LT3869B - Tertiary hydroxyalkylxantines, process for the preparation thereof and pharmaceutical composition containing them - Google Patents
Tertiary hydroxyalkylxantines, process for the preparation thereof and pharmaceutical composition containing them Download PDFInfo
- Publication number
- LT3869B LT3869B LTIP1467A LTIP1467A LT3869B LT 3869 B LT3869 B LT 3869B LT IP1467 A LTIP1467 A LT IP1467A LT IP1467 A LTIP1467 A LT IP1467A LT 3869 B LT3869 B LT 3869B
- Authority
- LT
- Lithuania
- Prior art keywords
- formula
- compounds
- tertiary
- group
- residue
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 37
- 239000008194 pharmaceutical composition Substances 0.000 title claims 2
- 230000008569 process Effects 0.000 title abstract description 5
- 238000002360 preparation method Methods 0.000 title description 13
- 150000001875 compounds Chemical class 0.000 claims abstract description 114
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 23
- 239000003814 drug Substances 0.000 claims abstract description 19
- 238000011282 treatment Methods 0.000 claims abstract description 19
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 16
- 230000002093 peripheral effect Effects 0.000 claims abstract description 14
- 125000004043 oxo group Chemical group O=* 0.000 claims abstract description 11
- 125000004430 oxygen atom Chemical group O* 0.000 claims abstract description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 4
- -1 3,7-disubstituted xanthines Chemical class 0.000 claims description 58
- LRFVTYWOQMYALW-UHFFFAOYSA-N 9H-xanthine Chemical class O=C1NC(=O)NC2=C1NC=N2 LRFVTYWOQMYALW-UHFFFAOYSA-N 0.000 claims description 53
- 239000000203 mixture Substances 0.000 claims description 50
- 238000006243 chemical reaction Methods 0.000 claims description 42
- 125000005429 oxyalkyl group Chemical group 0.000 claims description 22
- 229910052739 hydrogen Inorganic materials 0.000 claims description 21
- 230000002829 reductive effect Effects 0.000 claims description 21
- 239000003795 chemical substances by application Substances 0.000 claims description 20
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 18
- 239000001257 hydrogen Substances 0.000 claims description 15
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 13
- 239000002253 acid Substances 0.000 claims description 13
- 229940065721 systemic for obstructive airway disease xanthines Drugs 0.000 claims description 13
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 12
- 238000005804 alkylation reaction Methods 0.000 claims description 12
- 229910052799 carbon Inorganic materials 0.000 claims description 12
- 150000003839 salts Chemical class 0.000 claims description 12
- 229940075420 xanthine Drugs 0.000 claims description 12
- 150000002576 ketones Chemical class 0.000 claims description 11
- 229910052751 metal Inorganic materials 0.000 claims description 10
- 239000002184 metal Substances 0.000 claims description 10
- 229910052757 nitrogen Inorganic materials 0.000 claims description 10
- 239000002168 alkylating agent Substances 0.000 claims description 9
- 229940100198 alkylating agent Drugs 0.000 claims description 9
- 230000029936 alkylation Effects 0.000 claims description 8
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 claims description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 6
- 208000026106 cerebrovascular disease Diseases 0.000 claims description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 6
- 208000018262 Peripheral vascular disease Diseases 0.000 claims description 5
- 238000009472 formulation Methods 0.000 claims description 5
- 238000006703 hydration reaction Methods 0.000 claims description 5
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 claims description 4
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 4
- 125000004849 alkoxymethyl group Chemical group 0.000 claims description 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 4
- 239000003153 chemical reaction reagent Substances 0.000 claims description 4
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 230000003301 hydrolyzing effect Effects 0.000 claims description 4
- 125000005188 oxoalkyl group Chemical group 0.000 claims description 4
- 238000005932 reductive alkylation reaction Methods 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 3
- 239000003638 chemical reducing agent Substances 0.000 claims description 3
- 150000002367 halogens Chemical group 0.000 claims description 3
- 230000003387 muscular Effects 0.000 claims description 3
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 claims description 3
- 208000031104 Arterial Occlusive disease Diseases 0.000 claims description 2
- 201000002169 Mitochondrial myopathy Diseases 0.000 claims description 2
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 2
- 208000021328 arterial occlusion Diseases 0.000 claims description 2
- 230000037149 energy metabolism Effects 0.000 claims description 2
- 125000004185 ester group Chemical group 0.000 claims description 2
- 208000023692 inborn mitochondrial myopathy Diseases 0.000 claims description 2
- 125000000468 ketone group Chemical group 0.000 claims description 2
- 208000030159 metabolic disease Diseases 0.000 claims description 2
- 238000005580 one pot reaction Methods 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 2
- 238000011321 prophylaxis Methods 0.000 claims 2
- GJCOSYZMQJWQCA-UHFFFAOYSA-N 9H-xanthene Chemical class C1=CC=C2CC3=CC=CC=C3OC2=C1 GJCOSYZMQJWQCA-UHFFFAOYSA-N 0.000 claims 1
- 125000006267 biphenyl group Chemical group 0.000 claims 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims 1
- 229940079593 drug Drugs 0.000 abstract description 10
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 abstract description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract description 6
- 230000002490 cerebral effect Effects 0.000 abstract description 4
- 125000001931 aliphatic group Chemical group 0.000 abstract description 3
- 230000002265 prevention Effects 0.000 abstract description 2
- 238000004519 manufacturing process Methods 0.000 abstract 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 abstract 1
- 230000002262 irrigation Effects 0.000 abstract 1
- 238000003973 irrigation Methods 0.000 abstract 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 78
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 60
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 54
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 54
- 239000000243 solution Substances 0.000 description 49
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 39
