HRP970698A2 - NITROGEN CONTAINING HETEROAROMATICS AS FACTOR Xa INHIBITORS - Google Patents
NITROGEN CONTAINING HETEROAROMATICS AS FACTOR Xa INHIBITORS Download PDFInfo
- Publication number
- HRP970698A2 HRP970698A2 HR08/879,944A HRP970698A HRP970698A2 HR P970698 A2 HRP970698 A2 HR P970698A2 HR P970698 A HRP970698 A HR P970698A HR P970698 A2 HRP970698 A2 HR P970698A2
- Authority
- HR
- Croatia
- Prior art keywords
- aminocarbonyl
- pyrazole
- methyl
- biphen
- phenyl
- Prior art date
Links
- 229910052757 nitrogen Inorganic materials 0.000 title description 42
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 title description 40
- 229940123583 Factor Xa inhibitor Drugs 0.000 title description 5
- 150000002390 heteroarenes Chemical class 0.000 title description 4
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 421
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 335
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 288
- 238000005160 1H NMR spectroscopy Methods 0.000 description 250
- 150000001875 compounds Chemical class 0.000 description 212
- -1 nitrogen-containing heteroaromatic compounds Chemical class 0.000 description 197
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 190
- 238000006243 chemical reaction Methods 0.000 description 184
- 238000002360 preparation method Methods 0.000 description 180
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 178
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 136
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 135
- 239000000203 mixture Substances 0.000 description 124
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 123
- 235000019439 ethyl acetate Nutrition 0.000 description 122
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 118
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 118
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 116
- 239000000243 solution Substances 0.000 description 92
- 239000000047 product Substances 0.000 description 84
- 238000000034 method Methods 0.000 description 82
- 238000000746 purification Methods 0.000 description 80
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 77
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 73
- 239000007787 solid Substances 0.000 description 70
- 239000011541 reaction mixture Substances 0.000 description 62
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Substances C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 60
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 59
- 235000019341 magnesium sulphate Nutrition 0.000 description 59
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 57
- ZHGNHOOVYPHPNJ-UHFFFAOYSA-N Amigdalin Chemical compound FC(F)(F)C(=O)OCC1OC(OCC2OC(OC(C#N)C3=CC=CC=C3)C(OC(=O)C(F)(F)F)C(OC(=O)C(F)(F)F)C2OC(=O)C(F)(F)F)C(OC(=O)C(F)(F)F)C(OC(=O)C(F)(F)F)C1OC(=O)C(F)(F)F ZHGNHOOVYPHPNJ-UHFFFAOYSA-N 0.000 description 56
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 56
- 150000001409 amidines Chemical class 0.000 description 56
- 239000000741 silica gel Substances 0.000 description 55
- 229910002027 silica gel Inorganic materials 0.000 description 55
- 239000013078 crystal Substances 0.000 description 54
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 52
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 52
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 52
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 49
- 125000001309 chloro group Chemical group Cl* 0.000 description 48
- 238000004128 high performance liquid chromatography Methods 0.000 description 48
- 238000010992 reflux Methods 0.000 description 47
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 46
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 46
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 45
- 230000008878 coupling Effects 0.000 description 40
- 238000010168 coupling process Methods 0.000 description 40
- 238000005859 coupling reaction Methods 0.000 description 40
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 40
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 40
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 37
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 36
- 150000003839 salts Chemical class 0.000 description 36
- 150000003536 tetrazoles Chemical class 0.000 description 36
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 35
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 35
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 35
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 34
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 33
- 239000012043 crude product Substances 0.000 description 33
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 31
- 239000000460 chlorine Substances 0.000 description 31
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 30
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 30
- 229910052739 hydrogen Inorganic materials 0.000 description 29
- 238000004458 analytical method Methods 0.000 description 28
- 229910052717 sulfur Inorganic materials 0.000 description 28
- 238000003786 synthesis reaction Methods 0.000 description 28
- 125000000623 heterocyclic group Chemical group 0.000 description 27
- 239000002904 solvent Substances 0.000 description 27
- 230000015572 biosynthetic process Effects 0.000 description 26
- 239000012266 salt solution Substances 0.000 description 26
- 150000001412 amines Chemical class 0.000 description 25
- 238000001228 spectrum Methods 0.000 description 25
- 239000002253 acid Substances 0.000 description 24
- 239000002585 base Substances 0.000 description 24
- 150000002825 nitriles Chemical class 0.000 description 24
- 239000011734 sodium Substances 0.000 description 24
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 23
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 23
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 22
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic acid anhydride Natural products CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 22
- 150000001408 amides Chemical class 0.000 description 22
- 238000004587 chromatography analysis Methods 0.000 description 22
- 235000019441 ethanol Nutrition 0.000 description 22
- 150000003233 pyrroles Chemical class 0.000 description 21
- 238000010183 spectrum analysis Methods 0.000 description 21
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 description 21
- 229920006395 saturated elastomer Polymers 0.000 description 20
- JRAJODNIRCHQMY-UHFFFAOYSA-N 2-(3-cyanophenyl)-5-methylpyrazole-3-carboxylic acid Chemical compound N1=C(C)C=C(C(O)=O)N1C1=CC=CC(C#N)=C1 JRAJODNIRCHQMY-UHFFFAOYSA-N 0.000 description 19
- 229910052801 chlorine Inorganic materials 0.000 description 19
- 150000002148 esters Chemical class 0.000 description 19
- 125000005842 heteroatom Chemical group 0.000 description 19
- 229910052760 oxygen Inorganic materials 0.000 description 19
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- 102100022631 Glutamate receptor ionotropic, NMDA 2C Human genes 0.000 description 18
- PXXJHWLDUBFPOL-UHFFFAOYSA-N benzamidine Chemical compound NC(=N)C1=CC=CC=C1 PXXJHWLDUBFPOL-UHFFFAOYSA-N 0.000 description 18
- 238000003818 flash chromatography Methods 0.000 description 18
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 18
- 238000000524 positive electrospray ionisation mass spectrometry Methods 0.000 description 18
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 18
- 108091008646 testicular receptors Proteins 0.000 description 18
- 229960000583 acetic acid Drugs 0.000 description 17
- 125000000217 alkyl group Chemical group 0.000 description 17
- 125000002837 carbocyclic group Chemical group 0.000 description 17
- 229910052731 fluorine Inorganic materials 0.000 description 17
- 239000010410 layer Substances 0.000 description 17
- 230000002829 reductive effect Effects 0.000 description 17
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 16
- 239000012267 brine Substances 0.000 description 16
- 239000003480 eluent Substances 0.000 description 16
- 238000002953 preparative HPLC Methods 0.000 description 16
- 125000004076 pyridyl group Chemical group 0.000 description 16
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 16
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 15
- 229910052799 carbon Inorganic materials 0.000 description 15
- 239000001257 hydrogen Substances 0.000 description 15
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 14
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 14
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 14
- 150000001299 aldehydes Chemical class 0.000 description 14
- 239000000706 filtrate Substances 0.000 description 14
- 239000000543 intermediate Substances 0.000 description 14
- 238000010561 standard procedure Methods 0.000 description 14
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 14
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 14
- JLTRXTDYQLMHGR-UHFFFAOYSA-N trimethylaluminium Chemical compound C[Al](C)C JLTRXTDYQLMHGR-UHFFFAOYSA-N 0.000 description 14
- 150000002460 imidazoles Chemical class 0.000 description 13
- 125000002883 imidazolyl group Chemical group 0.000 description 13
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 13
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 13
- 239000012071 phase Substances 0.000 description 13
- 239000000651 prodrug Substances 0.000 description 13
- 229940002612 prodrug Drugs 0.000 description 13
- 125000000168 pyrrolyl group Chemical group 0.000 description 13
- 239000000126 substance Substances 0.000 description 13
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 12
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 12
- 108020002076 NR2 subfamily Proteins 0.000 description 12
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 12
- 125000000714 pyrimidinyl group Chemical group 0.000 description 12
- 230000009467 reduction Effects 0.000 description 12
- 238000006722 reduction reaction Methods 0.000 description 12
- 229940124530 sulfonamide Drugs 0.000 description 12
- 239000003153 chemical reaction reagent Substances 0.000 description 11
- 239000012044 organic layer Substances 0.000 description 11
- 229910000029 sodium carbonate Inorganic materials 0.000 description 11
- 235000017550 sodium carbonate Nutrition 0.000 description 11
- 125000001424 substituent group Chemical group 0.000 description 11
- 125000001302 tertiary amino group Chemical group 0.000 description 11
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- 239000004305 biphenyl Substances 0.000 description 10
- 230000003197 catalytic effect Effects 0.000 description 10
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 10
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 10
- 235000017557 sodium bicarbonate Nutrition 0.000 description 10
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- 150000003568 thioethers Chemical class 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 9
- 238000003482 Pinner synthesis reaction Methods 0.000 description 9
- 229910021529 ammonia Inorganic materials 0.000 description 9
- 239000001099 ammonium carbonate Substances 0.000 description 9
- 235000012501 ammonium carbonate Nutrition 0.000 description 9
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 9
- 239000000284 extract Substances 0.000 description 9
- 125000000524 functional group Chemical group 0.000 description 9
- 125000005843 halogen group Chemical group 0.000 description 9
- 239000003921 oil Substances 0.000 description 9
- 235000019198 oils Nutrition 0.000 description 9
- 230000003647 oxidation Effects 0.000 description 9
- 238000007254 oxidation reaction Methods 0.000 description 9
- 229910000027 potassium carbonate Inorganic materials 0.000 description 9
- 125000001544 thienyl group Chemical group 0.000 description 9
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 8
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 8
- SFZULDYEOVSIKM-UHFFFAOYSA-N chembl321317 Chemical compound C1=CC(C(=N)NO)=CC=C1C1=CC=C(C=2C=CC(=CC=2)C(=N)NO)O1 SFZULDYEOVSIKM-UHFFFAOYSA-N 0.000 description 8
- 125000002541 furyl group Chemical group 0.000 description 8
- 125000004193 piperazinyl group Chemical group 0.000 description 8
- 125000003226 pyrazolyl group Chemical group 0.000 description 8
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 8
- 150000003457 sulfones Chemical class 0.000 description 8
- 150000003573 thiols Chemical class 0.000 description 8
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 8
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 7
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 7
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 7
- 238000006069 Suzuki reaction reaction Methods 0.000 description 7
- 230000002378 acidificating effect Effects 0.000 description 7
- 229910052786 argon Inorganic materials 0.000 description 7
- 125000004429 atom Chemical group 0.000 description 7
- 125000003739 carbamimidoyl group Chemical group C(N)(=N)* 0.000 description 7
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 7
- 238000004440 column chromatography Methods 0.000 description 7
- 238000009833 condensation Methods 0.000 description 7
- 230000005494 condensation Effects 0.000 description 7
- 125000004122 cyclic group Chemical group 0.000 description 7
- 238000004108 freeze drying Methods 0.000 description 7
- 239000012948 isocyanate Substances 0.000 description 7
- 150000002513 isocyanates Chemical class 0.000 description 7
