 1-piperonoyl-3-indolyl aliphatic acid derivatives | |
| US5003090A (en) | Process for the preparation of benzopyrans | |
| EP0066254B1 (en) | Mercapto amino acids, process for their preparation and pharmaceutical compositions containing them | |
| US4198412A (en) | Pyrazolo [1,5-C] quinazoline derivatives and their use in treating allergic conditions | |
| US3703513A (en) | Novel 3,5-dioxopyrazolidine derivatives | |
| US3855230A (en) | 2-(3{40 -trifluoromethylthio-anilino)-benzoic acid and salts thereof with pharmaceutically acceptable bases |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |