NO845228L - Kinolinforbindelser. - Google Patents
Kinolinforbindelser.Info
- Publication number
- NO845228L NO845228L NO845228A NO845228A NO845228L NO 845228 L NO845228 L NO 845228L NO 845228 A NO845228 A NO 845228A NO 845228 A NO845228 A NO 845228A NO 845228 L NO845228 L NO 845228L
- Authority
- NO
- Norway
- Prior art keywords
- formula
- alkyl
- quinolone
- group
- compound
- Prior art date
Links
- 125000002943 quinolinyl group Chemical class N1=C(C=CC2=CC=CC=C12)* 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 75
- 239000000203 mixture Substances 0.000 claims description 72
- 238000006243 chemical reaction Methods 0.000 claims description 44
- -1 hydroxy, hydroxymethyl Chemical group 0.000 claims description 43
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 41
- 239000007858 starting material Substances 0.000 claims description 37
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 36
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 29
- 238000000034 method Methods 0.000 claims description 29
- 238000010992 reflux Methods 0.000 claims description 29
- 229910052739 hydrogen Inorganic materials 0.000 claims description 27
- 238000002360 preparation method Methods 0.000 claims description 23
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 22
- 229910052794 bromium Inorganic materials 0.000 claims description 21
- 150000003839 salts Chemical class 0.000 claims description 19
- 229910052757 nitrogen Inorganic materials 0.000 claims description 18
- 229910052799 carbon Inorganic materials 0.000 claims description 15
- 229910052740 iodine Inorganic materials 0.000 claims description 12
- 238000012546 transfer Methods 0.000 claims description 12
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 11
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 11
- 229910052801 chlorine Inorganic materials 0.000 claims description 11
- 239000000460 chlorine Substances 0.000 claims description 11
- 239000001257 hydrogen Substances 0.000 claims description 11
- 239000002253 acid Substances 0.000 claims description 10
- 229910052736 halogen Inorganic materials 0.000 claims description 10
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 9
- 150000002367 halogens Chemical class 0.000 claims description 9
- LISFMEBWQUVKPJ-UHFFFAOYSA-N quinolin-2-ol Chemical group C1=CC=C2NC(=O)C=CC2=C1 LISFMEBWQUVKPJ-UHFFFAOYSA-N 0.000 claims description 9
- 239000003054 catalyst Substances 0.000 claims description 8
- 230000017858 demethylation Effects 0.000 claims description 7
- 238000010520 demethylation reaction Methods 0.000 claims description 7
- 239000003960 organic solvent Substances 0.000 claims description 7
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 claims description 6
- 150000001204 N-oxides Chemical class 0.000 claims description 6
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 6
- 125000002373 5 membered heterocyclic group Chemical group 0.000 claims description 5
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims description 5
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 125000002541 furyl group Chemical group 0.000 claims description 5
- 229910052751 metal Inorganic materials 0.000 claims description 5
- 239000002184 metal Substances 0.000 claims description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 5
- 125000001715 oxadiazolyl group Chemical group 0.000 claims description 5
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 5
- 125000002098 pyridazinyl group Chemical group 0.000 claims description 5
- 125000004076 pyridyl group Chemical group 0.000 claims description 5
- YPNVIBVEFVRZPJ-UHFFFAOYSA-L silver sulfate Chemical compound [Ag+].[Ag+].[O-]S([O-])(=O)=O YPNVIBVEFVRZPJ-UHFFFAOYSA-L 0.000 claims description 5
- 229910000367 silver sulfate Inorganic materials 0.000 claims description 5
- 239000001632 sodium acetate Substances 0.000 claims description 5
- 235000017281 sodium acetate Nutrition 0.000 claims description 5
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 5
- 125000000335 thiazolyl group Chemical group 0.000 claims description 5
- 125000001544 thienyl group Chemical group 0.000 claims description 5
- 125000001425 triazolyl group Chemical group 0.000 claims description 5
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 4
- 125000004769 (C1-C4) alkylsulfonyl group Chemical group 0.000 claims description 4
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000005842 heteroatom Chemical group 0.000 claims description 4
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 4
- 239000011707 mineral Substances 0.000 claims description 4
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 4
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- 125000004768 (C1-C4) alkylsulfinyl group Chemical group 0.000 claims description 3
- TZOYXRMEFDYWDQ-UHFFFAOYSA-N 3,4-dihydro-1h-quinolin-2-one Chemical compound C1=CC=C2NC(=O)CCC2=C1 TZOYXRMEFDYWDQ-UHFFFAOYSA-N 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 claims description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 125000002883 imidazolyl group Chemical group 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 239000007800 oxidant agent Substances 0.000 claims description 3
- 159000000000 sodium salts Chemical class 0.000 claims description 3
- VMQMZMRVKUZKQL-UHFFFAOYSA-N Cu+ Chemical compound [Cu+] VMQMZMRVKUZKQL-UHFFFAOYSA-N 0.000 claims description 2
- 125000006615 aromatic heterocyclic group Chemical group 0.000 claims description 2
- 125000001246 bromo group Chemical group Br* 0.000 claims description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 230000026030 halogenation Effects 0.000 claims description 2
- 238000005658 halogenation reaction Methods 0.000 claims description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims description 2
- 125000002950 monocyclic group Chemical group 0.000 claims description 2
- 150000004967 organic peroxy acids Chemical class 0.000 claims description 2
- 150000004965 peroxy acids Chemical class 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 7
- 238000007363 ring formation reaction Methods 0.000 claims 2
