DE3415608C2 - - Google Patents
Info
- Publication number
- DE3415608C2 DE3415608C2 DE3415608A DE3415608A DE3415608C2 DE 3415608 C2 DE3415608 C2 DE 3415608C2 DE 3415608 A DE3415608 A DE 3415608A DE 3415608 A DE3415608 A DE 3415608A DE 3415608 C2 DE3415608 C2 DE 3415608C2
- Authority
- DE
- Germany
- Prior art keywords
- radical
- charge
- group
- layer
- substituted
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 disazo compound Chemical class 0.000 claims description 118
- 239000000463 material Substances 0.000 claims description 99
- 239000010410 layer Substances 0.000 claims description 81
- 239000000126 substance Substances 0.000 claims description 25
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 21
- 125000005843 halogen group Chemical group 0.000 claims description 18
- 125000004432 carbon atom Chemical group C* 0.000 claims description 16
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims description 14
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 11
- 239000011230 binding agent Substances 0.000 claims description 11
- 150000003254 radicals Chemical class 0.000 claims description 11
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 10
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 claims description 5
- 125000001424 substituent group Chemical group 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 4
- 125000005504 styryl group Chemical group 0.000 claims description 4
- 125000001041 indolyl group Chemical group 0.000 claims description 3
- 239000000049 pigment Substances 0.000 claims description 3
- KKFDJZZADQONDE-UHFFFAOYSA-N (hydridonitrato)hydroxidocarbon(.) Chemical compound O[C]=N KKFDJZZADQONDE-UHFFFAOYSA-N 0.000 claims description 2
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical group C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000005907 alkyl ester group Chemical group 0.000 claims description 2
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 claims description 2
- ORTFAQDWJHRMNX-UHFFFAOYSA-M oxidooxomethyl Chemical compound [O-][C]=O ORTFAQDWJHRMNX-UHFFFAOYSA-M 0.000 claims description 2
- 239000002356 single layer Substances 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 17
- 150000001875 compounds Chemical class 0.000 description 14
- 230000035945 sensitivity Effects 0.000 description 11
- 239000000243 solution Substances 0.000 description 10
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical group C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 9
- 229910052782 aluminium Inorganic materials 0.000 description 9
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 9
- 230000000052 comparative effect Effects 0.000 description 9
- 238000004519 manufacturing process Methods 0.000 description 9
- 238000000034 method Methods 0.000 description 9
- 239000000758 substrate Substances 0.000 description 9
- 238000007740 vapor deposition Methods 0.000 description 8
- 238000000576 coating method Methods 0.000 description 7
- 239000006185 dispersion Substances 0.000 description 7
- 239000011248 coating agent Substances 0.000 description 6
- 229920003227 poly(N-vinyl carbazole) Polymers 0.000 description 6
- 239000002800 charge carrier Substances 0.000 description 5
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- 239000001257 hydrogen Substances 0.000 description 5
- 238000012546 transfer Methods 0.000 description 5
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 4
- 125000001624 naphthyl group Chemical group 0.000 description 4
- 150000004866 oxadiazoles Chemical class 0.000 description 4
- 230000005855 radiation Effects 0.000 description 4
- 229920005989 resin Polymers 0.000 description 4
- 239000011347 resin Substances 0.000 description 4
- NGQSLSMAEVWNPU-YTEMWHBBSA-N 1,2-bis[(e)-2-phenylethenyl]benzene Chemical compound C=1C=CC=CC=1/C=C/C1=CC=CC=C1\C=C\C1=CC=CC=C1 NGQSLSMAEVWNPU-YTEMWHBBSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 239000004793 Polystyrene Substances 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 238000013461 design Methods 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- GACNTLAEHODJKY-UHFFFAOYSA-N n,n-dibenzyl-4-[1-[4-(dibenzylamino)phenyl]propyl]aniline Chemical compound C=1C=C(N(CC=2C=CC=CC=2)CC=2C=CC=CC=2)C=CC=1C(CC)C(C=C1)=CC=C1N(CC=1C=CC=CC=1)CC1=CC=CC=C1 GACNTLAEHODJKY-UHFFFAOYSA-N 0.000 description 3
- QYXUHIZLHNDFJT-UHFFFAOYSA-N n-[(9-ethylcarbazol-3-yl)methylideneamino]-n-methylaniline Chemical compound C=1C=C2N(CC)C3=CC=CC=C3C2=CC=1C=NN(C)C1=CC=CC=C1 QYXUHIZLHNDFJT-UHFFFAOYSA-N 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 125000002080 perylenyl group Chemical group C1(=CC=C2C=CC=C3C4=CC=CC5=CC=CC(C1=C23)=C45)* 0.000 description 3
- 229920005668 polycarbonate resin Polymers 0.000 description 3
- 239000004431 polycarbonate resin Substances 0.000 description 3
- 229920006267 polyester film Polymers 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 230000003595 spectral effect Effects 0.000 description 3
- 235000014692 zinc oxide Nutrition 0.000 description 3
- QNLZIZAQLLYXTC-UHFFFAOYSA-N 1,2-dimethylnaphthalene Chemical compound C1=CC=CC2=C(C)C(C)=CC=C21 QNLZIZAQLLYXTC-UHFFFAOYSA-N 0.000 description 2
- LWHDQPLUIFIFFT-UHFFFAOYSA-N 2,3,5,6-tetrabromocyclohexa-2,5-diene-1,4-dione Chemical compound BrC1=C(Br)C(=O)C(Br)=C(Br)C1=O LWHDQPLUIFIFFT-UHFFFAOYSA-N 0.000 description 2
- VHQGURIJMFPBKS-UHFFFAOYSA-N 2,4,7-trinitrofluoren-9-one Chemical compound [O-][N+](=O)C1=CC([N+]([O-])=O)=C2C3=CC=C([N+](=O)[O-])C=C3C(=O)C2=C1 VHQGURIJMFPBKS-UHFFFAOYSA-N 0.000 description 2
- CLQYLLIGYDFCGY-UHFFFAOYSA-N 4-(2-anthracen-9-ylethenyl)-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C=CC1=C(C=CC=C2)C2=CC2=CC=CC=C12 CLQYLLIGYDFCGY-UHFFFAOYSA-N 0.000 description 2
- BZKRKPGZABEOSM-XMHGGMMESA-N 4-[(e)-2-[3-[4-(diethylamino)phenyl]-2-phenyl-3,4-dihydropyrazol-5-yl]ethenyl]-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1\C=C\C1=NN(C=2C=CC=CC=2)C(C=2C=CC(=CC=2)N(CC)CC)C1 BZKRKPGZABEOSM-XMHGGMMESA-N 0.000 description 2
- UZGVMZRBRRYLIP-UHFFFAOYSA-N 4-[5-[4-(diethylamino)phenyl]-1,3,4-oxadiazol-2-yl]-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C1=NN=C(C=2C=CC(=CC=2)N(CC)CC)O1 UZGVMZRBRRYLIP-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 2
- 150000005840 aryl radicals Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000000151 deposition Methods 0.000 description 2
