NO122246B - - Google Patents
Download PDFInfo
- Publication number
- NO122246B NO122246B NO168071A NO16807167A NO122246B NO 122246 B NO122246 B NO 122246B NO 168071 A NO168071 A NO 168071A NO 16807167 A NO16807167 A NO 16807167A NO 122246 B NO122246 B NO 122246B
- Authority
- NO
- Norway
- Prior art keywords
- formula
- carbon atoms
- dibenzo
- given above
- alkyl
- Prior art date
Links
- 125000000217 alkyl group Chemical group 0.000 claims description 15
- 239000002253 acid Substances 0.000 claims description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 150000002148 esters Chemical class 0.000 claims description 8
- 150000001298 alcohols Chemical class 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 7
- 239000000047 product Substances 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 150000001412 amines Chemical class 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000000304 alkynyl group Chemical group 0.000 claims description 4
- 150000003141 primary amines Chemical class 0.000 claims description 4
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims description 4
- 150000003335 secondary amines Chemical class 0.000 claims description 4
- QPJORFLSOJAUNL-UHFFFAOYSA-N dibenzo[a,d][7]annulene Chemical class C1=CC2=CC=CC=C2CC2=CC=CC=C21 QPJORFLSOJAUNL-UHFFFAOYSA-N 0.000 claims description 3
- 239000007795 chemical reaction product Substances 0.000 claims description 2
- PJQCANLCUDUPRF-UHFFFAOYSA-N dibenzocycloheptene Chemical class C1CC2=CC=CC=C2CC2=CC=CC=C12 PJQCANLCUDUPRF-UHFFFAOYSA-N 0.000 claims description 2
- 239000012458 free base Substances 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 150000003512 tertiary amines Chemical class 0.000 claims description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 14
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 239000007868 Raney catalyst Substances 0.000 description 4
- 229910000564 Raney nickel Inorganic materials 0.000 description 4
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- -1 hydrohalic acids Chemical class 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 235000011121 sodium hydroxide Nutrition 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 229910045601 alloy Inorganic materials 0.000 description 2
- 239000000956 alloy Substances 0.000 description 2
- 230000001773 anti-convulsant effect Effects 0.000 description 2
- 239000001961 anticonvulsive agent Substances 0.000 description 2
- 229960003965 antiepileptics Drugs 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000002026 chloroform extract Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- RZJLDZMIOKCPJA-UHFFFAOYSA-N cycloheptene;hydrochloride Chemical compound Cl.C1CCC=CCC1 RZJLDZMIOKCPJA-UHFFFAOYSA-N 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- BWPIARFWQZKAIA-UHFFFAOYSA-N protriptyline Chemical compound C1=CC2=CC=CC=C2C(CCCNC)C2=CC=CC=C21 BWPIARFWQZKAIA-UHFFFAOYSA-N 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- 229940086542 triethylamine Drugs 0.000 description 2
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- CJDMGGVKOZCNJH-UHFFFAOYSA-N 1-(6,11-dihydro-5h-dibenzo[1,2-a:1',2'-e][7]annulen-11-yl)-n,n-dimethylmethanamine Chemical compound C1CC2=CC=CC=C2C(CN(C)C)C2=CC=CC=C21 CJDMGGVKOZCNJH-UHFFFAOYSA-N 0.000 description 1
- KRGZWDPNVIINFY-UHFFFAOYSA-N 1-(6,11-dihydro-5h-dibenzo[1,2-a:1',2'-e][7]annulen-11-yl)-n-methylmethanamine Chemical compound C1CC2=CC=CC=C2C(CNC)C2=CC=CC=C21 KRGZWDPNVIINFY-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 1
- WEFIZNULHWPABZ-UHFFFAOYSA-N N-methyltetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaen-8-imine Chemical compound CN=C1C2C3=C(C(C4=C1C=CC=C4)C2)C=CC=C3 WEFIZNULHWPABZ-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 238000005905 alkynylation reaction Methods 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 230000003556 anti-epileptic effect Effects 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- WWBGONGKRSWMGE-UHFFFAOYSA-N cycloheptene Chemical compound [CH]1CCCC=CC1 WWBGONGKRSWMGE-UHFFFAOYSA-N 0.000 description 1