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 claims 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- 125000003277 amino group Chemical group 0.000 claims 1
- 230000001335 demethylating effect Effects 0.000 claims 1
- 230000032050 esterification Effects 0.000 claims 1
- 238000005886 esterification reaction Methods 0.000 claims 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims 1
- 230000001590 oxidative effect Effects 0.000 claims 1
- 239000000243 solution Substances 0.000 description 104
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 102
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 99
- 239000000543 intermediate Substances 0.000 description 97
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 90
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 60
- 238000004458 analytical method Methods 0.000 description 59
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 57
- 239000007787 solid Substances 0.000 description 51
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 44
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 42
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 32
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 30
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 29
- 239000000377 silicon dioxide Substances 0.000 description 27
- 229910001868 water Inorganic materials 0.000 description 27
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 26
- 239000000284 extract Substances 0.000 description 23
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 19
- 239000008346 aqueous phase Substances 0.000 description 18
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 18
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical class [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- 239000000047 product Substances 0.000 description 16
- 239000000463 material Substances 0.000 description 15
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 14
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 14
- 238000010438 heat treatment Methods 0.000 description 14
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 14
- 229960000583 acetic acid Drugs 0.000 description 13
- 239000003921 oil Substances 0.000 description 12
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical group [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 11
- 235000005074 zinc chloride Nutrition 0.000 description 11
- KBTKKEMYFUMFSJ-UHFFFAOYSA-N 6-bromo-2-methoxyquinoline Chemical compound C1=C(Br)C=CC2=NC(OC)=CC=C21 KBTKKEMYFUMFSJ-UHFFFAOYSA-N 0.000 description 10
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 10
- 238000001704 evaporation Methods 0.000 description 10
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 9
- 239000011592 zinc chloride Substances 0.000 description 9
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 8
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 8
- 239000000725 suspension Substances 0.000 description 8
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- 241000282472 Canis lupus familiaris Species 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- 238000004587 chromatography analysis Methods 0.000 description 6
- UBJFKNSINUCEAL-UHFFFAOYSA-N lithium;2-methylpropane Chemical compound [Li+].C[C-](C)C UBJFKNSINUCEAL-UHFFFAOYSA-N 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- 238000012360 testing method Methods 0.000 description 6
- ICFYDVQIOHUFBH-UHFFFAOYSA-N 6-bromo-2-methoxyquinoline-3-carbonitrile Chemical compound C1=C(Br)C=C2C=C(C#N)C(OC)=NC2=C1 ICFYDVQIOHUFBH-UHFFFAOYSA-N 0.000 description 5
- ZGTMUACCHSMWAC-UHFFFAOYSA-L EDTA disodium salt (anhydrous) Chemical compound [Na+].[Na+].OC(=O)CN(CC([O-])=O)CCN(CC(O)=O)CC([O-])=O ZGTMUACCHSMWAC-UHFFFAOYSA-L 0.000 description 5
- 230000008602 contraction Effects 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 230000002861 ventricular Effects 0.000 description 5
- LKKOTNANHGDBLV-UHFFFAOYSA-N 2-methoxyquinoline-6-carboxamide Chemical compound C1=C(C(N)=O)C=CC2=NC(OC)=CC=C21 LKKOTNANHGDBLV-UHFFFAOYSA-N 0.000 description 4
- QIVQFJMYODEUNM-UHFFFAOYSA-N 2-methoxyquinoline-6-carboxylic acid Chemical compound C1=C(C(O)=O)C=CC2=NC(OC)=CC=C21 QIVQFJMYODEUNM-UHFFFAOYSA-N 0.000 description 4
- SYGLDUUIMYLBGH-UHFFFAOYSA-N 6-bromo-2-oxo-1h-quinoline-3-carbonitrile Chemical compound N1C(=O)C(C#N)=CC2=CC(Br)=CC=C21 SYGLDUUIMYLBGH-UHFFFAOYSA-N 0.000 description 4
- HRQARRHZNIORQE-UHFFFAOYSA-N 6-iodo-1h-quinolin-2-one Chemical compound N1C(=O)C=CC2=CC(I)=CC=C21 HRQARRHZNIORQE-UHFFFAOYSA-N 0.000 description 4
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 235000011114 ammonium hydroxide Nutrition 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 4
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 4
- 239000010779 crude oil Substances 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- 150000002431 hydrogen Chemical class 0.000 description 4
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 4
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 4
- 150000007660 quinolones Chemical class 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- QSHYKMOLPBKEKQ-UHFFFAOYSA-N (2-amino-5-iodophenyl)methanol Chemical compound NC1=CC=C(I)C=C1CO QSHYKMOLPBKEKQ-UHFFFAOYSA-N 0.000 description 3
- MCTWTZJPVLRJOU-UHFFFAOYSA-N 1-methyl-1H-imidazole Chemical compound CN1C=CN=C1 MCTWTZJPVLRJOU-UHFFFAOYSA-N 0.000 description 3
- TXABUHLZTXEVNP-UHFFFAOYSA-N 2-amino-5-iodobenzaldehyde Chemical compound NC1=CC=C(I)C=C1C=O TXABUHLZTXEVNP-UHFFFAOYSA-N 0.000 description 3
- KJWQQJOABCMNPD-UHFFFAOYSA-N 2-methoxy-6-pyridin-3-ylquinoline Chemical compound C1=CC2=NC(OC)=CC=C2C=C1C1=CC=CN=C1 KJWQQJOABCMNPD-UHFFFAOYSA-N 0.000 description 3
- FYHRFFZLPUDBQQ-UHFFFAOYSA-N 2-methoxyquinoline-6-carbonitrile Chemical compound C1=C(C#N)C=CC2=NC(OC)=CC=C21 FYHRFFZLPUDBQQ-UHFFFAOYSA-N 0.000 description 3
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 3
- XIXPNXNVNWBPEL-UHFFFAOYSA-N 6-(2,6-dimethylpyridin-3-yl)-8-methyl-1h-quinolin-2-one Chemical compound CC1=NC(C)=CC=C1C1=CC(C)=C(NC(=O)C=C2)C2=C1 XIXPNXNVNWBPEL-UHFFFAOYSA-N 0.000 description 3
- FFAIUVQNAJQHTR-UHFFFAOYSA-N 6-bromo-2-chloroquinoline-3-carbonitrile Chemical compound C1=C(Br)C=C2C=C(C#N)C(Cl)=NC2=C1 FFAIUVQNAJQHTR-UHFFFAOYSA-N 0.000 description 3
