DE3612212A1 - Verfahren zur herstellung von festen pharmazeutischen formen - Google Patents
Verfahren zur herstellung von festen pharmazeutischen formenInfo
- Publication number
- DE3612212A1 DE3612212A1 DE19863612212 DE3612212A DE3612212A1 DE 3612212 A1 DE3612212 A1 DE 3612212A1 DE 19863612212 DE19863612212 DE 19863612212 DE 3612212 A DE3612212 A DE 3612212A DE 3612212 A1 DE3612212 A1 DE 3612212A1
- Authority
- DE
- Germany
- Prior art keywords
- vinylpyrrolidone
- binder
- vinyl acetate
- acid
- polymer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000007787 solid Substances 0.000 title claims abstract description 10
- 238000004519 manufacturing process Methods 0.000 title description 6
- 239000011230 binding agent Substances 0.000 claims abstract description 15
- 238000000034 method Methods 0.000 claims abstract description 12
- 229920000642 polymer Polymers 0.000 claims abstract description 12
- 238000001746 injection moulding Methods 0.000 claims abstract description 10
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims abstract description 6
- 238000002156 mixing Methods 0.000 claims abstract description 5
- 239000000203 mixture Substances 0.000 claims abstract description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 3
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 3
- 239000001301 oxygen Substances 0.000 claims abstract description 3
- 238000007493 shaping process Methods 0.000 claims abstract description 3
- 238000002360 preparation method Methods 0.000 claims abstract 2
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 claims description 14
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 claims description 12
- 150000001298 alcohols Chemical class 0.000 claims description 4
- 229920000036 polyvinylpyrrolidone Polymers 0.000 claims description 4
- 239000001267 polyvinylpyrrolidone Substances 0.000 claims description 4
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 claims description 4
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 claims description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 claims description 3
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 claims description 3
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 claims description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 claims description 3
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 2
- QZPSOSOOLFHYRR-UHFFFAOYSA-N 3-hydroxypropyl prop-2-enoate Chemical compound OCCCOC(=O)C=C QZPSOSOOLFHYRR-UHFFFAOYSA-N 0.000 claims description 2
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 claims description 2
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 claims description 2
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- LDHQCZJRKDOVOX-NSCUHMNNSA-N crotonic acid Chemical compound C\C=C\C(O)=O LDHQCZJRKDOVOX-NSCUHMNNSA-N 0.000 claims description 2
- 150000002148 esters Chemical class 0.000 claims description 2
- 239000011976 maleic acid Substances 0.000 claims description 2
- LDHQCZJRKDOVOX-UHFFFAOYSA-N trans-crotonic acid Natural products CC=CC(O)=O LDHQCZJRKDOVOX-UHFFFAOYSA-N 0.000 claims description 2
- 229920005596 polymer binder Polymers 0.000 claims 2
- 239000002491 polymer binding agent Substances 0.000 claims 2
- 239000002253 acid Substances 0.000 claims 1
- 150000007513 acids Chemical class 0.000 claims 1
- 239000008186 active pharmaceutical agent Substances 0.000 claims 1
- 238000001125 extrusion Methods 0.000 abstract description 6
- 150000001875 compounds Chemical class 0.000 abstract 1
- 239000004480 active ingredient Substances 0.000 description 18
- ZFXYFBGIUFBOJW-UHFFFAOYSA-N theophylline Chemical compound O=C1N(C)C(=O)N(C)C2=C1NC=N2 ZFXYFBGIUFBOJW-UHFFFAOYSA-N 0.000 description 16
- 239000003826 tablet Substances 0.000 description 15
- 239000003814 drug Substances 0.000 description 11
- 229920001577 copolymer Polymers 0.000 description 10
- 229940079593 drug Drugs 0.000 description 9
- -1 Polyethylene Polymers 0.000 description 8
- 229960000278 theophylline Drugs 0.000 description 8
- GLDOVTGHNKAZLK-UHFFFAOYSA-N octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 description 6
- 239000011162 core material Substances 0.000 description 5
- 229920003023 plastic Polymers 0.000 description 5
- 239000004033 plastic Substances 0.000 description 5
- 239000008298 dragée Substances 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 230000003111 delayed effect Effects 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 238000000465 moulding Methods 0.000 description 3
- GOQYKNQRPGWPLP-UHFFFAOYSA-N n-heptadecyl alcohol Natural products CCCCCCCCCCCCCCCCCO GOQYKNQRPGWPLP-UHFFFAOYSA-N 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- BLFLLBZGZJTVJG-UHFFFAOYSA-N benzocaine Chemical compound CCOC(=O)C1=CC=C(N)C=C1 BLFLLBZGZJTVJG-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical class OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Substances OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- UIWXSTHGICQLQT-UHFFFAOYSA-N ethenyl propanoate Chemical compound CCC(=O)OC=C UIWXSTHGICQLQT-UHFFFAOYSA-N 0.000 description 2
- 210000004051 gastric juice Anatomy 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 238000006116 polymerization reaction Methods 0.000 description 2