- 230000008021 deposition Effects 0.000 description 2
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000002985 plastic film Substances 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 229920001225 polyester resin Polymers 0.000 description 2
- 239000004645 polyester resin Substances 0.000 description 2
- 230000027756 respiratory electron transport chain Effects 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 229910052711 selenium Inorganic materials 0.000 description 2
- 239000011669 selenium Substances 0.000 description 2
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 2
- 239000011787 zinc oxide Substances 0.000 description 2
- NAWXUBYGYWOOIX-SFHVURJKSA-N (2s)-2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioic acid Chemical compound C1=CC2=NC(N)=NC(N)=C2C=C1CCC1=CC=C(C(=O)N[C@@H](CC(=C)C(O)=O)C(O)=O)C=C1 NAWXUBYGYWOOIX-SFHVURJKSA-N 0.000 description 1
- PMBBBTMBKMPOQF-UHFFFAOYSA-N 1,3,7-trinitrodibenzothiophene 5,5-dioxide Chemical compound O=S1(=O)C2=CC([N+](=O)[O-])=CC=C2C2=C1C=C([N+]([O-])=O)C=C2[N+]([O-])=O PMBBBTMBKMPOQF-UHFFFAOYSA-N 0.000 description 1
- DVITXSOESPNBSI-UHFFFAOYSA-N 1,5,7-trinitroxanthen-9-one Chemical compound C1=CC([N+]([O-])=O)=C2C(=O)C3=CC([N+](=O)[O-])=CC([N+]([O-])=O)=C3OC2=C1 DVITXSOESPNBSI-UHFFFAOYSA-N 0.000 description 1
- AOLUMCPVEUKWBX-UHFFFAOYSA-N 1-[2-[2-[2-(2,4-dimethoxyphenyl)ethenyl]phenyl]ethenyl]-2,4-dimethoxybenzene Chemical compound COC1=CC(OC)=CC=C1C=CC1=CC=CC=C1C=CC1=CC=C(OC)C=C1OC AOLUMCPVEUKWBX-UHFFFAOYSA-N 0.000 description 1
- LFKNYYQRWMMFSM-UHFFFAOYSA-N 1-ethyl-9h-carbazole;formaldehyde Chemical compound O=C.N1C2=CC=CC=C2C2=C1C(CC)=CC=C2 LFKNYYQRWMMFSM-UHFFFAOYSA-N 0.000 description 1
- JOERSAVCLPYNIZ-UHFFFAOYSA-N 2,4,5,7-tetranitrofluoren-9-one Chemical compound O=C1C2=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C2C2=C1C=C([N+](=O)[O-])C=C2[N+]([O-])=O JOERSAVCLPYNIZ-UHFFFAOYSA-N 0.000 description 1
- FVNMKGQIOLSWHJ-UHFFFAOYSA-N 2,4,5,7-tetranitroxanthen-9-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)C3=CC([N+](=O)[O-])=CC([N+]([O-])=O)=C3OC2=C1[N+]([O-])=O FVNMKGQIOLSWHJ-UHFFFAOYSA-N 0.000 description 1
- HJCNIHXYINVVFF-UHFFFAOYSA-N 2,6,8-trinitroindeno[1,2-b]thiophen-4-one Chemical compound O=C1C2=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C2C2=C1C=C([N+](=O)[O-])S2 HJCNIHXYINVVFF-UHFFFAOYSA-N 0.000 description 1
- ATLPNNQYMFUNKY-UHFFFAOYSA-N 2,7-diaminoxanthen-9-one Chemical compound C1=C(N)C=C2C(=O)C3=CC(N)=CC=C3OC2=C1 ATLPNNQYMFUNKY-UHFFFAOYSA-N 0.000 description 1
- WDFBSMBVBUXHRP-UHFFFAOYSA-N 2-[2-(4-methylphenyl)-1-phenylethenyl]-n-phenylaniline Chemical compound C1=CC(C)=CC=C1C=C(C=1C(=CC=CC=1)NC=1C=CC=CC=1)C1=CC=CC=C1 WDFBSMBVBUXHRP-UHFFFAOYSA-N 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- CUDANNOCLGTWLM-UHFFFAOYSA-N 2-methyl-n-(2-methylphenyl)-n-[4-(2-phenylethenyl)phenyl]aniline Chemical compound CC1=CC=CC=C1N(C=1C(=CC=CC=1)C)C(C=C1)=CC=C1C=CC1=CC=CC=C1 CUDANNOCLGTWLM-UHFFFAOYSA-N 0.000 description 1
- JNGDCMHTNXRQQD-UHFFFAOYSA-N 3,6-dioxocyclohexa-1,4-diene-1,2,4,5-tetracarbonitrile Chemical compound O=C1C(C#N)=C(C#N)C(=O)C(C#N)=C1C#N JNGDCMHTNXRQQD-UHFFFAOYSA-N 0.000 description 1