- 125000001786 isothiazolyl group Chemical group 0.000 description 7
- 125000000842 isoxazolyl group Chemical group 0.000 description 7
- 125000004674 methylcarbonyl group Chemical group CC(=O)* 0.000 description 7
- 125000002757 morpholinyl group Chemical group 0.000 description 7
- 125000002971 oxazolyl group Chemical group 0.000 description 7
- 125000003386 piperidinyl group Chemical group 0.000 description 7
- 235000015320 potassium carbonate Nutrition 0.000 description 7
- 239000002243 precursor Substances 0.000 description 7
- 125000006239 protecting group Chemical group 0.000 description 7
- 238000004007 reversed phase HPLC Methods 0.000 description 7
- 239000012312 sodium hydride Substances 0.000 description 7
- 229910000104 sodium hydride Inorganic materials 0.000 description 7
- 150000003462 sulfoxides Chemical class 0.000 description 7
- 125000004434 sulfur atom Chemical group 0.000 description 7
- 125000000335 thiazolyl group Chemical group 0.000 description 7
- 125000001399 1,2,3-triazolyl group Chemical group N1N=NC(=C1)* 0.000 description 6
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 6
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 6
- 108010074860 Factor Xa Proteins 0.000 description 6
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 6
- DBTDEFJAFBUGPP-UHFFFAOYSA-N Methanethial Chemical compound S=C DBTDEFJAFBUGPP-UHFFFAOYSA-N 0.000 description 6
- 238000005481 NMR spectroscopy Methods 0.000 description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 125000004093 cyano group Chemical group *C#N 0.000 description 6
- 238000001704 evaporation Methods 0.000 description 6
- 230000008020 evaporation Effects 0.000 description 6
- 239000006260 foam Substances 0.000 description 6
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 description 6
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 6
- HXITXNWTGFUOAU-UHFFFAOYSA-N phenylboronic acid Chemical compound OB(O)C1=CC=CC=C1 HXITXNWTGFUOAU-UHFFFAOYSA-N 0.000 description 6
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 6
- 239000000843 powder Substances 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 6
- LEHBURLTIWGHEM-UHFFFAOYSA-N pyridinium chlorochromate Chemical compound [O-][Cr](Cl)(=O)=O.C1=CC=[NH+]C=C1 LEHBURLTIWGHEM-UHFFFAOYSA-N 0.000 description 6
- 239000012279 sodium borohydride Substances 0.000 description 6
- 229910000033 sodium borohydride Inorganic materials 0.000 description 6
- 150000003456 sulfonamides Chemical class 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 6
- 238000005406 washing Methods 0.000 description 6
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 5
- 125000004502 1,2,3-oxadiazolyl group Chemical group 0.000 description 5
- 125000004511 1,2,3-thiadiazolyl group Chemical group 0.000 description 5
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 5
- 125000001376 1,2,4-triazolyl group Chemical group N1N=C(N=C1)* 0.000 description 5
- 125000004506 1,2,5-oxadiazolyl group Chemical group 0.000 description 5
- 125000004517 1,2,5-thiadiazolyl group Chemical group 0.000 description 5
- 125000001781 1,3,4-oxadiazolyl group Chemical group 0.000 description 5
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 5
- FQVUSLUPETYVCP-UHFFFAOYSA-N 2-(3-cyanophenyl)-5-(trifluoromethyl)pyrazole-3-carboxylic acid Chemical compound OC(=O)C1=CC(C(F)(F)F)=NN1C1=CC=CC(C#N)=C1 FQVUSLUPETYVCP-UHFFFAOYSA-N 0.000 description 5
- JZTPKAROPNTQQV-UHFFFAOYSA-N 3-fluorobenzonitrile Chemical compound FC1=CC=CC(C#N)=C1 JZTPKAROPNTQQV-UHFFFAOYSA-N 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 5
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 5
- 239000005695 Ammonium acetate Substances 0.000 description 5
- 238000006969 Curtius rearrangement reaction Methods 0.000 description 5
- 108020000002 NR3 subfamily Proteins 0.000 description 5
- 108090000190 Thrombin Proteins 0.000 description 5
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 5
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 5
- 235000019257 ammonium acetate Nutrition 0.000 description 5
- 229940043376 ammonium acetate Drugs 0.000 description 5
- BOHPRDIOICLUCK-UHFFFAOYSA-N benzenecarboximidamide;2,2,2-trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.OC(=O)C(F)(F)F.NC(=N)C1=CC=CC=C1 BOHPRDIOICLUCK-UHFFFAOYSA-N 0.000 description 5
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 5
- 125000002619 bicyclic group Chemical group 0.000 description 5
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 5
- OAKJQQAXSVQMHS-UHFFFAOYSA-N hydrazine Substances NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 150000002576 ketones Chemical class 0.000 description 5
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 5
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 description 5
- 125000001715 oxadiazolyl group Chemical group 0.000 description 5
- 150000003217 pyrazoles Chemical class 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- 235000011150 stannous chloride Nutrition 0.000 description 5
- 239000001119 stannous chloride Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 238000006467 substitution reaction Methods 0.000 description 5
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 5
- JRMUNVKIHCOMHV-UHFFFAOYSA-M tetrabutylammonium bromide Chemical compound [Br-].CCCC[N+](CCCC)(CCCC)CCCC JRMUNVKIHCOMHV-UHFFFAOYSA-M 0.000 description 5
- 229960004072 thrombin Drugs 0.000 description 5
- 150000003852 triazoles Chemical class 0.000 description 5
- 125000006569 (C5-C6) heterocyclic group Chemical group 0.000 description 4
- 125000004504 1,2,4-oxadiazolyl group Chemical group 0.000 description 4
- 150000000178 1,2,4-triazoles Chemical class 0.000 description 4
- KOPFEFZSAMLEHK-UHFFFAOYSA-N 1h-pyrazole-5-carboxylic acid Chemical compound OC(=O)C=1C=CNN=1 KOPFEFZSAMLEHK-UHFFFAOYSA-N 0.000 description 4
- WWFYVVSJPJEBBZ-UHFFFAOYSA-N 2-(3-cyanophenyl)-5-methylpyrazole-3-carbonyl chloride Chemical compound N1=C(C)C=C(C(Cl)=O)N1C1=CC=CC(C#N)=C1 WWFYVVSJPJEBBZ-UHFFFAOYSA-N 0.000 description 4
- NJXPYZHXZZCTNI-UHFFFAOYSA-N 3-aminobenzonitrile Chemical compound NC1=CC=CC(C#N)=C1 NJXPYZHXZZCTNI-UHFFFAOYSA-N 0.000 description 4
- TYMLOMAKGOJONV-UHFFFAOYSA-N 4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1 TYMLOMAKGOJONV-UHFFFAOYSA-N 0.000 description 4
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 4
- 239000007818 Grignard reagent Substances 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 4
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 4
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 description 4
- 125000002947 alkylene group Chemical group 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 4
- 239000012298 atmosphere Substances 0.000 description 4
- 125000004603 benzisoxazolyl group Chemical group O1N=C(C2=C1C=CC=C2)* 0.000 description 4
- DMVOXQPQNTYEKQ-UHFFFAOYSA-N biphenyl-4-amine Chemical group C1=CC(N)=CC=C1C1=CC=CC=C1 DMVOXQPQNTYEKQ-UHFFFAOYSA-N 0.000 description 4
- 239000004202 carbamide Substances 0.000 description 4
- 150000001735 carboxylic acids Chemical class 0.000 description 4
- 238000006114 decarboxylation reaction Methods 0.000 description 4
- 238000010511 deprotection reaction Methods 0.000 description 4
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 4
- 208000035475 disorder Diseases 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- 150000002367 halogens Chemical class 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- 125000001041 indolyl group Chemical group 0.000 description 4
- 229910052744 lithium Inorganic materials 0.000 description 4
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 4
- WDWDWGRYHDPSDS-UHFFFAOYSA-N methanimine Chemical compound N=C WDWDWGRYHDPSDS-UHFFFAOYSA-N 0.000 description 4
- 230000004048 modification Effects 0.000 description 4
- 238000012986 modification Methods 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 description 4
- 125000001113 thiadiazolyl group Chemical group 0.000 description 4
- 230000009424 thromboembolic effect Effects 0.000 description 4
- 125000001425 triazolyl group Chemical group 0.000 description 4
- WJKHJLXJJJATHN-UHFFFAOYSA-N triflic anhydride Chemical compound FC(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F WJKHJLXJJJATHN-UHFFFAOYSA-N 0.000 description 4
- 125000000025 triisopropylsilyl group Chemical group C(C)(C)[Si](C(C)C)(C(C)C)* 0.000 description 4
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 description 3
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 3
- YWJXXWUXYPWXGX-UHFFFAOYSA-N 1-(3-cyanophenyl)pyrrole-2-carboxylic acid Chemical compound OC(=O)C1=CC=CN1C1=CC=CC(C#N)=C1 YWJXXWUXYPWXGX-UHFFFAOYSA-N 0.000 description 3
- ZDFBKZUDCQQKAC-UHFFFAOYSA-N 1-bromo-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(Br)C=C1 ZDFBKZUDCQQKAC-UHFFFAOYSA-N 0.000 description 3
- 238000004293 19F NMR spectroscopy Methods 0.000 description 3
- NRKYWOKHZRQRJR-UHFFFAOYSA-N 2,2,2-trifluoroacetamide Chemical compound NC(=O)C(F)(F)F NRKYWOKHZRQRJR-UHFFFAOYSA-N 0.000 description 3
- HZNVUJQVZSTENZ-UHFFFAOYSA-N 2,3-dichloro-5,6-dicyano-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(C#N)=C(C#N)C1=O HZNVUJQVZSTENZ-UHFFFAOYSA-N 0.000 description 3
- MGANJOUQFOPFNS-UHFFFAOYSA-N 2-fluoro-5-hydrazinylbenzonitrile Chemical compound NNC1=CC=C(F)C(C#N)=C1 MGANJOUQFOPFNS-UHFFFAOYSA-N 0.000 description 3
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 3
- ULRPISSMEBPJLN-UHFFFAOYSA-N 2h-tetrazol-5-amine Chemical compound NC1=NN=NN1 ULRPISSMEBPJLN-UHFFFAOYSA-N 0.000 description 3
- VDERABPBRHOLJS-UHFFFAOYSA-N 3-(2-formylpyrrol-1-yl)benzonitrile Chemical compound O=CC1=CC=CN1C1=CC=CC(C#N)=C1 VDERABPBRHOLJS-UHFFFAOYSA-N 0.000 description 3
- WIKRDNYZQFOLCO-UHFFFAOYSA-N 3-(5-amino-3-methylpyrazol-1-yl)benzonitrile Chemical compound N1=C(C)C=C(N)N1C1=CC=CC(C#N)=C1 WIKRDNYZQFOLCO-UHFFFAOYSA-N 0.000 description 3
- WDFQBORIUYODSI-UHFFFAOYSA-N 4-bromoaniline Chemical compound NC1=CC=C(Br)C=C1 WDFQBORIUYODSI-UHFFFAOYSA-N 0.000 description 3
- HHTRAISBAAXRKZ-UHFFFAOYSA-N 5-amino-2-fluorobenzonitrile Chemical compound NC1=CC=C(F)C(C#N)=C1 HHTRAISBAAXRKZ-UHFFFAOYSA-N 0.000 description 3
- XKVUYEYANWFIJX-UHFFFAOYSA-N 5-methyl-1h-pyrazole Chemical compound CC1=CC=NN1 XKVUYEYANWFIJX-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- QMMFVYPAHWMCMS-UHFFFAOYSA-N Dimethyl sulfide Chemical compound CSC QMMFVYPAHWMCMS-UHFFFAOYSA-N 0.000 description 3
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 3
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 3
- 229910017917 NH4 Cl Inorganic materials 0.000 description 3
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical compound O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- JNSBEPKGFVENFS-UHFFFAOYSA-N [2-(trifluoromethyl)phenyl]boronic acid Chemical compound OB(O)C1=CC=CC=C1C(F)(F)F JNSBEPKGFVENFS-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-WFGJKAKNSA-N acetone d6 Chemical compound [2H]C([2H])([2H])C(=O)C([2H])([2H])[2H] CSCPPACGZOOCGX-WFGJKAKNSA-N 0.000 description 3
- PBCJIPOGFJYBJE-UHFFFAOYSA-N acetonitrile;hydrate Chemical compound O.CC#N PBCJIPOGFJYBJE-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 description 3
- 229910052782 aluminium Inorganic materials 0.000 description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 3
- 238000013459 approach Methods 0.000 description 3
- 125000005199 aryl carbonyloxy group Chemical group 0.000 description 3
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 description 3
- 125000004104 aryloxy group Chemical group 0.000 description 3
- 125000004604 benzisothiazolyl group Chemical group S1N=C(C2=C1C=CC=C2)* 0.000 description 3
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 3
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 3
- RROBIDXNTUAHFW-UHFFFAOYSA-N benzotriazol-1-yloxy-tris(dimethylamino)phosphanium Chemical compound C1=CC=C2N(O[P+](N(C)C)(N(C)C)N(C)C)N=NC2=C1 RROBIDXNTUAHFW-UHFFFAOYSA-N 0.000 description 3
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 3
- YNHIGQDRGKUECZ-UHFFFAOYSA-L bis(triphenylphosphine)palladium(ii) dichloride Chemical compound [Cl-].[Cl-].[Pd+2].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-L 0.000 description 3
- 230000023555 blood coagulation Effects 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 238000000451 chemical ionisation Methods 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- BQVVSSAWECGTRN-UHFFFAOYSA-L copper;dithiocyanate Chemical compound [Cu+2].[S-]C#N.[S-]C#N BQVVSSAWECGTRN-UHFFFAOYSA-L 0.000 description 3
- 230000005595 deprotonation Effects 0.000 description 3
- 238000010537 deprotonation reaction Methods 0.000 description 3
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 3
- VWRMYDBREAQNPL-UHFFFAOYSA-N ethyl 1-(3-cyanophenyl)tetrazole-5-carboxylate Chemical compound CCOC(=O)C1=NN=NN1C1=CC=CC(C#N)=C1 VWRMYDBREAQNPL-UHFFFAOYSA-N 0.000 description 3
- NCEPENCYJKZXET-UHFFFAOYSA-N ethyl 2-(3-cyano-4-fluorophenyl)-5-methylpyrazole-3-carboxylate Chemical compound CCOC(=O)C1=CC(C)=NN1C1=CC=C(F)C(C#N)=C1 NCEPENCYJKZXET-UHFFFAOYSA-N 0.000 description 3
- ZIWYSZPIDHPIIS-UHFFFAOYSA-N ethyl 5-butyl-2-(3-cyanophenyl)pyrazole-3-carboxylate Chemical compound N1=C(CCCC)C=C(C(=O)OCC)N1C1=CC=CC(C#N)=C1 ZIWYSZPIDHPIIS-UHFFFAOYSA-N 0.000 description 3
- 150000004795 grignard reagents Chemical class 0.000 description 3
- 150000002431 hydrogen Chemical group 0.000 description 3
- 239000003112 inhibitor Substances 0.000 description 3
- 125000005438 isoindazolyl group Chemical group 0.000 description 3