- IKAVUUPTFNVPJQ-UHFFFAOYSA-N 6-bromo-2-methoxy-8-methylquinoline Chemical compound C1=C(Br)C=C(C)C2=NC(OC)=CC=C21 IKAVUUPTFNVPJQ-UHFFFAOYSA-N 0.000 description 3
- HRDONPIKXJKBQC-UHFFFAOYSA-N 6-bromo-4-methyl-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=C(Br)C=C2C(C)CC(=O)NC2=C1 HRDONPIKXJKBQC-UHFFFAOYSA-N 0.000 description 3
- NAWJUZKNHPSKDJ-UHFFFAOYSA-N 6-pyridin-3-yl-1h-quinolin-2-one Chemical compound C=1C=C2NC(=O)C=CC2=CC=1C1=CC=CN=C1 NAWJUZKNHPSKDJ-UHFFFAOYSA-N 0.000 description 3
- RKFONCZIJDCAIR-UHFFFAOYSA-N 8-bromo-6-(2,6-dimethylpyridin-3-yl)-1h-quinolin-2-one Chemical compound CC1=NC(C)=CC=C1C1=CC(Br)=C(NC(=O)C=C2)C2=C1 RKFONCZIJDCAIR-UHFFFAOYSA-N 0.000 description 3
- KNFMHTSIOZRZKU-UHFFFAOYSA-N 8-methyl-6-pyridin-3-yl-1h-quinolin-2-one Chemical compound C=1C=2C=CC(=O)NC=2C(C)=CC=1C1=CC=CN=C1 KNFMHTSIOZRZKU-UHFFFAOYSA-N 0.000 description 3
- 206010019280 Heart failures Diseases 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- UREBWPXBXRYXRJ-UHFFFAOYSA-N ethyl acetate;methanol Chemical compound OC.CCOC(C)=O UREBWPXBXRYXRJ-UHFFFAOYSA-N 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 238000001990 intravenous administration Methods 0.000 description 3
- 230000001057 ionotropic effect Effects 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 229910052749 magnesium Inorganic materials 0.000 description 3
- GACUMWICVHTQMC-UHFFFAOYSA-N methyl 6-bromo-2-chloroquinoline-3-carboxylate Chemical compound BrC1=CC=C2N=C(Cl)C(C(=O)OC)=CC2=C1 GACUMWICVHTQMC-UHFFFAOYSA-N 0.000 description 3
- 230000002107 myocardial effect Effects 0.000 description 3
- 230000037361 pathway Effects 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 230000004936 stimulating effect Effects 0.000 description 3
- 238000011282 treatment Methods 0.000 description 3
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 2
- SFMFACMIOWQIPR-ONEGZZNKSA-N (e)-3-ethoxyprop-2-enoyl chloride Chemical compound CCO\C=C\C(Cl)=O SFMFACMIOWQIPR-ONEGZZNKSA-N 0.000 description 2
- XVCAAXRIKPVUNC-VOTSOKGWSA-N (e)-n-(4-bromo-2-methylphenyl)-3-ethoxyprop-2-enamide Chemical compound CCO\C=C\C(=O)NC1=CC=C(Br)C=C1C XVCAAXRIKPVUNC-VOTSOKGWSA-N 0.000 description 2
- UYXKSJRBCLSBNE-UHFFFAOYSA-N 1-(4-phenyldiazenylphenyl)ethanone Chemical compound C1=CC(C(=O)C)=CC=C1N=NC1=CC=CC=C1 UYXKSJRBCLSBNE-UHFFFAOYSA-N 0.000 description 2
- MLPVBIWIRCKMJV-UHFFFAOYSA-N 2-ethylaniline Chemical compound CCC1=CC=CC=C1N MLPVBIWIRCKMJV-UHFFFAOYSA-N 0.000 description 2
- CHSTWXUUBLSURL-UHFFFAOYSA-N 2-methoxy-6-(1-methylimidazol-2-yl)quinoline Chemical compound C1=CC2=NC(OC)=CC=C2C=C1C1=NC=CN1C CHSTWXUUBLSURL-UHFFFAOYSA-N 0.000 description 2
- HHNZPDZTAWBMQB-UHFFFAOYSA-N 2-methoxy-6-pyrazin-2-ylquinoline Chemical compound C1=CC2=NC(OC)=CC=C2C=C1C1=CN=CC=N1 HHNZPDZTAWBMQB-UHFFFAOYSA-N 0.000 description 2
- IWCDOKQSPLUGHR-UHFFFAOYSA-N 2-methoxy-6-pyrimidin-4-ylquinoline Chemical compound C1=CC2=NC(OC)=CC=C2C=C1C1=CC=NC=N1 IWCDOKQSPLUGHR-UHFFFAOYSA-N 0.000 description 2
- NBTUFSKKFBXPCM-UHFFFAOYSA-N 2-methoxy-8-methyl-6-(1-methylimidazol-2-yl)quinoline Chemical compound C1=C(C)C2=NC(OC)=CC=C2C=C1C1=NC=CN1C NBTUFSKKFBXPCM-UHFFFAOYSA-N 0.000 description 2
- GOEXAWWCXCKZEA-UHFFFAOYSA-N 2-methoxy-8-methyl-6-pyridin-3-ylquinoline Chemical compound C1=C(C)C2=NC(OC)=CC=C2C=C1C1=CC=CN=C1 GOEXAWWCXCKZEA-UHFFFAOYSA-N 0.000 description 2
- ZTQNUTNKGQGWCM-UHFFFAOYSA-N 2-methoxyquinoline Chemical compound C1=CC=CC2=NC(OC)=CC=C21 ZTQNUTNKGQGWCM-UHFFFAOYSA-N 0.000 description 2
- GBYBGAWQZRGALL-UHFFFAOYSA-N 3-bromo-6-pyridin-3-yl-1h-quinolin-2-one Chemical compound C=1C=C2NC(=O)C(Br)=CC2=CC=1C1=CC=CN=C1 GBYBGAWQZRGALL-UHFFFAOYSA-N 0.000 description 2
- NYPYPOZNGOXYSU-UHFFFAOYSA-N 3-bromopyridine Chemical compound BrC1=CC=CN=C1 NYPYPOZNGOXYSU-UHFFFAOYSA-N 0.000 description 2
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 2
- PCHYYOCUCGCSBU-UHFFFAOYSA-N 4-bromo-2-methylaniline Chemical compound CC1=CC(Br)=CC=C1N PCHYYOCUCGCSBU-UHFFFAOYSA-N 0.000 description 2
- WLOFXSNCVREIRC-UHFFFAOYSA-N 5-(2-methoxyquinolin-6-yl)-1,2,4-oxadiazole Chemical compound C1=CC2=NC(OC)=CC=C2C=C1C1=NC=NO1 WLOFXSNCVREIRC-UHFFFAOYSA-N 0.000 description 2
- QPLRCIKWDUXCIJ-UHFFFAOYSA-N 6-(1-butyltetrazol-5-yl)-2-methoxyquinoline Chemical compound CCCCN1N=NN=C1C1=CC=C(N=C(OC)C=C2)C2=C1 QPLRCIKWDUXCIJ-UHFFFAOYSA-N 0.000 description 2
- MJGFMTWJOLMFHG-UHFFFAOYSA-N 6-(2,6-dimethylpyridin-3-yl)-2-methoxy-8-methylquinoline Chemical compound C1=C(C)C2=NC(OC)=CC=C2C=C1C1=CC=C(C)N=C1C MJGFMTWJOLMFHG-UHFFFAOYSA-N 0.000 description 2
- UQQYRNXMFCTOOQ-UHFFFAOYSA-N 6-(2,6-dimethylpyridin-3-yl)-8-methyl-3,4-dihydro-1h-quinolin-2-one Chemical compound CC1=NC(C)=CC=C1C1=CC(C)=C(NC(=O)CC2)C2=C1 UQQYRNXMFCTOOQ-UHFFFAOYSA-N 0.000 description 2
- QHFFCVBMDJFGDX-UHFFFAOYSA-N 6-(6-methoxypyridin-3-yl)-1h-quinolin-2-one Chemical compound C1=NC(OC)=CC=C1C1=CC=C(NC(=O)C=C2)C2=C1 QHFFCVBMDJFGDX-UHFFFAOYSA-N 0.000 description 2
- YLAFBGATSQRSTB-UHFFFAOYSA-N 6-bromo-1h-quinolin-2-one Chemical class N1C(=O)C=CC2=CC(Br)=CC=C21 YLAFBGATSQRSTB-UHFFFAOYSA-N 0.000 description 2
- TUIZVCPHHDYUBB-UHFFFAOYSA-N 6-bromo-2-chloro-4,8-dimethylquinoline Chemical compound C1=C(Br)C=C2C(C)=CC(Cl)=NC2=C1C TUIZVCPHHDYUBB-UHFFFAOYSA-N 0.000 description 2
- FCWVVYZNPYLTNJ-UHFFFAOYSA-N 6-bromo-2-chloro-8-methylquinoline Chemical compound C1=C(Cl)N=C2C(C)=CC(Br)=CC2=C1 FCWVVYZNPYLTNJ-UHFFFAOYSA-N 0.000 description 2
- MQWZSSIUHXNNTM-UHFFFAOYSA-N 6-bromo-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=CC(Br)=CC=C21 MQWZSSIUHXNNTM-UHFFFAOYSA-N 0.000 description 2
- PSQCYNBBHLNTDR-UHFFFAOYSA-N 6-bromo-4,8-dimethyl-1h-quinolin-2-one Chemical compound CC1=CC(=O)NC2=C1C=C(Br)C=C2C PSQCYNBBHLNTDR-UHFFFAOYSA-N 0.000 description 2
- NRTSKZZQWFZTTG-UHFFFAOYSA-N 6-bromo-8-methyl-1h-quinolin-2-one Chemical compound C1=CC(=O)NC2=C1C=C(Br)C=C2C NRTSKZZQWFZTTG-UHFFFAOYSA-N 0.000 description 2
- NOTSUCDQSBRXBY-UHFFFAOYSA-N 6-iodo-3-nitro-1h-quinolin-2-one Chemical compound IC1=CC=C2NC(=O)C([N+](=O)[O-])=CC2=C1 NOTSUCDQSBRXBY-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- NMSDVNPLUFZNGH-UHFFFAOYSA-N 8-bromo-6-(2-methyl-1,2,4-triazol-3-yl)-1h-quinolin-2-one Chemical compound CN1N=CN=C1C1=CC(Br)=C(NC(=O)C=C2)C2=C1 NMSDVNPLUFZNGH-UHFFFAOYSA-N 0.000 description 2