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 36
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 33
- 238000003756 stirring Methods 0.000 description 25
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 24
- 239000002904 solvent Substances 0.000 description 23
- GMSNIKWWOQHZGF-UHFFFAOYSA-N 3-methyl-9H-xanthine Chemical compound O=C1NC(=O)N(C)C2=C1N=CN2 GMSNIKWWOQHZGF-UHFFFAOYSA-N 0.000 description 22
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 22
- 235000011121 sodium hydroxide Nutrition 0.000 description 20
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 18
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 17
- 230000000694 effects Effects 0.000 description 13
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 13
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- CCERQOYLJJULMD-UHFFFAOYSA-M magnesium;carbanide;chloride Chemical compound [CH3-].[Mg+2].[Cl-] CCERQOYLJJULMD-UHFFFAOYSA-M 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 12
- 238000010992 reflux Methods 0.000 description 12
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 11
- 238000012360 testing method Methods 0.000 description 11
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- BYPFEZZEUUWMEJ-UHFFFAOYSA-N Pentoxifylline Chemical compound O=C1N(CCCCC(=O)C)C(=O)N(C)C2=C1N(C)C=N2 BYPFEZZEUUWMEJ-UHFFFAOYSA-N 0.000 description 10
- 230000000302 ischemic effect Effects 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 9
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 9
- 229910000027 potassium carbonate Inorganic materials 0.000 description 9
- 229910052938 sodium sulfate Inorganic materials 0.000 description 9
- 235000011152 sodium sulphate Nutrition 0.000 description 9
- 150000003509 tertiary alcohols Chemical group 0.000 description 9
- 210000003205 muscle Anatomy 0.000 description 8
- 229960001476 pentoxifylline Drugs 0.000 description 8
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 7
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical group CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 7
- 229960000583 acetic acid Drugs 0.000 description 7
- 239000012043 crude product Substances 0.000 description 7
- 229940083747 low-ceiling diuretics xanthine derivative Drugs 0.000 description 7
- 230000007935 neutral effect Effects 0.000 description 7
- 150000002902 organometallic compounds Chemical class 0.000 description 7
- GXDHCNNESPLIKD-UHFFFAOYSA-N 2-methylhexane Chemical compound CCCCC(C)C GXDHCNNESPLIKD-UHFFFAOYSA-N 0.000 description 6
- 241001465754 Metazoa Species 0.000 description 6
- 230000036770 blood supply Effects 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- 239000000543 intermediate Substances 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- 229960004559 theobromine Drugs 0.000 description 6
- 210000001519 tissue Anatomy 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 5
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- YAPQBXQYLJRXSA-UHFFFAOYSA-N Theobromine Natural products CN1C(=O)NC(=O)C2=C1N=CN2C YAPQBXQYLJRXSA-UHFFFAOYSA-N 0.000 description 5
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 5
- 235000019270 ammonium chloride Nutrition 0.000 description 5
- 239000000010 aprotic solvent Substances 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 238000009835 boiling Methods 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 5
- 208000035475 disorder Diseases 0.000 description 5
- 239000010410 layer Substances 0.000 description 5
- 229910052744 lithium Inorganic materials 0.000 description 5
- 239000011777 magnesium Substances 0.000 description 5
- 229910052749 magnesium Inorganic materials 0.000 description 5
- 239000003208 petroleum Substances 0.000 description 5
- 238000006722 reduction reaction Methods 0.000 description 5
- 239000000741 silica gel Substances 0.000 description 5
- 229910002027 silica gel Inorganic materials 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 4
- 239000005909 Kieselgur Substances 0.000 description 4
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 4
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 4
- 241000699670 Mus sp. Species 0.000 description 4
- 235000011054 acetic acid Nutrition 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 239000008280 blood Substances 0.000 description 4
- 210000004369 blood Anatomy 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 210000001105 femoral artery Anatomy 0.000 description 4
- 239000012362 glacial acetic acid Substances 0.000 description 4
- 150000004678 hydrides Chemical class 0.000 description 4
- 229930195733 hydrocarbon Natural products 0.000 description 4
- 150000002430 hydrocarbons Chemical class 0.000 description 4
- 210000004185 liver Anatomy 0.000 description 4
- 230000002503 metabolic effect Effects 0.000 description 4
- 230000000144 pharmacologic effect Effects 0.000 description 4
- 239000011591 potassium Substances 0.000 description 4
- 229910052700 potassium Inorganic materials 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- 150000003512 tertiary amines Chemical class 0.000 description 4
- 229910052725 zinc Inorganic materials 0.000 description 4
- 239000011701 zinc Substances 0.000 description 4
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 3
- NGGPQVDOOZWSIG-UHFFFAOYSA-N 7-benzyl-3-methylpurine-2,6-dione Chemical compound C1=2C(=O)NC(=O)N(C)C=2N=CN1CC1=CC=CC=C1 NGGPQVDOOZWSIG-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical class CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- 239000003377 acid catalyst Substances 0.000 description 3
- 230000007059 acute toxicity Effects 0.000 description 3
- 231100000403 acute toxicity Toxicity 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 210000001367 artery Anatomy 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 230000033228 biological regulation Effects 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 210000004556 brain Anatomy 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 150000001721 carbon Chemical group 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 230000008602 contraction Effects 0.000 description 3
- 150000002009 diols Chemical class 0.000 description 3
- 239000006196 drop Substances 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- 230000036571 hydration Effects 0.000 description 3
- 230000006872 improvement Effects 0.000 description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 description 3
- 238000007912 intraperitoneal administration Methods 0.000 description 3
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 238000005259 measurement Methods 0.000 description 3