- 125000003971 isoxazolinyl group Chemical group 0.000 description 3
- 239000011777 magnesium Substances 0.000 description 3
- 229910052749 magnesium Inorganic materials 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 125000002950 monocyclic group Chemical group 0.000 description 3
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 3
- 231100000252 nontoxic Toxicity 0.000 description 3
- 230000003000 nontoxic effect Effects 0.000 description 3
- 125000004430 oxygen atom Chemical group O* 0.000 description 3
- 229920000728 polyester Polymers 0.000 description 3
- 150000003141 primary amines Chemical class 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 230000002441 reversible effect Effects 0.000 description 3
- 238000007363 ring formation reaction Methods 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- DYHSDKLCOJIUFX-UHFFFAOYSA-N tert-butoxycarbonyl anhydride Chemical compound CC(C)(C)OC(=O)OC(=O)OC(C)(C)C DYHSDKLCOJIUFX-UHFFFAOYSA-N 0.000 description 3
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 description 3
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 3
- 239000011701 zinc Substances 0.000 description 3
- 229910052725 zinc Inorganic materials 0.000 description 3
- QXBWTYBCNFKURT-UHFFFAOYSA-N (2-methylsulfanylphenyl)boronic acid Chemical compound CSC1=CC=CC=C1B(O)O QXBWTYBCNFKURT-UHFFFAOYSA-N 0.000 description 2
- MOOOGTOEKZWEJA-UHFFFAOYSA-N (3-methylthiophen-2-yl)boronic acid Chemical compound CC=1C=CSC=1B(O)O MOOOGTOEKZWEJA-UHFFFAOYSA-N 0.000 description 2
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 description 2
- 125000004916 (C1-C6) alkylcarbonyl group Chemical group 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- VSKXABQKAPPZBR-UHFFFAOYSA-N 1-(3-bromophenyl)-4-methoxy-5-methyl-3-(trifluoromethyl)pyrazole Chemical compound N1=C(C(F)(F)F)C(OC)=C(C)N1C1=CC=CC(Br)=C1 VSKXABQKAPPZBR-UHFFFAOYSA-N 0.000 description 2
- FLQZDRHGMHQDHM-UHFFFAOYSA-N 1-(4-nitrophenyl)benzimidazole Chemical compound C1=CC([N+](=O)[O-])=CC=C1N1C2=CC=CC=C2N=C1 FLQZDRHGMHQDHM-UHFFFAOYSA-N 0.000 description 2
- PUCOOPJLAXJKOO-UHFFFAOYSA-N 1-(4-nitrophenyl)imidazole Chemical compound C1=CC([N+](=O)[O-])=CC=C1N1C=NC=C1 PUCOOPJLAXJKOO-UHFFFAOYSA-N 0.000 description 2
- NHYHTYJIILODSA-UHFFFAOYSA-N 1-(4-nitrophenyl)tetrazole Chemical compound C1=CC([N+](=O)[O-])=CC=C1N1N=NN=C1 NHYHTYJIILODSA-UHFFFAOYSA-N 0.000 description 2
- XXJGBENTLXFVFI-UHFFFAOYSA-N 1-amino-methylene Chemical compound N[CH2] XXJGBENTLXFVFI-UHFFFAOYSA-N 0.000 description 2
- YLRBJYMANQKEAW-UHFFFAOYSA-N 1-bromo-4-(bromomethyl)benzene Chemical compound BrCC1=CC=C(Br)C=C1 YLRBJYMANQKEAW-UHFFFAOYSA-N 0.000 description 2
- 125000005955 1H-indazolyl group Chemical group 0.000 description 2
- NKWCGTOZTHZDHB-UHFFFAOYSA-N 1h-imidazol-1-ium-4-carboxylate Chemical compound OC(=O)C1=CNC=N1 NKWCGTOZTHZDHB-UHFFFAOYSA-N 0.000 description 2
- WAUGGYPDCQZJKK-UHFFFAOYSA-N 1h-pyrrol-3-amine Chemical class NC=1C=CNC=1 WAUGGYPDCQZJKK-UHFFFAOYSA-N 0.000 description 2
- LEHZBHSKVAXLCR-UHFFFAOYSA-N 1h-pyrrole-3-thiol Chemical class SC=1C=CNC=1 LEHZBHSKVAXLCR-UHFFFAOYSA-N 0.000 description 2
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 2
- XTRBYUHWHOHGKT-UHFFFAOYSA-N 2-(3-carbamimidoylphenyl)-5-methyl-n-(3-phenylpropyl)pyrazole-3-carboxamide Chemical compound C=1C=CC(C(N)=N)=CC=1N1N=C(C)C=C1C(=O)NCCCC1=CC=CC=C1 XTRBYUHWHOHGKT-UHFFFAOYSA-N 0.000 description 2
- MWXXSCAGBBSFHI-UHFFFAOYSA-N 2-(3-carbamimidoylphenyl)-5-methyl-n-(4-piperidin-1-ylsulfonylphenyl)pyrazole-3-carboxamide Chemical compound C=1C=CC(C(N)=N)=CC=1N1N=C(C)C=C1C(=O)NC(C=C1)=CC=C1S(=O)(=O)N1CCCCC1 MWXXSCAGBBSFHI-UHFFFAOYSA-N 0.000 description 2
- JOIGRZLCDQUNIN-UHFFFAOYSA-N 2-(3-carbamimidoylphenyl)-5-methyl-n-(4-propan-2-yloxyphenyl)pyrazole-3-carboxamide Chemical compound C1=CC(OC(C)C)=CC=C1NC(=O)C1=CC(C)=NN1C1=CC=CC(C(N)=N)=C1 JOIGRZLCDQUNIN-UHFFFAOYSA-N 0.000 description 2
- XZMAAHLEADWNNR-UHFFFAOYSA-N 2-(3-carbamimidoylphenyl)-5-methyl-n-[3-(pyridin-2-ylmethylamino)phenyl]pyrazole-3-carboxamide Chemical compound C=1C=CC(C(N)=N)=CC=1N1N=C(C)C=C1C(=O)NC(C=1)=CC=CC=1NCC1=CC=CC=N1 XZMAAHLEADWNNR-UHFFFAOYSA-N 0.000 description 2
- FUPYBPPDEBXUIT-UHFFFAOYSA-N 2-(3-carbamimidoylphenyl)-5-methyl-n-[4-(piperidine-1-carbonyl)phenyl]pyrazole-3-carboxamide Chemical compound C=1C=CC(C(N)=N)=CC=1N1N=C(C)C=C1C(=O)NC(C=C1)=CC=C1C(=O)N1CCCCC1 FUPYBPPDEBXUIT-UHFFFAOYSA-N 0.000 description 2
- ZVQHHOCZEHTVHY-UHFFFAOYSA-N 2-(3-cyano-n-ethylanilino)acetic acid Chemical compound OC(=O)CN(CC)C1=CC=CC(C#N)=C1 ZVQHHOCZEHTVHY-UHFFFAOYSA-N 0.000 description 2
- KBARBWXXBVBPAM-UHFFFAOYSA-N 2-(3-cyano-n-nitrosoanilino)acetic acid Chemical compound OC(=O)CN(N=O)C1=CC=CC(C#N)=C1 KBARBWXXBVBPAM-UHFFFAOYSA-N 0.000 description 2
- ZXEFJAWHZVPDKS-UHFFFAOYSA-N 2-[(3-cyanophenyl)azaniumyl]acetate Chemical compound OC(=O)CNC1=CC=CC(C#N)=C1 ZXEFJAWHZVPDKS-UHFFFAOYSA-N 0.000 description 2
- ZYHQGITXIJDDKC-UHFFFAOYSA-N 2-[2-(2-aminophenyl)ethyl]aniline Chemical group NC1=CC=CC=C1CCC1=CC=CC=C1N ZYHQGITXIJDDKC-UHFFFAOYSA-N 0.000 description 2
- HCHMZNZTBNBAHG-UHFFFAOYSA-N 2-[4-(bromomethyl)-3-chlorophenyl]-n-tert-butylbenzenesulfonamide Chemical group CC(C)(C)NS(=O)(=O)C1=CC=CC=C1C1=CC=C(CBr)C(Cl)=C1 HCHMZNZTBNBAHG-UHFFFAOYSA-N 0.000 description 2
- FBPINGSGHKXIQA-UHFFFAOYSA-N 2-amino-3-(2-carboxyethylsulfanyl)propanoic acid Chemical compound OC(=O)C(N)CSCCC(O)=O FBPINGSGHKXIQA-UHFFFAOYSA-N 0.000 description 2
- SCVJRXQHFJXZFZ-KVQBGUIXSA-N 2-amino-9-[(2r,4s,5r)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3h-purine-6-thione Chemical class C1=2NC(N)=NC(=S)C=2N=CN1[C@H]1C[C@H](O)[C@@H](CO)O1 SCVJRXQHFJXZFZ-KVQBGUIXSA-N 0.000 description 2
- GEJFFFJUVXSVCT-UHFFFAOYSA-N 2-chloro-4-morpholin-4-ylaniline Chemical compound C1=C(Cl)C(N)=CC=C1N1CCOCC1 GEJFFFJUVXSVCT-UHFFFAOYSA-N 0.000 description 2
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 2
- WCSZDMUTWBSGAW-UHFFFAOYSA-N 2-fluoro-4-(2-methylsulfonylphenyl)aniline Chemical group CS(=O)(=O)C1=CC=CC=C1C1=CC=C(N)C(F)=C1 WCSZDMUTWBSGAW-UHFFFAOYSA-N 0.000 description 2
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 2
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 2
- GSDHPOQTEXEBDN-UHFFFAOYSA-N 2-methyl-1-(4-nitrophenyl)imidazole Chemical compound CC1=NC=CN1C1=CC=C([N+]([O-])=O)C=C1 GSDHPOQTEXEBDN-UHFFFAOYSA-N 0.000 description 2
- GUGQQGROXHPINL-UHFFFAOYSA-N 2-oxobutanoyl chloride Chemical compound CCC(=O)C(Cl)=O GUGQQGROXHPINL-UHFFFAOYSA-N 0.000 description 2
- LJGHYPLBDBRCRZ-UHFFFAOYSA-N 3-(3-aminophenyl)sulfonylaniline Chemical group NC1=CC=CC(S(=O)(=O)C=2C=C(N)C=CC=2)=C1 LJGHYPLBDBRCRZ-UHFFFAOYSA-N 0.000 description 2
- WTFWFZRLWVPBLD-UHFFFAOYSA-N 3-(4-bromo-2-formylpyrrol-1-yl)benzonitrile Chemical compound C1=C(Br)C=C(C=O)N1C1=CC=CC(C#N)=C1 WTFWFZRLWVPBLD-UHFFFAOYSA-N 0.000 description 2
- MKLGZRDYUTXEAP-UHFFFAOYSA-N 3-[5-[(4-bromophenyl)sulfamoyl]-3-methylpyrazol-1-yl]benzenecarboximidamide Chemical compound N1=C(C)C=C(S(=O)(=O)NC=2C=CC(Br)=CC=2)N1C1=CC=CC(C(N)=N)=C1 MKLGZRDYUTXEAP-UHFFFAOYSA-N 0.000 description 2
- VLRGXXKFHVJQOL-UHFFFAOYSA-N 3-chloropentane-2,4-dione Chemical compound CC(=O)C(Cl)C(C)=O VLRGXXKFHVJQOL-UHFFFAOYSA-N 0.000 description 2
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 2
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 2
- OLRXCKFWRROJFZ-UHFFFAOYSA-N 3-hydrazinylbenzonitrile;hydrochloride Chemical compound [Cl-].[NH3+]NC1=CC=CC(C#N)=C1 OLRXCKFWRROJFZ-UHFFFAOYSA-N 0.000 description 2
- WTSYEEOMLMUPSN-UHFFFAOYSA-N 3-imidazol-1-ylbenzonitrile Chemical compound N#CC1=CC=CC(N2C=NC=C2)=C1 WTSYEEOMLMUPSN-UHFFFAOYSA-N 0.000 description 2
- 108020004021 3-ketosteroid receptors Proteins 0.000 description 2
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 2
- XXKIAELSMMDZRB-UHFFFAOYSA-N 3-pyrrol-1-ylbenzonitrile Chemical compound N#CC1=CC=CC(N2C=CC=C2)=C1 XXKIAELSMMDZRB-UHFFFAOYSA-N 0.000 description 2
- JRRAUWWVBVECPY-UHFFFAOYSA-N 4-(tetrazol-1-yl)aniline Chemical compound C1=CC(N)=CC=C1N1N=NN=C1 JRRAUWWVBVECPY-UHFFFAOYSA-N 0.000 description 2
- 125000004801 4-cyanophenyl group Chemical group [H]C1=C([H])C(C#N)=C([H])C([H])=C1* 0.000 description 2
- JLNMBIKJQAKQBH-UHFFFAOYSA-N 4-cyclohexylaniline Chemical compound C1=CC(N)=CC=C1C1CCCCC1 JLNMBIKJQAKQBH-UHFFFAOYSA-N 0.000 description 2
- PHNDZBFLOPIMSM-UHFFFAOYSA-N 4-morpholin-4-ylaniline Chemical compound C1=CC(N)=CC=C1N1CCOCC1 PHNDZBFLOPIMSM-UHFFFAOYSA-N 0.000 description 2
- 125000005986 4-piperidonyl group Chemical group 0.000 description 2
- 125000002471 4H-quinolizinyl group Chemical group C=1(C=CCN2C=CC=CC12)* 0.000 description 2
- UJLNOXSOXZZLQX-UHFFFAOYSA-N 5-(2-methylsulfonylphenyl)pyridin-2-amine;hydrochloride Chemical compound Cl.CS(=O)(=O)C1=CC=CC=C1C1=CC=C(N)N=C1 UJLNOXSOXZZLQX-UHFFFAOYSA-N 0.000 description 2
- KJMJKGBKXASHSV-UHFFFAOYSA-N 5-(2-methylsulfonylphenyl)pyrimidin-2-amine;hydrochloride Chemical compound Cl.CS(=O)(=O)C1=CC=CC=C1C1=CN=C(N)N=C1 KJMJKGBKXASHSV-UHFFFAOYSA-N 0.000 description 2
- ZTTSDMBKAKCPBZ-UHFFFAOYSA-N 5-butyl-2-(3-cyanophenyl)pyrazole-3-carboxylic acid Chemical compound N1=C(CCCC)C=C(C(O)=O)N1C1=CC=CC(C#N)=C1 ZTTSDMBKAKCPBZ-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 239000004342 Benzoyl peroxide Substances 0.000 description 2
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical group [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- AIJULSRZWUXGPQ-UHFFFAOYSA-N Methylglyoxal Chemical compound CC(=O)C=O AIJULSRZWUXGPQ-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 238000006859 Swern oxidation reaction Methods 0.000 description 2
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 2
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 238000005874 Vilsmeier-Haack formylation reaction Methods 0.000 description 2
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 2
- 238000005903 acid hydrolysis reaction Methods 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 230000009435 amidation Effects 0.000 description 2
- 238000007112 amidation reaction Methods 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical compound [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 150000001448 anilines Chemical class 0.000 description 2
- MMCPOSDMTGQNKG-UHFFFAOYSA-N anilinium chloride Chemical compound Cl.NC1=CC=CC=C1 MMCPOSDMTGQNKG-UHFFFAOYSA-N 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 150000001491 aromatic compounds Chemical class 0.000 description 2
- 150000003937 benzamidines Chemical class 0.000 description 2
- 235000019400 benzoyl peroxide Nutrition 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 125000002618 bicyclic heterocycle group Chemical group 0.000 description 2
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- 235000010216 calcium carbonate Nutrition 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 238000006555 catalytic reaction Methods 0.000 description 2
- 238000010531 catalytic reduction reaction Methods 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 238000005660 chlorination reaction Methods 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- CHHJDCVKYCVTHD-UHFFFAOYSA-N chloromethyl formate Chemical compound ClCOC=O CHHJDCVKYCVTHD-UHFFFAOYSA-N 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- ILIBSNFYCSCTMD-UHFFFAOYSA-N copper diisocyanate Chemical compound [Cu++].[N-]=C=O.[N-]=C=O ILIBSNFYCSCTMD-UHFFFAOYSA-N 0.000 description 2
- 239000007822 coupling agent Substances 0.000 description 2
- 239000013058 crude material Substances 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- NLUNLVTVUDIHFE-UHFFFAOYSA-N cyclooctylcyclooctane Chemical compound C1CCCCCCC1C1CCCCCCC1 NLUNLVTVUDIHFE-UHFFFAOYSA-N 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- NNBZCPXTIHJBJL-UHFFFAOYSA-N decalin Chemical compound C1CCCC2CCCCC21 NNBZCPXTIHJBJL-UHFFFAOYSA-N 0.000 description 2
- 238000007865 diluting Methods 0.000 description 2
- 239000000539 dimer Substances 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 238000007336 electrophilic substitution reaction Methods 0.000 description 2
- JCVIQZGQEJMZOV-UHFFFAOYSA-N ethyl 1-(3-bromophenyl)-5-methylpyrazole-3-carboxylate Chemical compound N1=C(C(=O)OCC)C=C(C)N1C1=CC=CC(Br)=C1 JCVIQZGQEJMZOV-UHFFFAOYSA-N 0.000 description 2
- NDBUCFLWLTZNDG-UHFFFAOYSA-N ethyl 2-(3-bromophenyl)-5-methylpyrazole-3-carboxylate Chemical compound CCOC(=O)C1=CC(C)=NN1C1=CC=CC(Br)=C1 NDBUCFLWLTZNDG-UHFFFAOYSA-N 0.000 description 2
- MOHBDDPICKNHEW-UHFFFAOYSA-N ethyl 2-(3-cyanophenyl)-5-methylpyrazole-3-carboxylate Chemical compound CCOC(=O)C1=CC(C)=NN1C1=CC=CC(C#N)=C1 MOHBDDPICKNHEW-UHFFFAOYSA-N 0.000 description 2
- QKVKGYAZEBLNHO-UHFFFAOYSA-N ethyl 2-[(3-cyanophenyl)methyl]-5-methylpyrazole-3-carboxylate Chemical compound CCOC(=O)C1=CC(C)=NN1CC1=CC=CC(C#N)=C1 QKVKGYAZEBLNHO-UHFFFAOYSA-N 0.000 description 2
- JFFLSLDQYCGGNH-UHFFFAOYSA-N ethyl 2-[(4-cyanophenyl)methyl]-5-methylpyrazole-3-carboxylate Chemical compound CCOC(=O)C1=CC(C)=NN1CC1=CC=C(C#N)C=C1 JFFLSLDQYCGGNH-UHFFFAOYSA-N 0.000 description 2
- JBEHAOGLPHSQSL-UHFFFAOYSA-N ethyl 2h-tetrazole-5-carboxylate Chemical compound CCOC(=O)C=1N=NNN=1 JBEHAOGLPHSQSL-UHFFFAOYSA-N 0.000 description 2
- ZPMZOGKBRQLMQG-UHFFFAOYSA-N ethyl 3-(3-cyanophenyl)prop-2-ynoate Chemical compound CCOC(=O)C#CC1=CC=CC(C#N)=C1 ZPMZOGKBRQLMQG-UHFFFAOYSA-N 0.000 description 2
- CEIPQQODRKXDSB-UHFFFAOYSA-N ethyl 3-(6-hydroxynaphthalen-2-yl)-1H-indazole-5-carboximidate dihydrochloride Chemical compound Cl.Cl.C1=C(O)C=CC2=CC(C3=NNC4=CC=C(C=C43)C(=N)OCC)=CC=C21 CEIPQQODRKXDSB-UHFFFAOYSA-N 0.000 description 2