- IMTCJUNMHSJUPH-UHFFFAOYSA-N 8-methylsulfonyl-6-(2-methyl-1,2,4-triazol-3-yl)-1h-quinolin-2-one Chemical compound CN1N=CN=C1C1=CC(S(C)(=O)=O)=C(NC(=O)C=C2)C2=C1 IMTCJUNMHSJUPH-UHFFFAOYSA-N 0.000 description 2
- 206010007559 Cardiac failure congestive Diseases 0.000 description 2
- 239000007818 Grignard reagent Substances 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- ZSXGLVDWWRXATF-UHFFFAOYSA-N N,N-dimethylformamide dimethyl acetal Chemical compound COC(OC)N(C)C ZSXGLVDWWRXATF-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical group CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 229930040373 Paraformaldehyde Natural products 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 241000287181 Sturnus vulgaris Species 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 210000001715 carotid artery Anatomy 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 239000002026 chloroform extract Substances 0.000 description 2
- 238000009109 curative therapy Methods 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 2
- 230000000297 inotrophic effect Effects 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 150000002641 lithium Chemical class 0.000 description 2
- RIPMIWXYTJZOMC-UHFFFAOYSA-N methyl 2-oxo-6-pyridin-3-yl-1h-quinoline-3-carboxylate Chemical compound C=1C=C2NC(=O)C(C(=O)OC)=CC2=CC=1C1=CC=CN=C1 RIPMIWXYTJZOMC-UHFFFAOYSA-N 0.000 description 2
- NBPMCLFNOOOSPQ-UHFFFAOYSA-N methyl 6-bromo-2-methoxyquinoline-3-carboxylate Chemical compound BrC1=CC=C2N=C(OC)C(C(=O)OC)=CC2=C1 NBPMCLFNOOOSPQ-UHFFFAOYSA-N 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- LWJIFNULDBNYCR-UHFFFAOYSA-N n-(4-bromo-2-methylphenyl)-3-oxobutanamide Chemical compound CC(=O)CC(=O)NC1=CC=C(Br)C=C1C LWJIFNULDBNYCR-UHFFFAOYSA-N 0.000 description 2
- BMNDJWSIKZECMH-UHFFFAOYSA-N nitrosyl bromide Chemical compound BrN=O BMNDJWSIKZECMH-UHFFFAOYSA-N 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 229920002866 paraformaldehyde Polymers 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 238000011321 prophylaxis Methods 0.000 description 2
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- RMBAVIFYHOYIFM-UHFFFAOYSA-M sodium methanethiolate Chemical compound [Na+].[S-]C RMBAVIFYHOYIFM-UHFFFAOYSA-M 0.000 description 2
- 239000011343 solid material Substances 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- 238000000859 sublimation Methods 0.000 description 2
- 230000008022 sublimation Effects 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- FWPIDFUJEMBDLS-UHFFFAOYSA-L tin(II) chloride dihydrate Chemical compound O.O.Cl[Sn]Cl FWPIDFUJEMBDLS-UHFFFAOYSA-L 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- JKVRTUCVPZTEQZ-UHFFFAOYSA-N tributyltin azide Chemical compound CCCC[Sn](CCCC)(CCCC)N=[N+]=[N-] JKVRTUCVPZTEQZ-UHFFFAOYSA-N 0.000 description 2
- NDJWVRYQEOSLHA-BQYQJAHWSA-N (e)-3-ethoxy-n-(4-iodo-2-propan-2-ylphenyl)prop-2-enamide Chemical compound CCO\C=C\C(=O)NC1=CC=C(I)C=C1C(C)C NDJWVRYQEOSLHA-BQYQJAHWSA-N 0.000 description 1
- NCEUTPRVLLTWLZ-BQYQJAHWSA-N (e)-3-ethoxy-n-(4-iodophenyl)prop-2-enamide Chemical compound CCO\C=C\C(=O)NC1=CC=C(I)C=C1 NCEUTPRVLLTWLZ-BQYQJAHWSA-N 0.000 description 1
- RXHKLTLXXIWULZ-VOTSOKGWSA-N (e)-n-(3-bromophenyl)-3-ethoxyprop-2-enamide Chemical compound CCO\C=C\C(=O)NC1=CC=CC(Br)=C1 RXHKLTLXXIWULZ-VOTSOKGWSA-N 0.000 description 1
- VRHQWDHZUUSJGP-VOTSOKGWSA-N (e)-n-(4-bromo-2-methoxyphenyl)-3-ethoxyprop-2-enamide Chemical compound CCO\C=C\C(=O)NC1=CC=C(Br)C=C1OC VRHQWDHZUUSJGP-VOTSOKGWSA-N 0.000 description 1
- HGROIZRECHQULG-VOTSOKGWSA-N (e)-n-(4-bromo-3-methylphenyl)-3-ethoxyprop-2-enamide Chemical compound CCO\C=C\C(=O)NC1=CC=C(Br)C(C)=C1 HGROIZRECHQULG-VOTSOKGWSA-N 0.000 description 1
- 125000001414 1,2,4-triazol-5-yl group Chemical group [H]N1N=C([H])N=C1[*] 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- FMVLRESYIWVOKU-UHFFFAOYSA-N 1-methyl-6-pyridin-3-ylquinolin-2-one Chemical compound C1=C2C=CC(=O)N(C)C2=CC=C1C1=CC=CN=C1 FMVLRESYIWVOKU-UHFFFAOYSA-N 0.000 description 1
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- YKOLZVXSPGIIBJ-UHFFFAOYSA-N 2-Isopropylaniline Chemical compound CC(C)C1=CC=CC=C1N YKOLZVXSPGIIBJ-UHFFFAOYSA-N 0.000 description 1
- IMRWILPUOVGIMU-UHFFFAOYSA-N 2-bromopyridine Chemical compound BrC1=CC=CC=N1 IMRWILPUOVGIMU-UHFFFAOYSA-N 0.000 description 1
- 150000005642 2-chloroquinolines Chemical class 0.000 description 1
- PLKZGDYLTZBAEH-UHFFFAOYSA-N 2-ethyl-4-iodoaniline Chemical compound CCC1=CC(I)=CC=C1N PLKZGDYLTZBAEH-UHFFFAOYSA-N 0.000 description 1
- CIUHERBMNJLPRS-UHFFFAOYSA-N 2-methoxy-4,8-dimethyl-6-(2-methyl-1,2,4-triazol-3-yl)quinoline Chemical compound C1=C(C)C2=NC(OC)=CC(C)=C2C=C1C1=NC=NN1C CIUHERBMNJLPRS-UHFFFAOYSA-N 0.000 description 1
- BQFLOSZTNCBPMX-UHFFFAOYSA-N 2-methoxy-6-(1h-1,2,4-triazol-5-yl)quinoline Chemical compound C1=CC2=NC(OC)=CC=C2C=C1C1=NC=NN1 BQFLOSZTNCBPMX-UHFFFAOYSA-N 0.000 description 1
- JPNYADRUAXSHCD-UHFFFAOYSA-N 2-methoxy-6-pyridazin-3-ylquinoline Chemical compound C1=CC2=NC(OC)=CC=C2C=C1C1=CC=CN=N1 JPNYADRUAXSHCD-UHFFFAOYSA-N 0.000 description 1
- BHQBCQVFQKCIHC-UHFFFAOYSA-N 2-methoxy-6-pyridazin-4-ylquinoline Chemical compound C1=CC2=NC(OC)=CC=C2C=C1C1=CC=NN=C1 BHQBCQVFQKCIHC-UHFFFAOYSA-N 0.000 description 1
- WNRMLIGSXULUPQ-UHFFFAOYSA-N 2-oxo-1h-quinoline-3-carbonitrile Chemical compound C1=CC=C2C=C(C#N)C(=O)NC2=C1 WNRMLIGSXULUPQ-UHFFFAOYSA-N 0.000 description 1
- QPDXTWRVRZGSEB-UHFFFAOYSA-N 3-amino-6-pyridin-3-yl-1h-quinolin-2-one Chemical compound C=1C=C2NC(=O)C(N)=CC2=CC=1C1=CC=CN=C1 QPDXTWRVRZGSEB-UHFFFAOYSA-N 0.000 description 1
- TUJVGHCSNXCAFE-UHFFFAOYSA-N 3-bromo-2,6-dimethylpyridine Chemical compound CC1=CC=C(Br)C(C)=N1 TUJVGHCSNXCAFE-UHFFFAOYSA-N 0.000 description 1
- JMMMQHDFFZCZOS-UHFFFAOYSA-N 3-ethoxyprop-2-enamide Chemical compound CCOC=CC(N)=O JMMMQHDFFZCZOS-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- WRFYIYOXJWKONR-UHFFFAOYSA-N 4-bromo-2-methoxyaniline Chemical compound COC1=CC(Br)=CC=C1N WRFYIYOXJWKONR-UHFFFAOYSA-N 0.000 description 1
