DE848496C - Verfahren zur Herstellung von neuen Abkoemmlingen der 4, 4'-Diaminostilben-disulfonsaeure-(2, 2') - Google Patents
Verfahren zur Herstellung von neuen Abkoemmlingen der 4, 4'-Diaminostilben-disulfonsaeure-(2, 2')Info
- Publication number
- DE848496C DE848496C DEC2139A DEC0002139A DE848496C DE 848496 C DE848496 C DE 848496C DE C2139 A DEC2139 A DE C2139A DE C0002139 A DEC0002139 A DE C0002139A DE 848496 C DE848496 C DE 848496C
- Authority
- DE
- Germany
- Prior art keywords
- amino
- disulfonic acid
- mole
- triazyl
- mol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 13
- 238000004519 manufacturing process Methods 0.000 title description 2
- -1 aromatic hydroxyl compound Chemical class 0.000 claims description 50
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 37
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 claims description 34
- 150000001875 compounds Chemical class 0.000 claims description 28
- 239000000047 product Substances 0.000 claims description 23
- 239000007859 condensation product Substances 0.000 claims description 21
- 239000002253 acid Substances 0.000 claims description 14
- 150000003839 salts Chemical class 0.000 claims description 14
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 12
- 125000003118 aryl group Chemical group 0.000 claims description 11
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical group C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 claims description 10
- 125000001931 aliphatic group Chemical group 0.000 claims description 10
- 150000001412 amines Chemical class 0.000 claims description 10
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 10
- 125000003277 amino group Chemical group 0.000 claims description 9
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 9
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 7
- 229910052757 nitrogen Inorganic materials 0.000 claims description 7
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 7
- 239000003513 alkali Substances 0.000 claims description 6
- 229910021529 ammonia Inorganic materials 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- VHYBUUMUUNCHCK-UHFFFAOYSA-N 2,4,6-tribromo-1,3,5-triazine Chemical compound BrC1=NC(Br)=NC(Br)=N1 VHYBUUMUUNCHCK-UHFFFAOYSA-N 0.000 claims description 5
- 125000001424 substituent group Chemical group 0.000 claims description 5
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- 239000007795 chemical reaction product Substances 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- ZJOJXRSMJNWWRN-UHFFFAOYSA-N 3-amino-6-[2-(4-aminophenyl)ethenyl]benzene-1,2-disulfonic acid Chemical class C1=CC(N)=CC=C1C=CC1=CC=C(N)C(S(O)(=O)=O)=C1S(O)(=O)=O ZJOJXRSMJNWWRN-UHFFFAOYSA-N 0.000 claims description 3
- OBMWMYYXXOFKMR-UHFFFAOYSA-N C1=CC(N)=CC=C1C=CC1=CC=C([N+]([O-])=O)C(S(O)(=O)=O)=C1S(O)(=O)=O Chemical compound C1=CC(N)=CC=C1C=CC1=CC=C([N+]([O-])=O)C(S(O)(=O)=O)=C1S(O)(=O)=O OBMWMYYXXOFKMR-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- PJANXHGTPQOBST-VAWYXSNFSA-N Stilbene Natural products C=1C=CC=CC=1/C=C/C1=CC=CC=C1 PJANXHGTPQOBST-VAWYXSNFSA-N 0.000 claims description 2
- 239000011230 binding agent Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 235000021286 stilbenes Nutrition 0.000 claims description 2
- 150000001447 alkali salts Chemical class 0.000 claims 4
- 125000000467 secondary amino group Chemical class [H]N([*:1])[*:2] 0.000 claims 3
- 230000004048 modification Effects 0.000 claims 1
- 238000012986 modification Methods 0.000 claims 1