- NIZIGUQDQIALBQ-UHFFFAOYSA-N 4-(2,2-diphenylethenyl)-n,n-diphenylaniline Chemical compound C=1C=C(N(C=2C=CC=CC=2)C=2C=CC=CC=2)C=CC=1C=C(C=1C=CC=CC=1)C1=CC=CC=C1 NIZIGUQDQIALBQ-UHFFFAOYSA-N 0.000 description 1
- PLVXCTLGYWKUAY-UHFFFAOYSA-N 4-(2-naphthalen-1-ylethenyl)-n,n-diphenylaniline Chemical compound C=1C=CC2=CC=CC=C2C=1C=CC(C=C1)=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 PLVXCTLGYWKUAY-UHFFFAOYSA-N 0.000 description 1
- GAYAMEKFIBYRJW-UHFFFAOYSA-N 4-(fluoren-9-ylidenemethyl)-n,n-dimethylaniline Chemical compound C1=CC(N(C)C)=CC=C1C=C1C2=CC=CC=C2C2=CC=CC=C21 GAYAMEKFIBYRJW-UHFFFAOYSA-N 0.000 description 1
- YGBCLRRWZQSURU-UHFFFAOYSA-N 4-[(diphenylhydrazinylidene)methyl]-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C=NN(C=1C=CC=CC=1)C1=CC=CC=C1 YGBCLRRWZQSURU-UHFFFAOYSA-N 0.000 description 1
- YTJZGOONVHNAQC-UHFFFAOYSA-N 4-[(diphenylhydrazinylidene)methyl]-n,n-dimethylaniline Chemical compound C1=CC(N(C)C)=CC=C1C=NN(C=1C=CC=CC=1)C1=CC=CC=C1 YTJZGOONVHNAQC-UHFFFAOYSA-N 0.000 description 1
- VWEQSBRKYZRWPQ-UHFFFAOYSA-N 4-[2-(10-bromoanthracen-9-yl)ethenyl]-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C=CC1=C(C=CC=C2)C2=C(Br)C2=CC=CC=C12 VWEQSBRKYZRWPQ-UHFFFAOYSA-N 0.000 description 1
- ZTYUDPDLRTYFCU-UHFFFAOYSA-N 4-[2-[2-[2-[4-(diethylamino)phenyl]ethenyl]phenyl]ethenyl]-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C=CC1=CC=CC=C1C=CC1=CC=C(N(CC)CC)C=C1 ZTYUDPDLRTYFCU-UHFFFAOYSA-N 0.000 description 1
- NEZCBMZHMQVZOD-UHFFFAOYSA-N 4-[2-[3-[4-(dimethylamino)phenyl]-2-phenyl-1,3-dihydropyrazol-5-yl]ethenyl]-n,n-dimethylaniline Chemical compound C1=CC(N(C)C)=CC=C1C=CC1=CC(C=2C=CC(=CC=2)N(C)C)N(C=2C=CC=CC=2)N1 NEZCBMZHMQVZOD-UHFFFAOYSA-N 0.000 description 1
- HXOZSIAZPFUUHH-UHFFFAOYSA-N 4-[2-[4-[5-[4-[2-[4-(diethylamino)phenyl]ethenyl]phenyl]-1,3,4-oxadiazol-2-yl]phenyl]ethenyl]-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C=CC1=CC=C(C=2OC(=NN=2)C=2C=CC(C=CC=3C=CC(=CC=3)N(CC)CC)=CC=2)C=C1 HXOZSIAZPFUUHH-UHFFFAOYSA-N 0.000 description 1
- JJQOKUCYWIGCIN-UHFFFAOYSA-N 4-[4-(2-chlorophenyl)-2-ethenyl-1,3-oxazol-5-yl]-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C1=C(C=2C(=CC=CC=2)Cl)N=C(C=C)O1 JJQOKUCYWIGCIN-UHFFFAOYSA-N 0.000 description 1
- AEEHOVNCLFTKTO-UHFFFAOYSA-N 4-[[benzyl(phenyl)hydrazinylidene]methyl]-n,n-diphenylaniline Chemical compound C=1C=CC=CC=1CN(C=1C=CC=CC=1)N=CC(C=C1)=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 AEEHOVNCLFTKTO-UHFFFAOYSA-N 0.000 description 1
- SBMCZDLOXDWNIN-UHFFFAOYSA-N 4-[bis[4-(diethylamino)phenyl]methyl]-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C(C=1C=CC(=CC=1)N(CC)CC)C1=CC=C(N(CC)CC)C=C1 SBMCZDLOXDWNIN-UHFFFAOYSA-N 0.000 description 1
- FVGPNZKTTWPLOC-UHFFFAOYSA-N 9-ethyl-3-(2-phenylethenyl)carbazole Chemical compound C=1C=C2N(CC)C3=CC=CC=C3C2=CC=1C=CC1=CC=CC=C1 FVGPNZKTTWPLOC-UHFFFAOYSA-N 0.000 description 1
- BODPVHGDJHVWAW-UHFFFAOYSA-N 9-ethyl-3-[2-(4-methoxyphenyl)ethenyl]carbazole Chemical compound C=1C=C2N(CC)C3=CC=CC=C3C2=CC=1C=CC1=CC=C(OC)C=C1 BODPVHGDJHVWAW-UHFFFAOYSA-N 0.000 description 1
- SCHUFJWXJINKKV-UHFFFAOYSA-N 9-ethyl-3-fluoren-9-ylidene-2h-carbazole Chemical compound C12=CC=CC=C2C2=CC=CC=C2C1=C1C=C2C3=CC=CC=C3N(CC)C2=CC1 SCHUFJWXJINKKV-UHFFFAOYSA-N 0.000 description 1