- DWQGELZWNCZPIP-UHFFFAOYSA-N 4-iodo-2-propan-2-ylaniline Chemical compound CC(C)C1=CC(I)=CC=C1N DWQGELZWNCZPIP-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- XLNXYWXWOLFEOD-UHFFFAOYSA-N 5-bromo-1h-quinolin-2-one Chemical compound N1C(=O)C=CC2=C1C=CC=C2Br XLNXYWXWOLFEOD-UHFFFAOYSA-N 0.000 description 1
- XADICJHFELMBGX-UHFFFAOYSA-N 5-bromo-2-methoxypyridine Chemical compound COC1=CC=C(Br)C=N1 XADICJHFELMBGX-UHFFFAOYSA-N 0.000 description 1
- QURLGTQPBWYCAJ-UHFFFAOYSA-N 6-(2,6-dimethylpyridin-3-yl)-4,8-dimethyl-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=C2C(C)CC(=O)NC2=C(C)C=C1C1=CC=C(C)N=C1C QURLGTQPBWYCAJ-UHFFFAOYSA-N 0.000 description 1
- FPCWTFOXEZJKFF-UHFFFAOYSA-N 6-(2,6-dimethylpyridin-3-yl)-8-hydroxy-1h-quinolin-2-one Chemical compound CC1=NC(C)=CC=C1C1=CC(O)=C(NC(=O)C=C2)C2=C1 FPCWTFOXEZJKFF-UHFFFAOYSA-N 0.000 description 1
- DZPXCJITMBBZRP-UHFFFAOYSA-N 6-(2,6-dimethylpyridin-3-yl)-8-hydroxy-3,4-dihydro-1h-quinolin-2-one Chemical compound CC1=NC(C)=CC=C1C1=CC(O)=C(NC(=O)CC2)C2=C1 DZPXCJITMBBZRP-UHFFFAOYSA-N 0.000 description 1
- NUYKCVKRBITRPW-UHFFFAOYSA-N 6-(2,6-dimethylpyridin-3-yl)-8-methoxy-3,4-dihydro-1h-quinolin-2-one Chemical compound C=1C=2CCC(=O)NC=2C(OC)=CC=1C1=CC=C(C)N=C1C NUYKCVKRBITRPW-UHFFFAOYSA-N 0.000 description 1
- IYLGYXOIHNQKNV-UHFFFAOYSA-N 6-(2-methyl-1,2,4-triazol-3-yl)-3,4-dihydro-1h-quinolin-2-one Chemical compound CN1N=CN=C1C1=CC=C(NC(=O)CC2)C2=C1 IYLGYXOIHNQKNV-UHFFFAOYSA-N 0.000 description 1
- GVCUTTDHMOQCBK-UHFFFAOYSA-N 6-(2h-tetrazol-5-yl)-1h-quinolin-2-one Chemical compound C=1C=C2NC(=O)C=CC2=CC=1C1=NN=NN1 GVCUTTDHMOQCBK-UHFFFAOYSA-N 0.000 description 1
- YXRDWUJAJLDABJ-UHFFFAOYSA-N 6-bromo-2-chloroquinoline Chemical compound C1=C(Br)C=CC2=NC(Cl)=CC=C21 YXRDWUJAJLDABJ-UHFFFAOYSA-N 0.000 description 1
- AIKOHOJIIKVWSP-UHFFFAOYSA-N 6-bromo-2-methoxy-4,8-dimethylquinoline Chemical compound C1=C(Br)C=C(C)C2=NC(OC)=CC(C)=C21 AIKOHOJIIKVWSP-UHFFFAOYSA-N 0.000 description 1
- WHTMUKMEYXFSSM-UHFFFAOYSA-N 6-bromo-5-methyl-1h-quinolin-2-one Chemical compound N1C(=O)C=CC2=C1C=CC(Br)=C2C WHTMUKMEYXFSSM-UHFFFAOYSA-N 0.000 description 1
- QGUBXHGQAGOSJB-UHFFFAOYSA-N 6-bromo-7-methyl-1h-quinolin-2-one Chemical compound N1C(=O)C=CC2=C1C=C(C)C(Br)=C2 QGUBXHGQAGOSJB-UHFFFAOYSA-N 0.000 description 1
- UFEZXECGOCKZIJ-UHFFFAOYSA-N 6-bromo-8-methoxy-1h-quinolin-2-one Chemical compound C1=CC(=O)NC2=C1C=C(Br)C=C2OC UFEZXECGOCKZIJ-UHFFFAOYSA-N 0.000 description 1
- GFZXSOINKWWSDP-UHFFFAOYSA-N 6-iodo-2-methoxyquinoline Chemical class C1=C(I)C=CC2=NC(OC)=CC=C21 GFZXSOINKWWSDP-UHFFFAOYSA-N 0.000 description 1
- OCTJZCJMXIWXLA-UHFFFAOYSA-N 6-iodo-8-propan-2-yl-1h-quinolin-2-one Chemical compound C1=CC(=O)NC2=C1C=C(I)C=C2C(C)C OCTJZCJMXIWXLA-UHFFFAOYSA-N 0.000 description 1
- WDYVUKGVKRZQNM-UHFFFAOYSA-N 6-phosphonohexylphosphonic acid Chemical compound OP(O)(=O)CCCCCCP(O)(O)=O WDYVUKGVKRZQNM-UHFFFAOYSA-N 0.000 description 1
- QOFKBVYWLUKWLL-UHFFFAOYSA-N 7-bromo-1h-quinolin-2-one Chemical compound C1=CC(=O)NC2=CC(Br)=CC=C21 QOFKBVYWLUKWLL-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- WYYCEUGGRHVWJR-UHFFFAOYSA-N 8-bromo-6-(2,6-dimethylpyridin-3-yl)-3,4-dihydro-1h-quinolin-2-one Chemical compound CC1=NC(C)=CC=C1C1=CC(Br)=C(NC(=O)CC2)C2=C1 WYYCEUGGRHVWJR-UHFFFAOYSA-N 0.000 description 1
- BFVFKDPKXFAMTC-UHFFFAOYSA-N 8-ethyl-6-iodo-1h-quinolin-2-one Chemical compound C1=CC(=O)NC2=C1C=C(I)C=C2CC BFVFKDPKXFAMTC-UHFFFAOYSA-N 0.000 description 1
- TWGKVMUUSPGONU-UHFFFAOYSA-N 8-hydroxy-6-(2-methyl-1,2,4-triazol-3-yl)-1h-quinolin-2-one Chemical compound CN1N=CN=C1C1=CC(O)=C(NC(=O)C=C2)C2=C1 TWGKVMUUSPGONU-UHFFFAOYSA-N 0.000 description 1
- QIDILRNSJWVZKQ-UHFFFAOYSA-N 8-methoxy-6-(2-methyl-1,2,4-triazol-3-yl)-1h-quinolin-2-one Chemical compound C=1C=2C=CC(=O)NC=2C(OC)=CC=1C1=NC=NN1C QIDILRNSJWVZKQ-UHFFFAOYSA-N 0.000 description 1
- IWQREIGFDRHFAI-UHFFFAOYSA-N 8-methylsulfinyl-6-(2-methyl-1,2,4-triazol-3-yl)-1h-quinolin-2-one Chemical compound CN1N=CN=C1C1=CC(S(C)=O)=C(NC(=O)C=C2)C2=C1 IWQREIGFDRHFAI-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical class NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- 229910014265 BrCl Inorganic materials 0.000 description 1
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 1
- 206010007556 Cardiac failure acute Diseases 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- RGHNJXZEOKUKBD-SQOUGZDYSA-M D-gluconate Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O RGHNJXZEOKUKBD-SQOUGZDYSA-M 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- IYFCZALHGYMIIU-UHFFFAOYSA-N Glycophymoline Chemical compound N=1C2=CC=CC=C2C(OC)=NC=1CC1=CC=CC=C1 IYFCZALHGYMIIU-UHFFFAOYSA-N 0.000 description 1
- QZRGKCOWNLSUDK-UHFFFAOYSA-N Iodochlorine Chemical compound ICl QZRGKCOWNLSUDK-UHFFFAOYSA-N 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical class [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 238000007126 N-alkylation reaction Methods 0.000 description 1
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N N-phenyl amine Natural products NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 1
- OTKCOKWMDSPKIB-UHFFFAOYSA-N N1=C(OC)C=CC2=CC([Li])=CC=C21 Chemical compound N1=C(OC)C=CC2=CC([Li])=CC=C21 OTKCOKWMDSPKIB-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-L Phosphate ion(2-) Chemical compound OP([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-L 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- YXUVQQDLYINJIN-UHFFFAOYSA-M [Cl-].CC1=NC(=CC=C1[Zn+])C Chemical compound [Cl-].CC1=NC(=CC=C1[Zn+])C YXUVQQDLYINJIN-UHFFFAOYSA-M 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 150000001356 alkyl thiols Chemical class 0.000 description 1
- 229910021529 ammonia Chemical class 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- CODNYICXDISAEA-UHFFFAOYSA-N bromine monochloride Chemical compound BrCl CODNYICXDISAEA-UHFFFAOYSA-N 0.000 description 1
- KMGBZBJJOKUPIA-UHFFFAOYSA-N butyl iodide Chemical compound CCCCI KMGBZBJJOKUPIA-UHFFFAOYSA-N 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- WGXZDYPGLJYBJW-UHFFFAOYSA-N chloroform;propan-2-ol Chemical compound CC(C)O.ClC(Cl)Cl WGXZDYPGLJYBJW-UHFFFAOYSA-N 0.000 description 1