- 238000005648 named reaction Methods 0.000 claims 1
- 239000000243 solution Substances 0.000 description 45
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 42
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 40
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 27
- 239000011541 reaction mixture Substances 0.000 description 22
- 239000011780 sodium chloride Substances 0.000 description 21
- 239000000203 mixture Substances 0.000 description 20
- 229910000029 sodium carbonate Inorganic materials 0.000 description 20
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 19
- 238000006243 chemical reaction Methods 0.000 description 18
- 239000007858 starting material Substances 0.000 description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 13
- 230000007935 neutral effect Effects 0.000 description 13
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 12
- 239000000843 powder Substances 0.000 description 11
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- 150000003335 secondary amines Chemical group 0.000 description 10
- 150000003254 radicals Chemical class 0.000 description 9
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 8
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 8
- 239000000463 material Substances 0.000 description 8
- 239000011734 sodium Substances 0.000 description 7
- YXIWHUQXZSMYRE-UHFFFAOYSA-N 1,3-benzothiazole-2-thiol Chemical compound C1=CC=C2SC(S)=NC2=C1 YXIWHUQXZSMYRE-UHFFFAOYSA-N 0.000 description 6
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 6
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 5
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 4
- 238000009833 condensation Methods 0.000 description 4
- 230000005494 condensation Effects 0.000 description 4
- QWVGKYWNOKOFNN-UHFFFAOYSA-N o-cresol Chemical compound CC1=CC=CC=C1O QWVGKYWNOKOFNN-UHFFFAOYSA-N 0.000 description 4
- CWERGRDVMFNCDR-UHFFFAOYSA-N thioglycolic acid Chemical compound OC(=O)CS CWERGRDVMFNCDR-UHFFFAOYSA-N 0.000 description 4
- 210000002268 wool Anatomy 0.000 description 4
- ISPYQTSUDJAMAB-UHFFFAOYSA-N 2-chlorophenol Chemical compound OC1=CC=CC=C1Cl ISPYQTSUDJAMAB-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 239000007900 aqueous suspension Substances 0.000 description 3
- LBUJPTNKIBCYBY-UHFFFAOYSA-N 1,2,3,4-tetrahydroquinoline Chemical compound C1=CC=C2CCCNC2=C1 LBUJPTNKIBCYBY-UHFFFAOYSA-N 0.000 description 2
- WGJCBBASTRWVJL-UHFFFAOYSA-N 1,3-thiazolidine-2-thione Chemical compound SC1=NCCS1 WGJCBBASTRWVJL-UHFFFAOYSA-N 0.000 description 2
- ZRKMQKLGEQPLNS-UHFFFAOYSA-N 1-Pentanethiol Chemical compound CCCCCS ZRKMQKLGEQPLNS-UHFFFAOYSA-N 0.000 description 2
- KDSNLYIMUZNERS-UHFFFAOYSA-N 2-methylpropanamine Chemical compound CC(C)CN KDSNLYIMUZNERS-UHFFFAOYSA-N 0.000 description 2
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical group NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000000872 buffer Substances 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 150000001721 carbon Chemical group 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 238000004040 coloring Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- LHGVFZTZFXWLCP-UHFFFAOYSA-N guaiacol Chemical compound COC1=CC=CC=C1O LHGVFZTZFXWLCP-UHFFFAOYSA-N 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- VMPITZXILSNTON-UHFFFAOYSA-N o-anisidine Chemical compound COC1=CC=CC=C1N VMPITZXILSNTON-UHFFFAOYSA-N 0.000 description 2
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 2