- 150000003839 salts Chemical group 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 210000002784 stomach Anatomy 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- JWYVGKFDLWWQJX-UHFFFAOYSA-N 1-ethenylazepan-2-one Chemical compound C=CN1CCCCCC1=O JWYVGKFDLWWQJX-UHFFFAOYSA-N 0.000 description 1
- SGTNSNPWRIOYBX-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-{[2-(3,4-dimethoxyphenyl)ethyl](methyl)amino}-2-(propan-2-yl)pentanenitrile Chemical compound C1=C(OC)C(OC)=CC=C1CCN(C)CCCC(C#N)(C(C)C)C1=CC=C(OC)C(OC)=C1 SGTNSNPWRIOYBX-UHFFFAOYSA-N 0.000 description 1
- PXRKCOCTEMYUEG-UHFFFAOYSA-N 5-aminoisoindole-1,3-dione Chemical compound NC1=CC=C2C(=O)NC(=O)C2=C1 PXRKCOCTEMYUEG-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical class CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical class OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- ARCGXLSVLAOJQL-UHFFFAOYSA-N anhydrous trimellitic acid Natural products OC(=O)C1=CC=C(C(O)=O)C(C(O)=O)=C1 ARCGXLSVLAOJQL-UHFFFAOYSA-N 0.000 description 1
- 150000001536 azelaic acids Chemical class 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-N benzene-dicarboxylic acid Natural products OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 1
- 229960005274 benzocaine Drugs 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 229940046011 buccal tablet Drugs 0.000 description 1
- 239000006189 buccal tablet Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 238000005520 cutting process Methods 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 230000009477 glass transition Effects 0.000 description 1
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical class CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 229920001477 hydrophilic polymer Polymers 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- 210000000936 intestine Anatomy 0.000 description 1
- XGZVUEUWXADBQD-UHFFFAOYSA-L lithium carbonate Chemical compound [Li+].[Li+].[O-]C([O-])=O XGZVUEUWXADBQD-UHFFFAOYSA-L 0.000 description 1
- 229910052808 lithium carbonate Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000007935 oral tablet Substances 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 230000004526 pharmaceutical effect Effects 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 125000005498 phthalate group Chemical class 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920002338 polyhydroxyethylmethacrylate Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 229910001414 potassium ion Inorganic materials 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 150000003330 sebacic acids Chemical class 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 229910001415 sodium ion Inorganic materials 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000007885 tablet disintegrant Substances 0.000 description 1
- 238000009475 tablet pressing Methods 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 150000003899 tartaric acid esters Chemical class 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 229960001722 verapamil Drugs 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/20—Pills, tablets, discs, rods
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/20—Pills, tablets, discs, rods
- A61K9/2095—Tabletting processes; Dosage units made by direct compression of powders or specially processed granules, by eliminating solvents, by melt-extrusion, by injection molding, by 3D printing
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/20—Pills, tablets, discs, rods
- A61K9/2004—Excipients; Inactive ingredients
- A61K9/2022—Organic macromolecular compounds
- A61K9/2027—Organic macromolecular compounds obtained by reactions only involving carbon-to-carbon unsaturated bonds, e.g. polyvinyl pyrrolidone, poly(meth)acrylates
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B29—WORKING OF PLASTICS; WORKING OF SUBSTANCES IN A PLASTIC STATE IN GENERAL
- B29K—INDEXING SCHEME ASSOCIATED WITH SUBCLASSES B29B, B29C OR B29D, RELATING TO MOULDING MATERIALS OR TO MATERIALS FOR MOULDS, REINFORCEMENTS, FILLERS OR PREFORMED PARTS, e.g. INSERTS
- B29K2105/00—Condition, form or state of moulded material or of the material to be shaped
- B29K2105/0005—Condition, form or state of moulded material or of the material to be shaped containing compounding ingredients
- B29K2105/0035—Medical or pharmaceutical agents
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Medicinal Preparation (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Steroid Compounds (AREA)
- Surgical Instruments (AREA)
- Measuring Pulse, Heart Rate, Blood Pressure Or Blood Flow (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Cephalosporin Compounds (AREA)
Priority Applications (25)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19863612212 DE3612212A1 (de) | 1986-04-11 | 1986-04-11 | Verfahren zur herstellung von festen pharmazeutischen formen |
| EP87104724A EP0240904B1 (de) | 1986-04-11 | 1987-03-31 | Verfahren zur Herstellung von festen pharmazeutischen Formen |
| ES198787104724T ES2037020T3 (es) | 1986-04-11 | 1987-03-31 | Procedimiento para la obtencion de formas solidas farmaceuticas. |