- 229940001468 citrate Drugs 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- GBRBMTNGQBKBQE-UHFFFAOYSA-L copper;diiodide Chemical compound I[Cu]I GBRBMTNGQBKBQE-UHFFFAOYSA-L 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 238000007269 dehydrobromination reaction Methods 0.000 description 1
- WASQWSOJHCZDFK-UHFFFAOYSA-N diketene Chemical compound C=C1CC(=O)O1 WASQWSOJHCZDFK-UHFFFAOYSA-N 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000003683 electrophilic halogenation reaction Methods 0.000 description 1
- FTKASJMIPSSXBP-UHFFFAOYSA-N ethyl 2-nitroacetate Chemical compound CCOC(=O)C[N+]([O-])=O FTKASJMIPSSXBP-UHFFFAOYSA-N 0.000 description 1
- POZIHPKRJFLANV-UHFFFAOYSA-N ethyl 2-oxo-1h-quinoline-3-carboxylate Chemical compound C1=CC=C2NC(=O)C(C(=O)OCC)=CC2=C1 POZIHPKRJFLANV-UHFFFAOYSA-N 0.000 description 1
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 229940050411 fumarate Drugs 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229940050410 gluconate Drugs 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 208000019622 heart disease Diseases 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- QWXYZCJEXYQNEI-OSZHWHEXSA-N intermediate I Chemical compound COC(=O)[C@@]1(C=O)[C@H]2CC=[N+](C\C2=C\C)CCc2c1[nH]c1ccccc21 QWXYZCJEXYQNEI-OSZHWHEXSA-N 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 125000000842 isoxazolyl group Chemical group 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 229940001447 lactate Drugs 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical class [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 235000011147 magnesium chloride Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- NNXVARLKWUFGGG-UHFFFAOYSA-N methyl 2-amino-5-iodobenzoate Chemical compound COC(=O)C1=CC(I)=CC=C1N NNXVARLKWUFGGG-UHFFFAOYSA-N 0.000 description 1
- RQNJXHDWGWWSKJ-UHFFFAOYSA-N methyl 2-methoxy-6-pyridin-3-ylquinoline-3-carboxylate Chemical compound C=1C=C2N=C(OC)C(C(=O)OC)=CC2=CC=1C1=CC=CN=C1 RQNJXHDWGWWSKJ-UHFFFAOYSA-N 0.000 description 1
- QEQDEWUHEODSCF-UHFFFAOYSA-N methyl 2-oxo-6-pyridin-4-yl-1h-quinoline-3-carboxylate Chemical compound C=1C=C2NC(=O)C(C(=O)OC)=CC2=CC=1C1=CC=NC=C1 QEQDEWUHEODSCF-UHFFFAOYSA-N 0.000 description 1
- HDZGCSFEDULWCS-UHFFFAOYSA-N monomethylhydrazine Chemical compound CNN HDZGCSFEDULWCS-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 1
- 229940078552 o-xylene Drugs 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 150000002902 organometallic compounds Chemical class 0.000 description 1
- 125000002971 oxazolyl group Chemical group 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- LXNAVEXFUKBNMK-UHFFFAOYSA-N palladium(II) acetate Substances [Pd].CC(O)=O.CC(O)=O LXNAVEXFUKBNMK-UHFFFAOYSA-N 0.000 description 1
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 1
- XMVJITFPVVRMHC-UHFFFAOYSA-N roxarsone Chemical group OC1=CC=C([As](O)(O)=O)C=C1[N+]([O-])=O XMVJITFPVVRMHC-UHFFFAOYSA-N 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000000021 stimulant Substances 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- WHRNULOCNSKMGB-UHFFFAOYSA-N tetrahydrofuran thf Chemical compound C1CCOC1.C1CCOC1 WHRNULOCNSKMGB-UHFFFAOYSA-N 0.000 description 1
- 125000000101 thioether group Chemical group 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical class CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- PIILXFBHQILWPS-UHFFFAOYSA-N tributyltin Chemical group CCCC[Sn](CCCC)CCCC PIILXFBHQILWPS-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 208000019553 vascular disease Diseases 0.000 description 1
- STORJTFYFWTIFQ-UHFFFAOYSA-M zinc;2h-pyridin-2-ide;chloride Chemical compound [Zn+]Cl.C1=CC=N[C-]=C1 STORJTFYFWTIFQ-UHFFFAOYSA-M 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/36—Radicals substituted by singly-bound nitrogen atoms
- C07D213/40—Acylated substituent nitrogen atom
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/04—Inotropic agents, i.e. stimulants of cardiac contraction; Drugs for heart failure
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/18—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/22—Oxygen atoms attached in position 2 or 4
- C07D215/227—Oxygen atoms attached in position 2 or 4 only one oxygen atom which is attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/24—Oxygen atoms attached in position 8
- C07D215/26—Alcohols; Ethers thereof
- C07D215/28—Alcohols; Ethers thereof with halogen atoms or nitro radicals in positions 5, 6 or 7
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D215/54—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D407/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00
- C07D407/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00 containing two hetero rings
- C07D407/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having oxygen atoms as the only ring hetero atoms, not provided for by group C07D405/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Cardiology (AREA)
- Hospice & Palliative Care (AREA)
- Heart & Thoracic Surgery (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (2)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
GB838334282A GB8334282D0 (en) | 1983-12-22 | 1983-12-22 | Quinolone inotropic agents |
GB848417340A GB8417340D0 (en) | 1984-07-06 | 1984-07-06 | Quinoline inotropic agents |
Publications (1)
Publication Number | Publication Date |
---|---|
NO845228L true NO845228L (no) | 1985-06-24 |
Family
ID=26287130
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
NO845228A NO845228L (no) | 1983-12-22 | 1984-12-21 | Kinolinforbindelser. |
Country Status (17)
Country | Link |
---|---|
US (1) | US4710507A (el) |
EP (1) | EP0148623A3 (el) |
KR (1) | KR870000911B1 (el) |
AU (1) | AU556494B2 (el) |
CA (1) | CA1253497A (el) |
CS (1) | CS249533B2 (el) |
DK (1) | DK619584A (el) |
ES (1) | ES8603863A1 (el) |
FI (1) | FI845036L (el) |
GR (1) | GR82511B (el) |
HU (1) | HUT36472A (el) |
IL (1) | IL73877A (el) |
NO (1) | NO845228L (el) |
NZ (1) | NZ210670A (el) |
PL (1) | PL144816B1 (el) |
PT (1) | PT79699B (el) |
SU (1) | SU1407397A3 (el) |
Families Citing this family (54)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
CA1292234C (en) * | 1984-05-29 | 1991-11-19 | Simon Fraser Campbell | Heterocyclic-substituted quinolone inotropic agents |
