FI85980C - Foerfarande foer framstaellning av nya terapeutiskt anvaendbara peptidaldehyder. - Google Patents
Foerfarande foer framstaellning av nya terapeutiskt anvaendbara peptidaldehyder. Download PDFInfo
- Publication number
- FI85980C FI85980C FI855118A FI855118A FI85980C FI 85980 C FI85980 C FI 85980C FI 855118 A FI855118 A FI 855118A FI 855118 A FI855118 A FI 855118A FI 85980 C FI85980 C FI 85980C
- Authority
- FI
- Finland
- Prior art keywords
- benzyloxycarbonyl
- arginine
- phenylalanyl
- prolyl
- aldehyde
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 50
- 108090000765 processed proteins & peptides Proteins 0.000 title claims description 21
- 238000002360 preparation method Methods 0.000 title claims description 8
- 229910052757 nitrogen Inorganic materials 0.000 claims description 25
- -1 arginine lactam Chemical class 0.000 claims description 24
- 229960002429 proline Drugs 0.000 claims description 14
- 150000003839 salts Chemical class 0.000 claims description 13
- ONIBWKKTOPOVIA-BYPYZUCNSA-N L-Proline Chemical compound OC(=O)[C@@H]1CCCN1 ONIBWKKTOPOVIA-BYPYZUCNSA-N 0.000 claims description 10
- 239000002253 acid Substances 0.000 claims description 10
- 108010016626 Dipeptides Proteins 0.000 claims description 8
- 229930182821 L-proline Natural products 0.000 claims description 8
- 150000003951 lactams Chemical class 0.000 claims description 8
- 230000002829 reductive effect Effects 0.000 claims description 8
- 229930182832 D-phenylalanine Natural products 0.000 claims description 6
- 125000000174 L-prolyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])[C@@]1([H])C(*)=O 0.000 claims description 6
- ODKSFYDXXFIFQN-UHFFFAOYSA-N Arginine Chemical group OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 229940024606 amino acid Drugs 0.000 claims description 5
- 125000003277 amino group Chemical group 0.000 claims description 5
- COLNVLDHVKWLRT-MRVPVSSYSA-N D-phenylalanine Chemical compound OC(=O)[C@H](N)CC1=CC=CC=C1 COLNVLDHVKWLRT-MRVPVSSYSA-N 0.000 claims description 4
- 150000001413 amino acids Chemical class 0.000 claims description 4
- 125000006239 protecting group Chemical group 0.000 claims description 4
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 claims description 3
- 239000004475 Arginine Substances 0.000 claims description 3
- 229960003121 arginine Drugs 0.000 claims description 3
- 125000003182 D-alloisoleucine group Chemical group [H]N([H])[C@@]([H])(C(=O)[*])[C@](C([H])([H])[H])([H])C(C([H])([H])[H])([H])[H] 0.000 claims description 2
- 125000001711 D-phenylalanine group Chemical group [H]N([H])[C@@]([H])(C(=O)[*])C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 claims 4
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims 1
- AGPKZVBTJJNPAG-CRCLSJGQSA-N D-allo-isoleucine Chemical compound CC[C@H](C)[C@@H](N)C(O)=O AGPKZVBTJJNPAG-CRCLSJGQSA-N 0.000 claims 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 claims 1
- 238000011144 upstream manufacturing Methods 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 109
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 69
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 57
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 48
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 46
- 239000000243 solution Substances 0.000 description 43
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 40
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 33
- 238000004458 analytical method Methods 0.000 description 29
- 239000002904 solvent Substances 0.000 description 27
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 24
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 24
- 150000001299 aldehydes Chemical class 0.000 description 22
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 21
- 239000003153 chemical reaction reagent Substances 0.000 description 21
- 239000000203 mixture Substances 0.000 description 21
- 239000000047 product Substances 0.000 description 21
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 20
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 18
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 18
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 15
- 238000003756 stirring Methods 0.000 description 15
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 14
- 239000011541 reaction mixture Substances 0.000 description 14