| DE8787104724T DE3780059D1 (de) | 1986-04-11 | 1987-03-31 | Verfahren zur herstellung von festen pharmazeutischen formen. |
| AT87104724T ATE77739T1 (de) | 1986-04-11 | 1987-03-31 | Verfahren zur herstellung von festen pharmazeutischen formen. |
| YU59187A YU46534B (sh) | 1986-04-11 | 1987-04-03 | Postupak za proizvodnju čvrstih farmaceutskih oblika |
| SI8710591A SI8710591A8 (sl) | 1986-04-11 | 1987-04-03 | Postopek proizvodnje trdnih farmacevtskih oblikovancev |
| US07/034,938 US4801460A (en) | 1986-04-11 | 1987-04-06 | Preparation of solid pharmaceutical forms |
| FI871539A FI87887C (fi) | 1986-04-11 | 1987-04-08 | Foerfarande foer framstaellning av fasta farmaceutiska preparat |
| CS872532A CS268177B2 (en) | 1986-04-11 | 1987-04-08 | Method of solid pharmaceutical forms production |
| JP62085889A JPH089551B2 (ja) | 1986-04-11 | 1987-04-09 | 固形薬剤の製法 |
| UA4202334A UA13038A1 (uk) | 1986-04-11 | 1987-04-10 | Спосіб одержаhhя таблеток |
| PT84661A PT84661B (pt) | 1986-04-11 | 1987-04-10 | Processo para a preparacao de composicoes farmaceuticas com a forma solida |
| AU71413/87A AU587897B2 (en) | 1986-04-11 | 1987-04-10 | Preparation of solid pharmaceutical forms |
| SU874202334A SU1731037A3 (ru) | 1986-04-11 | 1987-04-10 | Способ получени таблеток |
| CA000534435A CA1308353C (en) | 1986-04-11 | 1987-04-10 | Preparation of solid pharmaceutical forms |
| HU871617A HU196132B (en) | 1986-04-11 | 1987-04-10 | Process for preparing solid pharmaceuticals |
| NO871513A NO170570C (no) | 1986-04-11 | 1987-04-10 | Fremgangsmaate for fremstilling av faste farmasoeytiske former |
| CN87103409A CN1022666C (zh) | 1986-04-11 | 1987-04-11 | 固体药物剂型的制备 |
| KR1019870003527A KR920003575B1 (ko) | 1986-04-11 | 1987-04-11 | 고체 제약형태의 제조방법 |
| GR920402198T GR3005866T3 (cg-RX-API-DMAC7.html) | 1986-04-11 | 1992-10-01 | |
| LTRP532A LT2085B (lt) | 1986-04-11 | 1993-05-06 | Tableciu gavimo budas |
| LV930427A LV5176A3 (lv) | 1986-04-11 | 1993-05-27 | Tablesu izgatavosanas panemiens |
| HRP-591/87 HRP931379B1 (en) | 1986-04-11 | 1993-11-04 | Process for the preparation of solid pharmaceutical forms |
| MD95-0073A MD374C2 (ro) | 1986-04-11 | 1994-12-29 | Procedeu de obţinere a pastilelor |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19863612212 DE3612212A1 (de) | 1986-04-11 | 1986-04-11 | Verfahren zur herstellung von festen pharmazeutischen formen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3612212A1 true DE3612212A1 (de) | 1987-10-15 |
Family
ID=6298473
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19863612212 Withdrawn DE3612212A1 (de) | 1986-04-11 | 1986-04-11 | Verfahren zur herstellung von festen pharmazeutischen formen |
| DE8787104724T Expired - Lifetime DE3780059D1 (de) | 1986-04-11 | 1987-03-31 | Verfahren zur herstellung von festen pharmazeutischen formen. |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8787104724T Expired - Lifetime DE3780059D1 (de) | 1986-04-11 | 1987-03-31 | Verfahren zur herstellung von festen pharmazeutischen formen. |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4801460A (cg-RX-API-DMAC7.html) |
| EP (1) | EP0240904B1 (cg-RX-API-DMAC7.html) |
| JP (1) | JPH089551B2 (cg-RX-API-DMAC7.html) |
| KR (1) | KR920003575B1 (cg-RX-API-DMAC7.html) |
| CN (1) | CN1022666C (cg-RX-API-DMAC7.html) |
| AT (1) | ATE77739T1 (cg-RX-API-DMAC7.html) |
| AU (1) | AU587897B2 (cg-RX-API-DMAC7.html) |
| CA (1) | CA1308353C (cg-RX-API-DMAC7.html) |
| CS (1) | CS268177B2 (cg-RX-API-DMAC7.html) |
| DE (2) | DE3612212A1 (cg-RX-API-DMAC7.html) |
| ES (1) | ES2037020T3 (cg-RX-API-DMAC7.html) |
| FI (1) | FI87887C (cg-RX-API-DMAC7.html) |
| GR (1) | GR3005866T3 (cg-RX-API-DMAC7.html) |
| HU (1) | HU196132B (cg-RX-API-DMAC7.html) |
| MD (1) | MD374C2 (cg-RX-API-DMAC7.html) |
| NO (1) | NO170570C (cg-RX-API-DMAC7.html) |
| PT (1) | PT84661B (cg-RX-API-DMAC7.html) |
| SU (1) | SU1731037A3 (cg-RX-API-DMAC7.html) |
| UA (1) | UA13038A1 (cg-RX-API-DMAC7.html) |
| YU (1) | YU46534B (cg-RX-API-DMAC7.html) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4957681A (en) * | 1988-04-15 | 1990-09-18 | Basf Aktiengesellschaft | Preparation of pharmaceutical mixtures |
| DE4031881A1 (de) * | 1990-10-08 | 1992-04-09 | Sanol Arznei Schwarz Gmbh | Loesungsmittelfreie, oral zu verabreichende pharmazeutische zubereitung mit verzoegerter wirkstoffreisetzung und verfahren zu deren herstellung |
| WO2010040686A1 (de) * | 2008-10-07 | 2010-04-15 | Basf Se | Verfahren zur herstellung oraler darreichungsformen mit kontrollierter freisetzung |
Families Citing this family (154)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3612211A1 (de) * | 1986-04-11 | 1987-10-15 | Basf Ag | Kontinuierliches verfahren zum tablettieren |
| US5051261A (en) * | 1987-11-24 | 1991-09-24 | Fmc Corporation | Method for preparing a solid sustained release form of a functionally active composition |
| CA1334379C (en) * | 1987-11-24 | 1995-02-14 | James William Mcginity | Method for preparing a solid sustained release form of a functionally active composition |
| DE3803482A1 (de) * | 1988-02-05 | 1989-08-17 | Lohmann Therapie Syst Lts | Schwimmfaehiges orales therapeutisches system |