- BOTXQJAHRCGJEG-UHFFFAOYSA-N ethyl 5-methyl-1h-pyrazole-3-carboxylate Chemical compound CCOC(=O)C=1C=C(C)NN=1 BOTXQJAHRCGJEG-UHFFFAOYSA-N 0.000 description 2
- FMVJYQGSRWVMQV-UHFFFAOYSA-N ethyl propiolate Chemical compound CCOC(=O)C#C FMVJYQGSRWVMQV-UHFFFAOYSA-N 0.000 description 2
- 238000002290 gas chromatography-mass spectrometry Methods 0.000 description 2
- 229940093915 gynecological organic acid Drugs 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 125000001475 halogen functional group Chemical group 0.000 description 2
- 150000002429 hydrazines Chemical class 0.000 description 2
- 150000004678 hydrides Chemical class 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 125000001841 imino group Chemical group [H]N=* 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- NONOKGVFTBWRLD-UHFFFAOYSA-N isocyanatosulfanylimino(oxo)methane Chemical class O=C=NSN=C=O NONOKGVFTBWRLD-UHFFFAOYSA-N 0.000 description 2
- 125000005647 linker group Chemical group 0.000 description 2
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 2
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 238000001819 mass spectrum Methods 0.000 description 2
- 230000001404 mediated effect Effects 0.000 description 2
- MMTQIPPUQMMTCD-UHFFFAOYSA-N methyl 1-(3-cyanophenyl)imidazole-2-carboxylate Chemical compound COC(=O)C1=NC=CN1C1=CC=CC(C#N)=C1 MMTQIPPUQMMTCD-UHFFFAOYSA-N 0.000 description 2
- AQIAIZBHFAKICS-UHFFFAOYSA-N methylaminomethyl Chemical compound [CH2]NC AQIAIZBHFAKICS-UHFFFAOYSA-N 0.000 description 2
- ZGEGCLOFRBLKSE-UHFFFAOYSA-N methylene hexane Natural products CCCCCC=C ZGEGCLOFRBLKSE-UHFFFAOYSA-N 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- BQTKEIMARVWUAP-UHFFFAOYSA-N o-methyl 2-(3-cyanophenyl)-5-methylpyrazole-3-carbothioate Chemical compound COC(=S)C1=CC(C)=NN1C1=CC=CC(C#N)=C1 BQTKEIMARVWUAP-UHFFFAOYSA-N 0.000 description 2
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 2
- 239000004533 oil dispersion Substances 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 150000002902 organometallic compounds Chemical class 0.000 description 2
- 125000000160 oxazolidinyl group Chemical group 0.000 description 2
- 230000037361 pathway Effects 0.000 description 2
- 238000005897 peptide coupling reaction Methods 0.000 description 2
- 235000011181 potassium carbonates Nutrition 0.000 description 2
- 239000012286 potassium permanganate Substances 0.000 description 2
- 238000012545 processing Methods 0.000 description 2
- 125000001042 pteridinyl group Chemical group N1=C(N=CC2=NC=CN=C12)* 0.000 description 2
- 125000003373 pyrazinyl group Chemical group 0.000 description 2
- 125000002098 pyridazinyl group Chemical group 0.000 description 2
- 125000002112 pyrrolidino group Chemical group [*]N1C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000006268 reductive amination reaction Methods 0.000 description 2
- 125000006413 ring segment Chemical group 0.000 description 2
- 238000007127 saponification reaction Methods 0.000 description 2
- 239000003521 serotonin 5-HT1 receptor agonist Substances 0.000 description 2
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 238000006277 sulfonation reaction Methods 0.000 description 2
- 150000003458 sulfonic acid derivatives Chemical class 0.000 description 2
- 150000003460 sulfonic acids Chemical class 0.000 description 2
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 2
- 235000011149 sulphuric acid Nutrition 0.000 description 2
- DMHILFAMOKMHSO-UHFFFAOYSA-N tert-butyl n-(4-bromo-2-fluorophenyl)carbamate Chemical compound CC(C)(C)OC(=O)NC1=CC=C(Br)C=C1F DMHILFAMOKMHSO-UHFFFAOYSA-N 0.000 description 2
- AVJZDKRYPXHWDM-UHFFFAOYSA-N tert-butyl n-(5-bromopyridin-2-yl)-n-[(2-methylpropan-2-yl)oxycarbonyl]carbamate Chemical compound CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)C1=CC=C(Br)C=N1 AVJZDKRYPXHWDM-UHFFFAOYSA-N 0.000 description 2
- GDKYABNFMXOTAN-UHFFFAOYSA-N tert-butyl n-(5-bromopyrimidin-2-yl)-n-[(2-methylpropan-2-yl)oxycarbonyl]carbamate Chemical compound CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)C1=NC=C(Br)C=N1 GDKYABNFMXOTAN-UHFFFAOYSA-N 0.000 description 2
- DIWWZVFHGNWBBT-UHFFFAOYSA-N tert-butyl n-[(2-methylpropan-2-yl)oxycarbonyl]-n-[5-(2-methylsulfanylphenyl)pyridin-2-yl]carbamate Chemical compound CSC1=CC=CC=C1C1=CC=C(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)N=C1 DIWWZVFHGNWBBT-UHFFFAOYSA-N 0.000 description 2
- LGAVDIZCFHRLRJ-UHFFFAOYSA-N tert-butyl n-[(2-methylpropan-2-yl)oxycarbonyl]-n-[5-(2-methylsulfanylphenyl)pyrimidin-2-yl]carbamate Chemical compound CSC1=CC=CC=C1C1=CN=C(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)N=C1 LGAVDIZCFHRLRJ-UHFFFAOYSA-N 0.000 description 2
- WRRWQJHGYFNSNN-UHFFFAOYSA-N tert-butyl n-[(2-methylpropan-2-yl)oxycarbonyl]-n-[5-(2-methylsulfonylphenyl)pyrimidin-2-yl]carbamate Chemical compound C1=NC(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)=NC=C1C1=CC=CC=C1S(C)(=O)=O WRRWQJHGYFNSNN-UHFFFAOYSA-N 0.000 description 2
- DLLSIIVEFWLOGT-UHFFFAOYSA-N tert-butyl n-[2-fluoro-4-(2-methylsulfanylphenyl)phenyl]carbamate Chemical group CSC1=CC=CC=C1C1=CC=C(NC(=O)OC(C)(C)C)C(F)=C1 DLLSIIVEFWLOGT-UHFFFAOYSA-N 0.000 description 2
- YRZSQDWWVKJVQY-UHFFFAOYSA-N tert-butyl n-[2-fluoro-4-(2-methylsulfonylphenyl)phenyl]carbamate Chemical group C1=C(F)C(NC(=O)OC(C)(C)C)=CC=C1C1=CC=CC=C1S(C)(=O)=O YRZSQDWWVKJVQY-UHFFFAOYSA-N 0.000 description 2
- 229940124597 therapeutic agent Drugs 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- 125000003396 thiol group Chemical group [H]S* 0.000 description 2
- 229910000406 trisodium phosphate Inorganic materials 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- PHCYUJRYSFMJMG-UHFFFAOYSA-N (2-bromophenyl)hydrazine;hydron;chloride Chemical compound Cl.NNC1=CC=CC=C1Br PHCYUJRYSFMJMG-UHFFFAOYSA-N 0.000 description 1
- PESJTQQZJJTNOC-UHFFFAOYSA-N (3-bromophenyl)hydrazine Chemical compound NNC1=CC=CC(Br)=C1 PESJTQQZJJTNOC-UHFFFAOYSA-N 0.000 description 1
- RPYIPFXHIKXRKS-UHFFFAOYSA-N (3-bromophenyl)hydrazine;hydron;chloride Chemical compound Cl.NNC1=CC=CC(Br)=C1 RPYIPFXHIKXRKS-UHFFFAOYSA-N 0.000 description 1
- MAYZWDRUFKUGGP-VIFPVBQESA-N (3s)-1-[5-tert-butyl-3-[(1-methyltetrazol-5-yl)methyl]triazolo[4,5-d]pyrimidin-7-yl]pyrrolidin-3-ol Chemical compound CN1N=NN=C1CN1C2=NC(C(C)(C)C)=NC(N3C[C@@H](O)CC3)=C2N=N1 MAYZWDRUFKUGGP-VIFPVBQESA-N 0.000 description 1
- BVYUYDBWQMSOKM-UHFFFAOYSA-N (4-bromophenyl)methanamine;hydron;chloride Chemical compound Cl.NCC1=CC=C(Br)C=C1 BVYUYDBWQMSOKM-UHFFFAOYSA-N 0.000 description 1
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 description 1
- JOTLBZRQYMMANO-ARJAWSKDSA-N (Z)-3-methoxy-2-(2,2,2-trichloroacetyl)but-2-enoic acid Chemical compound CO\C(C)=C(/C(O)=O)C(=O)C(Cl)(Cl)Cl JOTLBZRQYMMANO-ARJAWSKDSA-N 0.000 description 1
- DEIBXAPEZDJDRC-UHFFFAOYSA-M (dimethylaminomethylideneamino)methylidene-dimethylazanium;chloride Chemical compound [Cl-].CN(C)C=NC=[N+](C)C DEIBXAPEZDJDRC-UHFFFAOYSA-M 0.000 description 1
- DELJOESCKJGFML-DUXPYHPUSA-N (e)-3-aminobut-2-enenitrile Chemical compound C\C(N)=C/C#N DELJOESCKJGFML-DUXPYHPUSA-N 0.000 description 1
- ZGYIXVSQHOKQRZ-COIATFDQSA-N (e)-n-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-[(3s)-oxolan-3-yl]oxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide Chemical compound N#CC1=CN=C2C=C(O[C@@H]3COCC3)C(NC(=O)/C=C/CN(C)C)=CC2=C1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 ZGYIXVSQHOKQRZ-COIATFDQSA-N 0.000 description 1
- ODIGIKRIUKFKHP-UHFFFAOYSA-N (n-propan-2-yloxycarbonylanilino) acetate Chemical compound CC(C)OC(=O)N(OC(C)=O)C1=CC=CC=C1 ODIGIKRIUKFKHP-UHFFFAOYSA-N 0.000 description 1
- SHXHPUAKLCCLDV-UHFFFAOYSA-N 1,1,1-trifluoropentane-2,4-dione Chemical compound CC(=O)CC(=O)C(F)(F)F SHXHPUAKLCCLDV-UHFFFAOYSA-N 0.000 description 1
- APQIUTYORBAGEZ-UHFFFAOYSA-N 1,1-dibromoethane Chemical compound CC(Br)Br APQIUTYORBAGEZ-UHFFFAOYSA-N 0.000 description 1
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- XBYRMPXUBGMOJC-UHFFFAOYSA-N 1,2-dihydropyrazol-3-one Chemical compound OC=1C=CNN=1 XBYRMPXUBGMOJC-UHFFFAOYSA-N 0.000 description 1
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 1
- APWRZPQBPCAXFP-UHFFFAOYSA-N 1-(1-oxo-2H-isoquinolin-5-yl)-5-(trifluoromethyl)-N-[2-(trifluoromethyl)pyridin-4-yl]pyrazole-4-carboxamide Chemical compound O=C1NC=CC2=C(C=CC=C12)N1N=CC(=C1C(F)(F)F)C(=O)NC1=CC(=NC=C1)C(F)(F)F APWRZPQBPCAXFP-UHFFFAOYSA-N 0.000 description 1
- BHTZCIGVYSJBQB-UHFFFAOYSA-N 1-(1h-pyrazol-5-yl)ethanone Chemical compound CC(=O)C=1C=CNN=1 BHTZCIGVYSJBQB-UHFFFAOYSA-N 0.000 description 1
- VWOJSRICSKDKAW-UHFFFAOYSA-N 1-(4-nitrophenyl)piperazine Chemical compound C1=CC([N+](=O)[O-])=CC=C1N1CCNCC1 VWOJSRICSKDKAW-UHFFFAOYSA-N 0.000 description 1
- ABDDQTDRAHXHOC-QMMMGPOBSA-N 1-[(7s)-5,7-dihydro-4h-thieno[2,3-c]pyran-7-yl]-n-methylmethanamine Chemical compound CNC[C@@H]1OCCC2=C1SC=C2 ABDDQTDRAHXHOC-QMMMGPOBSA-N 0.000 description 1
- QLXYKKHCYOZZQU-UHFFFAOYSA-N 1-[2-(trifluoromethylsulfanyl)phenyl]cyclohexa-2,4-dien-1-amine Chemical group C=1C=CC=C(SC(F)(F)F)C=1C1(N)CC=CC=C1 QLXYKKHCYOZZQU-UHFFFAOYSA-N 0.000 description 1
- QLLAXIJDFUORDI-UHFFFAOYSA-N 1-[6-amino-6-[2-(trifluoromethylsulfanyl)phenyl]cyclohexa-2,4-dien-1-yl]-3,3,3-trifluoropropan-1-one Chemical group C=1C=CC=C(SC(F)(F)F)C=1C1(N)C=CC=CC1C(=O)CC(F)(F)F QLLAXIJDFUORDI-UHFFFAOYSA-N 0.000 description 1
- KBLPBARVTPBUNQ-UHFFFAOYSA-N 1-benzylsulfonylpiperidin-4-amine Chemical compound C1CC(N)CCN1S(=O)(=O)CC1=CC=CC=C1 KBLPBARVTPBUNQ-UHFFFAOYSA-N 0.000 description 1
- RWXUNIMBRXGNEP-UHFFFAOYSA-N 1-bromo-2-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC=C1Br RWXUNIMBRXGNEP-UHFFFAOYSA-N 0.000 description 1
- IWRJVJJQWGZKMT-UHFFFAOYSA-N 1-bromo-2-(trifluoromethylsulfanyl)benzene Chemical compound FC(F)(F)SC1=CC=CC=C1Br IWRJVJJQWGZKMT-UHFFFAOYSA-N 0.000 description 1
- ALAQDUSTXPEHMH-UHFFFAOYSA-N 1-bromo-2-methylsulfanylbenzene Chemical compound CSC1=CC=CC=C1Br ALAQDUSTXPEHMH-UHFFFAOYSA-N 0.000 description 1
- WFQDTOYDVUWQMS-UHFFFAOYSA-N 1-fluoro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C=C1 WFQDTOYDVUWQMS-UHFFFAOYSA-N 0.000 description 1
- AVFZOVWCLRSYKC-UHFFFAOYSA-N 1-methylpyrrolidine Chemical compound CN1CCCC1 AVFZOVWCLRSYKC-UHFFFAOYSA-N 0.000 description 1
- LYUPJHVGLFETDG-UHFFFAOYSA-N 1-phenylbutan-2-ol Chemical compound CCC(O)CC1=CC=CC=C1 LYUPJHVGLFETDG-UHFFFAOYSA-N 0.000 description 1
- 238000001644 13C nuclear magnetic resonance spectroscopy Methods 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- BAXOFTOLAUCFNW-UHFFFAOYSA-N 1H-indazole Chemical compound C1=CC=C2C=NNC2=C1 BAXOFTOLAUCFNW-UHFFFAOYSA-N 0.000 description 1
- KJUGUADJHNHALS-UHFFFAOYSA-N 1H-tetrazole Substances C=1N=NNN=1 KJUGUADJHNHALS-UHFFFAOYSA-N 0.000 description 1
- KOPFEFZSAMLEHK-UHFFFAOYSA-M 1h-pyrazole-5-carboxylate Chemical compound [O-]C(=O)C=1C=CNN=1 KOPFEFZSAMLEHK-UHFFFAOYSA-M 0.000 description 1
- BLMWCZBKCOBVAM-UHFFFAOYSA-N 2,2,2-trifluoro-n-(4-nitrophenyl)acetamide Chemical compound [O-][N+](=O)C1=CC=C(NC(=O)C(F)(F)F)C=C1 BLMWCZBKCOBVAM-UHFFFAOYSA-N 0.000 description 1
- VGJWVEYTYIBXIA-UHFFFAOYSA-N 2,2,2-trifluoroethane-1,1-diol Chemical compound OC(O)C(F)(F)F VGJWVEYTYIBXIA-UHFFFAOYSA-N 0.000 description 1
- GFISDBXSWQMOND-UHFFFAOYSA-N 2,5-dimethoxyoxolane Chemical compound COC1CCC(OC)O1 GFISDBXSWQMOND-UHFFFAOYSA-N 0.000 description 1
- BFNIFSOJXBTFKR-UHFFFAOYSA-N 2-(1-aminocyclohexa-2,4-dien-1-yl)-n-tert-butylbenzenesulfonamide Chemical group CC(C)(C)NS(=O)(=O)C1=CC=CC=C1C1(N)C=CC=CC1 BFNIFSOJXBTFKR-UHFFFAOYSA-N 0.000 description 1
- LYRJBTOWQROLBP-UHFFFAOYSA-N 2-(3-cyanophenyl)-4-ethyl-5-methylpyrazole-3-carboxylic acid Chemical compound OC(=O)C1=C(CC)C(C)=NN1C1=CC=CC(C#N)=C1 LYRJBTOWQROLBP-UHFFFAOYSA-N 0.000 description 1
- JXXGWWIUQVDWEF-UHFFFAOYSA-N 2-(3-cyanophenyl)-4-methoxy-5-(trifluoromethyl)pyrazole-3-carboxylic acid Chemical compound OC(=O)C1=C(OC)C(C(F)(F)F)=NN1C1=CC=CC(C#N)=C1 JXXGWWIUQVDWEF-UHFFFAOYSA-N 0.000 description 1
- LAAVOASESNVMQA-UHFFFAOYSA-N 2-(4-aminophenyl)-n-tert-butylbenzenesulfonamide Chemical group CC(C)(C)NS(=O)(=O)C1=CC=CC=C1C1=CC=C(N)C=C1 LAAVOASESNVMQA-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- IVKFWEWZAQSPRN-UHFFFAOYSA-N 2-[(3-cyanophenyl)methyl]-5-methylpyrazole-3-carboxylic acid Chemical compound N1=C(C)C=C(C(O)=O)N1CC1=CC=CC(C#N)=C1 IVKFWEWZAQSPRN-UHFFFAOYSA-N 0.000 description 1
- IVMCMLUAEHCPOR-UHFFFAOYSA-N 2-[(4-cyanophenyl)methyl]-5-methyl-1H-pyrazole-3,3-dicarboxylic acid Chemical compound N1C(C)=CC(C(O)=O)(C(O)=O)N1CC1=CC=C(C#N)C=C1 IVMCMLUAEHCPOR-UHFFFAOYSA-N 0.000 description 1
- WSJVJRIJBNSYLK-UHFFFAOYSA-N 2-[(4-cyanophenyl)methyl]-5-methylpyrazole-3-carboxylic acid Chemical compound N1=C(C)C=C(C(O)=O)N1CC1=CC=C(C#N)C=C1 WSJVJRIJBNSYLK-UHFFFAOYSA-N 0.000 description 1
- SWJHMCGSQUMGMO-UHFFFAOYSA-N 2-[3-(aminomethyl)phenyl]-n-[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]-5-(trifluoromethyl)pyrazole-3-carboxamide Chemical compound CC1=NC=CN1C(C(=C1)F)=CC=C1NC(=O)C1=CC(C(F)(F)F)=NN1C1=CC=CC(CN)=C1 SWJHMCGSQUMGMO-UHFFFAOYSA-N 0.000 description 1
- IEKZDAYHUACDSC-QRQIAZFYSA-N 2-[[5-(3,4-dimethoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-n-[(z)-[4-(dimethylamino)phenyl]methylideneamino]acetamide Chemical compound C1=C(OC)C(OC)=CC=C1C(N1C=2C=CC=CC=2)=NN=C1SCC(=O)N\N=C/C1=CC=C(N(C)C)C=C1 IEKZDAYHUACDSC-QRQIAZFYSA-N 0.000 description 1
- 125000005273 2-acetoxybenzoic acid group Chemical group 0.000 description 1
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 1