- GHXMSCWAYSZCMW-BBWFWOEESA-N (2s)-1-[(2r)-2-amino-3-phenylpropanoyl]-n-[(2s)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide Chemical compound C([C@@H](N)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCNC(N)=N)C=O)C1=CC=CC=C1 GHXMSCWAYSZCMW-BBWFWOEESA-N 0.000 description 13
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- 150000001875 compounds Chemical class 0.000 description 12
- WEVKQMBWAPJFSP-UHFFFAOYSA-N ethyl acetate;2-pyridin-2-ylacetic acid;hydrate Chemical compound O.CCOC(C)=O.OC(=O)CC1=CC=CC=N1 WEVKQMBWAPJFSP-UHFFFAOYSA-N 0.000 description 12
- 239000007858 starting material Substances 0.000 description 12
- 239000003208 petroleum Substances 0.000 description 11
- 239000003054 catalyst Substances 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 9
- 239000013078 crystal Substances 0.000 description 9
- 239000000706 filtrate Substances 0.000 description 9
- 238000007327 hydrogenolysis reaction Methods 0.000 description 9
- 239000012188 paraffin wax Substances 0.000 description 9
- 238000004809 thin layer chromatography Methods 0.000 description 9
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- 102000004196 processed proteins & peptides Human genes 0.000 description 8
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 239000003921 oil Substances 0.000 description 7
- 239000012071 phase Substances 0.000 description 7
- 235000017557 sodium bicarbonate Nutrition 0.000 description 7
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 7
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- 239000013256 coordination polymer Substances 0.000 description 6
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 6
- 239000008367 deionised water Substances 0.000 description 6
- 229910021641 deionized water Inorganic materials 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- 229910052938 sodium sulfate Inorganic materials 0.000 description 6
- 235000011152 sodium sulphate Nutrition 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- 206010016590 Fibrin deposition on lens postoperative Diseases 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 150000008064 anhydrides Chemical class 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 239000000284 extract Substances 0.000 description 5
- 229940012952 fibrinogen Drugs 0.000 description 5
- 229910021653 sulphate ion Inorganic materials 0.000 description 5
- BISKEOIROPAOGY-RXQQAGQTSA-N (2s)-n-[(2s)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[(2r)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide;sulfuric acid Chemical compound OS(O)(=O)=O.C([C@@H](NC)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCN=C(N)N)C=O)C1=CC=CC=C1 BISKEOIROPAOGY-RXQQAGQTSA-N 0.000 description 4
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- 125000002252 acyl group Chemical group 0.000 description 4
- 239000003146 anticoagulant agent Substances 0.000 description 4
- 229940127219 anticoagulant drug Drugs 0.000 description 4
- 230000023555 blood coagulation Effects 0.000 description 4
- 230000015556 catabolic process Effects 0.000 description 4
- 238000004440 column chromatography Methods 0.000 description 4
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 4
- 238000001802 infusion Methods 0.000 description 4
- 230000000977 initiatory effect Effects 0.000 description 4
- 238000001990 intravenous administration Methods 0.000 description 4
- 239000012280 lithium aluminium hydride Substances 0.000 description 4
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 4
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 230000001225 therapeutic effect Effects 0.000 description 4
- ZHLKFJCNKZEBNG-SNVBAGLBSA-N (2r)-2-(ethylamino)-3-phenylpropanoic acid Chemical compound CCN[C@@H](C(O)=O)CC1=CC=CC=C1 ZHLKFJCNKZEBNG-SNVBAGLBSA-N 0.000 description 3
- SLQMUASKUOLVIO-MOPGFXCFSA-N (2s)-1-[(2r)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]pyrrolidine-2-carboxylic acid Chemical compound OC(=O)[C@@H]1CCCN1C(=O)[C@H](NC(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 SLQMUASKUOLVIO-MOPGFXCFSA-N 0.000 description 3
- LHJGJYXLEPZJPM-UHFFFAOYSA-N 2,4,5-trichlorophenol Chemical compound OC1=CC(Cl)=C(Cl)C=C1Cl LHJGJYXLEPZJPM-UHFFFAOYSA-N 0.000 description 3
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 3
- 102000009123 Fibrin Human genes 0.000 description 3
- 108010073385 Fibrin Proteins 0.000 description 3