- OBAPJZDFDIJDKV-UHFFFAOYSA-N C1=CC(N(CC)CC)=CC=C1C=C=NN(C)C1=CC=CC=C1 Chemical compound C1=CC(N(CC)CC)=CC=C1C=C=NN(C)C1=CC=CC=C1 OBAPJZDFDIJDKV-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- 206010034972 Photosensitivity reaction Diseases 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- PJANXHGTPQOBST-VAWYXSNFSA-N Stilbene Natural products C=1C=CC=CC=1/C=C/C1=CC=CC=C1 PJANXHGTPQOBST-VAWYXSNFSA-N 0.000 description 1
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical group C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 239000012790 adhesive layer Substances 0.000 description 1
- 239000004840 adhesive resin Substances 0.000 description 1
- 229920006223 adhesive resin Polymers 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical compound [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 description 1
- 125000005577 anthracene group Chemical group 0.000 description 1
- HFACYLZERDEVSX-UHFFFAOYSA-N benzidine Chemical compound C1=CC(N)=CC=C1C1=CC=C(N)C=C1 HFACYLZERDEVSX-UHFFFAOYSA-N 0.000 description 1
- 239000004566 building material Substances 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 238000010351 charge transfer process Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000004965 chloroalkyl group Chemical group 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- HAORKNGNJCEJBX-UHFFFAOYSA-N cyprodinil Chemical group N=1C(C)=CC(C2CC2)=NC=1NC1=CC=CC=C1 HAORKNGNJCEJBX-UHFFFAOYSA-N 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 229960002380 dibutyl phthalate Drugs 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- ORTFAQDWJHRMNX-UHFFFAOYSA-N hydroxidooxidocarbon(.) Chemical compound O[C]=O ORTFAQDWJHRMNX-UHFFFAOYSA-N 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 238000005286 illumination Methods 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- OJVNNLDLHOFPFQ-UHFFFAOYSA-N n,n-dibenzyl-4-(2-phenylethenyl)aniline Chemical compound C=1C=CC=CC=1CN(C=1C=CC(C=CC=2C=CC=CC=2)=CC=1)CC1=CC=CC=C1 OJVNNLDLHOFPFQ-UHFFFAOYSA-N 0.000 description 1
- IRKBOPBCDTWDDY-UHFFFAOYSA-N n,n-dibenzyl-4-[(diphenylhydrazinylidene)methyl]aniline Chemical compound C=1C=CC=CC=1CN(C=1C=CC(C=NN(C=2C=CC=CC=2)C=2C=CC=CC=2)=CC=1)CC1=CC=CC=C1 IRKBOPBCDTWDDY-UHFFFAOYSA-N 0.000 description 1
- BVTXDOPTUCCGGU-UHFFFAOYSA-N n,n-diethyl-4-(2-naphthalen-1-ylethenyl)aniline Chemical compound C1=CC(N(CC)CC)=CC=C1C=CC1=CC=CC2=CC=CC=C12 BVTXDOPTUCCGGU-UHFFFAOYSA-N 0.000 description 1
- GAZKGHIEJKXNCQ-UHFFFAOYSA-N n,n-diethyl-4-(4-phenyl-1,3-oxazol-2-yl)aniline Chemical compound C1=CC(N(CC)CC)=CC=C1C1=NC(C=2C=CC=CC=2)=CO1 GAZKGHIEJKXNCQ-UHFFFAOYSA-N 0.000 description 1
- DXYYLUGHPCHMRQ-UHFFFAOYSA-N n,n-diphenyl-4-(2-phenylethenyl)aniline Chemical compound C=1C=CC=CC=1C=CC(C=C1)=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 DXYYLUGHPCHMRQ-UHFFFAOYSA-N 0.000 description 1
- UAVOVDWXWRXKPS-UHFFFAOYSA-N n-[(4-methoxyphenyl)methylideneamino]-n-methylaniline Chemical compound C1=CC(OC)=CC=C1C=NN(C)C1=CC=CC=C1 UAVOVDWXWRXKPS-UHFFFAOYSA-N 0.000 description 1