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 2
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 2
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- 125000000542 sulfonic acid group Chemical group 0.000 description 2
- XOAAWQZATWQOTB-UHFFFAOYSA-N taurine Chemical compound NCCS(O)(=O)=O XOAAWQZATWQOTB-UHFFFAOYSA-N 0.000 description 2
- MGSRCZKZVOBKFT-UHFFFAOYSA-N thymol Chemical compound CC(C)C1=CC=C(C)C=C1O MGSRCZKZVOBKFT-UHFFFAOYSA-N 0.000 description 2
- HRXKRNGNAMMEHJ-UHFFFAOYSA-K trisodium citrate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O HRXKRNGNAMMEHJ-UHFFFAOYSA-K 0.000 description 2
- 235000013311 vegetables Nutrition 0.000 description 2
- 239000004552 water soluble powder Substances 0.000 description 2
- DGVVWUTYPXICAM-UHFFFAOYSA-N β‐Mercaptoethanol Chemical compound OCCS DGVVWUTYPXICAM-UHFFFAOYSA-N 0.000 description 2
- RAIPHJJURHTUIC-UHFFFAOYSA-N 1,3-thiazol-2-amine Chemical compound NC1=NC=CS1 RAIPHJJURHTUIC-UHFFFAOYSA-N 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- HFZWRUODUSTPEG-UHFFFAOYSA-N 2,4-dichlorophenol Chemical compound OC1=CC=C(Cl)C=C1Cl HFZWRUODUSTPEG-UHFFFAOYSA-N 0.000 description 1
- NHAUBUMQRJWWAT-UHFFFAOYSA-N 2,5-dimethylbenzenethiol Chemical compound CC1=CC=C(C)C(S)=C1 NHAUBUMQRJWWAT-UHFFFAOYSA-N 0.000 description 1
- ULIKDJVNUXNQHS-UHFFFAOYSA-N 2-Propene-1-thiol Chemical compound SCC=C ULIKDJVNUXNQHS-UHFFFAOYSA-N 0.000 description 1
- AKCRQHGQIJBRMN-UHFFFAOYSA-N 2-chloroaniline Chemical compound NC1=CC=CC=C1Cl AKCRQHGQIJBRMN-UHFFFAOYSA-N 0.000 description 1
- NJBCRXCAPCODGX-UHFFFAOYSA-N 2-methyl-n-(2-methylpropyl)propan-1-amine Chemical compound CC(C)CNCC(C)C NJBCRXCAPCODGX-UHFFFAOYSA-N 0.000 description 1
- JBIJLHTVPXGSAM-UHFFFAOYSA-N 2-naphthylamine Chemical compound C1=CC=CC2=CC(N)=CC=C21 JBIJLHTVPXGSAM-UHFFFAOYSA-N 0.000 description 1
- ULRPISSMEBPJLN-UHFFFAOYSA-N 2h-tetrazol-5-amine Chemical compound NC1=NN=NN1 ULRPISSMEBPJLN-UHFFFAOYSA-N 0.000 description 1
- KOGDFDWINXIWHI-OWOJBTEDSA-N 4-[(e)-2-(4-aminophenyl)ethenyl]aniline Chemical compound C1=CC(N)=CC=C1\C=C\C1=CC=C(N)C=C1 KOGDFDWINXIWHI-OWOJBTEDSA-N 0.000 description 1
- GZFGOTFRPZRKDS-UHFFFAOYSA-N 4-bromophenol Chemical class OC1=CC=C(Br)C=C1 GZFGOTFRPZRKDS-UHFFFAOYSA-N 0.000 description 1
- WXNZTHHGJRFXKQ-UHFFFAOYSA-N 4-chlorophenol Chemical compound OC1=CC=C(Cl)C=C1 WXNZTHHGJRFXKQ-UHFFFAOYSA-N 0.000 description 1
- QHPQWRBYOIRBIT-UHFFFAOYSA-N 4-tert-butylphenol Chemical compound CC(C)(C)C1=CC=C(O)C=C1 QHPQWRBYOIRBIT-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methyl-N-phenylamine Natural products CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 1
- 241000396922 Pontia daplidice Species 0.000 description 1
- 229920001131 Pulp (paper) Polymers 0.000 description 1
- 239000005844 Thymol Substances 0.000 description 1
- LZEVHSMIYLROAC-UHFFFAOYSA-N [Na].CN Chemical compound [Na].CN LZEVHSMIYLROAC-UHFFFAOYSA-N 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000012148 binding buffer Substances 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001896 cresols Chemical class 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229960001867 guaiacol Drugs 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- DILRJUIACXKSQE-UHFFFAOYSA-N n',n'-dimethylethane-1,2-diamine Chemical compound CN(C)CCN DILRJUIACXKSQE-UHFFFAOYSA-N 0.000 description 1
- KUDPGZONDFORKU-UHFFFAOYSA-N n-chloroaniline Chemical class ClNC1=CC=CC=C1 KUDPGZONDFORKU-UHFFFAOYSA-N 0.000 description 1