- BWGVNKXGVNDBDI-UHFFFAOYSA-N Fibrin monomer Chemical compound CNC(=O)CNC(=O)CN BWGVNKXGVNDBDI-UHFFFAOYSA-N 0.000 description 3
- 229930064664 L-arginine Natural products 0.000 description 3
- 235000014852 L-arginine Nutrition 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 235000001014 amino acid Nutrition 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 229950003499 fibrin Drugs 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 239000008194 pharmaceutical composition Substances 0.000 description 3
- 229940012957 plasmin Drugs 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 229910000104 sodium hydride Inorganic materials 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- DQUNNSOIEICROK-HXUWFJFHSA-N (2,4,5-trichlorophenyl) (2r)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate Chemical compound C1=C(Cl)C(Cl)=CC(Cl)=C1OC(=O)[C@H](NC(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 DQUNNSOIEICROK-HXUWFJFHSA-N 0.000 description 2
- SNVGWZGCCPFUMX-LJQANCHMSA-N (2r)-2-[2-methylpropyl(phenylmethoxycarbonyl)amino]-3-phenylpropanoic acid Chemical compound C([C@@H](N(CC(C)C)C(=O)OCC=1C=CC=CC=1)C(O)=O)C1=CC=CC=C1 SNVGWZGCCPFUMX-LJQANCHMSA-N 0.000 description 2
- FJDGTDOSUUBXAB-QGZVFWFLSA-N (2r)-2-[ethyl(phenylmethoxycarbonyl)amino]-3-phenylpropanoic acid Chemical compound C([C@@H](N(CC)C(=O)OCC=1C=CC=CC=1)C(O)=O)C1=CC=CC=C1 FJDGTDOSUUBXAB-QGZVFWFLSA-N 0.000 description 2
- WEQJQNWXCSUVMA-NEPJUHHUSA-N (2s)-1-[(2r)-2-azaniumyl-3-phenylpropanoyl]pyrrolidine-2-carboxylate Chemical compound C([C@@H](N)C(=O)N1[C@@H](CCC1)C(O)=O)C1=CC=CC=C1 WEQJQNWXCSUVMA-NEPJUHHUSA-N 0.000 description 2
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 2
- ADFXKUOMJKEIND-UHFFFAOYSA-N 1,3-dicyclohexylurea Chemical compound C1CCCCC1NC(=O)NC1CCCCC1 ADFXKUOMJKEIND-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- IJNVARQSRMTMKS-UHFFFAOYSA-N 2-amino-2-(hydroxymethyl)propane-1,3-diol;dihydrochloride Chemical compound Cl.Cl.OCC(N)(CO)CO IJNVARQSRMTMKS-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- 241000283690 Bos taurus Species 0.000 description 2
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 2
- 206010053567 Coagulopathies Diseases 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108010049003 Fibrinogen Proteins 0.000 description 2
- 102000008946 Fibrinogen Human genes 0.000 description 2
- AMIMRNSIRUDHCM-UHFFFAOYSA-N Isopropylaldehyde Chemical compound CC(C)C=O AMIMRNSIRUDHCM-UHFFFAOYSA-N 0.000 description 2
- 241000283973 Oryctolagus cuniculus Species 0.000 description 2
- ONIBWKKTOPOVIA-UHFFFAOYSA-N Proline Natural products OC(=O)C1CCCN1 ONIBWKKTOPOVIA-UHFFFAOYSA-N 0.000 description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 2
- 239000003708 ampul Substances 0.000 description 2
- 239000004019 antithrombin Substances 0.000 description 2
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 230000035602 clotting Effects 0.000 description 2
- 230000003247 decreasing effect Effects 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- 229940110377 dl- arginine Drugs 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 229940088598 enzyme Drugs 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 239000007792 gaseous phase Substances 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 150000004678 hydrides Chemical class 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 239000003456 ion exchange resin Substances 0.000 description 2
- 229920003303 ion-exchange polymer Polymers 0.000 description 2
- GSYSFVSGPABNNL-UHFFFAOYSA-N methyl 2-dimethoxyphosphoryl-2-(phenylmethoxycarbonylamino)acetate Chemical group COC(=O)C(P(=O)(OC)OC)NC(=O)OCC1=CC=CC=C1 GSYSFVSGPABNNL-UHFFFAOYSA-N 0.000 description 2
- NUJGJRNETVAIRJ-UHFFFAOYSA-N octanal Chemical compound CCCCCCCC=O NUJGJRNETVAIRJ-UHFFFAOYSA-N 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 229960003766 thrombin (human) Drugs 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 230000009466 transformation Effects 0.000 description 2
- AQMWJXXSHUGYDZ-GFCCVEGCSA-N (2r)-2-(2-methylpropylamino)-3-phenylpropanoic acid Chemical compound CC(C)CN[C@@H](C(O)=O)CC1=CC=CC=C1 AQMWJXXSHUGYDZ-GFCCVEGCSA-N 0.000 description 1
- RRONHWAVOYADJL-OAHLLOKOSA-N (2r)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoic acid Chemical compound C([C@H](C(=O)O)NC(=O)OCC=1C=CC=CC=1)C1=CC=CC=C1 RRONHWAVOYADJL-OAHLLOKOSA-N 0.000 description 1