| DE3807895A1 (de) * | 1988-03-10 | 1989-09-21 | Knoll Ag | Erzeugnisse, enthaltend einen calciumantagonisten und einen lipidsenker |
| DE3830353A1 (de) * | 1988-09-07 | 1990-03-15 | Basf Ag | Verfahren zur kontinuierlichen herstellung von festen pharmazeutischen formen |
| DE3830355A1 (de) * | 1988-09-07 | 1990-03-15 | Basf Ag | Verfahren zur herstellung von pharmazeutischen tabletten |
| PH26730A (en) * | 1988-12-30 | 1992-09-28 | Ciba Geigy Ag | Coated adhesive tablets |
| US5310549A (en) * | 1989-08-31 | 1994-05-10 | Ecolab Inc. | Solid concentrate iodine composition |
| US5008106A (en) * | 1989-12-14 | 1991-04-16 | Gaf Chemicals Corporation | Method for reducing the microbial content of surfaces with a microbiocidal, anhydrous complex of PVP-H2 O2 |
| WO1991007184A1 (en) * | 1989-11-08 | 1991-05-30 | Gaf Chemicals Corporation | SUBSTANTIALLY ANHYDROUS COMPLEXES OF PVP and H2O¿2? |
| IE63986B1 (en) * | 1989-12-30 | 1995-06-28 | Akzo Nv | Pharmaceutical preparation for oral administration in fluid form |
| FR2663818B1 (fr) † | 1990-06-29 | 1993-07-09 | Rhone Poulenc Nutrition Animale | Procede de preparation de granules de principes actifs par extrusion. |
| ATE144424T1 (de) * | 1991-04-09 | 1996-11-15 | Takeda Chemical Industries Ltd | Stabilisiertes vitamin d arzneimittel |
| WO1992018106A1 (fr) * | 1991-04-16 | 1992-10-29 | Nippon Shinyaku Co., Ltd. | Procede de production d'une dispersion solide |
| US5286497A (en) * | 1991-05-20 | 1994-02-15 | Carderm Capital L.P. | Diltiazem formulation |
| US5326570A (en) * | 1991-07-23 | 1994-07-05 | Pharmavene, Inc. | Advanced drug delivery system and method of treating psychiatric, neurological and other disorders with carbamazepine |
| DE69226624T3 (de) | 1991-09-06 | 2009-11-05 | Ortho-Mcneil Pharmaceutical, Inc. | Zusammensetzung, die eine tramadol-verbindung und acetaminophen enthält, und ihre verwendung |
| WO1993007859A1 (en) * | 1991-10-23 | 1993-04-29 | Warner-Lambert Company | Novel pharmaceutical pellets and process for their production |
| DE4138513A1 (de) * | 1991-11-23 | 1993-05-27 | Basf Ag | Feste pharmazeutische retardform |
| DE69222182T2 (de) | 1991-12-18 | 1998-02-26 | Warner Lambert Co | Verfahren für die herstellung einer festen dispersion |
| US5190749A (en) * | 1992-01-13 | 1993-03-02 | Isp Investments Inc. | Copolymers of vinyl pyrrolidone and a quaternary ammonium monomer complexed with H2 O2 in the form of free-flowing powders |
| US5429825A (en) * | 1992-06-26 | 1995-07-04 | Mcneil-Ppc, Inc. | Rotomelt granulation |
| TW246635B (cg-RX-API-DMAC7.html) * | 1992-10-08 | 1995-05-01 | Shell Internat Res Schappej B V | |
| NZ260408A (en) * | 1993-05-10 | 1996-05-28 | Euro Celtique Sa | Controlled release preparation comprising tramadol |
| DE4316537A1 (de) * | 1993-05-18 | 1994-11-24 | Basf Ag | Zubereitungen in Form fester Lösungen |
| DE69432186T2 (de) * | 1993-11-18 | 2004-05-06 | Nippon Shinyaku Co., Ltd. | Verfahren zur herstellung stabiler arzneimittel |
| KR100354702B1 (ko) * | 1993-11-23 | 2002-12-28 | 유로-셀티크 소시에떼 아노뉨 | 약학조성물의제조방법및서방형조성물 |
| US5891471A (en) * | 1993-11-23 | 1999-04-06 | Euro-Celtique, S.A. | Pharmaceutical multiparticulates |
| US5843480A (en) * | 1994-03-14 | 1998-12-01 | Euro-Celtique, S.A. | Controlled release diamorphine formulation |
| DE4413350A1 (de) | 1994-04-18 | 1995-10-19 | Basf Ag | Retard-Matrixpellets und Verfahren zu ihrer Herstellung |
| EP0691124A1 (en) * | 1994-07-07 | 1996-01-10 | Sara Lee/DE N.V. | Mouth care products |
| GB9422154D0 (en) * | 1994-11-03 | 1994-12-21 | Euro Celtique Sa | Pharmaceutical compositions and method of producing the same |
| US5965161A (en) | 1994-11-04 | 1999-10-12 | Euro-Celtique, S.A. | Extruded multi-particulates |
| US20020006438A1 (en) * | 1998-09-25 | 2002-01-17 | Benjamin Oshlack | Sustained release hydromorphone formulations exhibiting bimodal characteristics |
| US5871776A (en) * | 1995-01-31 | 1999-02-16 | Mehta; Atul M. | Controlled-release nifedipine |
| DE19504832A1 (de) * | 1995-02-14 | 1996-08-22 | Basf Ag | Feste Wirkstoff-Zubereitungen |
| DE19509805A1 (de) * | 1995-03-21 | 1996-09-26 | Basf Ag | Transparente, schnell freisetzende Zubereitungen von nichtsteroidalen Analgetica |
| DE19509806A1 (de) * | 1995-03-21 | 1996-09-26 | Basf Ag | Lagerstabile Arzneiformen |
| DE19511131A1 (de) * | 1995-03-27 | 1996-10-02 | Basf Ag | Mechanisch stabile feste Wirkstoffzubereitungsformen |
| US5900425A (en) * | 1995-05-02 | 1999-05-04 | Bayer Aktiengesellschaft | Pharmaceutical preparations having controlled release of active compound and processes for their preparation |
| BE1009375A6 (nl) * | 1995-05-29 | 1997-02-04 | Picanol Nv | Kanteninrichting voor weefmachines. |
| US5869079A (en) * | 1995-06-02 | 1999-02-09 | Oculex Pharmaceuticals, Inc. | Formulation for controlled release of drugs by combining hydrophilic and hydrophobic agents |
| US20060280774A1 (en) * | 1995-06-02 | 2006-12-14 | Allergan, Inc. | Compositions and methods for treating glaucoma |
| AU7106996A (en) * | 1995-09-07 | 1997-03-27 | Fuisz Technologies Ltd. | System for rendering substantially non-dissoluble bio-affecting agents bio-available |
| DE19539361A1 (de) * | 1995-10-23 | 1997-04-24 | Basf Ag | Verfahren zur Herstellung von mehrschichtigen, festen Arzneiformen zur oralen oder rektalen Verabreichung |