- IQHSSYROJYPFDV-UHFFFAOYSA-N 2-bromo-1,3-dichloro-5-(trifluoromethyl)benzene Chemical group FC(F)(F)C1=CC(Cl)=C(Br)C(Cl)=C1 IQHSSYROJYPFDV-UHFFFAOYSA-N 0.000 description 1
- RGHQKFQZGLKBCF-UHFFFAOYSA-N 2-bromoethyl acetate Chemical compound CC(=O)OCCBr RGHQKFQZGLKBCF-UHFFFAOYSA-N 0.000 description 1
- YLACBMHBZVYOAP-UHFFFAOYSA-N 2-fluoro-5-nitrobenzonitrile Chemical compound [O-][N+](=O)C1=CC=C(F)C(C#N)=C1 YLACBMHBZVYOAP-UHFFFAOYSA-N 0.000 description 1
- CSDSSGBPEUDDEE-UHFFFAOYSA-N 2-formylpyridine Chemical compound O=CC1=CC=CC=N1 CSDSSGBPEUDDEE-UHFFFAOYSA-N 0.000 description 1
- LXBGSDVWAMZHDD-UHFFFAOYSA-N 2-methyl-1h-imidazole Chemical compound CC1=NC=CN1 LXBGSDVWAMZHDD-UHFFFAOYSA-N 0.000 description 1
- XNIHZNNZJHYHLC-UHFFFAOYSA-M 2-oxohexanoate Chemical compound CCCCC(=O)C([O-])=O XNIHZNNZJHYHLC-UHFFFAOYSA-M 0.000 description 1
- QQZTUJMRDPQJQN-UHFFFAOYSA-N 2-phenyl-1H-imidazole-5-carboximidamide Chemical class NC(=N)C1=CNC(C=2C=CC=CC=2)=N1 QQZTUJMRDPQJQN-UHFFFAOYSA-N 0.000 description 1
- HCDMJFOHIXMBOV-UHFFFAOYSA-N 3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-8-(morpholin-4-ylmethyl)-4,7-dihydropyrrolo[4,5]pyrido[1,2-d]pyrimidin-2-one Chemical compound C=1C2=C3N(CC)C(=O)N(C=4C(=C(OC)C=C(OC)C=4F)F)CC3=CN=C2NC=1CN1CCOCC1 HCDMJFOHIXMBOV-UHFFFAOYSA-N 0.000 description 1
- XAKWXRNVLHIDDI-UHFFFAOYSA-N 3-(4-aminophenyl)-1,1-dimethylurea Chemical compound CN(C)C(=O)NC1=CC=C(N)C=C1 XAKWXRNVLHIDDI-UHFFFAOYSA-N 0.000 description 1
- BYHQTRFJOGIQAO-GOSISDBHSA-N 3-(4-bromophenyl)-8-[(2R)-2-hydroxypropyl]-1-[(3-methoxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decan-2-one Chemical compound C[C@H](CN1CCC2(CC1)CN(C(=O)N2CC3=CC(=CC=C3)OC)C4=CC=C(C=C4)Br)O BYHQTRFJOGIQAO-GOSISDBHSA-N 0.000 description 1
- CVKOOKPNCVYHNY-UHFFFAOYSA-N 3-(bromomethyl)benzonitrile Chemical compound BrCC1=CC=CC(C#N)=C1 CVKOOKPNCVYHNY-UHFFFAOYSA-N 0.000 description 1
- BWYLTVHMQNRDQV-UHFFFAOYSA-N 3-[1-[(4-bromophenyl)methyl]tetrazol-5-yl]benzonitrile Chemical compound C1=CC(Br)=CC=C1CN1C(C=2C=C(C=CC=2)C#N)=NN=N1 BWYLTVHMQNRDQV-UHFFFAOYSA-N 0.000 description 1
- WNEODWDFDXWOLU-QHCPKHFHSA-N 3-[3-(hydroxymethyl)-4-[1-methyl-5-[[5-[(2s)-2-methyl-4-(oxetan-3-yl)piperazin-1-yl]pyridin-2-yl]amino]-6-oxopyridin-3-yl]pyridin-2-yl]-7,7-dimethyl-1,2,6,8-tetrahydrocyclopenta[3,4]pyrrolo[3,5-b]pyrazin-4-one Chemical compound C([C@@H](N(CC1)C=2C=NC(NC=3C(N(C)C=C(C=3)C=3C(=C(N4C(C5=CC=6CC(C)(C)CC=6N5CC4)=O)N=CC=3)CO)=O)=CC=2)C)N1C1COC1 WNEODWDFDXWOLU-QHCPKHFHSA-N 0.000 description 1
- AEKHAWFSWHUVIB-UHFFFAOYSA-N 3-[4-methoxy-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]benzonitrile Chemical compound N1=C(C(F)(F)F)C(OC)=C(C)N1C1=CC=CC(C#N)=C1 AEKHAWFSWHUVIB-UHFFFAOYSA-N 0.000 description 1
- ZHENZDVVZGREQA-UHFFFAOYSA-N 3-[5-(bromomethyl)-4-methoxy-3-(trifluoromethyl)pyrazol-1-yl]benzonitrile Chemical compound N1=C(C(F)(F)F)C(OC)=C(CBr)N1C1=CC=CC(C#N)=C1 ZHENZDVVZGREQA-UHFFFAOYSA-N 0.000 description 1
- YFWXWRNUCHZCQM-UHFFFAOYSA-N 3-[5-(hydroxymethyl)-3-(trifluoromethyl)pyrazol-1-yl]benzonitrile Chemical compound OCC1=CC(C(F)(F)F)=NN1C1=CC=CC(C#N)=C1 YFWXWRNUCHZCQM-UHFFFAOYSA-N 0.000 description 1
- CCGSYRHGIZXTOX-UHFFFAOYSA-N 3-[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]benzonitrile Chemical compound CC1=CC(C(F)(F)F)=NN1C1=CC=CC(C#N)=C1 CCGSYRHGIZXTOX-UHFFFAOYSA-N 0.000 description 1
- ZZHFDFIWLDELCX-UHFFFAOYSA-N 3-bromo-1h-pyrrole Chemical compound BrC=1C=CNC=1 ZZHFDFIWLDELCX-UHFFFAOYSA-N 0.000 description 1
- BGARPMGQRREXLN-UHFFFAOYSA-N 3-iodobenzonitrile Chemical compound IC1=CC=CC(C#N)=C1 BGARPMGQRREXLN-UHFFFAOYSA-N 0.000 description 1
- AORUEVNIFNOHDR-UHFFFAOYSA-N 3-isocyanatosulfanylbenzonitrile Chemical compound O=C=NSC1=CC=CC(C#N)=C1 AORUEVNIFNOHDR-UHFFFAOYSA-N 0.000 description 1
- VJTNHUAQYLLSRE-UHFFFAOYSA-N 3-n-(pyridin-2-ylmethyl)benzene-1,3-diamine Chemical compound NC1=CC=CC(NCC=2N=CC=CC=2)=C1 VJTNHUAQYLLSRE-UHFFFAOYSA-N 0.000 description 1
- XJCVRTZCHMZPBD-UHFFFAOYSA-N 3-nitroaniline Chemical compound NC1=CC=CC([N+]([O-])=O)=C1 XJCVRTZCHMZPBD-UHFFFAOYSA-N 0.000 description 1
- GSBDHQDPAGRRJE-UHFFFAOYSA-N 4-(1h-imidazol-2-yl)aniline Chemical compound C1=CC(N)=CC=C1C1=NC=CN1 GSBDHQDPAGRRJE-UHFFFAOYSA-N 0.000 description 1
- IEZCMVRWKNEHJB-UHFFFAOYSA-N 4-(2-methylimidazol-1-yl)aniline Chemical compound CC1=NC=CN1C1=CC=C(N)C=C1 IEZCMVRWKNEHJB-UHFFFAOYSA-N 0.000 description 1
- DDXKAGIILGJQOZ-UHFFFAOYSA-N 4-(2-methylsulfonylphenyl)aniline Chemical group CS(=O)(=O)C1=CC=CC=C1C1=CC=C(N)C=C1 DDXKAGIILGJQOZ-UHFFFAOYSA-N 0.000 description 1
- DWGWNNCHJPKZNC-UHFFFAOYSA-N 4-(4-chlorophenyl)-1,3-thiazol-2-amine Chemical compound S1C(N)=NC(C=2C=CC(Cl)=CC=2)=C1 DWGWNNCHJPKZNC-UHFFFAOYSA-N 0.000 description 1
- DWYMPMWWYZEKLQ-UHFFFAOYSA-N 4-(benzimidazol-1-yl)aniline Chemical compound C1=CC(N)=CC=C1N1C2=CC=CC=C2N=C1 DWYMPMWWYZEKLQ-UHFFFAOYSA-N 0.000 description 1
- UMLFTCYAQPPZER-UHFFFAOYSA-N 4-(bromomethyl)benzonitrile Chemical compound BrCC1=CC=C(C#N)C=C1 UMLFTCYAQPPZER-UHFFFAOYSA-N 0.000 description 1
- LOQLDQJTSMKBJU-UHFFFAOYSA-N 4-(chloromethyl)benzonitrile Chemical compound ClCC1=CC=C(C#N)C=C1 LOQLDQJTSMKBJU-UHFFFAOYSA-N 0.000 description 1
- LJCVZUUEHDTQQS-UHFFFAOYSA-N 4-[4-(4-carbamimidoylphenyl)-1h-pyrrol-2-yl]benzenecarboximidamide Chemical compound C1=CC(C(=N)N)=CC=C1C1=CNC(C=2C=CC(=CC=2)C(N)=N)=C1 LJCVZUUEHDTQQS-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- BABGMPQXLCJMSK-UHFFFAOYSA-N 4-amino-n,n-dimethylbenzenesulfonamide Chemical compound CN(C)S(=O)(=O)C1=CC=C(N)C=C1 BABGMPQXLCJMSK-UHFFFAOYSA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- XEJAJZSTMLRDKH-UHFFFAOYSA-N 4-amino-n-tert-butylbenzenesulfonamide Chemical compound CC(C)(C)NS(=O)(=O)C1=CC=C(N)C=C1 XEJAJZSTMLRDKH-UHFFFAOYSA-N 0.000 description 1
- GAMYYCRTACQSBR-UHFFFAOYSA-N 4-azabenzimidazole Chemical compound C1=CC=C2NC=NC2=N1 GAMYYCRTACQSBR-UHFFFAOYSA-N 0.000 description 1
- WVGCPEDBFHEHEZ-UHFFFAOYSA-N 4-bromo-1h-pyrazole Chemical compound BrC=1C=NNC=1 WVGCPEDBFHEHEZ-UHFFFAOYSA-N 0.000 description 1
- INMZDDDQLHKGPF-UHFFFAOYSA-N 4-bromo-2-chloroaniline Chemical compound NC1=CC=C(Br)C=C1Cl INMZDDDQLHKGPF-UHFFFAOYSA-N 0.000 description 1
- GZRMNMGWNKSANY-UHFFFAOYSA-N 4-bromo-2-fluoroaniline Chemical compound NC1=CC=C(Br)C=C1F GZRMNMGWNKSANY-UHFFFAOYSA-N 0.000 description 1
- KMMHZIBWCXYAAH-UHFFFAOYSA-N 4-bromobenzenesulfonyl chloride Chemical compound ClS(=O)(=O)C1=CC=C(Br)C=C1 KMMHZIBWCXYAAH-UHFFFAOYSA-N 0.000 description 1
- ZOLUACWHRMUETA-UHFFFAOYSA-N 4-chloro-1h-pyrazole-5-carboxylic acid Chemical compound OC(=O)C=1NN=CC=1Cl ZOLUACWHRMUETA-UHFFFAOYSA-N 0.000 description 1
- BYQMUVAEWOWYTC-UHFFFAOYSA-N 4-cyclopentyloxyaniline Chemical compound C1=CC(N)=CC=C1OC1CCCC1 BYQMUVAEWOWYTC-UHFFFAOYSA-N 0.000 description 1
- LVOASPZGXNAHJI-UHFFFAOYSA-N 4-imidazol-1-ylaniline Chemical compound C1=CC(N)=CC=C1N1C=NC=C1 LVOASPZGXNAHJI-UHFFFAOYSA-N 0.000 description 1
- LLNQWPTUJJYTTE-UHFFFAOYSA-N 4-iodopyrazole Chemical compound IC=1C=NNC=1 LLNQWPTUJJYTTE-UHFFFAOYSA-N 0.000 description 1
- QNGVNLMMEQUVQK-UHFFFAOYSA-N 4-n,4-n-diethylbenzene-1,4-diamine Chemical compound CCN(CC)C1=CC=C(N)C=C1 QNGVNLMMEQUVQK-UHFFFAOYSA-N 0.000 description 1
- NKJIFDNZPGLLSH-UHFFFAOYSA-N 4-nitrobenzonitrile Chemical compound [O-][N+](=O)C1=CC=C(C#N)C=C1 NKJIFDNZPGLLSH-UHFFFAOYSA-N 0.000 description 1
- ODGIMMLDVSWADK-UHFFFAOYSA-N 4-trifluoromethylaniline Chemical compound NC1=CC=C(C(F)(F)F)C=C1 ODGIMMLDVSWADK-UHFFFAOYSA-N 0.000 description 1
- 125000004199 4-trifluoromethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C(F)(F)F 0.000 description 1
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical class C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 1
- CYBHWCLUGRHMCK-UHFFFAOYSA-N 4aH-carbazole Chemical compound C1=CC=C2C3C=CC=CC3=NC2=C1 CYBHWCLUGRHMCK-UHFFFAOYSA-N 0.000 description 1
- SFZSPSXVNGQVTG-UHFFFAOYSA-N 5-(4-nitrophenyl)-2-(trifluoromethyl)tetrazole Chemical compound C1=CC([N+](=O)[O-])=CC=C1C1=NN(C(F)(F)F)N=N1 SFZSPSXVNGQVTG-UHFFFAOYSA-N 0.000 description 1
- IRPVABHDSJVBNZ-RTHVDDQRSA-N 5-[1-(cyclopropylmethyl)-5-[(1R,5S)-3-(oxetan-3-yl)-3-azabicyclo[3.1.0]hexan-6-yl]pyrazol-3-yl]-3-(trifluoromethyl)pyridin-2-amine Chemical compound C1=C(C(F)(F)F)C(N)=NC=C1C1=NN(CC2CC2)C(C2[C@@H]3CN(C[C@@H]32)C2COC2)=C1 IRPVABHDSJVBNZ-RTHVDDQRSA-N 0.000 description 1
- XHZWFUVEKDDQPF-UHFFFAOYSA-N 5-bromo-1h-pyrazole Chemical class BrC1=CC=NN1 XHZWFUVEKDDQPF-UHFFFAOYSA-N 0.000 description 1
- WGOLHUGPTDEKCF-UHFFFAOYSA-N 5-bromopyridin-2-amine Chemical compound NC1=CC=C(Br)C=N1 WGOLHUGPTDEKCF-UHFFFAOYSA-N 0.000 description 1
- UHRHPPKWXSNZLR-UHFFFAOYSA-N 5-bromopyrimidin-2-amine Chemical compound NC1=NC=C(Br)C=N1 UHRHPPKWXSNZLR-UHFFFAOYSA-N 0.000 description 1
- BQRBAXFOPZRMCU-UHFFFAOYSA-N 5-chloro-1h-imidazole Chemical class ClC1=CN=CN1 BQRBAXFOPZRMCU-UHFFFAOYSA-N 0.000 description 1
- KCBWAFJCKVKYHO-UHFFFAOYSA-N 6-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-1-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]pyrazolo[3,4-d]pyrimidine Chemical compound C1(CC1)C1=NC=NC(=C1C1=NC=C2C(=N1)N(N=C2)CC1=CC=C(C=C1)C=1N(C=C(N=1)C(F)(F)F)C(C)C)OC KCBWAFJCKVKYHO-UHFFFAOYSA-N 0.000 description 1
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 1
- IVRMZWNICZWHMI-UHFFFAOYSA-N Azide Chemical compound [N-]=[N+]=[N-] IVRMZWNICZWHMI-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- XCGFINNQLNINSO-UHFFFAOYSA-N CCOC(=O)CC(=O)C1=CC=CC(C#N)=C1Br Chemical compound CCOC(=O)CC(=O)C1=CC=CC(C#N)=C1Br XCGFINNQLNINSO-UHFFFAOYSA-N 0.000 description 1
- 101100516568 Caenorhabditis elegans nhr-7 gene Proteins 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical class CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 1
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- 108010014172 Factor V Proteins 0.000 description 1
- 102000009123 Fibrin Human genes 0.000 description 1
- 108010073385 Fibrin Proteins 0.000 description 1
- BWGVNKXGVNDBDI-UHFFFAOYSA-N Fibrin monomer Chemical compound CNC(=O)CNC(=O)CN BWGVNKXGVNDBDI-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 1
- 238000003445 Hantzsch reaction Methods 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- 238000006945 Knorr synthesis reaction Methods 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- WAEMQWOKJMHJLA-UHFFFAOYSA-N Manganese(2+) Chemical compound [Mn+2] WAEMQWOKJMHJLA-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- AHVYPIQETPWLSZ-UHFFFAOYSA-N N-methyl-pyrrolidine Natural products CN1CC=CC1 AHVYPIQETPWLSZ-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- IDRGFNPZDVBSSE-UHFFFAOYSA-N OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F Chemical compound OCCN1CCN(CC1)c1ccc(Nc2ncc3cccc(-c4cccc(NC(=O)C=C)c4)c3n2)c(F)c1F IDRGFNPZDVBSSE-UHFFFAOYSA-N 0.000 description 1
- 239000012425 OXONE® Substances 0.000 description 1
- 229910019201 POBr3 Inorganic materials 0.000 description 1
- 238000006086 Paal-Knorr synthesis reaction Methods 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 108010094028 Prothrombin Proteins 0.000 description 1
- 102100027378 Prothrombin Human genes 0.000 description 1
- 101000605527 Rattus norvegicus Kallikrein-1 Proteins 0.000 description 1
- 238000006680 Reformatsky reaction Methods 0.000 description 1
- 229910021604 Rhodium(III) chloride Inorganic materials 0.000 description 1
- 229910005948 SO2Cl Inorganic materials 0.000 description 1
- 229910018162 SeO2 Inorganic materials 0.000 description 1
- 102000012479 Serine Proteases Human genes 0.000 description 1
- 108010022999 Serine Proteases Proteins 0.000 description 1
- 238000007351 Smiles rearrangement reaction Methods 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 102000057032 Tissue Kallikreins Human genes 0.000 description 1
- GCTFWCDSFPMHHS-UHFFFAOYSA-M Tributyltin chloride Chemical compound CCCC[Sn](Cl)(CCCC)CCCC GCTFWCDSFPMHHS-UHFFFAOYSA-M 0.000 description 1
- 108090000631 Trypsin Proteins 0.000 description 1
- 102000004142 Trypsin Human genes 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- BBAWTPDTGRXPDG-UHFFFAOYSA-N [1,3]thiazolo[4,5-b]pyridine Chemical compound C1=CC=C2SC=NC2=N1 BBAWTPDTGRXPDG-UHFFFAOYSA-N 0.000 description 1
- TUEIURIZJQRMQE-UHFFFAOYSA-N [2-(tert-butylsulfamoyl)phenyl]boronic acid Chemical compound CC(C)(C)NS(=O)(=O)C1=CC=CC=C1B(O)O TUEIURIZJQRMQE-UHFFFAOYSA-N 0.000 description 1
- UVSSPWOKVSKHCU-UHFFFAOYSA-N [2-(trifluoromethyl)phenoxy]boronic acid Chemical compound OB(O)OC1=CC=CC=C1C(F)(F)F UVSSPWOKVSKHCU-UHFFFAOYSA-N 0.000 description 1
- YZFXTNHSDOYGQK-UHFFFAOYSA-N [4-amino-2-(3,3,3-trifluoropropanoyl)phenyl]boronic acid Chemical compound NC1=CC(=C(C=C1)B(O)O)C(CC(F)(F)F)=O YZFXTNHSDOYGQK-UHFFFAOYSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- GLRAHDCHUZLKKC-UHFFFAOYSA-N acetonitrile;2,2,2-trifluoroacetic acid;hydrate Chemical compound O.CC#N.OC(=O)C(F)(F)F GLRAHDCHUZLKKC-UHFFFAOYSA-N 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 150000001263 acyl chlorides Chemical class 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 238000004220 aggregation Methods 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 238000006668 aldol addition reaction Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 208000026935 allergic disease Diseases 0.000 description 1
- 150000001371 alpha-amino acids Chemical class 0.000 description 1
- 235000008206 alpha-amino acids Nutrition 0.000 description 1
- 230000003321 amplification Effects 0.000 description 1
- 239000005557 antagonist Substances 0.000 description 1
- 239000003146 anticoagulant agent Substances 0.000 description 1