- OVXLPYFDJUFEHQ-XCUBXKJBSA-N (2r)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrate;hydrochloride Chemical compound O.Cl.CC(C)(C)OC(=O)N[C@@H](C(O)=O)CCCN=C(N)N OVXLPYFDJUFEHQ-XCUBXKJBSA-N 0.000 description 1
- JSHXJPFZKBRLFU-CMPLNLGQSA-N (2r,3s)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoic acid Chemical compound CC[C@H](C)[C@H](C(O)=O)NC(=O)OCC1=CC=CC=C1 JSHXJPFZKBRLFU-CMPLNLGQSA-N 0.000 description 1
- QJYRUYURLPTHLR-YFKPBYRVSA-N 2-[(4s)-4-amino-5-oxopentyl]guanidine Chemical compound O=C[C@@H](N)CCCNC(N)=N QJYRUYURLPTHLR-YFKPBYRVSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- PEDODSOFPMWUMO-UHFFFAOYSA-N 3-ethyl-4-methylmorpholine Chemical compound CCC1COCCN1C PEDODSOFPMWUMO-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- MFYSYFVPBJMHGN-UHFFFAOYSA-N Cortisone Natural products O=C1CCC2(C)C3C(=O)CC(C)(C(CC4)(O)C(=O)CO)C4C3CCC2=C1 MFYSYFVPBJMHGN-UHFFFAOYSA-N 0.000 description 1
- 102000008100 Human Serum Albumin Human genes 0.000 description 1
- 108091006905 Human Serum Albumin Proteins 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-N L-arginine Chemical compound OC(=O)[C@@H](N)CCCN=C(N)N ODKSFYDXXFIFQN-BYPYZUCNSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-N Metaphosphoric acid Chemical compound OP(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- YCCZLSZDZSAZPR-BJGDADDRSA-N OS(O)(=O)=O.C([C@@H](NC)C(=O)NC(CCCNC(N)=N)C(=O)C(=O)[C@H]1NCCC1)C1=CC=CC=C1 Chemical compound OS(O)(=O)=O.C([C@@H](NC)C(=O)NC(CCCNC(N)=N)C(=O)C(=O)[C@H]1NCCC1)C1=CC=CC=C1 YCCZLSZDZSAZPR-BJGDADDRSA-N 0.000 description 1
- 241000283977 Oryctolagus Species 0.000 description 1
- 101710173835 Penton protein Proteins 0.000 description 1
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 239000004133 Sodium thiosulphate Substances 0.000 description 1
- 108090000190 Thrombin Proteins 0.000 description 1
- 208000007536 Thrombosis Diseases 0.000 description 1
- 101000870345 Vasconcellea cundinamarcensis Cysteine proteinase 1 Proteins 0.000 description 1
- JFBZPFYRPYOZCQ-UHFFFAOYSA-N [Li].[Al] Chemical compound [Li].[Al] JFBZPFYRPYOZCQ-UHFFFAOYSA-N 0.000 description 1
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- YBCVMFKXIKNREZ-UHFFFAOYSA-N acoh acetic acid Chemical compound CC(O)=O.CC(O)=O YBCVMFKXIKNREZ-UHFFFAOYSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 230000002429 anti-coagulating effect Effects 0.000 description 1
- 235000009697 arginine Nutrition 0.000 description 1
- 125000000637 arginyl group Chemical group N[C@@H](CCCNC(N)=N)C(=O)* 0.000 description 1
- NHVHYFAWHCJELN-UHFFFAOYSA-N benzene;n,n-dimethylformamide Chemical compound CN(C)C=O.C1=CC=CC=C1 NHVHYFAWHCJELN-UHFFFAOYSA-N 0.000 description 1
- IMNRJGSQCGFPHL-UHFFFAOYSA-N benzene;oxolane Chemical compound C1CCOC1.C1=CC=CC=C1 IMNRJGSQCGFPHL-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- 239000002021 butanolic extract Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- VFNGKCDDZUSWLR-UHFFFAOYSA-L disulfate(2-) Chemical compound [O-]S(=O)(=O)OS([O-])(=O)=O VFNGKCDDZUSWLR-UHFFFAOYSA-L 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- MVEAAGBEUOMFRX-UHFFFAOYSA-N ethyl acetate;hydrochloride Chemical compound Cl.CCOC(C)=O MVEAAGBEUOMFRX-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- BTCSSZJGUNDROE-UHFFFAOYSA-N gamma-aminobutyric acid Chemical compound NCCCC(O)=O BTCSSZJGUNDROE-UHFFFAOYSA-N 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- XLYOFNOQVPJJNP-ZSJDYOACSA-N heavy water Substances [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N hydrofluoric acid Substances F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- QPJSUIGXIBEQAC-UHFFFAOYSA-N n-(2,4-dichloro-5-propan-2-yloxyphenyl)acetamide Chemical compound CC(C)OC1=CC(NC(C)=O)=C(Cl)C=C1Cl QPJSUIGXIBEQAC-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000014508 negative regulation of coagulation Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 239000008024 pharmaceutical diluent Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- CHKVPAROMQMJNQ-UHFFFAOYSA-M potassium bisulfate Chemical compound [K+].OS([O-])(=O)=O CHKVPAROMQMJNQ-UHFFFAOYSA-M 0.000 description 1
- 229910000343 potassium bisulfate Inorganic materials 0.000 description 1
- 230000002797 proteolythic effect Effects 0.000 description 1
- 230000006340 racemization Effects 0.000 description 1
- 239000012925 reference material Substances 0.000 description 1
- 239000013558 reference substance Substances 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- UQDJGEHQDNVPGU-UHFFFAOYSA-N serine phosphoethanolamine Chemical compound [NH3+]CCOP([O-])(=O)OCC([NH3+])C([O-])=O UQDJGEHQDNVPGU-UHFFFAOYSA-N 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 229960004072 thrombin Drugs 0.000 description 1
- 238000000844 transformation Methods 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07K—PEPTIDES
- C07K5/00—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof
- C07K5/04—Peptides containing up to four amino acids in a fully defined sequence; Derivatives thereof containing only normal peptide links
- C07K5/06—Dipeptides
- C07K5/06008—Dipeptides with the first amino acid being neutral
- C07K5/06078—Dipeptides with the first amino acid being neutral and aromatic or cycloaliphatic
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Genetics & Genomics (AREA)
- Biochemistry (AREA)
- Biophysics (AREA)
- General Health & Medical Sciences (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Molecular Biology (AREA)
- Proteomics, Peptides & Aminoacids (AREA)
- Life Sciences & Earth Sciences (AREA)
- Peptides Or Proteins (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU844763A HU192646B (en) | 1984-12-21 | 1984-12-21 | Process for preparing new n-alkyl-peptide aldehydes |
| HU476384 | 1984-12-21 |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| FI855118A0 FI855118A0 (fi) | 1985-12-20 |
| FI855118L FI855118L (fi) | 1986-06-22 |
| FI85980B FI85980B (fi) | 1992-03-13 |
| FI85980C true FI85980C (fi) | 1992-06-25 |
Family
ID=10968854
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI855118A FI85980C (fi) | 1984-12-21 | 1985-12-20 | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara peptidaldehyder. |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4703036A (en:Method) |
| EP (1) | EP0185390B1 (en:Method) |
| JP (1) | JPH0680078B2 (en:Method) |
| CN (1) | CN1025738C (en:Method) |
| AR (1) | AR241710A1 (en:Method) |
| AT (1) | ATE68002T1 (en:Method) |
| AU (1) | AU585561B2 (en:Method) |
| CA (1) | CA1261547A (en:Method) |
| DE (1) | DE3584281D1 (en:Method) |
| DK (1) | DK171403B1 (en:Method) |
| ES (1) | ES8708237A1 (en:Method) |
| FI (1) | FI85980C (en:Method) |
| GR (1) | GR853121B (en:Method) |
| HU (1) | HU192646B (en:Method) |
| IL (1) | IL77416A (en:Method) |
| PT (1) | PT81746B (en:Method) |
| SU (1) | SU1384203A3 (en:Method) |
| ZA (1) | ZA859756B (en:Method) |
Families Citing this family (79)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH075634B2 (ja) * | 1987-10-30 | 1995-01-25 | 日東紡績株式会社 | トリペプチド類及びこれを含有する抗プラスミン剤 |
| GB2244994B (en) * | 1990-06-12 | 1994-01-19 | Richter Gedeon Vegyeszet | Improved process for the preparation of tripeptide aldehydes |
| IL99527A (en) * | 1990-09-28 | 1997-08-14 | Lilly Co Eli | Tripeptide antithrombotic agents |
| US5430023A (en) * | 1990-09-28 | 1995-07-04 | Eli Lilly And Company | Tripeptide antithrombotic agents |
| US5391705A (en) * | 1991-03-15 | 1995-02-21 | Merrell Dow Pharmaceuticals Inc. | Polyfluorinated tripeptide thrombin inhibitors |
| EP0503203A1 (en) * | 1991-03-15 | 1992-09-16 | Merrell Dow Pharmaceuticals Inc. | Novel thrombin inhibitors |
| CA2071621C (en) * | 1991-06-19 | 1996-08-06 | Ahihiko Hosoda | Aldehyde derivatives |
| CA2075154A1 (en) * | 1991-08-06 | 1993-02-07 | Neelakantan Balasubramanian | Peptide aldehydes as antithrombotic agents |
| US5416093A (en) * | 1991-11-12 | 1995-05-16 | Eli Lilly And Company | Antithrombotic agents |
| US5252566A (en) * | 1991-11-12 | 1993-10-12 | Eli Lilly And Company | Antithrombotic agents |
| ZA928581B (en) * | 1991-11-12 | 1994-05-06 | Lilly Co Eli | Antithrombotic agents |
| EP0629212B1 (en) * | 1992-03-04 | 1997-10-08 | Gyogyszerkutato Intezet Kft. | New anticoagulant peptide derivatives and pharmaceutical compositions containing the same as well as a process for the preparation thereof |
| IL108031A0 (en) * | 1992-12-22 | 1994-04-12 | Procter & Gamble | Difluoro pentapeptide derivatives and pharmaceutical compositions containing them |
| US5455229A (en) * | 1992-12-23 | 1995-10-03 | Eli Lilly And Company | Method for minimizing and containing ischemic and reperfusion injury |
| US5672582A (en) * | 1993-04-30 | 1997-09-30 | Merck & Co., Inc. | Thrombin inhibitors |
| AU670381B2 (en) * | 1993-04-30 | 1996-07-11 | Merck & Co., Inc. | Thrombin inhibitors |
| US5783563A (en) * | 1993-06-03 | 1998-07-21 | Astra Aktiebolag | Method for treatment or prophylaxis of venous thrombosis |
| SE9301916D0 (sv) * | 1993-06-03 | 1993-06-03 | Ab Astra | New peptides derivatives |
| US6984627B1 (en) | 1993-06-03 | 2006-01-10 | Astrazeneca Ab | Peptide derivatives |
| US5436229A (en) * | 1994-03-04 | 1995-07-25 | Eli Lilly And Company | Bisulfite adducts of arginine aldehydes |
| US5726159A (en) * | 1994-03-04 | 1998-03-10 | Eli Lilly And Company | Antithrombotic agents |
| US5707966A (en) * | 1994-03-04 | 1998-01-13 | Eli Lilly And Company | Antithrombotic agents |
| US5705487A (en) * | 1994-03-04 | 1998-01-06 | Eli Lilly And Company | Antithrombotic agents |
| US5439888A (en) * | 1994-03-04 | 1995-08-08 | Eli Lilly And Company | Antithrombotic agents |
| CA2143533A1 (en) * | 1994-03-04 | 1995-09-05 | Kenneth D. Kurz | Antithrombotic agents |
| US5885967A (en) * | 1994-03-04 | 1999-03-23 | Eli Lilly And Company | Antithrombotic agents |
| US5488037A (en) * | 1994-03-04 | 1996-01-30 | Eli Lilly And Company | Antithrombotic agents |
| US5484772A (en) * | 1994-03-04 | 1996-01-16 | Eli Lilly And Company | Antithrombotic agents |
| US5602101A (en) * | 1994-03-04 | 1997-02-11 | Eli Lilly And Company | Antithrombotic agents |
| ZA951618B (en) * | 1994-03-04 | 1996-08-27 | Lilly Co Eli | Antithrombotic agents |
| DE4421052A1 (de) | 1994-06-17 | 1995-12-21 | Basf Ag | Neue Thrombininhibitoren, ihre Herstellung und Verwendung |
| US5514777A (en) * | 1994-06-17 | 1996-05-07 | Corvas International, Inc. | Methods of synthesis of peptidyl argininals |
| DE69525641T2 (de) * | 1994-06-17 | 2002-10-17 | Corvas International, Inc. | Verfahren zur herstellung von peptidyl-argininaldehyden |
| SE9404196D0 (sv) * | 1994-12-02 | 1994-12-02 | Astra Ab | New antithrombotic formulation |
| US6025472A (en) * | 1994-12-21 | 2000-02-15 | Corvas International, Inc. | N-substituted glycine derivatives as enzyme inhibitors |
| US5696231A (en) * | 1994-12-21 | 1997-12-09 | Corvas International, Inc. | N-substituted glycine derivatives as enzyme inhibitors |
| JPH11500120A (ja) * | 1995-02-17 | 1999-01-06 | ビーエーエスエフ アクチェンゲゼルシャフト | 新規なトロンビンインヒビター |
| US5914319A (en) * | 1995-02-27 | 1999-06-22 | Eli Lilly And Company | Antithrombotic agents |
| US5710130A (en) * | 1995-02-27 | 1998-01-20 | Eli Lilly And Company | Antithrombotic agents |
| SA96170106A (ar) | 1995-07-06 | 2005-12-03 | أسترا أكتيبولاج | مشتقات حامض أميني جديدة |
| US6069232A (en) * | 1995-10-02 | 2000-05-30 | Hoechst Marion Roussel, Inc. | Polyfluoroalkyl tryptophan tripeptide thrombin inhibitors |
| AR005245A1 (es) * | 1995-12-21 | 1999-04-28 | Astrazeneca Ab | Prodrogas de inhibidores de trombina, una formulación farmaceutica que las comprende, el uso de dichas prodrogas para la manufactura de un medicamento y un procedimiento para su preparacion |
| DE19549118C2 (de) * | 1995-12-29 | 2000-07-13 | Thomas W Stief | Hämostaseaktivierungs-Inhibitor und Verfahren zum Hemmen der Hämostaseaktivierung in Blut oder anderen biologischen Flüssigkeiten |
| DE19605039A1 (de) | 1996-02-12 | 1997-08-14 | Hoechst Ag | Verfahren zur Herstellung von Oligopeptid-Aldehyden |
| US5739354A (en) * | 1996-03-26 | 1998-04-14 | Hoechst Marion Roussel, Inc. | Process for the preparation of N-methyl-D-phenylalanyl-N- 1- 3- (aminoiminomethyl)amino!propyl!-3,3-difluoro-2-oxohexyl!-L-prolinamide |
| HU224315B1 (hu) * | 1996-06-05 | 2005-07-28 | Gyógyszerkutató Intézet Kft. | Véralvadásgátló hatású peptidil-arginin-aldehid-származékok és a vegyületeket tartalmazó gyógyszerkészítmények |
| HU222199B1 (hu) * | 1996-06-05 | 2003-05-28 | Gyógyszerkutató Intézet Kft. | Véralvadásgátló hatású peptid-aldehid-származékok és a vegyületeket tartalmazó gyógyszerkészítmények |
| SE9602263D0 (sv) | 1996-06-07 | 1996-06-07 | Astra Ab | New amino acid derivatives |
| SE9602646D0 (sv) | 1996-07-04 | 1996-07-04 | Astra Ab | Pharmaceutically-useful compounds |
| BR9712114A (pt) | 1996-09-24 | 1999-08-31 | Procter & Gamble | Composições detergente líquidas para lavanderia contendo enzima proteolítica e inibidores de protease. |
| US6165966A (en) * | 1996-09-24 | 2000-12-26 | The Procter & Gamble Company | Liquid detergents containing proteolytic enzyme and protease inhibitors |
| US6162783A (en) * | 1996-09-24 | 2000-12-19 | The Procter & Gamble Company | Liquid detergents containing proteolytic enzyme and protease inhibitors |
| US5798377A (en) * | 1996-10-21 | 1998-08-25 | Merck & Co., Inc. | Thrombin inhibitors |
| AR013084A1 (es) | 1997-06-19 | 2000-12-13 | Astrazeneca Ab | Derivados de amidino utiles como inhibidores de la trombina, composicion farmaceutica, utilizacion de dichos compuestos para la preparacion demedicamentos y proceso para la preparacion de los compuestos mencionados |
| SE9704543D0 (sv) | 1997-12-05 | 1997-12-05 | Astra Ab | New compounds |
| WO1999037668A1 (de) | 1998-01-26 | 1999-07-29 | Basf Aktiengesellschaft | Thrombininhibitoren |
| SE9804313D0 (sv) | 1998-12-14 | 1998-12-14 | Astra Ab | New compounds |
| TR200102037T2 (tr) | 1999-01-13 | 2001-10-22 | Astrazeneca Ab | Yeni amidinobenzilamin türevleri ve trombin engelleyiciler olarak kullanılmaları. |
| KR20020004971A (ko) * | 1999-03-16 | 2002-01-16 | 이경하 | 치환 프로린 유도체 및 이들을 함유하고 있는 의약 조성물 |
| SE0001803D0 (sv) | 2000-05-16 | 2000-05-16 | Astrazeneca Ab | New compounds i |
| US6433186B1 (en) | 2000-08-16 | 2002-08-13 | Astrazeneca Ab | Amidino derivatives and their use as thormbin inhibitors |
| AR035216A1 (es) | 2000-12-01 | 2004-05-05 | Astrazeneca Ab | Derivados de acido mandelico ,derivados farmaceuticamente aceptables, uso de estos derivados para la fabricacion de medicamentos, metodos de tratamiento ,procesos para la preparacion de estos derivados, y compuestos intermediarios |
| US7129233B2 (en) | 2000-12-01 | 2006-10-31 | Astrazeneca Ab | Mandelic acid derivatives and their use as thrombin inhibitors |
| AU2002230836A1 (en) | 2000-12-18 | 2002-07-01 | Merck & Co., Inc. | Benzylamine derivatives and their use as thrombin inhibitors |
| US6528503B2 (en) | 2000-12-18 | 2003-03-04 | Merck & Co., Inc. | Thrombin inhibitors |
| JP2005504003A (ja) | 2001-02-09 | 2005-02-10 | メルク エンド カムパニー インコーポレーテッド | トロンビン阻害剤 |
| AR034517A1 (es) * | 2001-06-21 | 2004-02-25 | Astrazeneca Ab | Formulacion farmaceutica |
| MXPA04001534A (es) * | 2001-08-21 | 2004-11-22 | Ivax Drug Res Inst Ltd | Peptidos arginales y metodos para el tratamiento de la coagulacion intravascular diseminada. |
| US7084134B2 (en) * | 2002-05-02 | 2006-08-01 | Merk & Co., Inc. | Thrombin inhibitors |
| SE0201659D0 (sv) | 2002-05-31 | 2002-05-31 | Astrazeneca Ab | Modified release pharmaceutical formulation |
| SE0201661D0 (sv) | 2002-05-31 | 2002-05-31 | Astrazeneca Ab | New salts |
| US7781424B2 (en) * | 2003-05-27 | 2010-08-24 | Astrazeneca Ab | Modified release pharmaceutical formulation |
| US7795205B2 (en) | 2004-04-12 | 2010-09-14 | Canyon Pharmaceuticals, Inc. | Methods for effecting regression of tumor mass and size in a metastasized pancreatic tumor |
| TW200827336A (en) | 2006-12-06 | 2008-07-01 | Astrazeneca Ab | New crystalline forms |
| EP2224949B1 (en) | 2007-11-30 | 2012-10-17 | University of Debrecen | Use of urokinase type plasminogen activator inhibitors for the treatment of corneal disorders |
| KR101956895B1 (ko) | 2011-07-01 | 2019-03-12 | 노보자임스 에이/에스 | 안정화된 서브틸리신 조성물 |
| WO2016001319A1 (en) | 2014-07-03 | 2016-01-07 | Novozymes A/S | Improved stabilization of non-protease enzyme |
| CN107469379B (zh) * | 2016-06-07 | 2020-03-06 | 中国科学院大连化学物理研究所 | 一种样品中残留水溶性有机溶剂的去除方法 |
| JP2022538360A (ja) | 2019-07-01 | 2022-09-01 | ビーエーエスエフ ソシエタス・ヨーロピア | 酵素を安定化するためのペプチドアセタール |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| HU177098B (en) * | 1979-01-04 | 1981-07-28 | Gyogyszerkutato Intezet | Process for producing new peptidyl-n-carboxy-l-arginin-a |
| CA1161431A (en) * | 1979-05-11 | 1984-01-31 | Lars G. Svendsen | Tripeptide derivatives |
| HU184368B (en) * | 1981-01-13 | 1984-08-28 | Gyogyszerkutato Intezet | Process for preparing d-phenyl-alanyl-l-propyl-l-arginine-ald ehyde-shulphate |
| US4434096A (en) * | 1981-06-30 | 1984-02-28 | E. I. Du Pont De Nemours And Company | Substrates for the quantitative determination of proteolytic enzymes |
| US4448717A (en) * | 1982-11-12 | 1984-05-15 | Eli Lilly And Company | Pharmacologically active peptides |
| DE3244030A1 (de) * | 1982-11-27 | 1984-05-30 | Behringwerke Ag, 3550 Marburg | Chromogene verbindungen, verfahren zu ihrer herstellung und ihre verwendung |
| CA1267499A (en) * | 1983-07-12 | 1990-04-03 | Cedric H. Hassall | Peptide amides and aldehydes |
-
1984
- 1984-12-21 HU HU844763A patent/HU192646B/hu unknown
-
1985
- 1985-12-19 CN CN85109736A patent/CN1025738C/zh not_active Expired - Lifetime