- 150000004780 naphthols Chemical class 0.000 description 1
- 150000005002 naphthylamines Chemical class 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000005429 oxyalkyl group Chemical group 0.000 description 1
- BHAAPTBBJKJZER-UHFFFAOYSA-N p-anisidine Chemical compound COC1=CC=C(N)C=C1 BHAAPTBBJKJZER-UHFFFAOYSA-N 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 229920001515 polyalkylene glycol Polymers 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 229960003080 taurine Drugs 0.000 description 1
- RCZJVHXVCSKDKB-OYKKKHCWSA-N tert-butyl 2-[(z)-[1-(2-amino-1,3-thiazol-4-yl)-2-(1,3-benzothiazol-2-ylsulfanyl)-2-oxoethylidene]amino]oxy-2-methylpropanoate Chemical group N=1C2=CC=CC=C2SC=1SC(=O)\C(=N/OC(C)(C)C(=O)OC(C)(C)C)C1=CSC(N)=N1 RCZJVHXVCSKDKB-OYKKKHCWSA-N 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 229960000790 thymol Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing three or more hetero rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
- Coloring (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH681642X | 1949-10-14 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE848496C true DE848496C (de) | 1952-09-04 |
Family
ID=4528513
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEC2139A Expired DE848496C (de) | 1949-10-14 | 1950-09-13 | Verfahren zur Herstellung von neuen Abkoemmlingen der 4, 4'-Diaminostilben-disulfonsaeure-(2, 2') |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US2846397A (cg-RX-API-DMAC10.html) |
| BE (1) | BE498678A (cg-RX-API-DMAC10.html) |
| CA (1) | CA528443A (cg-RX-API-DMAC10.html) |
| CH (13) | CH286329A (cg-RX-API-DMAC10.html) |
| DE (1) | DE848496C (cg-RX-API-DMAC10.html) |
| FR (1) | FR1026969A (cg-RX-API-DMAC10.html) |
| GB (1) | GB681642A (cg-RX-API-DMAC10.html) |
| IT (1) | IT471325A (cg-RX-API-DMAC10.html) |
| NL (1) | NL77219C (cg-RX-API-DMAC10.html) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE949741C (de) * | 1952-10-31 | 1956-09-27 | Ciba Geigy | Verfahren zur Herstellung neuer Derivate des Dibenzothiophendioxyds |
| DE1100584B (de) * | 1956-11-30 | 1961-03-02 | Sandoz Ag | Aufhellungsmittel fuer synthetische Polyamidfasern oder Polyamidgruppen enthaltende Naturfasern |
| DE1107667B (de) * | 1959-07-30 | 1961-05-31 | Wolfen Filmfab Veb | Verfahren zur Herstellung von optischen Aufhellungsmitteln |
| DE1114162B (de) * | 1960-03-25 | 1961-09-28 | Basf Ag | Aufheller |
| FR2396755A1 (fr) * | 1977-07-04 | 1979-02-02 | Ciba Geigy Ag | Derives du bis-triazinylaminostilbene, leur procede de preparation ainsi que leur utilisation comme azurants optiques |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3045013A (en) * | 1962-07-17 | chj-chj | ||
| US2713046A (en) * | 1955-07-12 | Chachj | ||
| US3177207A (en) * | 1965-04-06 | Nh-chs | ||
| DE1031268B (de) * | 1954-05-10 | 1958-06-04 | Bayer Ag | Optische Aufheller |
| US3031326A (en) * | 1956-11-30 | 1962-04-24 | Sandoz Ltd | Brightening agents for polyamide fibers |
| US3181948A (en) * | 1958-06-02 | 1965-05-04 | Gevaert Photo Prod Nv | Method for optical bleaching of coated papers and resultant product |
| US3181949A (en) * | 1958-06-02 | 1965-05-04 | Gevaert Photo Prod Nv | Light sensitive elements having optical bleaching compositions coated thereon |
| NL261845A (cg-RX-API-DMAC10.html) * | 1960-03-01 | 1900-01-01 | ||
| DE1183882B (de) * | 1960-08-30 | 1964-12-23 | Bayer Ag | Verfahren zur Behandlung von Cellulosetextilmaterialien mit Kunstharz-Vorkondensaten und Aufhellungsmitteln |