| DE19602206A1 (de) | 1996-01-23 | 1997-07-24 | Basf Ag | Zubereitungen nichtsteroidaler Analgetika |
| US6090419A (en) * | 1996-05-02 | 2000-07-18 | Mccormick & Company, Inc. | Salt compositions and method of preparation |
| DE19629040A1 (de) * | 1996-07-19 | 1998-01-22 | Basf Ag | Pflanzenextrakthaltige Arzneiformen |
| DE19629753A1 (de) * | 1996-07-23 | 1998-01-29 | Basf Ag | Verfahren zur Herstellung von festen Arzneiformen |
| DE19635676A1 (de) * | 1996-09-03 | 1998-03-05 | Basf Ag | Feste geschäumte Wirkstoffzubereitungen |
| HRP970485A2 (en) | 1996-09-13 | 1998-08-31 | Joerg Rosenberg | Process for producing solid pharmaceutical forms |
| DE19649565A1 (de) * | 1996-11-29 | 1998-06-04 | Knoll Ag | Verfahren zum Herstellen von Granulaten eines Wasch- oder Reinigungsmittels |
| DE19710213A1 (de) * | 1997-03-12 | 1998-09-17 | Basf Ag | Verfahren zur Herstellung von festen Kombinationsarzneiformen |
| DE19753298A1 (de) * | 1997-12-01 | 1999-06-02 | Basf Ag | Verfahren zur Herstellung von festen Dosierungsformen |
| DE19812688A1 (de) * | 1998-03-23 | 1999-09-30 | Basf Ag | Verfahren zur Herstellung von festen Dosierungsformen |
| DE19814730A1 (de) * | 1998-04-02 | 1999-10-07 | Basf Ag | Verwendung von N-Vinyllacram oder N-Vinylamin haltigen Copolymeren als Matrix zur Herstellung von festen pharmazeutischen und kosmetischen Darreichungsformen |
| TR200003183T2 (tr) | 1998-04-30 | 2002-04-22 | Basf Aktiengesellschaft | Bitki koruma maddelerinin geciktirici formülasyonları. |
| US6197347B1 (en) | 1998-06-29 | 2001-03-06 | Andrx Pharmaceuticals, Inc. | Oral dosage for the controlled release of analgesic |
| DE19840256A1 (de) | 1998-09-03 | 2000-03-09 | Basf Ag | Verfahren zur Herstellung von beschichteten festen Dosierungsformen |
| DE19841244A1 (de) | 1998-09-09 | 2000-03-16 | Knoll Ag | Verfahren und Vorrichtung zum Herstellen von Tabletten |
| DE19842753A1 (de) | 1998-09-18 | 2000-03-23 | Bayer Ag | Agitationsunabhängige pharmazeutische Retardzubereitungen und Verfahren zu ihrer Herstellung |
| DE19842914A1 (de) | 1998-09-18 | 2000-03-23 | Basf Ag | Testsystem zur Charakterisierung der Verträglichkeit von biologisch aktiven Substanzen und Polyvinylpyrrolidon |
| DE19843904A1 (de) * | 1998-09-24 | 2000-03-30 | Basf Ag | Feste Dosierungsform mit polymerem Bindemittel |
| DE19843903A1 (de) * | 1998-09-24 | 2000-03-30 | Basf Ag | Feste Dosierungsform mit copolymerem Bindemittel |
| DE19847618A1 (de) | 1998-10-15 | 2000-04-20 | Basf Ag | Verfahren zur Herstellung von festen Dosierungsformen |
| WO2000028816A1 (de) * | 1998-11-12 | 2000-05-25 | Basf Aktiengesellschaft | Pflanzenschutzmitteltabletten |
| DE19853985A1 (de) * | 1998-11-23 | 2000-05-25 | Basf Ag | Verfahren zur Herstellung von festen Dosierungsformen |
| CZ301947B6 (cs) * | 1998-12-16 | 2010-08-11 | Aventisub Ii Inc. | Zpusob výroby farmaceutické kompozice vykazující aktivitu antagonisty serotoninového receptoru a farmaceutická kompozice vykazující uvedenou aktivitu |
| US6455526B1 (en) | 1998-12-16 | 2002-09-24 | Aventis Pharmaceuticals, Inc. | Biodegradable polymer encapsulated pharmaceutical compositions and method for preparing the same |
| DE19901383A1 (de) | 1999-01-15 | 2000-07-20 | Knoll Ag | Verfahren zur Herstellung unterschiedlicher fester Dosierungsformen |
| DE19913692A1 (de) | 1999-03-25 | 2000-09-28 | Basf Ag | Mechanisch stabile pharmazeutische Darreichungsformen, enthaltend flüssige oder halbfeste oberflächenaktive Substanzen |
| DE19918325A1 (de) | 1999-04-22 | 2000-10-26 | Euro Celtique Sa | Verfahren zur Herstellung von Arzneiformen mit regulierter Wirkstofffreisetzung mittels Extrusion |
| DE19934610A1 (de) * | 1999-07-23 | 2001-01-25 | Bayer Ag | Schnellfreisetzende Extrudate und Verfahren zu ihrer Herstellung sowie daraus erhältliche Zubereitungen |
| DE19943501A1 (de) * | 1999-09-10 | 2001-03-15 | Basf Ag | Unterwassergranulation wirkstoffhaltiger Schmelzen |
| DE19945982A1 (de) | 1999-09-24 | 2001-03-29 | Knoll Ag | Geschwindigkeitsbestimmte Partikel |
| US6331313B1 (en) | 1999-10-22 | 2001-12-18 | Oculex Pharmaceticals, Inc. | Controlled-release biocompatible ocular drug delivery implant devices and methods |
| EP1175205B1 (en) * | 1999-11-12 | 2006-06-14 | Abbott Laboratories | Solid dispersion comprising ritonavir, fenofibrate or griseofulvin |
| US7364752B1 (en) | 1999-11-12 | 2008-04-29 | Abbott Laboratories | Solid dispersion pharamaceutical formulations |
| US6544553B1 (en) * | 1999-12-28 | 2003-04-08 | Watson Pharmaceuticals, Inc. | Dosage forms and methods for oral delivery of progesterone |
| DE10017102A1 (de) | 2000-04-06 | 2001-10-11 | Basf Ag | Verfahren zur Herstellung von festen Kreatin-Dosierungsformen und dadurch erhältliche Dosierungsformen |
| US6635277B2 (en) | 2000-04-12 | 2003-10-21 | Wockhardt Limited | Composition for pulsatile delivery of diltiazem and process of manufacture |
| DE10026698A1 (de) | 2000-05-30 | 2001-12-06 | Basf Ag | Selbstemulgierende Wirkstoffformulierung und Verwendung dieser Formulierung |
| DE10029201A1 (de) * | 2000-06-19 | 2001-12-20 | Basf Ag | Verfahren zur Herstellung fester oraler Darreichungsformen mit retardierender Wirkstoffreisetzung |
| US6726918B1 (en) | 2000-07-05 | 2004-04-27 | Oculex Pharmaceuticals, Inc. | Methods for treating inflammation-mediated conditions of the eye |
| US6500457B1 (en) | 2000-08-14 | 2002-12-31 | Peirce Management, Llc | Oral pharmaceutical dosage forms for pulsatile delivery of an antiarrhythmic agent |
| DE10046541A1 (de) * | 2000-09-19 | 2002-03-28 | Knoll Ag | Mechanisch stabile darreichungsformen, enthaltend Ubichinone |
| JP2004514702A (ja) * | 2000-11-29 | 2004-05-20 | オキュレックス ファーマシューティカルズ, インコーポレイテッド | 眼における移植拒絶を予防するための眼内インプラント |
| GB0102342D0 (en) | 2001-01-30 | 2001-03-14 | Smithkline Beecham Plc | Pharmaceutical formulation |
| US7842308B2 (en) * | 2001-01-30 | 2010-11-30 | Smithkline Beecham Limited | Pharmaceutical formulation |
| US20050175687A1 (en) * | 2001-01-30 | 2005-08-11 | Mcallister Stephen M. | Pharmaceutical formulations |
| US7883721B2 (en) | 2001-01-30 | 2011-02-08 | Smithkline Beecham Limited | Pharmaceutical formulation |
| GB0113841D0 (en) * | 2001-06-07 | 2001-08-01 | Boots Co Plc | Therapeutic agents |
| NZ533784A (en) * | 2002-01-03 | 2006-08-31 | Smithkline Beecham Corp | Novel pharmaceutical dosage forms and method for producing same |
| AR038375A1 (es) | 2002-02-01 | 2005-01-12 | Pfizer Prod Inc | Composiciones farmaceuticas de inhibidores de la proteina de transferencia de esteres de colesterilo |
| EP1474144B1 (en) | 2002-02-01 | 2008-08-06 | Pfizer Products Inc. | Controlled release pharmaceutical dosage forms of a cholesteryl ester transfer protein inhibitor |
| US8128957B1 (en) | 2002-02-21 | 2012-03-06 | Valeant International (Barbados) Srl | Modified release compositions of at least one form of tramadol |
| US20050182056A9 (en) * | 2002-02-21 | 2005-08-18 | Seth Pawan | Modified release formulations of at least one form of tramadol |
| AU2003218127B2 (en) * | 2002-03-11 | 2007-07-12 | Alcon, Inc. | Implantable drug delivery system |
| DE10213242A1 (de) * | 2002-03-25 | 2003-10-16 | Abbott Gmbh & Co Kg | Testsystem zur Evaluierung der Kompatibilität biologisch aktiver Substanzen mit Copolymeren |
| ATE442130T1 (de) | 2002-08-12 | 2009-09-15 | Bend Res Inc | Arzneizubereitungen bestehend aus arzneimitteln in halb-geordneter form und polymeren |
| EP1545468A4 (en) * | 2002-09-20 | 2007-06-20 | Alpharma Inc | SUSTAINED RELEASE OPIOID PREPARATIONS AND METHODS OF USE |
| DE10247037A1 (de) * | 2002-10-09 | 2004-04-22 | Abbott Gmbh & Co. Kg | Herstellung von festen Dosierungsformen unter Verwendung eines vernetzten nichtthermoplastischen Trägers |
| DE60313359T2 (de) * | 2002-12-17 | 2008-01-03 | Abbott Gmbh & Co. Kg | Fenofibratsäure enthaltende pharmazeutische zusammensetzung und deren physiologisch verträgliche salze und derivate |
| US20080051411A1 (en) * | 2002-12-17 | 2008-02-28 | Cink Russell D | Salts of Fenofibric Acid and Pharmaceutical Formulations Thereof |
| US20050048099A1 (en) | 2003-01-09 | 2005-03-03 | Allergan, Inc. | Ocular implant made by a double extrusion process |
| WO2004069180A2 (en) * | 2003-01-31 | 2004-08-19 | Smithkline Beecham Corporation | Solid dispersion compositions |
| US8486447B2 (en) | 2003-02-03 | 2013-07-16 | Novartis Ag | Pharmaceutical formulation |
| US20050100608A1 (en) * | 2003-02-21 | 2005-05-12 | Watson Pharmaceuticals, Inc. | Testosterone oral dosage formulations and associated methods |
| US20040219210A1 (en) * | 2003-05-01 | 2004-11-04 | Jian-Hwa Guo | Controlled release solid dosage nifedipine formulations |
| WO2005003192A1 (en) * | 2003-06-26 | 2005-01-13 | Symyx Technologies, Inc. | Synthesis of photoresist polymers |
| TW200526274A (en) | 2003-07-21 | 2005-08-16 | Smithkline Beecham Plc | Pharmaceutical formulations |
| US8377952B2 (en) | 2003-08-28 | 2013-02-19 | Abbott Laboratories | Solid pharmaceutical dosage formulation |
| US8025899B2 (en) * | 2003-08-28 | 2011-09-27 | Abbott Laboratories | Solid pharmaceutical dosage form |
| EP1667645A1 (en) * | 2003-09-19 | 2006-06-14 | Symyx Technologies | Materials for enhanced delivery of hydrophilic active agents in personal care formulations |
| JP2007511559A (ja) * | 2003-11-18 | 2007-05-10 | ベーリンガー インゲルハイム インターナショナル ゲゼルシャフト ミット ベシュレンクテル ハフツング | 固形医薬製剤 |
| TWI350762B (en) * | 2004-02-12 | 2011-10-21 | Euro Celtique Sa | Particulates |
| GB0403098D0 (en) * | 2004-02-12 | 2004-03-17 | Euro Celtique Sa | Extrusion |
| AR048033A1 (es) * | 2004-03-12 | 2006-03-22 | Smithkline Beecham Plc | Composicion farmaceutica para moldear componentes que comprende copolimero de poli(met)acrilato, cubierta, conector o espaciador de capsula moldeado por inyeccion que tiene la composicion farmaceutica y forma de dosificacion farmaceutica de multicomponentes a partir de dicha composicion |
| US20050244469A1 (en) | 2004-04-30 | 2005-11-03 | Allergan, Inc. | Extended therapeutic effect ocular implant treatments |
| JP2007536299A (ja) * | 2004-05-04 | 2007-12-13 | ベーリンガー インゲルハイム インターナショナル ゲゼルシャフト ミット ベシュレンクテル ハフツング | Ltb4アンタゴニトを含有する固形医薬形態 |
| EP1748762B1 (de) | 2004-05-28 | 2013-12-18 | AbbVie Deutschland GmbH & Co KG | Dosierungsform, erhältlich aus einer ein anorganisches pigment umfassenden pulvermischung |
| FR2875409B1 (fr) * | 2004-09-17 | 2010-05-07 | Sanofi Aventis | Composition pharmaceutique comprenant une dispersion solide a matrice polymere comprenant une phase continue de polydextrose et une phase continue d'un polymere autre que du polydextrose |
| RU2007145528A (ru) * | 2005-05-10 | 2009-06-20 | Новартис АГ (CH) | Фармацевтические композиции с модифицированным высвобождением фамцикловира |
| ZA200711123B (en) | 2005-06-27 | 2009-08-26 | Biovail Lab Int Srl | Modified-release formulations of a bupropion salt |
| US20090220596A1 (en) * | 2005-07-05 | 2009-09-03 | Abbott Gmbh & Co. Kg | Composition and Dosage Form Comprising a Solid or Semi-Solid Matrix |
| US8486456B2 (en) | 2005-08-08 | 2013-07-16 | Abbott Gmbh & Co., Kg | Itraconazole compositions with improved bioavailability |
| PT1912626T (pt) * | 2005-08-08 | 2016-07-20 | Abbvie Deutschland | Formas farmacêuticas com biodisponibilidade melhorada |
| US7534381B2 (en) * | 2005-09-14 | 2009-05-19 | Isp Investments Inc. | Process and apparatus for forming agglomerates of a powder composition of an active and binder |
| US20070178138A1 (en) * | 2006-02-01 | 2007-08-02 | Allergan, Inc. | Biodegradable non-opthalmic implants and related methods |
| EP1832281A1 (en) * | 2006-03-10 | 2007-09-12 | Abbott GmbH & Co. KG | Process for producing a solid dispersion of an active ingredient |
| US8802128B2 (en) * | 2006-06-23 | 2014-08-12 | Allergan, Inc. | Steroid-containing sustained release intraocular implants and related methods |
| US20070298073A1 (en) * | 2006-06-23 | 2007-12-27 | Allergan, Inc. | Steroid-containing sustained release intraocular implants and related methods |
| US20080057122A1 (en) * | 2006-08-31 | 2008-03-06 | Aaipharma Inc. | Acetaminophen pharmaceutical compositions |
| EP2112925A4 (en) * | 2006-11-15 | 2013-01-09 | Abbott Lab | SOLID PHARMACEUTICAL DOSAGE FORMULATIONS |
| US20080145405A1 (en) * | 2006-12-15 | 2008-06-19 | Kunzler Jay F | Drug delivery devices |
| RU2356539C2 (ru) * | 2006-12-28 | 2009-05-27 | Закрытое Акционерное Общество "Канонфарма Продакшн" | Твердая лекарственная форма бетагистина дигидрохлорида и способ ее получения |
| US7607596B1 (en) | 2007-03-07 | 2009-10-27 | Exxpharma, LLC | Process for enhancing the solubility of poorly soluble drugs |
| EP2219624A2 (en) | 2007-11-08 | 2010-08-25 | Glaxo Group Limited | Pharmaceutical formulations |
| US20090246276A1 (en) | 2008-01-28 | 2009-10-01 | Graham Jackson | Pharmaceutical Compositions |
| AU2009256572A1 (en) * | 2008-06-13 | 2009-12-17 | Capsugel Belgium Nv | Hydroxypropyl cellulose capsule shell |
| US20100003322A1 (en) * | 2008-07-03 | 2010-01-07 | Lai Felix S | Enteric coated hydrophobic matrix formulation |
| LT2346495T (lt) * | 2008-10-07 | 2016-10-10 | Astrazeneca Uk Limited | Farmacinė kompozicija 514 |
| EP2477593A1 (de) * | 2009-09-18 | 2012-07-25 | Basf Se | Verfahren zur herstellung von zubereitungen von in wasser schwer löslichen substanzen |
| US9594073B2 (en) | 2010-02-18 | 2017-03-14 | Abbvie Deutschland Gmbh & Co Kg | Test solvent for evaluating the compatibility of biologically active substances and graft copolymers |
| EP2463327A3 (de) | 2010-12-10 | 2015-06-03 | Basf Se | Verfahren zur herstellung von granulaten, enthaltend mindestens eine wasserlösliche komponente |
| ES2598235T3 (es) | 2010-12-23 | 2017-01-26 | AbbVie Deutschland GmbH & Co. KG | Formulaciones de retardo sólidas basadas en dispersiones sólidas |
| HK1232218A1 (zh) | 2014-02-05 | 2018-01-05 | Merck Sharp & Dohme Llc | Cgrp-活性化合物的片剂制剂 |
| CN104666084B (zh) * | 2014-11-27 | 2018-07-13 | 天津坤健生物制药有限公司 | 一种提高缓控释包衣片溶出度稳定性的方法 |
| MD4399C1 (ro) * | 2015-02-19 | 2016-09-30 | Государственный Университет Молд0 | Material polimeric cu proprietăţi antibacteriene |
| CN107921000B (zh) * | 2015-08-21 | 2021-03-30 | 巴斯夫欧洲公司 | 活性成分与聚合抗衡离子的盐 |
| US20180228730A1 (en) * | 2015-08-21 | 2018-08-16 | Basf Se | Use of water-soluble polymers based on n-vinylpyrrolidone and acrylic acid as pharmaceutical adjuvants |
| AU2017336537B2 (en) | 2016-09-27 | 2020-02-27 | L.P. Brown Company, Inc. | Harvested bale wrapping material sheets |
| EP3703724A1 (en) | 2017-11-02 | 2020-09-09 | NatureCeuticals Sdn. Bhd. | Extract of orthosiphon stamineus, formulations, and uses thereof |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3089818A (en) * | 1960-06-02 | 1963-05-14 | Baxter Laboratories Inc | Water dispersible antibiotics |
| DE1137009B (de) * | 1961-01-04 | 1962-09-27 | Bayer Ag | Verfahren zur Herstellung eines leichtloeslichen Streptomycinsalzes |
| NL297357A (cg-RX-API-DMAC7.html) * | 1962-08-31 | |||
| GB1348786A (en) * | 1971-05-14 | 1974-03-20 | Plessey Co Ltd | Apparatus and methods for assessing the length of a moving vehicle |
| GB1388786A (en) * | 1972-04-03 | 1975-03-26 | Scherer Corp R P | Integral solid gel-lattice dosage form of high-moisture content |
| CA1211892A (en) * | 1982-09-20 | 1986-09-23 | James R. Cho | Preparation of polyvinylpyrrolidone or vinylpyrrolidone/vinyl acetate copolymers of various molecular weights using a single initiator system |
| FI82188C (fi) * | 1983-03-16 | 1991-02-11 | Boehringer Ingelheim Ltd | Foerfarande foer framstaellning av en vattenloeslig, farmaceutiskt godtagbar dispersion av klortalidon. |