- 1985-12-20 ZA ZA859756A patent/ZA859756B/xx unknown
- 1985-12-20 AU AU51553/85A patent/AU585561B2/en not_active Ceased
- 1985-12-20 ES ES550296A patent/ES8708237A1/es not_active Expired
- 1985-12-20 IL IL77416A patent/IL77416A/xx active IP Right Grant
- 1985-12-20 FI FI855118A patent/FI85980C/fi not_active IP Right Cessation
- 1985-12-20 GR GR853121A patent/GR853121B/el not_active IP Right Cessation
- 1985-12-20 SU SU3992296A patent/SU1384203A3/ru active
- 1985-12-20 US US06/811,937 patent/US4703036A/en not_active Expired - Lifetime
- 1985-12-20 DK DK596385A patent/DK171403B1/da not_active IP Right Cessation
- 1985-12-20 PT PT81746A patent/PT81746B/pt not_active IP Right Cessation
- 1985-12-20 AR AR85302660A patent/AR241710A1/es active
- 1985-12-20 CA CA000498306A patent/CA1261547A/en not_active Expired
- 1985-12-20 JP JP60285851A patent/JPH0680078B2/ja not_active Expired - Fee Related
- 1985-12-23 AT AT85116383T patent/ATE68002T1/de not_active IP Right Cessation
- 1985-12-23 DE DE8585116383T patent/DE3584281D1/de not_active Expired - Lifetime
- 1985-12-23 EP EP85116383A patent/EP0185390B1/de not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| AR241710A1 (es) | 1992-11-30 |
| EP0185390B1 (de) | 1991-10-02 |
| US4703036A (en) | 1987-10-27 |
| CN85109736A (zh) | 1987-03-18 |
| AU585561B2 (en) | 1989-06-22 |
| EP0185390A3 (en) | 1988-09-07 |
| ATE68002T1 (de) | 1991-10-15 |
| EP0185390A2 (de) | 1986-06-25 |
| PT81746A (en) | 1986-01-01 |
| DE3584281D1 (de) | 1991-11-07 |
| CN1025738C (zh) | 1994-08-24 |
| DK596385D0 (da) | 1985-12-20 |
| HU192646B (en) | 1987-06-29 |
| JPS61152699A (ja) | 1986-07-11 |
| FI855118L (fi) | 1986-06-22 |
| PT81746B (pt) | 1987-11-11 |
| JPH0680078B2 (ja) | 1994-10-12 |
| FI85980B (fi) | 1992-03-13 |
| ES8708237A1 (es) | 1987-10-01 |
| CA1261547A (en) | 1989-09-26 |
| DK171403B1 (da) | 1996-10-14 |
| HUT38954A (en) | 1986-07-28 |
| DK596385A (da) | 1986-06-22 |
| ZA859756B (en) | 1986-09-24 |
| GR853121B (en:Method) | 1986-04-22 |
| SU1384203A3 (ru) | 1988-03-23 |
| ES550296A0 (es) | 1987-10-01 |
| AU5155385A (en) | 1986-06-26 |
| IL77416A (en) | 1990-04-29 |
| FI855118A0 (fi) | 1985-12-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI85980C (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara peptidaldehyder. | |
| FI74024C (fi) | Foerfarande foer framstaellning av d-fenylalanyl-l-prolyl-l-argininaldehydsulfat. | |
| JP3453357B2 (ja) | トロンビンの阻害剤および基質 | |
| Bajusz et al. | Highly active and selective anticoagulants: D-Phe-Pro-Arg-H, a free tripeptide aldehyde prone to spontaneous inactivation, and its stable N-methyl derivative, D-MePhe-Pro-Arg-H | |
| EP0664786B1 (en) | Arginine keto-amide enzyme inhibitors | |
| FI119812B (fi) | Menetelmä uusien, terapeuttisesti käyttökelpoisten peptidijohdannaisten valmistamiseksi | |
| JP4537581B2 (ja) | VIIa因子阻害剤 | |
| US5658939A (en) | Methionine sulfone and S-substituted cysteine sulfone derivatives as enzyme inhibitors | |
| US4927809A (en) | Oligopeptidyl nitrile derivatives, agents containing them and their use | |
| KR100360831B1 (ko) | 시클로펩티드유도체및이의제조방법 | |
| JPH08508716A (ja) | 血栓症のインヒビター | |
| CA2338524A1 (en) | Inhibitors of urokinase and blood vessel formation | |
| IE49653B1 (en) | Mercaptoacyldipeptides | |
| FI93646C (fi) | Menetelmä terapeuttisesti käyttökelpoisten oligopeptidien valmistamiseksi, joissa on proliinille analogisia syklisiä aminohappoja | |
| US5532366A (en) | Heterocyclic amides | |
| DE69313290T2 (de) | Laktam-dipeptide mit inhibierender wirkung auf die menschliche leukozytenelastase | |
| US4371466A (en) | Mammalian collagenase inhibitors | |
| US5648338A (en) | Inhibitors and substrates of thrombin | |
| CN108610394B (zh) | 一种拟肽类化合物的制备纯化方法以及应用 | |
| US3793304A (en) | Cyclic decapeptides comprising an l-tyrosine radical | |
| US6387881B1 (en) | Inhibitors and substrates of thrombin | |
| Bajusz | Chemistry and biology of the peptide anticoagulant D-MePhe-Pro-Arg-H (GYKI-14766) | |
| CA2192686A1 (en) | Arginine mimic derivatives as enzyme inhibitors | |
| CA2192210A1 (en) | 3-amino-2-oxo-1-piperidineacetic derivatives as enzyme inhibitors | |
| CA2207373A1 (en) | N-substituted glycine derivatives as inhibitors of factor xa |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FG | Patent granted |
Owner name: GYOGYSZERKUTATO INTEZET KFT |
|
| MA | Patent expired |