- 239000000010 aprotic solvent Substances 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 1
- 150000001499 aryl bromides Chemical class 0.000 description 1
- 238000005447 aza-Wittig reaction Methods 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 125000004931 azocinyl group Chemical group N1=C(C=CC=CC=C1)* 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- DZXMLNHELXXZGY-UHFFFAOYSA-N benzonitrile;1h-pyrazole Chemical compound C=1C=NNC=1.N#CC1=CC=CC=C1 DZXMLNHELXXZGY-UHFFFAOYSA-N 0.000 description 1
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 1
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 1
- 125000004935 benzoxazolinyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000005512 benztetrazolyl group Chemical group 0.000 description 1
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 1
- 229910000085 borane Inorganic materials 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 125000005620 boronic acid group Chemical class 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- KDPAWGWELVVRCH-UHFFFAOYSA-M bromoacetate Chemical compound [O-]C(=O)CBr KDPAWGWELVVRCH-UHFFFAOYSA-M 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- 125000004623 carbolinyl group Chemical group 0.000 description 1
- XEVRDFDBXJMZFG-UHFFFAOYSA-N carbonyl dihydrazine Chemical compound NNC(=O)NN XEVRDFDBXJMZFG-UHFFFAOYSA-N 0.000 description 1
- 230000006315 carbonylation Effects 0.000 description 1
- 238000005810 carbonylation reaction Methods 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 210000004027 cell Anatomy 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- VXIVSQZSERGHQP-UHFFFAOYSA-N chloroacetamide Chemical compound NC(=O)CCl VXIVSQZSERGHQP-UHFFFAOYSA-N 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N chlorosulfonic acid Substances OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 1
- 125000004230 chromenyl group Chemical group O1C(C=CC2=CC=CC=C12)* 0.000 description 1
- 230000035602 clotting Effects 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- UWCHSDIUMBNDLT-UHFFFAOYSA-L copper;methylsulfanylmethane;dibromide Chemical compound CSC.Br[Cu]Br UWCHSDIUMBNDLT-UHFFFAOYSA-L 0.000 description 1
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 description 1
- 238000006352 cycloaddition reaction Methods 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- XSYZCZPCBXYQTE-UHFFFAOYSA-N cyclodecylcyclodecane Chemical compound C1CCCCCCCCC1C1CCCCCCCCC1 XSYZCZPCBXYQTE-UHFFFAOYSA-N 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000004856 decahydroquinolinyl group Chemical group N1(CCCC2CCCCC12)* 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000001212 derivatisation Methods 0.000 description 1
- FXORZKOZOQWVMQ-UHFFFAOYSA-L dichloropalladium;triphenylphosphane Chemical compound Cl[Pd]Cl.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 FXORZKOZOQWVMQ-UHFFFAOYSA-L 0.000 description 1
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 1
- 125000005594 diketone group Chemical group 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- HPYNZHMRTTWQTB-UHFFFAOYSA-N dimethylpyridine Natural products CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- PXJJSXABGXMUSU-UHFFFAOYSA-N disulfur dichloride Chemical compound ClSSCl PXJJSXABGXMUSU-UHFFFAOYSA-N 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000012039 electrophile Substances 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- GRADKOIWYZOROX-UHFFFAOYSA-N ethyl 1-(3-cyanophenyl)-4-methylimidazole-2-carboxylate Chemical compound CCOC(=O)C1=NC(C)=CN1C1=CC=CC(C#N)=C1 GRADKOIWYZOROX-UHFFFAOYSA-N 0.000 description 1
- HLNNQMSVLMGYGX-UHFFFAOYSA-N ethyl 2-methoxyimino-4-oxooctanoate Chemical compound CCCCC(=O)CC(=NOC)C(=O)OCC HLNNQMSVLMGYGX-UHFFFAOYSA-N 0.000 description 1
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 1
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 1
- PQVSTLUFSYVLTO-UHFFFAOYSA-N ethyl n-ethoxycarbonylcarbamate Chemical compound CCOC(=O)NC(=O)OCC PQVSTLUFSYVLTO-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 229960000301 factor viii Drugs 0.000 description 1
- 229950003499 fibrin Drugs 0.000 description 1
- 108010020275 fibrin receptor Proteins 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- UGWBARXDYRKUDV-UHFFFAOYSA-N fluoro(fluoromethylsulfonyl)methane Chemical compound FCS(=O)(=O)CF UGWBARXDYRKUDV-UHFFFAOYSA-N 0.000 description 1
- 235000019256 formaldehyde Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 230000022244 formylation Effects 0.000 description 1
- 238000006170 formylation reaction Methods 0.000 description 1
- 239000012634 fragment Substances 0.000 description 1
- 125000003838 furazanyl group Chemical group 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 125000001072 heteroaryl group Chemical group 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000007857 hydrazones Chemical class 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- RGZRSLKIOCHTSI-UHFFFAOYSA-N hydron;n-methylhydroxylamine;chloride Chemical compound Cl.CNO RGZRSLKIOCHTSI-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- UWYVPFMHMJIBHE-OWOJBTEDSA-N hydroxymaleic acid group Chemical group O/C(/C(=O)O)=C/C(=O)O UWYVPFMHMJIBHE-OWOJBTEDSA-N 0.000 description 1
- 125000002632 imidazolidinyl group Chemical group 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 230000000415 inactivating effect Effects 0.000 description 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000004926 indolenyl group Chemical group 0.000 description 1
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- LZKLAOYSENRNKR-LNTINUHCSA-N iron;(z)-4-oxoniumylidenepent-2-en-2-olate Chemical compound [Fe].C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O LZKLAOYSENRNKR-LNTINUHCSA-N 0.000 description 1
- 125000004936 isatinoyl group Chemical group N1(C(=O)C(=O)C2=CC=CC=C12)C(=O)* 0.000 description 1
- 125000001977 isobenzofuranyl group Chemical group C=1(OC=C2C=CC=CC12)* 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000003384 isochromanyl group Chemical group C1(OCCC2=CC=CC=C12)* 0.000 description 1
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 1
- 125000004594 isoindolinyl group Chemical group C1(NCC2=CC=CC=C12)* 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 229940040692 lithium hydroxide monohydrate Drugs 0.000 description 1
- GLXDVVHUTZTUQK-UHFFFAOYSA-M lithium hydroxide monohydrate Substances [Li+].O.[OH-] GLXDVVHUTZTUQK-UHFFFAOYSA-M 0.000 description 1
- UBJFKNSINUCEAL-UHFFFAOYSA-N lithium;2-methylpropane Chemical compound [Li+].C[C-](C)C UBJFKNSINUCEAL-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- OKKJLVBELUTLKV-VMNATFBRSA-N methanol-d1 Chemical compound [2H]OC OKKJLVBELUTLKV-VMNATFBRSA-N 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- CHFUTDOVXUXYMV-UHFFFAOYSA-N methyl 2-(3-cyanophenyl)-5-methylpyrazole-3-carboxylate Chemical compound COC(=O)C1=CC(C)=NN1C1=CC=CC(C#N)=C1 CHFUTDOVXUXYMV-UHFFFAOYSA-N 0.000 description 1
- LZXXNPOYQCLXRS-UHFFFAOYSA-N methyl 4-aminobenzoate Chemical compound COC(=O)C1=CC=C(N)C=C1 LZXXNPOYQCLXRS-UHFFFAOYSA-N 0.000 description 1
- CZNGTXVOZOWWKM-UHFFFAOYSA-N methyl 4-bromobenzoate Chemical compound COC(=O)C1=CC=C(Br)C=C1 CZNGTXVOZOWWKM-UHFFFAOYSA-N 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- HDZGCSFEDULWCS-UHFFFAOYSA-N monomethylhydrazine Chemical compound CNN HDZGCSFEDULWCS-UHFFFAOYSA-N 0.000 description 1
- KRKPYFLIYNGWTE-UHFFFAOYSA-N n,o-dimethylhydroxylamine Chemical compound CNOC KRKPYFLIYNGWTE-UHFFFAOYSA-N 0.000 description 1
- WGOGEBQEODKTMI-UHFFFAOYSA-N n-[(4-bromophenyl)methyl]-3-cyanobenzamide Chemical compound C1=CC(Br)=CC=C1CNC(=O)C1=CC=CC(C#N)=C1 WGOGEBQEODKTMI-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- ILCQYORZHHFLNL-UHFFFAOYSA-N n-bromoaniline Chemical compound BrNC1=CC=CC=C1 ILCQYORZHHFLNL-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- AKMDMCHHHRVKCA-UHFFFAOYSA-N n-tert-butyl-2-(3-chloro-4-methylphenyl)benzenesulfonamide Chemical group C1=C(Cl)C(C)=CC=C1C1=CC=CC=C1S(=O)(=O)NC(C)(C)C AKMDMCHHHRVKCA-UHFFFAOYSA-N 0.000 description 1
- OPECTNGATDYLSS-UHFFFAOYSA-N naphthalene-2-sulfonyl chloride Chemical compound C1=CC=CC2=CC(S(=O)(=O)Cl)=CC=C21 OPECTNGATDYLSS-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- JPWNXVRKIXSUEI-UHFFFAOYSA-N nitramidosulfanyl hydrogen sulfate Chemical group [N+](=O)([O-])NSOS(=O)(=O)O JPWNXVRKIXSUEI-UHFFFAOYSA-N 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 1
- 230000009935 nitrosation Effects 0.000 description 1
- 238000007034 nitrosation reaction Methods 0.000 description 1
- 238000003199 nucleic acid amplification method Methods 0.000 description 1
- 239000012038 nucleophile Substances 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- RCALDWJXTVCBAZ-UHFFFAOYSA-N oct-1-enylbenzene Chemical compound CCCCCCC=CC1=CC=CC=C1 RCALDWJXTVCBAZ-UHFFFAOYSA-N 0.000 description 1
- 125000004930 octahydroisoquinolinyl group Chemical group C1(NCCC2CCCC=C12)* 0.000 description 1
- 238000005457 optimization Methods 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- QNNHQVPFZIFNFK-UHFFFAOYSA-N oxazolo[4,5-b]pyridine Chemical compound C1=CC=C2OC=NC2=N1 QNNHQVPFZIFNFK-UHFFFAOYSA-N 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- 125000004095 oxindolyl group Chemical group N1(C(CC2=CC=CC=C12)=O)* 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 238000005192 partition Methods 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 125000004934 phenanthridinyl group Chemical group C1(=CC=CC2=NC=C3C=CC=CC3=C12)* 0.000 description 1
- 125000001791 phenazinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3N=C12)* 0.000 description 1
- 125000001484 phenothiazinyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 description 1
- 125000005954 phenoxathiinyl group Chemical group 0.000 description 1
- 125000001644 phenoxazinyl group Chemical group C1(=CC=CC=2OC3=CC=CC=C3NC12)* 0.000 description 1
- BZBAYMUKLAYQEO-UHFFFAOYSA-N phenylborane Chemical class BC1=CC=CC=C1 BZBAYMUKLAYQEO-UHFFFAOYSA-N 0.000 description 1
- 150000003904 phospholipids Chemical class 0.000 description 1
- UXCDUFKZSUBXGM-UHFFFAOYSA-N phosphoric tribromide Chemical compound BrP(Br)(Br)=O UXCDUFKZSUBXGM-UHFFFAOYSA-N 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- CPGRMGOILBSUQC-UHFFFAOYSA-N phosphoryl azide Chemical compound [N-]=[N+]=NP(=O)(N=[N+]=[N-])N=[N+]=[N-] CPGRMGOILBSUQC-UHFFFAOYSA-N 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 150000004885 piperazines Chemical class 0.000 description 1
- 125000004928 piperidonyl group Chemical group 0.000 description 1
- 239000003880 polar aprotic solvent Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 150000003140 primary amides Chemical class 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 230000017854 proteolysis Effects 0.000 description 1
- 229940039716 prothrombin Drugs 0.000 description 1
- 108010014806 prothrombinase complex Proteins 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- 125000002755 pyrazolinyl group Chemical group 0.000 description 1
- 125000001422 pyrrolinyl group Chemical group 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 1
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 1
- 125000004621 quinuclidinyl group Chemical group N12C(CC(CC1)CC2)* 0.000 description 1
- 229910052702 rhenium Inorganic materials 0.000 description 1
- SONJTKJMTWTJCT-UHFFFAOYSA-K rhodium(iii) chloride Chemical compound [Cl-].[Cl-].[Cl-].[Rh+3] SONJTKJMTWTJCT-UHFFFAOYSA-K 0.000 description 1
- BIXNGBXQRRXPLM-UHFFFAOYSA-K ruthenium(3+);trichloride;hydrate Chemical compound O.Cl[Ru](Cl)Cl BIXNGBXQRRXPLM-UHFFFAOYSA-K 0.000 description 1
- YBCAZPLXEGKKFM-UHFFFAOYSA-K ruthenium(iii) chloride Chemical compound [Cl-].[Cl-].[Cl-].[Ru+3] YBCAZPLXEGKKFM-UHFFFAOYSA-K 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- JPJALAQPGMAKDF-UHFFFAOYSA-N selenium dioxide Chemical compound O=[Se]=O JPJALAQPGMAKDF-UHFFFAOYSA-N 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229910001961 silver nitrate Inorganic materials 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 150000003413 spiro compounds Chemical class 0.000 description 1
- 230000006103 sulfonylation Effects 0.000 description 1
- 238000005694 sulfonylation reaction Methods 0.000 description 1
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Inorganic materials O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 1
- 229940066771 systemic antihistamines piperazine derivative Drugs 0.000 description 1
- 229940042055 systemic antimycotics triazole derivative Drugs 0.000 description 1
- WRCRIGRVTPLDDD-UHFFFAOYSA-N tert-butyl 4-iodopyrazole-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1C=C(I)C=N1 WRCRIGRVTPLDDD-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- CKXAMCSVTNPSCZ-UHFFFAOYSA-N tert-butyl n-(5-bromopyridin-2-yl)carbamate Chemical compound CC(C)(C)OC(=O)NC1=CC=C(Br)C=N1 CKXAMCSVTNPSCZ-UHFFFAOYSA-N 0.000 description 1
- VDOHGNUGROYDCF-UHFFFAOYSA-N tert-butyl n-[5-(2-methylsulfonylphenyl)pyridin-2-yl]carbamate Chemical compound C1=NC(NC(=O)OC(C)(C)C)=CC=C1C1=CC=CC=C1S(C)(=O)=O VDOHGNUGROYDCF-UHFFFAOYSA-N 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000003039 tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 description 1
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 125000004627 thianthrenyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3SC12)* 0.000 description 1
- 125000004001 thioalkyl group Chemical group 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 238000013519 translation Methods 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 1