- 229910052987 metal hydride Inorganic materials 0.000 description 3
- 150000004681 metal hydrides Chemical class 0.000 description 3
- 235000010755 mineral Nutrition 0.000 description 3
- 239000011707 mineral Substances 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000000825 pharmaceutical preparation Substances 0.000 description 3
- 239000003444 phase transfer catalyst Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 125000005767 propoxymethyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])[#8]C([H])([H])* 0.000 description 3
- 239000012429 reaction media Substances 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 239000000523 sample Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 150000003871 sulfonates Chemical class 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- 238000012546 transfer Methods 0.000 description 3
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 2
- KVNYFPKFSJIPBJ-UHFFFAOYSA-N 1,2-diethylbenzene Chemical compound CCC1=CC=CC=C1CC KVNYFPKFSJIPBJ-UHFFFAOYSA-N 0.000 description 2
- HYOAGWAIGJXNQH-UHFFFAOYSA-N 1-bromo-1-chloropropane Chemical compound CCC(Cl)Br HYOAGWAIGJXNQH-UHFFFAOYSA-N 0.000 description 2
- NIDSRGCVYOEDFW-UHFFFAOYSA-N 1-bromo-4-chlorobutane Chemical compound ClCCCCBr NIDSRGCVYOEDFW-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- MHNVSFOURBQRPK-UHFFFAOYSA-N 3-methyl-7-propylpurine-2,6-dione Chemical compound CN1C(=O)NC(=O)C2=C1N=CN2CCC MHNVSFOURBQRPK-UHFFFAOYSA-N 0.000 description 2
- JDVQZFHNZYVOBA-UHFFFAOYSA-N 3-methyl-7h-purine-2,6-dione;sodium Chemical compound [Na].O=C1NC(=O)N(C)C2=C1NC=N2 JDVQZFHNZYVOBA-UHFFFAOYSA-N 0.000 description 2
- DUJLSYKBOIGDTC-UHFFFAOYSA-N 7-(ethoxymethyl)-3-methylpurine-2,6-dione Chemical compound CN1C(=O)NC(=O)C2=C1N=CN2COCC DUJLSYKBOIGDTC-UHFFFAOYSA-N 0.000 description 2
- 241000282472 Canis lupus familiaris Species 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 241000282326 Felis catus Species 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- 238000003747 Grignard reaction Methods 0.000 description 2
- 102000004316 Oxidoreductases Human genes 0.000 description 2
- 108090000854 Oxidoreductases Proteins 0.000 description 2
- QGMRQYFBGABWDR-UHFFFAOYSA-M Pentobarbital sodium Chemical compound [Na+].CCCC(C)C1(CC)C(=O)NC(=O)[N-]C1=O QGMRQYFBGABWDR-UHFFFAOYSA-M 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 2
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 210000001015 abdomen Anatomy 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 230000008321 arterial blood flow Effects 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 150000001649 bromium compounds Chemical class 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 229950005499 carbon tetrachloride Drugs 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- XTEGARKTQYYJKE-UHFFFAOYSA-N chloric acid Chemical compound OCl(=O)=O XTEGARKTQYYJKE-UHFFFAOYSA-N 0.000 description 2
- 229940005991 chloric acid Drugs 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 230000001684 chronic effect Effects 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 230000003247 decreasing effect Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- FYRUUJJYHRFYGI-UHFFFAOYSA-N ethoxymethyl 4-methylbenzenesulfonate Chemical compound CCOCOS(=O)(=O)C1=CC=C(C)C=C1 FYRUUJJYHRFYGI-UHFFFAOYSA-N 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 210000003414 extremity Anatomy 0.000 description 2
- 238000010579 first pass effect Methods 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- 150000004694 iodide salts Chemical class 0.000 description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- OTCKOJUMXQWKQG-UHFFFAOYSA-L magnesium bromide Chemical compound [Mg+2].[Br-].[Br-] OTCKOJUMXQWKQG-UHFFFAOYSA-L 0.000 description 2
- 229910001623 magnesium bromide Inorganic materials 0.000 description 2
- NXPHGHWWQRMDIA-UHFFFAOYSA-M magnesium;carbanide;bromide Chemical compound [CH3-].[Mg+2].[Br-] NXPHGHWWQRMDIA-UHFFFAOYSA-M 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 2
- 230000003228 microsomal effect Effects 0.000 description 2
- SNMVRZFUUCLYTO-UHFFFAOYSA-N n-propyl chloride Chemical compound CCCCl SNMVRZFUUCLYTO-UHFFFAOYSA-N 0.000 description 2
- 235000016709 nutrition Nutrition 0.000 description 2
- 230000035764 nutrition Effects 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 150000004714 phosphonium salts Chemical class 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000011160 research Methods 0.000 description 2
- 230000029058 respiratory gaseous exchange Effects 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- 210000002027 skeletal muscle Anatomy 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 230000002269 spontaneous effect Effects 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 229910052718 tin Inorganic materials 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- 230000007704 transition Effects 0.000 description 2
- 210000005166 vasculature Anatomy 0.000 description 2
- 230000000304 vasodilatating effect Effects 0.000 description 2
- 210000003462 vein Anatomy 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- 150000003738 xylenes Chemical class 0.000 description 2
- VNDYJBBGRKZCSX-UHFFFAOYSA-L zinc bromide Chemical compound Br[Zn]Br VNDYJBBGRKZCSX-UHFFFAOYSA-L 0.000 description 2
- AFINAILKDBCXMX-PBHICJAKSA-N (2s,3r)-2-amino-3-hydroxy-n-(4-octylphenyl)butanamide Chemical compound CCCCCCCCC1=CC=C(NC(=O)[C@@H](N)[C@@H](C)O)C=C1 AFINAILKDBCXMX-PBHICJAKSA-N 0.000 description 1
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- XBEDAMVJWVPVDS-UHFFFAOYSA-N 1,3-dimethyl-7-(5-oxohexyl)purine-2,6-dione Chemical compound CN1C(=O)N(C)C(=O)C2=C1N=CN2CCCCC(=O)C XBEDAMVJWVPVDS-UHFFFAOYSA-N 0.000 description 1
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- 238000005160 1H NMR spectroscopy Methods 0.000 description 1
- HUHXLHLWASNVDB-UHFFFAOYSA-N 2-(oxan-2-yloxy)oxane Chemical compound O1CCCCC1OC1OCCCC1 HUHXLHLWASNVDB-UHFFFAOYSA-N 0.000 description 1
- IKCLCGXPQILATA-UHFFFAOYSA-N 2-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1Cl IKCLCGXPQILATA-UHFFFAOYSA-N 0.000 description 1
- VSCGOLICSUUSBE-UHFFFAOYSA-N 3,7-dimethyl-1-(5-methylhex-4-enyl)purine-2,6-dione Chemical compound O=C1N(CCCC=C(C)C)C(=O)N(C)C2=C1N(C)C=N2 VSCGOLICSUUSBE-UHFFFAOYSA-N 0.000 description 1
- WAFGRTWRIGODOK-UHFFFAOYSA-N 3,7-dimethyl-8-(5-oxohexyl)purine-2,6-dione Chemical compound CN1C(=O)NC(=O)C2=C1N=C(CCCCC(=O)C)N2C WAFGRTWRIGODOK-UHFFFAOYSA-N 0.000 description 1
- PMVNCSJILAJACU-UHFFFAOYSA-N 3,8-dimethyl-7h-purine-2,6-dione Chemical compound CN1C(=O)NC(=O)C2=C1N=C(C)N2 PMVNCSJILAJACU-UHFFFAOYSA-N 0.000 description 1