- 150000001933 cycloheptenes Chemical class 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 239000008098 formaldehyde solution Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- MJGFBOZCAJSGQW-UHFFFAOYSA-N mercury sodium Chemical compound [Na].[Hg] MJGFBOZCAJSGQW-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229960002601 protriptyline Drugs 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000006894 reductive elimination reaction Methods 0.000 description 1
- 229910001023 sodium amalgam Inorganic materials 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- GSCKMHFCKGEORH-UHFFFAOYSA-N tetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaen-8-imine Chemical class C1C2C3=C(C(C1C1=C2C=CC=C1)=N)C=CC=C3 GSCKMHFCKGEORH-UHFFFAOYSA-N 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical class CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/33—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of rings other than six-membered aromatic rings
- C07C211/34—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of rings other than six-membered aromatic rings of a saturated carbon skeleton
- C07C211/38—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to carbon atoms of rings other than six-membered aromatic rings of a saturated carbon skeleton containing condensed ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/01—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms
- C07C211/26—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing at least one six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C211/00—Compounds containing amino groups bound to a carbon skeleton
- C07C211/01—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms
- C07C211/26—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing at least one six-membered aromatic ring
- C07C211/29—Compounds containing amino groups bound to a carbon skeleton having amino groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing at least one six-membered aromatic ring the carbon skeleton being further substituted by halogen atoms or by nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH678166A CH473759A (de) | 1966-05-10 | 1966-05-10 | Verfahren zur Herstellung von 10,11-Dihydro-5H-dibenzo (a,d)-cyclohepten-Derivaten |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO122246B true NO122246B (cs) | 1971-06-07 |
Family
ID=4314928
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO168071A NO122246B (cs) | 1966-05-10 | 1967-05-09 |
Country Status (12)
| Country | Link |
|---|---|
| AT (3) | AT283312B (cs) |
| BE (1) | BE698198A (cs) |
| CH (3) | CH481869A (cs) |
| CS (4) | CS154228B2 (cs) |
| DE (1) | DE1643212A1 (cs) |
| ES (1) | ES340257A1 (cs) |
| FI (1) | FI47348C (cs) |
| FR (1) | FR6502M (cs) |
| GB (1) | GB1170798A (cs) |
| GR (1) | GR36291B (cs) |
| NL (1) | NL6706480A (cs) |
| NO (1) | NO122246B (cs) |
-
1966
- 1966-05-10 CH CH1716968A patent/CH481869A/de not_active IP Right Cessation
- 1966-05-10 CH CH1716868A patent/CH481055A/de not_active IP Right Cessation
- 1966-05-10 CH CH678166A patent/CH473759A/de not_active IP Right Cessation
-
1967
- 1967-05-03 FI FI671285A patent/FI47348C/fi active
- 1967-05-03 DE DE19671643212 patent/DE1643212A1/de active Pending
- 1967-05-05 GB GB20979/67A patent/GB1170798A/en not_active Expired
- 1967-05-08 ES ES340257A patent/ES340257A1/es not_active Expired
- 1967-05-08 GR GR670136291A patent/GR36291B/el unknown
- 1967-05-09 NL NL6706480A patent/NL6706480A/xx unknown
- 1967-05-09 AT AT870769A patent/AT283312B/de not_active IP Right Cessation
- 1967-05-09 AT AT434967A patent/AT283303B/de not_active IP Right Cessation