- SEDZOYHHAIAQIW-UHFFFAOYSA-N trimethylsilyl azide Chemical compound C[Si](C)(C)N=[N+]=[N-] SEDZOYHHAIAQIW-UHFFFAOYSA-N 0.000 description 1
- NHDIQVFFNDKAQU-UHFFFAOYSA-N tripropan-2-yl borate Chemical compound CC(C)OB(OC(C)C)OC(C)C NHDIQVFFNDKAQU-UHFFFAOYSA-N 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 235000019801 trisodium phosphate Nutrition 0.000 description 1
- 239000012588 trypsin Substances 0.000 description 1
- 108010036927 trypsin-like serine protease Proteins 0.000 description 1
- 229940045136 urea Drugs 0.000 description 1
- 238000003828 vacuum filtration Methods 0.000 description 1
- PXXNTAGJWPJAGM-UHFFFAOYSA-N vertaline Natural products C1C2C=3C=C(OC)C(OC)=CC=3OC(C=C3)=CC=C3CCC(=O)OC1CC1N2CCCC1 PXXNTAGJWPJAGM-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 125000001834 xanthenyl group Chemical group C1=CC=CC=2OC3=CC=CC=C3C(C12)* 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- 125000004933 β-carbolinyl group Chemical group C1(=NC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D257/00—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms
- C07D257/02—Heterocyclic compounds containing rings having four nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D257/04—Five-membered rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
- A61P7/02—Antithrombotic agents; Anticoagulants; Platelet aggregation inhibitors
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/34—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/16—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/18—One oxygen or sulfur atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/38—Nitrogen atoms
- C07D231/40—Acylated on said nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/14—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D231/38—Nitrogen atoms
- C07D231/42—Benzene-sulfonamido pyrazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/90—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/04—1,2,3-Triazoles; Hydrogenated 1,2,3-triazoles
- C07D249/06—1,2,3-Triazoles; Hydrogenated 1,2,3-triazoles with aryl radicals directly attached to ring atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
- C07D249/10—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Veterinary Medicine (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Public Health (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Hematology (AREA)
- Diabetes (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyridine Compounds (AREA)
- Pyrrole Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US76985996A | 1996-12-23 | 1996-12-23 | |
| US87994497A | 1997-06-20 | 1997-06-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HRP970698A2 true HRP970698A2 (en) | 1998-10-31 |
Family
ID=27118232
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HR08/879,944A HRP970698A2 (en) | 1996-12-23 | 1997-12-22 | NITROGEN CONTAINING HETEROAROMATICS AS FACTOR Xa INHIBITORS |
Country Status (24)
| Country | Link |
|---|---|
| EP (1) | EP0946508B1 (de) |
| JP (1) | JP2001509145A (de) |
| KR (1) | KR20000062284A (de) |
| CN (1) | CN1246847A (de) |
| AR (1) | AR020305A1 (de) |
| AT (1) | ATE443698T1 (de) |
| AU (1) | AU730224B2 (de) |
| CA (1) | CA2275796A1 (de) |
| CZ (1) | CZ225699A3 (de) |
| DE (1) | DE69739593D1 (de) |
| EA (1) | EA003056B1 (de) |
| EE (1) | EE9900316A (de) |
| ES (1) | ES2331860T3 (de) |
| HR (1) | HRP970698A2 (de) |
| HU (1) | HUP0000735A3 (de) |
| IL (1) | IL130286A0 (de) |
| LV (1) | LV12430B (de) |
| NO (1) | NO313190B1 (de) |
| NZ (1) | NZ336162A (de) |
| PL (1) | PL334250A1 (de) |
| SI (1) | SI20017A (de) |
| SK (1) | SK86699A3 (de) |
| TW (1) | TW492971B (de) |
| WO (1) | WO1998028269A1 (de) |
Families Citing this family (131)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP1012150A4 (de) * | 1997-05-19 | 2002-05-29 | Sugen Inc | Heteroarylcarboxamid-verbindungen die gegen durch protein-tyrosin-kinase verursachte krankheiten wirksam sind |
| EP0993448A1 (de) * | 1997-06-19 | 2000-04-19 | The Du Pont Merck Pharmaceutical Company | (amidino)6-gliedrige aromaten als factor xa inhibitoren |
| CA2314401A1 (en) * | 1997-12-22 | 1999-07-01 | Du Pont Pharmaceuticals Company | Nitrogen containing heteroaromatics with ortho-substituted p1's as factor xa inhibitors |
| US6271237B1 (en) | 1997-12-22 | 2001-08-07 | Dupont Pharmaceuticals Company | Nitrogen containing heteromatics with ortho-substituted P1s as factor Xa inhabitors |
| US6900228B1 (en) | 1998-03-10 | 2005-05-31 | Research Triangle Institute | Opiate compounds, methods of making and methods of use |
| CA2321538A1 (en) | 1998-03-27 | 1999-10-07 | Dupont Pharmaceuticals Company | Disubstituted pyrazolines and triazolines as factor xa inhibitors |
| WO2000038683A1 (en) | 1998-12-23 | 2000-07-06 | Du Pont Pharmaceuticals Company | THROMBIN OR FACTOR Xa INHIBITORS |
| AU3857300A (en) * | 1999-02-11 | 2000-08-29 | Cor Therapeutics, Inc. | Inhibitors of factor xa |
| EP1159273A1 (de) | 1999-03-02 | 2001-12-05 | Boehringer Ingelheim Pharmaceuticals Inc. | Verbindungen, verwendbar als reversible inhibitoren von cathepsin s |
| US6794412B1 (en) | 1999-03-11 | 2004-09-21 | Bristol-Myers Squibb Pharma Company | Treatment of thrombosis by combined use of a factor Xa inhibitor and aspirin |
| EP1161279A1 (de) * | 1999-03-11 | 2001-12-12 | Du Pont Pharmaceuticals Company | Behandlung von thrombose mit kombinationen aus factor xa hemmern mit aspirin, gewebe-plasminogenaktivatoren (tpa), gpiib/iiia antagonisten, niedermolekulare heparin oder heparin |
| US6673817B1 (en) | 1999-05-24 | 2004-01-06 | Millennium Pharmaceuticals, Inc. | Inhibitors of factor Xa |
| EP1183235A2 (de) * | 1999-05-24 | 2002-03-06 | Cor Therapeutics, Inc. | INHIBITOREN VON FAKTOR Xa |
| EP1185512A2 (de) * | 1999-05-24 | 2002-03-13 | Cor Therapeutics, Inc. | Faktor xa inhibitoren |
| DE60011430T2 (de) | 1999-07-16 | 2005-07-07 | Bristol-Myers Squibb Pharma Co. | Stickstoff enthaltende heterobicyclen als factor xa inhibitoren |
| US6420364B1 (en) | 1999-09-13 | 2002-07-16 | Boehringer Ingelheim Pharmaceuticals, Inc. | Compound useful as reversible inhibitors of cysteine proteases |
| US6844367B1 (en) | 1999-09-17 | 2005-01-18 | Millennium Pharmaceuticals, Inc. | Benzamides and related inhibitors of factor Xa |
| BR0014076A (pt) * | 1999-09-17 | 2002-10-15 | Millennium Pharm Inc | Benzamidas e inibidores correlatos do fator xa |
| US6720317B1 (en) | 1999-09-17 | 2004-04-13 | Millennium Pharmaceuticals, Inc. | Inhibitors of factor Xa |
| HUP0203954A2 (hu) * | 1999-09-17 | 2003-03-28 | Millennium Pharmaceuticals, Inc. | Xa faktor inhibitorok |
| US6632815B2 (en) | 1999-09-17 | 2003-10-14 | Millennium Pharmaceuticals, Inc. | Inhibitors of factor Xa |
| US6329527B1 (en) * | 1999-10-21 | 2001-12-11 | Bristol-Myers Squibb Pharma Company | Synthesis of 1,3,5-trisubstituted pyrazoles |
| WO2001032628A1 (en) * | 1999-11-03 | 2001-05-10 | Bristol-Myers Squibb Pharma Company | Cyano compounds as factor xa inhibitors |
| US6407256B1 (en) | 1999-11-03 | 2002-06-18 | Bristol Myers Squibb Co | Cyano-pyrrole, cyano-imidazole, cyano-pyrazole, and cyano-triazole compounds as factor Xa inhibitors |
| DK1259485T3 (da) | 2000-02-29 | 2006-04-10 | Millennium Pharm Inc | Benzamider og beslægtede inhibitorer for faktor Xa |
| MY138097A (en) | 2000-03-22 | 2009-04-30 | Du Pont | Insecticidal anthranilamides |
| CA2409762A1 (en) * | 2000-06-23 | 2002-01-03 | Donald J.P. Pinto | Heteroaryl-phenyl substituted factor xa inhibitors |
| EP1296982B1 (de) | 2000-06-23 | 2007-09-19 | Bristol-Myers Squibb Pharma Company | 1-(heteroaryl-phenyl)-kondensierte pyrazol-derivate als factor xa inhibitoren |
| AU2001277731A1 (en) | 2000-08-09 | 2002-02-18 | Welfide Corporation | Fused bicyclic amide compounds and medicinal use thereof |
| DE60221505D1 (de) * | 2001-03-30 | 2007-09-13 | Millennium Pharm Inc | FAKTOR Xa BENZAMIDIN INHIBITOREN |
| US7312235B2 (en) | 2001-03-30 | 2007-12-25 | Millennium Pharmaceuticals, Inc. | Benzamide inhibitors of factor Xa |
| GB0112834D0 (en) | 2001-05-25 | 2001-07-18 | Smithkline Beecham Plc | Medicaments |
| DE10139060A1 (de) | 2001-08-08 | 2003-02-20 | Merck Patent Gmbh | Phenylderivate |
| AR036872A1 (es) | 2001-08-13 | 2004-10-13 | Du Pont | Compuesto de antranilamida, composicion que lo comprende y metodo para controlar una plaga de invertebrados |
| MY142967A (en) | 2001-08-13 | 2011-01-31 | Du Pont | Method for controlling particular insect pests by applying anthranilamide compounds |
| WO2003016304A1 (en) | 2001-08-15 | 2003-02-27 | E. I. Du Pont De Nemours And Company | Ortho-heterocyclic substituted aryl amides for controlling invertebrate pests |
| JP4095959B2 (ja) | 2001-08-15 | 2008-06-04 | イー・アイ・デュポン・ドウ・ヌムール・アンド・カンパニー | 無脊椎有害生物を防除するためのオルト置換アリールアミド類 |
| ATE417829T1 (de) | 2001-08-16 | 2009-01-15 | Du Pont | Substituierte anthranilamide und ihre verwendung als pesticide |
| TWI320039B (en) | 2001-09-21 | 2010-02-01 | Lactam-containing compounds and derivatives thereof as factor xa inhibitors | |
| TW200724033A (en) | 2001-09-21 | 2007-07-01 | Du Pont | Anthranilamide arthropodicide treatment |
| ES2329881T3 (es) | 2001-09-21 | 2009-12-02 | Bristol-Myers Squibb Company | Compuestos que contienen lactama y derivados de los mismos como inhibidores del factor xa. |
| WO2003042190A1 (en) | 2001-11-12 | 2003-05-22 | Pfizer Products Inc. | N-alkyl-adamantyl derivatives as p2x7-receptor antagonists |
| PA8557501A1 (es) | 2001-11-12 | 2003-06-30 | Pfizer Prod Inc | Benzamida, heteroarilamida y amidas inversas |
| TW200303309A (en) | 2001-12-04 | 2003-09-01 | Bristol Myers Squibb Co | Novel n-[4-(1h-imidazol-1-yl)-2-fluorophenyl]-3-trifluoromethyl)-1h-pyrazole-5-carboxamides as factor Xa inhibitors |
| AU2002350217A1 (en) | 2001-12-04 | 2003-06-17 | Bristol-Myers Squibb Company | Glycinamides as factor xa inhibitors |
| TW200302225A (en) | 2001-12-04 | 2003-08-01 | Bristol Myers Squibb Co | Substituted amino methyl factor Xa inhibitors |
| KR101011837B1 (ko) | 2002-01-22 | 2011-01-31 | 이 아이 듀폰 디 네모아 앤드 캄파니 | 무척추 해충 방제를 위한 퀴나졸린(디)온 |
| AU2003273179A1 (en) | 2002-05-10 | 2003-12-12 | Bristol-Myers Squibb Company | 1,1-disubstituted cycloalkyl derivatives as factor xa inhibitors |
| US7754738B2 (en) | 2002-06-13 | 2010-07-13 | E.I. Du Pont De Nemours And Company | Pyrazole and pyrrole carboxamide insecticides |
| DE10229070A1 (de) * | 2002-06-28 | 2004-01-15 | Merck Patent Gmbh | Phenylderivate 5 |
| US7154002B1 (en) | 2002-10-08 | 2006-12-26 | Takeda San Diego, Inc. | Histone deacetylase inhibitors |
| US7250514B1 (en) | 2002-10-21 | 2007-07-31 | Takeda San Diego, Inc. | Histone deacetylase inhibitors |
| WO2004046129A2 (en) | 2002-11-15 | 2004-06-03 | E.I. Du Pont De Nemours And Company | Novel anthranilamide insecticides |
| CA2507707C (en) | 2002-12-03 | 2011-06-21 | Axys Pharmaceuticals, Inc. | 2-(2-hydroxybiphenyl-3-yl)-1h-benzoimidazole-5-carboxamidine derivatives as factor viia inhibitors |
| US7429581B2 (en) | 2002-12-23 | 2008-09-30 | Sanofi-Aventis Deutschland Gmbh | Pyrazole-derivatives as factor Xa inhibitors |
| CN1732163B (zh) * | 2002-12-23 | 2012-07-18 | 4Sc股份公司 | 作为抗炎和免疫调节及抗增殖试剂的芳香化合物 |
| EP1433788A1 (de) * | 2002-12-23 | 2004-06-30 | Aventis Pharma Deutschland GmbH | Pyrazol-Derivate als Faktor Xa Inhibitoren |
| US7071223B1 (en) | 2002-12-31 | 2006-07-04 | Pfizer, Inc. | Benzamide inhibitors of the P2X7 receptor |
| PA8591801A1 (es) | 2002-12-31 | 2004-07-26 | Pfizer Prod Inc | Inhibidores benzamidicos del receptor p2x7. |
| BR0317844A (pt) * | 2002-12-31 | 2005-12-06 | Pfizer Prod Inc | Inibidores de benzamida do receptor p2x7 |
| MD3864C2 (ro) | 2003-01-28 | 2009-11-30 | E.I. Du Pont De Nemours And Company | Compuşi ai cianoantranilamidei, compoziţii pe baza ei şi procedeu de combatere a dăunătorilor nevertebraţi |
| US7381825B2 (en) | 2003-03-17 | 2008-06-03 | Takeda San Diego, Inc. | Histone deacetylase inhibitors |
| US7122557B2 (en) | 2003-03-18 | 2006-10-17 | Bristol-Myers Squibb Company | Sulfonyl-amidino-containing and tetrahydropyrimidino-containing compounds as factor Xa inhibitors |
| US20040220170A1 (en) * | 2003-05-01 | 2004-11-04 | Atkinson Robert N. | Pyrazole-amides and sulfonamides as sodium channel modulators |
| MXPA05011775A (es) * | 2003-05-01 | 2006-02-17 | Abbott Lab | Sulfonamidas y pirazolamidas como moduladores de canal de sodio. |
| HRP20110757T1 (hr) | 2003-06-26 | 2011-11-30 | Novartis Ag | Inhibitori kinaze p38 bazirani na 5-članom heterociklu |
| BRPI0412259B1 (pt) | 2003-07-22 | 2019-08-20 | Astex Therapeutics Limited | Compostos de 1H-pirazol 3,4-dissubstituídos como moduladores de quinases dependentes de ciclina (CDK), seus usos, processo para a preparação dos mesmos e composição farmacêutica |
| KR20060110288A (ko) | 2003-10-09 | 2006-10-24 | 밀레니엄 파머슈티컬스 인코퍼레이티드 | 인자 xa 의 저해제로서의 티오에테르-치환 벤즈아미드 |
| TWI258478B (en) | 2003-10-31 | 2006-07-21 | Arena Pharm Inc | Tetrazole derivatives and methods of treatment of metabolic-related disorders thereof |
| EP1568698A1 (de) | 2004-02-27 | 2005-08-31 | Aventis Pharma Deutschland GmbH | Pyrrolderivate als faktor-xa-inhibitoren |
| TWI357901B (en) * | 2004-03-12 | 2012-02-11 | Lundbeck & Co As H | Substituted morpholine and thiomorpholine derivati |
| CA2565437A1 (en) | 2004-06-18 | 2006-01-05 | Millennium Pharmaceuticals, Inc. | Factor xa inhibitors |