- 125000004975 3-butenyl group Chemical group C(CC=C)* 0.000 description 1
- JRAPIKYLZZQQEK-UHFFFAOYSA-N 3-ethyl-7-methyl-1-(6-methylhept-5-enyl)purine-2,6-dione Chemical compound O=C1N(CCCCC=C(C)C)C(=O)N(CC)C2=C1N(C)C=N2 JRAPIKYLZZQQEK-UHFFFAOYSA-N 0.000 description 1
- QCJOEPKBQHHYNX-UHFFFAOYSA-N 3-ethyl-7-methylpurine-2,6-dione Chemical compound O=C1NC(=O)N(CC)C2=C1N(C)C=N2 QCJOEPKBQHHYNX-UHFFFAOYSA-N 0.000 description 1
- QANXTEAQVXUYGN-UHFFFAOYSA-N 3-methyl-1,7-bis(5-oxohexyl)purine-2,6-dione Chemical compound CN1C(=O)N(CCCCC(C)=O)C(=O)C2=C1N=CN2CCCCC(=O)C QANXTEAQVXUYGN-UHFFFAOYSA-N 0.000 description 1
- LQDOHJMZSIHISL-UHFFFAOYSA-N 3-methyl-1-(4-methylpent-3-enyl)-7-propylpurine-2,6-dione Chemical compound CN1C(=O)N(CCC=C(C)C)C(=O)C2=C1N=CN2CCC LQDOHJMZSIHISL-UHFFFAOYSA-N 0.000 description 1
- IBFQIKMLNUVUJQ-UHFFFAOYSA-N 3-methyl-1-(5-methylhex-4-enyl)-7-propylpurine-2,6-dione Chemical compound CN1C(=O)N(CCCC=C(C)C)C(=O)C2=C1N=CN2CCC IBFQIKMLNUVUJQ-UHFFFAOYSA-N 0.000 description 1
- GTFLJFCUFUWKTB-UHFFFAOYSA-N 3-methyl-1-(5-oxohexyl)-7-(2-oxopropyl)purine-2,6-dione Chemical compound O=C1N(CCCCC(=O)C)C(=O)N(C)C2=C1N(CC(C)=O)C=N2 GTFLJFCUFUWKTB-UHFFFAOYSA-N 0.000 description 1
- UEGOAAXVUJWIHJ-UHFFFAOYSA-N 3-methyl-1-propyl-7h-purine-2,6-dione Chemical compound O=C1N(CCC)C(=O)N(C)C2=C1NC=N2 UEGOAAXVUJWIHJ-UHFFFAOYSA-N 0.000 description 1
- CHMAGERHKOBWNR-UHFFFAOYSA-N 3-methyl-7-(2-oxopropyl)purine-2,6-dione Chemical compound CN1C(=O)NC(=O)C2=C1N=CN2CC(=O)C CHMAGERHKOBWNR-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- VXEGSRKPIUDPQT-UHFFFAOYSA-N 4-[4-(4-methoxyphenyl)piperazin-1-yl]aniline Chemical compound C1=CC(OC)=CC=C1N1CCN(C=2C=CC(N)=CC=2)CC1 VXEGSRKPIUDPQT-UHFFFAOYSA-N 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- CMDIDTNMHQUVPE-UHFFFAOYSA-N 6-chlorohexan-2-one Chemical compound CC(=O)CCCCCl CMDIDTNMHQUVPE-UHFFFAOYSA-N 0.000 description 1
- JHUQMCTUNIEZTJ-UHFFFAOYSA-N 7-(ethoxymethyl)-3-methyl-1-(5-oxohexyl)purine-2,6-dione Chemical compound CN1C(=O)N(CCCCC(C)=O)C(=O)C2=C1N=CN2COCC JHUQMCTUNIEZTJ-UHFFFAOYSA-N 0.000 description 1
- YEQIYKWKMFRLME-UHFFFAOYSA-N 7-benzyl-3-methyl-1-(5-oxohexyl)purine-2,6-dione Chemical compound C1=2C(=O)N(CCCCC(=O)C)C(=O)N(C)C=2N=CN1CC1=CC=CC=C1 YEQIYKWKMFRLME-UHFFFAOYSA-N 0.000 description 1
- XDUTVTQACWYOMX-UHFFFAOYSA-N 7-benzyl-3h-purine-2,6-dione Chemical compound C1=2C(=O)NC(=O)NC=2N=CN1CC1=CC=CC=C1 XDUTVTQACWYOMX-UHFFFAOYSA-N 0.000 description 1
- AFFGLYSEFLHGSL-UHFFFAOYSA-N 7-but-3-enyl-3-methylpurine-2,6-dione Chemical compound O=C1NC(=O)N(C)C2=C1N(CCC=C)C=N2 AFFGLYSEFLHGSL-UHFFFAOYSA-N 0.000 description 1
- FSPYXHOSNGUISH-UHFFFAOYSA-N 8-(2-oxopropyl)-3,7-dihydropurine-2,6-dione Chemical compound N1C(=O)NC(=O)C2=C1N=C(CC(=O)C)N2 FSPYXHOSNGUISH-UHFFFAOYSA-N 0.000 description 1
- DEDHQVXKYCLMFM-UHFFFAOYSA-N 8-propyl-3,7-dihydropurine-2,6-dione Chemical compound N1C(=O)NC(=O)C2=C1N=C(CCC)N2 DEDHQVXKYCLMFM-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- BCWJRNUQCIPKKK-UHFFFAOYSA-N CCCN1C(=NC2=C1C(=O)NC(=O)N2)CCCC(=O)C Chemical group CCCN1C(=NC2=C1C(=O)NC(=O)N2)CCCC(=O)C BCWJRNUQCIPKKK-UHFFFAOYSA-N 0.000 description 1
- 108090000312 Calcium Channels Proteins 0.000 description 1
- 102000003922 Calcium Channels Human genes 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical class O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 206010058842 Cerebrovascular insufficiency Diseases 0.000 description 1
- 108091006146 Channels Proteins 0.000 description 1
- 208000017667 Chronic Disease Diseases 0.000 description 1
- 208000035473 Communicable disease Diseases 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 1
- AQZGPSLYZOOYQP-UHFFFAOYSA-N Diisoamyl ether Chemical class CC(C)CCOCCC(C)C AQZGPSLYZOOYQP-UHFFFAOYSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 238000010471 Markovnikov's rule Methods 0.000 description 1
- 102000014171 Milk Proteins Human genes 0.000 description 1
- 108010011756 Milk Proteins Proteins 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- 230000006181 N-acylation Effects 0.000 description 1
- 101100005280 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) cat-3 gene Proteins 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 240000007711 Peperomia pellucida Species 0.000 description 1
- CXOFVDLJLONNDW-UHFFFAOYSA-N Phenytoin Chemical group N1C(=O)NC(=O)C1(C=1C=CC=CC=1)C1=CC=CC=C1 CXOFVDLJLONNDW-UHFFFAOYSA-N 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- RBQOQRRFDPXAGN-UHFFFAOYSA-N Propentofylline Chemical compound CN1C(=O)N(CCCCC(C)=O)C(=O)C2=C1N=CN2CCC RBQOQRRFDPXAGN-UHFFFAOYSA-N 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- YWPHQNQXFGVHQX-UHFFFAOYSA-N [K].O=C1N(C)C(=O)N(C)C2=C1NC=N2 Chemical compound [K].O=C1N(C)C(=O)N(C)C2=C1NC=N2 YWPHQNQXFGVHQX-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- 150000001243 acetic acids Chemical class 0.000 description 1
- 125000001539 acetonyl group Chemical group [H]C([H])([H])C(=O)C([H])([H])* 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- CPYGBGOXCJJJGC-GKLGUMFISA-L alcuronium chloride Chemical compound [Cl-].[Cl-].C/1([C@@H]23)=C\N([C@H]4\5)C6=CC=CC=C6[C@]4(CC[N@@+]4(CC=C)C\C6=C\CO)[C@@H]4C[C@@H]6C/5=C/N3C3=CC=CC=C3[C@@]22CC[N@@+]3(CC=C)C/C(=C/CO)[C@@H]\1C[C@H]32 CPYGBGOXCJJJGC-GKLGUMFISA-L 0.000 description 1
- 229960001358 alcuronium chloride Drugs 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 229930013930 alkaloid Natural products 0.000 description 1
- 150000003797 alkaloid derivatives Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000005081 alkoxyalkoxyalkyl group Chemical group 0.000 description 1
- 150000001346 alkyl aryl ethers Chemical class 0.000 description 1
- 150000004791 alkyl magnesium halides Chemical class 0.000 description 1
- VREFGVBLTWBCJP-UHFFFAOYSA-N alprazolam Chemical compound C12=CC(Cl)=CC=C2N2C(C)=NN=C2CN=C1C1=CC=CC=C1 VREFGVBLTWBCJP-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 230000003288 anthiarrhythmic effect Effects 0.000 description 1
- 230000001430 anti-depressive effect Effects 0.000 description 1
- 230000002058 anti-hyperglycaemic effect Effects 0.000 description 1
- 230000003276 anti-hypertensive effect Effects 0.000 description 1
- 230000002785 anti-thrombosis Effects 0.000 description 1
- 239000003416 antiarrhythmic agent Substances 0.000 description 1
- 239000003146 anticoagulant agent Substances 0.000 description 1
- 239000000935 antidepressant agent Substances 0.000 description 1
- 229940005513 antidepressants Drugs 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 239000010953 base metal Substances 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 230000036983 biotransformation Effects 0.000 description 1