- CEAPHJPESODIQL-UHFFFAOYSA-N n-[(9-ethylcarbazol-3-yl)methylideneamino]-n-phenylaniline Chemical compound C=1C=C2N(CC)C3=CC=CC=C3C2=CC=1C=NN(C=1C=CC=CC=1)C1=CC=CC=C1 CEAPHJPESODIQL-UHFFFAOYSA-N 0.000 description 1
- ZQKFNYHHBMBPHU-UHFFFAOYSA-N n-benzyl-n-[(2,4-dimethoxyphenyl)methylideneamino]aniline Chemical compound COC1=CC(OC)=CC=C1C=NN(C=1C=CC=CC=1)CC1=CC=CC=C1 ZQKFNYHHBMBPHU-UHFFFAOYSA-N 0.000 description 1
- HIWDRSNALOGCSA-UHFFFAOYSA-N n-benzyl-n-[(4-methoxynaphthalen-1-yl)methylideneamino]aniline Chemical compound C12=CC=CC=C2C(OC)=CC=C1C=NN(C=1C=CC=CC=1)CC1=CC=CC=C1 HIWDRSNALOGCSA-UHFFFAOYSA-N 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 239000012860 organic pigment Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 150000002916 oxazoles Chemical class 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- PJQYNUFEEZFYIS-UHFFFAOYSA-N perylene maroon Chemical group C=12C3=CC=C(C(N(C)C4=O)=O)C2=C4C=CC=1C1=CC=C2C(=O)N(C)C(=O)C4=CC=C3C1=C42 PJQYNUFEEZFYIS-UHFFFAOYSA-N 0.000 description 1
- CSHWQDPOILHKBI-UHFFFAOYSA-N peryrene Natural products C1=CC(C2=CC=CC=3C2=C2C=CC=3)=C3C2=CC=CC3=C1 CSHWQDPOILHKBI-UHFFFAOYSA-N 0.000 description 1
- 230000036211 photosensitivity Effects 0.000 description 1
- 229920006255 plastic film Polymers 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 1
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920001470 polyketone Polymers 0.000 description 1
- 239000004926 polymethyl methacrylate Substances 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229920006215 polyvinyl ketone Polymers 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- RCYFOPUXRMOLQM-UHFFFAOYSA-N pyrene-1-carbaldehyde Chemical compound C1=C2C(C=O)=CC=C(C=C3)C2=C2C3=CC=CC2=C1 RCYFOPUXRMOLQM-UHFFFAOYSA-N 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000001850 reproductive effect Effects 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- 150000003384 small molecules Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- PJANXHGTPQOBST-UHFFFAOYSA-N stilbene Chemical compound C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 description 1
- 235000021286 stilbenes Nutrition 0.000 description 1
- 238000004381 surface treatment Methods 0.000 description 1
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 1
- NLDYACGHTUPAQU-UHFFFAOYSA-N tetracyanoethylene Chemical group N#CC(C#N)=C(C#N)C#N NLDYACGHTUPAQU-UHFFFAOYSA-N 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 239000012808 vapor phase Substances 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- JNELGWHKGNBSMD-UHFFFAOYSA-N xanthone Chemical group C1=CC=C2C(=O)C3=CC=CC=C3OC2=C1 JNELGWHKGNBSMD-UHFFFAOYSA-N 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- RNWHGQJWIACOKP-UHFFFAOYSA-N zinc;oxygen(2-) Chemical class [O-2].[Zn+2] RNWHGQJWIACOKP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/14—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/78—Ring systems having three or more relevant rings
- C07D311/80—Dibenzopyrans; Hydrogenated dibenzopyrans
- C07D311/82—Xanthenes
- C07D311/84—Xanthenes with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 9
- C07D311/86—Oxygen atoms, e.g. xanthones
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/06—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being organic