| GB1021527A (en) * | 1963-04-12 | 1966-03-02 | Gen Aniline & Film Corp | Improvements in or relating to stilbene-cyanuric compounds |
| DE1444015A1 (de) * | 1963-08-10 | 1969-10-09 | Bayer Ag | Bis-triazinylaminostilben-disulfonsaeure-Verbindungen |
| DE1278637B (de) * | 1964-11-02 | 1968-09-26 | Bayer Ag | Farbstoffe und deren Verwendung zum Faerben und Bedrucken von synthetischen Fasermaterialien |
| FR1523740A (cg-RX-API-DMAC10.html) * | 1966-05-21 | 1968-08-28 | ||
| GB1565202A (en) * | 1975-07-25 | 1980-04-16 | Hickson & Welch Ltd | Aqueous dispersions of optical brighteners |
| ES459553A1 (es) * | 1976-06-07 | 1978-12-01 | Ici Ltd | Procedimiento para preparar una sal amonica sustituida de unacido n,n'-disustituido-diaminoestilbeno-sulfonico. |
| EP0002042B1 (de) * | 1977-11-16 | 1980-10-29 | Hoechst Aktiengesellschaft | Diamino-1,3,5-triazinylstilbenverbindungen, Verfahren zu deren Herstellung und ihre Verwendung als optische Aufheller |
| US6030443A (en) * | 1999-04-29 | 2000-02-29 | Hercules Incorporated | Paper coating composition with improved optical brightener carriers |
| CN110922531B (zh) * | 2019-12-06 | 2022-06-24 | 陕西科技大学 | 一种淀粉接枝荧光共聚乳液及其制备方法与应用 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US564835A (en) * | 1896-07-28 | Sigmund neumann | ||
| CA388425A (en) * | 1936-10-03 | 1940-04-30 | Schmid Max | Azo-dyestuff metal compound |
| CA392680A (en) * | 1937-03-20 | 1940-11-19 | Eggert John | Wrapping material |
| US2376743A (en) * | 1939-12-19 | 1945-05-22 | Wendt Bruno | Carbohydrate solutions |
| IT428783A (cg-RX-API-DMAC10.html) * | 1943-02-10 | |||
| US2473475A (en) * | 1943-06-28 | 1949-06-14 | Geigy Ag J R | Water-soluble triazine condensation products and a process of making same |
| BE464494A (cg-RX-API-DMAC10.html) * | 1945-04-12 | |||
| US2539766A (en) * | 1948-06-04 | 1951-01-30 | Geigy Ag J R | Triazine brightening agents |
-
0
- IT IT471325D patent/IT471325A/it unknown
- NL NL77219D patent/NL77219C/xx active
- CA CA528443A patent/CA528443A/en not_active Expired
- BE BE498678D patent/BE498678A/xx unknown
-
1949
- 1949-10-14 CH CH286329D patent/CH286329A/de unknown
- 1949-10-14 CH CH286336D patent/CH286336A/de unknown
- 1949-10-14 CH CH286332D patent/CH286332A/de unknown
- 1949-10-14 CH CH286335D patent/CH286335A/de unknown
- 1949-10-14 CH CH286331D patent/CH286331A/de unknown
- 1949-10-14 CH CH286334D patent/CH286334A/de unknown
- 1949-10-14 CH CH286326D patent/CH286326A/de unknown
- 1949-10-14 CH CH281400D patent/CH281400A/de unknown
- 1949-10-14 CH CH286328D patent/CH286328A/de unknown
- 1949-10-14 CH CH286330D patent/CH286330A/de unknown
- 1949-10-14 CH CH286327D patent/CH286327A/de unknown
- 1949-10-14 CH CH286333D patent/CH286333A/de unknown
-
1950
- 1950-09-13 DE DEC2139A patent/DE848496C/de not_active Expired
- 1950-10-02 US US188071A patent/US2846397A/en not_active Expired - Lifetime
- 1950-10-06 GB GB24513/50A patent/GB681642A/en not_active Expired
- 1950-10-12 FR FR1026969D patent/FR1026969A/fr not_active Expired
-
1951
- 1951-09-03 CH CH286337D patent/CH286337A/de unknown
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE949741C (de) * | 1952-10-31 | 1956-09-27 | Ciba Geigy | Verfahren zur Herstellung neuer Derivate des Dibenzothiophendioxyds |
| DE1100584B (de) * | 1956-11-30 | 1961-03-02 | Sandoz Ag | Aufhellungsmittel fuer synthetische Polyamidfasern oder Polyamidgruppen enthaltende Naturfasern |
| DE1107667B (de) * | 1959-07-30 | 1961-05-31 | Wolfen Filmfab Veb | Verfahren zur Herstellung von optischen Aufhellungsmitteln |