- 230000002051 biphasic effect Effects 0.000 description 1
- 230000017531 blood circulation Effects 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- 238000009529 body temperature measurement Methods 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 229940065285 cadmium compound Drugs 0.000 description 1
- 150000001662 cadmium compounds Chemical class 0.000 description 1
- 244000309466 calf Species 0.000 description 1
- 230000008822 capillary blood flow Effects 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 230000003177 cardiotonic effect Effects 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 230000003727 cerebral blood flow Effects 0.000 description 1
- RLGQACBPNDBWTB-UHFFFAOYSA-N cetyltrimethylammonium ion Chemical compound CCCCCCCCCCCCCCCC[N+](C)(C)C RLGQACBPNDBWTB-UHFFFAOYSA-N 0.000 description 1
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 239000002036 chloroform fraction Substances 0.000 description 1
- JEIJBKDXJPNHGD-UHFFFAOYSA-N chloroform;pyridine Chemical compound ClC(Cl)Cl.C1=CC=NC=C1 JEIJBKDXJPNHGD-UHFFFAOYSA-N 0.000 description 1
- FCYRSDMGOLYDHL-UHFFFAOYSA-N chloromethoxyethane Chemical compound CCOCCl FCYRSDMGOLYDHL-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 230000004087 circulation Effects 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000002788 crimping Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 150000001983 dialkylethers Chemical class 0.000 description 1
- 239000002027 dichloromethane extract Substances 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- 230000010339 dilation Effects 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 230000001882 diuretic effect Effects 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 210000001198 duodenum Anatomy 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- 150000002118 epoxides Chemical class 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- KLKFAASOGCDTDT-UHFFFAOYSA-N ethoxymethoxyethane Chemical compound CCOCOCC KLKFAASOGCDTDT-UHFFFAOYSA-N 0.000 description 1
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 210000003191 femoral vein Anatomy 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 210000001061 forehead Anatomy 0.000 description 1
- 150000004674 formic acids Chemical class 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 238000003304 gavage Methods 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000005283 haloketone group Chemical group 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- CUILPNURFADTPE-UHFFFAOYSA-N hypobromous acid Chemical group BrO CUILPNURFADTPE-UHFFFAOYSA-N 0.000 description 1
- 210000003090 iliac artery Anatomy 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 230000000622 irritating effect Effects 0.000 description 1
- 208000028867 ischemia Diseases 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 238000002386 leaching Methods 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 150000002641 lithium Chemical group 0.000 description 1
- HZRMTWQRDMYLNW-UHFFFAOYSA-N lithium metaborate Chemical compound [Li+].[O-]B=O HZRMTWQRDMYLNW-UHFFFAOYSA-N 0.000 description 1
- 210000003141 lower extremity Anatomy 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 150000002681 magnesium compounds Chemical class 0.000 description 1
- FRIJBUGBVQZNTB-UHFFFAOYSA-M magnesium;ethane;bromide Chemical compound [Mg+2].[Br-].[CH2-]C FRIJBUGBVQZNTB-UHFFFAOYSA-M 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 238000013160 medical therapy Methods 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 239000002207 metabolite Substances 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- 230000001035 methylating effect Effects 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- ZUZLIXGTXQBUDC-UHFFFAOYSA-N methyltrioctylammonium Chemical compound CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC ZUZLIXGTXQBUDC-UHFFFAOYSA-N 0.000 description 1
- 239000003094 microcapsule Substances 0.000 description 1
- 235000021239 milk protein Nutrition 0.000 description 1
- 230000002438 mitochondrial effect Effects 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 230000004118 muscle contraction Effects 0.000 description 1
- 230000004220 muscle function Effects 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical group CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 238000013421 nuclear magnetic resonance imaging Methods 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000005457 optimization Methods 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 150000002900 organolithium compounds Chemical class 0.000 description 1
- 125000002524 organometallic group Chemical group 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 230000001575 pathological effect Effects 0.000 description 1
- 230000007310 pathophysiology Effects 0.000 description 1
- 229960002275 pentobarbital sodium Drugs 0.000 description 1
- 125000004115 pentoxy group Chemical group [*]OC([H])([H])C([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 239000002831 pharmacologic agent Substances 0.000 description 1
- NHKJPPKXDNZFBJ-UHFFFAOYSA-N phenyllithium Chemical compound [Li]C1=CC=CC=C1 NHKJPPKXDNZFBJ-UHFFFAOYSA-N 0.000 description 1
- DJFBJKSMACBYBD-UHFFFAOYSA-N phosphane;hydrate Chemical compound O.P DJFBJKSMACBYBD-UHFFFAOYSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 125000005496 phosphonium group Chemical class 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 210000003240 portal vein Anatomy 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000010970 precious metal Substances 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000006894 reductive elimination reaction Methods 0.000 description 1
- 238000005057 refrigeration Methods 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 230000000241 respiratory effect Effects 0.000 description 1
- 230000036387 respiratory rate Effects 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 125000003198 secondary alcohol group Chemical group 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000005049 silicon tetrachloride Substances 0.000 description 1
- 230000012232 skeletal muscle contraction Effects 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- NVIFVTYDZMXWGX-UHFFFAOYSA-N sodium metaborate Chemical compound [Na+].[O-]B=O NVIFVTYDZMXWGX-UHFFFAOYSA-N 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- 239000007892 solid unit dosage form Substances 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 238000013268 sustained release Methods 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 230000001839 systemic circulation Effects 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 238000002626 targeted therapy Methods 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000001650 tertiary alcohol group Chemical group 0.000 description 1
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- ZFXYFBGIUFBOJW-UHFFFAOYSA-N theophylline Chemical compound O=C1N(C)C(=O)N(C)C2=C1NC=N2 ZFXYFBGIUFBOJW-UHFFFAOYSA-N 0.000 description 1
- 229960000278 theophylline Drugs 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- 230000002110 toxicologic effect Effects 0.000 description 1
- 231100000027 toxicology Toxicity 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- BSVBQGMMJUBVOD-UHFFFAOYSA-N trisodium borate Chemical compound [Na+].[Na+].[Na+].[O-]B([O-])[O-] BSVBQGMMJUBVOD-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 239000005526 vasoconstrictor agent Substances 0.000 description 1
- 230000024883 vasodilation Effects 0.000 description 1
- 239000003071 vasodilator agent Substances 0.000 description 1
- 235000019871 vegetable fat Nutrition 0.000 description 1
- 239000011782 vitamin Substances 0.000 description 1
- 235000013343 vitamin Nutrition 0.000 description 1
- 229940088594 vitamin Drugs 0.000 description 1
- 229930003231 vitamin Natural products 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 229940102001 zinc bromide Drugs 0.000 description 1
- 150000003755 zirconium compounds Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/02—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6
- C07D473/04—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/02—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6
- C07D473/04—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms
- C07D473/06—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms with radicals containing only hydrogen and carbon atoms, attached in position 1 or 3
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/28—Drugs for disorders of the nervous system for treating neurodegenerative disorders of the central nervous system, e.g. nootropic agents, cognition enhancers, drugs for treating Alzheimer's disease or other forms of dementia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/08—Vasodilators for multiple indications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
- C07D473/02—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6
- C07D473/04—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms
- C07D473/06—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms with radicals containing only hydrogen and carbon atoms, attached in position 1 or 3
- C07D473/08—Heterocyclic compounds containing purine ring systems with oxygen, sulphur, or nitrogen atoms directly attached in positions 2 and 6 two oxygen atoms with radicals containing only hydrogen and carbon atoms, attached in position 1 or 3 with methyl radicals in positions 1 and 3, e.g. theophylline
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Public Health (AREA)
- Neurosurgery (AREA)
- Heart & Thoracic Surgery (AREA)
- Biomedical Technology (AREA)
- Cardiology (AREA)
- Neurology (AREA)
- Psychiatry (AREA)
- Hospice & Palliative Care (AREA)
- Diabetes (AREA)
- Hematology (AREA)
- Obesity (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Steroid Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19853525801 DE3525801A1 (de) | 1985-07-19 | 1985-07-19 | Tertiaere hydroxyalkylxanthine, verfahren zu ihrer herstellung, die sie enthaltenden arzneimittel und ihre verwendung |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| LTIP1467A LTIP1467A (en) | 1995-05-25 |
| LT3869B true LT3869B (en) | 1996-04-25 |
Family
ID=6276182
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| LTIP1467A LT3869B (en) | 1985-07-19 | 1993-11-12 | Tertiary hydroxyalkylxantines, process for the preparation thereof and pharmaceutical composition containing them |
Country Status (33)
| Country | Link |
|---|---|
| US (1) | US4833146A (cs) |
| EP (1) | EP0268585B1 (cs) |
| JP (1) | JPH0788382B2 (cs) |
| KR (1) | KR950001019B1 (cs) |
| CN (1) | CN1026112C (cs) |
| AR (1) | AR244689A1 (cs) |
| AT (1) | ATE53211T1 (cs) |
| AU (1) | AU588350B2 (cs) |
| BG (1) | BG60767B2 (cs) |
| CA (1) | CA1262248A (cs) |
| CS (1) | CS272766B2 (cs) |
| DD (1) | DD261156A5 (cs) |
| DE (2) | DE3525801A1 (cs) |
| DK (1) | DK157867C (cs) |
| ES (1) | ES2001019A6 (cs) |
| FI (1) | FI89921C (cs) |
| GR (1) | GR861866B (cs) |
| HU (1) | HU198486B (cs) |
| IE (1) | IE59025B1 (cs) |
| IL (1) | IL79457A0 (cs) |
| LT (1) | LT3869B (cs) |
| LV (1) | LV5703A3 (cs) |
| MA (1) | MA20739A1 (cs) |
| MX (1) | MX9254A (cs) |
| NO (1) | NO165803C (cs) |
| NZ (1) | NZ216888A (cs) |
| OA (1) | OA08707A (cs) |
| PH (1) | PH26262A (cs) |
| PT (1) | PT83013B (cs) |
| RU (1) | RU2051918C1 (cs) |
| TN (1) | TNSN86111A1 (cs) |
| WO (1) | WO1987000523A2 (cs) |
| ZA (1) | ZA865374B (cs) |
Families Citing this family (60)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8621870D0 (en) * | 1986-09-11 | 1986-10-15 | Beecham Group Plc | Active compounds |
| US5338741A (en) * | 1986-10-27 | 1994-08-16 | Nestec S.A. | 1-hydroxyalkylxanthines and medicaments containing them |
| JP2661666B2 (ja) * | 1988-02-19 | 1997-10-08 | ヘキスト薬品工業株式会社 | 抗消化性潰瘍剤 |
| GB8826595D0 (en) * | 1988-11-14 | 1988-12-21 | Beecham Wuelfing Gmbh & Co Kg | Active compounds |
| DD298051A5 (de) * | 1989-08-16 | 1992-02-06 | ��@���������@�������k�� | Verfahren zur herstellung eines therapeutischen agens zur behandlung von verdauungskrankheiten |
| GB8924392D0 (en) * | 1989-10-30 | 1989-12-20 | Bayer Ag | Substituted cycloalkano/b/dihydroindole-and-indolesulphonamides |
| EP0430300A3 (en) * | 1989-12-01 | 1992-03-25 | Takeda Chemical Industries, Ltd. | Xanthine derivatives, their production and use |
| DE3942872A1 (de) * | 1989-12-23 | 1991-06-27 | Hoechst Ag | Verfahren zur enantioselektiven darstellung von ((omega)-1)-hydroxyalkylxanthinen |
| IT1240843B (it) * | 1990-05-24 | 1993-12-17 | Malesci Istituto Farmacobiologico | Derivati xantinici 1-7 sostituiti ad attivita' antiasmatica, loro sali fisiologicamente accettabili, loro composizioni farmaceutiche e procedimento per la loro preparazione. |
| DE4019892A1 (de) * | 1990-06-22 | 1992-01-02 | Boehringer Ingelheim Kg | Neue xanthinderivate |
| US5039666A (en) * | 1990-10-30 | 1991-08-13 | Hoechst-Roussel Pharmaceuticals Inc. | Aminoglycoside composition having substantially reduced nephrotoxicity induced by the aminoglycoside |