- 1967-05-09 NO NO168071A patent/NO122246B/no unknown
- 1967-05-09 AT AT870569A patent/AT283311B/de not_active IP Right Cessation
- 1967-05-09 BE BE698198D patent/BE698198A/xx unknown
- 1967-05-10 CS CS337867A patent/CS154228B2/cs unknown
- 1967-05-10 CS CS281170*1A patent/CS154229B2/cs unknown
- 1967-05-10 FR FR105888A patent/FR6502M/fr not_active Expired
- 1967-05-10 CS CS281270*1A patent/CS154230B2/cs unknown
- 1967-05-10 CS CS281370*1A patent/CS154231B2/cs unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FI47348C (fi) | 1973-11-12 |
| FI47348B (cs) | 1973-07-31 |
| FR6502M (cs) | 1968-12-02 |
| CH473759A (de) | 1969-06-15 |
| AT283312B (de) | 1970-08-10 |
| CS154230B2 (cs) | 1974-03-29 |
| CH481055A (de) | 1969-11-15 |
| AT283311B (de) | 1970-08-10 |
| AT283303B (de) | 1970-08-10 |
| GR36291B (el) | 1969-01-20 |
| ES340257A1 (es) | 1968-09-01 |
| CS154228B2 (cs) | 1974-03-29 |
| BE698198A (cs) | 1967-11-09 |
| NL6706480A (cs) | 1967-11-13 |
| CS154229B2 (cs) | 1974-03-29 |
| GB1170798A (en) | 1969-11-19 |
| CS154231B2 (cs) | 1974-03-29 |
| DE1643212A1 (de) | 1971-03-11 |
| CH481869A (de) | 1969-11-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH443274A (de) | Verfahren zur Herstellung von Phenyl-cycloalkanmethylaminen | |
| DE1620198C3 (de) | 5H-Benz eckige Klammer auf f eckige Klammer zu 2,5-oxazocine oder Benz eckige Klammer auf g eckige Klammer zu 2,6-oxazonine, ihre Salze und Arzneimittel | |
| DE2413102A1 (de) | Verfahren zur herstellung von 1-(3,5dihydroxyphenyl)-1-hydroxy-2- eckige klammer auf 1-methyl-2-(4-hydroxyphenyl)-aethyl eckige klammer zu -amino-aethan | |
| NO122246B (cs) | ||
| DE1543777B2 (de) | Verfahren zur Herstellung von alpha niedrig Alkyl beta (4 hydroxy phenyl) alaninen | |
| US2631154A (en) | 1-(hydroxylakylaminoalkylamino)-4-methylxanthones and their preparation | |
| DE1793611B2 (de) | 4,4-diphenylcyclohexylamine, ihre saeureadditionssalze und quartaeren ammoniumsalze | |
| CH484070A (de) | Verfahren zur Herstellung basisch substituierter Phenylacetonitrile | |
| CH396941A (de) | Verfahren zur Herstellung neuer sekundärer Amine | |
| US3022301A (en) | Amido-diamines and triamines | |
| DE1110160B (de) | Verfahren zur Herstellung analeptisch wirksamer N-substituierter Aminonorcamphanderivate bzw. von deren Saeureadditionssalzen und quaternaeren Ammoniumverbindungen | |
| US1972450A (en) | Production of derivatives of amino-6-methyl-2-heptene-2 | |
| DE953803C (de) | Verfahren zur Herstellung von Alkaminestern von 4-Amino-2-oxybenzoesaeure, die am N-und O-Atom alkyliert sind | |
| AT360992B (de) | Verfahren zur herstellung neuer phenylazacyclo- alkane und von deren salzen und optisch aktiven verbindungen | |
| AT239209B (de) | Verfahren zur Herstellung von neuen bicyclisch substituierten Aminoalkanen sowie deren Salzen und quaternären Ammoniumverbindungen | |
| DE2004818C3 (de) | Basisch substituierte Chinobenzazepine | |
| DE1468377C (de) | Verfahren zur Herstellung von 4,4 Diphenylcyclohexylammen | |
| AT347473B (de) | Verfahren zur herstellung von neuen morpholinverbindungen und deren nicht-toxischen salzen | |
| AT360993B (de) | Verfahren zur herstellung neuer phenylazacyclo- alkane und von deren salzen und optisch aktiven verbindungen | |
| SE441825B (sv) | Sett att framstella nya 1-fenyl-2-amino-1,3-propandiol-n-alkyl-derivat | |
| AT337155B (de) | Verfahren zur herstellung von neuen n-cycloalkylbenzylaminen und deren physiologisch vertraglichen saureadditionssalzen | |
| DE1493522C (de) | Verfahren zur Herstellung von Diphenyl propylaminderivaten | |
| DE881663C (de) | Verfahren zur Herstellung von 1-(p-Oxyphenyl)-2-(ª‡-methyl-ª†-phenyl-propylamino)-propanen | |
| US2546653A (en) | Chlorinated derivatives of 1-pyridindene and their preparation | |
| DE2339528C3 (de) | Basische Äther und ein Verfahren zu deren Herstellung |