US4567186A (en) * | 1985-01-14 | 1986-01-28 | Sterling Drug Inc. | 5-Heteryl-1,6-naphthyridin-2(1H)-ones, cardiotonic use thereof and intermediates therefor |
NZ214837A (en) * | 1985-01-28 | 1988-10-28 | Sterling Drug Inc | 5-substituted 1,6 naphthyridin-2(1h)-ones |
GB8502267D0 (en) * | 1985-01-30 | 1985-02-27 | Pfizer Ltd | Quinolone inotropic agents |
FR2580646A1 (fr) * | 1985-04-19 | 1986-10-24 | Synthelabo | Derives de 2(1h)-quinolinone, leur preparation et leur application en therapeutique |
GB8516573D0 (en) * | 1985-07-01 | 1985-08-07 | Janssen Pharmaceuticaa Nv | Controlling weeds |
US4666913A (en) * | 1985-11-22 | 1987-05-19 | William H. Rorer, Inc. | Hydroxy and aminothiazolyl-benzodiazinone compounds, cardiotonic compositions including the same, and their uses |
GB8529362D0 (en) * | 1985-11-28 | 1986-01-02 | Pfizer Ltd | Quinolone cardiac stimulants |
US5358949A (en) * | 1986-03-05 | 1994-10-25 | Otsuka Pharmaceutical Co., Ltd. | Carbostyril derivatives and salts thereof and anti-arrhythmic agents containing the carbostyril derivatives |
DK111387A (da) * | 1986-03-05 | 1987-09-06 | Otsuka Pharma Co Ltd | Carbostyrilderivater og salte deraf, laegemiddel indeholdende saadanne derivater samt fremgangsmaade til fremstilling af derivaterne |
US4792561A (en) * | 1986-05-29 | 1988-12-20 | Syntex (U.S.A.) Inc. | Carbostyril derivatives as combined thromboxane synthetase and cyclic-AMP phosphodiesterase inhibitors |
US4921862A (en) * | 1986-05-29 | 1990-05-01 | Syntex (U.S.A.) Inc. | Carbostyril derivatives as combined thromboxane synthetase and cyclic-amp phosphodiesterase inhibitors |
US4785005A (en) * | 1986-06-25 | 1988-11-15 | Rorer Pharmaceutical Corporation | 6-(6-alkylpyridone)-carbostyril compounds and their cardiotonic uses |
GB8619902D0 (en) * | 1986-08-15 | 1986-09-24 | Pfizer Ltd | Quinolone cardiac stimulants |
US4859672A (en) * | 1986-10-29 | 1989-08-22 | Rorer Pharmaceutical Corporation | Pyrido[2,3-d]pyrimidinone and imidazo[4,5-b]pyrimidinone |
US5002944A (en) * | 1986-10-29 | 1991-03-26 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Compounds having cardiotonic activity |
US5166160A (en) * | 1986-12-23 | 1992-11-24 | Burroughs Wellcome Co. | Quinoline compound |
GB8630702D0 (en) * | 1986-12-23 | 1987-02-04 | Wellcome Found | Quinoline compound |
GB8709448D0 (en) * | 1987-04-21 | 1987-05-28 | Pfizer Ltd | Heterobicyclic quinoline derivatives |
DE3935514A1 (de) * | 1989-10-25 | 1991-05-02 | Boehringer Mannheim Gmbh | Neue bicyclo-imidazole, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel |
EP0549729B1 (en) * | 1990-09-07 | 1997-12-17 | Schering Corporation | Antiviral compounds and antihypertensive compounds |
HU207308B (en) * | 1990-11-09 | 1993-03-29 | Richter Gedeon Vegyeszet | Process for producing 1- /2-/5-/dimethyl-amino-methyl/-2-/furyl-methyl-thio/-ethyl//- -amino-1-/methyl-amino-2-nitro-ethylene |
US5141931A (en) * | 1991-01-03 | 1992-08-25 | Sterling Winthrop Inc. | 5-Quinolinylpyridinones, cardiotonic compositions and methods |
GB9200781D0 (en) * | 1992-01-15 | 1992-03-11 | Merck Sharp & Dohme | Therapeutic agents |
JP2686887B2 (ja) * | 1992-08-11 | 1997-12-08 | キッセイ薬品工業株式会社 | ピペリジノ−3,4−ジヒドロカルボスチリル誘導体 |
FR2703681B1 (fr) * | 1993-04-08 | 1995-05-12 | Bellon Labor Sa Roger | Procede de preparation de fluoro-6-halogeno-2 quinoleine |
JP2000256323A (ja) | 1999-01-08 | 2000-09-19 | Japan Tobacco Inc | 2−オキソキノリン化合物及びその医薬用途 |
CZ2002711A3 (cs) | 1999-08-27 | 2003-11-12 | Ligand Pharmaceuticals Incorporated | Modulátory androgenních receptorů, způsoby jejich výroby a způsoby jejich použití |
US6566372B1 (en) | 1999-08-27 | 2003-05-20 | Ligand Pharmaceuticals Incorporated | Bicyclic androgen and progesterone receptor modulator compounds and methods |
AU6941200A (en) | 1999-08-27 | 2001-03-26 | Ligand Pharmaceuticals Incorporated | 8-substituted-6-trifluoromethyl-9-pyrido(3,2-g)quinoline compounds as androgen receptor modulators |
WO2001019770A2 (en) | 1999-09-14 | 2001-03-22 | Ligand Pharmaceuticals Incorporated | Rxr modulators with improved pharmacologic profile |
JP2004526756A (ja) * | 2001-04-06 | 2004-09-02 | スミスクライン ビーチャム コーポレーション | hYAK1及びhYAK3キナーゼのキノリン阻害剤 |
UA79293C2 (en) * | 2002-07-03 | 2007-06-11 | Univ Wayne State | 4-(7'-halo-2-quino (xa-) linyloxy)phenoxy propionic acid derivatives as antineoplastic agents |
WO2004065379A1 (en) * | 2003-01-17 | 2004-08-05 | Warner-Lambert Company Llc | Androgen receptor antagonists |
US7550480B2 (en) * | 2003-02-14 | 2009-06-23 | Smithkline Beecham Corporation | Compounds |
EP1656142A4 (en) * | 2003-08-22 | 2011-06-22 | Ligand Pharm Inc | 6-CYCLOAMINO-2-QUINOLINONE DERIVATIVES AS MODULATORS ANDROGEN RECEPTOR COMPOUNDS |
CL2008000838A1 (es) | 2007-03-23 | 2008-10-10 | Neuraxon Inc | Compuestos derivados de quinolina y tetrahidroquinolina, con actividad inhibidora nos; composicion farmaceutica que comprende a dichos compuestos; y su uso para tratar un dolor de cabeza tal como migrana, dolor cronico, desordenes del sistema nervios |
DE102008022221A1 (de) * | 2008-05-06 | 2009-11-12 | Universität des Saarlandes | Inhibitoren der humanen Aldosteronsynthase CYP11B2 |
US8541404B2 (en) | 2009-11-09 | 2013-09-24 | Elexopharm Gmbh | Inhibitors of the human aldosterone synthase CYP11B2 |
WO2013037779A1 (en) * | 2011-09-15 | 2013-03-21 | F. Hoffmann-La Roche Ag | New dihydroquinoline-2-one derivatives |
CA2850700C (en) | 2011-11-30 | 2019-11-12 | F. Hoffmann-La Roche Ag | New bicyclic dihydroisoquinoline-1-one derivatives |
BR112015008308A2 (pt) | 2012-10-16 | 2017-12-05 | Janssen Pharmaceutica Nv | moduladores de quinolinila ligados por metileno do ror-gama-t |
KR20150070348A (ko) | 2012-10-16 | 2015-06-24 | 얀센 파마슈티카 엔.브이. | RoRγt의 헤테로아릴 결합 퀴놀리닐 조절제 |
SG11201502935VA (en) | 2012-10-16 | 2015-09-29 | Janssen Pharmaceutica Nv | Phenyl linked quinolinyl modulators of ror-gamma-t |
RU2015137972A (ru) * | 2013-03-08 | 2017-04-13 | Ф. Хоффманн-Ля Рош Аг | Новые производные дигидрохинолин-2-она в качестве ингибиторов альдостеронсинтазы (cyp1 1 b2 или cyp1 1 b1) |
AR096424A1 (es) * | 2013-05-27 | 2015-12-30 | Hoffmann La Roche | Compuestos de 3,4-dihidro-2h-isoquinolin-1-ona y 2,3-dihidro-isoindol-1-ona |