| DE3312668A1 (de) * | 1983-04-08 | 1984-10-11 | Basf Ag, 6700 Ludwigshafen | Wasserloesliche polymere mit geringer hygroskopie |
| US4661521A (en) * | 1984-04-30 | 1987-04-28 | Mallinckrodt, Inc. | Direct tableting acetaminophen compositions |
| US4631284A (en) * | 1984-11-19 | 1986-12-23 | Mallinckrodt, Inc. | Acetaminophen compositions containing low doses of chlorpheniramine maleate, method for preparing same and tablets formed therefrom |
| FR2581541B1 (fr) * | 1985-05-09 | 1988-05-20 | Rhone Poulenc Sante | Nouvelles compositions pharmaceutiques permettant la liberation prolongee d'un principe actif et leur procede de preparation |
| EP0214092A1 (en) * | 1985-08-08 | 1987-03-11 | Ciba-Geigy Ag | Enhanced absorption of psychoactive 2-aryl-pyrazolo quinolines as a solid molecular dispersion in polyvinylpyrrolidone |
-
1986
- 1986-04-11 DE DE19863612212 patent/DE3612212A1/de not_active Withdrawn
-
1987
- 1987-03-31 DE DE8787104724T patent/DE3780059D1/de not_active Expired - Lifetime
- 1987-03-31 AT AT87104724T patent/ATE77739T1/de not_active IP Right Cessation
- 1987-03-31 ES ES198787104724T patent/ES2037020T3/es not_active Expired - Lifetime
- 1987-03-31 EP EP87104724A patent/EP0240904B1/de not_active Expired - Lifetime
- 1987-04-03 YU YU59187A patent/YU46534B/sh unknown
- 1987-04-06 US US07/034,938 patent/US4801460A/en not_active Expired - Lifetime
- 1987-04-08 FI FI871539A patent/FI87887C/fi not_active IP Right Cessation
- 1987-04-08 CS CS872532A patent/CS268177B2/cs not_active IP Right Cessation
- 1987-04-09 JP JP62085889A patent/JPH089551B2/ja not_active Expired - Lifetime
- 1987-04-10 NO NO871513A patent/NO170570C/no not_active IP Right Cessation
- 1987-04-10 HU HU871617A patent/HU196132B/hu not_active IP Right Cessation
- 1987-04-10 SU SU874202334A patent/SU1731037A3/ru active
- 1987-04-10 AU AU71413/87A patent/AU587897B2/en not_active Ceased
- 1987-04-10 UA UA4202334A patent/UA13038A1/uk unknown
- 1987-04-10 PT PT84661A patent/PT84661B/pt not_active IP Right Cessation
- 1987-04-10 CA CA000534435A patent/CA1308353C/en not_active Expired - Lifetime
- 1987-04-11 CN CN87103409A patent/CN1022666C/zh not_active Expired - Lifetime
- 1987-04-11 KR KR1019870003527A patent/KR920003575B1/ko not_active Expired
-
1992
- 1992-10-01 GR GR920402198T patent/GR3005866T3/el unknown
-
1994
- 1994-12-29 MD MD95-0073A patent/MD374C2/ro unknown
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4957681A (en) * | 1988-04-15 | 1990-09-18 | Basf Aktiengesellschaft | Preparation of pharmaceutical mixtures |
| DE4031881A1 (de) * | 1990-10-08 | 1992-04-09 | Sanol Arznei Schwarz Gmbh | Loesungsmittelfreie, oral zu verabreichende pharmazeutische zubereitung mit verzoegerter wirkstoffreisetzung und verfahren zu deren herstellung |
| WO2010040686A1 (de) * | 2008-10-07 | 2010-04-15 | Basf Se | Verfahren zur herstellung oraler darreichungsformen mit kontrollierter freisetzung |
| US9789065B2 (en) | 2008-10-07 | 2017-10-17 | Basf Se | Process for producing oral dosage forms with controlled release |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3612212A1 (de) | Verfahren zur herstellung von festen pharmazeutischen formen | |
| EP0240906B1 (de) | Kontinuierliches Verfahren zum Tablettieren | |
| EP0544144B1 (de) | Feste pharmazeutische Retardform | |
| EP1175207B1 (de) | Spritzgussverfahren für (meth)acrylat-copolymere mit tertiären ammoniumgruppen | |
| EP1150820B1 (de) | Spritzgussverfahren für neutrale und säuregruppenhaltige (meth)acrylat-copolymere | |
| EP0864326B1 (de) | Mehrphasige wirkstoffhaltige Zubereitungsformen | |
| EP0358105B1 (de) | Verfahren und Vorrichtung zur kontinuierlichen Herstellung von festen pharmazeutischen Formen. | |
| EP0704207B1 (de) | Thermoplastischer Kunststoff für darmsaftlösliche Arznei-Umhüllungen | |
| EP0930875B1 (de) | Verfahren zur herstellung fester pharmazeutischer formen durch extrudierung | |
| EP1166776B1 (de) | Verfahren zur Herstellung fester oraler Darreichungsformen mit retardierender Wirkstofffreisetzung | |
| EP0998918B1 (de) | Feste Dosierungsform mit copolymerem Bindemittel | |
| EP0993828A1 (de) | Verfahren zur Herstellung von beschichteten festen Dosierungsformen | |
| DE3830355A1 (de) | Verfahren zur herstellung von pharmazeutischen tabletten | |
| DE29502547U1 (de) | Thermoplastisches Überzugs- und Bindemittel für Arzneiformen | |
| EP1083196A1 (de) | Unterwassergranulation wirkstoffhaltiger Schmelzen | |
| EP1142571B1 (de) | Verfahren zur Herstellung von festen Kreatin-Dosierungsformen und dadurch erhältliche Dosierungsformen | |
| EP0876141B1 (de) | Zubereitungen nichtsteroidaler analgetika | |
| EP0922462A2 (de) | Verfahren zur Herstellung von festen Dosierungsformen | |
| DE3810343A1 (de) | Verfahren zur herstellung von festen pharmazeutischen retardformen | |
| DE19539363A1 (de) | Verfahren zur Herstellung von festen Arzneiformen | |
| EP0998919A2 (de) | Feste Dosierungsform mit copolymerem Bindemittel | |
| DE19511131A1 (de) | Mechanisch stabile feste Wirkstoffzubereitungsformen | |
| DE19734011A1 (de) | Verfahren zur Herstellung fester pharmazeutischer Formen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8141 | Disposal/no request for examination |