| DE69119700T2 (de) * | 1990-11-07 | 1996-11-07 | Hoechst Roussel Pharma | Verwendung von Xanthinen zur Herstellung von Arzneimitteln zur Hemmung der Vermehrung menschlicher Retroviren |
| US6420374B1 (en) | 1990-11-30 | 2002-07-16 | Fred Hutchinson Cancer Research Center | Use of xanthines as immunosuppressants and to inhibit allograft reactions |
| MX9203323A (es) * | 1991-07-11 | 1994-07-29 | Hoechst Ag | El empleo de derivados de xantina para el tratamiento de lesiones secundarias de las celulas nerviosas y trastornos funcionales despues de traumas craneo-cerebrales. |
| TW209834B (cs) * | 1991-12-11 | 1993-07-21 | Hoechst Ag | |
| TW288977B (cs) * | 1992-02-22 | 1996-10-21 | Hoechst Ag | |
| WO1993017684A2 (en) * | 1992-03-04 | 1993-09-16 | Cell Therapeutics, Inc. | Enantiomeric hydroxylated xanthine compounds |
| EP0570831A2 (de) * | 1992-05-20 | 1993-11-24 | Hoechst Aktiengesellschaft | Verwendung von Xanthinderivaten zur Behandlung von Nervenschädigungen nach Unterbrechung der Blutzirkulation |
| US5288721A (en) * | 1992-09-22 | 1994-02-22 | Cell Therapeutics, Inc. | Substituted epoxyalkyl xanthines |
| US5817662A (en) * | 1992-11-09 | 1998-10-06 | Cell Therapeutics, Inc. | Substituted amino alkyl compounds |
| US5780476A (en) * | 1992-11-16 | 1998-07-14 | Cell Therapeutics, Inc. | Hydroxyl-containing xanthine compounds |
| US6693105B1 (en) | 1992-11-16 | 2004-02-17 | Cell Therapeutics, Inc. | Hydroxyl-containing compounds |
| US5473070A (en) * | 1992-11-16 | 1995-12-05 | Cell Therapeutics, Inc. | Substituted long chain alcohol xanthine compounds |
| US5866576A (en) * | 1992-12-16 | 1999-02-02 | Cell Therapeutics, Inc. | Epoxide-containing compounds |
| AU6087894A (en) * | 1993-01-14 | 1994-08-15 | Cell Therapeutics, Inc. | Acetal or ketal substituted therapeutic compounds |
| WO1994016704A1 (en) * | 1993-01-19 | 1994-08-04 | Cell Therapeutics, Inc. | Oxime-substituted therapeutic compounds |
| US5641783A (en) * | 1993-11-12 | 1997-06-24 | Cell Therapeutics, Inc. | Substituted amino alcohol compounds |
| US5837703A (en) * | 1993-03-31 | 1998-11-17 | Cell Therapeutics, Inc. | Amino-alcohol substituted cyclic compounds |
| US6020337A (en) * | 1993-04-05 | 2000-02-01 | Cell Therapeutics, Inc. | Electronegative-substituted long chain xanthine compounds |
| CA2192470A1 (en) * | 1994-01-14 | 1995-07-20 | Paul A. Brown | Method for treating diseases mediated by cellular proliferation in response to pdgf, egf, fgf and vegf |
| WO1995022546A1 (en) * | 1994-02-18 | 1995-08-24 | Cell Therapeutics, Inc. | Intracellular signalling mediators |
| US6103730A (en) * | 1994-03-24 | 2000-08-15 | Cell Therapeutics, Inc. | Amine substituted compounds |
| US5801182A (en) * | 1994-03-24 | 1998-09-01 | Cell Therapeutics, Inc. | Amine substituted compounds |
| US5807861A (en) * | 1994-03-24 | 1998-09-15 | Cell Therapeutics, Inc. | Amine substituted xanthinyl compounds |
| DE19540798A1 (de) * | 1995-11-02 | 1997-05-07 | Hoechst Ag | Alkylxanthinphosphonate und Alkylxanthinphosphinoxide und deren Verwendung als Arzneimittel |
| ES2185837T3 (es) * | 1996-06-07 | 2003-05-01 | Hoechst Ag | Utilizacion de derivados de teofilina para el tratamiento y la profilaxis de las enfermedades de choque, nuevos compuestos de xantina y procedimientos para su produccion. |
| US5965555A (en) * | 1996-06-07 | 1999-10-12 | Hoechst Aktiengesellschaft | Xanthine compounds having terminally animated alkynol side chains |
| US5856330A (en) * | 1996-07-31 | 1999-01-05 | Hoechst Aktiengesellschaft | Use of xanthine derivatives for the inhibition of dephosphorylation of cofilin |
| US5981536A (en) * | 1996-07-31 | 1999-11-09 | Hoechst Aktiengesellschaft | Use of xanthine derivatives for the modulation of apoptosis |
| DE19707655A1 (de) * | 1997-02-26 | 1998-08-27 | Hoechst Ag | Kombinationspräparat zur Anwendung bei Demenz |
| US6294350B1 (en) | 1997-06-05 | 2001-09-25 | Dalhousie University | Methods for treating fibroproliferative diseases |
| US5985592A (en) * | 1997-06-05 | 1999-11-16 | Dalhousie University | Uses for pentoxifylline or functional derivatives/metabolites thereof |
| US6075029A (en) * | 1998-01-02 | 2000-06-13 | Cell Therapeutics, Inc. | Xanthine modulators of metabolism of cellular P-450 |
| US20030207901A1 (en) * | 1999-07-27 | 2003-11-06 | Cell Therapeutics, Inc. | Hydroxyl-containing compounds |
| RU2157209C1 (ru) * | 2000-03-23 | 2000-10-10 | Открытое акционерное общество "Химико-фармацевтический комбинат "Акрихин" | Улучшающее мозговое кровообращение, антиагрегатное средство и способ его получения |
| DE10042152A1 (de) * | 2000-08-26 | 2002-03-28 | Basf Coatings Ag | Mit aktinischer Strahlung aktivierbares Thixotropierungsmittel, Verfahren zu seiner Herstellung und seine Verwendung |
| DE10122390A1 (de) * | 2001-05-09 | 2002-11-28 | Basf Coatings Ag | Carbamat-und/oder Allophanatgruppen enthaltende, thermisch härtbare, thixotrope Gemische |
| DE10139262C1 (de) * | 2001-08-09 | 2003-01-02 | Basf Coatings Ag | Rheologiehilfsmittel, Verfahren zu seiner Herstellung und seine Verwendung |
| WO2003091350A1 (de) * | 2002-04-24 | 2003-11-06 | Basf Coatings Ag | Carbamat- und/oder allophanatgruppen enthaltende, thermisch härtbare, thixotrope gemische |
| KR100872788B1 (ko) * | 2002-05-28 | 2008-12-09 | 엘지전자 주식회사 | 드럼세탁기 |
| US8686090B2 (en) * | 2003-12-10 | 2014-04-01 | Basf Coatings Gmbh | Use of urea crystals for non-polymeric coatings |
| US20080081816A1 (en) * | 2006-10-03 | 2008-04-03 | Kaohsiung Medical University | Anti-inflammation activity of newly synthesized xanthine derivatives kmup-1 and kmup-3 |
| CA2716788C (en) * | 2008-02-29 | 2016-08-16 | Concert Pharmaceuticals, Inc. | Deuterium-substituted xanthine derivatives |
| AU2009233315B2 (en) * | 2008-03-31 | 2013-08-29 | Sun Pharmaceutical Industries Ltd. | An improved process for the preparation of morphinane analogues |
| US8263601B2 (en) | 2009-02-27 | 2012-09-11 | Concert Pharmaceuticals, Inc. | Deuterium substituted xanthine derivatives |
| WO2011028820A1 (en) | 2009-09-02 | 2011-03-10 | Concert Pharmaceuticals, Inc. | Substituted derivatives of bicyclic [4.3.0] heteroaryl compounds |
| MX2012002704A (es) | 2009-09-02 | 2012-03-21 | Concert Pharmaceuticals Inc | Derivados de xantina sustituidos. |
| US9085788B2 (en) | 2010-09-01 | 2015-07-21 | Concert Pharmaceuticals, Inc. | Process for preparing an enantiomerically enriched, deuterated secondary alcohol from a corresponding ketone without reducing deuterium incorporation |
| WO2012031073A1 (en) | 2010-09-01 | 2012-03-08 | Concert Pharmaceuticals, Inc. | Process for preparing an enantiomerically enriched, deuterated secondary alcohol from a corresponding ketone without reducing deuterium incorporation |
