DE926426C - Verfahren zur Herstellung von Isopropylbenzolperoxyd - Google Patents
Verfahren zur Herstellung von IsopropylbenzolperoxydInfo
- Publication number
- DE926426C DE926426C DEP33124A DEP0033124A DE926426C DE 926426 C DE926426 C DE 926426C DE P33124 A DEP33124 A DE P33124A DE P0033124 A DEP0033124 A DE P0033124A DE 926426 C DE926426 C DE 926426C
- Authority
- DE
- Germany
- Prior art keywords
- isopropylbenzene
- oxidation
- reaction
- peroxide
- reaction mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 28
- XMNIXWIUMCBBBL-UHFFFAOYSA-N 2-(2-phenylpropan-2-ylperoxy)propan-2-ylbenzene Chemical compound C=1C=CC=CC=1C(C)(C)OOC(C)(C)C1=CC=CC=C1 XMNIXWIUMCBBBL-UHFFFAOYSA-N 0.000 title claims description 8
- 238000004519 manufacturing process Methods 0.000 title description 8
- RWGFKTVRMDUZSP-UHFFFAOYSA-N cumene Chemical compound CC(C)C1=CC=CC=C1 RWGFKTVRMDUZSP-UHFFFAOYSA-N 0.000 claims description 125
- 150000002978 peroxides Chemical class 0.000 claims description 55
- 229910052760 oxygen Inorganic materials 0.000 claims description 42
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 41
- 238000007254 oxidation reaction Methods 0.000 claims description 41
- 239000001301 oxygen Substances 0.000 claims description 41
- 230000003647 oxidation Effects 0.000 claims description 39
- 239000011541 reaction mixture Substances 0.000 claims description 39
- 238000006243 chemical reaction Methods 0.000 claims description 36
- 238000010521 absorption reaction Methods 0.000 claims description 17
- 239000007791 liquid phase Substances 0.000 claims description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 10
- 239000008346 aqueous phase Substances 0.000 claims description 8
- 239000000203 mixture Substances 0.000 claims description 8
- 239000003085 diluting agent Substances 0.000 claims description 7
- 239000007789 gas Substances 0.000 claims description 7
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 6
- 239000007764 o/w emulsion Substances 0.000 claims description 6
- 239000000126 substance Substances 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 5
- 229910001882 dioxygen Inorganic materials 0.000 claims description 5
- 230000015572 biosynthetic process Effects 0.000 claims description 4
- 239000003054 catalyst Substances 0.000 claims description 3
- 150000003440 styrenes Chemical class 0.000 claims description 3
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 claims description 2
- 229910001385 heavy metal Inorganic materials 0.000 claims description 2
- 239000002253 acid Substances 0.000 claims 1
- 150000007513 acids Chemical class 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 23
- 239000003513 alkali Substances 0.000 description 14
- 238000000354 decomposition reaction Methods 0.000 description 10
- 239000007788 liquid Substances 0.000 description 10
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- 235000011121 sodium hydroxide Nutrition 0.000 description 7
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 5
- 230000035484 reaction time Effects 0.000 description 5
- 239000000047 product Substances 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- 229910001209 Low-carbon steel Inorganic materials 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 3
- 230000009286 beneficial effect Effects 0.000 description 3
- 230000007423 decrease Effects 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 150000004679 hydroxides Chemical class 0.000 description 3
- 230000006698 induction Effects 0.000 description 3
- RYYKJJJTJZKILX-UHFFFAOYSA-M sodium octadecanoate Chemical compound [Na+].CCCCCCCCCCCCCCCCCC([O-])=O RYYKJJJTJZKILX-UHFFFAOYSA-M 0.000 description 3
- JLBJTVDPSNHSKJ-UHFFFAOYSA-N 4-Methylstyrene Chemical compound CC1=CC=C(C=C)C=C1 JLBJTVDPSNHSKJ-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 239000012295 chemical reaction liquid Substances 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 238000010924 continuous production Methods 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000011049 filling Methods 0.000 description 2