| DE1114162B (de) * | 1960-03-25 | 1961-09-28 | Basf Ag | Aufheller |
| FR2396755A1 (fr) * | 1977-07-04 | 1979-02-02 | Ciba Geigy Ag | Derives du bis-triazinylaminostilbene, leur procede de preparation ainsi que leur utilisation comme azurants optiques |
Also Published As
| Publication number | Publication date |
|---|---|
| CA528443A (en) | 1956-07-31 |
| FR1026969A (fr) | 1953-05-06 |
| CH286331A (de) | 1952-10-15 |
| CH286327A (de) | 1952-10-15 |
| CH286326A (de) | 1952-10-15 |
| CH281400A (de) | 1952-03-15 |
| CH286328A (de) | 1952-10-15 |
| IT471325A (cg-RX-API-DMAC10.html) | |
| CH286336A (de) | 1952-10-15 |
| CH286334A (de) | 1952-10-15 |
| GB681642A (en) | 1952-10-29 |
| NL77219C (cg-RX-API-DMAC10.html) | |
| US2846397A (en) | 1958-08-05 |
| CH286330A (de) | 1952-10-15 |
| CH286335A (de) | 1952-10-15 |
| BE498678A (cg-RX-API-DMAC10.html) | |
| CH286333A (de) | 1952-10-15 |
| CH286337A (de) | 1952-10-15 |
| CH286332A (de) | 1952-10-15 |
| CH286329A (de) | 1952-10-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE848496C (de) | Verfahren zur Herstellung von neuen Abkoemmlingen der 4, 4'-Diaminostilben-disulfonsaeure-(2, 2') | |
| DE2503611C2 (de) | Sulfogruppen enthaltende Reaktivfarbstoffe | |
| DE1206296B (de) | Konzentriertes fluessiges Aufhellungsmittel fuer Papiere | |
| DE2915323A1 (de) | Basische bzw. kationische, sulfonsaeuregruppenhaltige monoazo- oder disazoverbindungen | |
| DE2145384C3 (de) | Verbindungen der Bis-(triazinylamino)-stibendisulfonsäurereihe, deren Herstellung und Verwendung | |
| DE2406883A1 (de) | Stilbenverbindungen | |
| DE859313C (de) | Verfahren zur Herstellung von Bis-[2-morpholino-4-amino-1, 3, 5-triazyl-(6)]-4, 4''-diaminostilbendisulfon- und -dicarbonsaeuren | |
| DE906937C (de) | Verfahren zur Herstellung von neuen Abkoemmlingen der 4,4'-Diaminostilben-disulfonsaeure-(2,2') | |
| DE949741C (de) | Verfahren zur Herstellung neuer Derivate des Dibenzothiophendioxyds | |
| DE957034C (de) | Verfahren zur Herstellung neuer Derivate der 4, 4'-Diaminostilben-disulfonsaeure-(2, 2') | |
| DE1939521B2 (de) | Gegebenenfalls substituierte 4,4'-BIs-(2-beta-carbamido-äthylamino-4-anilinos-triazin-6-yl-amino)stilben-2,2'-disulfonate und Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE882703C (de) | Verfahren zur Herstellung von neuen Abkoemmlingen der 4, 4'-Diaminostilben-disulfonsaeure-(2, 2') | |
| DE2262028C2 (de) | Neue Stilbenderivate | |
| DE870263C (de) | Verfahren zur Herstellung von neuen Abkoemmlingen der 4, 4'-Diaminostilben-disulfonsaeure-(2, 2') | |
| DE1419333B1 (de) | Optische Aufhellungsmittel | |
| DE1210504B (de) | Verfahren zur Herstellung von Anthrachinonfarbstoffen | |
| DE882704C (de) | Verfahren zur Herstellung von neuen Abkoemmlingen der 4, 4'-Diaminostilben-disulfonsaeure-(2, 2') | |
| DE960484C (de) | Verfahren zur Herstellung neuer Monoazofarbstoffe | |
| DE1177267B (de) | Verfahren zur Herstellung von Farbstoffen der Tetrazaporphinreihe | |
| DE1024652B (de) | Verfahren zur Herstellung von Farbstoffen der Oxazinreihe | |
| AT227270B (de) | Verfahren zur Herstellung von Lösungen neuer Triazinderivate | |
| DE60223004T2 (de) | Schutz für reduktionsempfindliche farbstoffe | |
| DE1047163B (de) | Optische Aufhellungsmittel | |
| DE942396C (de) | Verfahren zur Herstellung von fluoreszierenden Bistriazinylaminostilbenverbindungen | |
| AT227271B (de) | Verfahren zur Herstellung von neuen Bis-triazinylaminostilbenverbindungen |