KR20160068956A (ko) | 2013-10-15 | 2016-06-15 | 얀센 파마슈티카 엔.브이. | RORyT의 퀴놀리닐 조절제 |
US9328095B2 (en) | 2013-10-15 | 2016-05-03 | Janssen Pharmaceutica Nv | Heteroaryl linked quinolinyl modulators of RORgammat |
US9403816B2 (en) | 2013-10-15 | 2016-08-02 | Janssen Pharmaceutica Nv | Phenyl linked quinolinyl modulators of RORγt |
US9221804B2 (en) | 2013-10-15 | 2015-12-29 | Janssen Pharmaceutica Nv | Secondary alcohol quinolinyl modulators of RORγt |
US10555941B2 (en) | 2013-10-15 | 2020-02-11 | Janssen Pharmaceutica Nv | Alkyl linked quinolinyl modulators of RORγt |
JP6423423B2 (ja) | 2013-10-15 | 2018-11-14 | ヤンセン ファーマシューティカ エヌ.ベー. | Rorγtのアルキル結合キノリニルモジュレーター |
US9284308B2 (en) | 2013-10-15 | 2016-03-15 | Janssen Pharmaceutica Nv | Methylene linked quinolinyl modulators of RORγt |
CN115504933A (zh) * | 2022-10-13 | 2022-12-23 | 广东工业大学 | 一种多取代喹啉酮化合物的制备方法及其应用 |
Family Cites Families (9)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3907808A (en) * | 1971-05-17 | 1975-09-23 | Sterling Drug Inc | 1,4-Dihydro-4-oxo-7-pyridyl-3-quinolinecarboxylic acid derivatives |
US3962445A (en) * | 1973-05-19 | 1976-06-08 | Beecham Group Limited | Anti-allergenic carbostyril derivatives |
US3993656A (en) * | 1974-11-19 | 1976-11-23 | Merck & Co., Inc. | 1,8-Naphthyridine compounds |
JPS5473783A (en) * | 1977-11-15 | 1979-06-13 | Otsuka Pharmaceut Co Ltd | Pyridine derivative |
US4258185A (en) * | 1978-10-17 | 1981-03-24 | Yoshitomi Pharmaceutical Industries, Ltd. | Pyridazinone compounds |
FR2439196A1 (fr) * | 1978-10-17 | 1980-05-16 | Yoshitomi Pharmaceutical | Nouveaux derives de la pyridazinone utilisables en therapeutique comme agents anti-thrombotiques et anti-hypertenseurs |
JPS5777676A (en) * | 1980-10-31 | 1982-05-15 | Otsuka Pharmaceut Co Ltd | Carbostyril derivative |
CA1164459A (en) * | 1980-11-11 | 1984-03-27 | Yung-Hsiung Yang | Process for preparing (imidazo¬1,2-a|pyridine- 2-yl)-carbostyril or -3,4-dihydrocarbostyryl derivatives |
EP0102046A1 (en) * | 1982-08-26 | 1984-03-07 | Schering Corporation | Tricyclic lactams, method for making them, pharmaceutical compositions containing them |
-
1984
- 1984-12-18 PT PT79699A patent/PT79699B/pt unknown
- 1984-12-18 US US06/683,440 patent/US4710507A/en not_active Expired - Lifetime
- 1984-12-19 CS CS8410000A patent/CS249533B2/cs unknown
- 1984-12-19 GR GR82511A patent/GR82511B/el unknown
- 1984-12-19 EP EP84308925A patent/EP0148623A3/en not_active Withdrawn
- 1984-12-19 ES ES538805A patent/ES8603863A1/es not_active Expired
- 1984-12-19 FI FI845036A patent/FI845036L/fi not_active Application Discontinuation
- 1984-12-20 NZ NZ210670A patent/NZ210670A/en unknown
- 1984-12-20 IL IL73877A patent/IL73877A/xx unknown
- 1984-12-20 CA CA000470605A patent/CA1253497A/en not_active Expired
- 1984-12-20 PL PL1984251092A patent/PL144816B1/pl unknown
- 1984-12-21 DK DK619584A patent/DK619584A/da not_active Application Discontinuation
- 1984-12-21 KR KR1019840008229A patent/KR870000911B1/ko not_active IP Right Cessation
- 1984-12-21 NO NO845228A patent/NO845228L/no unknown
- 1984-12-21 SU SU843826174A patent/SU1407397A3/ru active
- 1984-12-21 AU AU37017/84A patent/AU556494B2/en not_active Ceased
- 1984-12-21 HU HU844800A patent/HUT36472A/hu unknown
Also Published As
Publication number | Publication date |
---|---|
AU556494B2 (en) | 1986-11-06 |
PT79699A (en) | 1985-01-01 |
PL251092A1 (en) | 1985-12-17 |
KR870000911B1 (ko) | 1987-05-06 |
DK619584D0 (da) | 1984-12-21 |
IL73877A (en) | 1988-10-31 |
KR850004478A (ko) | 1985-07-15 |
SU1407397A3 (ru) | 1988-06-30 |
EP0148623A2 (en) | 1985-07-17 |
NZ210670A (en) | 1987-03-31 |
ES538805A0 (es) | 1986-01-01 |
IL73877A0 (en) | 1985-03-31 |
EP0148623A3 (en) | 1986-06-04 |
PL144816B1 (en) | 1988-07-30 |
PT79699B (en) | 1986-12-10 |
CS249533B2 (en) | 1987-03-12 |
ES8603863A1 (es) | 1986-01-01 |
US4710507A (en) | 1987-12-01 |
FI845036L (fi) | 1985-06-23 |
AU3701784A (en) | 1985-07-04 |
HUT36472A (en) | 1985-09-30 |
GR82511B (en) | 1985-04-22 |
DK619584A (da) | 1985-06-23 |
CA1253497A (en) | 1989-05-02 |
FI845036A0 (fi) | 1984-12-19 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
NO845228L (no) | Kinolinforbindelser. | |
TWI275390B (en) | Process for the preparation of 7-substituted-3- quinolinecarbonitriles | |
JP3579350B2 (ja) | 二環式キナーゼ阻害剤 | |
NO167693B (no) | System for syklisk avbrytelse av driften av en anordning mellom en foerste tilstand og en andre tilstand. | |
US5236937A (en) | Pyridinyl compounds which are useful as angiotensin ii antagonists | |
NO136150B (no) | Analogifremgangsm}te til fremstilling av terapeutisk aktive pyridyl- eller piperidinsubstituerte 1,4-dihydro-4-okso-3-kinolinkarboksylsyre-estere. | |
DE69713255T2 (de) | Pharmazeutische Pyridin-Derivate, ihre Herstellungsverfahren und Zwischenprodukte dafür | |
US4636506A (en) | 7-heterocyclic-1,4-dihydroquinolones | |
US4782055A (en) | Imidazopyridine compounds useful in the treatment of ulcers | |
WO1997032858A1 (en) | Quinoxaline derivatives as glutamate receptor antagonists | |
CN109790144A (zh) | 新型杂环化合物作为酪氨酸激酶bcr-abl抑制剂 | |
JP2006517976A (ja) | 新規化合物 | |
US4584381A (en) | 5-(Nitro or halogen)-3-(alkyl)-2-(aminoalkyl)pyridines | |
US5380730A (en) | Pyridine compounds which have useful pharmaceutical utility | |
JPH03145487A (ja) | ピリジニル―キノロン化合物類、それらの製造方法および用途 | |
WO2002055502A1 (en) | Pyridine derivatives useful as cyclooxygenase inhibitor | |
CZ20033519A3 (en) | Dibenzocycloheptene compound | |
WO2016063080A1 (en) | Indazole and indole derivatives as inhibitors of retinoic acid relates orphan receptor gamma (ror gamma) for the treatment of immune-related diseases | |
NO144110B (no) | Analogifremgangsmaate ved fremstilling av terapeutisk aktive 5:6-benzo-4-pyron-derivater | |
NO834777L (no) | Fremgangsmaate for fremstilling av terapeutisk aktive pyridin-derivater | |
NO831642L (no) | Kinazolinderivater. | |
JP4294469B2 (ja) | Pdeiv阻害剤 | |
DD234009A5 (de) | Verfahren zur herstellung substituierter chinolone | |
NZ207582A (en) | (1h-tetrazol-5-yl)-tetrazolo(1,5-a)quinoline derivatives and pharmaceutical composition | |
JPH0710873A (ja) | インドリジン誘導体その製造法および中間体としての使用 |