| WO2013155465A1 (en) | 2012-04-13 | 2013-10-17 | Concert Pharmaceuticals, Inc. | Substituted xanthine derivatives |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1245969B (de) * | 1967-08-03 | VEB Arzneimittelwerk Dresden, Radebeul | Verfahren zur Herstellung von Xanthinderivaten | |
| US2517410A (en) * | 1947-08-15 | 1950-08-01 | Searle & Co | Hydroxy alkyl xanthines and the production thereof |
| FR1211333A (fr) * | 1955-10-19 | 1960-03-15 | Boehringer Sohn Ingelheim | Perfectionnements apportés aux procédés pour fabriquer des oxyalcoylxanthines |
| US4576947A (en) * | 1967-12-16 | 1986-03-18 | Hoechst Aktiengesellschaft | Pharmaceutical compositions |
| DE2335170C2 (de) * | 1973-07-11 | 1989-07-20 | Hoechst Ag, 6230 Frankfurt | 1,3-Dialkyl-7-(hydroxyalkyl)-xanthine, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel |
| BE795345A (fr) * | 1972-02-19 | 1973-08-13 | Albert Ag Chem Werke | MEDICAMENT UTILE NOTAMMENT POUR L'IRRIGATION CEREBRALE, PROCEDE DE PREPARATION DE SES MATIERES ACTIVES ET CES MATIERES ElLES-MEMES |
| CH622519A5 (en) * | 1974-07-05 | 1981-04-15 | Hoechst Ag | Process for the preparation of hydroxyalkylxanthines |
| DE2432702C2 (de) * | 1974-07-08 | 1983-01-20 | Hoechst Ag, 6000 Frankfurt | Verfahren zur Herstellung von Hydroxyalkylxanthinen |
| CA1075690A (en) * | 1974-12-13 | 1980-04-15 | Hoechst Aktiengesellschaft | Xanthine derivatives |
| EP0017478B1 (en) * | 1979-04-05 | 1983-03-30 | BEECHAM - WUELFING GmbH & Co. KG | Dialkoxy- and dioxacycloalkyl-alkyltheobromines, pharmaceutical compositions containing them and their preparation |
| JPS5838284A (ja) * | 1981-09-01 | 1983-03-05 | Teikoku Chem Ind Corp Ltd | 1−(5′−オキソヘキシル)−3,7−ジメチルキサンチンの製造方法 |
| DE3138397A1 (de) * | 1981-09-26 | 1983-04-07 | Hoechst Ag, 6230 Frankfurt | "arzneimittel, darin enthaltene vicinale dihydroxyalkylxanthine und herstellungsverfahren fuer diese xanthinverbindungen" |
| US4575795A (en) * | 1983-04-01 | 1986-03-11 | Honeywell Information Systems Inc. | Apparatus for detecting a predetermined character of a data string |
-
1985
- 1985-07-19 DE DE19853525801 patent/DE3525801A1/de not_active Withdrawn
-
1986
- 1986-07-08 US US07/032,729 patent/US4833146A/en not_active Expired - Lifetime
- 1986-07-08 WO PCT/EP1986/000401 patent/WO1987000523A2/de not_active Ceased
- 1986-07-08 DE DE8686904158T patent/DE3671627D1/de not_active Expired - Fee Related
- 1986-07-08 JP JP61504113A patent/JPH0788382B2/ja not_active Expired - Lifetime
- 1986-07-08 HU HU863670A patent/HU198486B/hu not_active IP Right Cessation
- 1986-07-08 AU AU61439/86A patent/AU588350B2/en not_active Ceased
- 1986-07-08 KR KR1019870700245A patent/KR950001019B1/ko not_active Expired - Fee Related
- 1986-07-08 RU SU864355018A patent/RU2051918C1/ru active
- 1986-07-08 AT AT86904158T patent/ATE53211T1/de not_active IP Right Cessation
- 1986-07-08 EP EP86904158A patent/EP0268585B1/de not_active Expired - Lifetime
- 1986-07-17 ES ES8600356A patent/ES2001019A6/es not_active Expired
- 1986-07-17 PH PH34027A patent/PH26262A/en unknown
- 1986-07-17 DD DD86292595A patent/DD261156A5/de not_active IP Right Cessation
- 1986-07-17 CS CS545386A patent/CS272766B2/cs unknown
- 1986-07-17 GR GR861866A patent/GR861866B/el unknown
- 1986-07-17 NZ NZ216888A patent/NZ216888A/xx unknown
- 1986-07-18 MX MX925486A patent/MX9254A/es unknown
- 1986-07-18 TN TNTNSN86111A patent/TNSN86111A1/fr unknown
- 1986-07-18 MA MA20967A patent/MA20739A1/fr unknown
- 1986-07-18 CN CN86105835A patent/CN1026112C/zh not_active Expired - Lifetime
- 1986-07-18 IL IL79457A patent/IL79457A0/xx not_active IP Right Cessation
- 1986-07-18 CA CA000514174A patent/CA1262248A/en not_active Expired
- 1986-07-18 AR AR86304545A patent/AR244689A1/es active
- 1986-07-18 ZA ZA865374A patent/ZA865374B/xx unknown
- 1986-07-18 IE IE191786A patent/IE59025B1/en not_active IP Right Cessation
- 1986-07-18 PT PT83013A patent/PT83013B/pt not_active IP Right Cessation
-
1987
- 1987-03-18 DK DK139287A patent/DK157867C/da not_active IP Right Cessation
- 1987-03-18 NO NO871111A patent/NO165803C/no not_active IP Right Cessation
-
1988
- 1988-01-15 FI FI880174A patent/FI89921C/fi not_active IP Right Cessation
- 1988-01-18 OA OA59264A patent/OA08707A/xx unknown
-
1993
- 1993-05-05 LV LV930291A patent/LV5703A3/xx unknown
- 1993-11-12 LT LTIP1467A patent/LT3869B/lt not_active IP Right Cessation
-
1994
- 1994-02-23 BG BG098535A patent/BG60767B2/bg unknown
Non-Patent Citations (3)
| Title |
|---|
| MICHAEL H. KARGER, YEHUDA MAZUR: "Methoxymethyl methanesulfonate. Active oxyalkylating agent", J. AM. CHEM. SOC, 1969, pages 5663 - 5665 |
| MÜLLER EUGEN, BAYER OTTO, CRIEGEE RUDOLF: "Methoden der organischen Chemie (Houben-Weyl) ; Bd. 6, 1a", pages: 928 - 940 |
| YEHUDA MAZUR, MICHAEL H. KARGER: "Mixed sulfonic-carboxylic anhydrides. I. Synthesis and thermal stability. New syntheses of sulfonic anhydrides", J. ORG. CHEM., 1971, pages 528 - 531, XP002480436, DOI: doi:10.1021/jo00803a009 |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| LT3869B (en) | Tertiary hydroxyalkylxantines, process for the preparation thereof and pharmaceutical composition containing them | |
| KR100937620B1 (ko) | A2b 아데노신 수용체 길항제 | |
| ES2232871T3 (es) | Nuevos derivados de purina. | |
| JPH0130834B2 (cs) | ||
| JP2002540207A (ja) | ピリミド[6,1−a]イソキノリン−4−オン誘導体 | |
| JP2001525412A (ja) | Pdeiv阻害活性を有するプリン化合物および合成方法 | |
| US20120035192A1 (en) | Selective antagonists of a2a adenosine receptors | |
| US20080188495A1 (en) | A2a adenosine receptor antagonists | |
| JPS5948483A (ja) | 置換9−(1−o−もしくは3−o−モノ置換又は1,3−ジ−o−置換プロポキシメチル)プリン類、これらの製造方法、これらを含む医薬組成物及びウイルス感染の治療方法 | |
| JPH0314314B2 (cs) | ||
| JPS6363547B2 (cs) | ||
| US10045972B2 (en) | Hydroxypyridone derivatives, pharmaceutical compositions thereof, and their therapeutic use for treating inflammatory, neurodegenerative, or immune-mediated diseases | |
| CZ174397A3 (en) | Use of xanthine derivatives for preparing a medicament for treating and prophylaxis of shock diseases, novel xanthine derivatives and process of their preparation | |
| JPS63246378A (ja) | 8−アザキサンチン類、その製法及び医薬組成物 | |
| CS272800B2 (en) | Method of tertiary hydroxyalkylxantine production | |
| ES2368998T3 (es) | Antagonistas del receptor de adenosina a2b. | |
| CN113493459A (zh) | Pde5抑制剂化合物及其制备方法和应用 | |
| PT93122A (pt) | Processo para a preparacao de didesoxinucleosidos isomericos e de composicoes farmaceuticas que os contem | |
| JPS62289580A (ja) | テオフイリンおよびテオブロミンのピペラジン誘導体 | |
| JPH04128285A (ja) | キサンチン誘導体 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM9A | Lapsed patents |
Effective date: 19961112 |