| AU2005258911A1 (en) | 2004-06-29 | 2006-01-12 | Pfizer Products Inc. | Method for preparing 5-`4-(2-hydroxy-propyl)-3,5-dioxo-4,5-dihydro-3H`1,2,4!triazin-2-YL!-benzamide derivatives by deprotecting the hydroxyl-protected precursers |
| JO2540B1 (en) | 2004-07-01 | 2010-09-05 | اي.اي.ديو بونت دي نيمورز اند كومباني | Control factors for pests from invertebrate insects include a symbiotic mixture of anthranilamide |
| EP1803709B1 (de) | 2004-09-30 | 2013-01-02 | Takeda Pharmaceutical Company Limited | Protonenpumpenhemmer |
| WO2006055951A2 (en) | 2004-11-19 | 2006-05-26 | Portola Pharmaceuticals, Inc. | Tetrahydroisoquinolines as factor xa inhibitors |
| WO2006063113A2 (en) | 2004-12-07 | 2006-06-15 | Portola Pharmaceuticals, Inc. | Ureas as factor xa inhibitors |
| WO2006066133A2 (en) | 2004-12-16 | 2006-06-22 | Takeda San Diego, Inc. | Histone deacetylase inhibitors |
| TWI441819B (zh) | 2005-01-07 | 2014-06-21 | Synta Pharmaceuticals Corp | 用於炎症及免疫相關用途之化合物 |
| AR054425A1 (es) | 2005-01-21 | 2007-06-27 | Astex Therapeutics Ltd | Sales de adicion de piperidin 4-il- amida de acido 4-(2,6-dicloro-benzoilamino) 1h-pirazol-3-carboxilico. |
| US8404718B2 (en) | 2005-01-21 | 2013-03-26 | Astex Therapeutics Limited | Combinations of pyrazole kinase inhibitors |
| JPWO2006109846A1 (ja) | 2005-04-06 | 2008-11-20 | 武田薬品工業株式会社 | トリアゾール誘導体およびその用途 |
| EP1896436A2 (de) | 2005-05-11 | 2008-03-12 | Takeda San Diego, Inc. | Inhibitoren der histondeacetylase |
| ZA200800901B (en) | 2005-07-14 | 2010-05-26 | Takeda San Diego Inc | Histone deacetylase inhibitors |
| KR20080038426A (ko) | 2005-08-24 | 2008-05-06 | 이 아이 듀폰 디 네모아 앤드 캄파니 | 무척추 해충 방제용 안트라닐아미드 |
| AU2006285641A1 (en) | 2005-08-30 | 2007-03-08 | Takeda Pharmaceutical Company Limited | 1-heterocyclylsulfonyl, 2-aminomethyl, 5- (hetero-) aryl substituted 1-h-pyrrole derivatives as acid secretion inhibitors |
| NZ592533A (en) | 2005-11-08 | 2012-08-31 | Millennium Pharm Inc | METHOD FOR THE PREPARATION OF N-(5-CHLORO-2-PYRIDINYL)-2-[[4-[(DIMETHYLAMINO) IMINOMETHYL] BENZOYL] AMINO]-5-METHOXY-BENZAMIDE, A FACTOR Xa INHIBITOR |
| JP2007186507A (ja) * | 2005-12-15 | 2007-07-26 | Nippon Nohyaku Co Ltd | フタルアミド誘導体及び農園芸用殺虫剤並びにその使用方法 |
| TWI324908B (en) | 2006-01-05 | 2010-05-21 | Du Pont | Liquid formulations of carboxamide arthropodicides |
| WO2007114338A1 (ja) | 2006-03-31 | 2007-10-11 | Takeda Pharmaceutical Company Limited | 酸分泌抑制薬 |
| EP1894924A1 (de) * | 2006-08-29 | 2008-03-05 | Phenex Pharmaceuticals AG | Heterozyklische FXR Bindungsverbindungen |
| CA2664794A1 (en) | 2006-10-20 | 2008-05-02 | Merck & Co., Inc. | Substituted imidazoles as bombesin receptor subtype-3 modulators |
| WO2008051405A1 (en) | 2006-10-20 | 2008-05-02 | Merck & Co., Inc. | Substituted imidazoles as bombesin receptor subtype-3 modulators |
| AU2007309570B2 (en) | 2006-10-20 | 2012-07-12 | Merck Sharp & Dohme Corp. | Substituted imidazoles as bombesin receptor subtype-3 modulators |
| EP2404906B1 (de) | 2006-11-02 | 2015-07-15 | Millennium Pharmaceuticals, Inc. | Verfahren zur Synthetisierung pharmazeutischer Salze aus einem Faktor XA-Hemmer |
| CN101583593A (zh) | 2006-11-13 | 2009-11-18 | 辉瑞产品公司 | 二芳基、二吡啶基和芳基-吡啶基衍生物及其用途 |
| CN101605788A (zh) | 2006-12-11 | 2009-12-16 | 默克公司 | 用作铃蟾肽受体亚型-3调节剂的取代的二氮杂磺酰胺类化合物 |
| US7737149B2 (en) | 2006-12-21 | 2010-06-15 | Astrazeneca Ab | N-[5-[2-(3,5-dimethoxyphenyl)ethyl]-2H-pyrazol-3-yl]-4-(3,5-dimethylpiperazin-1-yl)benzamide and salts thereof |
| US8933105B2 (en) | 2007-02-28 | 2015-01-13 | Takeda Pharmaceutical Company Limited | Pyrrole compounds |
| EP2529624A3 (de) * | 2007-04-03 | 2013-03-13 | E. I. du Pont de Nemours and Company | Substituierte Benzenfungizide |
| CA2735162C (en) | 2008-08-27 | 2015-06-23 | Takeda Pharmaceutical Company Limited | Pyrrole compounds |
| AU2010228220B2 (en) | 2009-03-26 | 2015-05-21 | Takeda Pharmaceutical Company Limited | Pyrazole compound |
| US8252829B2 (en) | 2009-06-05 | 2012-08-28 | Link Medicine Corporation | Aminopyrrolidinone derivatives and uses thereof |
| EA015918B1 (ru) | 2010-03-03 | 2011-12-30 | Дмитрий Геннадьевич ТОВБИН | УРЕТАНЫ, МОЧЕВИНЫ, АМИДЫ И РОДСТВЕННЫЕ ИНГИБИТОРЫ ФАКТОРА Xa |
| CN110269856A (zh) | 2010-03-30 | 2019-09-24 | 维颂公司 | 多取代芳族化合物作为凝血酶的抑制剂 |
| JP6313312B2 (ja) | 2012-10-02 | 2018-04-18 | バイエル・クロップサイエンス・アクチェンゲゼルシャフト | 農薬としての複素環化合物 |
| US20140179712A1 (en) | 2012-12-21 | 2014-06-26 | Astrazeneca Ab | Pharmaceutical formulation of n-[5-[2-(3,5-dimethoxyphenyl)ethyl]-2h-pyrazol-3-yl]-4-[(3r,5s)-3,5-dimethylpiperazin-1-yl]benzamide |
| US9828345B2 (en) | 2013-02-28 | 2017-11-28 | Bristol-Myers Squibb Company | Phenylpyrazole derivatives as potent ROCK1 and ROCK2 inhibitors |
| TW201444798A (zh) | 2013-02-28 | 2014-12-01 | 必治妥美雅史谷比公司 | 作爲強效rock1及rock2抑制劑之苯基吡唑衍生物 |
| KR20150130405A (ko) | 2013-03-15 | 2015-11-23 | 베르선 코포레이션 | 트롬빈의 억제제로서의 할로게노피라졸 |
| RU2678830C2 (ru) | 2013-03-15 | 2019-02-04 | Версеон Корпорейшн | Полизамещенные ароматические соединения в качестве ингибиторов сериновых протеаз |
| AU2014365744A1 (en) * | 2013-12-19 | 2016-05-26 | Grunenthal Gmbh | Fluoromethyl-substituted pyrrole carboxamides III |
| JP2016540823A (ja) * | 2013-12-19 | 2016-12-28 | グリュネンタール・ゲゼルシャフト・ミト・ベシュレンクテル・ハフツング | フルオロ置換ピロールカルボキサミドiv |
| PT3113772T (pt) * | 2014-03-07 | 2020-12-15 | Biocryst Pharm Inc | Pirazois substituídos por trifluorometilo como inibidores de calicreína plasmática humana |
| MA40281B1 (fr) | 2014-06-03 | 2018-11-30 | Idorsia Pharmaceuticals Ltd | Composés de pyrazole et leur utilisation en tant qu' agents de blocage des canaux calciques de type t |
| CN104072439B (zh) * | 2014-07-23 | 2015-11-04 | 张远强 | 卤素取代的四氮唑苯乙酮化合物、其制备方法和用途 |
| CN104086502B (zh) * | 2014-07-23 | 2015-10-14 | 张远强 | 卤代四氮唑苯乙酮化合物、其制备方法和用途 |
| CN104072438B (zh) * | 2014-07-23 | 2015-10-14 | 张远强 | 二烷氧代四氮唑苯乙酮化合物、其制备方法和用途 |
| CN104072436B (zh) * | 2014-07-23 | 2015-10-14 | 张远强 | 对位取代的四氮唑苯乙酮化合物、其制备方法和用途 |
| EP3194374B1 (de) | 2014-09-15 | 2018-08-01 | Idorsia Pharmaceuticals Ltd | Triazolverbindungen als t-typ-calciumkanalblocker |
| JP2017528486A (ja) | 2014-09-17 | 2017-09-28 | ヴァーセオン コーポレイション | セリンプロテアーゼ阻害剤としてのピラゾリル置換ピリドン化合物 |
| MX373651B (es) | 2014-10-08 | 2020-03-31 | Redx Pharma Plc | Derivados de n-piridinil acetamida como inhibidores de la via de señalizacion wnt. |
| BR112017007218B1 (pt) | 2014-10-08 | 2023-10-10 | Redx Pharma Plc | Derivados de n-piridil acetamida como inibidores da via de sinalização de wnt, formulações farmacêuticas compreendendo os mesmos e seus usos |
| HK1246164A1 (zh) | 2015-02-27 | 2018-09-07 | Verseon Corporation | 作为丝氨酸蛋白酶抑制剂的被取代的吡唑化合物 |
| EP3554490B1 (de) | 2016-12-16 | 2022-02-16 | Idorsia Pharmaceuticals Ltd | Pharmazeutische kombination mit einem calciumkanalblocker vom typ t |
| EP3577099B1 (de) | 2017-02-06 | 2024-01-24 | Idorsia Pharmaceuticals Ltd | Ein neues verfahren zur herstellung von 1-aryl-1-trifluormethylcyclopropanen |
| WO2018224455A1 (en) | 2017-06-07 | 2018-12-13 | Basf Se | Substituted cyclopropyl derivatives |
| WO2020036133A1 (ja) * | 2018-08-17 | 2020-02-20 | クミアイ化学工業株式会社 | 3-(1h-1,2,4-トリアゾール-1-イル)安息香酸アミド誘導体及び有害生物防除剤 |
| US11034669B2 (en) | 2018-11-30 | 2021-06-15 | Nuvation Bio Inc. | Pyrrole and pyrazole compounds and methods of use thereof |
| AU2020417293A1 (en) | 2020-01-03 | 2022-09-01 | Berg Llc | Polycyclic amides as UBE2K modulators for treating cancer |
| CN116068081B (zh) * | 2022-12-30 | 2024-06-21 | 上海荣迪生物技术有限公司 | 一种检测氟尿嘧啶注射液中氟乙醛的方法 |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE663344A (de) | 1964-05-04 | |||
| CH535777A (de) | 1967-03-01 | 1973-04-15 | Ciba Geigy Ag | Verfahren zur Herstellung neuer azacycloaliphatischer Verbindungen |
| JPS5536447A (en) * | 1978-09-07 | 1980-03-14 | Otsuka Pharmaceut Co Ltd | Butyramide derivative |
| ES2052545T3 (es) | 1986-02-27 | 1994-07-16 | Duphar Int Res | (n-piperidinil)-metil- y (n-piperazinil)metilazoles sustituidos con arilo que tienen propiedades antipsicoticas. |
| DE3633840A1 (de) * | 1986-10-04 | 1988-04-14 | Hoechst Ag | Phenylpyrazolcarbonsaeurederivate, ihre herstellung und verwendung als pflanzenwachstumsregulatoren und safener |
| JPH02129171A (ja) * | 1988-11-08 | 1990-05-17 | Nissan Chem Ind Ltd | ピラゾールカルボキサニリド誘導体及び有害生物防除剤 |
| JPH0341072A (ja) * | 1989-07-07 | 1991-02-21 | Hokko Chem Ind Co Ltd | トリアゾールカルボン酸アミド誘導体および除草剤 |
| PH27357A (en) * | 1989-09-22 | 1993-06-21 | Fujisawa Pharmaceutical Co | Pyrazole derivatives and pharmaceutical compositions comprising the same |
| JPH04247081A (ja) * | 1991-02-01 | 1992-09-03 | Takeda Chem Ind Ltd | 5員複素環酸アミド類 |
| IL104311A (en) * | 1992-02-05 | 1997-07-13 | Fujisawa Pharmaceutical Co | Pyrazole derivatives, processes for the preparation thereof and pharmaceutical compositions containing the same |
| JPH07509452A (ja) | 1992-07-24 | 1995-10-19 | メルク シヤープ エンド ドーム リミテツド | イミダゾール,トリアゾール及びテトラゾール誘導体 |
| GB9225141D0 (en) | 1992-12-01 | 1993-01-20 | Smithkline Beecham Corp | Chemical compounds |
| GB9324244D0 (en) | 1993-11-25 | 1994-01-12 | Merck Sharp & Dohme | Therapeutic agents |
| JPH10509140A (ja) | 1994-11-08 | 1998-09-08 | エーザイ株式会社 | ピラゾール誘導体 |
| JPH08143565A (ja) * | 1994-11-16 | 1996-06-04 | Fujisawa Pharmaceut Co Ltd | ベンズアミド化合物 |
-
1997
- 1997-12-15 CZ CZ19992256A patent/CZ225699A3/cs unknown
- 1997-12-15 CN CN97181852A patent/CN1246847A/zh active Pending
- 1997-12-15 WO PCT/US1997/022895 patent/WO1998028269A1/en not_active Ceased
- 1997-12-15 AU AU56020/98A patent/AU730224B2/en not_active Ceased
- 1997-12-15 PL PL97334250A patent/PL334250A1/xx unknown
- 1997-12-15 SI SI9720082A patent/SI20017A/sl not_active IP Right Cessation
- 1997-12-15 CA CA002275796A patent/CA2275796A1/en not_active Abandoned
- 1997-12-15 IL IL13028697A patent/IL130286A0/xx unknown
- 1997-12-15 EP EP97952409A patent/EP0946508B1/de not_active Revoked
- 1997-12-15 AT AT97952409T patent/ATE443698T1/de not_active IP Right Cessation
- 1997-12-15 EE EEP199900316A patent/EE9900316A/xx unknown
- 1997-12-15 EA EA199900591A patent/EA003056B1/ru not_active IP Right Cessation
- 1997-12-15 SK SK866-99A patent/SK86699A3/sk unknown
- 1997-12-15 ES ES97952409T patent/ES2331860T3/es not_active Expired - Lifetime
- 1997-12-15 HU HU0000735A patent/HUP0000735A3/hu unknown
- 1997-12-15 DE DE69739593T patent/DE69739593D1/de not_active Expired - Lifetime
- 1997-12-15 NZ NZ336162A patent/NZ336162A/en unknown
- 1997-12-15 KR KR19997005679A patent/KR20000062284A/ko not_active Ceased
- 1997-12-15 JP JP52884598A patent/JP2001509145A/ja active Pending
- 1997-12-22 HR HR08/879,944A patent/HRP970698A2/hr not_active Application Discontinuation
- 1997-12-23 AR ARP970106177A patent/AR020305A1/es not_active Application Discontinuation
-
1998
- 1998-02-03 TW TW086119637A patent/TW492971B/zh not_active IP Right Cessation
-
1999
- 1999-06-01 NO NO19992633A patent/NO313190B1/no unknown
- 1999-07-30 LV LVP-99-99A patent/LV12430B/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| EA003056B1 (ru) | 2002-12-26 |
| NZ336162A (en) | 2000-09-29 |
| PL334250A1 (en) | 2000-02-14 |
| SI20017A (sl) | 2000-02-29 |
| WO1998028269A1 (en) | 1998-07-02 |
| AU730224B2 (en) | 2001-03-01 |
| JP2001509145A (ja) | 2001-07-10 |
| HUP0000735A3 (en) | 2002-03-28 |
| DE69739593D1 (de) | 2009-11-05 |
| LV12430B (en) | 2000-07-20 |
| HUP0000735A2 (hu) | 2001-04-28 |
| ES2331860T3 (es) | 2010-01-18 |
| SK86699A3 (en) | 2000-11-07 |
| CZ225699A3 (cs) | 2000-09-13 |
| LV12430A (lv) | 2000-02-20 |
| NO992633L (no) | 1999-08-20 |
| CA2275796A1 (en) | 1998-07-02 |
| ATE443698T1 (de) | 2009-10-15 |
| NO992633D0 (no) | 1999-06-01 |
| IL130286A0 (en) | 2000-06-01 |
| EA199900591A1 (ru) | 2000-08-28 |
| EP0946508B1 (de) | 2009-09-23 |
| MX9905878A (en) | 2000-01-01 |
| TW492971B (en) | 2002-07-01 |
| KR20000062284A (ko) | 2000-10-25 |
| NO313190B1 (no) | 2002-08-26 |
| CN1246847A (zh) | 2000-03-08 |
| EP0946508A1 (de) | 1999-10-06 |
| AR020305A1 (es) | 2002-05-08 |
| AU5602098A (en) | 1998-07-17 |
| EE9900316A (et) | 2000-02-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HRP970698A2 (en) | NITROGEN CONTAINING HETEROAROMATICS AS FACTOR Xa INHIBITORS | |
| US6020357A (en) | Nitrogen containing heteroaromatics as factor Xa inhibitors | |
| US6271237B1 (en) | Nitrogen containing heteromatics with ortho-substituted P1s as factor Xa inhabitors | |
| US6602895B2 (en) | Inhibitors of factor Xa with a neutral P1 specificity group | |
| US6339099B1 (en) | Guanidine mimics as factor Xa inhibitors | |
| AU756755B2 (en) | Novel guanidine mimics as factor Xa inhibitors | |
| EP0991625B1 (de) | Inhibitoren des faktors xa mit einer neutralen gruppe mit p1-spezifität | |
| EP1042299A1 (de) | Stickstoffenthaltende heteroaromaten mit ortho-substituierten p1 gruppen als faktor-xa-inhibitoren | |
| US6548512B1 (en) | Nitrogen containing heteroaromatics as factor Xa inhibitors | |
| LT4673B (lt) | Azoto heteroaromatiniai junginiai kaip faktoriaus xa inhibitoriai | |
| MXPA99005878A (en) | NITROGEN CONTAINING HETEROAROMATICS AS FACTOR Xa INHIBITORS | |
| MXPA00006159A (en) | Nitrogen containing heteroaromatics with ortho-substituted p1's as factor xa inhibitors | |
| LT4702B (lt) | Xa faktoriaus inhibitorius su neutralia p1 specifine grupe | |
| CZ444399A3 (cs) | Inhibitory faktoru Xa s neutrální Pl skupinovou specifičností |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| A1OB | Publication of a patent application | ||
| AIPI | Request for the grant of a patent on the basis of a substantive examination of a patent application | ||
| ODRP | Renewal fee for the maintenance of a patent |
Payment date: 20001222 Year of fee payment: 4 |
|
| ODBI | Application refused |