- G03G5/0664—Dyes
- G03G5/0675—Azo dyes
- G03G5/0679—Disazo dyes
- G03G5/0681—Disazo dyes containing hetero rings in the part of the molecule between the azo-groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Physics & Mathematics (AREA)
- Spectroscopy & Molecular Physics (AREA)
- General Physics & Mathematics (AREA)
- Photoreceptors In Electrophotography (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP7317783A JPS59197465A (ja) | 1983-04-26 | 1983-04-26 | 新規なジスアゾ化合物 |
| JP7558683A JPS59201060A (ja) | 1983-04-28 | 1983-04-28 | 電子写真用感光体 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3415608A1 DE3415608A1 (de) | 1984-10-31 |
| DE3415608C2 true DE3415608C2 (enExample) | 1989-07-13 |
Family
ID=26414330
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3448011A Expired DE3448011C2 (enExample) | 1983-04-26 | 1984-04-26 | |
| DE19843415608 Granted DE3415608A1 (de) | 1983-04-26 | 1984-04-26 | Neue tetrazoniumsalzverbindungen, neue disazoverbindungen, verfahren zu deren herstellung und eine disazoverbindung enthaltende elektrophotographische elemente |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3448011A Expired DE3448011C2 (enExample) | 1983-04-26 | 1984-04-26 |
Country Status (3)
| Country | Link |
|---|---|
| US (2) | US4540643A (enExample) |
| DE (2) | DE3448011C2 (enExample) |
| GB (1) | GB2147894B (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4631242A (en) * | 1984-09-13 | 1986-12-23 | Mitsubishi Paper Mills, Ltd. | Bisazo electrophotographic sensitive materials with --CF3 group |
| JPS61272754A (ja) * | 1985-05-29 | 1986-12-03 | Canon Inc | 電子写真感光体 |
| JPS63133155A (ja) * | 1986-11-25 | 1988-06-04 | Minolta Camera Co Ltd | 感光体 |
| US4868080A (en) * | 1986-12-03 | 1989-09-19 | Canon Kabushiki Kaisha | Electrophotographic photosensitive member comprising aromatic azo pigment containing cyclic amino group |
| JP2605704B2 (ja) * | 1987-02-12 | 1997-04-30 | ミノルタ株式会社 | 感光体 |
| JP2611209B2 (ja) * | 1987-02-17 | 1997-05-21 | ミノルタ株式会社 | 感光体 |
| JP2556079B2 (ja) * | 1987-12-29 | 1996-11-20 | ミノルタ株式会社 | 感光体 |
| JP2643209B2 (ja) * | 1988-01-09 | 1997-08-20 | ミノルタ株式会社 | 感光体 |
| US4945021A (en) * | 1988-02-16 | 1990-07-31 | Minolta Camera Kabushiki Kaisha | Photosensitive member comprising bisazo pigment |
| JP2679082B2 (ja) * | 1988-02-23 | 1997-11-19 | ミノルタ株式会社 | 感光体 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1624944A (en) * | 1924-12-11 | 1927-04-19 | Grasselli Dyestuff Corp | Azo dyestuffs from aminodiphenylenoxide |
| US3950342A (en) * | 1971-09-08 | 1976-04-13 | Burroughs Wellcome Co. | Acridone-dicarboxylic acids |
| DE2306673A1 (de) * | 1973-02-10 | 1974-08-15 | Cassella Farbwerke Mainkur Ag | Bisazofarbstoffe der 2,6-diaminopyridinreihe und verfahren zu ihrer herstellung |
| US4251613A (en) * | 1977-06-08 | 1981-02-17 | Ricoh Company, Ltd. | Disazo compounds, process for preparation of same and application of said disazo compounds and analogues thereof to electrophotographic sensitive materials |
| US4390611A (en) * | 1980-09-26 | 1983-06-28 | Shozo Ishikawa | Electrophotographic photosensitive azo pigment containing members |