- 210000004124 hock Anatomy 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- -1 peroxide compounds Chemical class 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- IVAOQJNBYYIDSI-UHFFFAOYSA-N [O].[Na] Chemical compound [O].[Na] IVAOQJNBYYIDSI-UHFFFAOYSA-N 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- 230000001133 acceleration Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 238000010923 batch production Methods 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- MOTZDAYCYVMXPC-UHFFFAOYSA-N dodecyl hydrogen sulfate Chemical compound CCCCCCCCCCCCOS(O)(=O)=O MOTZDAYCYVMXPC-UHFFFAOYSA-N 0.000 description 1
- 229940043264 dodecyl sulfate Drugs 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 231100000989 no adverse effect Toxicity 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 230000036284 oxygen consumption Effects 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000001577 simple distillation Methods 0.000 description 1
- IJRHDFLHUATAOS-DPMBMXLASA-M sodium ricinoleate Chemical compound [Na+].CCCCCC[C@@H](O)C\C=C/CCCCCCCC([O-])=O IJRHDFLHUATAOS-DPMBMXLASA-M 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 238000009827 uniform distribution Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C409/00—Peroxy compounds
- C07C409/02—Peroxy compounds the —O—O— group being bound between a carbon atom, not further substituted by oxygen atoms, and hydrogen, i.e. hydroperoxides
- C07C409/04—Peroxy compounds the —O—O— group being bound between a carbon atom, not further substituted by oxygen atoms, and hydrogen, i.e. hydroperoxides the carbon atom being acyclic
- C07C409/08—Compounds containing six-membered aromatic rings
- C07C409/10—Cumene hydroperoxide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C407/00—Preparation of peroxy compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8742/47A GB630286A (en) | 1947-04-01 | 1947-04-01 | Manufacture of peroxides |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE926426C true DE926426C (de) | 1955-04-18 |
Family
ID=9858394
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEP33124A Expired DE926426C (de) | 1947-04-01 | 1949-02-03 | Verfahren zur Herstellung von Isopropylbenzolperoxyd |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US2632772A (enExample) |
| BE (1) | BE481560A (enExample) |
| DE (1) | DE926426C (enExample) |
| FR (1) | FR964006A (enExample) |
| GB (1) | GB630286A (enExample) |
| IT (2) | IT440452A (enExample) |
| NL (2) | NL139666B (enExample) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2735870A (en) * | 1956-02-21 | Peroxides of saturated cyclic terpenes | ||
| US2632773A (en) * | 1947-04-01 | 1953-03-24 | Hercules Powder Co Ltd | Manufacture of peroxidic compounds |
| US3187055A (en) * | 1948-03-19 | 1965-06-01 | Hercules Powder Co Ltd | Manufacture of peroxidic compounds |
| DE969744C (de) * | 1950-03-03 | 1958-07-10 | Bayer Ag | Verfahren zur Herstellung von ª‡, ª‡-Dimethylbenzylhydroperoxyd |
| BE509545A (enExample) * | 1951-04-28 | |||
| BE513635A (enExample) * | 1951-08-23 | |||
| DE969206C (de) * | 1951-10-31 | 1958-05-14 | Bergwerksgesellschaft Hibernia | Verfahren zur Herstellung von Cumolhydroperoxyd |
| NL79941C (enExample) * | 1951-10-31 | |||
| DE973216C (de) * | 1952-01-01 | 1959-12-24 | Bergwerksgesellschaft Hibernia | Verfahren zur Herstellung von alkyl- oder aralkylsubstituierten aromatischen Hydroperoxyden |
| US2749368A (en) * | 1952-09-15 | 1956-06-05 | Shell Dev | Production of aralkyl hydroperoxides |
| US2829173A (en) * | 1952-11-08 | 1958-04-01 | California Research Corp | Oxidation process |
| US2776999A (en) * | 1952-11-20 | 1957-01-08 | Allied Chem & Dye Corp | Manufacture of cumene hydroperoxide |
| US2991314A (en) * | 1953-10-20 | 1961-07-04 | Inventa Ag | Process for cleavage of lignin to produce phenols |
| US2798096A (en) * | 1954-02-17 | 1957-07-02 | Exxon Research Engineering Co | Production of cyclic hydroperoxides |
| US2867666A (en) * | 1954-09-22 | 1959-01-06 | Monsanto Chemicals | Production of alpha-methylbenzyl hydroperoxide |
| US2906789A (en) * | 1956-09-17 | 1959-09-29 | Schenectady Varnish Company In | Manufacture of phenol from cumene |
| US2967891A (en) * | 1958-04-03 | 1961-01-10 | Texaco Inc | Manufacture of secondary butylbenzene hydroperoxide |
| US4036890A (en) * | 1964-05-13 | 1977-07-19 | Veba-Chemie Ag | Preparation of organic hydroperoxides |
| JPS5123490B2 (enExample) * | 1972-06-23 | 1976-07-17 | ||
| US4258948A (en) * | 1979-08-20 | 1981-03-31 | Hoffmann Thomas M | Roofer's bundle tool |
| CA1156264A (en) * | 1980-01-21 | 1983-11-01 | Ludovicus B.J.O. Van Der Weijst | Method for the prevention of disturbances and/or the effects of disturbances in the preparation of hydrocarbon hydroperoxides by oxidation of hydrocarbons with molecular oxygen |
| US4935551A (en) * | 1987-12-22 | 1990-06-19 | Indspec Chemical Corporation | Hydroperoxidation of diisopropylbenzene |
| US4950794A (en) * | 1989-05-24 | 1990-08-21 | Arco Chemical Technology, Inc. | Ethylbenzene oxidation |
| US6077977A (en) * | 1998-06-01 | 2000-06-20 | General Electric Company | Method for preparing hydroperoxides by oxygenation |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2379390A (en) * | 1942-01-08 | 1945-06-26 | Distillers Co Yeast Ltd | Manufacture of acyl peroxides |
| US2403772A (en) * | 1943-11-15 | 1946-07-09 | Shell Dev | Production of organic hydroperoxides |
| US2472152A (en) * | 1944-08-05 | 1949-06-07 | Union Oil Co | Diesel engine fuel |
| US2430864A (en) * | 1945-01-30 | 1947-11-18 | Union Oil Co | Hydrocarbon peroxides |
| US2447794A (en) * | 1945-01-30 | 1948-08-24 | Union Oil Co | Hydrocarbon peroxides |
| US2484841A (en) * | 1947-05-14 | 1949-10-18 | Hercules Powder Co Ltd | Reduction of hydroperoxides |
-
0
- BE BE481560D patent/BE481560A/xx unknown
- IT IT456410D patent/IT456410A/it unknown
- FR FR964006D patent/FR964006A/fr not_active Expired
- IT IT440452D patent/IT440452A/it unknown
- NL NL88782D patent/NL88782C/xx active
- NL NL696905913A patent/NL139666B/xx unknown
-
1947
- 1947-04-01 GB GB8742/47A patent/GB630286A/en not_active Expired
-
1948
- 1948-03-19 US US15954A patent/US2632772A/en not_active Expired - Lifetime
-
1949
- 1949-02-03 DE DEP33124A patent/DE926426C/de not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IT456410A (enExample) | |
| NL139666B (nl) | |
| FR964006A (enExample) | 1950-08-01 |
| NL88782C (enExample) | |
| IT440452A (enExample) | |
| GB630286A (en) | 1949-10-10 |
| US2632772A (en) | 1953-03-24 |
| BE481560A (enExample) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE926426C (de) | Verfahren zur Herstellung von Isopropylbenzolperoxyd | |
| DE60314010T2 (de) | Verfahren zur reduzierung der aldehydkonzentration in einer mischung die cyclohexanon und ein oder mehrere aldehyde enthält | |
| DE2650892A1 (de) | Verfahren zur aufarbeitung von cyclohexanol und cyclohexanon enthaltenden reaktionsgemischen | |
| DE2315350C3 (de) | Verfahren zur Oxidation von aliphatischen und cycloaliphatischen C5-C12-Kohlenwasserstoffen | |
| DE1618818B1 (de) | Verfahren zur Herstellung von Cyclohexanol und Gemischen von Cyclhexanol und Cyclohexanon | |
| DE1000024B (de) | Verfahren zur Herstellung von Hydroperoxyden alkylaromatischer Kohlenwasserstoffe, besonders von Cumolhydroperoxyd | |
| DE1668480A1 (de) | Verfahren zur Herstellung von AEthylbenzolhydroperoxyd | |
| DE870853C (de) | Verfahren zur Herstellung von Diisopropylbenzolhydroperoxyden | |
| DE2035496C3 (de) | Verfahren zur kontinuierlichen Herstellung von Cumolhydroperoxid | |
| DE1959621C3 (de) | Verfahren zur Gewinnung von Adipinsäure aus 6-Hydroperoxyhexansäure | |
| CH379496A (de) | Verfahren zur Herstellung von Hydroperoxyden aus dialkylierten Aromaten | |
| DE961168C (de) | Verfahren zur Herstellung von m- und p-Diisopropylbenzoldihydroperoxyden | |
| DE1668221C3 (de) | Verfahren zur Herstellung von Gemischen aus Cycloalkanolen und den entsprechenden Cycloalkanonen | |
| DE962527C (de) | Verfahren zur Herstellung von Oxyhydroperoxyden | |
| DE2435821A1 (de) | Verfahren zur gewinnung von propylenoxid | |
| DE819092C (de) | Verfahren zur Herstellung von Isopropylbenzolhydroperoxyd | |
| DE2029706A1 (de) | Verfahren zur Herstellung von Kresol und Aceton | |
| DE1082255B (de) | Verfahren zur Herstellung von Hydroperoxyden der Terpenkohlenwasserstoffe | |
| DE2342459A1 (de) | Verfahren zur kontinuierlichen herstellung von meta- und para-diisopropylbenzol-dihydroperoxyd | |
| DE1518012C3 (de) | Verfahren zur Herstellung von Resorcin durch saurekatalysierte Spaltung eines m Dialkylbenzolbishydro peroxyds | |
| DE1058047B (de) | Verfahren zur Herstellung von Mesityloxyd oder seiner Homologen | |
| DE970174C (de) | Verfahren zur Herstellung von Wasserstoffperoxyd | |
| DE2254548C3 (de) | Verfahren zur Herstellung von Äthylphenolen und Acetaldehyd | |
| DE866941C (de) | Verfahren zur Herstellung von ª‰-Naphthol | |
| AT221507B (de) | Verfahren zur Herstellung von Dihydroperoxyden in Form ihrer Lösungen in wässerigen Alkalien |