| JPS57102643A (en) * | 1980-12-19 | 1982-06-25 | Ricoh Co Ltd | Electrophotographic receptor |
| US4440845A (en) * | 1981-06-08 | 1984-04-03 | Ricoh Co., Ltd. | Disazo compound, method of making same and electrophotographic element using same |
| JPH0248589B2 (ja) * | 1981-07-01 | 1990-10-25 | Ricoh Kk | Shinkinajisuazokagobutsuoyobisonoseizoho |
-
1984
- 1984-04-09 US US06/597,991 patent/US4540643A/en not_active Expired - Lifetime
- 1984-04-26 DE DE3448011A patent/DE3448011C2/de not_active Expired
- 1984-04-26 DE DE19843415608 patent/DE3415608A1/de active Granted
- 1984-04-26 GB GB08410722A patent/GB2147894B/en not_active Expired
-
1985
- 1985-07-09 US US06/753,281 patent/US4716220A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| GB2147894A (en) | 1985-05-22 |
| GB8410722D0 (en) | 1984-05-31 |
| US4540643A (en) | 1985-09-10 |
| GB2147894B (en) | 1986-06-11 |
| DE3448011C2 (enExample) | 1988-09-29 |
| DE3415608A1 (de) | 1984-10-31 |
| US4716220A (en) | 1987-12-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2829543C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3626497C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3347905C2 (enExample) | ||
| DE3750498T2 (de) | Photoempfindliches material für elektrophotographie. | |
| DE3303830A1 (de) | Elektrophotographisches aufzeichnungsmaterial | |
| DE2756857C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3447685A1 (de) | Disazoverbindungen, verfahren zu ihrer herstellung und ein diese verbindungen enthaltendes elektrophotographisches element | |
| DE3415608C2 (enExample) | ||
| DE3602987C2 (enExample) | ||
| DE2947760C2 (enExample) | ||
| DE3441646C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3810522C2 (de) | Aromatische Diethylverbindungen und elektrophotographische Photoleiter, die eine aromatische Diethylverbindung enthalten | |
| DE3625766C2 (de) | Elektrophotographisches aufzeichnungsmaterial | |
| DE3249395C2 (enExample) | ||
| DE4304299A1 (enExample) | ||
| DE3909537A1 (de) | Photoleiter fuer die elektrophotographie | |
| DE3049303C2 (enExample) | ||
| DE3336595C2 (enExample) | ||
| DE69117233T2 (de) | Elektrophotographischer Photorezeptor | |
| DE3521652C2 (enExample) | ||
| DE3852012T2 (de) | Photorezeptor für Elektrophotographie. | |
| DE4130062A1 (de) | Photoleiter fuer die elektrophotographie | |
| DE69214715T2 (de) | Elektrophotographischer Photorezeptor | |
| DE3220010C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3835791C2 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| 8128 | New person/name/address of the agent |
Representative=s name: SCHWABE, H., DIPL.-ING. SANDMAIR, K., DIPL.-CHEM. |
|
| 8125 | Change of the main classification |
Ipc: G03G 5/06 |
|
| 8172 | Supplementary division/partition in: |
Ref country code: DE Ref document number: 3448011 Format of ref document f/p: P |
|
| Q171 | Divided out to: |
Ref country code: DE Ref document number: 3448011 |
|
| AH | Division in |
Ref country code: DE Ref document number: 3448011 Format of ref document f/p: P |
|
| AH | Division in |
Ref country code: DE Ref document number: 3448011 Format of ref document f/p: P |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |